DE1237103B - Verfahren zur Herstellung von Isocyanaten - Google Patents
Verfahren zur Herstellung von IsocyanatenInfo
- Publication number
- DE1237103B DE1237103B DEA47050A DEA0047050A DE1237103B DE 1237103 B DE1237103 B DE 1237103B DE A47050 A DEA47050 A DE A47050A DE A0047050 A DEA0047050 A DE A0047050A DE 1237103 B DE1237103 B DE 1237103B
- Authority
- DE
- Germany
- Prior art keywords
- pressure
- reaction
- isocyanates
- temperature
- isocyanate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 40
- 239000012948 isocyanate Substances 0.000 title claims description 25
- 150000002513 isocyanates Chemical class 0.000 title claims description 24
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 19
- -1 aromatic dinitro compound Chemical class 0.000 claims description 17
- 239000002904 solvent Substances 0.000 claims description 17
- 239000003054 catalyst Substances 0.000 claims description 15
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims description 14
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 14
- 239000007858 starting material Substances 0.000 claims description 14
- 150000002828 nitro derivatives Chemical class 0.000 claims description 12
- 229910000510 noble metal Inorganic materials 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 238000000354 decomposition reaction Methods 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 26
- 239000000047 product Substances 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 7
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 6
- PLAZTCDQAHEYBI-UHFFFAOYSA-N 2-nitrotoluene Chemical compound CC1=CC=CC=C1[N+]([O-])=O PLAZTCDQAHEYBI-UHFFFAOYSA-N 0.000 description 5
- 238000005810 carbonylation reaction Methods 0.000 description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 5
- AJDIZQLSFPQPEY-UHFFFAOYSA-N 1,1,2-Trichlorotrifluoroethane Chemical compound FC(F)(Cl)C(F)(Cl)Cl AJDIZQLSFPQPEY-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- KMAQZIILEGKYQZ-UHFFFAOYSA-N 1-chloro-3-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC(Cl)=C1 KMAQZIILEGKYQZ-UHFFFAOYSA-N 0.000 description 2
- ZPTVNYMJQHSSEA-UHFFFAOYSA-N 4-nitrotoluene Chemical compound CC1=CC=C([N+]([O-])=O)C=C1 ZPTVNYMJQHSSEA-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Natural products CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 230000006315 carbonylation Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- NJNQUTDUIPVROZ-UHFFFAOYSA-N nitrocyclohexane Chemical compound [O-][N+](=O)C1CCCCC1 NJNQUTDUIPVROZ-UHFFFAOYSA-N 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- 239000010948 rhodium Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229910052715 tantalum Inorganic materials 0.000 description 2
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 2
- DAGUXKOUBVTFGR-UHFFFAOYSA-N 1,1-dinitrooctane Chemical compound CCCCCCCC([N+]([O-])=O)[N+]([O-])=O DAGUXKOUBVTFGR-UHFFFAOYSA-N 0.000 description 1
