CS254974B2 - Method of aryloxyphenoxy propionic acid's esters production - Google Patents
Method of aryloxyphenoxy propionic acid's esters production Download PDFInfo
- Publication number
- CS254974B2 CS254974B2 CS843566A CS356684A CS254974B2 CS 254974 B2 CS254974 B2 CS 254974B2 CS 843566 A CS843566 A CS 843566A CS 356684 A CS356684 A CS 356684A CS 254974 B2 CS254974 B2 CS 254974B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- reaction mixture
- mol
- temperature
- mixture
- trifluoromethyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 35
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical class O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 title claims description 6
- 238000004519 manufacturing process Methods 0.000 title description 7
- 239000011541 reaction mixture Substances 0.000 claims abstract description 64
- 238000006243 chemical reaction Methods 0.000 claims abstract description 59
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 56
- 230000015572 biosynthetic process Effects 0.000 claims abstract description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 48
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 39
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 35
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 25
- 238000004821 distillation Methods 0.000 claims description 24
- 239000000203 mixture Substances 0.000 claims description 20
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims description 16
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 claims description 15
- 150000002148 esters Chemical class 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 14
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 11
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 8
- -1 2-pyridinyl Chemical group 0.000 claims description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 7
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 claims description 7
- 229940031826 phenolate Drugs 0.000 claims description 7
- NLZUEZXRPGMBCV-UHFFFAOYSA-N Butylhydroxytoluene Chemical compound CC1=CC(C(C)(C)C)=C(O)C(C(C)(C)C)=C1 NLZUEZXRPGMBCV-UHFFFAOYSA-N 0.000 claims description 6
- 235000010354 butylated hydroxytoluene Nutrition 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 239000000047 product Substances 0.000 claims description 6
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 5
- 238000001816 cooling Methods 0.000 claims description 5
- 239000012299 nitrogen atmosphere Substances 0.000 claims description 5
- 235000019260 propionic acid Nutrition 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 239000007858 starting material Substances 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- 150000004702 methyl esters Chemical class 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 238000000746 purification Methods 0.000 claims description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims 11
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims 9
- ABNQGNFVSFKJGI-UHFFFAOYSA-N 2,3-dichloro-5-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CN=C(Cl)C(Cl)=C1 ABNQGNFVSFKJGI-UHFFFAOYSA-N 0.000 claims 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims 6
- 229910052757 nitrogen Inorganic materials 0.000 claims 6
- 239000010410 layer Substances 0.000 claims 5
- JLEJCNOTNLZCHQ-UHFFFAOYSA-N methyl 2-chloropropanoate Chemical compound COC(=O)C(C)Cl JLEJCNOTNLZCHQ-UHFFFAOYSA-N 0.000 claims 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims 4
- 238000004458 analytical method Methods 0.000 claims 4
- 238000003756 stirring Methods 0.000 claims 4
- 239000000839 emulsion Substances 0.000 claims 3
- 239000012044 organic layer Substances 0.000 claims 3
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 claims 2
- 229910052799 carbon Inorganic materials 0.000 claims 2
- 238000010438 heat treatment Methods 0.000 claims 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims 2
