DE1204407B - Verfahren zur Herstellung von Mischpolymerisaten - Google Patents
Verfahren zur Herstellung von MischpolymerisatenInfo
- Publication number
- DE1204407B DE1204407B DEA43312A DEA0043312A DE1204407B DE 1204407 B DE1204407 B DE 1204407B DE A43312 A DEA43312 A DE A43312A DE A0043312 A DEA0043312 A DE A0043312A DE 1204407 B DE1204407 B DE 1204407B
- Authority
- DE
- Germany
- Prior art keywords
- parts
- chlorine
- copolymers
- percent
- copolymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229920001577 copolymer Polymers 0.000 title claims description 25
- 238000000034 method Methods 0.000 title claims description 13
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 239000000460 chlorine Substances 0.000 claims description 23
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 22
- 229910052801 chlorine Inorganic materials 0.000 claims description 22
- 239000000178 monomer Substances 0.000 claims description 9
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- 239000000839 emulsion Substances 0.000 claims description 4
- XJELOQYISYPGDX-UHFFFAOYSA-N ethenyl 2-chloroacetate Chemical compound ClCC(=O)OC=C XJELOQYISYPGDX-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 238000006116 polymerization reaction Methods 0.000 claims description 3
- 239000007900 aqueous suspension Substances 0.000 claims description 2
- 239000000047 product Substances 0.000 description 15
- 229920001971 elastomer Polymers 0.000 description 12
- 239000000806 elastomer Substances 0.000 description 10
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 9
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 4
- 125000005396 acrylic acid ester group Chemical group 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 3
- 125000005250 alkyl acrylate group Chemical group 0.000 description 3
- 238000007334 copolymerization reaction Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 229920000058 polyacrylate Polymers 0.000 description 3
- 238000005096 rolling process Methods 0.000 description 3
- 238000004073 vulcanization Methods 0.000 description 3
- VILCJCGEZXAXTO-UHFFFAOYSA-N 2,2,2-tetramine Chemical compound NCCNCCNCCN VILCJCGEZXAXTO-UHFFFAOYSA-N 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- 229920000800 acrylic rubber Polymers 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 229920001084 poly(chloroprene) Polymers 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- DNJRKFKAFWSXSE-UHFFFAOYSA-N 1-chloro-2-ethenoxyethane Chemical compound ClCCOC=C DNJRKFKAFWSXSE-UHFFFAOYSA-N 0.000 description 1
- WHBAYNMEIXUTJV-UHFFFAOYSA-N 2-chloroethyl prop-2-enoate Chemical compound ClCCOC(=O)C=C WHBAYNMEIXUTJV-UHFFFAOYSA-N 0.000 description 1
- REEBWSYYNPPSKV-UHFFFAOYSA-N 3-[(4-formylphenoxy)methyl]thiophene-2-carbonitrile Chemical compound C1=CC(C=O)=CC=C1OCC1=C(C#N)SC=C1 REEBWSYYNPPSKV-UHFFFAOYSA-N 0.000 description 1
- UHBAWOXYQROEIH-UHFFFAOYSA-N 3-chloro-4-(2-chlorobut-3-enoxy)but-1-ene Chemical compound C=CC(Cl)COCC(Cl)C=C UHBAWOXYQROEIH-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- KQNZLOUWXSAZGD-UHFFFAOYSA-N benzylperoxymethylbenzene Chemical compound C=1C=CC=CC=1COOCC1=CC=CC=C1 KQNZLOUWXSAZGD-UHFFFAOYSA-N 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- AFZSMODLJJCVPP-UHFFFAOYSA-N dibenzothiazol-2-yl disulfide Chemical compound C1=CC=C2SC(SSC=3SC4=CC=CC=C4N=3)=NC2=C1 AFZSMODLJJCVPP-UHFFFAOYSA-N 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 229920001198 elastomeric copolymer Polymers 0.000 description 1