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- WDCYWAQPCXBPJA-UHFFFAOYSA-N 1,3-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC([N+]([O-])=O)=C1 WDCYWAQPCXBPJA-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- FYFDQJRXFWGIBS-UHFFFAOYSA-N 1,4-dinitrobenzene Chemical compound [O-][N+](=O)C1=CC=C([N+]([O-])=O)C=C1 FYFDQJRXFWGIBS-UHFFFAOYSA-N 0.000 description 1
- SBJCUZQNHOLYMD-UHFFFAOYSA-N 1,5-Naphthalene diisocyanate Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1N=C=O SBJCUZQNHOLYMD-UHFFFAOYSA-N 0.000 description 1
- ZUTCJXFCHHDFJS-UHFFFAOYSA-N 1,5-dinitronaphthalene Chemical compound C1=CC=C2C([N+](=O)[O-])=CC=CC2=C1[N+]([O-])=O ZUTCJXFCHHDFJS-UHFFFAOYSA-N 0.000 description 1
- YXBHCFHBPVLHEZ-UHFFFAOYSA-N 1,6-dinitrohexane Chemical compound [O-][N+](=O)CCCCCC[N+]([O-])=O YXBHCFHBPVLHEZ-UHFFFAOYSA-N 0.000 description 1
- ZAIDGMWHINKYFA-UHFFFAOYSA-N 1,7-dinitronaphthalene Chemical compound C1=CC=C([N+]([O-])=O)C2=CC([N+](=O)[O-])=CC=C21 ZAIDGMWHINKYFA-UHFFFAOYSA-N 0.000 description 1
- HHIRBXHEYVDUAM-UHFFFAOYSA-N 1-chloro-3-isocyanatobenzene Chemical compound ClC1=CC=CC(N=C=O)=C1 HHIRBXHEYVDUAM-UHFFFAOYSA-N 0.000 description 1
- ZMEJRPKJAMJHCX-UHFFFAOYSA-N 1-chloro-3-nitropropane Chemical compound [O-][N+](=O)CCCCl ZMEJRPKJAMJHCX-UHFFFAOYSA-N 0.000 description 1
- CPPGZWWUPFWALU-UHFFFAOYSA-N 1-isocyanato-3-methylbenzene Chemical compound CC1=CC=CC(N=C=O)=C1 CPPGZWWUPFWALU-UHFFFAOYSA-N 0.000 description 1
- VJLRNYJSDNWVGF-UHFFFAOYSA-N 1-methyl-2-[(2-methylphenyl)-dinitromethyl]benzene Chemical compound [N+](=O)([O-])C(C1=C(C=CC=C1)C)(C1=C(C=CC=C1)C)[N+](=O)[O-] VJLRNYJSDNWVGF-UHFFFAOYSA-N 0.000 description 1
- WHNAMGUAXHGCHH-UHFFFAOYSA-N 1-nitro-3-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC=CC(C(F)(F)F)=C1 WHNAMGUAXHGCHH-UHFFFAOYSA-N 0.000 description 1
- BDLNCFCZHNKBGI-UHFFFAOYSA-N 1-nitro-4-(4-nitrophenyl)benzene Chemical group C1=CC([N+](=O)[O-])=CC=C1C1=CC=C([N+]([O-])=O)C=C1 BDLNCFCZHNKBGI-UHFFFAOYSA-N 0.000 description 1
- GLBZQZXDUTUCGK-UHFFFAOYSA-N 1-nitro-4-[(4-nitrophenyl)methyl]benzene Chemical compound C1=CC([N+](=O)[O-])=CC=C1CC1=CC=C([N+]([O-])=O)C=C1 GLBZQZXDUTUCGK-UHFFFAOYSA-N 0.000 description 1
- YCANAXVBJKNANM-UHFFFAOYSA-N 1-nitroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2[N+](=O)[O-] YCANAXVBJKNANM-UHFFFAOYSA-N 0.000 description 1
- NALZTFARIYUCBY-UHFFFAOYSA-N 1-nitrobutane Chemical compound CCCC[N+]([O-])=O NALZTFARIYUCBY-UHFFFAOYSA-N 0.000 description 1
- YBXXUYRSOKDDET-UHFFFAOYSA-N 1-nitrocyclohexan-1-ol Chemical compound [O-][N+](=O)C1(O)CCCCC1 YBXXUYRSOKDDET-UHFFFAOYSA-N 0.000 description 1
- DJBRXNRKYAWTBL-UHFFFAOYSA-N 1-nitrocyclohexene Chemical compound [O-][N+](=O)C1=CCCCC1 DJBRXNRKYAWTBL-UHFFFAOYSA-N 0.000 description 1
- GSYMYSYDHKNXFU-UHFFFAOYSA-N 1-nitrooctadecane Chemical compound CCCCCCCCCCCCCCCCCC[N+]([O-])=O GSYMYSYDHKNXFU-UHFFFAOYSA-N 0.000 description 1
- RIHXMHKNTLBIPJ-UHFFFAOYSA-N 1-nitroprop-1-ene Chemical group CC=C[N+]([O-])=O RIHXMHKNTLBIPJ-UHFFFAOYSA-N 0.000 description 1
- JSZOAYXJRCEYSX-UHFFFAOYSA-N 1-nitropropane Chemical compound CCC[N+]([O-])=O JSZOAYXJRCEYSX-UHFFFAOYSA-N 0.000 description 1
