HU175816B - Sposob poluchenija o-/2-metil-allil/-oksi-fenola s selektivnoj ehterifikaciej pirokatekhina - Google Patents
Sposob poluchenija o-/2-metil-allil/-oksi-fenola s selektivnoj ehterifikaciej pirokatekhina Download PDFInfo
- Publication number
- HU175816B HU175816B HU78PI644A HUPI000644A HU175816B HU 175816 B HU175816 B HU 175816B HU 78PI644 A HU78PI644 A HU 78PI644A HU PI000644 A HUPI000644 A HU PI000644A HU 175816 B HU175816 B HU 175816B
- Authority
- HU
- Hungary
- Prior art keywords
- pyrocatechin
- methylallyl
- oxy
- phenol
- mol
- Prior art date
Links
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 title claims abstract description 64
- 238000006266 etherification reaction Methods 0.000 title claims abstract description 8
- 125000005394 methallyl group Chemical group 0.000 title claims description 36
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000000034 method Methods 0.000 claims abstract description 30
- OHXAOPZTJOUYKM-UHFFFAOYSA-N 3-Chloro-2-methylpropene Chemical compound CC(=C)CCl OHXAOPZTJOUYKM-UHFFFAOYSA-N 0.000 claims abstract description 24
- 238000006243 chemical reaction Methods 0.000 claims abstract description 19
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 claims abstract description 7
- 239000000010 aprotic solvent Substances 0.000 claims abstract description 7
- 238000002360 preparation method Methods 0.000 claims abstract description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 25
- 239000000203 mixture Substances 0.000 claims description 14
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 14
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 7
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 5
- 229910052700 potassium Inorganic materials 0.000 claims description 5
- 239000011591 potassium Substances 0.000 claims description 5
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 4
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 3
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 2
- 150000001408 amides Chemical group 0.000 claims description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 2
- 150000002170 ethers Chemical class 0.000 claims description 2
- 150000002825 nitriles Chemical class 0.000 claims description 2
- 150000003462 sulfoxides Chemical class 0.000 claims description 2
- 235000011181 potassium carbonates Nutrition 0.000 claims 2
- 239000000284 extract Substances 0.000 claims 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 claims 1
- 235000015497 potassium bicarbonate Nutrition 0.000 claims 1
- 239000011736 potassium bicarbonate Substances 0.000 claims 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 claims 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M sodium bicarbonate Substances [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims 1
- 235000017557 sodium bicarbonate Nutrition 0.000 claims 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 abstract description 4
- 230000015572 biosynthetic process Effects 0.000 abstract description 3
- AAXBKJXGVXNSHI-UHFFFAOYSA-N 2-(2-methylprop-2-enoxy)phenol Chemical compound CC(=C)COC1=CC=CC=C1O AAXBKJXGVXNSHI-UHFFFAOYSA-N 0.000 abstract 1
- 239000003513 alkali Substances 0.000 abstract 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 39
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 25
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 12
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- -1 pyrocatechin Chemical class 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 239000006227 byproduct Substances 0.000 description 6
- 239000003153 chemical reaction reagent Substances 0.000 description 6
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001340 alkali metals Chemical group 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 2
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 2
- 150000005205 dihydroxybenzenes Chemical class 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Inorganic materials [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 2
- PFTAWBLQPZVEMU-DZGCQCFKSA-N (+)-catechin Chemical compound C1([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O)=CC=C(O)C(O)=C1 PFTAWBLQPZVEMU-DZGCQCFKSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 238000001461 argentometric titration Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- ADRVNXBAWSRFAJ-UHFFFAOYSA-N catechin Natural products OC1Cc2cc(O)cc(O)c2OC1c3ccc(O)c(O)c3 ADRVNXBAWSRFAJ-UHFFFAOYSA-N 0.000 description 1
