DD219477A5 - Verbessertes verfahren zur herstellung von estern der aryloxyphenoxy-propansaeure - Google Patents
Verbessertes verfahren zur herstellung von estern der aryloxyphenoxy-propansaeure Download PDFInfo
- Publication number
- DD219477A5 DD219477A5 DD84262952A DD26295284A DD219477A5 DD 219477 A5 DD219477 A5 DD 219477A5 DD 84262952 A DD84262952 A DD 84262952A DD 26295284 A DD26295284 A DD 26295284A DD 219477 A5 DD219477 A5 DD 219477A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- item
- reaction
- ppm
- reaction mixture
- aryloxyphenoxy
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 37
- 238000004519 manufacturing process Methods 0.000 title description 5
- 239000002253 acid Substances 0.000 title description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 title 2
- 239000001294 propane Substances 0.000 title 1
- 238000006243 chemical reaction Methods 0.000 claims abstract description 61
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 49
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims abstract description 14
- 230000000269 nucleophilic effect Effects 0.000 claims abstract description 9
- 238000011065 in-situ storage Methods 0.000 claims abstract description 5
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims description 16
- 150000002148 esters Chemical class 0.000 claims description 13
- 230000008569 process Effects 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 11
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 claims description 10
- 239000000376 reactant Substances 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 2
- 235000010354 butylated hydroxytoluene Nutrition 0.000 claims 1
- 239000013256 coordination polymer Substances 0.000 claims 1
- 230000000694 effects Effects 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 abstract description 48
- 230000015572 biosynthetic process Effects 0.000 abstract description 13
- 239000006227 byproduct Substances 0.000 abstract description 6
- 150000003151 propanoic acid esters Chemical class 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 48
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 34
- 239000000203 mixture Substances 0.000 description 27
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- -1 halogen propionate Chemical class 0.000 description 18
- QIGBRXMKCJKVMJ-UHFFFAOYSA-L benzene-1,4-diolate Chemical compound [O-]C1=CC=C([O-])C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-L 0.000 description 13
- 229940031826 phenolate Drugs 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 8
- 150000001502 aryl halides Chemical class 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 230000006872 improvement Effects 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- JLEJCNOTNLZCHQ-UHFFFAOYSA-N methyl 2-chloropropanoate Chemical compound COC(=O)C(C)Cl JLEJCNOTNLZCHQ-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- ABNQGNFVSFKJGI-UHFFFAOYSA-N 2,3-dichloro-5-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CN=C(Cl)C(Cl)=C1 ABNQGNFVSFKJGI-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 150000004703 alkoxides Chemical class 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- XWBHCJMXMDVYLP-UHFFFAOYSA-N 2-pyridin-2-yloxyphenol Chemical class OC1=CC=CC=C1OC1=CC=CC=N1 XWBHCJMXMDVYLP-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000000638 solvent extraction Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 229950011008 tetrachloroethylene Drugs 0.000 description 2
- IUSXXDHQFMPZQX-UHFFFAOYSA-N (2-hydroxyphenyl) prop-2-enoate Chemical class OC1=CC=CC=C1OC(=O)C=C IUSXXDHQFMPZQX-UHFFFAOYSA-N 0.000 description 1
