DE1225788B - Verfahren zur Herstellung von Dihalogenpyrimidylfarbstoffen - Google Patents
Verfahren zur Herstellung von DihalogenpyrimidylfarbstoffenInfo
- Publication number
- DE1225788B DE1225788B DENDAT1225788D DE1225788DA DE1225788B DE 1225788 B DE1225788 B DE 1225788B DE NDAT1225788 D DENDAT1225788 D DE NDAT1225788D DE 1225788D A DE1225788D A DE 1225788DA DE 1225788 B DE1225788 B DE 1225788B
- Authority
- DE
- Germany
- Prior art keywords
- parts
- acid
- dyes
- amino
- dye
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000975 dye Substances 0.000 title claims description 130
- 238000000034 method Methods 0.000 title claims description 18
- 230000008569 process Effects 0.000 title claims description 10
- 239000002243 precursor Substances 0.000 claims description 17
- 125000003118 aryl group Chemical group 0.000 claims description 11
- 239000007795 chemical reaction product Substances 0.000 claims description 5
- 238000004040 coloring Methods 0.000 claims description 2
- -1 heterocyclic radical Chemical class 0.000 description 61
- 239000000243 solution Substances 0.000 description 54
- 150000001875 compounds Chemical class 0.000 description 52
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 38
- 230000008878 coupling Effects 0.000 description 35
- 238000010168 coupling process Methods 0.000 description 35
- 238000005859 coupling reaction Methods 0.000 description 35
- 229920000742 Cotton Polymers 0.000 description 34
- 239000002253 acid Substances 0.000 description 33
- 239000000203 mixture Substances 0.000 description 30
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 27
- 125000003277 amino group Chemical group 0.000 description 26
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 22
- 150000001412 amines Chemical class 0.000 description 22
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 19
- 238000002844 melting Methods 0.000 description 18
- 230000008018 melting Effects 0.000 description 18
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 16
- 235000002639 sodium chloride Nutrition 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 13
- 229910000029 sodium carbonate Inorganic materials 0.000 description 13
- 239000011780 sodium chloride Substances 0.000 description 12
- 239000012954 diazonium Substances 0.000 description 11
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 10
- 238000004043 dyeing Methods 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000013078 crystal Substances 0.000 description 9
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 8
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 8
- 125000005843 halogen group Chemical group 0.000 description 8
- 239000005457 ice water Substances 0.000 description 8
- 235000017281 sodium acetate Nutrition 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- XELRJMFGVUMDMU-UHFFFAOYSA-N 2-(2,6-dichloropyrimidin-4-yl)benzoic acid Chemical compound C(=O)(O)C1=C(C=CC=C1)C1=NC(=NC(=C1)Cl)Cl XELRJMFGVUMDMU-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 7
- 230000007935 neutral effect Effects 0.000 description 7
- 150000002828 nitro derivatives Chemical class 0.000 description 7
- 150000003254 radicals Chemical class 0.000 description 7
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 6
- 150000001989 diazonium salts Chemical class 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 239000001632 sodium acetate Substances 0.000 description 6
