DE1147570B - Verfahren zur Herstellung von Alkylaralkylphthalaten - Google Patents
Verfahren zur Herstellung von AlkylaralkylphthalatenInfo
- Publication number
- DE1147570B DE1147570B DEC24809A DEC0024809A DE1147570B DE 1147570 B DE1147570 B DE 1147570B DE C24809 A DEC24809 A DE C24809A DE C0024809 A DEC0024809 A DE C0024809A DE 1147570 B DE1147570 B DE 1147570B
- Authority
- DE
- Germany
- Prior art keywords
- aralkyl
- alkyl
- phthalates
- yield
- xylene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 alkyl aralkyl phthalates Chemical class 0.000 title claims description 28
- 238000000034 method Methods 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 27
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 12
- 239000008096 xylene Substances 0.000 claims description 11
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 10
- 238000009835 boiling Methods 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 230000002378 acidificating effect Effects 0.000 claims description 9
- 239000002904 solvent Substances 0.000 claims description 9
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 7
- 238000007127 saponification reaction Methods 0.000 claims description 7
- 238000003756 stirring Methods 0.000 claims description 6
- 239000011541 reaction mixture Substances 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 claims 1
- 125000005498 phthalate group Chemical class 0.000 claims 1
- 230000035484 reaction time Effects 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 11
- 229940073608 benzyl chloride Drugs 0.000 description 10
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 8
- IRIAEXORFWYRCZ-UHFFFAOYSA-N Butylbenzyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCC1=CC=CC=C1 IRIAEXORFWYRCZ-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 6
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- YZBOVSFWWNVKRJ-UHFFFAOYSA-N Monobutylphthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(O)=O YZBOVSFWWNVKRJ-UHFFFAOYSA-N 0.000 description 4
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- 238000010533 azeotropic distillation Methods 0.000 description 3
- 150000005524 benzylchlorides Chemical class 0.000 description 3
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical group [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical class [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- MFEVGQHCNVXMER-UHFFFAOYSA-L 1,3,2$l^{2}-dioxaplumbetan-4-one Chemical compound [Pb+2].[O-]C([O-])=O MFEVGQHCNVXMER-UHFFFAOYSA-L 0.000 description 1
- BETNPSBTDMBHCZ-UHFFFAOYSA-N 1-(chloromethyl)-2,4-dimethylbenzene Chemical compound CC1=CC=C(CCl)C(C)=C1 BETNPSBTDMBHCZ-UHFFFAOYSA-N 0.000 description 1
- DMHZDOTYAVHSEH-UHFFFAOYSA-N 1-(chloromethyl)-4-methylbenzene Chemical compound CC1=CC=C(CCl)C=C1 DMHZDOTYAVHSEH-UHFFFAOYSA-N 0.000 description 1
- KPJKMUJJFXZGAX-UHFFFAOYSA-N 2-chloropropan-2-ylbenzene Chemical compound CC(C)(Cl)C1=CC=CC=C1 KPJKMUJJFXZGAX-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 229910000003 Lead carbonate Inorganic materials 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000010426 asphalt Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000007265 chloromethylation reaction Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 125000006182 dimethyl benzyl group Chemical group 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- DJDSLBVSSOQSLW-UHFFFAOYSA-N mono(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(O)=O DJDSLBVSSOQSLW-UHFFFAOYSA-N 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/08—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides with the hydroxy or O-metal group of organic compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/10—Esters; Ether-esters