- 239000002904 solvent Substances 0.000 claims 2
- 238000000638 solvent extraction Methods 0.000 claims 2
- 229950011008 tetrachloroethylene Drugs 0.000 claims 2
- JFZJMSDDOOAOIV-UHFFFAOYSA-N 2-chloro-5-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CC=C(Cl)N=C1 JFZJMSDDOOAOIV-UHFFFAOYSA-N 0.000 claims 1
- GAWAYYRQGQZKCR-UHFFFAOYSA-N 2-chloropropionic acid Chemical compound CC(Cl)C(O)=O GAWAYYRQGQZKCR-UHFFFAOYSA-N 0.000 claims 1
- OPWVAHVZIOIFQE-UHFFFAOYSA-N 2-ethoxyethyl 2-chloropropanoate Chemical compound CCOCCOC(=O)C(C)Cl OPWVAHVZIOIFQE-UHFFFAOYSA-N 0.000 claims 1
- MTJGVAJYTOXFJH-UHFFFAOYSA-N 3-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 MTJGVAJYTOXFJH-UHFFFAOYSA-N 0.000 claims 1
- 238000001159 Fisher's combined probability test Methods 0.000 claims 1
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 claims 1
- KATNUXHENWPMQJ-UHFFFAOYSA-N butyl 2-chloropropanoate Chemical compound CCCCOC(=O)C(C)Cl KATNUXHENWPMQJ-UHFFFAOYSA-N 0.000 claims 1
- 239000012043 crude product Substances 0.000 claims 1
- 238000001514 detection method Methods 0.000 claims 1
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 claims 1
- 238000000605 extraction Methods 0.000 claims 1
- 239000000706 filtrate Substances 0.000 claims 1
- 238000007710 freezing Methods 0.000 claims 1
- 230000008014 freezing Effects 0.000 claims 1
- 238000004128 high performance liquid chromatography Methods 0.000 claims 1
- KIBRBMKSBVQDMK-UHFFFAOYSA-N methyl 2-phenoxypropanoate Chemical compound COC(=O)C(C)OC1=CC=CC=C1 KIBRBMKSBVQDMK-UHFFFAOYSA-N 0.000 claims 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims 1
- 239000012074 organic phase Substances 0.000 claims 1
- 239000008188 pellet Substances 0.000 claims 1
- 239000002244 precipitate Substances 0.000 claims 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 abstract description 12
- 239000006227 byproduct Substances 0.000 abstract description 8
- 230000000269 nucleophilic effect Effects 0.000 abstract description 7
- 238000011065 in-situ storage Methods 0.000 abstract description 4
- 150000003151 propanoic acid esters Chemical class 0.000 abstract description 3
- QIGBRXMKCJKVMJ-UHFFFAOYSA-L benzene-1,4-diolate Chemical compound [O-]C1=CC=C([O-])C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-L 0.000 description 11
- 150000004703 alkoxides Chemical class 0.000 description 10
- 150000001502 aryl halides Chemical class 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- 239000000376 reactant Substances 0.000 description 7
- 238000007086 side reaction Methods 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- XWBHCJMXMDVYLP-UHFFFAOYSA-N 2-pyridin-2-yloxyphenol Chemical compound OC1=CC=CC=C1OC1=CC=CC=N1 XWBHCJMXMDVYLP-UHFFFAOYSA-N 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 2
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- MZODOBBOQXPSNU-UHFFFAOYSA-N 2-(1,3-benzothiazol-2-yloxy)phenol Chemical class OC1=CC=CC=C1OC1=NC2=CC=CC=C2S1 MZODOBBOQXPSNU-UHFFFAOYSA-N 0.000 description 1
- BRTBEJXASJPQAO-UHFFFAOYSA-N 2-(1,3-benzoxazol-2-yloxy)phenol Chemical class OC1=CC=CC=C1OC1=NC2=CC=CC=C2O1 BRTBEJXASJPQAO-UHFFFAOYSA-N 0.000 description 1
- GOCUAJYOYBLQRH-UHFFFAOYSA-N 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl GOCUAJYOYBLQRH-UHFFFAOYSA-N 0.000 description 1
- KDTZBYPBMTXCSO-UHFFFAOYSA-N 2-phenoxyphenol Chemical class OC1=CC=CC=C1OC1=CC=CC=C1 KDTZBYPBMTXCSO-UHFFFAOYSA-N 0.000 description 1
- DHPRDYAOEQALLA-UHFFFAOYSA-N 2-quinolin-2-yloxyphenol Chemical class OC1=CC=CC=C1OC1=CC=C(C=CC=C2)C2=N1 DHPRDYAOEQALLA-UHFFFAOYSA-N 0.000 description 1
- CGUXGNBXUPVTPJ-UHFFFAOYSA-N 2-quinoxalin-2-yloxyphenol Chemical class OC1=CC=CC=C1OC1=CN=C(C=CC=C2)C2=N1 CGUXGNBXUPVTPJ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 1
