CS241512B2 - Method of water-soluble and fibre-reactive phthalocyanine derivatives production - Google Patents
Method of water-soluble and fibre-reactive phthalocyanine derivatives production Download PDFInfo
- Publication number
- CS241512B2 CS241512B2 CS826949A CS694982A CS241512B2 CS 241512 B2 CS241512 B2 CS 241512B2 CS 826949 A CS826949 A CS 826949A CS 694982 A CS694982 A CS 694982A CS 241512 B2 CS241512 B2 CS 241512B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- formula
- phthalocyanine
- pyridine
- acid
- dyes
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 29
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical class N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 title claims description 17
- -1 methoxy, ethoxy, propoxy Chemical group 0.000 claims description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 18
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 16
- 150000001412 amines Chemical class 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 15
- 239000000203 mixture Substances 0.000 claims description 15
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 12
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 9
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 claims description 9
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 8
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 claims description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 8
- 239000011230 binding agent Substances 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- KZVLNAGYSAKYMG-UHFFFAOYSA-N pyridine-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=N1 KZVLNAGYSAKYMG-UHFFFAOYSA-N 0.000 claims description 6
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical group CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 229910004727 OSO3H Inorganic materials 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 239000007858 starting material Substances 0.000 claims description 3
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 239000012736 aqueous medium Substances 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- 239000007900 aqueous suspension Substances 0.000 claims 1
- 229920002554 vinyl polymer Polymers 0.000 claims 1
- 239000000975 dye Substances 0.000 description 96
- 238000004043 dyeing Methods 0.000 description 33
- 238000009833 condensation Methods 0.000 description 22
- 230000005494 condensation Effects 0.000 description 22
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 20
- 239000000243 solution Substances 0.000 description 19
- 241000083869 Polyommatus dorylas Species 0.000 description 13
- YXZRCLVVNRLPTP-UHFFFAOYSA-J turquoise blue Chemical compound [Na+].[Na+].[Na+].[Na+].[Cu+2].NC1=NC(Cl)=NC(NC=2C=C(NS(=O)(=O)C3=CC=4C(=C5NC=4NC=4[N-]C(=C6C=CC(=CC6=4)S([O-])(=O)=O)NC=4NC(=C6C=C(C=CC6=4)S([O-])(=O)=O)NC=4[N-]C(=C6C=CC(=CC6=4)S([O-])(=O)=O)N5)C=C3)C(=CC=2)S([O-])(=O)=O)=N1 YXZRCLVVNRLPTP-UHFFFAOYSA-J 0.000 description 13
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 10
- 235000017557 sodium bicarbonate Nutrition 0.000 description 10
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- 239000001045 blue dye Substances 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 7
- 229920000742 Cotton Polymers 0.000 description 7
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 7
- 239000000985 reactive dye Substances 0.000 description 7
- 210000002268 wool Anatomy 0.000 description 7
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 239000002657 fibrous material Substances 0.000 description 6
- 150000004982 aromatic amines Chemical class 0.000 description 5
- 239000001103 potassium chloride Substances 0.000 description 5
- 235000011164 potassium chloride Nutrition 0.000 description 5
- GIAFURWZWWWBQT-UHFFFAOYSA-N 2-(2-aminoethoxy)ethanol Chemical compound NCCOCCO GIAFURWZWWWBQT-UHFFFAOYSA-N 0.000 description 4
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 4
- 238000004040 coloring Methods 0.000 description 4
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 4
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 4
- 238000009792 diffusion process Methods 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- VHYUNSUGCNKWSO-UHFFFAOYSA-N 3-propan-2-yloxypropan-1-amine Chemical compound CC(C)OCCCN VHYUNSUGCNKWSO-UHFFFAOYSA-N 0.000 description 3
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 238000006482 condensation reaction Methods 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 239000012065 filter cake Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 230000009257 reactivity Effects 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 2
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 2
- 229920003043 Cellulose fiber Polymers 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 238000005299 abrasion Methods 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 229960004050 aminobenzoic acid Drugs 0.000 description 2
- 229960002684 aminocaproic acid Drugs 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- UCMIRNVEIXFBKS-UHFFFAOYSA-N beta-alanine Chemical compound NCCC(O)=O UCMIRNVEIXFBKS-UHFFFAOYSA-N 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- TWBYWOBDOCUKOW-UHFFFAOYSA-N isonicotinic acid Chemical compound OC(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-N 0.000 description 2
- BMFVGAAISNGQNM-UHFFFAOYSA-N isopentylamine Chemical compound CC(C)CCN BMFVGAAISNGQNM-UHFFFAOYSA-N 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- 239000010985 leather Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- YFZBPSXRYCOKCW-UHFFFAOYSA-N n-(3-aminopropyl)acetamide Chemical compound CC(=O)NCCCN YFZBPSXRYCOKCW-UHFFFAOYSA-N 0.000 description 2
- 235000001968 nicotinic acid Nutrition 0.000 description 2
- 239000011664 nicotinic acid Substances 0.000 description 2
- 239000008363 phosphate buffer Substances 0.000 description 2
- 239000001007 phthalocyanine dye Substances 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- GJAWHXHKYYXBSV-UHFFFAOYSA-N quinolinic acid Chemical compound OC(=O)C1=CC=CN=C1C(O)=O GJAWHXHKYYXBSV-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000004627 regenerated cellulose Substances 0.000 description 2
- 238000005185 salting out Methods 0.000 description 2
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- XOAAWQZATWQOTB-UHFFFAOYSA-N taurine Chemical compound NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 2
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 2
- QQVDJLLNRSOCEL-UHFFFAOYSA-N (2-aminoethyl)phosphonic acid Chemical compound [NH3+]CCP(O)([O-])=O QQVDJLLNRSOCEL-UHFFFAOYSA-N 0.000 description 1
- QFUSOYKIDBRREL-NSCUHMNNSA-N (e)-but-2-en-1-amine Chemical compound C\C=C\CN QFUSOYKIDBRREL-NSCUHMNNSA-N 0.000 description 1
- MKUDQQQXIYJLLM-UHFFFAOYSA-N 1-(2-aminoethyl)-1-propan-2-ylurea Chemical compound CC(C)N(C(N)=O)CCN MKUDQQQXIYJLLM-UHFFFAOYSA-N 0.000 description 1
- ASASRSMRAPYLQI-UHFFFAOYSA-N 2-(3-aminophenyl)sulfonylethanol Chemical compound NC1=CC=CC(S(=O)(=O)CCO)=C1 ASASRSMRAPYLQI-UHFFFAOYSA-N 0.000 description 1
- MXZROAOUCUVNHX-UHFFFAOYSA-N 2-Aminopropanol Chemical compound CCC(N)O MXZROAOUCUVNHX-UHFFFAOYSA-N 0.000 description 1
- UANWURKQKKYIGV-UHFFFAOYSA-N 2-methoxypropan-1-amine Chemical compound COC(C)CN UANWURKQKKYIGV-UHFFFAOYSA-N 0.000 description 1
- NJBCRXCAPCODGX-UHFFFAOYSA-N 2-methyl-n-(2-methylpropyl)propan-1-amine Chemical compound CC(C)CNCC(C)C NJBCRXCAPCODGX-UHFFFAOYSA-N 0.000 description 1
- PHRNISIZSLWXBY-UHFFFAOYSA-N 2-methylpyridine-3-sulfonic acid Chemical compound CC1=NC=CC=C1S(O)(=O)=O PHRNISIZSLWXBY-UHFFFAOYSA-N 0.000 description 1