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- DACUJXBUANTBKE-UHFFFAOYSA-N 4-acetamido-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(NC(=O)C)=CC(S(O)(=O)=O)=CC2=C1 DACUJXBUANTBKE-UHFFFAOYSA-N 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- 229960000583 acetic acid Drugs 0.000 description 5
- 239000000987 azo dye Substances 0.000 description 5
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 5
- RBTKNAXYKSUFRK-UHFFFAOYSA-N heliogen blue Chemical compound [Cu].[N-]1C2=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=NC([N-]1)=C(C=CC=C3)C3=C1N=C([N-]1)C3=CC=CC=C3C1=N2 RBTKNAXYKSUFRK-UHFFFAOYSA-N 0.000 description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000000985 reactive dye Substances 0.000 description 5
- 235000017557 sodium bicarbonate Nutrition 0.000 description 5
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 5
- 125000000542 sulfonic acid group Chemical group 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 4
- TZBROGJRQUABOK-UHFFFAOYSA-N 4-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(O)=CC(S(O)(=O)=O)=CC2=C1 TZBROGJRQUABOK-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- RISUMPVKPHEEJG-UHFFFAOYSA-N C1=CC=CC=C1[Cu](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 Chemical compound C1=CC=CC=C1[Cu](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 RISUMPVKPHEEJG-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 4
- 150000004056 anthraquinones Chemical class 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- XCJYREBRNVKWGJ-UHFFFAOYSA-N copper(II) phthalocyanine Chemical compound [Cu+2].C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 XCJYREBRNVKWGJ-UHFFFAOYSA-N 0.000 description 4
- 238000006193 diazotization reaction Methods 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 230000009257 reactivity Effects 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- LRJMMKDAEVSILQ-UHFFFAOYSA-N 2-(4,6-dichloropyrimidin-2-yl)benzoic acid Chemical compound C(=O)(O)C1=C(C=CC=C1)C1=NC(=CC(=N1)Cl)Cl LRJMMKDAEVSILQ-UHFFFAOYSA-N 0.000 description 3
- XJPZKYIHCLDXST-UHFFFAOYSA-N 4,6-dichloropyrimidine Chemical group ClC1=CC(Cl)=NC=N1 XJPZKYIHCLDXST-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 3
- WDEQGLDWZMIMJM-UHFFFAOYSA-N benzyl 4-hydroxy-2-(hydroxymethyl)pyrrolidine-1-carboxylate Chemical compound OCC1CC(O)CN1C(=O)OCC1=CC=CC=C1 WDEQGLDWZMIMJM-UHFFFAOYSA-N 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000003086 colorant Substances 0.000 description 3
- JZCCFEFSEZPSOG-UHFFFAOYSA-L copper(II) sulfate pentahydrate Chemical compound O.O.O.O.O.[Cu+2].[O-]S([O-])(=O)=O JZCCFEFSEZPSOG-UHFFFAOYSA-L 0.000 description 3
- 150000008049 diazo compounds Chemical class 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 239000010981 turquoise Substances 0.000 description 3
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 2
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 2
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 2
- VRNSMZDBMUSIFT-UHFFFAOYSA-N 2,4-dichloro-6-phenylpyrimidine Chemical compound ClC1=NC(Cl)=CC(C=2C=CC=CC=2)=N1 VRNSMZDBMUSIFT-UHFFFAOYSA-N 0.000 description 2
- BDKLKNJTMLIAFE-UHFFFAOYSA-N 2-(3-fluorophenyl)-1,3-oxazole-4-carbaldehyde Chemical compound FC1=CC=CC(C=2OC=C(C=O)N=2)=C1 BDKLKNJTMLIAFE-UHFFFAOYSA-N 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical class NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 2
- ZRPGJAFGRMSTPH-UHFFFAOYSA-N 4-(4,6-dichloropyrimidin-2-yl)aniline Chemical compound C1=CC(N)=CC=C1C1=NC(Cl)=CC(Cl)=N1 ZRPGJAFGRMSTPH-UHFFFAOYSA-N 0.000 description 2