- C08K5/12—Esters; Ether-esters of cyclic polycarboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE621071D BE621071A (OSRAM) | 1961-08-05 | ||
| NL279978D NL279978A (OSRAM) | 1961-08-05 | ||
| DEC24809A DE1147570B (de) | 1961-08-05 | 1961-08-05 | Verfahren zur Herstellung von Alkylaralkylphthalaten |
| CH468162A CH411828A (de) | 1961-08-05 | 1962-04-17 | Verfahren zur Herstellung von Alkylaralkylphthalaten |
| DK230062AA DK106184C (da) | 1961-08-05 | 1962-05-22 | Fremgangsmåde til fremstilling af alkylaralkylftalater. |
| US206519A US3281456A (en) | 1961-08-05 | 1962-06-29 | Process for the production of alkyl aralkyl phthalates |
| GB27449/62A GB951527A (en) | 1961-08-05 | 1962-07-17 | Improvements in or relating to the preparation of mixed alkyl-aralkyl esters of phthalic acid |
| FR904295A FR1329230A (fr) | 1961-08-05 | 1962-07-18 | Procédé de préparation de phtalates d'alkylaralkyle |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEC24809A DE1147570B (de) | 1961-08-05 | 1961-08-05 | Verfahren zur Herstellung von Alkylaralkylphthalaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1147570B true DE1147570B (de) | 1963-04-25 |
Family
ID=7017733
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEC24809A Pending DE1147570B (de) | 1961-08-05 | 1961-08-05 | Verfahren zur Herstellung von Alkylaralkylphthalaten |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3281456A (OSRAM) |
| BE (1) | BE621071A (OSRAM) |
| CH (1) | CH411828A (OSRAM) |
| DE (1) | DE1147570B (OSRAM) |
| DK (1) | DK106184C (OSRAM) |
| GB (1) | GB951527A (OSRAM) |
| NL (1) | NL279978A (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1603809B1 (de) * | 1966-02-25 | 1970-09-24 | Dieter Haubold Ind Nagelgeraet | Eintreibstoesselbefestigung am Arbeitskolben eines Druckluftnaglers |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3034634C2 (de) * | 1980-09-13 | 1982-11-11 | Chemische Fabrik Kalk GmbH, 5000 Köln | Tetrabromphthalsäureester, Herstellung und Verwendung als Brandschutzmittel in Kunststoffen |
| AU2002327859B2 (en) * | 2001-09-26 | 2007-08-09 | Evonik Degussa Gmbh | Phthalic acid alkylester mixtures with controlled viscosity |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1554032A (en) * | 1920-12-03 | 1925-09-15 | Du Pont | Butyl esters of phthalic acid |
| DE968544C (de) * | 1954-06-09 | 1958-03-06 | Hoechst Ag | Verfahren zur Herstellung von Polyestern |
| US2985612A (en) * | 1958-09-15 | 1961-05-23 | Monsanto Chemicals | Alkyl phenacetonyl phthalates and vinyl chloride polymer compositions plasticized therewith |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2073937A (en) * | 1932-06-20 | 1937-03-16 | Monsanto Chemicals | Esters of polycarboxylic aromatic acids |
| US2120756A (en) * | 1937-01-09 | 1938-06-14 | Monsanto Chemicals | Methyl ester compositions |
| US2617820A (en) * | 1950-05-13 | 1952-11-11 | Monsanto Chemicals | Alkyl benzyl tetrachlorophthalates |
| US2802860A (en) * | 1954-08-06 | 1957-08-13 | Sherwin Williams Co | Method of manufacture of phthalic esters of anosmic character |
-
0
- NL NL279978D patent/NL279978A/xx unknown
- BE BE621071D patent/BE621071A/xx unknown
-
1961
- 1961-08-05 DE DEC24809A patent/DE1147570B/de active Pending
