DE1060713B - Material fuer die elektrophotographische Reproduktion - Google Patents
Material fuer die elektrophotographische ReproduktionInfo
- Publication number
- DE1060713B DE1060713B DEK30376A DEK0030376A DE1060713B DE 1060713 B DE1060713 B DE 1060713B DE K30376 A DEK30376 A DE K30376A DE K0030376 A DEK0030376 A DE K0030376A DE 1060713 B DE1060713 B DE 1060713B
- Authority
- DE
- Germany
- Prior art keywords
- ecm
- paper
- phenyl
- benzoin
- glacial acetic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000463 material Substances 0.000 title claims description 9
- DXGBXGUKMDUPIH-UHFFFAOYSA-N 4,5-diphenylimidazole-2-thione Chemical compound N=1C(=S)N=C(C=2C=CC=CC=2)C=1C1=CC=CC=C1 DXGBXGUKMDUPIH-UHFFFAOYSA-N 0.000 claims description 15
- 239000000126 substance Substances 0.000 claims description 15
- 239000000203 mixture Substances 0.000 claims description 10
- 239000000084 colloidal system Substances 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- OTLLZASEKLGFMH-UHFFFAOYSA-N 4,5-diphenylimidazol-2-one Chemical compound N=1C(=O)N=C(C=2C=CC=CC=2)C=1C1=CC=CC=C1 OTLLZASEKLGFMH-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 239000006104 solid solution Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 60
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical group C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 44
- 229920005989 resin Polymers 0.000 description 36
- 239000011347 resin Substances 0.000 description 36
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 33
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical group NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 32
- 229960000583 acetic acid Drugs 0.000 description 30
- 239000012362 glacial acetic acid Substances 0.000 description 30
- 150000001875 compounds Chemical class 0.000 description 26
- 239000000243 solution Substances 0.000 description 24
- 244000028419 Styrax benzoin Species 0.000 description 22
- 235000000126 Styrax benzoin Nutrition 0.000 description 22
- 235000008411 Sumatra benzointree Nutrition 0.000 description 22
- 229960002130 benzoin Drugs 0.000 description 22
- 235000019382 gum benzoic Nutrition 0.000 description 22
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 15
- 239000004202 carbamide Substances 0.000 description 15
- 239000000975 dye Substances 0.000 description 12
- 239000011888 foil Substances 0.000 description 11
- 235000019441 ethanol Nutrition 0.000 description 10
- 238000000034 method Methods 0.000 description 10
- 239000000843 powder Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 229910052782 aluminium Inorganic materials 0.000 description 7
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 7
- 239000000446 fuel Substances 0.000 description 7
- 150000002576 ketones Chemical class 0.000 description 7
- 229920003002 synthetic resin Polymers 0.000 description 7
- 239000000057 synthetic resin Substances 0.000 description 7
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- 229920003023 plastic Polymers 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- -1 methyl alcohols Chemical class 0.000 description 4
- 239000002985 plastic film Substances 0.000 description 4
- 235000019260 propionic acid Nutrition 0.000 description 4