- AJFDBNQQDYLMJN-UHFFFAOYSA-N n,n-diethylacetamide Chemical compound CCN(CC)C(C)=O AJFDBNQQDYLMJN-UHFFFAOYSA-N 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- CUQOHAYJWVTKDE-UHFFFAOYSA-N potassium;butan-1-olate Chemical compound [K+].CCCC[O-] CUQOHAYJWVTKDE-UHFFFAOYSA-N 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000002910 solid waste Substances 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/64—One oxygen atom attached in position 2 or 6
- C07D213/643—2-Phenoxypyridines; Derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US49419683A | 1983-05-13 | 1983-05-13 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CS356684A2 CS356684A2 (en) | 1987-07-16 |
| CS254974B2 true CS254974B2 (en) | 1988-02-15 |
Family
ID=23963454
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS843566A CS254974B2 (en) | 1983-05-13 | 1984-05-14 | Method of aryloxyphenoxy propionic acid's esters production |
Country Status (21)
| Country | Link |
|---|---|
| EP (1) | EP0128658B1 (enExample) |
| JP (1) | JPS59212473A (enExample) |
| KR (1) | KR900006684B1 (enExample) |
| AT (1) | ATE27814T1 (enExample) |
| AU (1) | AU561708B2 (enExample) |
| BR (1) | BR8402253A (enExample) |
| CA (1) | CA1217192A (enExample) |
| CS (1) | CS254974B2 (enExample) |
| DD (1) | DD219477A5 (enExample) |
| DE (1) | DE3464246D1 (enExample) |
| DK (1) | DK163503C (enExample) |
| ES (1) | ES8606239A1 (enExample) |
| HU (1) | HU189891B (enExample) |
| IL (1) | IL71668A (enExample) |
| NZ (1) | NZ208000A (enExample) |
| PL (1) | PL143532B1 (enExample) |
| PT (1) | PT78576A (enExample) |
| RO (1) | RO89262A (enExample) |
| SU (1) | SU1373319A3 (enExample) |
| YU (1) | YU83084A (enExample) |
| ZA (1) | ZA843493B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3678485D1 (de) * | 1985-04-01 | 1991-05-08 | Ciba Geigy Ag | 3-fluorpyridyl-2-oxy-phenoxy-derivate mit herbizider wirkung. |
| FR2598146B1 (fr) * | 1986-04-30 | 1989-01-20 | Rech Ind | Nouveau procede de preparation de fibrates. |
| GB8621689D0 (en) * | 1986-09-09 | 1986-10-15 | Ici Plc | Liquid crystal material |
| RU2152931C2 (ru) * | 1995-06-06 | 2000-07-20 | Пфайзер Инк. | Способ получения производных 2-арилокси-4-хлорпиридина |
| AU719087B2 (en) * | 1998-03-24 | 2000-05-04 | Syngenta Participations Ag | Process for preparation of propionic acid derivatives |
| US6426429B1 (en) * | 2000-08-11 | 2002-07-30 | General Electric Company | Process for the preparation of hindered phosphites |
| CN116535351A (zh) * | 2023-05-04 | 2023-08-04 | 江苏瑞恒新材料科技有限公司 | 一种合成高效盖草能的方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK154074C (da) * | 1974-10-17 | 1989-02-27 | Ishihara Sangyo Kaisha | Alfa-(4-(5 eller 3,5 substitueret pyridyl-2-oxy)-phenoxy)-alkan-carboxylsyrer eller derivater deraf til anvendelse som herbicider, herbicidt middel samt fremgangsmaader til bekaempelse af ukrudt |
| TR19824A (tr) * | 1977-07-21 | 1980-01-24 | Ishihara Sangyo Kaisha | Trilorometilpiridoksifenoksipropionik as tuerevleri ve bunlari ihtiva eden herbisidler |
| JPS5461182A (en) * | 1977-10-20 | 1979-05-17 | Ishihara Sangyo Kaisha Ltd | 2-phenoxy-5-trifluoromethylpyridine compounds |
| US4325729A (en) * | 1977-12-13 | 1982-04-20 | Ciba-Geigy Corporation | Herbicidal and plant growth regulating pyridyloxy-phenoxy-propionic acid derivatives |
| IL65708A (en) * | 1981-06-01 | 1986-01-31 | Dow Chemical Co | Process for making pyridyloxyphenol compounds |
-
1984
- 1984-04-27 IL IL71668A patent/IL71668A/xx not_active IP Right Cessation
- 1984-04-30 NZ NZ208000A patent/NZ208000A/en unknown
- 1984-05-01 CA CA000453207A patent/CA1217192A/en not_active Expired
- 1984-05-04 EP EP84303020A patent/EP0128658B1/en not_active Expired
- 1984-05-04 AT AT84303020T patent/ATE27814T1/de not_active IP Right Cessation
- 1984-05-04 DE DE8484303020T patent/DE3464246D1/de not_active Expired
- 1984-05-08 AU AU27794/84A patent/AU561708B2/en not_active Ceased
- 1984-05-09 ZA ZA843493A patent/ZA843493B/xx unknown
- 1984-05-10 RO RO84114510A patent/RO89262A/ro unknown
- 1984-05-11 DK DK236684A patent/DK163503C/da not_active IP Right Cessation
- 1984-05-11 SU SU843739180A patent/SU1373319A3/ru active
- 1984-05-11 PL PL1984247642A patent/PL143532B1/pl unknown
