CS259894B2 - Method of substituted nicotinates preparation - Google Patents
Method of substituted nicotinates preparation Download PDFInfo
- Publication number
- CS259894B2 CS259894B2 CS867743A CS774386A CS259894B2 CS 259894 B2 CS259894 B2 CS 259894B2 CS 867743 A CS867743 A CS 867743A CS 774386 A CS774386 A CS 774386A CS 259894 B2 CS259894 B2 CS 259894B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- alkyl
- formula
- process according
- above formulas
- compounds
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 20
- 238000002360 preparation method Methods 0.000 title claims abstract description 14
- 150000002814 niacins Chemical class 0.000 title claims description 3
- 235000001968 nicotinic acid Nutrition 0.000 title claims description 3
- 239000002904 solvent Substances 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 14
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 10
- 150000003863 ammonium salts Chemical class 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 7
- 150000001299 aldehydes Chemical class 0.000 claims description 6
- 150000002576 ketones Chemical class 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- 150000007524 organic acids Chemical class 0.000 claims description 5
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000007522 mineralic acids Chemical class 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 4
- JNQWFLVFHCCWPV-UHFFFAOYSA-N diethyl 2-chloro-3-oxobutanedioate Chemical compound CCOC(=O)C(Cl)C(=O)C(=O)OCC JNQWFLVFHCCWPV-UHFFFAOYSA-N 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 150000002430 hydrocarbons Chemical class 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims description 2
- VSPXTWXXNZJEHM-UHFFFAOYSA-N diethyl 5-ethylpyridine-2,3-dicarboxylate Chemical compound CCOC(=O)C1=CC(CC)=CN=C1C(=O)OCC VSPXTWXXNZJEHM-UHFFFAOYSA-N 0.000 claims description 2
- FPSIITQRJVXVIY-UHFFFAOYSA-N ethyl 5-ethyl-2-methylpyridine-3-carboxylate Chemical compound CCOC(=O)C1=CC(CC)=CN=C1C FPSIITQRJVXVIY-UHFFFAOYSA-N 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims 3
- 239000004215 Carbon black (E152) Substances 0.000 claims 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims 2
- LIEJOTPNNDMONH-UHFFFAOYSA-N diethyl 5,6-dimethylpyridine-2,3-dicarboxylate Chemical compound CCOC(=O)C1=CC(C)=C(C)N=C1C(=O)OCC LIEJOTPNNDMONH-UHFFFAOYSA-N 0.000 claims 1
- KIDQHBXPNBCITQ-UHFFFAOYSA-N diethyl 5-methylpyridine-2,3-dicarboxylate Chemical compound CCOC(=O)C1=CC(C)=CN=C1C(=O)OCC KIDQHBXPNBCITQ-UHFFFAOYSA-N 0.000 claims 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 1
- UUEVFMOUBSLVJW-UHFFFAOYSA-N oxo-[[1-[2-[2-[2-[4-(oxoazaniumylmethylidene)pyridin-1-yl]ethoxy]ethoxy]ethyl]pyridin-4-ylidene]methyl]azanium;dibromide Chemical compound [Br-].[Br-].C1=CC(=C[NH+]=O)C=CN1CCOCCOCCN1C=CC(=C[NH+]=O)C=C1 UUEVFMOUBSLVJW-UHFFFAOYSA-N 0.000 claims 1
- 239000007858 starting material Substances 0.000 claims 1
- 229910052757 nitrogen Inorganic materials 0.000 description 16
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 239000012043 crude product Substances 0.000 description 8
- GJAWHXHKYYXBSV-UHFFFAOYSA-N quinolinic acid Chemical compound OC(=O)C1=CC=CN=C1C(O)=O GJAWHXHKYYXBSV-UHFFFAOYSA-N 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- -1 ketones forms imines Chemical class 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- GMLDCZYTIPCVMO-UHFFFAOYSA-N 2-methylidenebutanal Chemical compound CCC(=C)C=O GMLDCZYTIPCVMO-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 150000002081 enamines Chemical class 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 description 2
- CGMJIXLCLAOYLR-UHFFFAOYSA-N 2-(4,5-dihydro-1h-imidazol-2-yl)pyridine-3-carboxylic acid Chemical class OC(=O)C1=CC=CN=C1C1=NCCN1 CGMJIXLCLAOYLR-UHFFFAOYSA-N 0.000 description 2
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- HZCGELONROQYQX-UHFFFAOYSA-N 2-chloro-3-oxobutanedioic acid Chemical compound OC(=O)C(Cl)C(=O)C(O)=O HZCGELONROQYQX-UHFFFAOYSA-N 0.000 description 1
- PKEFQSLNTJXAEE-UHFFFAOYSA-N 2-o-tert-butyl 3-o-ethyl 6-oxo-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-2,3-dicarboxylate Chemical group C1C(=O)CCC2CN(C(=O)OC(C)(C)C)C(C(=O)OCC)CC21 PKEFQSLNTJXAEE-UHFFFAOYSA-N 0.000 description 1
- LCMHEDXQAAJPPG-UHFFFAOYSA-N 2H-pyrimidine-1,2-dicarboxylic acid Chemical class N=1C(N(C=CC1)C(=O)O)C(=O)O LCMHEDXQAAJPPG-UHFFFAOYSA-N 0.000 description 1
- MTAVBTGOXNGCJR-UHFFFAOYSA-N 5-ethylpyridine-2,3-dicarboxylic acid Chemical compound CCC1=CN=C(C(O)=O)C(C(O)=O)=C1 MTAVBTGOXNGCJR-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- PQUCIEFHOVEZAU-UHFFFAOYSA-N Diammonium sulfite Chemical compound [NH4+].[NH4+].[O-]S([O-])=O PQUCIEFHOVEZAU-UHFFFAOYSA-N 0.000 description 1
- 238000006845 Michael addition reaction Methods 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- JCTDVOWBAHLRLG-UHFFFAOYSA-N diethyl 2-bromo-3-oxobutanedioate Chemical compound CCOC(=O)C(Br)C(=O)C(=O)OCC JCTDVOWBAHLRLG-UHFFFAOYSA-N 0.000 description 1
- HQOMJNUPLXPBNB-UHFFFAOYSA-N dimethyl 2-chloro-3-oxobutanedioate Chemical compound COC(=O)C(Cl)C(=O)C(=O)OC HQOMJNUPLXPBNB-UHFFFAOYSA-N 0.000 description 1
- CZGBLCUFEBWLRT-UHFFFAOYSA-N dimethyl 5-ethylpyridine-2,3-dicarboxylate Chemical compound CCC1=CN=C(C(=O)OC)C(C(=O)OC)=C1 CZGBLCUFEBWLRT-UHFFFAOYSA-N 0.000 description 1
- ARCOHBBKRVUVCD-UHFFFAOYSA-N dipropyl 2-chloro-3-oxobutanedioate Chemical compound CCCOC(=O)C(Cl)C(=O)C(=O)OCCC ARCOHBBKRVUVCD-UHFFFAOYSA-N 0.000 description 1
- KSEHOXPSGWRJEL-UHFFFAOYSA-N dipropyl 5-ethylpyridine-2,3-dicarboxylate Chemical compound CCCOC(=O)C1=CC(CC)=CN=C1C(=O)OCCC KSEHOXPSGWRJEL-UHFFFAOYSA-N 0.000 description 1
- 125000006575 electron-withdrawing group Chemical group 0.000 description 1
- 239000003759 ester based solvent Substances 0.000 description 1
- RDULEYWUGKOCMR-UHFFFAOYSA-N ethyl 2-chloro-3-oxobutanoate Chemical compound CCOC(=O)C(Cl)C(C)=O RDULEYWUGKOCMR-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000011005 laboratory method Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/55—Acids; Esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/791,671 US4723011A (en) | 1985-10-28 | 1985-10-28 | Preparation of substituted and disubstituted-pyridine-2,3-dicarboxylate esters |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS259894B2 true CS259894B2 (en) | 1988-11-15 |
Family
ID=25154435
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS867743A CS259894B2 (en) | 1985-10-28 | 1986-10-27 | Method of substituted nicotinates preparation |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4723011A (de) |
| EP (1) | EP0220518B1 (de) |
| JP (1) | JPH0768216B2 (de) |
| KR (1) | KR940001774B1 (de) |
| AR (1) | AR241244A1 (de) |
| AT (1) | ATE60758T1 (de) |
| AU (1) | AU592379B2 (de) |
| BR (1) | BR8605210A (de) |
| CA (1) | CA1274831A (de) |
| CS (1) | CS259894B2 (de) |
| DD (1) | DD254000A5 (de) |
| DE (1) | DE3634975C2 (de) |
| DK (1) | DK163505C (de) |
| ES (1) | ES2000910A6 (de) |
