DE1278044B - Verfahren zur Herstellung von Chromkomplex-Reaktivfarbstoffen - Google Patents
Verfahren zur Herstellung von Chromkomplex-ReaktivfarbstoffenInfo
- Publication number
- DE1278044B DE1278044B DEF43056A DEF0043056A DE1278044B DE 1278044 B DE1278044 B DE 1278044B DE F43056 A DEF43056 A DE F43056A DE F0043056 A DEF0043056 A DE F0043056A DE 1278044 B DE1278044 B DE 1278044B
- Authority
- DE
- Germany
- Prior art keywords
- amino
- hydroxy
- acid
- sulfonic acid
- hydroxynaphthalene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 title claims description 23
- 229910052804 chromium Inorganic materials 0.000 title claims description 22
- 239000011651 chromium Substances 0.000 title claims description 22
- 238000000034 method Methods 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 239000000985 reactive dye Substances 0.000 title claims description 5
- 239000002253 acid Substances 0.000 claims description 39
- 239000000975 dye Substances 0.000 claims description 35
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 15
- 230000008878 coupling Effects 0.000 claims description 6
- 238000010168 coupling process Methods 0.000 claims description 6
- 238000005859 coupling reaction Methods 0.000 claims description 6
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 5
- 150000007513 acids Chemical class 0.000 claims description 4
- 150000001555 benzenes Chemical class 0.000 claims description 3
- 230000001588 bifunctional effect Effects 0.000 claims description 3
- 238000004040 coloring Methods 0.000 claims description 3
- 150000002790 naphthalenes Chemical class 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- -1 alkyl radical Chemical class 0.000 description 32
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 31
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 21
- 229950011260 betanaphthol Drugs 0.000 description 16
- 229920000742 Cotton Polymers 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 5
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 5
- VILFVXYKHXVYAB-UHFFFAOYSA-N naphthalene-2,7-disulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(S(=O)(=O)O)=CC=C21 VILFVXYKHXVYAB-UHFFFAOYSA-N 0.000 description 5
- SPSSDDOTEZKOOV-UHFFFAOYSA-N 2,3-dichloroquinoxaline Chemical compound C1=CC=C2N=C(Cl)C(Cl)=NC2=C1 SPSSDDOTEZKOOV-UHFFFAOYSA-N 0.000 description 4
- VLZVIIYRNMWPSN-UHFFFAOYSA-N 2-Amino-4-nitrophenol Chemical compound NC1=CC([N+]([O-])=O)=CC=C1O VLZVIIYRNMWPSN-UHFFFAOYSA-N 0.000 description 4
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 description 4
- YLKCHWCYYNKADS-UHFFFAOYSA-N 5-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(O)=CC=CC2=C1S(O)(=O)=O YLKCHWCYYNKADS-UHFFFAOYSA-N 0.000 description 4
- UTFQLMARJGZTHW-UHFFFAOYSA-N 6-hydroxynaphthalene-2-carbonyl chloride Chemical compound C1=C(C(Cl)=O)C=CC2=CC(O)=CC=C21 UTFQLMARJGZTHW-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- GVBHCMNXRKOJRH-UHFFFAOYSA-N 2,4,5,6-tetrachloropyrimidine Chemical compound ClC1=NC(Cl)=C(Cl)C(Cl)=N1 GVBHCMNXRKOJRH-UHFFFAOYSA-N 0.000 description 3
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 3
- RXCMFQDTWCCLBL-UHFFFAOYSA-N 4-amino-3-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(N)=C(O)C=C(S(O)(=O)=O)C2=C1 RXCMFQDTWCCLBL-UHFFFAOYSA-N 0.000 description 3
- 239000000987 azo dye Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 150000001844 chromium Chemical class 0.000 description 3
- 229960003742 phenol Drugs 0.000 description 3
- NGCRLFIYVFOUMZ-UHFFFAOYSA-N 2,3-dichloroquinoxaline-6-carbonyl chloride Chemical compound N1=C(Cl)C(Cl)=NC2=CC(C(=O)Cl)=CC=C21 NGCRLFIYVFOUMZ-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- SWFNPENEBHAHEB-UHFFFAOYSA-N 2-amino-4-chlorophenol Chemical compound NC1=CC(Cl)=CC=C1O SWFNPENEBHAHEB-UHFFFAOYSA-N 0.000 description 2
- BSQLQMLFTHJVKS-UHFFFAOYSA-N 2-chloro-1,3-benzothiazole Chemical compound C1=CC=C2SC(Cl)=NC2=C1 BSQLQMLFTHJVKS-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical class O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 2
- 238000004043 dyeing Methods 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- MFSSMKGBOIMKJM-UHFFFAOYSA-N naphthalen-1-ol;hydrochloride Chemical compound Cl.C1=CC=C2C(O)=CC=CC2=C1 MFSSMKGBOIMKJM-UHFFFAOYSA-N 0.000 description 2
- SKMPRPUCTZWWAQ-UHFFFAOYSA-N naphthalen-1-ol;naphthalen-2-ol Chemical compound C1=CC=CC2=CC(O)=CC=C21.C1=CC=C2C(O)=CC=CC2=C1 SKMPRPUCTZWWAQ-UHFFFAOYSA-N 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- VIXWGKYSYIBATJ-UHFFFAOYSA-N pyrrol-2-one Chemical class O=C1C=CC=N1 VIXWGKYSYIBATJ-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- OXUFAKMNUGFQGZ-UHFFFAOYSA-N (4e)-4-diazo-3-hydroxy-7-nitro-3h-naphthalene-1-sulfonic acid Chemical compound [O-][N+](=O)C1=CC=C2C(=[N+]=[N-])C(O)C=C(S(O)(=O)=O)C2=C1 OXUFAKMNUGFQGZ-UHFFFAOYSA-N 0.000 description 1
- KQBZAOQPCOSQDB-UHFFFAOYSA-N (5e)-3-chloro-5-diazo-6-hydroxycyclohexa-1,3-diene-1-sulfonic acid Chemical compound OC1C(=[N+]=[N-])C=C(Cl)C=C1S(O)(=O)=O KQBZAOQPCOSQDB-UHFFFAOYSA-N 0.000 description 1
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- ODCNAEMHGMYADO-UHFFFAOYSA-N 1,4-dichlorophthalazine Chemical compound C1=CC=C2C(Cl)=NN=C(Cl)C2=C1 ODCNAEMHGMYADO-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- BTTNYQZNBZNDOR-UHFFFAOYSA-N 2,4-dichloropyrimidine Chemical compound ClC1=CC=NC(Cl)=N1 BTTNYQZNBZNDOR-UHFFFAOYSA-N 0.000 description 1
- DOPJTDJKZNWLRB-UHFFFAOYSA-N 2-Amino-5-nitrophenol Chemical compound NC1=CC=C([N+]([O-])=O)C=C1O DOPJTDJKZNWLRB-UHFFFAOYSA-N 0.000 description 1
- AACMNEWXGKOJJK-UHFFFAOYSA-N 2-amino-6-nitrophenol Chemical compound NC1=CC=CC([N+]([O-])=O)=C1O AACMNEWXGKOJJK-UHFFFAOYSA-N 0.000 description 1
- YCTAOQGPWNTYJE-UHFFFAOYSA-N 3-amino-5-chloro-2-hydroxybenzenesulfonic acid Chemical compound NC1=CC(Cl)=CC(S(O)(=O)=O)=C1O YCTAOQGPWNTYJE-UHFFFAOYSA-N 0.000 description 1
- QEYMMOKECZBKAC-UHFFFAOYSA-N 3-chloropropanoic acid Chemical compound OC(=O)CCCl QEYMMOKECZBKAC-UHFFFAOYSA-N 0.000 description 1
- NHLAPJMCARJFOG-UHFFFAOYSA-N 3-methyl-1,4-dihydropyrazol-5-one Chemical compound CC1=NNC(=O)C1 NHLAPJMCARJFOG-UHFFFAOYSA-N 0.000 description 1
- TXNPVSSOCHOJMY-UHFFFAOYSA-N 4-(ethylamino)-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(NCC)=CC(S(O)(=O)=O)=CC2=C1 TXNPVSSOCHOJMY-UHFFFAOYSA-N 0.000 description 1
- DACUJXBUANTBKE-UHFFFAOYSA-N 4-acetamido-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(NC(=O)C)=CC(S(O)(=O)=O)=CC2=C1 DACUJXBUANTBKE-UHFFFAOYSA-N 0.000 description 1
- DHXPRBHRJQAXHK-UHFFFAOYSA-N 4-amino-3-hydroxy-7-nitronaphthalene-1-sulfonic acid Chemical compound [O-][N+](=O)C1=CC=C2C(N)=C(O)C=C(S(O)(=O)=O)C2=C1 DHXPRBHRJQAXHK-UHFFFAOYSA-N 0.000 description 1
- ZFRBZRZEKIOGQI-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-1,3-disulfonic acid Chemical compound C1=CC(O)=C2C(N)=C(S(O)(=O)=O)C=C(S(O)(=O)=O)C2=C1 ZFRBZRZEKIOGQI-UHFFFAOYSA-N 0.000 description 1
- ZUQOBHTUMCEQBG-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-1,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 ZUQOBHTUMCEQBG-UHFFFAOYSA-N 0.000 description 1
- KEGNUIZNBCHWLZ-UHFFFAOYSA-N 5,8-dichloronaphthalen-1-ol Chemical compound C1=CC(Cl)=C2C(O)=CC=CC2=C1Cl KEGNUIZNBCHWLZ-UHFFFAOYSA-N 0.000 description 1
- YGNDWDUEMICDLW-UHFFFAOYSA-N 7-anilino-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C=1C=C2C(O)=CC(S(O)(=O)=O)=CC2=CC=1NC1=CC=CC=C1 YGNDWDUEMICDLW-UHFFFAOYSA-N 0.000 description 1
- HMNPDEGBVWDHAR-UHFFFAOYSA-N 8-aminonaphthalen-1-ol Chemical compound C1=CC(O)=C2C(N)=CC=CC2=C1 HMNPDEGBVWDHAR-UHFFFAOYSA-N 0.000 description 1
- KVHHMYZBFBSVDI-UHFFFAOYSA-N 8-aminonaphthalen-2-ol Chemical compound C1=C(O)C=C2C(N)=CC=CC2=C1 KVHHMYZBFBSVDI-UHFFFAOYSA-N 0.000 description 1
- ZPLBZGGKAUXTRT-UHFFFAOYSA-N 8-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=C2C(O)=CC=CC2=C1 ZPLBZGGKAUXTRT-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- VAYOSLLFUXYJDT-RDTXWAMCSA-N Lysergic acid diethylamide Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N(CC)CC)C2)=C3C2=CNC3=C1 VAYOSLLFUXYJDT-RDTXWAMCSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 241000219422 Urtica Species 0.000 description 1
- 235000009108 Urtica dioica Nutrition 0.000 description 1
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 description 1
- HFBMWMNUJJDEQZ-UHFFFAOYSA-N acryloyl chloride Chemical compound ClC(=O)C=C HFBMWMNUJJDEQZ-UHFFFAOYSA-N 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- AITZHECSAXGFAD-UHFFFAOYSA-N benzenesulfonic acid;naphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1.C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 AITZHECSAXGFAD-UHFFFAOYSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229910021563 chromium fluoride Inorganic materials 0.000 description 1
- BFGKITSFLPAWGI-UHFFFAOYSA-N chromium(3+) Chemical compound [Cr+3] BFGKITSFLPAWGI-UHFFFAOYSA-N 0.000 description 1
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 1
- QOWZHEWZFLTYQP-UHFFFAOYSA-K chromium(3+);triformate Chemical compound [Cr+3].[O-]C=O.[O-]C=O.[O-]C=O QOWZHEWZFLTYQP-UHFFFAOYSA-K 0.000 description 1
- GRWVQDDAKZFPFI-UHFFFAOYSA-H chromium(III) sulfate Chemical compound [Cr+3].[Cr+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRWVQDDAKZFPFI-UHFFFAOYSA-H 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- NXAXZXGMDLWFDA-UHFFFAOYSA-N naphthalene-2-sulfonic acid;hydrochloride Chemical compound Cl.C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 NXAXZXGMDLWFDA-UHFFFAOYSA-N 0.000 description 1
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- QXYMVUZOGFVPGH-UHFFFAOYSA-N picramic acid Chemical compound NC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O QXYMVUZOGFVPGH-UHFFFAOYSA-N 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000004045 reactive dyeing Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- ZRRGOUHITGRLBA-UHFFFAOYSA-N stattic Chemical compound [O-][N+](=O)C1=CC=C2C=CS(=O)(=O)C2=C1 ZRRGOUHITGRLBA-UHFFFAOYSA-N 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- FTBATIJJKIIOTP-UHFFFAOYSA-K trifluorochromium Chemical compound F[Cr](F)F FTBATIJJKIIOTP-UHFFFAOYSA-K 0.000 description 1
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/002—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the linkage of the reactive group being alternatively specified
- C09B62/006—Azodyes
- C09B62/012—Metal complex azo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF43056A DE1278044B (de) | 1964-06-03 | 1964-06-03 | Verfahren zur Herstellung von Chromkomplex-Reaktivfarbstoffen |
| IL2352065A IL23520A (en) | 1964-06-03 | 1965-05-11 | Chromium complex azo dyestuffs and process for their production |
| CH658865A CH518339A (de) | 1964-06-03 | 1965-05-11 | Verfahren zur Herstellung von Chromkomplex-Reaktivfarbstoffen |
| BE664682D BE664682A (enExample) | 1964-06-03 | 1965-05-31 | |
| FR19332A FR1436983A (fr) | 1964-06-03 | 1965-06-02 | Colorants azoïques complexes de chrome et procédé pour leur fabrication |
| GB2380565A GB1071320A (en) | 1964-06-03 | 1965-06-03 | Mixed chromium complex monoazo dyestuffs containing a fibre-reactive group |
| AT504065A AT255000B (de) | 1964-06-03 | 1965-06-03 | Verfahren zur Herstellung von neuen Chromkomplex-Azofarbstoffen |
| NL6507085A NL6507085A (enExample) | 1964-06-03 | 1965-06-03 |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF43056A DE1278044B (de) | 1964-06-03 | 1964-06-03 | Verfahren zur Herstellung von Chromkomplex-Reaktivfarbstoffen |
| DEF0044010 | 1964-09-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1278044B true DE1278044B (de) | 1968-09-19 |
Family
ID=25976288
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF43056A Pending DE1278044B (de) | 1964-06-03 | 1964-06-03 | Verfahren zur Herstellung von Chromkomplex-Reaktivfarbstoffen |
Country Status (8)
| Country | Link |
|---|---|
| AT (1) | AT255000B (enExample) |
| BE (1) | BE664682A (enExample) |
| CH (1) | CH518339A (enExample) |
| DE (1) | DE1278044B (enExample) |
| FR (1) | FR1436983A (enExample) |
| GB (1) | GB1071320A (enExample) |
| IL (1) | IL23520A (enExample) |
| NL (1) | NL6507085A (enExample) |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE636099A (enExample) * | 1962-08-13 | |||
| BE628031A (enExample) * | 1963-01-11 | |||
| DE1112228B (de) * | 1957-08-14 | 1961-08-03 | Ciba Geigy | Verfahren zur Herstellung metallhaltiger Azofarbstoffe |
| FR1277942A (fr) * | 1961-01-26 | 1961-12-01 | Geigy Ag J R | Nouveaux colorants azoïques réactifs et leur préparation |
| FR1320294A (fr) * | 1962-03-12 | 1963-03-08 | Ciba Geigy | Nouveaux colorants monoazoïques, leur procédé de préparation et leur emploi |
-
1964
- 1964-06-03 DE DEF43056A patent/DE1278044B/de active Pending
-
1965
- 1965-05-11 CH CH658865A patent/CH518339A/de not_active IP Right Cessation
- 1965-05-11 IL IL2352065A patent/IL23520A/en unknown
- 1965-05-31 BE BE664682D patent/BE664682A/xx unknown
- 1965-06-02 FR FR19332A patent/FR1436983A/fr not_active Expired
- 1965-06-03 GB GB2380565A patent/GB1071320A/en not_active Expired
- 1965-06-03 AT AT504065A patent/AT255000B/de active
- 1965-06-03 NL NL6507085A patent/NL6507085A/xx unknown
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1112228B (de) * | 1957-08-14 | 1961-08-03 | Ciba Geigy | Verfahren zur Herstellung metallhaltiger Azofarbstoffe |