- NZDXSXLYLMHYJA-UHFFFAOYSA-M 4-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]-n,n-dimethylaniline;chloride Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1N=NC1=[N+](C)C=CN1C NZDXSXLYLMHYJA-UHFFFAOYSA-M 0.000 description 2
- JLDYJXZCXHXBTL-UHFFFAOYSA-N 4-acetamido-5-hydroxynaphthalene-1,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(NC(=O)C)=CC=C(S(O)(=O)=O)C2=C1 JLDYJXZCXHXBTL-UHFFFAOYSA-N 0.000 description 2
- APRRQJCCBSJQOQ-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(O)=C2C(N)=CC(S(O)(=O)=O)=CC2=C1 APRRQJCCBSJQOQ-UHFFFAOYSA-N 0.000 description 2
- XIQKALDENTUXBY-UHFFFAOYSA-N 4-hydroxynaphthalene-1,5-disulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=C2C(O)=CC=C(S(O)(=O)=O)C2=C1 XIQKALDENTUXBY-UHFFFAOYSA-N 0.000 description 2
- XQAFHGXXHIZSGZ-UHFFFAOYSA-N 8-hydroxynaphthalene-1,6-disulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=C2C(O)=CC(S(O)(=O)=O)=CC2=C1 XQAFHGXXHIZSGZ-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 229920003043 Cellulose fiber Polymers 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- NRFQZTCQAYEXEE-UHFFFAOYSA-N Fenclorim Chemical compound ClC1=CC(Cl)=NC(C=2C=CC=CC=2)=N1 NRFQZTCQAYEXEE-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 241000092161 Pithys Species 0.000 description 2
- 241000083869 Polyommatus dorylas Species 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- BKYNVLMAAFDGJZ-UHFFFAOYSA-M S[Cu](C1=CC=CC=C1)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 Chemical compound S[Cu](C1=CC=CC=C1)(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 BKYNVLMAAFDGJZ-UHFFFAOYSA-M 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000001045 blue dye Substances 0.000 description 2
- 150000003857 carboxamides Chemical class 0.000 description 2
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 150000004700 cobalt complex Chemical class 0.000 description 2
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 229910000365 copper sulfate Inorganic materials 0.000 description 2
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 2
- 150000004985 diamines Chemical group 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- HYFMZOAPNQAXHU-UHFFFAOYSA-N naphthalene-1,7-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(S(=O)(=O)O)=CC=C21 HYFMZOAPNQAXHU-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- 239000001007 phthalocyanine dye Substances 0.000 description 2
- 239000001103 potassium chloride Substances 0.000 description 2
- 235000011164 potassium chloride Nutrition 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 239000010979 ruby Substances 0.000 description 2
- 229910001750 ruby Inorganic materials 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 2
- 229940087562 sodium acetate trihydrate Drugs 0.000 description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- YXZRCLVVNRLPTP-UHFFFAOYSA-J turquoise blue Chemical compound [Na+].[Na+].[Na+].[Na+].[Cu+2].NC1=NC(Cl)=NC(NC=2C=C(NS(=O)(=O)C3=CC=4C(=C5NC=4NC=4[N-]C(=C6C=CC(=CC6=4)S([O-])(=O)=O)NC=4NC(=C6C=C(C=CC6=4)S([O-])(=O)=O)NC=4[N-]C(=C6C=CC(=CC6=4)S([O-])(=O)=O)N5)C=C3)C(=CC=2)S([O-])(=O)=O)=N1 YXZRCLVVNRLPTP-UHFFFAOYSA-J 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- 239000001043 yellow dye Substances 0.000 description 2
- UQFHJDVUQSAVOQ-UHFFFAOYSA-N (2-aminophenyl) acetate Chemical compound CC(=O)OC1=CC=CC=C1N UQFHJDVUQSAVOQ-UHFFFAOYSA-N 0.000 description 1
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- IPOFQEDKXYAPBX-UHFFFAOYSA-N 1,4-diaminocyclohexa-2,4-diene-1-sulfonic acid Chemical compound NC1=CCC(N)(S(O)(=O)=O)C=C1 IPOFQEDKXYAPBX-UHFFFAOYSA-N 0.000 description 1