| HU (1) | HU198909B (de) |
| IE (1) | IE59324B1 (de) |
| IL (1) | IL80284A (de) |
| ZA (1) | ZA868167B (de) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8605868D0 (en) * | 1986-03-10 | 1986-04-16 | Shell Int Research | Preparation of heterocyclic compounds |
| DE3882055T2 (de) * | 1987-01-06 | 1993-12-02 | Sugai Chemical Ind Co Ltd | Verfahren zur Herstellung von Pyridin-2,3-dicarboxylsäure-Verbindungen. |
| JPH0625116B2 (ja) * | 1987-07-08 | 1994-04-06 | ダイソー株式会社 | ピリジン−2,3−ジカルボン酸誘導体の製造法 |
| US4871859A (en) * | 1988-03-02 | 1989-10-03 | Hoechst Celanese Corporation | Process for preparing pyridine carboxylic acid esters |
| US5047542A (en) * | 1988-07-01 | 1991-09-10 | Hoechst Celanese Corporation | Process for preparing pyridine carboxylic acid esters |
| WO1989008103A1 (en) * | 1988-03-02 | 1989-09-08 | Hoechst Celanese Corporation | Process for preparing pyridine carboxylic acid esters |
| EP0357792B1 (de) * | 1988-03-18 | 1995-06-28 | Sugai Chemical Industry Co., Ltd. | Verfahren zur herstellung von pyridin-2,3-dicarbonsäure-verbindungen |
| US5175300A (en) * | 1988-03-18 | 1992-12-29 | Sugai Chemical Ind. Co., Ltd. | Process for preparing pyridine-2,3-dicarboxylic acid compounds |
| DE3840554A1 (de) * | 1988-12-01 | 1990-06-13 | Wacker Chemie Gmbh | Verfahren zur herstellung von pyridin-2,3-dicarbonsaeureestern |
| US4925944A (en) * | 1989-03-21 | 1990-05-15 | American Cyanamid Company | Process for the preparation of o-carboxypyridyl- and o-carboxyquinolylimidazolinones |
| US5322948A (en) * | 1989-08-31 | 1994-06-21 | Hoechst Celanese Corporation | Process for preparing pyridinecarboxylic acid derivatives |
| US5405987A (en) * | 1989-08-31 | 1995-04-11 | Hoechst Celanese Corporation | Process for preparing pyridine and quinoline derivatives |
| CA2022408A1 (en) * | 1989-08-31 | 1991-03-01 | Michael P. Bodman | Process for preparing pyridine carboxylic acid derivatives |
| US5124458A (en) * | 1990-06-15 | 1992-06-23 | American Cyanamid Company | Process for the preparation of dialkyl pyridine-2,3-dicarboxylate and derivatives thereof from dialkyl dichlorosuccinate |
| US5118809A (en) * | 1990-06-15 | 1992-06-02 | American Cyanamid Company | Process for the preparation of substituted and unsubstituted-2,3-pyridinedicarboxylates from chloromaleate or chlorofumarate or mixtures thereof |
| US5225560A (en) * | 1990-06-15 | 1993-07-06 | American Cyanamid Company | Process for the preparation of dialkyl pyridine-2,3-dicarboxylate and derivatives thereof from dialkyl dichlorosuccinate |
| EP0461401A1 (de) * | 1990-06-15 | 1991-12-18 | American Cyanamid Company | Verfahren zur Herstellung von 2,3-Pyridindicarbonsäure-dialkylestern aus Dialkyldichloromaleinsäureestern |
| US5122608A (en) * | 1990-12-19 | 1992-06-16 | American Cyanamid Company | Method for the preparation of substituted and unsubstituted 2,3-pyridine and quinolinedicarboxylic acids |
| US5177266A (en) * | 1991-12-20 | 1993-01-05 | American Cyanamid Company | Proccess for the manufacture of 2-alkoxymethylacrolein |
| US5276157A (en) * | 1991-12-20 | 1994-01-04 | American Cyanamid Company | Process for the purification of 2,3-pyridine and quinolinedicarboxylic acid diester compounds |
| US5281713A (en) * | 1991-12-20 | 1994-01-25 | American Cyanamid Company | Process for the manufacture of 2-alkoxymethylacrolein |
| US5208342A (en) * | 1992-03-30 | 1993-05-04 | Hoechst Celanese Corporation | Conversion of pyridine-2,3-dicarboxylic acid esters to cyclic anhydrides |
