DE1125453B - Waermekopierverfahren - Google Patents
WaermekopierverfahrenInfo
- Publication number
- DE1125453B DE1125453B DEK42365A DEK0042365A DE1125453B DE 1125453 B DE1125453 B DE 1125453B DE K42365 A DEK42365 A DE K42365A DE K0042365 A DEK0042365 A DE K0042365A DE 1125453 B DE1125453 B DE 1125453B
- Authority
- DE
- Germany
- Prior art keywords
- original
- layer
- heat
- image
- copy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 9
- 239000000843 powder Substances 0.000 claims description 14
- 239000004952 Polyamide Substances 0.000 claims description 11
- 229920002647 polyamide Polymers 0.000 claims description 11
- 230000005855 radiation Effects 0.000 claims description 8
- 230000000694 effects Effects 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000000463 material Substances 0.000 description 16
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 10
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 8
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 239000001361 adipic acid Substances 0.000 description 5
- 235000011037 adipic acid Nutrition 0.000 description 5
- 125000005521 carbonamide group Chemical group 0.000 description 5
- 239000007859 condensation product Substances 0.000 description 5
- 239000011521 glass Substances 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 229910052709 silver Inorganic materials 0.000 description 4
- 239000004332 silver Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 229920002292 Nylon 6 Polymers 0.000 description 2
- 125000004849 alkoxymethyl group Chemical group 0.000 description 2
- ZRSKSQHEOZFGLJ-UHFFFAOYSA-N ammonium adipate Chemical compound [NH4+].[NH4+].[O-]C(=O)CCCCC([O-])=O ZRSKSQHEOZFGLJ-UHFFFAOYSA-N 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 230000035515 penetration Effects 0.000 description 2
- -1 polyhexamethylene Polymers 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 241000870659 Crassula perfoliata var. minor Species 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000001678 irradiating effect Effects 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 238000012800 visualization Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/26—Thermography ; Marking by high energetic means, e.g. laser otherwise than by burning, and characterised by the material used
- B41M5/398—Processes based on the production of stickiness patterns using powders
Landscapes
- Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
- Thermal Transfer Or Thermal Recording In General (AREA)
- Developing Agents For Electrophotography (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Printing Methods (AREA)
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE611269D BE611269A (enExample) | 1960-12-10 | ||
| NL272284D NL272284A (enExample) | 1960-12-10 | ||
| DEK42365A DE1125453B (de) | 1960-12-10 | 1960-12-10 | Waermekopierverfahren |
| DEK42512A DE1166795B (de) | 1960-12-10 | 1960-12-27 | Waermekopierverfahren |
| DEK42581A DE1140953B (de) | 1960-12-10 | 1961-01-07 | Waermekopierverfahren |
| DEK43334A DE1179566B (de) | 1960-12-10 | 1961-03-29 | Waermekopierverfahren |
| US146323A US3196029A (en) | 1960-12-10 | 1961-10-19 | Heat-copying process |
| AT859361A AT247379B (de) | 1960-12-10 | 1961-11-14 | Wärmekopierverfahren |
| LU40874D LU40874A1 (enExample) | 1960-12-10 | 1961-11-27 | |
| GB43263/61A GB988869A (en) | 1960-12-10 | 1961-12-04 | Heat-copying process |
| SE12191/61A SE312976B (enExample) | 1960-12-10 | 1961-12-06 | |
| CH1423761A CH408073A (de) | 1960-12-10 | 1961-12-08 | Wärmekopierverfahren |
| FR881478A FR1313359A (fr) | 1960-12-10 | 1961-12-08 | Procédé de reproduction par voie thermique |
| DK493361AA DK103302C (da) | 1960-12-10 | 1961-12-09 | Fremgangsmåde til varmekopiering. |
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK42365A DE1125453B (de) | 1960-12-10 | 1960-12-10 | Waermekopierverfahren |
| DEK42512A DE1166795B (de) | 1960-12-10 | 1960-12-27 | Waermekopierverfahren |
| DEK42581A DE1140953B (de) | 1960-12-10 | 1961-01-07 | Waermekopierverfahren |
