DE1034720B - Elektrisches Daempfungsglied fuer einen Hohlleiter - Google Patents
Elektrisches Daempfungsglied fuer einen HohlleiterInfo
- Publication number
- DE1034720B DE1034720B DEG16034A DEG0016034A DE1034720B DE 1034720 B DE1034720 B DE 1034720B DE G16034 A DEG16034 A DE G16034A DE G0016034 A DEG0016034 A DE G0016034A DE 1034720 B DE1034720 B DE 1034720B
- Authority
- DE
- Germany
- Prior art keywords
- waveguide
- organ
- per unit
- conductance
- resistive layer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000013016 damping Methods 0.000 title description 3
- 210000000056 organ Anatomy 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 5
- 239000011521 glass Substances 0.000 claims description 2
- 239000010445 mica Substances 0.000 claims description 2
- 229910052618 mica group Inorganic materials 0.000 claims description 2
- 239000000463 material Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910010293 ceramic material Inorganic materials 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 108010059642 isinglass Proteins 0.000 description 1
- 229910052627 muscovite Inorganic materials 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01P—WAVEGUIDES; RESONATORS, LINES, OR OTHER DEVICES OF THE WAVEGUIDE TYPE
- H01P1/00—Auxiliary devices
- H01P1/22—Attenuating devices
- H01P1/222—Waveguide attenuators
Landscapes
- Non-Reversible Transmitting Devices (AREA)
- Shielding Devices Or Components To Electric Or Magnetic Fields (AREA)
- Devices For Indicating Variable Information By Combining Individual Elements (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB35222/53A GB775452A (en) | 1953-12-17 | 1953-12-17 | Improvements in or relating to electrical attenuators |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1034720B true DE1034720B (de) | 1958-07-24 |
Family
ID=10375261
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG16034A Pending DE1034720B (de) | 1953-12-17 | 1954-12-17 | Elektrisches Daempfungsglied fuer einen Hohlleiter |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US2898561A (enExample) |
| BE (1) | BE534162A (enExample) |
| DE (1) | DE1034720B (enExample) |
| FR (1) | FR1116033A (enExample) |
| GB (1) | GB775452A (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3079551A (en) * | 1958-01-23 | 1963-02-26 | Beloit Iron Works | Apparatus and method for measurement of moisture content |
| US3034046A (en) * | 1959-10-12 | 1962-05-08 | Sasaki Shinichi | Automatic moisture content determination and control apparatus |
| US3887920A (en) * | 1961-03-16 | 1975-06-03 | Us Navy | Thin, lightweight electromagnetic wave absorber |
| US3487410A (en) * | 1968-01-08 | 1969-12-30 | North American Rockwell | Screening for engines |
| DE2918178A1 (de) * | 1979-05-05 | 1980-11-13 | Messerschmitt Boelkow Blohm | Verfahren und anordnung zur erkennung defekter spurgebundener objekte (fahrzeuge), die sich auf derselben bahn oder spur befinden |
| US4602229A (en) * | 1983-12-30 | 1986-07-22 | Motorola, Inc. | Resonant bandpass T filter and power splitter |
| US5325094A (en) * | 1986-11-25 | 1994-06-28 | Chomerics, Inc. | Electromagnetic energy absorbing structure |
| US5576710A (en) * | 1986-11-25 | 1996-11-19 | Chomerics, Inc. | Electromagnetic energy absorber |
| DE3853041T2 (de) * | 1987-05-04 | 1995-06-08 | At & T Corp | Absorbierendes mikrowellen-dämpfungsglied zur leistungsregelung eines linearen festkörperleistungsverstärkers. |
| US4868889A (en) * | 1987-05-04 | 1989-09-19 | American Telephone And Telegraph Company | Microwave absorber attenuator for linear SSPA power control |
| CN108592702A (zh) * | 2018-01-18 | 2018-09-28 | 陕西理工大学 | 一种消除棱边散射的装置及方法 |
| RU2713961C1 (ru) * | 2019-08-13 | 2020-02-11 | федеральное государственное бюджетное образовательное учреждение высшего образования "Уральский государственный педагогический университет" (УрГПУ) | Игрушка |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB617919A (en) * | 1945-07-04 | 1949-02-14 | Western Electric Co | An improved variable attenuator |
| GB645883A (en) * | 1946-11-02 | 1950-11-08 | Polytechnic Inst Brooklyn | Improvements in electric wave attenuators |
| FR1012670A (fr) * | 1950-01-27 | 1952-07-16 | Lignes Telegraph Telephon | Perfectionnements aux circuits affaiblisseurs à lames pour guides d'ondes |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2667622A (en) * | 1945-03-06 | 1954-01-26 | Polytechnic Inst Brooklyn | Coaxial cable attenuator matching device |
| US2705780A (en) * | 1946-11-02 | 1955-04-05 | Polytechnie Inst | Matched resistance film type wave guide attenuators |
| US2613251A (en) * | 1947-02-11 | 1952-10-07 | Polytechnic Inst Brooklyn | Resistance comparator |
| US2570814A (en) * | 1948-10-08 | 1951-10-09 | Wilbur A Joerndt | Wave guide attenuator |
| US2700749A (en) * | 1950-10-24 | 1955-01-25 | James R Bird | Resistor for high-frequency electrical transmission lines |
-
0
- BE BE534162D patent/BE534162A/xx unknown
-
1953
- 1953-12-17 GB GB35222/53A patent/GB775452A/en not_active Expired
-
1954
- 1954-12-14 US US475084A patent/US2898561A/en not_active Expired - Lifetime
- 1954-12-17 DE DEG16034A patent/DE1034720B/de active Pending
- 1954-12-17 FR FR1116033D patent/FR1116033A/fr not_active Expired
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB617919A (en) * | 1945-07-04 | 1949-02-14 | Western Electric Co | An improved variable attenuator |
| GB645883A (en) * | 1946-11-02 | 1950-11-08 | Polytechnic Inst Brooklyn | Improvements in electric wave attenuators |
| FR1012670A (fr) * | 1950-01-27 | 1952-07-16 | Lignes Telegraph Telephon | Perfectionnements aux circuits affaiblisseurs à lames pour guides d'ondes |
Also Published As
| Publication number | Publication date |
|---|---|
| GB775452A (en) | 1957-05-22 |
| BE534162A (enExample) | |
| FR1116033A (fr) | 1956-05-03 |
| US2898561A (en) | 1959-08-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1034720B (de) | Elektrisches Daempfungsglied fuer einen Hohlleiter | |
| WO2002037660A1 (de) | Betätigungselement und verfahren zu seiner herstellung | |
| DE1541944A1 (de) | Filter fuer Mikrowellen | |
| DE2800341A1 (de) | Elektrostatische anzeigezelle und damit ausgestattete anzeigevorrichtung | |
| DE836517C (de) | Hochfrequenzleiter | |
| DE2009119A1 (de) | Kontaktfedern fur die hochfrequenzdich te Verbindung verschraubter Schirmungs elemente | |
| DE2810813A1 (de) | Temperaturstabiles elektret-mikrofon | |
| DE102009011394A1 (de) | Wellenleiterstruktur | |
| DE684353C (de) | Schalteranordnung fuer Hochfrequenzgeraete, insbesondere zur Wellenbereichumschaltung | |
| DE2301451A1 (de) | Beruehrungsempfindliches signalgabebauelement | |
| DE1590413C3 (de) | Koaxiales Hochfrequenzkabel mit auf den Innenleiter aufgespritzten, scheibenförmigen, isolierenden Abstandhaltern zwischen dem Innenleiter und dem gewellten Außenleiter | |
| DE1280997B (de) | Absorber fuer elektromagnetische Wellen | |
| DE962181C (de) | Einrichtung zur Einstellung der Phasenlage einer elektromagnetischen Schwingung in einem Hohlleiter mit rechteckfoermigem Querschnitt | |
| DE3233621C1 (de) | Abschirmgehäuse mit einem aufsetzbaren Deckel und/oder aufsetzbaren Boden | |
| DE202008006222U1 (de) | Metamaterial | |
| DE1035224B (de) | Elektrisches Daempfungsglied | |
| DE1269698B (de) | Elektrische Klemmverbindung zwischen einem isolierten Draht und einem Anschlusselement | |
| DE1034721B (de) | Abgewinkelter, rechteckiger Hohlleiter | |
| DE1902293C3 (de) | Sekundärelektronenvervielfacher | |
| DE2447653A1 (de) | Formschaltung | |
| DE10061755C1 (de) | Anordnung zur Abschirmung elektromagnetischer Strahlung und Verfahren zur Herstellung einer Anordnung zur Abschirmung elektromagnetischer Strahlung | |
| DE959298C (de) | Elektronenroehre fuer sehr hohe Frequenzen nach Art einer Wanderfeldroehre | |
| DE2165756A1 (enExample) | ||
| DE4204641A1 (de) | Elektrischer kontakt fuer schaltgeraete | |
| DE1564118A1 (de) | Fokussierungsmagnet |