DD202294A5 - Verfahren zur herstellung von dithiazolyldisulfiden - Google Patents
Verfahren zur herstellung von dithiazolyldisulfiden Download PDFInfo
- Publication number
- DD202294A5 DD202294A5 DD82238611A DD23861182A DD202294A5 DD 202294 A5 DD202294 A5 DD 202294A5 DD 82238611 A DD82238611 A DD 82238611A DD 23861182 A DD23861182 A DD 23861182A DD 202294 A5 DD202294 A5 DD 202294A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- copper
- heavy metal
- oxygen
- mercapto
- radical
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 17
- 238000002360 preparation method Methods 0.000 title claims abstract description 10
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims abstract description 30
- 229910001385 heavy metal Inorganic materials 0.000 claims abstract description 25
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 24
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 24
- 239000001301 oxygen Substances 0.000 claims abstract description 24
- 239000003054 catalyst Substances 0.000 claims abstract description 19
- -1 dithiazolyl disulfides Chemical class 0.000 claims abstract description 18
- 229910021529 ammonia Inorganic materials 0.000 claims abstract description 15
- OCVLSHAVSIYKLI-UHFFFAOYSA-N 3h-1,3-thiazole-2-thione Chemical compound SC1=NC=CS1 OCVLSHAVSIYKLI-UHFFFAOYSA-N 0.000 claims abstract description 12
- 150000002736 metal compounds Chemical class 0.000 claims abstract description 12
- 239000002904 solvent Substances 0.000 claims abstract description 10
- 239000007789 gas Substances 0.000 claims abstract description 5
- 230000003647 oxidation Effects 0.000 claims abstract description 5
- 238000007254 oxidation reaction Methods 0.000 claims abstract description 5
- 230000003197 catalytic effect Effects 0.000 claims abstract description 3
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 claims description 26
- 239000010949 copper Substances 0.000 claims description 14
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 11
- 101000588924 Anthopleura elegantissima Delta-actitoxin-Ael1a Proteins 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 229910052802 copper Inorganic materials 0.000 claims description 8
- BERDEBHAJNAUOM-UHFFFAOYSA-N copper(i) oxide Chemical compound [Cu]O[Cu] BERDEBHAJNAUOM-UHFFFAOYSA-N 0.000 claims description 6
- 150000003512 tertiary amines Chemical class 0.000 claims description 6
- 125000005303 dithiazolyl group Chemical group S1SNC(=C1)* 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 claims description 4
- 239000005749 Copper compound Substances 0.000 claims description 3
- 229910021591 Copper(I) chloride Inorganic materials 0.000 claims description 3
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 claims description 3
- 150000001880 copper compounds Chemical class 0.000 claims description 3
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 claims description 3
- 150000003254 radicals Chemical class 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- BWFPGXWASODCHM-UHFFFAOYSA-N copper monosulfide Chemical compound [Cu]=S BWFPGXWASODCHM-UHFFFAOYSA-N 0.000 claims description 2
- SVOAENZIOKPANY-CVBJKYQLSA-L copper;(z)-octadec-9-enoate Chemical compound [Cu+2].CCCCCCCC\C=C/CCCCCCCC([O-])=O.CCCCCCCC\C=C/CCCCCCCC([O-])=O SVOAENZIOKPANY-CVBJKYQLSA-L 0.000 claims description 2
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 claims 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 claims 1
- 239000012452 mother liquor Substances 0.000 abstract description 8
- 239000003795 chemical substances by application Substances 0.000 abstract description 3