| DE4343923A1 (de) * | 1993-12-22 | 1995-06-29 | Basf Ag | Pyridin-2,3-dicarbonsäureimide, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses |
| EP0847389A4 (de) * | 1995-07-11 | 2001-04-11 | Reilly Ind Inc | Verfahren zur herstellung von chinolinbasen |
| NZ314904A (en) * | 1996-06-10 | 1998-06-26 | American Cyanamid Co | Preparation of a herbicidal [(5,6-dicarboxy-3-pyridyl)methyl]ammonium halide |
| US5892050A (en) * | 1998-01-28 | 1999-04-06 | American Cyanamid Company | Process for the preparation of pyridine dicarboxylate derivatives |
| US6080867A (en) * | 1998-06-15 | 2000-06-27 | American Cyanamid Company | Process and intermediates for the manufacture of pyridine-2,3-dicarboxylate compounds |
| US5925764A (en) * | 1998-06-15 | 1999-07-20 | Wu; Wen-Xue | Process and intermediated for the manufacture of pyridine-2, 3-dicarboxylate compounds |
| US7795439B2 (en) * | 2004-06-25 | 2010-09-14 | Basf Aktiengesellschaft | In-situ treatment of pyridine 2,3-dicarboxylic acid esters with an oxidizing agent |
| DE102005022043B3 (de) * | 2005-05-09 | 2006-09-28 | MAE Maschinen- und Apparatebau Götzen GmbH & Co. KG | Verfahren und Vorrichtung zum Richten eines länglichen Werkstückes |
| US8161289B2 (en) | 2005-12-21 | 2012-04-17 | SanDisk Technologies, Inc. | Voice controlled portable memory storage device |
| CN103373958B (zh) * | 2012-04-18 | 2015-11-04 | 中国中化股份有限公司 | 5-乙基吡啶-2,3-二甲酸二乙酯的制备方法 |
| EP3782985A1 (de) | 2019-08-19 | 2021-02-24 | BASF Agrochemical Products B.V. | Verfahren zur herstellung von 5-methoxymethylpyridin-2,3-dicarbonsäurederivaten |
| CN115403518B (zh) * | 2022-09-19 | 2024-11-22 | 浙江伟锋药业有限公司 | 一种5-烷基吡啶-2,3-二羧酸酯的连续流合成工艺 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2453305A1 (de) * | 1973-12-05 | 1975-06-12 | Heyden Chem Fab | Neue hydrazine, hydrazide und hydrazone von pyrazolo(3,4-b)pyridin-6-carbonsaeuren und -carbonsaeureestern und ihre salze |
| US4460776A (en) * | 1982-05-25 | 1984-07-17 | American Cyanamid Company | Process for the preparation of 6-substituted-2,3-pyridinedicarboxylic acid diesters |
| ZA844134B (en) * | 1983-06-02 | 1985-01-30 | American Cyanamid Co | (2-imidazolin-2-yl)thieno-and furo(2,3,-b)and(3,2-b)-pyridines and intermediates for the preparation thereof,and use of said compounds as herbicidal agents |
| US4748244A (en) * | 1984-05-11 | 1988-05-31 | Ciba-Geigy Corporation | Process for the preparation of pyridine-2-3-dicarboxylic acid derivatives, and novel 1-amino-1,4-dihydropyridine-2-3-diarboxylic acid derivatives |
-
1985
- 1985-10-28 US US06/791,671 patent/US4723011A/en not_active Expired - Lifetime
-
1986
- 1986-09-16 AR AR86305709A patent/AR241244A1/es active
- 1986-09-30 EP EP86113409A patent/EP0220518B1/de not_active Expired - Lifetime
- 1986-09-30 AT AT86113409T patent/ATE60758T1/de not_active IP Right Cessation
- 1986-10-01 IE IE260586A patent/IE59324B1/en not_active IP Right Cessation
- 1986-10-10 IL IL80284A patent/IL80284A/xx not_active IP Right Cessation
- 1986-10-14 DE DE3634975A patent/DE3634975C2/de not_active Expired - Lifetime
- 1986-10-17 KR KR1019860008743A patent/KR940001774B1/ko not_active Expired - Lifetime
- 1986-10-24 DD DD86295575A patent/DD254000A5/de unknown
- 1986-10-24 BR BR8605210A patent/BR8605210A/pt not_active IP Right Cessation
- 1986-10-24 CA CA000521312A patent/CA1274831A/en not_active Expired - Lifetime
- 1986-10-24 JP JP61252107A patent/JPH0768216B2/ja not_active Expired - Lifetime
