DD156261A5 - Verfahren zur herstellung von 1-amino-1,3,5-triazin-2,4(1h,3h)-dionen - Google Patents
Verfahren zur herstellung von 1-amino-1,3,5-triazin-2,4(1h,3h)-dionen Download PDFInfo
- Publication number
- DD156261A5 DD156261A5 DD81227508A DD22750881A DD156261A5 DD 156261 A5 DD156261 A5 DD 156261A5 DD 81227508 A DD81227508 A DD 81227508A DD 22750881 A DD22750881 A DD 22750881A DD 156261 A5 DD156261 A5 DD 156261A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- atoms
- alkyl
- substituted
- halogen
- cyano
- Prior art date
Links
- HIUSJCCJQZSYRQ-UHFFFAOYSA-N 1-amino-1,3,5-triazine-2,4-dione Chemical compound NN1C=NC(=O)NC1=O HIUSJCCJQZSYRQ-UHFFFAOYSA-N 0.000 title abstract description 5
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000000034 method Methods 0.000 claims abstract description 26
- -1 hydrocarbon radicals Chemical class 0.000 claims description 59
- 125000000217 alkyl group Chemical group 0.000 claims description 40
- 125000004432 carbon atom Chemical group C* 0.000 claims description 34
- 125000003545 alkoxy group Chemical group 0.000 claims description 27
- 229910052736 halogen Inorganic materials 0.000 claims description 27
- 150000002367 halogens Chemical class 0.000 claims description 27
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 25
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 22
- 125000004414 alkyl thio group Chemical group 0.000 claims description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 16
- 150000003254 radicals Chemical class 0.000 claims description 13
- 150000005840 aryl radicals Chemical class 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 229930195733 hydrocarbon Natural products 0.000 claims description 9
- 239000004215 Carbon black (E152) Substances 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- 238000002955 isolation Methods 0.000 claims description 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- 125000001960 7 membered carbocyclic group Chemical group 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 150000002430 hydrocarbons Chemical class 0.000 claims description 3
- 238000007363 ring formation reaction Methods 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000004122 cyclic group Chemical group 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical group C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000006413 ring segment Chemical group 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 claims 1
- 229910052731 fluorine Inorganic materials 0.000 claims 1
- 239000011737 fluorine Substances 0.000 claims 1
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical group [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 claims 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 17
- 238000006243 chemical reaction Methods 0.000 abstract description 15
- 238000002360 preparation method Methods 0.000 abstract description 15
- 238000005903 acid hydrolysis reaction Methods 0.000 abstract description 2
- 238000002844 melting Methods 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- 230000008018 melting Effects 0.000 description 12
- 239000007858 starting material Substances 0.000 description 12
- 238000009835 boiling Methods 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 239000000543 intermediate Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 239000004480 active ingredient Substances 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 5
- YEXIGDOOPPENOC-UHFFFAOYSA-N phenyl hydrogen carbonate;hydrochloride Chemical class Cl.OC(=O)OC1=CC=CC=C1 YEXIGDOOPPENOC-UHFFFAOYSA-N 0.000 description 5
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical class OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 235000010290 biphenyl Nutrition 0.000 description 4
