DE1218881B - Elektrophotographisches Verfahren zur Herstellung von Deformationsbildern - Google Patents
Elektrophotographisches Verfahren zur Herstellung von DeformationsbildernInfo
- Publication number
- DE1218881B DE1218881B DEG29900A DEG0029900A DE1218881B DE 1218881 B DE1218881 B DE 1218881B DE G29900 A DEG29900 A DE G29900A DE G0029900 A DEG0029900 A DE G0029900A DE 1218881 B DE1218881 B DE 1218881B
- Authority
- DE
- Germany
- Prior art keywords
- light
- layer
- recording material
- thermoplastic
- production
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 9
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 239000000463 material Substances 0.000 claims description 15
- 239000002245 particle Substances 0.000 claims description 10
- 229920001169 thermoplastic Polymers 0.000 claims description 10
- 238000000149 argon plasma sintering Methods 0.000 claims description 7
- 239000004416 thermosoftening plastic Substances 0.000 claims description 6
- 239000004793 Polystyrene Substances 0.000 claims description 3
- 229920002223 polystyrene Polymers 0.000 claims description 3
- 239000006229 carbon black Substances 0.000 claims 1
- 239000011521 glass Substances 0.000 claims 1
- 239000004033 plastic Substances 0.000 description 17
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 1
- 239000005337 ground glass Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920006267 polyester film Polymers 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04N—PICTORIAL COMMUNICATION, e.g. TELEVISION
- H04N5/00—Details of television systems
- H04N5/76—Television signal recording
- H04N5/80—Television signal recording using electrostatic recording
- H04N5/82—Television signal recording using electrostatic recording using deformable thermoplastic recording medium
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G16/00—Electrographic processes using deformation of thermoplastic layers; Apparatus therefor
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/022—Layers for surface-deformation imaging, e.g. frost imaging
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Signal Processing (AREA)
- Photoreceptors In Electrophotography (AREA)
- Laminated Bodies (AREA)
- Liquid Crystal (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US82209759A | 1959-06-22 | 1959-06-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1218881B true DE1218881B (de) | 1966-06-08 |
Family
ID=25235130
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG29900A Pending DE1218881B (de) | 1959-06-22 | 1960-06-21 | Elektrophotographisches Verfahren zur Herstellung von Deformationsbildern |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3655371A (enExample) |
| BE (1) | BE592152A (enExample) |
| CH (1) | CH385252A (enExample) |
| DE (1) | DE1218881B (enExample) |
| GB (1) | GB962648A (enExample) |
| OA (1) | OA00907A (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3169061A (en) * | 1961-05-01 | 1965-02-09 | Rca Corp | Electrostatic printing |
| US3258336A (en) * | 1962-05-08 | 1966-06-28 | Xerox Corp | Strippable layer frost printing |
| US3238041A (en) * | 1962-05-08 | 1966-03-01 | Xerox Co | Relief imaging of photoresponsive member and product |
| US3196010A (en) * | 1962-05-08 | 1965-07-20 | Xerox Corp | Electrophotographic process for formation of deformation images in deformable interference films |
| US3196008A (en) * | 1962-05-08 | 1965-07-20 | Xerox Corp | Electrophotographic process for formation of frost-like deformation images in mechanically deformable photoconductive layers |
| BE631983A (enExample) * | 1962-05-08 | |||
| US3196009A (en) * | 1962-05-08 | 1965-07-20 | Xerox Co | Electrostatic image liquid deformation development |
| US3196012A (en) * | 1962-06-07 | 1965-07-20 | Xerox Corp | Half-tone xerography with thermoplastic deformation of the image |
| US3322538A (en) * | 1962-11-30 | 1967-05-30 | Gen Electric | Electrophotographic process |
| US3322539A (en) * | 1962-11-30 | 1967-05-30 | Gen Electric | Electrophotographic process |
| CA1062324A (en) * | 1974-09-27 | 1979-09-11 | Roland Moraw | Exposure delay in thermoplastic recording apparatus |
| GB1512796A (en) * | 1974-12-13 | 1978-06-01 | Ibm | Image forming process |
| GB1542275A (en) * | 1975-03-13 | 1979-03-14 | Marconi Co Ltd | Recording systems |
| JPS61145544A (ja) * | 1984-12-19 | 1986-07-03 | Fuji Photo Film Co Ltd | 写真材料 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2703756A (en) * | 1951-12-12 | 1955-03-08 | Gen Aniline & Film Corp | Vesicular prints and process of making same |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2157384A (en) * | 1936-11-07 | 1939-05-09 | Carbide And Carbon Chemcials C | Photographic film base |
| US2244304A (en) * | 1939-02-04 | 1941-06-03 | Eastman Kodak Co | Photographic process |
| US2277013A (en) * | 1939-06-27 | 1942-03-17 | Chester F Carison | Electric recording and transmission of pictures |
| US2383566A (en) * | 1943-02-13 | 1945-08-28 | Republic Aviat Corp | Photomechanical negative |
| US2418479A (en) * | 1944-02-16 | 1947-04-08 | Du Pont | Process for orienting ferromagnetic flakes in paint films |
| FR959035A (enExample) * | 1946-09-23 | 1950-03-23 | ||
| US2570856A (en) * | 1947-03-25 | 1951-10-09 | Du Pont | Process for obtaining pigmented films |
| US2663636A (en) * | 1949-05-25 | 1953-12-22 | Haloid Co | Electrophotographic plate and method of producing same |
| US2662803A (en) * | 1949-06-29 | 1953-12-15 | Faximile Inc | Recording method and apparatus |
| US2896507A (en) * | 1952-04-16 | 1959-07-28 | Foerderung Forschung Gmbh | Arrangement for amplifying the light intensity of an optically projected image |
| US2739243A (en) * | 1953-01-08 | 1956-03-20 | Sheldon Edward Emanuel | Composite photosensitive screens |
| US2748288A (en) * | 1953-10-01 | 1956-05-29 | Rca Corp | Electron photography plate construction |
| US2798821A (en) * | 1954-03-29 | 1957-07-09 | Westinghouse Electric Corp | Method of forming a uniform layer of luminescent material on a surface |
| US2964666A (en) * | 1956-09-21 | 1960-12-13 | Philips Corp | Electroluminescent element |
| US3032414A (en) * | 1956-11-19 | 1962-05-01 | Kalvar Corp | System of photographic reproduction |
| US3113179A (en) * | 1957-11-22 | 1963-12-03 | Gen Electric | Method and apparatus for recording |
| NL242557A (enExample) * | 1958-08-25 | 1900-01-01 | ||
| NL273832A (enExample) * | 1961-01-24 |
-
0
- BE BE592152D patent/BE592152A/xx unknown
-
1959
- 1959-06-22 US US822097A patent/US3655371A/en not_active Expired - Lifetime
-
1960
- 1960-06-07 GB GB19934/60A patent/GB962648A/en not_active Expired
- 1960-06-21 CH CH703860A patent/CH385252A/de unknown
- 1960-06-21 DE DEG29900A patent/DE1218881B/de active Pending
-
1964
- 1964-12-16 OA OA50869A patent/OA00907A/xx unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2703756A (en) * | 1951-12-12 | 1955-03-08 | Gen Aniline & Film Corp | Vesicular prints and process of making same |
Also Published As
| Publication number | Publication date |
|---|---|
| CH385252A (de) | 1964-12-15 |
| OA00907A (fr) | 1968-03-22 |
| US3655371A (en) | 1972-04-11 |
| GB962648A (en) | 1964-07-01 |
| BE592152A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1218881B (de) | Elektrophotographisches Verfahren zur Herstellung von Deformationsbildern | |
| DE1267550B (de) | Elektrofotografisches Verfahren zur Herstellung eines Deformationsbildes | |
| DE1497219B2 (de) | Verfahren und Aufzeichnungsmaterial zur elektrophoretischen Bilderzeugung | |
| DE1497086A1 (de) | Verfahren und Vorrichtung zur Erzeugung eines latenten elektrostatischen Bildes | |
| DE1671576A1 (de) | Vervielfaeltigungsverfahren | |
| DE1261398B (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE1257169B (de) | Verfahren zur Herstellung von Bildern | |
| DE1522634A1 (de) | Verfahren und Aufzeichnungstraeger zur xerografischen Aufzeichnung von farbigen Bildern | |
| US3196765A (en) | Image development and projection | |
| DE1258428B (de) | Verfahren zur Herstellung von Bildern auf elektrophotographischem Material | |
| DE1220448B (de) | Verfahren und waermeempfindliches Kopierblatt zur Herstellung von Diapositiven | |
| DE2164622C3 (de) | Verfahren zum Abbilden eines elektrofotografisch hergestellten, transparenten Reliefbildes | |
| DE2027776C3 (de) | Verfahren zur Herstellung von Bildern und Vorrichtung zur Durchführung des Verfahrens | |
| DE2508793A1 (de) | Einrichtung zur ausbildung eines bilds | |
| DE1915210B2 (de) | Informationsträger für Projektionszwecke | |
| DE1258735B (de) | Elektrophotographisches Verfahren | |
| Ives | Improvements in the diffraction process of color photography | |
| US2185610A (en) | Method of and apparatus for making a motion picture record | |
| DE1291619B (de) | Verfahren zur Herstellung von Vesicularbildern | |
| AT236227B (de) | Verfahren zur Herstellung eines Projektionsdiapositives sowie einer wärmeempfindlichen Kopierfolie zur Durchführung dieses Verfahrens | |
| DE2952486A1 (de) | Elektrophotographisches verfahren und einrichtung zu dessen durchfuehrung | |
| DE2131718C3 (de) | Verfahren zum Erzeugen eines elektrostatischen Potentialbildes von mehreren Vorlagen | |
| DE732555C (de) | Verfahren zur Herstellung von Duplikatnegativen | |
| DE1497081B2 (de) | Verfahren und Vorrichtung zur Herstellung von Kopien eines auf elektrophotographischem Wege hergestellten Bildes | |
| AT134107B (de) | Verfahren zur Vervielfältigung von kinematographischen Filmen oder anderen Durchsichtsbildern in natürlichen Farben. |