- 238000004519 manufacturing process Methods 0.000 abstract description 2
- 238000006243 chemical reaction Methods 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- AFZSMODLJJCVPP-UHFFFAOYSA-N dibenzothiazol-2-yl disulfide Chemical compound C1=CC=C2SC(SSC=3SC4=CC=CC=C4N=3)=NC2=C1 AFZSMODLJJCVPP-UHFFFAOYSA-N 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical compound CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 2
- BBMCTIGTTCKYKF-UHFFFAOYSA-N 1-heptanol Chemical compound CCCCCCCO BBMCTIGTTCKYKF-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical class [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 150000001879 copper Chemical class 0.000 description 2
- 150000004699 copper complex Chemical class 0.000 description 2
- RFKZUAOAYVHBOY-UHFFFAOYSA-M copper(1+);acetate Chemical compound [Cu+].CC([O-])=O RFKZUAOAYVHBOY-UHFFFAOYSA-M 0.000 description 2
- RPJAQOVNRDOGAY-UHFFFAOYSA-L copper(1+);sulfite Chemical compound [Cu+].[Cu+].[O-]S([O-])=O RPJAQOVNRDOGAY-UHFFFAOYSA-L 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 150000004763 sulfides Chemical class 0.000 description 2
- FSJSYDFBTIVUFD-XHTSQIMGSA-N (e)-4-hydroxypent-3-en-2-one;oxovanadium Chemical compound [V]=O.C\C(O)=C/C(C)=O.C\C(O)=C/C(C)=O FSJSYDFBTIVUFD-XHTSQIMGSA-N 0.000 description 1
- MRORKWHSOOKUDV-UHFFFAOYSA-N 1h-benzo[e][1,3]benzothiazole-2-thione Chemical compound C1=CC=C2C(NC(S3)=S)=C3C=CC2=C1 MRORKWHSOOKUDV-UHFFFAOYSA-N 0.000 description 1
- MSXVEPNJUHWQHW-UHFFFAOYSA-N 2-methylbutan-2-ol Chemical compound CCC(C)(C)O MSXVEPNJUHWQHW-UHFFFAOYSA-N 0.000 description 1
- MYBFPRUVQGKNIV-UHFFFAOYSA-N 4-chloro-3h-1,3-benzothiazole-2-thione Chemical compound C1=CC=C2SC(S)=NC2=C1Cl MYBFPRUVQGKNIV-UHFFFAOYSA-N 0.000 description 1
- GUISIVZZEFLXQH-UHFFFAOYSA-N 4-phenyl-3h-1,3-benzothiazole-2-thione Chemical compound C1=CC=C2SC(=S)NC2=C1C1=CC=CC=C1 GUISIVZZEFLXQH-UHFFFAOYSA-N 0.000 description 1
- YANSPMBIFXPLFE-UHFFFAOYSA-N 5,6-dimethoxy-3h-1,3-benzothiazole-2-thione Chemical compound C1=C(OC)C(OC)=CC2=C1SC(S)=N2 YANSPMBIFXPLFE-UHFFFAOYSA-N 0.000 description 1
- SZNXHOMOAFJDRV-UHFFFAOYSA-N 6-hydroxy-3h-1,3-benzothiazole-2-thione Chemical compound OC1=CC=C2NC(=S)SC2=C1 SZNXHOMOAFJDRV-UHFFFAOYSA-N 0.000 description 1
- QPOZGXKWWKLJDK-UHFFFAOYSA-N 6-nitro-3h-1,3-benzothiazole-2-thione Chemical compound [O-][N+](=O)C1=CC=C2NC(=S)SC2=C1 QPOZGXKWWKLJDK-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- NBHVVGGHUVSPES-UHFFFAOYSA-N SC=1SC2=C(N1)C(=CC=C2)C.SC=2SC=C(N2)C2=CC(=CC=C2)Cl.SC=2SC=C(N2)C2=CC(=CC=C2)[N+](=O)[O-].SC=2SC=C(N2)C2=CC=C(C=C2)Br.SC=2SC(=C(N2)C2=CC=CC=C2)Cl Chemical compound SC=1SC2=C(N1)C(=CC=C2)C.SC=2SC=C(N2)C2=CC(=CC=C2)Cl.SC=2SC=C(N2)C2=CC(=CC=C2)[N+](=O)[O-].SC=2SC=C(N2)C2=CC=C(C=C2)Br.SC=2SC(=C(N2)C2=CC=CC=C2)Cl NBHVVGGHUVSPES-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- CUJRVFIICFDLGR-UHFFFAOYSA-N acetylacetonate Chemical compound CC(=O)[CH-]C(C)=O CUJRVFIICFDLGR-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 229910000431 copper oxide Inorganic materials 0.000 description 1
- IEDRGHHDYMVJLD-UHFFFAOYSA-N copper potassium tricyanide Chemical compound [K+].[Cu++].[C-]#N.[C-]#N.[C-]#N IEDRGHHDYMVJLD-UHFFFAOYSA-N 0.000 description 1