- 239000004305 biphenyl Substances 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000003995 emulsifying agent Substances 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 150000002989 phenols Chemical class 0.000 description 4
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- HQQGZFFHYJZCGS-UHFFFAOYSA-N 3-(2,2-dimethylpropyl)-6-ethylsulfanyl-1-(propan-2-ylideneamino)-1,3,5-triazine-2,4-dione Chemical compound CCSC1=NC(=O)N(CC(C)(C)C)C(=O)N1N=C(C)C HQQGZFFHYJZCGS-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 3
- ZOBFJDJPRVLPIQ-UHFFFAOYSA-N ethyl n'-(propan-2-ylideneamino)carbamimidothioate Chemical compound CCS\C(N)=N\N=C(C)C ZOBFJDJPRVLPIQ-UHFFFAOYSA-N 0.000 description 3
- 230000002363 herbicidal effect Effects 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 2
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 2
- XDIAMRVROCPPBK-UHFFFAOYSA-N 2,2-dimethylpropan-1-amine Chemical compound CC(C)(C)CN XDIAMRVROCPPBK-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 2
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 2
- RSHDHBSLQNAYDI-UHFFFAOYSA-N phenyl n-(2,2-dimethylpropyl)carbamate Chemical compound CC(C)(C)CNC(=O)OC1=CC=CC=C1 RSHDHBSLQNAYDI-UHFFFAOYSA-N 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 125000005919 1,2,2-trimethylpropyl group Chemical group 0.000 description 1
- KOKBUARVIJVMMM-UHFFFAOYSA-N 1-amino-3-(2,2-dimethylpropyl)-6-ethylsulfanyl-1,3,5-triazine-2,4-dione Chemical compound CCSC1=NC(=O)N(CC(C)(C)C)C(=O)N1N KOKBUARVIJVMMM-UHFFFAOYSA-N 0.000 description 1
- USXSCBCCYNVIPN-UHFFFAOYSA-N 1-isocyanato-2,2-dimethylpropane Chemical compound CC(C)(C)CN=C=O USXSCBCCYNVIPN-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- MHPHRPMWKGGYAV-UHFFFAOYSA-N 2,2-dimethylpropylcarbamic acid Chemical compound CC(C)(C)CNC(O)=O MHPHRPMWKGGYAV-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000003229 2-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000005916 2-methylpentyl group Chemical group 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000006479 2-pyridyl methyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- DGYIJVNZSDYBOE-UHFFFAOYSA-N [CH2]C1=CC=NC=C1 Chemical group [CH2]C1=CC=NC=C1 DGYIJVNZSDYBOE-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- FLICUHRPUPPGRJ-UHFFFAOYSA-N carbonic acid;chlorobenzene Chemical compound OC(O)=O.ClC1=CC=CC=C1 FLICUHRPUPPGRJ-UHFFFAOYSA-N 0.000 description 1
- IYRWEQXVUNLMAY-UHFFFAOYSA-N carbonyl fluoride Chemical compound FC(F)=O IYRWEQXVUNLMAY-UHFFFAOYSA-N 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000006622 cycloheptylmethyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 229940042396 direct acting antivirals thiosemicarbazones Drugs 0.000 description 1
- 238000007700 distillative separation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000004438 haloalkoxy group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- AMIMRNSIRUDHCM-UHFFFAOYSA-N isobutyric aldehyde Natural products CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- RKPDHXGEFVRONA-UHFFFAOYSA-N methyl n'-(propan-2-ylideneamino)carbamimidothioate Chemical compound CSC(N)=NN=C(C)C RKPDHXGEFVRONA-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- PDOAODRXHYFPDV-UHFFFAOYSA-N phenyl hydrogen carbonate hydrofluoride Chemical class OC(OC1=CC=CC=C1)=O.F PDOAODRXHYFPDV-UHFFFAOYSA-N 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003584 thiosemicarbazones Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/38—Sulfur atoms
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Plant Pathology (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803006263 DE3006263A1 (de) | 1980-02-20 | 1980-02-20 | Verfahren und herstellung von 1-amino-1,3,5-triazin-2,4(1h, 3h)-dionen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD156261A5 true DD156261A5 (de) | 1982-08-11 |
Family
ID=6095047
