DE1252691B - Verfahren zur Herstellung von 4-Nitro-pyrazolen - Google Patents
Verfahren zur Herstellung von 4-Nitro-pyrazolenInfo
- Publication number
- DE1252691B DE1252691B DE1964B0075758 DEB0075758A DE1252691B DE 1252691 B DE1252691 B DE 1252691B DE 1964B0075758 DE1964B0075758 DE 1964B0075758 DE B0075758 A DEB0075758 A DE B0075758A DE 1252691 B DE1252691 B DE 1252691B
- Authority
- DE
- Germany
- Prior art keywords
- nitro
- parts
- phenyl
- pyrazoles
- pyrazole
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- XORHNJQEWQGXCN-UHFFFAOYSA-N 4-nitro-1h-pyrazole Chemical class [O-][N+](=O)C=1C=NNC=1 XORHNJQEWQGXCN-UHFFFAOYSA-N 0.000 title claims description 9
- 238000000034 method Methods 0.000 title claims description 9
- 238000002360 preparation method Methods 0.000 title claims description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 9
- 239000011541 reaction mixture Substances 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 8
- DXBRCXLIQGEYDP-UHFFFAOYSA-N 4-hydroxy-5-nitro-1H-pyridazin-6-one Chemical compound [N+](=O)([O-])C=1C(NN=CC1O)=O DXBRCXLIQGEYDP-UHFFFAOYSA-N 0.000 claims description 7
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 5
- 238000001816 cooling Methods 0.000 claims description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 239000000375 suspending agent Substances 0.000 claims description 3
- CZVJIVYLYOVBRP-UHFFFAOYSA-N 1-methyl-4-nitropyrazole Chemical compound CN1C=C([N+]([O-])=O)C=N1 CZVJIVYLYOVBRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- 229910052759 nickel Inorganic materials 0.000 claims description 2
- MGGVALXERJRIRO-UHFFFAOYSA-N 4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-2-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-1H-pyrazol-5-one Chemical group C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)O MGGVALXERJRIRO-UHFFFAOYSA-N 0.000 claims 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 238000002844 melting Methods 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- -1 1-substituted 4-nitro-pyrazoles Chemical class 0.000 description 5
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- IATFOGDERDNVMS-UHFFFAOYSA-N 4-nitro-1-phenylpyrazole Chemical compound C1=C([N+](=O)[O-])C=NN1C1=CC=CC=C1 IATFOGDERDNVMS-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 241001072332 Monia Species 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 150000003217 pyrazoles Chemical class 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- UQXTZCMKWNNBMG-UHFFFAOYSA-N 1-(4-methylphenyl)sulfonyl-4-nitropyrazole Chemical compound C1=CC(C)=CC=C1S(=O)(=O)N1N=CC([N+]([O-])=O)=C1 UQXTZCMKWNNBMG-UHFFFAOYSA-N 0.000 description 1
- WQDQLOXQQUFECI-UHFFFAOYSA-N 2-nitropropanedial Chemical compound [O-][N+](=O)C(C=O)C=O WQDQLOXQQUFECI-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- CLWQEWCCJFUHNV-UHFFFAOYSA-N 5-methyl-2-phenylpyrazole-3-carboxylic acid Chemical compound N1=C(C)C=C(C(O)=O)N1C1=CC=CC=C1 CLWQEWCCJFUHNV-UHFFFAOYSA-N 0.000 description 1
- KKMBBLOQARAATR-UHFFFAOYSA-N C1(=CC=CC=C1)N1NC(C=C1)(C(=O)O)O Chemical compound C1(=CC=CC=C1)N1NC(C=C1)(C(=O)O)O KKMBBLOQARAATR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- OHZZTXYKLXZFSZ-UHFFFAOYSA-I manganese(3+) 5,10,15-tris(1-methylpyridin-1-ium-4-yl)-20-(1-methylpyridin-4-ylidene)porphyrin-22-ide pentachloride Chemical compound [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Mn+3].C1=CN(C)C=CC1=C1C(C=C2)=NC2=C(C=2C=C[N+](C)=CC=2)C([N-]2)=CC=C2C(C=2C=C[N+](C)=CC=2)=C(C=C2)N=C2C(C=2C=C[N+](C)=CC=2)=C2N=C1C=C2 OHZZTXYKLXZFSZ-UHFFFAOYSA-I 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000007157 ring contraction reaction Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-N sodium;hydron;carbonate Chemical compound [Na+].OC(O)=O UIIMBOGNXHQVGW-UHFFFAOYSA-N 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/16—Halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1964B0075758 DE1252691B (de) | 1964-03-06 | 1964-03-06 | Verfahren zur Herstellung von 4-Nitro-pyrazolen |
| CH222465A CH440294A (de) | 1964-03-06 | 1965-02-18 | Verfahren zur Herstellung von 4-Nitropyrazolen |
| NL6502690A NL6502690A (US20050075337A1-20050407-C00081.png) | 1964-03-06 | 1965-03-03 | |
| US439518A US3294814A (en) | 1964-03-06 | 1965-03-04 | 4-nitropyrazoles |
| BE660636D BE660636A (US20050075337A1-20050407-C00081.png) | 1964-03-06 | 1965-03-04 | |
| FR8100A FR1441516A (fr) | 1964-03-06 | 1965-03-05 | Procédé pour la préparation de nitro-4-pyrazoles |
| AT198565A AT246133B (de) | 1964-03-06 | 1965-03-05 | Verfahren zur Herstellung von neuen 4-Nitropyrazolen |