- 239000012772 electrical insulation material Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000006232 furnace black Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- -1 hexyl Octyl ester Chemical class 0.000 description 1
- LNMQRPPRQDGUDR-UHFFFAOYSA-N hexyl prop-2-enoate Chemical compound CCCCCCOC(=O)C=C LNMQRPPRQDGUDR-UHFFFAOYSA-N 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F220/00—Copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and only one being terminated by only one carboxyl radical or a salt, anhydride ester, amide, imide or nitrile thereof
- C08F220/02—Monocarboxylic acids having less than ten carbon atoms; Derivatives thereof
- C08F220/10—Esters
- C08F220/12—Esters of monohydric alcohols or phenols
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F18/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by an acyloxy radical of a saturated carboxylic acid, of carbonic acid or of a haloformic acid
- C08F18/20—Esters containing halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Graft Or Block Polymers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US203463A US3201373A (en) | 1962-06-19 | 1962-06-19 | Synthetic chlorine containing rubberacrylate type polymers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1204407B true DE1204407B (de) | 1965-11-04 |
Family
ID=22754118
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEA43312A Pending DE1204407B (de) | 1962-06-19 | 1963-06-11 | Verfahren zur Herstellung von Mischpolymerisaten |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3201373A (https=) |
| DE (1) | DE1204407B (https=) |
| GB (1) | GB1042754A (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4992177A (https=) * | 1972-05-15 | 1974-09-03 |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3467624A (en) * | 1963-06-03 | 1969-09-16 | Bridgestone Tire Co Ltd | Epoxide polymers and process for preparing same |
| US3324088A (en) * | 1963-06-04 | 1967-06-06 | American Cyanamid Co | Process for vulcanization of elastomers |
| US3285867A (en) * | 1963-08-29 | 1966-11-15 | Goodrich Co B F | Triethylene-tetramine-benzothiazyl disulfide vulcanizate of an acrylic acid ester-neutral haloalkyl vinyl compound interpolymer stabilized with a copper salt of a saturated straight chain fatty acid |
| US3335110A (en) * | 1964-01-03 | 1967-08-08 | American Cyanamid Co | Process for stabilizing vulcanized acrylic elastomers |
| US3397193A (en) * | 1964-10-21 | 1968-08-13 | American Cyanamid Co | Acrylic elastomer |
| US3337492A (en) * | 1965-06-08 | 1967-08-22 | American Cyanamid Co | High-temperature stabilization of certain acrylic elastomers |
| US3458461A (en) * | 1965-09-01 | 1969-07-29 | American Cyanamid Co | Halogen-containing elastomers vulcanized with sulfur and a salt of a carboxylic acid |
| US3976611A (en) * | 1974-12-09 | 1976-08-24 | American Cyanamid Company | Free-flowing beads of particles of an acrylate elastomer |
| US4092303A (en) * | 1975-05-27 | 1978-05-30 | American Cyanamid Company | Polyacrylate elastomers with improved elasticity |
| USRE31322E (en) * | 1978-03-27 | 1983-07-26 | Nippon Zeon Co. Ltd. | Process for producing sulfur-curable acrylic rubbers |
| US4228265A (en) * | 1979-03-27 | 1980-10-14 | Nippon Zeon Co. Ltd. | Process for producing sulfur-curable acrylic rubbers |
| JPS54127495A (en) * | 1978-03-28 | 1979-10-03 | Nippon Zeon Co Ltd | Vulcanizable composition of acrylic rubber |
| IT1095389B (it) * | 1978-04-14 | 1985-08-10 | Montedison Spa | Procedimento per la preparazione di elastomeri acrilici vulcanizzaeili |
| US4255547A (en) * | 1980-03-10 | 1981-03-10 | American Cyanamid Company | Novel elastomer composition and processes therefor |