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- XIFCGIKPAAZFFS-UHFFFAOYSA-N 2,3-difluoro-5-(trifluoromethyl)pyridine Chemical compound FC1=CC(C(F)(F)F)=CN=C1F XIFCGIKPAAZFFS-UHFFFAOYSA-N 0.000 description 1
- MZODOBBOQXPSNU-UHFFFAOYSA-N 2-(1,3-benzothiazol-2-yloxy)phenol Chemical class OC1=CC=CC=C1OC1=NC2=CC=CC=C2S1 MZODOBBOQXPSNU-UHFFFAOYSA-N 0.000 description 1
- BRTBEJXASJPQAO-UHFFFAOYSA-N 2-(1,3-benzoxazol-2-yloxy)phenol Chemical class OC1=CC=CC=C1OC1=NC2=CC=CC=C2O1 BRTBEJXASJPQAO-UHFFFAOYSA-N 0.000 description 1
- GOCUAJYOYBLQRH-UHFFFAOYSA-N 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl GOCUAJYOYBLQRH-UHFFFAOYSA-N 0.000 description 1
- YUVKUEAFAVKILW-UHFFFAOYSA-N 2-(4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 YUVKUEAFAVKILW-UHFFFAOYSA-N 0.000 description 1
- SXERGJJQSKIUIC-UHFFFAOYSA-N 2-Phenoxypropionic acid Chemical compound OC(=O)C(C)OC1=CC=CC=C1 SXERGJJQSKIUIC-UHFFFAOYSA-N 0.000 description 1
- BDBJONVXJIXDSV-UHFFFAOYSA-N 2-[4-[3-fluoro-5-(trifluoromethyl)pyridin-2-yl]oxyphenoxy]propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=NC=C(C(F)(F)F)C=C1F BDBJONVXJIXDSV-UHFFFAOYSA-N 0.000 description 1
- JFZJMSDDOOAOIV-UHFFFAOYSA-N 2-chloro-5-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CC=C(Cl)N=C1 JFZJMSDDOOAOIV-UHFFFAOYSA-N 0.000 description 1
- OPWVAHVZIOIFQE-UHFFFAOYSA-N 2-ethoxyethyl 2-chloropropanoate Chemical compound CCOCCOC(=O)C(C)Cl OPWVAHVZIOIFQE-UHFFFAOYSA-N 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- KDTZBYPBMTXCSO-UHFFFAOYSA-N 2-phenoxyphenol Chemical class OC1=CC=CC=C1OC1=CC=CC=C1 KDTZBYPBMTXCSO-UHFFFAOYSA-N 0.000 description 1
- DHPRDYAOEQALLA-UHFFFAOYSA-N 2-quinolin-2-yloxyphenol Chemical class OC1=CC=CC=C1OC1=CC=C(C=CC=C2)C2=N1 DHPRDYAOEQALLA-UHFFFAOYSA-N 0.000 description 1
- CGUXGNBXUPVTPJ-UHFFFAOYSA-N 2-quinoxalin-2-yloxyphenol Chemical class OC1=CC=CC=C1OC1=CN=C(C=CC=C2)C2=N1 CGUXGNBXUPVTPJ-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical class C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KATNUXHENWPMQJ-UHFFFAOYSA-N butyl 2-chloropropanoate Chemical compound CCCCOC(=O)C(C)Cl KATNUXHENWPMQJ-UHFFFAOYSA-N 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- MFSWTRQUCLNFOM-UHFFFAOYSA-N methyl 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate Chemical compound C1=CC(OC(C)C(=O)OC)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl MFSWTRQUCLNFOM-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- AJFDBNQQDYLMJN-UHFFFAOYSA-N n,n-diethylacetamide Chemical compound CCN(CC)C(C)=O AJFDBNQQDYLMJN-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
- C07D213/643—2-Phenoxypyridines; Derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US49419683A | 1983-05-13 | 1983-05-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD219477A5 true DD219477A5 (de) | 1985-03-06 |
Family
ID=23963454
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD84262952A DD219477A5 (de) | 1983-05-13 | 1984-05-11 | Verbessertes verfahren zur herstellung von estern der aryloxyphenoxy-propansaeure |
Country Status (21)
| Country | Link |
|---|---|
| EP (1) | EP0128658B1 (enExample) |
| JP (1) | JPS59212473A (enExample) |
| KR (1) | KR900006684B1 (enExample) |
| AT (1) | ATE27814T1 (enExample) |
| AU (1) | AU561708B2 (enExample) |
| BR (1) | BR8402253A (enExample) |
| CA (1) | CA1217192A (enExample) |
| CS (1) | CS254974B2 (enExample) |
| DD (1) | DD219477A5 (enExample) |
| DE (1) | DE3464246D1 (enExample) |
| DK (1) | DK163503C (enExample) |
| ES (1) | ES8606239A1 (enExample) |
| HU (1) | HU189891B (enExample) |
| IL (1) | IL71668A (enExample) |
| NZ (1) | NZ208000A (enExample) |