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 239000004071 soot Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- LRRQSCPPOIUNGX-UHFFFAOYSA-N 2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone Chemical compound C1=CC(OC)=CC=C1C(O)C(=O)C1=CC=C(OC)C=C1 LRRQSCPPOIUNGX-UHFFFAOYSA-N 0.000 description 3
- QKUFWHVKSNPKQR-UHFFFAOYSA-N CNC1=CC=C(C=C1)C(=O)C(O)C1=CC=CC=C1 Chemical compound CNC1=CC=C(C=C1)C(=O)C(O)C1=CC=CC=C1 QKUFWHVKSNPKQR-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 229920003086 cellulose ether Polymers 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 230000035515 penetration Effects 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- PYWVYCXTNDRMGF-UHFFFAOYSA-N rhodamine B Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=CC=C1C(O)=O PYWVYCXTNDRMGF-UHFFFAOYSA-N 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 3
- SRYLJBWDZZMDSK-UHFFFAOYSA-N (4-methoxyphenyl)thiourea Chemical compound COC1=CC=C(NC(N)=S)C=C1 SRYLJBWDZZMDSK-UHFFFAOYSA-N 0.000 description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- NERIXXGHVFINSN-UHFFFAOYSA-N 1-(4-methoxyphenyl)-3-(2-methylphenyl)thiourea Chemical compound C1=CC(OC)=CC=C1NC(=S)NC1=CC=CC=C1C NERIXXGHVFINSN-UHFFFAOYSA-N 0.000 description 2
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Chemical compound C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 2
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- 206010034972 Photosensitivity reaction Diseases 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- HFVAFDPGUJEFBQ-UHFFFAOYSA-M alizarin red S Chemical compound [Na+].O=C1C2=CC=CC=C2C(=O)C2=C1C=C(S([O-])(=O)=O)C(O)=C2O HFVAFDPGUJEFBQ-UHFFFAOYSA-M 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 238000010411 cooking Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000005684 electric field Effects 0.000 description 2
- SEACYXSIPDVVMV-UHFFFAOYSA-L eosin Y Chemical compound [Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C1=C2C=C(Br)C(=O)C(Br)=C2OC2=C(Br)C([O-])=C(Br)C=C21 SEACYXSIPDVVMV-UHFFFAOYSA-L 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical group [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 229920001568 phenolic resin Polymers 0.000 description 2
- 229920006255 plastic film Polymers 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- GUEIZVNYDFNHJU-UHFFFAOYSA-N quinizarin Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(O)=CC=C2O GUEIZVNYDFNHJU-UHFFFAOYSA-N 0.000 description 2
- 229940043267 rhodamine b Drugs 0.000 description 2
- 229910052711 selenium Inorganic materials 0.000 description 2
- 239000011669 selenium Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- ANRHNWWPFJCPAZ-UHFFFAOYSA-M thionine Chemical compound [Cl-].C1=CC(N)=CC2=[S+]C3=CC(N)=CC=C3N=C21 ANRHNWWPFJCPAZ-UHFFFAOYSA-M 0.000 description 2
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- UPFRREZNWCUAHC-UHFFFAOYSA-N 1,2-bis(3-chlorophenyl)-2-hydroxyethanone Chemical compound C=1C=CC(Cl)=CC=1C(O)C(=O)C1=CC=CC(Cl)=C1 UPFRREZNWCUAHC-UHFFFAOYSA-N 0.000 description 1
- UCXPESOPEKJXJR-UHFFFAOYSA-N 1,2-bis(4-chlorophenyl)-2-hydroxyethanone Chemical compound C=1C=C(Cl)C=CC=1C(O)C(=O)C1=CC=C(Cl)C=C1 UCXPESOPEKJXJR-UHFFFAOYSA-N 0.000 description 1
- BFHFAXGAEDMUDI-UHFFFAOYSA-N 1,3-bis(3-bromophenyl)urea Chemical compound BrC1=CC=CC(NC(=O)NC=2C=C(Br)C=CC=2)=C1 BFHFAXGAEDMUDI-UHFFFAOYSA-N 0.000 description 1
