DE1228717B - Hochdruck-Entladungslampe - Google Patents
Hochdruck-EntladungslampeInfo
- Publication number
- DE1228717B DE1228717B DEN23103A DEN0023103A DE1228717B DE 1228717 B DE1228717 B DE 1228717B DE N23103 A DEN23103 A DE N23103A DE N0023103 A DEN0023103 A DE N0023103A DE 1228717 B DE1228717 B DE 1228717B
- Authority
- DE
- Germany
- Prior art keywords
- discharge lamp
- pressure discharge
- discharge
- patents
- tin dioxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 claims description 16
- 230000005855 radiation Effects 0.000 claims description 14
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 8
- 229910052753 mercury Inorganic materials 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 229910001511 metal iodide Inorganic materials 0.000 claims description 4
- 229910052756 noble gas Inorganic materials 0.000 claims description 4
- -1 metals Iodides Chemical class 0.000 claims description 2
- 229910006404 SnO 2 Inorganic materials 0.000 description 3
- 150000004694 iodide salts Chemical class 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 229910052738 indium Inorganic materials 0.000 description 2
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 238000009877 rendering Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052716 thallium Inorganic materials 0.000 description 2
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- QKEOZZYXWAIQFO-UHFFFAOYSA-M mercury(1+);iodide Chemical class [Hg]I QKEOZZYXWAIQFO-UHFFFAOYSA-M 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002835 noble gases Chemical class 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/82—Lamps with high-pressure unconstricted discharge having a cold pressure > 400 Torr
- H01J61/827—Metal halide arc lamps
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/125—Selection of substances for gas fillings; Specified operating pressure or temperature having an halogenide as principal component
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/18—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/30—Vessels; Containers
- H01J61/35—Vessels; Containers provided with coatings on the walls thereof; Selection of materials for the coatings
Landscapes
- Discharge Lamp (AREA)
- Physical Or Chemical Processes And Apparatus (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
- Vessels And Coating Films For Discharge Lamps (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL277952 | 1962-05-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1228717B true DE1228717B (de) | 1966-11-17 |
Family
ID=19753795
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN23103A Pending DE1228717B (de) | 1962-05-02 | 1963-04-27 | Hochdruck-Entladungslampe |
| DEN14905U Expired DE1963512U (de) | 1962-05-02 | 1963-04-27 | Strahlenquelle mit einer gasentladungslampe. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEN14905U Expired DE1963512U (de) | 1962-05-02 | 1963-04-27 | Strahlenquelle mit einer gasentladungslampe. |
Country Status (7)
| Country | Link |
|---|---|
| BE (1) | BE631753A (https=) |
| CH (1) | CH427080A (https=) |
| DE (2) | DE1228717B (https=) |
| ES (1) | ES287551A1 (https=) |
| GB (1) | GB1012574A (https=) |
| NL (1) | NL277952A (https=) |
| OA (1) | OA00845A (https=) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3331982A (en) * | 1964-10-20 | 1967-07-18 | Sylvania Electric Prod | High pressure electric discharge device having a fill including vanadium |
| US4109175A (en) * | 1976-03-19 | 1978-08-22 | Matsushita Electronics Corporation | High pressure sodium vapor discharge lamp |
| DE2926938A1 (de) | 1979-07-04 | 1981-01-22 | Rau Swf Autozubehoer | Schaltanordnung zum antrieb eines beweglichen elementes, insbesondere zum antrieb von scheiben o.dgl. in kraftfahrzeugen |
| EP1632985B1 (de) | 2004-09-07 | 2014-06-25 | OSRAM GmbH | Hochdruckentladungslampe |
Citations (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE134732C (https=) * | ||||
| CH165991A (de) * | 1931-09-19 | 1933-12-15 | Philips Nv | Elektrische Entladungsröhre zum Aussenden von Lichtstrahlen. |
| GB415613A (en) * | 1932-11-15 | 1934-08-30 | Philips Nv | Improvements in or relating to devices comprising at least one electric discharge lamp |
| DE684577C (de) * | 1936-10-29 | 1939-12-01 | Patra Patent Treuhand | Einsockelige elektrische Metalldampfentladungslampe mit umschliessendem Waermeschutzmantel |
| CH208846A (de) * | 1938-03-11 | 1940-02-29 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Elektrische Hochdruck-Quecksilberdampflampe mit festen Glühelektroden. |
| DE902528C (de) * | 1935-11-19 | 1954-01-25 | Ulrich W Doering | Elektrische Hochdruckentladungsleuchtroehre |
| DE948897C (de) * | 1951-10-20 | 1956-09-06 | Dr Franz Skaupy | Gasentladungsfluoreszenzlampe |