- RMBFBMJGBANMMK-UHFFFAOYSA-N 2,4-dinitrotoluene Chemical compound CC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O RMBFBMJGBANMMK-UHFFFAOYSA-N 0.000 description 1
- WGJPTPNEGGRIRA-UHFFFAOYSA-N 2-isocyanatofuran Chemical compound O=C=NC1=CC=CO1 WGJPTPNEGGRIRA-UHFFFAOYSA-N 0.000 description 1
- SZNILIWUUKKNPE-UHFFFAOYSA-N 2-nitrocyclohexan-1-one Chemical compound [O-][N+](=O)C1CCCCC1=O SZNILIWUUKKNPE-UHFFFAOYSA-N 0.000 description 1
- FUBFWTUFPGFHOJ-UHFFFAOYSA-N 2-nitrofuran Chemical compound [O-][N+](=O)C1=CC=CO1 FUBFWTUFPGFHOJ-UHFFFAOYSA-N 0.000 description 1
- NCUNAWPWFZUEPV-UHFFFAOYSA-N 2-nitrooxolane Chemical compound [O-][N+](=O)C1CCCO1 NCUNAWPWFZUEPV-UHFFFAOYSA-N 0.000 description 1
- CSHPMTHZMGMMAC-UHFFFAOYSA-N 2-nitropentanenitrile Chemical compound CCCC(C#N)[N+]([O-])=O CSHPMTHZMGMMAC-UHFFFAOYSA-N 0.000 description 1
- VAYMIYBJLRRIFR-UHFFFAOYSA-N 2-tolyl isocyanate Chemical compound CC1=CC=CC=C1N=C=O VAYMIYBJLRRIFR-UHFFFAOYSA-N 0.000 description 1
- QZYHIOPPLUPUJF-UHFFFAOYSA-N 3-nitrotoluene Chemical compound CC1=CC=CC([N+]([O-])=O)=C1 QZYHIOPPLUPUJF-UHFFFAOYSA-N 0.000 description 1
- UPMLOUAZCHDJJD-UHFFFAOYSA-N 4,4'-Diphenylmethane Diisocyanate Chemical compound C1=CC(N=C=O)=CC=C1CC1=CC=C(N=C=O)C=C1 UPMLOUAZCHDJJD-UHFFFAOYSA-N 0.000 description 1
- BAJQRLZAPXASRD-UHFFFAOYSA-N 4-Nitrobiphenyl Chemical group C1=CC([N+](=O)[O-])=CC=C1C1=CC=CC=C1 BAJQRLZAPXASRD-UHFFFAOYSA-N 0.000 description 1
- XSCMOKDVPSTAJY-UHFFFAOYSA-N 4-methyl-2-[(5-methyl-2-nitrophenyl)methyl]-1-nitrobenzene Chemical compound CC1=CC=C([N+]([O-])=O)C(CC=2C(=CC=C(C)C=2)[N+]([O-])=O)=C1 XSCMOKDVPSTAJY-UHFFFAOYSA-N 0.000 description 1
- MGYGFNQQGAQEON-UHFFFAOYSA-N 4-tolyl isocyanate Chemical compound CC1=CC=C(N=C=O)C=C1 MGYGFNQQGAQEON-UHFFFAOYSA-N 0.000 description 1
- MDIQRSXTLMQNJQ-UHFFFAOYSA-N 5-isocyanatopyrimidine Chemical compound O=C=NC1=CN=CN=C1 MDIQRSXTLMQNJQ-UHFFFAOYSA-N 0.000 description 1
- NOYDQGFVFOQSAJ-UHFFFAOYSA-N 5-nitropyrimidine Chemical compound [O-][N+](=O)C1=CN=CN=C1 NOYDQGFVFOQSAJ-UHFFFAOYSA-N 0.000 description 1
- LSIKFJXEYJIZNB-UHFFFAOYSA-N 9-Nitroanthracene Chemical compound C1=CC=C2C([N+](=O)[O-])=C(C=CC=C3)C3=CC2=C1 LSIKFJXEYJIZNB-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- BNUHAJGCKIQFGE-UHFFFAOYSA-N Nitroanisol Chemical compound COC1=CC=C([N+]([O-])=O)C=C1 BNUHAJGCKIQFGE-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- NOFALFIAXQXOFU-UHFFFAOYSA-N [N+](=O)([O-])CCC=CCCCC[N+](=O)[O-] Chemical compound [N+](=O)([O-])CCC=CCCCC[N+](=O)[O-] NOFALFIAXQXOFU-UHFFFAOYSA-N 0.000 description 1
- JYPKTXWNQVIJJE-UHFFFAOYSA-N [dinitro(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C([N+]([O-])=O)([N+](=O)[O-])C1=CC=CC=C1 JYPKTXWNQVIJJE-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 150000001923 cyclic compounds Chemical class 0.000 description 1
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 231100000086 high toxicity Toxicity 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 125000004971 nitroalkyl group Chemical group 0.000 description 1
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 150000002941 palladium compounds Chemical class 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- CLSUSRZJUQMOHH-UHFFFAOYSA-L platinum dichloride Chemical compound Cl[Pt]Cl CLSUSRZJUQMOHH-UHFFFAOYSA-L 0.000 description 1
- NWAHZABTSDUXMJ-UHFFFAOYSA-N platinum(2+);dinitrate Chemical compound [Pt+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O NWAHZABTSDUXMJ-UHFFFAOYSA-N 0.000 description 1
- PQTLYDQECILMMB-UHFFFAOYSA-L platinum(2+);sulfate Chemical compound [Pt+2].[O-]S([O-])(=O)=O PQTLYDQECILMMB-UHFFFAOYSA-L 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 230000003335 steric effect Effects 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C263/00—Preparation of derivatives of isocyanic acid
- C07C263/14—Preparation of derivatives of isocyanic acid by catalytic reaction of nitro compounds with carbon monoxide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/66—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US30868463A | 1963-09-13 | 1963-09-13 | |
| US33372763A | 1963-12-26 | 1963-12-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1237103B true DE1237103B (de) | 1967-03-23 |
Family
ID=26976379
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEA47050A Pending DE1237103B (de) | 1963-09-13 | 1964-09-10 | Verfahren zur Herstellung von Isocyanaten |
Country Status (5)
| Country | Link |
|---|---|
| BE (1) | BE651876A (cg-RX-API-DMAC7.html) |
| DE (1) | DE1237103B (cg-RX-API-DMAC7.html) |
| GB (1) | GB1025436A (cg-RX-API-DMAC7.html) |
| LU (1) | LU46905A1 (cg-RX-API-DMAC7.html) |
| NL (1) | NL141501B (cg-RX-API-DMAC7.html) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2311092A1 (de) * | 1972-03-07 | 1973-09-20 | Sumitomo Chemical Co | Verfahren zur herstellung von aromatischen isocyanaten |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3467694A (en) * | 1965-10-15 | 1969-09-16 | American Cyanamid Co | Process for producing urethanes |
| US3481967A (en) * | 1966-04-01 | 1969-12-02 | Olin Mathieson | Process for preparing aromatic isocyanates |
| US3523966A (en) * | 1966-04-01 | 1970-08-11 | Olin Corp | Process for preparing aromatic isocyanates |
| US3467688A (en) * | 1966-07-05 | 1969-09-16 | American Cyanamid Co | Conversion of azo or azoxy compounds to isocyanates |
| US3481968A (en) * | 1967-10-02 | 1969-12-02 | Olin Mathieson | Preparation of halogenated aromatic isocyanates |
| US4052437A (en) * | 1975-09-22 | 1977-10-04 | Ethyl Corporation | Process for producing urethane from nitro compounds, hydroxyl compounds and carbon monoxide using rhodium oxide catalysts |
| US4070391A (en) | 1975-09-22 | 1978-01-24 | Ethyl Corporation | Process for producing isocyanate from nitro compounds and carbon monoxide using rhodium oxide catalysts |
| US4052420A (en) * | 1975-09-22 | 1977-10-04 | Ethyl Corporation | Process for producing diurethane from dinitro compounds, hydroxyl compounds and carbon monoxide |
| DE2917569A1 (de) * | 1979-04-30 | 1980-11-13 | Basf Ag | Verfahren zur herstellung von aromatischen di- und polyurethanen |