- FAXDZWQIWUSWJH-UHFFFAOYSA-N 3-methoxypropan-1-amine Chemical compound COCCCN FAXDZWQIWUSWJH-UHFFFAOYSA-N 0.000 description 1
- DYOKWPWMTZHTPS-UHFFFAOYSA-N 4,6-dimethylpyridine-2-carboxylic acid Chemical compound CC1=CC(C)=NC(C(O)=O)=C1 DYOKWPWMTZHTPS-UHFFFAOYSA-N 0.000 description 1
- ZQDCHFWHASWLKG-UHFFFAOYSA-N 4-ethylpyridine-3-carboxylic acid Chemical compound CCC1=CC=NC=C1C(O)=O ZQDCHFWHASWLKG-UHFFFAOYSA-N 0.000 description 1
- ZKUZSTXNVMIDCY-UHFFFAOYSA-N 4-methylpyridine-3-carboxylic acid Chemical compound CC1=CC=NC=C1C(O)=O ZKUZSTXNVMIDCY-UHFFFAOYSA-N 0.000 description 1
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241001197082 Knodus beta Species 0.000 description 1
- 241000208202 Linaceae Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical group CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical group 0.000 description 1
- 239000000980 acid dye Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- LHIJANUOQQMGNT-UHFFFAOYSA-N aminoethylethanolamine Chemical compound NCCNCCO LHIJANUOQQMGNT-UHFFFAOYSA-N 0.000 description 1
- 150000001642 boronic acid derivatives Chemical group 0.000 description 1
- 229940043430 calcium compound Drugs 0.000 description 1
- 150000001674 calcium compounds Chemical class 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- MUYSADWCWFFZKR-UHFFFAOYSA-N cinchomeronic acid Chemical compound OC(=O)C1=CC=NC=C1C(O)=O MUYSADWCWFFZKR-UHFFFAOYSA-N 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- XCJYREBRNVKWGJ-UHFFFAOYSA-N copper(II) phthalocyanine Chemical compound [Cu+2].C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 XCJYREBRNVKWGJ-UHFFFAOYSA-N 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- MPFLRYZEEAQMLQ-UHFFFAOYSA-N dinicotinic acid Chemical compound OC(=O)C1=CN=CC(C(O)=O)=C1 MPFLRYZEEAQMLQ-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000005189 flocculation Methods 0.000 description 1
- 230000016615 flocculation Effects 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- LVPMIMZXDYBCDF-UHFFFAOYSA-N isocinchomeronic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)N=C1 LVPMIMZXDYBCDF-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- MJIVRKPEXXHNJT-UHFFFAOYSA-N lutidinic acid Chemical compound OC(=O)C1=CC=NC(C(O)=O)=C1 MJIVRKPEXXHNJT-UHFFFAOYSA-N 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- AGVKXDPPPSLISR-UHFFFAOYSA-N n-ethylcyclohexanamine Chemical compound CCNC1CCCCC1 AGVKXDPPPSLISR-UHFFFAOYSA-N 0.000 description 1
- NSBIQPJIWUJBBX-UHFFFAOYSA-N n-methoxyaniline Chemical compound CONC1=CC=CC=C1 NSBIQPJIWUJBBX-UHFFFAOYSA-N 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- DPBLXKKOBLCELK-UHFFFAOYSA-N pentan-1-amine Chemical compound CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical group 0.000 description 1
- 150000003112 potassium compounds Chemical class 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- PTWLOSARXIJRRJ-UHFFFAOYSA-N pyridin-1-ium-4-sulfonate Chemical compound OS(=O)(=O)C1=CC=NC=C1 PTWLOSARXIJRRJ-UHFFFAOYSA-N 0.000 description 1
- VOTYOVOSRFKUSM-UHFFFAOYSA-N pyridine-2,3,4-tricarboxylic acid Chemical compound OC(=O)C1=CC=NC(C(O)=O)=C1C(O)=O VOTYOVOSRFKUSM-UHFFFAOYSA-N 0.000 description 1
- IFLXVSWHQQZRQI-UHFFFAOYSA-N pyridine-2,4,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=C(C(O)=O)C=N1 IFLXVSWHQQZRQI-UHFFFAOYSA-N 0.000 description 1
- OYSBZLVHMPNJMR-UHFFFAOYSA-N pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC=CN=C1.OC(=O)C1=CC=CN=C1 OYSBZLVHMPNJMR-UHFFFAOYSA-N 0.000 description 1
- DVECLMOWYVDJRM-UHFFFAOYSA-N pyridine-3-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=CN=C1 DVECLMOWYVDJRM-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000009938 salting Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 230000001180 sulfating effect Effects 0.000 description 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