- AQMRBJNRFUQADD-UHFFFAOYSA-N copper(I) sulfide Chemical compound [S-2].[Cu+].[Cu+] AQMRBJNRFUQADD-UHFFFAOYSA-N 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- ZKXWKVVCCTZOLD-FDGPNNRMSA-N copper;(z)-4-hydroxypent-3-en-2-one Chemical compound [Cu].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O ZKXWKVVCCTZOLD-FDGPNNRMSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 150000002019 disulfides Chemical class 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- LZKLAOYSENRNKR-LNTINUHCSA-N iron;(z)-4-oxoniumylidenepent-2-en-2-olate Chemical compound [Fe].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O LZKLAOYSENRNKR-LNTINUHCSA-N 0.000 description 1
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- 238000003918 potentiometric titration Methods 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
- C07D277/70—Sulfur atoms
- C07D277/76—Sulfur atoms attached to a second hetero atom
- C07D277/78—Sulfur atoms attached to a second hetero atom to a second sulphur atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813113298 DE3113298A1 (de) | 1981-04-02 | 1981-04-02 | Verfahren zur herstellung von dithiazolyldisulfiden |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD202294A5 true DD202294A5 (de) | 1983-09-07 |
Family
ID=6129140
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD82238611A DD202294A5 (de) | 1981-04-02 | 1982-03-31 | Verfahren zur herstellung von dithiazolyldisulfiden |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4558135A (enExample) |
| JP (1) | JPS57176971A (enExample) |
| BE (1) | BE892611A (enExample) |
| BR (1) | BR8201857A (enExample) |
| CA (1) | CA1170659A (enExample) |
| DD (1) | DD202294A5 (enExample) |
| DE (1) | DE3113298A1 (enExample) |
| ES (1) | ES8303373A2 (enExample) |
| FR (1) | FR2503158B1 (enExample) |
| GB (1) | GB2097391B (enExample) |
| IT (1) | IT1147923B (enExample) |
| NL (1) | NL8201115A (enExample) |
| PL (1) | PL235755A1 (enExample) |
| RO (1) | RO83114B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3205555A1 (de) * | 1982-02-17 | 1983-08-25 | Akzo Gmbh, 5600 Wuppertal | Verfahren zur herstellung von dithiazoldisulfiden |
| US4463178A (en) * | 1982-12-27 | 1984-07-31 | The Goodyear Tire & Rubber Company | Method of preparing dibenzothiazolyl disulfides |
| US4965863A (en) * | 1987-10-02 | 1990-10-23 | Cray Computer Corporation | Gallium arsenide depletion made MESFIT logic cell |
| US4868336A (en) * | 1987-11-20 | 1989-09-19 | Phillips Petroleum Company | Manufacture of disulfides |
| US5367082A (en) * | 1990-09-07 | 1994-11-22 | Akzo N.V. | Process for the preparation of 2-mercaptobenzothiazole |
| DE4032680A1 (de) * | 1990-10-15 | 1992-04-16 | Akzo Gmbh | Verfahren zur herstellung von 2-aminodithiothiazolen und 2-aminotrithiothiazolen |
| JPH0589129U (ja) * | 1991-07-15 | 1993-12-03 | 日本特殊陶業株式会社 | 自動車用アウトサイドミラーの水滴除去装置 |
| DE19856439A1 (de) * | 1998-12-08 | 2000-06-15 | Bayer Ag | Verfahren zur Herstellung von Dithiazolyldisulfiden |
| CN103044354A (zh) * | 2012-12-04 | 2013-04-17 | 山东鑫泉医药有限公司 | 以臭氧为氧化剂制备医药级dm的生产方法 |
| CN106631939B (zh) * | 2017-01-24 | 2019-05-17 | 郑州大学 | 水相中催化分子氧氧化生成具有s-s键的二硫化合物的方法 |
| CN106831644B (zh) * | 2017-01-24 | 2019-07-12 | 郑州大学 | 水相中催化分子氧氧化制备2,2’-二硫联二苯并噻唑的方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2031714A (en) * | 1934-08-03 | 1936-02-25 | Silesia Ver Chemischer Fabrike | Process for the production of disulphides from mercaptothiazols |
| US3086018A (en) * | 1957-12-24 | 1963-04-16 | Goodyear Tire & Rubber | Manufacture of amino thiazole disulfides |
| US3143574A (en) * | 1961-11-14 | 1964-08-04 | Universal Oil Prod Co | Manufacture of individual disulfides |
| US3654297A (en) * | 1969-02-10 | 1972-04-04 | American Cyanamid Co | Process for oxidizing 2-mercaptobenzothiazole |
| FR2201684A5 (enExample) * | 1972-10-04 | 1974-04-26 | Rhone Poulenc Sa | |