- PRXHANOJNVGVGC-UHFFFAOYSA-N 1,3-bis(4-ethoxyphenyl)thiourea Chemical compound C1=CC(OCC)=CC=C1NC(=S)NC1=CC=C(OCC)C=C1 PRXHANOJNVGVGC-UHFFFAOYSA-N 0.000 description 1
- CPSIMDUNVYMPAH-UHFFFAOYSA-N 1,3-bis(4-methoxyphenyl)urea Chemical compound C1=CC(OC)=CC=C1NC(=O)NC1=CC=C(OC)C=C1 CPSIMDUNVYMPAH-UHFFFAOYSA-N 0.000 description 1
- ULNVBRUIKLYGDF-UHFFFAOYSA-N 1,3-bis(4-methylphenyl)thiourea Chemical compound C1=CC(C)=CC=C1NC(=S)NC1=CC=C(C)C=C1 ULNVBRUIKLYGDF-UHFFFAOYSA-N 0.000 description 1
- PZLTXMRUOFZLOW-UHFFFAOYSA-N 1,3-bis[4-(dimethylamino)phenyl]thiourea Chemical compound C1=CC(N(C)C)=CC=C1NC(=S)NC1=CC=C(N(C)C)C=C1 PZLTXMRUOFZLOW-UHFFFAOYSA-N 0.000 description 1
- GJXBIVMCTDXUKR-UHFFFAOYSA-N 1-(2-chlorophenyl)-3-phenylthiourea Chemical compound ClC1=CC=CC=C1NC(=S)NC1=CC=CC=C1 GJXBIVMCTDXUKR-UHFFFAOYSA-N 0.000 description 1
- JMMWMCXMSYXCNN-UHFFFAOYSA-N 1-(2-methylphenyl)-3-phenylthiourea Chemical compound CC1=CC=CC=C1NC(=S)NC1=CC=CC=C1 JMMWMCXMSYXCNN-UHFFFAOYSA-N 0.000 description 1
- YRBVLVKDMVTDDO-UHFFFAOYSA-N 1-(3-chlorophenyl)-3-phenylthiourea Chemical compound ClC1=CC=CC(NC(=S)NC=2C=CC=CC=2)=C1 YRBVLVKDMVTDDO-UHFFFAOYSA-N 0.000 description 1
- VMLPHEQOCFISCL-UHFFFAOYSA-N 1-(4,4-dichlorocyclohexa-1,5-dien-1-yl)-2-hydroxy-2-phenylethanone Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CCC(Cl)(Cl)C=C1 VMLPHEQOCFISCL-UHFFFAOYSA-N 0.000 description 1
- XYAKDKSYCSTBMN-UHFFFAOYSA-N 1-(4-chlorophenyl)-3-phenylthiourea Chemical compound C1=CC(Cl)=CC=C1NC(=S)NC1=CC=CC=C1 XYAKDKSYCSTBMN-UHFFFAOYSA-N 0.000 description 1
- NZPBFKQKPZEPED-UHFFFAOYSA-N 1-(4-methylphenyl)-3-phenylthiourea Chemical compound C1=CC(C)=CC=C1NC(=S)NC1=CC=CC=C1 NZPBFKQKPZEPED-UHFFFAOYSA-N 0.000 description 1
- PTEHQQNPWLKMEE-UHFFFAOYSA-N 1-acetyl-3-methyl-4,5-diphenylimidazol-2-one Chemical compound CN1C(=O)N(C(=O)C)C(C=2C=CC=CC=2)=C1C1=CC=CC=C1 PTEHQQNPWLKMEE-UHFFFAOYSA-N 0.000 description 1
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 1
- UIFVCPMLQXKEEU-UHFFFAOYSA-N 2,3-dimethylbenzaldehyde Chemical compound CC1=CC=CC(C=O)=C1C UIFVCPMLQXKEEU-UHFFFAOYSA-N 0.000 description 1
- IOOMXAQUNPWDLL-UHFFFAOYSA-N 2-[6-(diethylamino)-3-(diethyliminiumyl)-3h-xanthen-9-yl]-5-sulfobenzene-1-sulfonate Chemical compound C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=C(S(O)(=O)=O)C=C1S([O-])(=O)=O IOOMXAQUNPWDLL-UHFFFAOYSA-N 0.000 description 1
- XCDGQRLFOGCSAT-UHFFFAOYSA-N 2-amino-4-methylbenzaldehyde Chemical compound CC1=CC=C(C=O)C(N)=C1 XCDGQRLFOGCSAT-UHFFFAOYSA-N 0.000 description 1
- BBCPEGLUSZIVIY-UHFFFAOYSA-N 2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone Chemical compound C1=CC(OC)=CC=C1C(O)C(=O)C1=CC=C(OC)C=C1.C1=CC(OC)=CC=C1C(O)C(=O)C1=CC=C(OC)C=C1 BBCPEGLUSZIVIY-UHFFFAOYSA-N 0.000 description 1
- NBYSFWKNMLCZLO-UHFFFAOYSA-N 2-hydroxy-1,2-bis(4-methylphenyl)ethanone Chemical compound C1=CC(C)=CC=C1C(O)C(=O)C1=CC=C(C)C=C1 NBYSFWKNMLCZLO-UHFFFAOYSA-N 0.000 description 1
- ZNQCSLYENQIUMJ-UHFFFAOYSA-N 4,4'-dichlorocarbanilide Chemical compound C1=CC(Cl)=CC=C1NC(=O)NC1=CC=C(Cl)C=C1 ZNQCSLYENQIUMJ-UHFFFAOYSA-N 0.000 description 1