-
1962
- 1962-04-17 CH CH468162A patent/CH411828A/de unknown
- 1962-05-22 DK DK230062AA patent/DK106184C/da active
- 1962-06-29 US US206519A patent/US3281456A/en not_active Expired - Lifetime
- 1962-07-17 GB GB27449/62A patent/GB951527A/en not_active Expired
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1554032A (en) * | 1920-12-03 | 1925-09-15 | Du Pont | Butyl esters of phthalic acid |
| DE968544C (de) * | 1954-06-09 | 1958-03-06 | Hoechst Ag | Verfahren zur Herstellung von Polyestern |
| US2985612A (en) * | 1958-09-15 | 1961-05-23 | Monsanto Chemicals | Alkyl phenacetonyl phthalates and vinyl chloride polymer compositions plasticized therewith |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1603809B1 (de) * | 1966-02-25 | 1970-09-24 | Dieter Haubold Ind Nagelgeraet | Eintreibstoesselbefestigung am Arbeitskolben eines Druckluftnaglers |
Also Published As
| Publication number | Publication date |
|---|---|
| BE621071A (OSRAM) | |
| DK106184C (da) | 1967-01-02 |
| NL279978A (OSRAM) | |
| CH411828A (de) | 1966-04-30 |
| GB951527A (en) | 1964-03-04 |
| US3281456A (en) | 1966-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1147570B (de) | Verfahren zur Herstellung von Alkylaralkylphthalaten | |
| DE1265758B (de) | Verfahren zur Herstellung von o-(beta-Dialkylaminoaethoxy)-phenylketonen und deren Saeureadditionssalzen und quartaeren Salzen | |
| DE3642256A1 (de) | Verfahren zur herstellung fluorsubstituierter 1,3-benzodioxole | |
| AT231433B (de) | Verfahren zur Herstellung von Alkylaralkylphthalaten | |
| EP0065804B1 (de) | Verfahren zur Herstellung von N-Benzyl-N-isopropylpivaloylamid | |
| EP0017832B1 (de) | Verfahren zur Herstellung von 5-Brom-5-nitro-1,3-dioxan | |
| DE1124960B (de) | Verfahren zur Herstellung von 3-Acetyl-4-oxycumarin | |
| EP1284253B1 (de) | Verfahren zur Herstellung von Monochlorkohlenwasserstoffen mit hoher Isomerenreinheit | |
| DE805757C (de) | Verfahren zur Herstellung von Acetylaethylenoxyd und Diacetyl | |
| DE1155774B (de) | Verfahren zur Herstellung von Cyanformimidoestern | |
| DE2211662A1 (de) | Verfahren zur umwandlung von pyridaziniumsalzen | |
| DE1543353C3 (OSRAM) | ||
| DE1183096B (de) | Verfahren zur Herstellung von alpha, beta-perhalogenierten Phenetolen | |
| EP0191385A2 (de) | Verfahren zur Herstellung von Thiocyanatomethylthiobenzothiazolen | |
| DE1236512B (de) | Verfahren zur Herstellung von Phosphor- und Thiophosphorsaeureestern substituierter 6-Hydroxypyrimidine | |
| DE1935725C3 (de) | Verfahren zur Herstellung von Chlorphenylestern | |
| AT212305B (de) | Verfahren zur Herstellung von neuen Carbonsäureestern des 4, 6-Dinitro-2-sek. butylphenols | |
| EP0012214B1 (de) | Verfahren zur Herstellung von 3-Phenoxy-benzylalkoholen | |
| DE1241830B (de) | Verfahren zur Herstellung von AEthern des N-Methylol-2, 2, 5, 5-tetramethyloxazolidons-(4) | |
| DE1161547B (de) | Verfahren zur Herstellung von Bromderivaten des Diphenyls oder des Diphenylaethers, die 4 und mehr g-Atom Brom pro Mol enthalten | |
| DE1271110B (de) | Verfahren zur Herstellung von 1, 4-Cyclohexadien-1, 4-dicarbonsaeure | |
| DE1051267B (de) | Verfahren zur Herstellung von 2,2,3,3-Tetrachlor-1,4-butandiol | |
| DE1166176B (de) | Verfahren zur Herstellung von Phenanthrenchinon | |
| DE1265738B (OSRAM) | ||
| DE1067422B (de) | Verfahren zur Einführung von Alkyl-, Cycloalkyl-, Alkenyl-, Cycloalkenyl-, Aralkyl- oder Arylresten in aktive Wasserstoff atome enthaltende Carbonsäureester |