| FR2206761A5 (enExample) * | 1972-11-13 | 1974-06-07 | Rhone Poulenc Sa | |
| FR2205900A5 (enExample) * | 1972-11-08 | 1974-05-31 | Rhone Poulenc Sa | |
| DE2944225A1 (de) * | 1979-11-02 | 1981-05-07 | Akzo Gmbh, 5600 Wuppertal | Verfahren zur herstellung von dithiazoldisulfiden |
-
1981
- 1981-04-02 DE DE19813113298 patent/DE3113298A1/de active Granted
- 1981-11-23 US US06/324,181 patent/US4558135A/en not_active Expired - Fee Related
- 1981-12-17 CA CA000392554A patent/CA1170659A/en not_active Expired
-
1982
- 1982-03-18 NL NL8201115A patent/NL8201115A/nl not_active Application Discontinuation
- 1982-03-23 IT IT48055/82A patent/IT1147923B/it active
- 1982-03-24 ES ES510730A patent/ES8303373A2/es not_active Expired
- 1982-03-24 BE BE0/207648A patent/BE892611A/fr not_active IP Right Cessation
- 1982-03-25 FR FR828205130A patent/FR2503158B1/fr not_active Expired
- 1982-03-31 DD DD82238611A patent/DD202294A5/de unknown
- 1982-03-31 RO RO107102A patent/RO83114B/ro unknown
- 1982-04-01 BR BR8201857A patent/BR8201857A/pt not_active IP Right Cessation
- 1982-04-01 JP JP57052355A patent/JPS57176971A/ja active Granted
- 1982-04-01 PL PL23575582A patent/PL235755A1/xx unknown
- 1982-04-01 GB GB8209649A patent/GB2097391B/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BR8201857A (pt) | 1983-03-01 |
| PL235755A1 (enExample) | 1982-10-11 |
| DE3113298C2 (enExample) | 1988-09-15 |
| CA1170659A (en) | 1984-07-10 |
| ES510730A0 (es) | 1983-02-01 |
| FR2503158A1 (fr) | 1982-10-08 |
| GB2097391A (en) | 1982-11-03 |
| JPS57176971A (en) | 1982-10-30 |
| IT8248055A0 (it) | 1982-03-23 |
| RO83114B (ro) | 1984-02-28 |
| ES8303373A2 (es) | 1983-02-01 |
| NL8201115A (nl) | 1982-11-01 |
| US4558135A (en) | 1985-12-10 |
| FR2503158B1 (fr) | 1985-07-26 |
| IT1147923B (it) | 1986-11-26 |
| GB2097391B (en) | 1985-02-27 |
| RO83114A (ro) | 1984-02-21 |
| JPH0234351B2 (enExample) | 1990-08-02 |
| BE892611A (fr) | 1982-07-16 |
| DE3113298A1 (de) | 1982-10-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3501383C2 (enExample) | ||
| DE2944225C2 (enExample) | ||
| DD202294A5 (de) | Verfahren zur herstellung von dithiazolyldisulfiden | |
| EP0131776B1 (de) | Verfahren zur Herstellung von Thiazolyl-2-sulfenamiden | |
| EP1205472B1 (de) | Verfahren zur Herstellung von Dithiazolyldisulfiden | |
| DE3105587C2 (de) | Verfahren zur Herstellung von Thiuramdisulfiden | |
| DE3105622A1 (de) | Verfahren zur herstellung von thiuramdisulfiden | |
| EP0129832B1 (de) | Verfahren zur Verminderung von Nebenproduktanteilen bei der Herstellung von Carbendazim | |
| DE2349934A1 (de) | Verfahren zur herstellung von thiazolsulfenamiden | |
| DE2355897C3 (de) | Verfahren zur Herstellung von Dithiazolyl (2,2,')- disulfiden | |
| EP1008591A1 (de) | Verfahren zur Herstellung von Dithiazolyldisulfiden | |
| EP0180650B1 (de) | Verfahren zur Herstellung von Thiurampolysulfiden | |
| EP0179931B1 (de) | Verfahren zur Herstellung von Thiurampolysulfiden | |
| DE3205555A1 (de) | Verfahren zur herstellung von dithiazoldisulfiden | |
| DE2356686A1 (de) | Verfahren zur herstellung von thiazolsulfenamiden | |
| DE102005004472A1 (de) | Verfahren zur Herstellung von Bis-DMTD | |
| DE4032680A1 (de) | Verfahren zur herstellung von 2-aminodithiothiazolen und 2-aminotrithiothiazolen | |
| EP1099682B1 (de) | Verfahren zur Herstellung von Nitrosobenzolen | |
| DE2503145B2 (de) | Verfahren zur Herstellung von 3-Chlor- bzw. 3,5-Dichloranilinen | |
| DE3009846A1 (de) | Verfahren zur herstellung von bis-(amino-phenyl)-disulfiden | |
| DE2505036A1 (de) | Verfahren zur herstellung von sulfonylsemicarbaziden |