- DWBYKKOMRNYEMS-UHFFFAOYSA-N 1,5-diamino-9,10-dioxoanthracene-2-sulfonic acid Chemical compound O=C1C2=C(N)C(S(O)(=O)=O)=CC=C2C(=O)C2=C1C=CC=C2N DWBYKKOMRNYEMS-UHFFFAOYSA-N 0.000 description 1
- QESOMBMPKAMMLJ-UHFFFAOYSA-N 1-amino-4-(3-amino-2-methyl-5-sulfoanilino)-9,10-dioxoanthracene-2-sulfonic acid Chemical compound CC1=C(N)C=C(S(O)(=O)=O)C=C1NC1=CC(S(O)(=O)=O)=C(N)C2=C1C(=O)C1=CC=CC=C1C2=O QESOMBMPKAMMLJ-UHFFFAOYSA-N 0.000 description 1
- ZOHPJXCEVYGLJT-UHFFFAOYSA-N 1-amino-4-(3-amino-4-sulfoanilino)-9,10-dioxoanthracene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C(N)=CC(NC=2C=3C(=O)C4=CC=CC=C4C(=O)C=3C(N)=C(C=2)S(O)(=O)=O)=C1 ZOHPJXCEVYGLJT-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical class C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical class C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 1
- ZBWXTIWHVVWTKU-UHFFFAOYSA-N 1h-pyrrole-2,3-diol Chemical compound OC=1C=CNC=1O ZBWXTIWHVVWTKU-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- GVBHCMNXRKOJRH-UHFFFAOYSA-N 2,4,5,6-tetrachloropyrimidine Chemical compound ClC1=NC(Cl)=C(Cl)C(Cl)=N1 GVBHCMNXRKOJRH-UHFFFAOYSA-N 0.000 description 1
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 1
- HBVHEVUMWFHFLT-UHFFFAOYSA-N 2-(methylamino)-4-nitrobenzenesulfonic acid Chemical compound CNC1=CC([N+]([O-])=O)=CC=C1S(O)(=O)=O HBVHEVUMWFHFLT-UHFFFAOYSA-N 0.000 description 1
- VLZVIIYRNMWPSN-UHFFFAOYSA-N 2-Amino-4-nitrophenol Chemical compound NC1=CC([N+]([O-])=O)=CC=C1O VLZVIIYRNMWPSN-UHFFFAOYSA-N 0.000 description 1
- KCMKIDORSDPITL-UHFFFAOYSA-N 2-acetamidobenzenesulfonic acid Chemical compound CC(=O)NC1=CC=CC=C1S(O)(=O)=O KCMKIDORSDPITL-UHFFFAOYSA-N 0.000 description 1
- YMJXNYUOEJPKHH-UHFFFAOYSA-N 2-amino-4-nitrobenzenesulfonic acid Chemical compound NC1=CC([N+]([O-])=O)=CC=C1S(O)(=O)=O YMJXNYUOEJPKHH-UHFFFAOYSA-N 0.000 description 1
- LTASFWDWBYFZQQ-UHFFFAOYSA-N 2-amino-5-nitrobenzenesulfonic acid Chemical compound NC1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O LTASFWDWBYFZQQ-UHFFFAOYSA-N 0.000 description 1
- QPKNFEVLZVJGBM-UHFFFAOYSA-N 2-aminonaphthalen-1-ol Chemical class C1=CC=CC2=C(O)C(N)=CC=C21 QPKNFEVLZVJGBM-UHFFFAOYSA-N 0.000 description 1
- ACEVCJQVGFNGAU-UHFFFAOYSA-N 2-benzyl-4,6-dichloropyrimidine Chemical compound ClC1=CC(Cl)=NC(CC=2C=CC=CC=2)=N1 ACEVCJQVGFNGAU-UHFFFAOYSA-N 0.000 description 1
- GOLXNPRSAZFLNL-UHFFFAOYSA-N 2-benzyl-4-hydroxy-1h-pyrimidin-6-one Chemical compound OC1=CC(O)=NC(CC=2C=CC=CC=2)=N1 GOLXNPRSAZFLNL-UHFFFAOYSA-N 0.000 description 1
- GNTARUIZNIWBCN-UHFFFAOYSA-N 2-chloro-5-nitrobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC([N+]([O-])=O)=CC=C1Cl GNTARUIZNIWBCN-UHFFFAOYSA-N 0.000 description 1
- HHRTVWVTNKNYGR-UHFFFAOYSA-N 3-(2,6-dichloropyrimidin-4-yl)benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C=1C=C(C=CC1)C1=NC(=NC(=C1)Cl)Cl HHRTVWVTNKNYGR-UHFFFAOYSA-N 0.000 description 1
- ARPCMHSSPSAPCV-UHFFFAOYSA-N 3-(4,6-dichloropyrimidin-2-yl)aniline Chemical compound NC1=CC=CC(C=2N=C(Cl)C=C(Cl)N=2)=C1 ARPCMHSSPSAPCV-UHFFFAOYSA-N 0.000 description 1
- YCTAOQGPWNTYJE-UHFFFAOYSA-N 3-amino-5-chloro-2-hydroxybenzenesulfonic acid Chemical compound NC1=CC(Cl)=CC(S(O)(=O)=O)=C1O YCTAOQGPWNTYJE-UHFFFAOYSA-N 0.000 description 1
- MTJGVAJYTOXFJH-UHFFFAOYSA-N 3-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 MTJGVAJYTOXFJH-UHFFFAOYSA-N 0.000 description 1