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD81227508A DD156261A5 (de) | 1980-02-20 | 1981-02-09 | Verfahren zur herstellung von 1-amino-1,3,5-triazin-2,4(1h,3h)-dionen |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4356024A (cs) |
| EP (1) | EP0034751B1 (cs) |
| JP (1) | JPS56131572A (cs) |
| AR (1) | AR225656A1 (cs) |
| AT (1) | ATE10326T1 (cs) |
| AU (1) | AU6689581A (cs) |
| BR (1) | BR8101010A (cs) |
| CA (1) | CA1171858A (cs) |
| CS (1) | CS224607B2 (cs) |
| DD (1) | DD156261A5 (cs) |
| DE (2) | DE3006263A1 (cs) |
| DK (1) | DK74481A (cs) |
| EG (1) | EG14958A (cs) |
| ES (1) | ES499588A0 (cs) |
| IL (1) | IL62148A0 (cs) |
| PL (1) | PL129275B1 (cs) |
| PT (1) | PT72479B (cs) |
| ZA (1) | ZA811101B (cs) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3106724A1 (de) | 1981-02-24 | 1982-09-09 | Bayer Ag, 5090 Leverkusen | "verfahren zur herstellung von 1-amino-1,3,5-triazin-2,4 (1h, 3h)-dionen" |
| DE3412946A1 (de) * | 1984-04-06 | 1985-10-17 | Bayer Ag, 5090 Leverkusen | 3-(2,2-tetramethylen-propyl)-1,3,5-triazin-2,4-dione |
| US5189058A (en) * | 1991-04-09 | 1993-02-23 | Warner-Lambert Company | Iminodicarbonic, iminodicarbonodithioic, and thiocarbonylcarbamic acid esters useful as ACAT inhibitors |
| CN1084930C (zh) * | 1997-06-16 | 2002-05-15 | 联华电子股份有限公司 | 只读存储器结构及其制造方法 |
| US10799496B2 (en) | 2018-07-13 | 2020-10-13 | Alkermes Pharma Ireland Limited | Naphthylenyl compounds for long-acting injectable compositions and related methods |
| WO2020012245A1 (en) | 2018-07-13 | 2020-01-16 | Alkermes Pharma Ireland Limited | Thienothiophene-naltrexone prodrugs for long-acting injectable compositions |
| WO2020094634A1 (en) | 2018-11-05 | 2020-05-14 | Alkermes Pharma Ireland Limited | Thiophene prodrugs of naltroxene for long-acting injectable compositions and related methods |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1344895A (fr) * | 1962-06-04 | 1963-12-06 | American Cyanamid Co | Procédé de préparation de nouvelles nu-(monooxy)-amino-triazines |
| BE785784A (fr) * | 1971-07-02 | 1973-01-03 | Bayer Ag | Nouveaux esters aryliques d'acides n-methyl-carbamiques n-carboxyles, leur procede de preparation et leurs applications commeinsecticides et acaricides |
| DE2254200C2 (de) * | 1972-11-06 | 1982-04-22 | Bayer Ag, 5090 Leverkusen | Tetrahydro-1,3,5-triazin-2,6-dione, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide |
| DE2311662C2 (de) * | 1973-03-09 | 1982-10-21 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Bis-Halogencarbonylanilinen sowie einige Bis-Halogencarbonylaniline |
| DE2351556C2 (de) * | 1973-10-13 | 1982-06-03 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von N-Halogenformyl-carbamidsäurehalogeniden |
| US3907796A (en) * | 1974-05-24 | 1975-09-23 | Du Pont | Imidazo-s-triazinediones and byrimido-s-triazinediones |
| DE3006226A1 (de) * | 1980-02-20 | 1981-08-27 | Bayer Ag, 5090 Leverkusen | N-substituierte imido-dicarbonsaeure-diarylester, verfahren zun ihrer herstellung und ihre verwendung als zwischenprodukte |
-
1980
- 1980-02-20 DE DE19803006263 patent/DE3006263A1/de not_active Withdrawn
-
1981
- 1981-01-20 AR AR284386A patent/AR225656A1/es active
- 1981-02-04 AU AU66895/81A patent/AU6689581A/en not_active Abandoned
- 1981-02-09 DD DD81227508A patent/DD156261A5/de unknown
- 1981-02-10 PT PT72479A patent/PT72479B/pt unknown
- 1981-02-10 DE DE8181100922T patent/DE3167251D1/de not_active Expired
- 1981-02-10 EP EP81100922A patent/EP0034751B1/de not_active Expired
- 1981-02-10 AT AT81100922T patent/ATE10326T1/de not_active IP Right Cessation
- 1981-02-10 US US06/233,250 patent/US4356024A/en not_active Expired - Fee Related
- 1981-02-17 JP JP2098181A patent/JPS56131572A/ja active Pending
- 1981-02-17 IL IL62148A patent/IL62148A0/xx unknown
- 1981-02-18 CA CA000371154A patent/CA1171858A/en not_active Expired
- 1981-02-18 PL PL1981229740A patent/PL129275B1/pl unknown
- 1981-02-18 EG EG79/81A patent/EG14958A/xx active
- 1981-02-18 CS CS811157A patent/CS224607B2/cs unknown
- 1981-02-19 DK DK74481A patent/DK74481A/da not_active Application Discontinuation
- 1981-02-19 BR BR8101010A patent/BR8101010A/pt unknown
- 1981-02-19 ES ES499588A patent/ES499588A0/es active Granted
- 1981-02-19 ZA ZA00811101A patent/ZA811101B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ATE10326T1 (de) | 1984-12-15 |
| PL129275B1 (en) | 1984-04-30 |
| EP0034751A3 (en) | 1982-06-30 |
| BR8101010A (pt) | 1981-08-25 |
| ES8201555A1 (es) | 1981-12-16 |
| US4356024A (en) | 1982-10-26 |
| CA1171858A (en) | 1984-07-31 |
| PT72479A (de) | 1981-03-01 |
| PL229740A1 (cs) | 1981-11-13 |
| ES499588A0 (es) | 1981-12-16 |
| DE3006263A1 (de) | 1981-08-27 |
| PT72479B (de) | 1982-02-05 |
| IL62148A0 (en) | 1981-03-31 |
| DK74481A (da) | 1981-08-21 |
| EG14958A (en) | 1985-06-30 |
| JPS56131572A (en) | 1981-10-15 |
| AU6689581A (en) | 1981-08-27 |
| CS224607B2 (en) | 1984-01-16 |
| EP0034751B1 (de) | 1984-11-21 |
| EP0034751A2 (de) | 1981-09-02 |
| AR225656A1 (es) | 1982-04-15 |
| DE3167251D1 (en) | 1985-01-03 |
| ZA811101B (en) | 1982-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0201030B1 (de) | Verfahren zur Herstellung von 1,3,5-Triazintrionen | |
| DE2207549B2 (de) | 1-Aminouracile und deren Salze, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| DE2254200C2 (de) | Tetrahydro-1,3,5-triazin-2,6-dione, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| DE3422824A1 (de) | Neue herbizid wirksame sulfonylharnstoffe | |
| DD156261A5 (de) | Verfahren zur herstellung von 1-amino-1,3,5-triazin-2,4(1h,3h)-dionen | |
| EP0132733B1 (de) | Neue Fluorpivalsäurefluoride und Verfahren zu ihrer Herstellung | |
| DE2326358A1 (de) | S-triazin-derivate und ihre herstellung und anwendung | |
| DE3613065A1 (de) | Verwendung von 3-carbamoyl-4-hydroxy-cumarinen zur bekaempfung von parasitaeren helminthen, neue 3-carbamoyl-4-hydroxy-cumarine und ihre herstellung | |
| EP0058868B1 (de) | Substituierte Tetrahydropyrimidinonderivate, Verfahren zu ihrer Herstellung und Herbizide, die diese Derivate als Wirkstoffe enthalten | |
| DE2334607A1 (de) | Sulfonyloxyphenylharnstoffe, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| EP0034750B1 (de) | N-substituierte Imido-dicarbonsäure-diarylester und Verfahren zu ihrer Herstellung | |
| DE3241114A1 (de) | Verfahren zur herstellung von 1-amino-1,3,5-triazin-2,4-(1h,3h)dionen | |
| EP0058895A1 (de) | Verfahren zur Herstellung von 1-Amino-6-alkylthio-3-neopentyl-1,3,5-triazin-2,4(1H, 3H)-dionen | |
| DE2852924A1 (de) | Substituierte spiro-derivate von 3- (3,5-dihalogenphenyl)-oxazolidin-2,4-dionen (thion-onen), verfahren zu ihrer herstellung sowie ihre verwendung als fungizide | |
| DE3623532A1 (de) | Verwendung von thiadiazinonen zur bekaempfung von endoparasiten | |
| EP1220846B1 (de) | Verfahren zur herstellung substituierter phenylsulfonylharnstoffe aus sulfohalogeniden | |
| DD298779A5 (de) | Verfahren zur herstellung von carbomaten und zwischenprodukten in diesem verfahren | |
| EP0048376B1 (de) | Verfahren zur Herstellung von N-substituierten Imido-dicarbonsäure-diarylestern | |
| EP0148755B1 (de) | 2-Phenoxy-phenylsulfonylisocyanat | |
| DE3146230A1 (de) | Verfahren zur herstellung von n-substituierten n-isocyanatocarbonyl-carbamaten | |
| EP0158248A2 (de) | Verfahren zur Herstellung von Biphenylylsulfonylharnstoff- Derivaten, Zwischenprodukte für diese sowie Verfahren für die Herstellung der Zwischenprodukte | |
| DE2351556A1 (de) | Verfahren zur herstellung von n-halogenformyl-carbamidsaeurehalogeniden | |
| DE3409887A1 (de) | Verfahren zur herstellung von isocyanaten | |
| EP0264020A2 (de) | Verfahren zur Herstellung von 0-Aryl-N'-pyrimidin-2-yl-isoharnstoffen | |
| DE3147735A1 (de) | Verfahren zur herstellung von 1-amino-1,3,5-triazin-2,4(1h,3h)dionen |