| PL (1) | PL143532B1 (enExample) |
| PT (1) | PT78576A (enExample) |
| RO (1) | RO89262A (enExample) |
| SU (1) | SU1373319A3 (enExample) |
| YU (1) | YU83084A (enExample) |
| ZA (1) | ZA843493B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0259995A1 (en) * | 1986-09-09 | 1988-03-16 | Imperial Chemical Industries Plc | Liquid crystal material |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3678485D1 (de) * | 1985-04-01 | 1991-05-08 | Ciba Geigy Ag | 3-fluorpyridyl-2-oxy-phenoxy-derivate mit herbizider wirkung. |
| FR2598146B1 (fr) * | 1986-04-30 | 1989-01-20 | Rech Ind | Nouveau procede de preparation de fibrates. |
| RU2152931C2 (ru) * | 1995-06-06 | 2000-07-20 | Пфайзер Инк. | Способ получения производных 2-арилокси-4-хлорпиридина |
| AU719087B2 (en) * | 1998-03-24 | 2000-05-04 | Syngenta Participations Ag | Process for preparation of propionic acid derivatives |
| US6426429B1 (en) * | 2000-08-11 | 2002-07-30 | General Electric Company | Process for the preparation of hindered phosphites |
| CN116535351A (zh) * | 2023-05-04 | 2023-08-04 | 江苏瑞恒新材料科技有限公司 | 一种合成高效盖草能的方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK154074C (da) * | 1974-10-17 | 1989-02-27 | Ishihara Sangyo Kaisha | Alfa-(4-(5 eller 3,5 substitueret pyridyl-2-oxy)-phenoxy)-alkan-carboxylsyrer eller derivater deraf til anvendelse som herbicider, herbicidt middel samt fremgangsmaader til bekaempelse af ukrudt |
| TR19824A (tr) * | 1977-07-21 | 1980-01-24 | Ishihara Sangyo Kaisha | Trilorometilpiridoksifenoksipropionik as tuerevleri ve bunlari ihtiva eden herbisidler |
| JPS5461182A (en) * | 1977-10-20 | 1979-05-17 | Ishihara Sangyo Kaisha Ltd | 2-phenoxy-5-trifluoromethylpyridine compounds |
| US4325729A (en) * | 1977-12-13 | 1982-04-20 | Ciba-Geigy Corporation | Herbicidal and plant growth regulating pyridyloxy-phenoxy-propionic acid derivatives |
| AU547854B2 (en) * | 1981-06-01 | 1985-11-07 | Dow Chemical Company, The | Preparation of pyridyloxyphenol compounds |
-
1984
- 1984-04-27 IL IL71668A patent/IL71668A/xx not_active IP Right Cessation
- 1984-04-30 NZ NZ208000A patent/NZ208000A/en unknown
- 1984-05-01 CA CA000453207A patent/CA1217192A/en not_active Expired
- 1984-05-04 DE DE8484303020T patent/DE3464246D1/de not_active Expired
- 1984-05-04 AT AT84303020T patent/ATE27814T1/de not_active IP Right Cessation
- 1984-05-04 EP EP84303020A patent/EP0128658B1/en not_active Expired
- 1984-05-08 AU AU27794/84A patent/AU561708B2/en not_active Ceased
- 1984-05-09 ZA ZA843493A patent/ZA843493B/xx unknown
- 1984-05-10 RO RO84114510A patent/RO89262A/ro unknown
- 1984-05-11 DD DD84262952A patent/DD219477A5/de unknown
- 1984-05-11 YU YU00830/84A patent/YU83084A/xx unknown
- 1984-05-11 SU SU843739180A patent/SU1373319A3/ru active
- 1984-05-11 PT PT78576A patent/PT78576A/pt not_active IP Right Cessation
- 1984-05-11 ES ES532444A patent/ES8606239A1/es not_active Expired
- 1984-05-11 PL PL1984247642A patent/PL143532B1/pl unknown
- 1984-05-11 DK DK236684A patent/DK163503C/da not_active IP Right Cessation
- 1984-05-11 HU HU841841A patent/HU189891B/hu not_active IP Right Cessation
- 1984-05-11 JP JP59094409A patent/JPS59212473A/ja active Granted
- 1984-05-12 KR KR1019840002562A patent/KR900006684B1/ko not_active Expired
- 1984-05-14 CS CS843566A patent/CS254974B2/cs unknown
- 1984-11-13 BR BR8402253A patent/BR8402253A/pt not_active IP Right Cessation
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0259995A1 (en) * | 1986-09-09 | 1988-03-16 | Imperial Chemical Industries Plc | Liquid crystal material |
| US4906402A (en) * | 1986-09-09 | 1990-03-06 | Imperial Chemical Industries, Plc | Liquid crystal material |