- USWINTIHFQKJTR-UHFFFAOYSA-N 3-hydroxynaphthalene-2,7-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(O)=CC2=C1 USWINTIHFQKJTR-UHFFFAOYSA-N 0.000 description 1
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 1
- SPGOAFUOMCIVDB-UHFFFAOYSA-N 4,6-dichloro-2-(4-methylphenyl)pyrimidine Chemical compound C1=CC(C)=CC=C1C1=NC(Cl)=CC(Cl)=N1 SPGOAFUOMCIVDB-UHFFFAOYSA-N 0.000 description 1
- ZFRBZRZEKIOGQI-UHFFFAOYSA-N 4-amino-5-hydroxynaphthalene-1,3-disulfonic acid Chemical compound C1=CC(O)=C2C(N)=C(S(O)(=O)=O)C=C(S(O)(=O)=O)C2=C1 ZFRBZRZEKIOGQI-UHFFFAOYSA-N 0.000 description 1
- OYOFJLGBEIOUDR-UHFFFAOYSA-N 4-amino-6-[(4-amino-9,10-dioxo-3-sulfoanthracen-1-yl)amino]benzene-1,3-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C(N)=CC(NC=2C=3C(=O)C4=CC=CC=C4C(=O)C=3C(N)=C(C=2)S(O)(=O)=O)=C1S(O)(=O)=O OYOFJLGBEIOUDR-UHFFFAOYSA-N 0.000 description 1
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 1
- BUVOCOQOYNGMCO-UHFFFAOYSA-N 4-benzamido-5-hydroxynaphthalene-1,7-disulfonic acid Chemical compound C=12C(O)=CC(S(O)(=O)=O)=CC2=C(S(O)(=O)=O)C=CC=1NC(=O)C1=CC=CC=C1 BUVOCOQOYNGMCO-UHFFFAOYSA-N 0.000 description 1
- RKKZDGOUSIOSIY-UHFFFAOYSA-N 4-benzamido-5-hydroxynaphthalene-2,7-disulfonic acid Chemical compound C=12C(O)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=CC=1NC(=O)C1=CC=CC=C1 RKKZDGOUSIOSIY-UHFFFAOYSA-N 0.000 description 1
- ZLZAWYKBEGMPAU-UHFFFAOYSA-N 4-hydroxy-2-(4-methylphenyl)-1h-pyrimidin-6-one Chemical compound C1=CC(C)=CC=C1C1=NC(O)=CC(O)=N1 ZLZAWYKBEGMPAU-UHFFFAOYSA-N 0.000 description 1
- WTDXDRUHQKVYKO-UHFFFAOYSA-N 4-hydroxy-2-phenyl-1h-pyrimidin-6-one Chemical compound OC1=CC(=O)NC(C=2C=CC=CC=2)=N1 WTDXDRUHQKVYKO-UHFFFAOYSA-N 0.000 description 1
- UIXCZYKNYITXLI-UHFFFAOYSA-N 4-hydroxy-6-oxo-2-phenyl-1H-pyrimidine-5-sulfonic acid Chemical class S(=O)(=O)(O)C=1C(=NC(=NC=1O)C1=CC=CC=C1)O UIXCZYKNYITXLI-UHFFFAOYSA-N 0.000 description 1
- FEPBITJSIHRMRT-UHFFFAOYSA-N 4-hydroxybenzenesulfonic acid Chemical compound OC1=CC=C(S(O)(=O)=O)C=C1 FEPBITJSIHRMRT-UHFFFAOYSA-N 0.000 description 1
- HGWQOFDAUWCQDA-UHFFFAOYSA-N 4-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(O)=CC=C(S(O)(=O)=O)C2=C1 HGWQOFDAUWCQDA-UHFFFAOYSA-N 0.000 description 1
- RAUWPNXIALNKQM-UHFFFAOYSA-N 4-nitro-1,2-phenylenediamine Chemical compound NC1=CC=C([N+]([O-])=O)C=C1N RAUWPNXIALNKQM-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- PHRVJZNHPVJYOM-UHFFFAOYSA-N 5-acetamido-2-aminobenzenesulfonic acid Chemical compound CC(=O)NC1=CC=C(N)C(S(O)(=O)=O)=C1 PHRVJZNHPVJYOM-UHFFFAOYSA-N 0.000 description 1
- DFXQIQUZABZAPU-UHFFFAOYSA-N 5-amino-8-(3-amino-2-chloro-5-sulfoanilino)-9,10-dioxoanthracene-1,6-disulfonic acid Chemical compound NC1=C(C=C(C=2C(C=3C(=CC=CC3C(C12)=O)S(=O)(=O)O)=O)NC1=C(C(=CC(=C1)S(=O)(=O)O)N)Cl)S(=O)(=O)O DFXQIQUZABZAPU-UHFFFAOYSA-N 0.000 description 1
- LGRBAKCNOUBJNW-UHFFFAOYSA-N 5-amino-8-(3-aminoanilino)-9,10-dioxoanthracene-1,6-disulfonic acid Chemical compound NC1=CC=CC(NC=2C=3C(=O)C4=C(C=CC=C4C(=O)C=3C(N)=C(C=2)S(O)(=O)=O)S(O)(=O)=O)=C1 LGRBAKCNOUBJNW-UHFFFAOYSA-N 0.000 description 1
- KZCSUEYBKAPKNH-UHFFFAOYSA-N 6-aminonaphthalene-1,3-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KZCSUEYBKAPKNH-UHFFFAOYSA-N 0.000 description 1
- VVPHSMHEYVOVLH-UHFFFAOYSA-N 6-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(O)=CC=C21 VVPHSMHEYVOVLH-UHFFFAOYSA-N 0.000 description 1