| GB9401/65A GB1092674A (en) | 1964-03-06 | 1965-03-05 | Production of 4-nitropyrazoles |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1964B0075758 DE1252691B (de) | 1964-03-06 | 1964-03-06 | Verfahren zur Herstellung von 4-Nitro-pyrazolen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1252691B true DE1252691B (de) | 1967-10-26 |
Family
ID=6978787
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1964B0075758 Pending DE1252691B (de) | 1964-03-06 | 1964-03-06 | Verfahren zur Herstellung von 4-Nitro-pyrazolen |
Country Status (8)
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3869274A (en) * | 1972-08-21 | 1975-03-04 | Abbott Lab | Method and composition for inducing fruit abscission |
| US4025530A (en) * | 1974-05-02 | 1977-05-24 | Abbott Laboratories | 4-Nitropyrazoles |
| DE3332270A1 (de) * | 1983-09-07 | 1985-03-21 | Bayer Ag, 5090 Leverkusen | Herbizide mittel enthaltend metribuzin in kombination mit 1,4-disubstituierten pyrazol-derivaten |
| US8603200B2 (en) * | 2009-06-22 | 2013-12-10 | Afton Chemical Corporation | Compositions comprising combustion improvers and methods of use thereof |
| WO2011056895A1 (en) * | 2009-11-03 | 2011-05-12 | University Of Notre Dame Du Lac | Ionic liquids comprising heteraromatic anions |
| CN114276251B (zh) * | 2021-12-07 | 2022-12-16 | 武汉大学 | 一种合成硝基(杂)芳烃的方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3102890A (en) * | 1963-09-03 | Pyrazole derivatives |
-
1964
- 1964-03-06 DE DE1964B0075758 patent/DE1252691B/de active Pending
-
1965
- 1965-02-18 CH CH222465A patent/CH440294A/de unknown
- 1965-03-03 NL NL6502690A patent/NL6502690A/xx unknown
- 1965-03-04 US US439518A patent/US3294814A/en not_active Expired - Lifetime
- 1965-03-04 BE BE660636D patent/BE660636A/xx unknown
- 1965-03-05 AT AT198565A patent/AT246133B/de active
- 1965-03-05 FR FR8100A patent/FR1441516A/fr not_active Expired
- 1965-03-05 GB GB9401/65A patent/GB1092674A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR1441516A (fr) | 1966-06-10 |
| NL6502690A (US20050075337A1-20050407-C00081.png) | 1965-09-07 |
| BE660636A (US20050075337A1-20050407-C00081.png) | 1965-09-06 |
| AT246133B (de) | 1966-04-12 |
| GB1092674A (en) | 1967-11-29 |
| US3294814A (en) | 1966-12-27 |
| CH440294A (de) | 1967-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH597199A5 (en) | 3-Phenyl pyridaz-6-ones prodn. | |
| DE1252691B (de) | Verfahren zur Herstellung von 4-Nitro-pyrazolen | |
| DE2347015A1 (de) | Neue pyrazolyloxyessigsaeurederivate und verfahren zu ihrer herstellung | |
| DE1695193A1 (de) | Verfahren zur Herstellung von Chinazolin-Derivaten | |
| DE2614827C2 (de) | Verfahren zur Herstellung von 3-Phenylpyridazon-(6) | |
| EP0073970B1 (de) | Verfahren zur Herstellung von 4-Methyl-5-oxo-3-thioxotetrahydro-1,2,4-(2H, 4H)-triazinen | |
| DE2814330B2 (de) | Verfahren zur Herstellung von 2,6-Dichlorpyridin-Derivaten | |
| DE1445507A1 (de) | Verfahren zur Herstellung von 4-Amino-5-hydroxypyridazonen-(6) | |
| DE1229095B (de) | Verfahren zur Herstellung von substituierten 4-Nitro-pyrazol-5-carbonsaeuren | |
| DE2819798C2 (US20050075337A1-20050407-C00081.png) | ||
| DE2653834C2 (de) | Verfahren zur Herstellung von 2-Cyanamino-4,6 bis (alkyl-bzw dialkyl-) amino-sym.-triazinen | |
| DE1695667A1 (de) | Neue Pyrrolderivate,deren Herstellung und deren Verwendung | |
| DE1234223B (de) | Verfahren zur Herstellung von Pyrazolderivaten | |
| EP0063349A1 (de) | 5-Acyloxy-4 (5H)-oxazolonium-Salze, Verfahren zu ihrer Herstellung und ihre Verwendung als Zwischenprodukte zur Synthese von herbizid wirksamen Triazinonen | |
| DE3727126A1 (de) | N-(2-chlor-pyridin-5-yl-methyl)-phthalimid, verfahren zu seiner herstellung und weiterverarbeitung zu 2-chlor-5-aminomethyl-pyridin | |
| DE1445521C (de) | Verfahren zur Herstellung von In dazol (3) carbonsauren | |
| DE1695893C (de) | Verfahren zur Herstellung von 4 Amino 5 acylamidomethyl pynmidinen | |
| DE1213841B (de) | Verfahren zur Herstellung von 3-Aryl-4-halogen-pyridazonen-(6) | |
| DE1275064B (de) | Verfahren zur Herstellung von Pyridazoniminen | |
| AT258916B (de) | Verfahren zur Herstellung von neuen Alkyl-3-amino-5-chlor-6-X-pyrazinoaten | |
| DE1695893B1 (de) | Verfahren zur Herstellung von 4-Amino-5-acylamidomethylpyrimidinen | |
| AT340426B (de) | Verfahren zur herstellung von 4,5-dihydrotetrazolo-(1,5-a)-chinolinverbindungen | |
| AT236382B (de) | Verfahren zur Herstellung von neuen Derivaten des Sulfanilamids | |
| EP3533789A1 (de) | Verfahren zur herstellung von trimethallylisocyanurat | |
| AT216505B (de) | Verfahren zur Herstellung von Pyrazolinobenzimidazolen |
