DE1124612B - Vorrichtung zur elektrisch steuerbaren UEbertragung von mechanischen Kraeften - Google Patents
Vorrichtung zur elektrisch steuerbaren UEbertragung von mechanischen KraeftenInfo
- Publication number
- DE1124612B DE1124612B DEI12636A DEI0012636A DE1124612B DE 1124612 B DE1124612 B DE 1124612B DE I12636 A DEI12636 A DE I12636A DE I0012636 A DEI0012636 A DE I0012636A DE 1124612 B DE1124612 B DE 1124612B
- Authority
- DE
- Germany
- Prior art keywords
- parts
- weight
- semiconductor
- semiconductor body
- conductive
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 230000005540 biological transmission Effects 0.000 title claims description 5
- 239000004065 semiconductor Substances 0.000 claims description 84
- 239000002245 particle Substances 0.000 claims description 23
- 239000000463 material Substances 0.000 claims description 14
- 239000011230 binding agent Substances 0.000 claims description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 8
- 239000007788 liquid Substances 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 6
- 229920001568 phenolic resin Polymers 0.000 claims description 6
- 239000005011 phenolic resin Substances 0.000 claims description 6
- 230000008569 process Effects 0.000 claims description 6
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 claims description 4
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 claims description 4
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 4
- 239000010425 asbestos Substances 0.000 claims description 4
- 229920001971 elastomer Polymers 0.000 claims description 4
- 239000004033 plastic Substances 0.000 claims description 4
- 229920003023 plastic Polymers 0.000 claims description 4
- -1 polytetrafluoroethylene Polymers 0.000 claims description 4
- 229920001343 polytetrafluoroethylene Polymers 0.000 claims description 4
- 239000004810 polytetrafluoroethylene Substances 0.000 claims description 4
- 229910052895 riebeckite Inorganic materials 0.000 claims description 4
- 239000005060 rubber Substances 0.000 claims description 4
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 2
- 235000021355 Stearic acid Nutrition 0.000 claims description 2
- 229910000831 Steel Inorganic materials 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 238000005054 agglomeration Methods 0.000 claims description 2
- 230000002776 aggregation Effects 0.000 claims description 2
- 239000003963 antioxidant agent Substances 0.000 claims description 2
- 230000003078 antioxidant effect Effects 0.000 claims description 2
- 239000006229 carbon black Substances 0.000 claims description 2
- 239000004927 clay Substances 0.000 claims description 2
- 238000001746 injection moulding Methods 0.000 claims description 2
- 229910044991 metal oxide Inorganic materials 0.000 claims description 2
- 150000004706 metal oxides Chemical class 0.000 claims description 2
- 229920003052 natural elastomer Polymers 0.000 claims description 2
- 229920001194 natural rubber Polymers 0.000 claims description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 claims description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 claims description 2
- 229920002545 silicone oil Polymers 0.000 claims description 2
- 229910001220 stainless steel Inorganic materials 0.000 claims description 2
- 239000010935 stainless steel Substances 0.000 claims description 2
- 239000008117 stearic acid Substances 0.000 claims description 2
- 239000010959 steel Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 229920003051 synthetic elastomer Polymers 0.000 claims description 2
- 239000011787 zinc oxide Substances 0.000 claims description 2
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical compound [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 claims description 2
- DUBNHZYBDBBJHD-UHFFFAOYSA-L ziram Chemical compound [Zn+2].CN(C)C([S-])=S.CN(C)C([S-])=S DUBNHZYBDBBJHD-UHFFFAOYSA-L 0.000 claims description 2
- 229920002313 fluoropolymer Polymers 0.000 claims 2
- 239000000919 ceramic Substances 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 claims 1
- 238000010304 firing Methods 0.000 claims 1
- 230000002687 intercalation Effects 0.000 claims 1
- 238000009830 intercalation Methods 0.000 claims 1
- 238000000465 moulding Methods 0.000 claims 1
- 230000008878 coupling Effects 0.000 description 32
- 238000010168 coupling process Methods 0.000 description 32
- 238000005859 coupling reaction Methods 0.000 description 32
- 229910052751 metal Inorganic materials 0.000 description 13
- 239000002184 metal Substances 0.000 description 13
- 230000000694 effects Effects 0.000 description 8
- 239000000314 lubricant Substances 0.000 description 8
- 239000004020 conductor Substances 0.000 description 7
- 239000000428 dust Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 230000001050 lubricating effect Effects 0.000 description 5
- 239000000853 adhesive Substances 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- 238000010586 diagram Methods 0.000 description 3
- 230000003628 erosive effect Effects 0.000 description 3
- 238000005461 lubrication Methods 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 229920003002 synthetic resin Polymers 0.000 description 3
- 239000000057 synthetic resin Substances 0.000 description 3
- 229910001369 Brass Inorganic materials 0.000 description 2
- 238000005299 abrasion Methods 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 239000010951 brass Substances 0.000 description 2
- 230000007547 defect Effects 0.000 description 2
- 230000005611 electricity Effects 0.000 description 2
- 239000010408 film Substances 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 210000000050 mohair Anatomy 0.000 description 2
- 239000010409 thin film Substances 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229910010293 ceramic material Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- XUCNUKMRBVNAPB-UHFFFAOYSA-N fluoroethene Chemical group FC=C XUCNUKMRBVNAPB-UHFFFAOYSA-N 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000010687 lubricating oil Substances 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- SOQBVABWOPYFQZ-UHFFFAOYSA-N oxygen(2-);titanium(4+) Chemical class [O-2].[O-2].[Ti+4] SOQBVABWOPYFQZ-UHFFFAOYSA-N 0.000 description 1
- 235000019353 potassium silicate Nutrition 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 210000002374 sebum Anatomy 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000001360 synchronised effect Effects 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H02—GENERATION; CONVERSION OR DISTRIBUTION OF ELECTRIC POWER
- H02N—ELECTRIC MACHINES NOT OTHERWISE PROVIDED FOR
- H02N13/00—Clutches or holding devices using electrostatic attraction, e.g. using Johnson-Rahbek effect
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01H—ELECTRIC SWITCHES; RELAYS; SELECTORS; EMERGENCY PROTECTIVE DEVICES
- H01H59/00—Electrostatic relays; Electro-adhesion relays
Landscapes
- Adhesives Or Adhesive Processes (AREA)
- Braking Arrangements (AREA)
- Mechanical Operated Clutches (AREA)
- Lubricants (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US55664455A | 1955-12-30 | 1955-12-30 | |
| US556676A US2923390A (en) | 1955-12-30 | 1955-12-30 | Electrostatic clutch |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1124612B true DE1124612B (de) | 1962-03-01 |
| DE1124612C2 DE1124612C2 (enExample) | 1962-09-13 |
Family
ID=27071210
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEI12636A Granted DE1124612B (de) | 1955-12-30 | 1956-12-22 | Vorrichtung zur elektrisch steuerbaren UEbertragung von mechanischen Kraeften |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US2923390A (enExample) |
| DE (1) | DE1124612B (enExample) |
| FR (1) | FR1179253A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1255430B (de) * | 1956-08-15 | 1967-11-30 | Ibm Deutschland | Elektrostatische Kupplung |
| DE102020203358B4 (de) | 2020-03-16 | 2022-12-22 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung eingetragener Verein | Nasslaufende, schaltbare Reibungskupplung, Kraftfahrzeug mit einer derartigen Reibungskupplung, sowie Verfahren zum Betreiben der Reibungskupplung |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3150678A (en) * | 1960-07-11 | 1964-09-29 | Warner Electric Brake & Clutch | Device utilizing electro-viscous liquid |
| US3195363A (en) * | 1962-02-09 | 1965-07-20 | Litton Systems Inc | Selective driving means |
| US3343635A (en) * | 1965-03-12 | 1967-09-26 | Gen Electric Co Ltd | Electrostatic clutches |
| US3454137A (en) * | 1966-12-23 | 1969-07-08 | Ncr Co | Lubrication device for electrostatic actuators |
| US3871944A (en) * | 1973-06-11 | 1975-03-18 | Minnesota Mining & Mfg | Integral composite element useful in electrostatic clutch or brake devices |
| WO2021118789A1 (en) | 2019-12-09 | 2021-06-17 | American Axle & Manufacturing, Inc. | Damped isolation pulley having an electro-adhesive clutch |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE384028C (de) * | 1921-08-11 | 1923-11-07 | Joseph Engl Dr | Vorrichtung zur Umwandlung elektrischer Energie in Bewegung |
| DE412874C (de) * | 1925-04-29 | Erich F Huth G M B H Dr | Anordnung fuer elektrostatische Relais mit Halbeleitern | |