- KYARBIJYVGJZLB-UHFFFAOYSA-N 7-amino-4-hydroxy-2-naphthalenesulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KYARBIJYVGJZLB-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- VTHLHLXNXCPRRW-UHFFFAOYSA-N C1(=CC=CC=C1)S(=O)(=O)[Cu](S(=O)(=O)C1=CC=CC=C1)(S(=O)(=O)C1=CC=CC=C1)S(=O)(=O)C1=CC=CC=C1 Chemical compound C1(=CC=CC=C1)S(=O)(=O)[Cu](S(=O)(=O)C1=CC=CC=C1)(S(=O)(=O)C1=CC=CC=C1)S(=O)(=O)C1=CC=CC=C1 VTHLHLXNXCPRRW-UHFFFAOYSA-N 0.000 description 1
- BMRLGFJWBQVVFJ-UHFFFAOYSA-N C1(=CC=CC=C1)[Cu](C1=CC=CC=C1)C1=CC=CC=C1 Chemical compound C1(=CC=CC=C1)[Cu](C1=CC=CC=C1)C1=CC=CC=C1 BMRLGFJWBQVVFJ-UHFFFAOYSA-N 0.000 description 1
- NOOAPUXOZSNKAV-UHFFFAOYSA-N C1(=CC=CC=C1)[Ni](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 Chemical compound C1(=CC=CC=C1)[Ni](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 NOOAPUXOZSNKAV-UHFFFAOYSA-N 0.000 description 1
- MZNHIUXYFAKADB-UHFFFAOYSA-N CC1=C(C=C(C=C1N)S(=O)(=O)O)NC1=CC=C(C=2C(C3=CC(=CC=C3C(C12)=O)S(=O)(=O)O)=O)NC1=C(C(=CC(=C1)S(=O)(=O)O)N)C Chemical compound CC1=C(C=C(C=C1N)S(=O)(=O)O)NC1=CC=C(C=2C(C3=CC(=CC=C3C(C12)=O)S(=O)(=O)O)=O)NC1=C(C(=CC(=C1)S(=O)(=O)O)N)C MZNHIUXYFAKADB-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- LKLHDSIEKTXLKA-UHFFFAOYSA-N ClS(=O)(=O)C=1C=C(C=CC1)C1=NC(=CC(=N1)Cl)Cl Chemical compound ClS(=O)(=O)C=1C=C(C=CC1)C1=NC(=CC(=N1)Cl)Cl LKLHDSIEKTXLKA-UHFFFAOYSA-N 0.000 description 1
- SZZYLYUVTJLJQM-UHFFFAOYSA-J Cl[Cu](Cl)(Cl)Cl Chemical compound Cl[Cu](Cl)(Cl)Cl SZZYLYUVTJLJQM-UHFFFAOYSA-J 0.000 description 1
- 229910002480 Cu-O Inorganic materials 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- AZNVZFNJEPDYEB-UHFFFAOYSA-N NC1=CC2=CC=CC=C2C(S(Cl)(=O)=O)=C1O Chemical class NC1=CC2=CC=CC=C2C(S(Cl)(=O)=O)=C1O AZNVZFNJEPDYEB-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- RERMKGZLKOZZOS-UHFFFAOYSA-N OS(C(C(Cl)=NC(C1=CC=CC=C1)=N1)=C1Cl)(=O)=O Chemical class OS(C(C(Cl)=NC(C1=CC=CC=C1)=N1)=C1Cl)(=O)=O RERMKGZLKOZZOS-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229910006069 SO3H Inorganic materials 0.000 description 1
- 241000158147 Sator Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- NUSORQHHEXCNQC-UHFFFAOYSA-N [Cu].N1C(C=C2N=C(C=C3NC(=C4)C=C3)C=C2)=CC=C1C=C1C=CC4=N1 Chemical class [Cu].N1C(C=C2N=C(C=C3NC(=C4)C=C3)C=C2)=CC=C1C=C1C=CC4=N1 NUSORQHHEXCNQC-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-N acetoacetic acid Chemical class CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 1
- 239000000980 acid dye Substances 0.000 description 1
- CQPFMGBJSMSXLP-UHFFFAOYSA-M acid orange 7 Chemical compound [Na+].OC1=CC=C2C=CC=CC2=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 CQPFMGBJSMSXLP-UHFFFAOYSA-M 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 1
- 239000001000 anthraquinone dye Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000004984 aromatic diamines Chemical class 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000001049 brown dye Substances 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- GTRGJJDVSJFNTE-UHFFFAOYSA-N chembl2009633 Chemical compound OC1=CC=C2C=C(S(O)(=O)=O)C=CC2=C1N=NC1=CC=CC=C1 GTRGJJDVSJFNTE-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- SRXDVSQUOYYPIR-UHFFFAOYSA-N chloro(phenyl)methanamine Chemical class NC(Cl)C1=CC=CC=C1 SRXDVSQUOYYPIR-UHFFFAOYSA-N 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 235000019646 color tone Nutrition 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000010014 continuous dyeing Methods 0.000 description 1