| US4851565A (en) * | 1979-04-30 | 1989-07-25 | Basf Aktiengesellschaft | Catalyzed process for the preparation of an aliphatic, cycloaliphatic, arylaliphatic or aliphatic-cycloaliphatic di- or polyurethane |
| DE2917493A1 (de) * | 1979-04-30 | 1980-11-13 | Basf Ag | Verfahren zur herstellung von aliphatischen und cycloaliphatischen di- und polyurethanen |
-
1964
- 1964-08-14 BE BE651876D patent/BE651876A/xx unknown
- 1964-08-19 GB GB33925/64A patent/GB1025436A/en not_active Expired
- 1964-09-08 LU LU46905D patent/LU46905A1/xx unknown
- 1964-09-09 NL NL646410490A patent/NL141501B/xx unknown
- 1964-09-10 DE DEA47050A patent/DE1237103B/de active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2311092A1 (de) * | 1972-03-07 | 1973-09-20 | Sumitomo Chemical Co | Verfahren zur herstellung von aromatischen isocyanaten |
Also Published As
| Publication number | Publication date |
|---|---|
| BE651876A (cg-RX-API-DMAC7.html) | 1965-02-15 |
| NL6410490A (cg-RX-API-DMAC7.html) | 1964-11-25 |
| GB1025436A (en) | 1966-04-06 |
| LU46905A1 (cg-RX-API-DMAC7.html) | 1964-11-09 |
| NL141501B (nl) | 1974-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2908251A1 (de) | Verfahren zur herstellung von urethanen | |
| DE1237103B (de) | Verfahren zur Herstellung von Isocyanaten | |
| DE1768181C3 (de) | Verfahren zur Herstellung von aromatischen Isocyanaten | |
| DE2526193A1 (de) | Verfahren zur herstellung von isocyanaten | |
| CH510643A (de) | Verfahren zur Herstellung von Urethanen | |
| DE2808980A1 (de) | Verfahren zur herstellung von urethanen | |
| DE1944747A1 (de) | Verfahren zur Herstellung von organischen Isocyanaten | |
| EP0014845B1 (de) | Verfahren zur Herstellung von Urethanen | |
| DE2555557B2 (de) | Verfahren zur herstellung eines aromatischen carbaminsaeurealkylesters | |
| DD149060A5 (de) | Verfahren zur herstellung m-chlor-substituierter aniline | |
| DE2005309B2 (de) | Verfahren zur Herstellung von 1,3-Cyclohexylendiisocyanaten | |
| EP0005226B1 (de) | Verfahren zur Herstellung von Urethanen | |
| DE1958013C3 (cg-RX-API-DMAC7.html) | ||
| EP0016949A1 (de) | Verfahren zur Herstellung von Urethanen | |
| CH451118A (de) | Verfahren zur Herstellung von Isocyanaten | |
| DE2334532A1 (de) | Verfahren zur herstellung von aromatischen isocyanaten | |
| DE1643572A1 (de) | Verfahren zur Herstellung von organischen Isocyanaten | |
| DE2743610B2 (de) | Verfahren zur Herstellung von chlorsubstituierten aromatischen Aminen | |
| DE1907595C3 (de) | Verfahren zur Herstellung von aromatischen Isocyanaten | |
| EP0315863B1 (de) | Fluor enthaltende Trifluormethylaminobenzole und deren Herstellung | |
| DE1668529B1 (de) | Verfahren zur Herstellung von aromatischen Isocyanaten | |
| DE1768184C3 (de) | Verfahren zur Herstellung aromatischer Isocyanate | |
| DE1568044C3 (de) | Verfahren zur Herstellung von Urethanen | |
| DE1959577C (de) | Verfahren zur Herstellung von Aminophenylalkylathern | |
| DE1593070A1 (de) | Verfahren zur Herstellung von cycloaliphatischen Diaminen |