| DE967658C (de) * | 1949-09-04 | 1957-12-05 | Heraeus Gmbh W C | Dampfentladungslampe |
| GB852783A (en) * | 1958-06-03 | 1960-11-02 | Gen Electric Co Ltd | Improvements in or relating to high pressure mercury vapour electric discharge lamps |
| DE1166366B (de) | 1961-10-04 | 1964-03-26 | Philips Nv | Natriumdampfentladungslampe |
| DE1196787B (de) | 1962-04-12 | 1965-07-15 | Philips Nv | Dampfentladungslampe |
-
0
- NL NL277952D patent/NL277952A/xx unknown
- BE BE631753D patent/BE631753A/xx unknown
-
1963
- 1963-04-27 DE DEN23103A patent/DE1228717B/de active Pending
- 1963-04-27 DE DEN14905U patent/DE1963512U/de not_active Expired
- 1963-04-29 CH CH534963A patent/CH427080A/de unknown
- 1963-04-29 GB GB16723/63A patent/GB1012574A/en not_active Expired
- 1963-04-30 ES ES287551A patent/ES287551A1/es not_active Expired
-
1964
- 1964-12-19 OA OA50931A patent/OA00845A/xx unknown
Patent Citations (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE134732C (https=) * | ||||
| CH165991A (de) * | 1931-09-19 | 1933-12-15 | Philips Nv | Elektrische Entladungsröhre zum Aussenden von Lichtstrahlen. |
| GB415613A (en) * | 1932-11-15 | 1934-08-30 | Philips Nv | Improvements in or relating to devices comprising at least one electric discharge lamp |
| DE902528C (de) * | 1935-11-19 | 1954-01-25 | Ulrich W Doering | Elektrische Hochdruckentladungsleuchtroehre |
| DE684577C (de) * | 1936-10-29 | 1939-12-01 | Patra Patent Treuhand | Einsockelige elektrische Metalldampfentladungslampe mit umschliessendem Waermeschutzmantel |
| CH208846A (de) * | 1938-03-11 | 1940-02-29 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Elektrische Hochdruck-Quecksilberdampflampe mit festen Glühelektroden. |
| DE967658C (de) * | 1949-09-04 | 1957-12-05 | Heraeus Gmbh W C | Dampfentladungslampe |
| DE948897C (de) * | 1951-10-20 | 1956-09-06 | Dr Franz Skaupy | Gasentladungsfluoreszenzlampe |
| GB852783A (en) * | 1958-06-03 | 1960-11-02 | Gen Electric Co Ltd | Improvements in or relating to high pressure mercury vapour electric discharge lamps |
| DE1166366B (de) | 1961-10-04 | 1964-03-26 | Philips Nv | Natriumdampfentladungslampe |
| DE1196787B (de) | 1962-04-12 | 1965-07-15 | Philips Nv | Dampfentladungslampe |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1012574A (en) | 1965-12-08 |
| CH427080A (de) | 1966-12-31 |
| BE631753A (https=) | |
| NL277952A (https=) | |
| DE1963512U (de) | 1967-07-06 |
| ES287551A1 (es) | 1963-07-16 |
| OA00845A (fr) | 1967-11-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3028405C2 (de) | Lampe mit einem Entladungsgefäß in einem äußeren Glaskolben und Verwendung dieser Lampe | |
| DE1464181A1 (de) | Elektrische Gasentladungslampe | |
| DE1940539A1 (de) | Quecksilberdampf-Hochdruckentladungslampe mit Metallhalogenidzusatz | |
| DE1217496B (de) | Quecksilberdampf-Hochdruckentladungslampe mit Metallhalogen-Zusatz | |
| DE2519377A1 (de) | Quecksilberdampf-hochdruckentladungslampe | |
| DE1764979A1 (de) | Quecksilber-Metallhalogenid-Dampflampe mit Regeneration | |
| DE2225308C3 (de) | Hochdruckgasentladungslampe | |
| DE2619674A1 (de) | Halogen-metalldampfentladungslampe | |
| DE1166366B (de) | Natriumdampfentladungslampe | |
| DE1228717B (de) | Hochdruck-Entladungslampe | |
| DE1489406C3 (de) | Hochdruck-Quecksilberdampf entladungslampe | |
| DE2639478A1 (de) | Hochdruckgasentladungslampe | |
| DE2106447A1 (de) | Quecksilberdampf-Hochdruckentladungslampe mit einem Zusatz von Metallhalogeniden | |
| DE2301465A1 (de) | Elektrische entladungslampe | |
| DE2225223C3 (de) | Ultraviolettlicht aussendende Quecksilberdampflampe | |
| DE1286637B (de) | Elektrische Hochdruck-Metalldampf-Entladungslampe | |
| DE3731134C2 (de) | Hochdruck-Metallhalogenidentladungslampe mit niedriger Farbtemperatur und guter Farbwiedergabe | |
| DE1001415B (de) | Entladungslampe mit farbkorrigierender Leuchtstoffschicht und Reflektor | |
| DE2722694A1 (de) | Quecksilberdampf-niederdruckentladungslampe | |
| DE729506C (de) | Analysenlampe mit einer ultraviolettdurchlaessigen, sichtbare Strahlen aber weitgehend abschirmenden Huelle | |
| DE2150740C3 (de) | Leuchtstofflampe hoher Intensität | |
| DE2903963A1 (de) | Entladungslampe und ihre verwendung | |
| DE975254C (de) | Leuchtstoffgemisch, insbesondere fuer eine im Strahlengang einer Hochdruckquecksilberdampfentladungslampe angeordnete Leuchtstoffschicht | |
| DE733786C (de) | Elektrische Mischlichtlampe, bestehend aus einer Gasentladungsroehre mit durch die Entladung aufgeheizten Gluehelektroden, einem mit dieser Roehre in Reihe geschalteten und deren Vorschaltwiderstand bildenden Gluehdraht sowie einer die Entladungsroehre und den Gluehdraht gasdicht umschliessenden Aussenhuelle | |
| EP0334356A1 (de) | Wandstabilisierte Metalldampfentladungslampe |