| FR1277942A (fr) * | 1961-01-26 | 1961-12-01 | Geigy Ag J R | Nouveaux colorants azoïques réactifs et leur préparation |
| FR1320294A (fr) * | 1962-03-12 | 1963-03-08 | Ciba Geigy | Nouveaux colorants monoazoïques, leur procédé de préparation et leur emploi |
| BE636099A (enExample) * | 1962-08-13 | |||
| BE628031A (enExample) * | 1963-01-11 |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1436983A (fr) | 1966-04-29 |
| CH518339A (de) | 1972-01-31 |
| AT255000B (de) | 1967-06-12 |
| IL23520A (en) | 1969-03-27 |
| GB1071320A (en) | 1967-06-07 |
| NL6507085A (enExample) | 1965-12-06 |
| BE664682A (enExample) | 1965-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH639680A5 (de) | Wasserloesliche farbstoffe und verfahren zu deren herstellung. | |
| EP0043560B1 (de) | Wasserlösliche Azoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| DE2529657C3 (de) | Flüssige Farbstoffzubereitungen von faserreaktiven Azofarbstoffen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2313722B2 (de) | Chromischkomplex-farbstoffe und ihre verwendung zum faerben und bedrucken von stickstoffhaltigen fasermaterialien | |
| DE2704364C2 (enExample) | ||
| EP0157733B1 (de) | Verfahren zur Herstellung von 1:2-Chromkomplexazofarbstoffen | |
| DE1644366B1 (de) | Verfahren zur Herstellung von metallhaltigen wasserloeslichen Pyrimidinreaktiv-Azofarbstoffen | |
| DE1278044B (de) | Verfahren zur Herstellung von Chromkomplex-Reaktivfarbstoffen | |
| DE1644164B2 (de) | 2 zu 1-chromkomplex-monoazofarbstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| CH372974A (de) | Ausdrückbarer Behälter für Flüssigkeiten und pastenförmige Massen | |
| DE1904112C3 (de) | Faserreaktive, schwermetallhaltige Formazanfarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung zum Färben oder Bedrucken von Textilmaterial | |
| EP0156768A2 (de) | Verfahren zur Herstellung von 1:2-Chromkomplexfarbstoffen | |
| DE1012007B (de) | Verfahren zur Herstellung chromhaltiger Azofarbstoffe | |
| DE2542707C3 (de) | Chrommischkomplexfarbstoffe und deren Verwendung zum Färben und Bedrucken von stickstoffhaltigen Fasermaterialien und Leder | |
| DE1225319B (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE1904113B2 (de) | Faserreaktive, schwermetallhaltige Formazanfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| AT222260B (de) | Verfahren zur Herstellung von neuen Azo-, Anthrachinon- oder Phthalocyaninfarbstoffen | |
| DE670259C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE1544543C3 (de) | Wasserlösliche Metallkomplexazofarbstoffe, Verfahren zu ihrer Herstellung und ihrer Verwendung | |
| DE2138525C3 (de) | Verfahren zur Herstellung von marineblauen und grauen 1 zu 2-Chrom- und Kobaltkomplexazofarbstoffgemisch für natürliche und synthetische Polyamid- und Polyurethanfasern | |
| DE1155872B (de) | Verfahren zur Herstellung von metallhaltigen, reaktiven Farbstoffen | |
| DE1964148C3 (de) | Chromhaltige Azo-Triazol-Komplexfarbstoffe und Verfahren zur Herstellung derselben und deren Verwendung | |
| EP0080094B1 (de) | Kupferhaltige Bisazoreaktivfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von hydroxyl- und/oder stickstoffhaltigen Materialien | |
| DE1544564C3 (enExample) | ||
| DE2429524C2 (de) | Chromhaltige Azofarbstoffe, deren Herstellung und Verwendung |