- 1986-10-27 CS CS867743A patent/CS259894B2/cs not_active IP Right Cessation
- 1986-10-27 DK DK512586A patent/DK163505C/da not_active IP Right Cessation
- 1986-10-27 AU AU64415/86A patent/AU592379B2/en not_active Expired
- 1986-10-27 ES ES8602775A patent/ES2000910A6/es not_active Expired
- 1986-10-27 ZA ZA868167A patent/ZA868167B/xx unknown
- 1986-10-28 HU HU864521A patent/HU198909B/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DK512586D0 (da) | 1986-10-27 |
| AU6441586A (en) | 1987-04-30 |
| US4723011A (en) | 1988-02-02 |
| BR8605210A (pt) | 1987-07-28 |
| EP0220518B1 (de) | 1991-02-06 |
| ZA868167B (en) | 1987-06-24 |
| IL80284A (en) | 1990-07-26 |
| EP0220518A3 (en) | 1988-03-30 |
| IE862605L (en) | 1987-04-28 |
| IE59324B1 (en) | 1994-02-09 |
| EP0220518A2 (de) | 1987-05-06 |
| DK163505B (da) | 1992-03-09 |
| KR870003989A (ko) | 1987-05-06 |
| JPH0768216B2 (ja) | 1995-07-26 |
| JPS62106081A (ja) | 1987-05-16 |
| ATE60758T1 (de) | 1991-02-15 |
| DK163505C (da) | 1992-08-24 |
| IL80284A0 (en) | 1987-01-30 |
| CA1274831A (en) | 1990-10-02 |
| DE3634975A1 (de) | 1987-04-30 |
| DK512586A (da) | 1987-04-29 |
| AU592379B2 (en) | 1990-01-11 |
| ES2000910A6 (es) | 1988-03-16 |
| DD254000A5 (de) | 1988-02-10 |
| KR940001774B1 (ko) | 1994-03-05 |
| HU198909B (en) | 1989-12-28 |
| HUT44016A (en) | 1988-01-28 |
| AR241244A1 (es) | 1992-03-31 |
| DE3634975C2 (de) | 1997-12-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS259894B2 (en) | Method of substituted nicotinates preparation | |
| CZ281966B6 (cs) | Způsob výroby pyrimidinových sloučenin | |
| US6166215A (en) | Process for producing guanidine derivatives, intermediates therefor and their production | |
| EP1723156A1 (de) | Verfahren zur herstellung von pyridinderivaten | |
| CS183391A3 (en) | Process for preparing dialkylpyridine-2,3-dicarboxylates and derivatives thereof | |
| CS183491A3 (en) | Process for preparing dialkylpyridine-2,3-dicarboxylates and derivatives thereof | |
| KR100262250B1 (ko) | 3-알콕시메틸퀴놀린, 및 2-알콕시메틸아크롤레인으로부터이의 제조 방법 | |
| SK284852B6 (sk) | Spôsob výroby pyridín-2,3-dikarboxylátových zlúčenín a ich medziprodukty | |
| Bonacorso et al. | New efficient approach for the synthesis of 2‐alkyl (aryl) substituted 4H‐pyrido [1, 2‐a] pyrimidin‐4‐ones | |
| US6320053B1 (en) | Preparation of heteroarylcarboxamides | |
| EP0578849B1 (de) | Verfahren zur Herstellung von 1,3-Dioxan-4,6-Dionderivaten | |
| EP0899262A2 (de) | Verfahren zur Herstellung von Heteroarylcarbonsäureamiden und -estern | |
| IL93393A (en) | Process for the preparation of omicron-carboxypyridyl and omicron-carboxyquinolyl- imidazolinones | |
| JPH07291933A (ja) | 2,5−二置換ピリジン類の製造方法 | |
| US6562979B1 (en) | Process for the preparation of substituted benzisothiazole compounds | |
| US6762303B2 (en) | Method for producing pyridine compounds | |
| Rubinov et al. | Synthesis of 1, 6-disubstituted 2, 4-pyridinediones from 5-acetoacetyl-2, 2-dimethyl-1, 3-dioxane-4, 6-dione | |
| US4127581A (en) | Method for the preparation of 3-phenyl-5-substituted-4(1H)-pyridones | |
| KR20050003080A (ko) | 3,4-디히드로퀴나졸린 유도체 및 그의 제조 방법 | |
| JPH0649685B2 (ja) | 1−ベンジルピリジニウム塩誘導体及びその製造方法 | |
| KR20190088051A (ko) | 3-(피리딜-2-아미노)프로피오니트릴 및 그 유연체의 제조 방법 | |
| HU217648B (hu) | 3-(Alkoxi-metil)-kinolin-származékok |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| IF00 | In force as of 2000-06-30 in czech republic | ||
| MK4A | Patent expired |
Effective date: 20011027 |