Also Published As
| Publication number | Publication date |
|---|---|
| ATE27814T1 (de) | 1987-07-15 |
| ES532444A0 (es) | 1985-11-01 |
| CS254974B2 (en) | 1988-02-15 |
| AU561708B2 (en) | 1987-05-14 |
| HUT34429A (en) | 1985-03-28 |
| NZ208000A (en) | 1987-11-27 |
| KR840009297A (ko) | 1984-12-26 |
| BR8402253A (pt) | 1984-12-18 |
| SU1373319A3 (ru) | 1988-02-07 |
| CA1217192A (en) | 1987-01-27 |
| PL143532B1 (en) | 1988-02-29 |
| EP0128658B1 (en) | 1987-06-16 |
| PT78576A (en) | 1984-06-01 |
| DK236684D0 (da) | 1984-05-11 |
| JPS59212473A (ja) | 1984-12-01 |
| IL71668A0 (en) | 1984-07-31 |
| CS356684A2 (en) | 1987-07-16 |
| JPH0475229B2 (enExample) | 1992-11-30 |
| HU189891B (en) | 1986-08-28 |
| ES8606239A1 (es) | 1985-11-01 |
| PL247642A1 (en) | 1985-03-26 |
| AU2779484A (en) | 1984-11-15 |
| IL71668A (en) | 1988-07-31 |
| YU83084A (en) | 1986-10-31 |
| ZA843493B (en) | 1985-12-24 |
| EP0128658A1 (en) | 1984-12-19 |
| DK163503C (da) | 1992-07-27 |
| DE3464246D1 (en) | 1987-07-23 |
| RO89262A (ro) | 1986-03-15 |
| DK236684A (da) | 1984-11-14 |
| DK163503B (da) | 1992-03-09 |
| KR900006684B1 (ko) | 1990-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69333037T2 (de) | Verfahren zur Herstellung von Beta-Diketonen | |
| DE69813312T2 (de) | Verfahren zur herstellung von cyclopropylethyn sowie zwischenprodukte zur herstellung von cyclopropylethyn | |
| DE2908804A1 (de) | Verfahren zum synthetisieren von p-nitrodiphenylaminen | |
| EP0025843A1 (de) | Herstellung von Monoalkylethern von Hydroxyphenolen und deren Umwandlung zu Hydroxycumaranen | |
| DD219477A5 (de) | Verbessertes verfahren zur herstellung von estern der aryloxyphenoxy-propansaeure | |
| DE2344926C3 (de) | Verfahren zur Herstellung von 3-Halogen- bzw. 3,5-Dihalogen-phenolen | |
| DE2734667A1 (de) | Derivate von phenoxyalkansaeuren, verfahren zu ihrer herstellung und ihre verwendung als herbicide | |
| DE2725255A1 (de) | Verfahren zur herstellung von dimethylaminoaethylmethacrylat | |
| DE2356702C2 (de) | Verfahren zur Herstellung von trans- Chrysanthemummonocarbonsäure durch Hydrolyse eines cis/trans Gemisches aus Chrysanthemummonocarbonsäure-C↓1↓-C↓8↓-alkylestern | |
| EP0105494A2 (de) | Verfahren zur Herstellung von Benzthiazolyloxyphenoxypropionsäurederivaten | |
| DE69108125T2 (de) | Verfahren zur Herstellung von arylsubstituierten Propionsäureestern. | |
| DE2946024A1 (de) | Verfahren zur herstellung von phenoxyalkenderivaten | |
| DE69404898T2 (de) | Verfahren zur Herstellung von 2-Chloro-Pyridinmethanol | |
| EP0987249B1 (de) | Verfahren zur Herstellung von Benzylcarbazaten | |
| EP0061629B1 (de) | Verfahren zur Herstellung von substituierter alpha-Halogenpropionsäure und ihren Derivaten; substituiertes Vinylidenchlorid | |
| DE2345360A1 (de) | Verfahren zur herstellung von transchrysanthemummonocarbonsaeure und deren alkylestern | |
| EP0023647B1 (de) | Verfahren zur Herstellung von halogenierten Benzoylfluoriden | |
| DE2735057A1 (de) | Verfahren zur herstellung von triorganozinnhalogeniden | |
| US4681941A (en) | Method of preparing esters of aryloxyphenoxy propanoic acid | |
| DE2345788A1 (de) | Verfahren zur herstellung eines alkylhalogennitrobenzoats in verbesserter ausbeute | |
| DE1935725C3 (de) | Verfahren zur Herstellung von Chlorphenylestern | |
| DE1961623C (de) | 2 (2 Butinyloxy) phenol | |
| DE2636384A1 (de) | Verfahren zur herstellung von n,n-diaethyl-2-(alpha-naphthoxy)-propionamid | |
| DE2619321C2 (de) | Oxalsäurederivate, ihre Herstellung und ihre Verwendung | |
| EP0591799B1 (de) | Oxidation von Hydroxybenzaldehyden zur Herstellung von Dihydroxybenzol Verbindungen |