| DEK43334A DE1179566B (de) | 1960-12-10 | 1961-03-29 | Waermekopierverfahren |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1125453B true DE1125453B (de) | 1962-03-15 |
Family
ID=27437113
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEK42365A Pending DE1125453B (de) | 1960-12-10 | 1960-12-10 | Waermekopierverfahren |
| DEK42512A Pending DE1166795B (de) | 1960-12-10 | 1960-12-27 | Waermekopierverfahren |
| DEK42581A Pending DE1140953B (de) | 1960-12-10 | 1961-01-07 | Waermekopierverfahren |
| DEK43334A Pending DE1179566B (de) | 1960-12-10 | 1961-03-29 | Waermekopierverfahren |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEK42512A Pending DE1166795B (de) | 1960-12-10 | 1960-12-27 | Waermekopierverfahren |
| DEK42581A Pending DE1140953B (de) | 1960-12-10 | 1961-01-07 | Waermekopierverfahren |
| DEK43334A Pending DE1179566B (de) | 1960-12-10 | 1961-03-29 | Waermekopierverfahren |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3196029A (enExample) |
| AT (1) | AT247379B (enExample) |
| BE (1) | BE611269A (enExample) |
| CH (1) | CH408073A (enExample) |
| DE (4) | DE1125453B (enExample) |
| DK (1) | DK103302C (enExample) |
| GB (1) | GB988869A (enExample) |
| LU (1) | LU40874A1 (enExample) |
| NL (1) | NL272284A (enExample) |
| SE (1) | SE312976B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1257159B (de) * | 1963-05-21 | 1967-12-28 | Kalle Ag | Verfahren zum Herstellen einer Reliefdruckform |
| DE1285485B (de) * | 1963-02-26 | 1968-12-19 | Konishiroku Photo Ind | Thermographisches Verfahren |
| DE1546750B1 (de) * | 1965-12-29 | 1973-04-26 | Matsushita Electric Ind Co Ltd | Thermographisches reproduktionsverfahren |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3446617A (en) * | 1962-04-20 | 1969-05-27 | Minnesota Mining & Mfg | Thermographic copying process |
| US3364858A (en) * | 1963-09-20 | 1968-01-23 | Konishiroku Photo Ind | Method for the preparation of an offset printing master |
| US3383505A (en) * | 1964-03-12 | 1968-05-14 | Nasu Kintaro | Process for copying utilizing heat-sensitive copying materials containing water of crystallization that can be released by heating |
| US3428952A (en) * | 1964-10-02 | 1969-02-18 | Keuffel & Esser Co | Method of thermally recording,and electrically retrieving information |
| US3409455A (en) * | 1965-01-04 | 1968-11-05 | Gaf Corp | Process of reproduction on benzene diazonium fluoborate sheet by heat exposure |
| BE674776A (enExample) * | 1965-01-08 | 1966-05-03 | ||
| GB1134938A (en) * | 1965-02-10 | 1968-11-27 | Fuji Photo Film Co Ltd | A photographic or thermographic reproduction process |
| US3404994A (en) * | 1965-02-11 | 1968-10-08 | Arnold G. Gulko | Thermographic copying process utilizing recording member with dispersed oil particles |
| US3329500A (en) * | 1965-06-07 | 1967-07-04 | Xerox Corp | Electrostatic frosting |
| US3510336A (en) * | 1965-08-12 | 1970-05-05 | Gaf Great Britain Ltd | Reflex copying method |
| US3515570A (en) * | 1965-12-20 | 1970-06-02 | Matsushita Electric Industrial Co Ltd | Heat-sensitive sheet and method of thermographic reproduction using the same |
| US3396401A (en) * | 1966-10-20 | 1968-08-06 | Kenneth K. Nonomura | Apparatus and method for the marking of intelligence on a record medium |
| US3557691A (en) * | 1968-06-25 | 1971-01-26 | Owens Illinois Inc | Electrostatic stencil printing process utilizing polyester-alkyd resin powder |
| US3619345A (en) * | 1968-06-28 | 1971-11-09 | Ricoh Kk | Heat-sensitive stencil paper |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2297691A (en) * | 1939-04-04 | 1942-10-06 | Chester F Carlson | Electrophotography |
| BE478771A (enExample) * | 1946-09-23 | |||
| US2561513A (en) * | 1948-10-20 | 1951-07-24 | Celanese Corp | Process for coating and coating compositions |
| US2909443A (en) * | 1953-09-29 | 1959-10-20 | Du Pont | Process of making polyethylene film receptive to organic coating |
| US2847330A (en) * | 1954-07-28 | 1958-08-12 | Ohio Commw Eng Co | Method and apparatus for gas plating printing circuits |
| US2855324A (en) * | 1955-04-07 | 1958-10-07 | van dorn | |