- FJKUOCCQEBLPNX-UHFFFAOYSA-N 8-hydroxyquinoline N-oxide Chemical compound C1=C[N+]([O-])=C2C(O)=CC=CC2=C1 FJKUOCCQEBLPNX-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- RGCKGOZRHPZPFP-UHFFFAOYSA-N Alizarin Natural products C1=CC=C2C(=O)C3=C(O)C(O)=CC=C3C(=O)C2=C1 RGCKGOZRHPZPFP-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- FCSHMCFRCYZTRQ-UHFFFAOYSA-N N,N'-diphenylthiourea Chemical compound C=1C=CC=CC=1NC(=S)NC1=CC=CC=C1 FCSHMCFRCYZTRQ-UHFFFAOYSA-N 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- 241000220317 Rosa Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical class C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- 208000000260 Warts Diseases 0.000 description 1
- JSQFXMIMWAKJQJ-UHFFFAOYSA-N [9-(2-carboxyphenyl)-6-(ethylamino)xanthen-3-ylidene]-diethylazanium;chloride Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(NCC)=CC=C2C=1C1=CC=CC=C1C(O)=O JSQFXMIMWAKJQJ-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000999 acridine dye Substances 0.000 description 1
- DPKHZNPWBDQZCN-UHFFFAOYSA-N acridine orange free base Chemical compound C1=CC(N(C)C)=CC2=NC3=CC(N(C)C)=CC=C3C=C21 DPKHZNPWBDQZCN-UHFFFAOYSA-N 0.000 description 1
- BGLGAKMTYHWWKW-UHFFFAOYSA-N acridine yellow Chemical compound [H+].[Cl-].CC1=C(N)C=C2N=C(C=C(C(C)=C3)N)C3=CC2=C1 BGLGAKMTYHWWKW-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 239000001001 arylmethane dye Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- DZBUGLKDJFMEHC-UHFFFAOYSA-N benzoquinolinylidene Natural products C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229960001506 brilliant green Drugs 0.000 description 1
- HXCILVUBKWANLN-UHFFFAOYSA-N brilliant green cation Chemical compound C1=CC(N(CC)CC)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](CC)CC)C=C1 HXCILVUBKWANLN-UHFFFAOYSA-N 0.000 description 1
- DBZJJPROPLPMSN-UHFFFAOYSA-N bromoeosin Chemical compound O1C(=O)C2=CC=CC=C2C21C1=CC(Br)=C(O)C(Br)=C1OC1=C(Br)C(O)=C(Br)C=C21 DBZJJPROPLPMSN-UHFFFAOYSA-N 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- VYXSBFYARXAAKO-WTKGSRSZSA-N chembl402140 Chemical compound Cl.C1=2C=C(C)C(NCC)=CC=2OC2=C\C(=N/CC)C(C)=CC2=C1C1=CC=CC=C1C(=O)OCC VYXSBFYARXAAKO-WTKGSRSZSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 229940127573 compound 38 Drugs 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- CEJANLKHJMMNQB-UHFFFAOYSA-M cryptocyanin Chemical compound [I-].C12=CC=CC=C2N(CC)C=CC1=CC=CC1=CC=[N+](CC)C2=CC=CC=C12 CEJANLKHJMMNQB-UHFFFAOYSA-M 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- JBBPTUVOZCXCSU-UHFFFAOYSA-L dipotassium;2',4',5',7'-tetrabromo-4,7-dichloro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3',6'-diolate Chemical compound [K+].[K+].O1C(=O)C(C(=CC=C2Cl)Cl)=C2C21C1=CC(Br)=C([O-])C(Br)=C1OC1=C(Br)C([O-])=C(Br)C=C21 JBBPTUVOZCXCSU-UHFFFAOYSA-L 0.000 description 1
- YQGOJNYOYNNSMM-UHFFFAOYSA-N eosin Chemical compound [Na+].OC(=O)C1=CC=CC=C1C1=C2C=C(Br)C(=O)C(Br)=C2OC2=C(Br)C(O)=C(Br)C=C21 YQGOJNYOYNNSMM-UHFFFAOYSA-N 0.000 description 1
- IINNWAYUJNWZRM-UHFFFAOYSA-L erythrosin B Chemical compound [Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C1=C2C=C(I)C(=O)C(I)=C2OC2=C(I)C([O-])=C(I)C=C21 IINNWAYUJNWZRM-UHFFFAOYSA-L 0.000 description 1
- 229940011411 erythrosine Drugs 0.000 description 1
- 235000012732 erythrosine Nutrition 0.000 description 1
- 239000004174 erythrosine Substances 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- GNBHRKFJIUUOQI-UHFFFAOYSA-N fluorescein Chemical compound O1C(=O)C2=CC=CC=C2C21C1=CC=C(O)C=C1OC1=CC(O)=CC=C21 GNBHRKFJIUUOQI-UHFFFAOYSA-N 0.000 description 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical class O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- NBGMRMDAEWWFIR-UHFFFAOYSA-N imidazole-2-thione Chemical compound S=C1N=CC=N1 NBGMRMDAEWWFIR-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 150000002689 maleic acids Chemical class 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- CXKWCBBOMKCUKX-UHFFFAOYSA-M methylene blue Chemical compound [Cl-].C1=CC(N(C)C)=CC2=[S+]C3=CC(N(C)C)=CC=C3N=C21 CXKWCBBOMKCUKX-UHFFFAOYSA-M 0.000 description 1
- 229960000907 methylthioninium chloride Drugs 0.000 description 1
- 239000008164 mustard oil Substances 0.000 description 1
- 239000005445 natural material Substances 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000000018 nitroso group Chemical group N(=O)* 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- PIDFDZJZLOTZTM-KHVQSSSXSA-N ombitasvir Chemical compound COC(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)NC1=CC=C([C@H]2N([C@@H](CC2)C=2C=CC(NC(=O)[C@H]3N(CCC3)C(=O)[C@@H](NC(=O)OC)C(C)C)=CC=2)C=2C=CC(=CC=2)C(C)(C)C)C=C1 PIDFDZJZLOTZTM-KHVQSSSXSA-N 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- ZRKUQAXOMUSPEH-UHFFFAOYSA-N p-methylaminobenzenecarboxaldehyde Natural products CNC1=CC=C(C=O)C=C1 ZRKUQAXOMUSPEH-UHFFFAOYSA-N 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 230000036211 photosensitivity Effects 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- QWYZFXLSWMXLDM-UHFFFAOYSA-M pinacyanol iodide Chemical compound [I-].C1=CC2=CC=CC=C2N(CC)C1=CC=CC1=CC=C(C=CC=C2)C2=[N+]1CC QWYZFXLSWMXLDM-UHFFFAOYSA-M 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 230000010076 replication Effects 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 201000010153 skin papilloma Diseases 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- AXMCIYLNKNGNOT-UHFFFAOYSA-M sodium;3-[[4-[(4-dimethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)-[4-[ethyl-[(3-sulfonatophenyl)methyl]amino]phenyl]methyl]-n-ethylanilino]methyl]benzenesulfonate Chemical compound [Na+].C=1C=C(C(=C2C=CC(C=C2)=[N+](C)C)C=2C=CC(=CC=2)N(CC)CC=2C=C(C=CC=2)S([O-])(=O)=O)C=CC=1N(CC)CC1=CC=CC(S([O-])(=O)=O)=C1 AXMCIYLNKNGNOT-UHFFFAOYSA-M 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000004528 spin coating Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- 239000001016 thiazine dye Substances 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 150000005691 triesters Chemical class 0.000 description 1
- LLWJPGAKXJBKKA-UHFFFAOYSA-N victoria blue B Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1C(C=1C=CC(=CC=1)N(C)C)=C(C=C1)C2=CC=CC=C2C1=[NH+]C1=CC=CC=C1 LLWJPGAKXJBKKA-UHFFFAOYSA-N 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0622—Heterocyclic compounds
- G03G5/0624—Heterocyclic compounds containing one hetero ring
- G03G5/0627—Heterocyclic compounds containing one hetero ring being five-membered
- G03G5/0631—Heterocyclic compounds containing one hetero ring being five-membered containing two hetero atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/70—One oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/84—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| LU35567D LU35567A1 (enExample) | 1956-11-21 | ||
| BE562426D BE562426A (enExample) | 1956-11-21 | ||
| NL222234D NL222234A (enExample) | 1956-11-21 | ||
| NL97724D NL97724C (enExample) | 1956-11-21 | ||
| DEK30376A DE1060713B (de) | 1956-11-21 | 1956-11-21 | Material fuer die elektrophotographische Reproduktion |
| CH5187857A CH362916A (de) | 1956-11-21 | 1957-10-23 | Material für elektrophotographische Reproduktion |
| GB35633/57A GB838245A (en) | 1956-11-21 | 1957-11-15 | Improvements in or relating to photographic reproduction |
| FR1188600D FR1188600A (fr) | 1956-11-21 | 1957-11-18 | Matériel pour la reproduction électrophotographique |
| US697533A US3097095A (en) | 1956-11-21 | 1957-11-20 | Material for electrophotographic reproduction |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK30376A DE1060713B (de) | 1956-11-21 | 1956-11-21 | Material fuer die elektrophotographische Reproduktion |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1060713B true DE1060713B (de) | 1959-07-02 |
Family
ID=7218816
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEK30376A Pending DE1060713B (de) | 1956-11-21 | 1956-11-21 | Material fuer die elektrophotographische Reproduktion |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3097095A (enExample) |
| BE (1) | BE562426A (enExample) |
| CH (1) | CH362916A (enExample) |
| DE (1) | DE1060713B (enExample) |
| FR (1) | FR1188600A (enExample) |
| GB (1) | GB838245A (enExample) |
| LU (1) | LU35567A1 (enExample) |
| NL (2) | NL222234A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3265497A (en) * | 1961-04-29 | 1966-08-09 | Renker Belipa G M B H Fa | Electrophotographic material |
| US3279918A (en) * | 1960-03-31 | 1966-10-18 | Gevaert Photo Prod Nv | Electrophotographic material |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL250328A (enExample) * | 1959-04-08 | |||
| NL250327A (enExample) * | 1959-04-08 | |||
| NL250330A (enExample) * | 1959-04-09 | |||
| NL250331A (enExample) * | 1959-04-09 | |||
| NL131029C (enExample) * | 1959-08-20 | |||
| BE591347A (enExample) * | 1959-10-31 | |||
| US3148982A (en) * | 1960-04-11 | 1964-09-15 | Gevaert Photo Prod Nv | Electrophotographic process utilizing organic photoconductors |
| NL273707A (enExample) * | 1961-01-28 | |||
| US3287117A (en) * | 1961-07-24 | 1966-11-22 | Azoplate Corp | Process for the sensitization of photoconductros |
| US3136776A (en) * | 1961-12-22 | 1964-06-09 | Monsanto Co | 4-methyl-imidazol-2-one |
| CA961506A (en) * | 1970-07-08 | 1975-01-21 | Ward H. Oliver | Process for the production of 4,4'-dibromobenzil |
| JPS57150853A (en) * | 1981-03-13 | 1982-09-17 | Konishiroku Photo Ind Co Ltd | Electrophotographic receptor |
| DE4107857A1 (de) * | 1991-03-12 | 1992-09-17 | Thomae Gmbh Dr K | Cyclische harnstoffderivate, diese verbindungen enthaltende arzneimittel und verfahren zu ihrer herstellung |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2297691A (en) * | 1939-04-04 | 1942-10-06 | Chester F Carlson | Electrophotography |
| FR1008598A (fr) * | 1948-04-30 | 1952-05-19 | Onera (Off Nat Aerospatiale) | Procédé pour l'enregistrement graphique ou l'inscription dirccte en matériaux pour la mise en oeuvre de ce procédé |
| US2663636A (en) * | 1949-05-25 | 1953-12-22 | Haloid Co | Electrophotographic plate and method of producing same |
| US2723197A (en) * | 1951-03-23 | 1955-11-08 | Gen Aniline & Film Corp | Silver halide emulsions for black and white prints containing brightening agents |