| US2417850A (en) * | 1942-04-14 | 1947-03-25 | Willis M Winslow | Method and means for translating electrical impulses into mechanical force |
| DE919002C (de) * | 1952-09-07 | 1954-10-11 | Engelbert Mueller | Vorrichtung zur Ausnutzung der Anziehungskraft auf Grund des Johnsen-Rahbeck-Effektes |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1045781A (en) * | 1908-06-16 | 1912-11-26 | Nat Electric Signaling Company | Wireless telegraphy. |
| US1533757A (en) * | 1919-03-10 | 1925-04-14 | Rahbek Knud | Apparatus for changing electrical variations to mechanical |
| US2148482A (en) * | 1934-01-10 | 1939-02-28 | Lorenz Charles Frederick | Electrical device and method of operating the same |
| US2568824A (en) * | 1946-02-27 | 1951-09-25 | Rahbek Knud | Semiconductor unit for the utilization of electroadhesion |
| US2589582A (en) * | 1949-08-12 | 1952-03-18 | Strughold Peter | Lubricant stick |
| US2686140A (en) * | 1952-03-29 | 1954-08-10 | Johns Manville | Composition brake block |
| GB729351A (en) * | 1953-01-13 | 1955-05-04 | Glacier Co Ltd | Improvements in or relating to plain bearings |
| GB839324A (en) * | 1956-08-03 | 1960-06-29 | Int Computers & Tabulators Ltd | Improvements in or relating to motion transmitters |
| US2850908A (en) * | 1957-03-06 | 1958-09-09 | Powers Samas Account Mach Ltd | Motion transmitters |
-
1955
- 1955-12-30 US US556676A patent/US2923390A/en not_active Expired - Lifetime
-
1956
- 1956-12-22 DE DEI12636A patent/DE1124612B/de active Granted
- 1956-12-27 FR FR1179253D patent/FR1179253A/fr not_active Expired
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE412874C (de) * | 1925-04-29 | Erich F Huth G M B H Dr | Anordnung fuer elektrostatische Relais mit Halbeleitern | |
| DE384028C (de) * | 1921-08-11 | 1923-11-07 | Joseph Engl Dr | Vorrichtung zur Umwandlung elektrischer Energie in Bewegung |
| US2417850A (en) * | 1942-04-14 | 1947-03-25 | Willis M Winslow | Method and means for translating electrical impulses into mechanical force |
| DE919002C (de) * | 1952-09-07 | 1954-10-11 | Engelbert Mueller | Vorrichtung zur Ausnutzung der Anziehungskraft auf Grund des Johnsen-Rahbeck-Effektes |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1255430B (de) * | 1956-08-15 | 1967-11-30 | Ibm Deutschland | Elektrostatische Kupplung |
| DE102020203358B4 (de) | 2020-03-16 | 2022-12-22 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung eingetragener Verein | Nasslaufende, schaltbare Reibungskupplung, Kraftfahrzeug mit einer derartigen Reibungskupplung, sowie Verfahren zum Betreiben der Reibungskupplung |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1179253A (fr) | 1959-05-22 |
| US2923390A (en) | 1960-02-02 |
| DE1124612C2 (enExample) | 1962-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE10083288B3 (de) | Dichtung und Rotationsanordnung zur Verwendung dieser Dichtung | |
| DE60224459T2 (de) | Kupplungsscheibe, Reibungskupplung und Kupplungsvorrichtung | |
| DE2706806A1 (de) | Nasse scheibenbremse | |
| DE4433584A1 (de) | Getriebe | |
| DE1124612B (de) | Vorrichtung zur elektrisch steuerbaren UEbertragung von mechanischen Kraeften | |
| EP0185134A1 (de) | Verschleissindikator für eine Gleitringdichtung | |
| DE3829702A1 (de) | Gleitringdichtung | |
| DE2755887C2 (de) | Elektromagnetisch betätigbare Reibungskupplung | |
| DE60131869T2 (de) | Magnetische dichtungsvorrichtung | |
| DE1079727B (de) | Bewegungsuebertragungsvorrichtung | |
| DE60038311T2 (de) | Kontaktelement und kontaktsystem | |
| DE102008041403A1 (de) | Schalteinheit mit mindestens einem elektroaktiven dielektrischen Verformungskörper | |
| EP0328737B1 (de) | Dichtung | |
| DE69917334T2 (de) | Reibschlussvorrichtung und verfahren zur steuerung der reibschlussvorrichtung | |
| DE2016105C3 (de) | Schraubtrieb-Andrehvorrichtung | |
| DE1020243B (de) | Kombinierte Reibungs- und Wirbelstromkupplung, insbesondere fuer Kraftfahrzeuge | |
| DE102015110428A1 (de) | Gleitkontaktelement | |
| EP2930025A1 (de) | Dichtungselement | |
| AT522255A1 (de) | Reibbelag | |
| EP1674752B1 (de) | Viskosekupplung | |
| DE2712395C3 (de) | Geschwindigkeitsregelvorrichtung für Rotationsdiisen | |
| DE593616C (de) | Einrichtung zur synchronen UEbertragung von Drehbewegungen einer Steuerwelle auf eine Arbeitswelle | |
| EP0961043A3 (de) | Biegeeinstellwalze | |
| DE2457762C3 (de) | Dichtung für Kolben bzw. Kolbenstangen von Arbeitszylindern | |
| EP0303769A2 (de) | Vorrichtung zur Übertragung von Drehbewegungen durch die Wand einer Vakuumkammer |