| DE1225524B (de) * | 1955-12-29 | 1966-09-22 | Bayer Ag | Verfahren zum Herstellen von Schutzueberzuegen aus pulverfoermigen schmelzbaren UEberzugs-massen auf Gegenstaenden aus metallen und anderen Stoffen |
| US2974060A (en) * | 1958-07-18 | 1961-03-07 | Polymer Corp | Fluidized bed coating method |
| US3081699A (en) * | 1958-12-22 | 1963-03-19 | Arnold G Gulko | Thermal reproduction |
| US3089953A (en) * | 1959-04-15 | 1963-05-14 | Kalle Ag | Reproduction process |
| BE594909A (enExample) * | 1959-09-11 | |||
| NL273128A (enExample) * | 1961-01-03 |
-
0
- BE BE611269D patent/BE611269A/xx unknown
- NL NL272284D patent/NL272284A/xx unknown
-
1960
- 1960-12-10 DE DEK42365A patent/DE1125453B/de active Pending
- 1960-12-27 DE DEK42512A patent/DE1166795B/de active Pending
-
1961
- 1961-01-07 DE DEK42581A patent/DE1140953B/de active Pending
- 1961-03-29 DE DEK43334A patent/DE1179566B/de active Pending
- 1961-10-19 US US146323A patent/US3196029A/en not_active Expired - Lifetime
- 1961-11-14 AT AT859361A patent/AT247379B/de active
- 1961-11-27 LU LU40874D patent/LU40874A1/xx unknown
- 1961-12-04 GB GB43263/61A patent/GB988869A/en not_active Expired
- 1961-12-06 SE SE12191/61A patent/SE312976B/xx unknown
- 1961-12-08 CH CH1423761A patent/CH408073A/de unknown
- 1961-12-09 DK DK493361AA patent/DK103302C/da active
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1285485B (de) * | 1963-02-26 | 1968-12-19 | Konishiroku Photo Ind | Thermographisches Verfahren |
| DE1257159B (de) * | 1963-05-21 | 1967-12-28 | Kalle Ag | Verfahren zum Herstellen einer Reliefdruckform |
| DE1546750B1 (de) * | 1965-12-29 | 1973-04-26 | Matsushita Electric Ind Co Ltd | Thermographisches reproduktionsverfahren |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1140953B (de) | 1962-12-13 |
| BE611269A (enExample) | |
| DK103302C (da) | 1965-12-13 |
| CH408073A (de) | 1966-02-28 |
| DE1166795B (de) | 1964-04-02 |
| DE1179566B (de) | 1964-10-15 |
| SE312976B (enExample) | 1969-07-28 |
| NL272284A (enExample) | |
| GB988869A (en) | 1965-04-14 |
| LU40874A1 (enExample) | 1962-01-27 |
| US3196029A (en) | 1965-07-20 |
| AT247379B (de) | 1966-06-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1125453B (de) | Waermekopierverfahren | |
| DE1572203C3 (de) | Verfahren zur Herstellung eines wärmeentwickelbaren Blattmaterials mit einem strahlungsempfindlichen Überzug | |
| DE1547949A1 (de) | Photoempfindliches Material | |
| DE2228258A1 (de) | Strahlungsempfindliche kristalline polyacetylenaminsalze und verwendung derselben zur erzeugung von bildern | |
| DE1295373B (de) | Elektrophotographisches Verfahren zur Herstellung von Bildern | |
| DE1257169B (de) | Verfahren zur Herstellung von Bildern | |
| DE2226292C3 (de) | Verfahren zur Herstellung von Kopien | |
| DE1257159B (de) | Verfahren zum Herstellen einer Reliefdruckform | |
| DE1249891B (de) | Warmekopierverfahren | |
| DE1497011A1 (de) | Elektrophotographisches Verfahren | |
| DE2703378A1 (de) | Saeurehaltiges donorblatt fuer thermographische aufzeichnungsverfahren und seine verwendung zur herstellung von durchsichtsbildern | |
| DE1220447B (de) | Thermoplastisches Aufzeichnungsverfahren | |
| DE1546744A1 (de) | Thermographisches Reflexkopierverfahren und Vorrichtung hierfuer | |
| DE604973C (de) | Lichtempfindliche Schicht, insbesondere fuer die Photographie und Reproduktion | |
| DE1258735B (de) | Elektrophotographisches Verfahren | |
| DE2855432A1 (de) | Waermeempfindliches registriermaterial | |
| DE1137449B (de) | Bildaufzeichnungsverfahren | |
| DE2228248A1 (de) | Thermographische flachdruckplatte | |
| AT258714B (de) | Wärmereproduktionsverfahren | |
| DE1285485B (de) | Thermographisches Verfahren | |
| DE1293590B (de) | Thermoelektrophotographisches Verfahren zur Herstellung von Kopien und Aufzeichnungsmaterial zur Durchfuehrung des Verfahrens | |
| AT229705B (de) | Bildaufzeichnungsverfahren | |
| AT267321B (de) | Verfahren zum Aufzeichnen eines Wärmebildes | |
| DE1107680B (de) | Verfahren zur Erzeugung elektrostatischer Bilder | |
| AT225029B (de) | Elektrothermographisches Kopierverfahren |