| US2709702A (en) * | 1951-10-12 | 1955-05-31 | Gen Aniline & Film Corp | Fluorescent agents |
| US2825814A (en) * | 1953-07-16 | 1958-03-04 | Haloid Co | Xerographic image formation |
| US2800559A (en) * | 1953-07-23 | 1957-07-23 | Nat Res Dev | Electrical semi-conductors comprising organo metallic compounds and process of producing same |
-
0
- NL NL97724D patent/NL97724C/xx active
- BE BE562426D patent/BE562426A/xx unknown
- NL NL222234D patent/NL222234A/xx unknown
- LU LU35567D patent/LU35567A1/xx unknown
-
1956
- 1956-11-21 DE DEK30376A patent/DE1060713B/de active Pending
-
1957
- 1957-10-23 CH CH5187857A patent/CH362916A/de unknown
- 1957-11-15 GB GB35633/57A patent/GB838245A/en not_active Expired
- 1957-11-18 FR FR1188600D patent/FR1188600A/fr not_active Expired
- 1957-11-20 US US697533A patent/US3097095A/en not_active Expired - Lifetime
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3279918A (en) * | 1960-03-31 | 1966-10-18 | Gevaert Photo Prod Nv | Electrophotographic material |
| US3265497A (en) * | 1961-04-29 | 1966-08-09 | Renker Belipa G M B H Fa | Electrophotographic material |
| DE1246407B (de) * | 1961-04-29 | 1967-08-03 | Renker Belipa G M B H | Photoleitfaehige Schicht |
Also Published As
| Publication number | Publication date |
|---|---|
| CH362916A (de) | 1962-06-30 |
| NL97724C (enExample) | |
| FR1188600A (fr) | 1959-09-23 |
| BE562426A (enExample) | |
| US3097095A (en) | 1963-07-09 |
| NL222234A (enExample) | |
| LU35567A1 (enExample) | |
| GB838245A (en) | 1960-06-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1060714B (de) | Material fuer elektrophotographische Reproduktion | |
| DE1060260B (de) | Material fuer elektrophotographische Reproduktion | |
| DE1058836B (de) | Material fuer elektrophotographische Reproduktion | |
| DE1120875B (de) | Material fuer elektrophotographische Reproduktion | |
| DE1105713B (de) | Material fuer elektrophotographische Reproduktion | |
| DE1068115B (enExample) | ||
| DE1137625B (de) | Material fuer die elektrophotographische Reproduktion | |
| DE1908343A1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE1060713B (de) | Material fuer die elektrophotographische Reproduktion | |
| DE1110518B (de) | Material fuer die elektrophotographische Bilderzeugung | |
| DE1908345A1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE1105714B (de) | Material fuer elektrophotographische Reproduktion | |
| DE1109032B (de) | Material fuer die elektrophotographische Bilderzeugung | |
| DE3513747A1 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE1116057B (de) | Material fuer elektrophotographische Reproduktion | |
| DE1147482B (de) | Photoleiterschichten fuer elektrophotographische Zwecke | |
| DE1797137C3 (enExample) | ||
| DE1814678A1 (de) | Neue Photoleiter mit kleinem Molekuel | |
| DE2726116C3 (de) | Elektrophotographische Druckform | |
| AT207247B (de) | Material für elektrophotographische Reproduktion | |
| DE1099846B (de) | Material fuer elektrophotographische Reproduktion | |
| DE1447008B2 (de) | Verfahren zur Herstellung einer Druckform. | |
| AT207248B (de) | Material für elektrophotographische Reproduktion | |
| AT216343B (de) | Material für elektrophotographische Reproduktion | |
| DE1193363B (de) | Photoleitfaehige Schicht fuer elektro-photographische Zwecke |