DD140453A5 - Verfahren zur herstellung von o-methallyloxphenol - Google Patents
Verfahren zur herstellung von o-methallyloxphenol Download PDFInfo
- Publication number
- DD140453A5 DD140453A5 DD78208587A DD20858778A DD140453A5 DD 140453 A5 DD140453 A5 DD 140453A5 DD 78208587 A DD78208587 A DD 78208587A DD 20858778 A DD20858778 A DD 20858778A DD 140453 A5 DD140453 A5 DD 140453A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- catechol
- monoether
- methallyl chloride
- mol
- methallyloxyphenol
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 19
- 238000002360 preparation method Methods 0.000 title claims abstract description 4
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 claims abstract description 127
- OHXAOPZTJOUYKM-UHFFFAOYSA-N 3-Chloro-2-methylpropene Chemical compound CC(=C)CCl OHXAOPZTJOUYKM-UHFFFAOYSA-N 0.000 claims abstract description 21
- 238000006243 chemical reaction Methods 0.000 claims abstract description 17
- 238000006266 etherification reaction Methods 0.000 claims abstract description 9
- 239000000010 aprotic solvent Substances 0.000 claims abstract description 8
- 150000001875 compounds Chemical class 0.000 claims description 8
- -1 ether aromatic hydrocarbons Chemical class 0.000 claims description 7
- 239000011734 sodium Substances 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 150000003462 sulfoxides Chemical class 0.000 claims description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims 2
- 229910052700 potassium Inorganic materials 0.000 claims 2
- 239000011591 potassium Substances 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- AAXBKJXGVXNSHI-UHFFFAOYSA-N 2-(2-methylprop-2-enoxy)phenol Chemical compound CC(=C)COC1=CC=CC=C1O AAXBKJXGVXNSHI-UHFFFAOYSA-N 0.000 abstract description 16
- 230000015572 biosynthetic process Effects 0.000 abstract description 8
- 239000003513 alkali Substances 0.000 abstract description 7
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 abstract description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 abstract description 3
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical class C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 150000005205 dihydroxybenzenes Chemical class 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 125000005394 methallyl group Chemical group 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 230000001174 ascending effect Effects 0.000 description 2
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 150000004707 phenolate Chemical class 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 1
- GQWNECFJGBQMBO-UHFFFAOYSA-N Molindone hydrochloride Chemical compound Cl.O=C1C=2C(CC)=C(C)NC=2CCC1CN1CCOCC1 GQWNECFJGBQMBO-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical class OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 1
- 229910052601 baryte Inorganic materials 0.000 description 1
- 239000010428 baryte Substances 0.000 description 1
- DUEPRVBVGDRKAG-UHFFFAOYSA-N carbofuran Chemical compound CNC(=O)OC1=CC=CC2=C1OC(C)(C)C2 DUEPRVBVGDRKAG-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- XGZRAKBCYZIBKP-UHFFFAOYSA-L disodium;dihydroxide Chemical compound [OH-].[OH-].[Na+].[Na+] XGZRAKBCYZIBKP-UHFFFAOYSA-L 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- IMNDHOCGZLYMRO-UHFFFAOYSA-N n,n-dimethylbenzamide Chemical compound CN(C)C(=O)C1=CC=CC=C1 IMNDHOCGZLYMRO-UHFFFAOYSA-N 0.000 description 1
- DHAFIDRKDGCXLV-UHFFFAOYSA-N n,n-dimethylformamide;1-methylpyrrolidin-2-one Chemical compound CN(C)C=O.CN1CCCC1=O DHAFIDRKDGCXLV-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000003822 preparative gas chromatography Methods 0.000 description 1
- POSICDHOUBKJKP-UHFFFAOYSA-N prop-2-enoxybenzene Chemical compound C=CCOC1=CC=CC=C1 POSICDHOUBKJKP-UHFFFAOYSA-N 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 125000004436 sodium atom Chemical group 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/23—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing hydroxy or O-metal groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7732340A FR2406622A1 (fr) | 1977-10-20 | 1977-10-20 | Procede de monoetherification selective de la pyrocatechine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD140453A5 true DD140453A5 (de) | 1980-03-05 |
Family
ID=9196982
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD78208587A DD140453A5 (de) | 1977-10-20 | 1978-10-20 | Verfahren zur herstellung von o-methallyloxphenol |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4250333A (enExample) |
| JP (1) | JPS54106438A (enExample) |
| AT (1) | AT358559B (enExample) |
| BE (1) | BE871395A (enExample) |
| BR (1) | BR7806906A (enExample) |
| CA (1) | CA1111864A (enExample) |
| CH (1) | CH635054A5 (enExample) |
| DD (1) | DD140453A5 (enExample) |
| DE (1) | DE2845429A1 (enExample) |
| DK (1) | DK170156B1 (enExample) |
| ES (1) | ES474342A1 (enExample) |
| FR (1) | FR2406622A1 (enExample) |
| GB (1) | GB2006211B (enExample) |
| HU (1) | HU175816B (enExample) |
| IE (1) | IE47457B1 (enExample) |
| IL (1) | IL55819A (enExample) |
| IT (1) | IT1101617B (enExample) |
| LU (1) | LU80394A1 (enExample) |
| NL (1) | NL190370C (enExample) |
| WO (1) | WO1979000219A1 (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2932458A1 (de) * | 1979-08-10 | 1981-02-26 | Bayer Ag | Herstellung von monoalkylethern von hydroxyphenolen und deren umwandlung zu hydroxycumaranen |
| DE3018004C2 (de) * | 1980-05-10 | 1982-06-16 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von Hydrochinonmonophenyläthern |
| IT1140948B (it) * | 1980-05-16 | 1986-10-10 | Montedison Spa | Processo per la preparazione del mono-metallil-etere della pirocatechina |
| DE3043230A1 (de) * | 1980-11-15 | 1982-07-08 | Bayer Ag, 5090 Leverkusen | Herstellung von monoalkylaethern von hydroxyphenolen |
| US4465868A (en) * | 1981-07-17 | 1984-08-14 | Otsuka Kagaku Yakuhin Kabushiki Kaisha | Process for preparing o-methallyloxyphenol |
| DE3136810A1 (de) * | 1981-09-16 | 1983-03-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur isolierung von dihydroxybenzol-monoethern aus reaktionsgemischen |
| US4420642A (en) * | 1982-02-18 | 1983-12-13 | Fmc Corporation | Selective removal and recovery of catechol mixed with 2-methallyloxyphenol |
| IT1151718B (it) * | 1982-04-19 | 1986-12-24 | Brichima Spa | Procedimento per la preparazione del 2,3-diidro-2,2-dimetilbenzofuran-7-olo |
| US4639536A (en) * | 1984-08-30 | 1987-01-27 | Union Carbide Corporation | Intermediate, its synthesis, and its use in a process for the preparation of 2,3-dihydro-2,2-dimethyl-7-hydroxybenzofuran |
| DE3439938A1 (de) * | 1984-11-02 | 1986-05-15 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung niedrigmolekularer diglycidylether zweiwertiger phenole |
| US4618728A (en) * | 1985-02-22 | 1986-10-21 | Fmc Corporation | Water aided catechol etherification |
| US4982012A (en) * | 1987-12-18 | 1991-01-01 | Fmc Corporation | Two phase process for preparing 2-methallyloxyphenol from catechol |
| US4851587A (en) * | 1988-05-31 | 1989-07-25 | Fmc Corporation | Single solvent process for preparing 2-methallyloxy-phenol from catechol |
| RU2203882C1 (ru) * | 2001-12-11 | 2003-05-10 | Общество с ограниченной ответственностью "НПК Реактив-Сервис" | Способ получения 1,5-бис(2-гидроксифенокси)-3-оксапентана моногидрата |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3474171A (en) * | 1964-01-23 | 1969-10-21 | Fmc Corp | 2,2-dimethyl-2,3-dihydrobenzofuranyl-7-n-methylcarbamate |
| US3927118A (en) * | 1973-12-21 | 1975-12-16 | Crown Zellerbach Corp | Process for monoetherification of polyhydric benzenes |
-
1977
- 1977-10-20 FR FR7732340A patent/FR2406622A1/fr active Granted
-
1978
- 1978-04-19 BR BR7806906A patent/BR7806906A/pt unknown
- 1978-10-12 US US05/951,278 patent/US4250333A/en not_active Expired - Lifetime
- 1978-10-18 DE DE19782845429 patent/DE2845429A1/de active Granted
- 1978-10-18 WO PCT/FR1978/000035 patent/WO1979000219A1/fr not_active Ceased
- 1978-10-18 NL NLAANVRAGE7810446,A patent/NL190370C/xx not_active IP Right Cessation
- 1978-10-18 GB GB7840983A patent/GB2006211B/en not_active Expired
- 1978-10-18 CA CA313,714A patent/CA1111864A/en not_active Expired
- 1978-10-18 IE IE2068/78A patent/IE47457B1/en not_active IP Right Cessation
- 1978-10-19 BE BE191229A patent/BE871395A/xx not_active IP Right Cessation
- 1978-10-19 DK DK466878A patent/DK170156B1/da not_active IP Right Cessation
- 1978-10-19 ES ES474342A patent/ES474342A1/es not_active Expired
- 1978-10-19 LU LU80394A patent/LU80394A1/fr unknown
- 1978-10-19 JP JP12902378A patent/JPS54106438A/ja active Granted
- 1978-10-19 HU HU78PI644A patent/HU175816B/hu not_active IP Right Cessation
- 1978-10-20 CH CH1089478A patent/CH635054A5/fr not_active IP Right Cessation
- 1978-10-20 AT AT756178A patent/AT358559B/de not_active IP Right Cessation
- 1978-10-20 DD DD78208587A patent/DD140453A5/de not_active IP Right Cessation
- 1978-10-20 IT IT28967/78A patent/IT1101617B/it active
- 1978-10-30 IL IL55819A patent/IL55819A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ATA756178A (de) | 1980-02-15 |
| FR2406622B1 (enExample) | 1980-09-05 |
| IT7828967A0 (it) | 1978-10-20 |
| DE2845429C2 (enExample) | 1989-01-05 |
| CA1111864A (en) | 1981-11-03 |
| IE47457B1 (en) | 1984-03-21 |
| FR2406622A1 (fr) | 1979-05-18 |
| GB2006211A (en) | 1979-05-02 |
| DE2845429A1 (de) | 1979-04-26 |
| IT1101617B (it) | 1985-10-07 |
| BR7806906A (pt) | 1979-06-26 |
| NL7810446A (nl) | 1979-04-24 |
| DK466878A (da) | 1979-04-21 |
| CH635054A5 (fr) | 1983-03-15 |
| HU175816B (hu) | 1980-10-28 |
| LU80394A1 (fr) | 1980-05-07 |
| IE782068L (en) | 1979-04-20 |
| NL190370B (nl) | 1993-09-01 |
| JPS54106438A (en) | 1979-08-21 |
| ES474342A1 (es) | 1979-04-16 |
| BE871395A (fr) | 1979-04-19 |
| AT358559B (de) | 1980-09-25 |
| JPS6339578B2 (enExample) | 1988-08-05 |
| US4250333A (en) | 1981-02-10 |
| DK170156B1 (da) | 1995-06-06 |
| GB2006211B (en) | 1982-02-17 |
| NL190370C (nl) | 1994-02-01 |
| WO1979000219A1 (fr) | 1979-05-03 |
| IL55819A (en) | 1981-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD140453A5 (de) | Verfahren zur herstellung von o-methallyloxphenol | |
| EP0574667A1 (de) | Verfahren zur Herstellung von 2,2,6,6-Tetramethylpiperidin-N-oxyl und in seiner 4-Stellung substituierten Derivaten | |
| DE1226554B (de) | Verfahren zur Herstellung von Glycid aus Glycerinmonochlorhydrin | |
| DE2925763C2 (enExample) | ||
| DE2748722A1 (de) | Verfahren zur herstellung eines aethersulfonats | |
| DE2925113C2 (enExample) | ||
| EP0052314B2 (de) | Herstellung von Monoalkyläthern von Hydroxyphenolen | |
| DE1793719A1 (de) | 3.61 grossbritanien 10501-61 bez: 2,4-dinitro-6-(1-methyl-n-heptyl)phenylcarbonate | |
| EP1581481A1 (de) | Verbesserte neutralisation von isophoronnitril-syntheseausträgen | |
| EP0491142B1 (de) | Verfahren zur Herstellung von Gemischen cyclischer Acroleinglycerinacetale | |
| CH631146A5 (de) | Verfahren zur herstellung von 2,6-dimethoxy-4-(quaternaeren-alkyl)phenolen. | |
| DE3335186C2 (de) | Verfahren zur Herstellung von Dinitrophenylethern | |
| DE19633608A1 (de) | Verfahren zur Herstellung von p-Kresol | |
| DE3641604C2 (enExample) | ||
| DE19635703A1 (de) | Verfahren zur Herstellung von Alkindiolen oder Gemischen von Alkindiolen mit Alkinmonoolen | |
| DE2054661A1 (en) | N-nitrosa-n-aryl-hydroxylamines prepn - from nitrosa-arenes and nitrogen oxide | |
| DE19756748C2 (de) | Verfahren zur Herstellung von Carbamaten | |
| DE3128962A1 (de) | "verfahren zur herstellung von alkylenglykoldiethern | |
| DE3528916C2 (de) | Verfahren zur Herstellung von 2-Hydroxybenzaldehyden | |
| DE891255C (de) | Verfahren zur Herstellung von Diglycidaether | |
| DE1917658C3 (de) | Hydroxycarbonsäurenitrile | |
| EP3145907B1 (de) | Verfahren zur herstellung von alkoxybenzonitrilen | |
| CH624662A5 (en) | Process for the preparation of cyclopropanecarbonitrile | |
| DE3607993A1 (de) | Verfahren zur herstellung von diaziridinen und produkte daraus | |
| DE4416661A1 (de) | Propylenglykol-Monomethyletherbutyrate und deren Isomere sowie Verfahren zur Herstellung derselben |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ENJ | Ceased due to non-payment of renewal fee |