- 235000005487 catechin Nutrition 0.000 description 1
- 229950001002 cianidanol Drugs 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- KJFNIMLMIUNQSJ-UHFFFAOYSA-N n,n,2,3-tetramethylbenzamide Chemical compound CN(C)C(=O)C1=CC=CC(C)=C1C KJFNIMLMIUNQSJ-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/23—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing hydroxy or O-metal groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7732340A FR2406622A1 (fr) | 1977-10-20 | 1977-10-20 | Procede de monoetherification selective de la pyrocatechine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU175816B true HU175816B (hu) | 1980-10-28 |
Family
ID=9196982
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU78PI644A HU175816B (hu) | 1977-10-20 | 1978-10-19 | Sposob poluchenija o-/2-metil-allil/-oksi-fenola s selektivnoj ehterifikaciej pirokatekhina |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4250333A (enExample) |
| JP (1) | JPS54106438A (enExample) |
| AT (1) | AT358559B (enExample) |
| BE (1) | BE871395A (enExample) |
| BR (1) | BR7806906A (enExample) |
| CA (1) | CA1111864A (enExample) |
| CH (1) | CH635054A5 (enExample) |
| DD (1) | DD140453A5 (enExample) |
| DE (1) | DE2845429A1 (enExample) |
| DK (1) | DK170156B1 (enExample) |
| ES (1) | ES474342A1 (enExample) |
| FR (1) | FR2406622A1 (enExample) |
| GB (1) | GB2006211B (enExample) |
| HU (1) | HU175816B (enExample) |
| IE (1) | IE47457B1 (enExample) |
| IL (1) | IL55819A (enExample) |
| IT (1) | IT1101617B (enExample) |
| LU (1) | LU80394A1 (enExample) |
| NL (1) | NL190370C (enExample) |
| WO (1) | WO1979000219A1 (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2932458A1 (de) * | 1979-08-10 | 1981-02-26 | Bayer Ag | Herstellung von monoalkylethern von hydroxyphenolen und deren umwandlung zu hydroxycumaranen |
| DE3018004C2 (de) * | 1980-05-10 | 1982-06-16 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von Hydrochinonmonophenyläthern |
| IT1140948B (it) * | 1980-05-16 | 1986-10-10 | Montedison Spa | Processo per la preparazione del mono-metallil-etere della pirocatechina |
| DE3043230A1 (de) * | 1980-11-15 | 1982-07-08 | Bayer Ag, 5090 Leverkusen | Herstellung von monoalkylaethern von hydroxyphenolen |
| US4465868A (en) * | 1981-07-17 | 1984-08-14 | Otsuka Kagaku Yakuhin Kabushiki Kaisha | Process for preparing o-methallyloxyphenol |
| DE3136810A1 (de) * | 1981-09-16 | 1983-03-31 | Bayer Ag, 5090 Leverkusen | Verfahren zur isolierung von dihydroxybenzol-monoethern aus reaktionsgemischen |
| US4420642A (en) * | 1982-02-18 | 1983-12-13 | Fmc Corporation | Selective removal and recovery of catechol mixed with 2-methallyloxyphenol |
| IT1151718B (it) * | 1982-04-19 | 1986-12-24 | Brichima Spa | Procedimento per la preparazione del 2,3-diidro-2,2-dimetilbenzofuran-7-olo |
| US4639536A (en) * | 1984-08-30 | 1987-01-27 | Union Carbide Corporation | Intermediate, its synthesis, and its use in a process for the preparation of 2,3-dihydro-2,2-dimethyl-7-hydroxybenzofuran |
| DE3439938A1 (de) * | 1984-11-02 | 1986-05-15 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung niedrigmolekularer diglycidylether zweiwertiger phenole |
| US4618728A (en) * | 1985-02-22 | 1986-10-21 | Fmc Corporation | Water aided catechol etherification |
| US4982012A (en) * | 1987-12-18 | 1991-01-01 | Fmc Corporation | Two phase process for preparing 2-methallyloxyphenol from catechol |
| US4851587A (en) * | 1988-05-31 | 1989-07-25 | Fmc Corporation | Single solvent process for preparing 2-methallyloxy-phenol from catechol |
| RU2203882C1 (ru) * | 2001-12-11 | 2003-05-10 | Общество с ограниченной ответственностью "НПК Реактив-Сервис" | Способ получения 1,5-бис(2-гидроксифенокси)-3-оксапентана моногидрата |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3474171A (en) * | 1964-01-23 | 1969-10-21 | Fmc Corp | 2,2-dimethyl-2,3-dihydrobenzofuranyl-7-n-methylcarbamate |
| US3927118A (en) * | 1973-12-21 | 1975-12-16 | Crown Zellerbach Corp | Process for monoetherification of polyhydric benzenes |
-
1977
- 1977-10-20 FR FR7732340A patent/FR2406622A1/fr active Granted
-
1978