| US4419493A (en) * | 1982-10-21 | 1983-12-06 | American Cyanamid Company | Sulfur-vulcanizable blends of ethylene-vinyl acetate copolymer elastomers and polyacrylate elastomers |
| US4408018A (en) * | 1982-10-29 | 1983-10-04 | Rohm And Haas Company | Acetoacetate functionalized polymers and monomers useful for crosslinking formulations |
| JPH01123809A (ja) * | 1987-11-10 | 1989-05-16 | Tosoh Corp | アクリル系共重合体エラストマー |
| IT1265040B1 (it) * | 1993-07-23 | 1996-10-28 | Enichem Elastomers | Composizioni vulcanizzabili a base di gomme acriliche modificate |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR914737A (fr) * | 1941-10-08 | 1946-10-16 | Ici Ltd | Polymérisation d'esters |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2643922A (en) * | 1951-04-13 | 1953-06-30 | Edward G Rudman | Vertically adjustable table top |
| US2742942A (en) * | 1952-05-29 | 1956-04-24 | Goodrich Co B F | Blend of polychloroprene and acrylic synthetic rubbers for adhering acrylic rubbers to other materials |
-
0
- GB GB1042754D patent/GB1042754A/en active Active
-
1962
- 1962-06-19 US US203463A patent/US3201373A/en not_active Expired - Lifetime
-
1963
- 1963-06-11 DE DEA43312A patent/DE1204407B/de active Pending
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR914737A (fr) * | 1941-10-08 | 1946-10-16 | Ici Ltd | Polymérisation d'esters |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4992177A (https=) * | 1972-05-15 | 1974-09-03 |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1042754A (https=) | |
| US3201373A (en) | 1965-08-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1204407B (de) | Verfahren zur Herstellung von Mischpolymerisaten | |
| DE2612360C3 (de) | Wärmehärtbare Masse auf Basis von Mischpolymerisaten | |
| DE1520543C3 (de) | Verfahren zur Herstellung von hartbaren elastomeren Tetrafluorathylen mischpolymerisaten | |
| DE1745520B2 (de) | Verfahren zur herstellung von vulkanisierbaren elastomeren | |
| DE3878786T2 (de) | Kautschukmischung. | |
| DE1136485B (de) | Verfahren zur Herstellung von Elastomeren | |
| DE2440316C2 (de) | Vulkanisierbare Fluorelastomere | |
| DE1469990B2 (de) | Thermoplastische Mischungen | |
| DE2748751A1 (de) | Schlagfeste polymermasse | |
| DE1745002B2 (de) | Vinylchloridharze und Verfahren zu deren Herstellung | |
| DE1103569B (de) | Fuer die Herstellung von geformten Gebilden geeignete waessrige Dispersionen von synthetischen Elastomeren | |
| DE1247021B (https=) | ||
| DE3323531A1 (de) | Verfahren zur herstellung von ethylen-vinylacetat-copolymerisaten | |
| DE2423714B2 (de) | Verfahren zur Herstellung eines flüssigen Chloroprenpolymeren | |
| DE2356656A1 (de) | Chloroprengummi | |
| DE1130177B (de) | Verfahren zur Herstellung von phosphorhaltigen Polymerisaten | |
| DE1745219A1 (de) | Verfahren zur Herstellung von AEthylacrylatcopolymerisaten | |
| DE1694336A1 (de) | Vulkanisierbare Acryl-Elastomere | |
| DE2414395A1 (de) | Thermoplastische mischpolymere und verfahren zu deren herstellung | |
| DE1694754B2 (de) | Herstellung elastomerer Formkörper. Ausscheidung aus: 1595075 | |
| DE1262594B (de) | Verfahren zum Vulkanisieren von Mischpolymerisaten | |
| DE1233135B (de) | Waermevulkanisierbare Formmassen aus Acrylsaeureesterpolymerisaten | |
| DE1070380B (de) | Verfahren zur Herstellung von kautschukartigen Polymerisaten aus Cyanätherestern | |
| DE1123114B (de) | Verfahren zur Herstellung von Copolymerisaten aus konjugierten Diolefinen, insbesondere Butadien, und Acrylnitril | |
| DE2358112A1 (de) | Zu elastomeren vulkanisierbare polyacrylatmassen |