- 1984-05-11 YU YU00830/84A patent/YU83084A/xx unknown
- 1984-05-11 ES ES532444A patent/ES8606239A1/es not_active Expired
- 1984-05-11 DD DD84262952A patent/DD219477A5/de unknown
- 1984-05-11 HU HU841841A patent/HU189891B/hu not_active IP Right Cessation
- 1984-05-11 JP JP59094409A patent/JPS59212473A/ja active Granted
- 1984-05-11 PT PT78576A patent/PT78576A/pt not_active IP Right Cessation
- 1984-05-12 KR KR1019840002562A patent/KR900006684B1/ko not_active Expired
- 1984-05-14 CS CS843566A patent/CS254974B2/cs unknown
- 1984-11-13 BR BR8402253A patent/BR8402253A/pt not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ES532444A0 (es) | 1985-11-01 |
| DK236684D0 (da) | 1984-05-11 |
| KR900006684B1 (ko) | 1990-09-17 |
| PL143532B1 (en) | 1988-02-29 |
| SU1373319A3 (ru) | 1988-02-07 |
| KR840009297A (ko) | 1984-12-26 |
| YU83084A (en) | 1986-10-31 |
| DK236684A (da) | 1984-11-14 |
| AU2779484A (en) | 1984-11-15 |
| BR8402253A (pt) | 1984-12-18 |
| HUT34429A (en) | 1985-03-28 |
| DK163503B (da) | 1992-03-09 |
| JPH0475229B2 (enExample) | 1992-11-30 |
| ES8606239A1 (es) | 1985-11-01 |
| ATE27814T1 (de) | 1987-07-15 |
| RO89262A (ro) | 1986-03-15 |
| NZ208000A (en) | 1987-11-27 |
| DE3464246D1 (en) | 1987-07-23 |
| PT78576A (en) | 1984-06-01 |
| ZA843493B (en) | 1985-12-24 |
| HU189891B (en) | 1986-08-28 |
| IL71668A0 (en) | 1984-07-31 |
| DK163503C (da) | 1992-07-27 |
| PL247642A1 (en) | 1985-03-26 |
| CS356684A2 (en) | 1987-07-16 |
| AU561708B2 (en) | 1987-05-14 |
| IL71668A (en) | 1988-07-31 |
| JPS59212473A (ja) | 1984-12-01 |
| EP0128658A1 (en) | 1984-12-19 |
| DD219477A5 (de) | 1985-03-06 |
| EP0128658B1 (en) | 1987-06-16 |
| CA1217192A (en) | 1987-01-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP2667714B9 (en) | Process for the preparation of 4-amino-5-fluoro-3-halo-6-(substituted)picolinates | |
| EP0465665B1 (en) | Process for producing diphenyl sulfone compound | |
| AU2009315580A1 (en) | Process for manufacturing substituted 3-pyridylmethyl ammonium bromides | |
| US4480102A (en) | 2,3-Difluoro-5-(trifluoromethyl)pyridine and methods of making and using the same | |
| CS254974B2 (en) | Method of aryloxyphenoxy propionic acid's esters production | |
| FI97132B (fi) | Parannettu menetelmä 3,5,6-triklooripyridiini-2-olin valmistamiseksi | |
| US4766220A (en) | Process for the preparation of optically active aryloxyalkanoic acid compounds | |
| US4681941A (en) | Method of preparing esters of aryloxyphenoxy propanoic acid | |
| CA1210408A (en) | Process for producing 2-(4-hydroxyphenoxy) propionate derivatives | |
| US4990620A (en) | Halogen substituted pyridylalkyl ketones | |
| JPH0770037A (ja) | シアノアシルシクロプロパン化合物の製造方法とそれに用いる2−シアノアシル−4−ブタノリド化合物 | |
| US5258521A (en) | Process of producing optically active propionic acid ester derivatives | |
| US4625035A (en) | 2,3-difluoro-5-(trifluoromethyl)pyridine | |
| EP0334720A1 (fr) | Nouveau procédé de préparation d'isocyanates d'acyle | |
| CA1246585A (en) | Process for the preparation of benzoxazolyl-, benzimidazolyl- and benzthiazolyl- oxyphenoxypropionic acid derivatives | |
| US4847426A (en) | Process for the preparation of 2,4-dinitrophenyl ethers | |
| FR2484416A1 (fr) | Derives 4-(3-iodopropargyloxy) pyrimidine et procede pour la production de ces derives | |
| US6344563B1 (en) | Process for making 5-lipoxygenase inhibitors having varied heterocyclic ring systems | |
| JPS5834466B2 (ja) | トルアニリド類の製法 | |
| RU2702121C1 (ru) | Способ получения производного бензилового эфира 2-аминоникотиновой кислоты | |
| US4374281A (en) | Process for the manufacture of hydroquinone-monophenyl ethers | |
| EP0136593A2 (en) | Novel halopyridines and methods of making | |
| JPH05294936A (ja) | 3−置換−2−ピリジニルジスルフィド及びその製造方法 | |
| JPH0584308B2 (enExample) | ||
| DE3026958A1 (de) | 2-(2,2,2-trichlor-1-hydroxy-ethyl)-phenole, ein verfahren zu deren herstellung sowie deren verwendung zur herstellung von salicylaldehyden |