- 1978-04-19 BR BR7806906A patent/BR7806906A/pt unknown
- 1978-10-12 US US05/951,278 patent/US4250333A/en not_active Expired - Lifetime
- 1978-10-18 DE DE19782845429 patent/DE2845429A1/de active Granted
- 1978-10-18 WO PCT/FR1978/000035 patent/WO1979000219A1/fr not_active Ceased
- 1978-10-18 NL NLAANVRAGE7810446,A patent/NL190370C/xx not_active IP Right Cessation
- 1978-10-18 GB GB7840983A patent/GB2006211B/en not_active Expired
- 1978-10-18 CA CA313,714A patent/CA1111864A/en not_active Expired
- 1978-10-18 IE IE2068/78A patent/IE47457B1/en not_active IP Right Cessation
- 1978-10-19 BE BE191229A patent/BE871395A/xx not_active IP Right Cessation
- 1978-10-19 DK DK466878A patent/DK170156B1/da not_active IP Right Cessation
- 1978-10-19 ES ES474342A patent/ES474342A1/es not_active Expired
- 1978-10-19 LU LU80394A patent/LU80394A1/fr unknown
- 1978-10-19 JP JP12902378A patent/JPS54106438A/ja active Granted
- 1978-10-19 HU HU78PI644A patent/HU175816B/hu not_active IP Right Cessation
- 1978-10-20 CH CH1089478A patent/CH635054A5/fr not_active IP Right Cessation
- 1978-10-20 AT AT756178A patent/AT358559B/de not_active IP Right Cessation
- 1978-10-20 DD DD78208587A patent/DD140453A5/de not_active IP Right Cessation
- 1978-10-20 IT IT28967/78A patent/IT1101617B/it active
- 1978-10-30 IL IL55819A patent/IL55819A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ATA756178A (de) | 1980-02-15 |
| FR2406622B1 (enExample) | 1980-09-05 |
| IT7828967A0 (it) | 1978-10-20 |
| DE2845429C2 (enExample) | 1989-01-05 |
| CA1111864A (en) | 1981-11-03 |
| IE47457B1 (en) | 1984-03-21 |
| FR2406622A1 (fr) | 1979-05-18 |
| GB2006211A (en) | 1979-05-02 |
| DE2845429A1 (de) | 1979-04-26 |
| IT1101617B (it) | 1985-10-07 |
| BR7806906A (pt) | 1979-06-26 |
| NL7810446A (nl) | 1979-04-24 |
| DK466878A (da) | 1979-04-21 |
| CH635054A5 (fr) | 1983-03-15 |
| LU80394A1 (fr) | 1980-05-07 |
| IE782068L (en) | 1979-04-20 |
| NL190370B (nl) | 1993-09-01 |
| JPS54106438A (en) | 1979-08-21 |
| ES474342A1 (es) | 1979-04-16 |
| BE871395A (fr) | 1979-04-19 |
| AT358559B (de) | 1980-09-25 |
| JPS6339578B2 (enExample) | 1988-08-05 |
| US4250333A (en) | 1981-02-10 |
| DK170156B1 (da) | 1995-06-06 |
| GB2006211B (en) | 1982-02-17 |
| NL190370C (nl) | 1994-02-01 |
| WO1979000219A1 (fr) | 1979-05-03 |
| IL55819A (en) | 1981-12-31 |
| DD140453A5 (de) | 1980-03-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU175816B (hu) | Sposob poluchenija o-/2-metil-allil/-oksi-fenola s selektivnoj ehterifikaciej pirokatekhina | |
| US4375566A (en) | Process for producing ortho-alkylated phenols from anisoles | |
| EP0252402B1 (en) | Process for the preparation of (2,2)-paracyclophane and derivatives thereof | |
| EP0024806B2 (en) | Preparation of alkyl glyceryl ether alcohols | |
| US3927118A (en) | Process for monoetherification of polyhydric benzenes | |
| HU185896B (en) | New process for producing 7-hydroxy-2,2-dimethyl-2,3-dihydro-bracket-benzo-furane-bracket closed | |
| EP0000219B1 (en) | Macrocyclic polyether complexes and a process for the isolation of macrocyclic polyethers | |
| CN109661385B (zh) | 用于合成9,9-双(羟甲基)芴的方法 | |
| US4465868A (en) | Process for preparing o-methallyloxyphenol | |
| KR880001051B1 (ko) | 2, 3-디하이드로-2, 2-디메틸벤조푸란-7-올의 제조방법 | |
| EP0119065B1 (en) | Process for preparing diaryls | |
| DE3043230A1 (de) | Herstellung von monoalkylaethern von hydroxyphenolen | |
| JPH0480909B2 (enExample) | ||
| US4405528A (en) | Method of preparing 4-(α-alkyl-α-cyano-methyl)2,6-di-substituted phenols | |
| EP0040400A1 (en) | Process for preparing the mono-methallyl-ether of pyrocatechin | |
| EP0119067B1 (en) | Process for preparing aldehydes | |
| EP0877023B1 (en) | Process for the preparation of aromatic compounds containing a heterocyclic system | |
| US2488499A (en) | 1, 4-di(halophenoxy)-2-butenes | |
| JP2565982B2 (ja) | 2,4ージニトロフエニルエーテルの製造方法 | |
| EP0262589B1 (en) | Triazole compounds, and their production | |
| US3422154A (en) | Process for producing dinitrodiphenyl ethers | |
| US4450308A (en) | Process for the preparation of trifluoromethylphenyl oxyphenyl ether compounds | |
| JPH06166652A (ja) | アルドール化合物の製造方法 | |
| EP0118082B1 (de) | Phenoxyacetylene und Verfahren zu ihrer Herstellung | |
| JPH08151343A (ja) | 4−アルコキシフェノールの製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |