DE1140180B - Verfahren zur Herstellung von konzentrierter Salzsaeure - Google Patents
Verfahren zur Herstellung von konzentrierter SalzsaeureInfo
- Publication number
- DE1140180B DE1140180B DED33822A DED0033822A DE1140180B DE 1140180 B DE1140180 B DE 1140180B DE D33822 A DED33822 A DE D33822A DE D0033822 A DED0033822 A DE D0033822A DE 1140180 B DE1140180 B DE 1140180B
- Authority
- DE
- Germany
- Prior art keywords
- acid
- hydrogen chloride
- hydrochloric acid
- chloride gas
- concentration
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 title claims description 120
- 238000000034 method Methods 0.000 title claims description 33
- 238000004519 manufacturing process Methods 0.000 title description 4
- 239000002253 acid Substances 0.000 claims description 99
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 48
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 48
- 239000007789 gas Substances 0.000 claims description 45
- 239000006096 absorbing agent Substances 0.000 claims description 13
- 238000004821 distillation Methods 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 2
- 238000005406 washing Methods 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims 2
- 238000000354 decomposition reaction Methods 0.000 claims 1
- 235000011167 hydrochloric acid Nutrition 0.000 description 26
- 239000000243 solution Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 150000007513 acids Chemical class 0.000 description 9
- 238000005660 chlorination reaction Methods 0.000 description 6
- 238000001816 cooling Methods 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 239000002250 absorbent Substances 0.000 description 3
- 230000002745 absorbent Effects 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000007038 hydrochlorination reaction Methods 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical class CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- -1 dichloroethylene, trichlorethylene, Tetrachlorethylene Chemical group 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B7/00—Halogens; Halogen acids
- C01B7/01—Chlorine; Hydrogen chloride
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Gas Separation By Absorption (AREA)
- Vaporization, Distillation, Condensation, Sublimation, And Cold Traps (AREA)
- Treating Waste Gases (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US828151A US3165453A (en) | 1959-07-20 | 1959-07-20 | Method of concentrating aqueous hci by vaporization, combined with partial condensation and absorption |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1140180B true DE1140180B (de) | 1962-11-29 |
Family
ID=25251027
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DED33822A Pending DE1140180B (de) | 1959-07-20 | 1960-07-20 | Verfahren zur Herstellung von konzentrierter Salzsaeure |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3165453A (cg-RX-API-DMAC7.html) |
| BE (1) | BE593155A (cg-RX-API-DMAC7.html) |
| DE (1) | DE1140180B (cg-RX-API-DMAC7.html) |
| FR (1) | FR1262537A (cg-RX-API-DMAC7.html) |
| GB (1) | GB950079A (cg-RX-API-DMAC7.html) |
| NL (1) | NL253964A (cg-RX-API-DMAC7.html) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3387430A (en) * | 1961-12-28 | 1968-06-11 | Falls Ind Inc | Hydrochloric acid process |
| BE631187A (cg-RX-API-DMAC7.html) * | 1962-04-19 | |||
| US3394056A (en) * | 1965-08-31 | 1968-07-23 | Exxon Research Engineering Co | Recovery of anhydrous hci from aqueous azeotropes by plural stage distillation |
| DE1792465A1 (de) * | 1968-09-05 | 1971-11-18 | Kali Chemie Ag | Verfahren zur Entfernung geringer Mengen Fluor und/oder Chlor enthaltender Methan- oder AEthanderivate aus Salzsaeure |
| US3634201A (en) * | 1969-12-24 | 1972-01-11 | Krupp Gmbh | Method for removing volatile impurities from raw oil by scrubbing and distillation with a stripping gas |
| DE2634959C2 (de) * | 1976-08-04 | 1984-09-20 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Gewinnung von Salzsäure durch Entfernung von Chlorwasserstoff aus Verbrennungsgasen |
| FR2473898A1 (fr) * | 1980-01-23 | 1981-07-24 | Bljum Grigory | Procede d'epuration des impuretes contenues dans une solution aqueuse d'un corps gazeux |
| CN114684986B (zh) * | 2020-12-31 | 2023-06-13 | 南通醋酸化工股份有限公司 | 一种山梨酸废水资源化利用方法 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA586845A (en) * | 1959-11-10 | Udic Societe Anonyme | Recovery and concentration of hydrochloric acid | |
| US1398224A (en) * | 1918-11-09 | 1921-11-29 | Kalbfleisch Corp | Process for producing highly-concentrated hydrochloric acid |
| US1628829A (en) * | 1923-04-05 | 1927-05-17 | Grasselli Chemical Co | Process of distilling hydrochloric acid |
| US1758351A (en) * | 1927-06-15 | 1930-05-13 | E B Badger & Sons Company | Chlorination |
| US1906467A (en) * | 1931-07-09 | 1933-05-02 | Dow Chemical Co | Distilling hydrochloric acid |
| US2545314A (en) * | 1943-02-12 | 1951-03-13 | Hercules Powder Co Ltd | Hydrochloric acid recovery |
| US2436432A (en) * | 1943-02-26 | 1948-02-24 | Eansteel Metallurg Corp | Method for making hydrochloric acid |
| US2490454A (en) * | 1946-06-20 | 1949-12-06 | Du Pont | Process for the recovery of hydrogen chloride from off-gas |
| BE568078A (cg-RX-API-DMAC7.html) * | 1957-07-31 |
-
0
- NL NL253964D patent/NL253964A/xx unknown
-
1959
- 1959-07-20 US US828151A patent/US3165453A/en not_active Expired - Lifetime
-
1960
- 1960-07-18 GB GB24988/60A patent/GB950079A/en not_active Expired
- 1960-07-19 FR FR833364A patent/FR1262537A/fr not_active Expired
- 1960-07-19 BE BE593155A patent/BE593155A/fr unknown
- 1960-07-20 DE DED33822A patent/DE1140180B/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| US3165453A (en) | 1965-01-12 |
| NL253964A (cg-RX-API-DMAC7.html) | |
| BE593155A (fr) | 1961-01-19 |
| FR1262537A (fr) | 1961-05-26 |
| GB950079A (en) | 1964-02-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2208102B2 (de) | Verfahren zum Entfernen von Schwefeldioxid aus einem schwefeldioxidhaltigen Gas | |
| DE1106738B (de) | Verfahren zur Herstellung von saeurefreiem, waesserigem Wasserstoffperoxyd | |
| DE2027018A1 (de) | Verfahren zur Ruckgewinnung von verbrauchter Salzsaure Beize | |
| DD140037A5 (de) | Verfahren zur isolierung und reinigung von acrylnitril oder methacrylnitril aus diese enthaltenden reaktionsgemischen | |
| DE2654883A1 (de) | Verfahren zur gewinnung von nicht- umgesetzten materialien und waerme bei der harnstoffsynthese | |
| DE1592324C3 (de) | Verfahren zur Reinigung eines wasserhaltigen, mit Schwefelwasserstoff verunreinigten Ammoniakgases | |
| DE1140180B (de) | Verfahren zur Herstellung von konzentrierter Salzsaeure | |
| DE4106373C2 (de) | Verfahren zur Herstellung einer hochkonzentrierten Salzsäure aus einer Ausgangssalzsäure mit einer unterhalb der azeotropen Konzentration liegenden Konzentration | |
| DE1593357A1 (de) | Verfahren zur Entfernung von Acrolein aus Acrylnitril | |
| DE2823972A1 (de) | Verfahren und vorrichtung zur abtrennung von stickstofftrichlorid aus chlor | |
| DE1567479C3 (de) | Verfahren zur Herstellung von Chlordioxid | |
| EP0005270A1 (de) | Verfahren zur Entfernung von Schwefeldioxid aus Abwässern und gegebenenfalls Abgasen | |
| DE1567504B1 (de) | Verfahren zur Gewinnung bzw.Entfernung von Fluorwasserstoff aus Gasmischungen | |
| DE69716440T2 (de) | Wiedergewinnung eines zur epoxidierung verwendeten molybdän-katalysators | |
| DE19725851A1 (de) | Verfahren zur Herstellung hochreiner, wässriger Hydroxylaminlösungen | |
| CH644085A5 (de) | Verfahren und vorrichtung zur gewinnung von reinem chlorcyan. | |
| DE2209841B2 (de) | Verfahren zur abtrennung von fluorwasserstoff aus einem fluorwasserstoff enthaltenden gasgemisch | |
| DE3517531A1 (de) | Verfahren zur gewinnung von ammoniak aus schwefelwasserstoff- und/oder kohlendioxidhaltigem ammoniakwasser | |
| DE1620290A1 (de) | Verfahren zur Herstellung von reinem Cyanurchlorid | |
| DE2244990C3 (de) | Verfahren zur Verringerung des Quecksilberdampfgehaltes eines damit verunreinigten Gases | |
| DE3521632A1 (de) | Verfahren zum behandeln einer eisenchlorid und salzsaeure enthaltenden waessrigen loesung | |
| DE2065278C3 (de) | Verfahren zur Abtrennung und Rückführung der njcht-umgesetzten Ausgangsstoffe bei einer Harnstoffsynthese aus Ammoniak und Kohlendioxid. Ausscheidung aus: 2050903 | |
| DE69109461T2 (de) | Verfahren und vorrichtung zur herstellung von distickstoffpentoxid. | |
| DE3923423A1 (de) | Verfahren zur entfernung von ammoniumsulfat aus hochteerhaltigen abfallstroemen der (meth)acrylnitrilherstellung | |
| DE2218968A1 (de) | Verfahren zur Entfernung von Quecksilber aus wäßrigen alkalischen Lösungen |