- 239000012084 conversion product Substances 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 150000004699 copper complex Chemical class 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- LBJNMUFDOHXDFG-UHFFFAOYSA-N copper;hydrate Chemical compound O.[Cu].[Cu] LBJNMUFDOHXDFG-UHFFFAOYSA-N 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 125000000950 dibromo group Chemical group Br* 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000001046 green dye Substances 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000004970 halomethyl group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- LTGQWIGRJSKNBP-UHFFFAOYSA-N hexahydrate;trihydrochloride Chemical compound O.O.O.O.O.O.Cl.Cl.Cl LTGQWIGRJSKNBP-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000005204 hydroxybenzenes Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- DRXLHYPPJRAJSL-UHFFFAOYSA-N n-(3-aminophenyl)formamide Chemical compound NC1=CC=CC(NC=O)=C1 DRXLHYPPJRAJSL-UHFFFAOYSA-N 0.000 description 1
- MUQQKIMNQFFGRV-UHFFFAOYSA-N n-(4-aminophenyl)formamide Chemical compound NC1=CC=C(NC=O)C=C1 MUQQKIMNQFFGRV-UHFFFAOYSA-N 0.000 description 1
- VILFVXYKHXVYAB-UHFFFAOYSA-N naphthalene-2,7-disulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(S(=O)(=O)O)=CC=C21 VILFVXYKHXVYAB-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- SFDJOSRHYKHMOK-UHFFFAOYSA-N nitramide Chemical class N[N+]([O-])=O SFDJOSRHYKHMOK-UHFFFAOYSA-N 0.000 description 1
- 239000004745 nonwoven fabric Substances 0.000 description 1
- 238000004816 paper chromatography Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- NUSQOFAKCBLANB-UHFFFAOYSA-N phthalocyanine tetrasulfonic acid Chemical compound C12=CC(S(=O)(=O)O)=CC=C2C(N=C2NC(C3=CC=C(C=C32)S(O)(=O)=O)=N2)=NC1=NC([C]1C=CC(=CC1=1)S(O)(=O)=O)=NC=1N=C1[C]3C=CC(S(O)(=O)=O)=CC3=C2N1 NUSQOFAKCBLANB-UHFFFAOYSA-N 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000004540 pour-on Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- MMNTZXRQPVRSSO-UHFFFAOYSA-N sulfamoylformic acid Chemical compound NS(=O)(=O)C(O)=O MMNTZXRQPVRSSO-UHFFFAOYSA-N 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/20—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a pyrimidine ring
- C09B62/24—Azo dyes
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/48—Polymers modified by chemical after-treatment
- C08G69/50—Polymers modified by chemical after-treatment with aldehydes
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/20—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a pyrimidine ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Coloring (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DEB0071006 | 1963-03-06 |
Publications (1)
Publication Number | Publication Date |
---|---|
DE1225788B true DE1225788B (de) | 1966-09-29 |
Family
ID=6976860
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DENDAT1225788D Pending DE1225788B (de) | 1963-03-06 | Verfahren zur Herstellung von Dihalogenpyrimidylfarbstoffen |
Country Status (8)
Country | Link |
---|---|
US (1) | US3336283A (en:Method) |
AT (2) | AT249197B (en:Method) |
BE (1) | BE644765A (en:Method) |
CH (2) | CH457661A (en:Method) |
DE (1) | DE1225788B (en:Method) |
FR (1) | FR1395833A (en:Method) |
GB (1) | GB1035779A (en:Method) |
NL (1) | NL6402233A (en:Method) |
Families Citing this family (8)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4007164A (en) * | 1968-03-19 | 1977-02-08 | Bayer Aktiengesellschaft | Azo dyestuffs containing 6-fluoro-pyrimidinyl 4-reactive group |
US3989692A (en) * | 1972-02-23 | 1976-11-02 | Bayer Aktiengesellschaft | Reactive dyestuffs |
CH579614A5 (en:Method) * | 1972-08-17 | 1976-09-15 | Ciba Geigy Ag | |
DE3840164A1 (de) * | 1988-11-29 | 1990-08-09 | Bayer Ag | Reaktivfarbstoffe |
EP0552237A1 (en) * | 1990-10-09 | 1993-07-28 | Neurogen Corporation | Certain cycloalkyl and azacycloalkyl pyrrolopyrimidines; a new class of gaba brain receptor ligands |
BR9303266A (pt) * | 1992-08-14 | 1994-03-08 | Sandoz Ag | Compostos e seus sais ou misturas de fais compostos ou sais,processos para sua preparacao,e processo para tingimento ou estampagem de um substrato organico |
GB2271776B (en) * | 1992-10-12 | 1996-01-17 | Sandoz Ltd | Fibre-reactive AZO dyestuffs |
CN106892844B (zh) * | 2015-12-21 | 2018-12-14 | 南京理工大学 | 一种n-(1-亚氨基-2,2-二硝基乙基)-2,2-二硝基乙酰胺钾盐的制备方法 |
Family Cites Families (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3126370A (en) * | 1964-03-24 | Oh nhc |
-
0
- DE DENDAT1225788D patent/DE1225788B/de active Pending
-
1964
- 1964-02-25 GB GB7742/64A patent/GB1035779A/en not_active Expired
- 1964-02-25 CH CH1674867A patent/CH457661A/de unknown
- 1964-02-25 CH CH230664A patent/CH458577A/de unknown
- 1964-02-28 US US348300A patent/US3336283A/en not_active Expired - Lifetime
- 1964-03-05 BE BE644765D patent/BE644765A/xx unknown
- 1964-03-05 NL NL6402233A patent/NL6402233A/xx unknown
- 1964-03-06 AT AT195464A patent/AT249197B/de active
- 1964-03-06 AT AT308365A patent/AT249206B/de active
- 1964-03-06 FR FR1395833A patent/FR1395833A/fr not_active Expired
Also Published As
Publication number | Publication date |
---|---|
AT249206B (de) | 1966-09-12 |
BE644765A (en:Method) | 1964-09-07 |
AT249197B (de) | 1966-09-12 |
NL6402233A (en:Method) | 1964-09-07 |
GB1035779A (en) | 1966-07-13 |
CH457661A (de) | 1968-06-15 |
US3336283A (en) | 1967-08-15 |
FR1395833A (fr) | 1965-04-16 |
CH458577A (de) | 1968-06-30 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE1644208C3 (de) | Reaktivfarbstoffe | |
DE1644203C3 (en:Method) | ||
EP0013765B1 (de) | Reaktivazofarbstoffe sowie deren Herstellung und Verwendung zum Färben von OH- und N-haltigen Materialien | |
DE1252824B (de) | Verfahren zur Herstellung von reaktiven Farbstoffen | |
DE1225788B (de) | Verfahren zur Herstellung von Dihalogenpyrimidylfarbstoffen | |
DE2838540A1 (de) | Farbstoffe, deren herstellung und verwendung | |
DE1444667C3 (de) | Verfahren zur Herstellung von Azofarbstoffen | |
DE1544570B1 (de) | Verfahren zur Herstellung reaktiver Farbstoffe | |
DE1089095B (de) | Verfahren zur Herstellung von Farbstoffen | |
DE2812634A1 (de) | Anthrachinon-azo-reaktivfarbstoffe | |
DE1230152B (de) | Verfahren zur Herstellung von Azofarbstoffen | |
CH497512A (de) | Verfahren zur Herstellung von wasserlöslichen Monoazofarbstoffen | |
DE1225319B (de) | Verfahren zur Herstellung von Azofarbstoffen | |
DE1419840C (de) | Verfahren zur Herstellung von reaktiven Färb stoffen | |
AT200686B (de) | Verfahren zur Herstellung neuer, wasserlöslicher Disazofarbstoffe | |
CH618725A5 (en:Method) | ||
DE1544570C (de) | Verfahren zur Herstellung reaktiver Farbstoffe | |
DE1444675C (de) | Verfahren zur Herstellung von reaktiven Monoazofarbstoffen | |
DE1112229B (de) | Verfahren zur Herstellung von reaktiven Azofarbstoffen | |
DE1544505C3 (de) | Reaktivfarbstoffe und Verfahren zu deren Herstellung und Anwendung | |
DE1261257B (de) | Verfahren zur Herstellung von Farbstoffen | |
DE1794298A1 (de) | Disulfimidgruppenhaltige Reaktivfarbstoffe | |
DE1109807B (de) | Verfahren zur Herstellung von reaktiven Farbstoffen | |
DE1155202B (de) | Verfahren zur Herstellung von Farbstoffen | |
DE1091677B (de) | Verfahren zur Herstellung von wasserloeslichen, Cellulose echt faerbenden Farbstoffen |