- 229960003080 taurine Drugs 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B47/00—Porphines; Azaporphines
- C09B47/04—Phthalocyanines abbreviation: Pc
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/503—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being an esterified or non-esterified hydroxyalkyl sulfonyl or mercaptoalkyl sulfonyl group, a quaternised or non-quaternised aminoalkyl sulfonyl group, a heterylmercapto alkyl sulfonyl group, a vinyl sulfonyl or a substituted vinyl sulfonyl group, or a thiophene-dioxide group
- C09B62/517—Porphines; Azaporphines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Investigating Or Analyzing Non-Biological Materials By The Use Of Chemical Means (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19813138864 DE3138864A1 (de) | 1981-09-30 | 1981-09-30 | Wasserloesliche faserreaktive phthalocyaninverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CS694982A2 CS694982A2 (en) | 1985-08-22 |
| CS241512B2 true CS241512B2 (en) | 1986-03-13 |
Family
ID=6143018
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS826949A CS241512B2 (en) | 1981-09-30 | 1982-09-29 | Method of water-soluble and fibre-reactive phthalocyanine derivatives production |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4576755A (enExample) |
| EP (1) | EP0075905B1 (enExample) |
| JP (1) | JPS5869257A (enExample) |
| KR (1) | KR890002349B1 (enExample) |
| AR (1) | AR247234A1 (enExample) |
| BR (1) | BR8205709A (enExample) |
| CS (1) | CS241512B2 (enExample) |
| DE (2) | DE3138864A1 (enExample) |
| IN (1) | IN158854B (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS61225256A (ja) * | 1985-03-29 | 1986-10-07 | Sumitomo Chem Co Ltd | 反応染料組成物 |
| DE3603124A1 (de) * | 1986-02-01 | 1987-08-06 | Hoechst Ag | Verfahren zur herstellung von wasserloeslichen phthalocyaninfarbstoffen |
| DE3727909A1 (de) * | 1987-08-21 | 1989-03-02 | Hoechst Ag | Wasserloesliche phthalocyaninverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| JP2590498B2 (ja) * | 1987-11-30 | 1997-03-12 | 住友化学工業株式会社 | 反応染料組成物およびそれを用いる繊維材料の染色方法 |
| DE4238047A1 (de) * | 1992-11-11 | 1994-05-19 | Basf Ag | Verfahren zur Herstellung von Phthalocyaninreaktivfarbstoffen |
| DE4242975A1 (de) * | 1992-12-18 | 1994-06-23 | Basf Ag | Verfahren zur Herstellung von Phthalocyaninreaktivfarbstoffen |
| EP0648815B1 (de) * | 1993-10-15 | 1998-07-29 | DyStar Textilfarben GmbH & Co. Deutschland KG | Wasserlösliche, metallfreie Phthalocyaninfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
| CH690649A5 (de) * | 1995-06-07 | 2000-11-30 | Clariant Finance Bvi Ltd | Phthalocyanin-Reaktivfarbstoffe für Fasern. |
| DE19529853A1 (de) * | 1995-08-14 | 1997-02-20 | Bayer Ag | Aluminium-Phthalocyanin-Reaktivfarbstoffe |
| KR100374122B1 (ko) * | 2000-03-31 | 2003-03-03 | 주식회사 한국 지오텍 | 소일시멘트에 고강도 및 고내구성을 제공하는 고화재 |
| US9067824B1 (en) | 2010-02-17 | 2015-06-30 | Roman Cement, Llc | Modification of pozzolanic chemistry through blending |
| WO2013059339A1 (en) | 2011-10-20 | 2013-04-25 | Roman Cement, Llc | Particle packed cement-scm blends |
| US9272953B2 (en) | 2010-11-30 | 2016-03-01 | Roman Cement, Llc | High early strength cement-SCM blends |
| US10131575B2 (en) | 2017-01-10 | 2018-11-20 | Roman Cement, Llc | Use of quarry fines and/or limestone powder to reduce clinker content of cementitious compositions |
| US10737980B2 (en) | 2017-01-10 | 2020-08-11 | Roman Cement, Llc | Use of mineral fines to reduce clinker content of cementitious compositions |
| US12151974B2 (en) | 2017-01-10 | 2024-11-26 | Roman Cement, Llc | Use of mineral fines to reduce clinker content of cementitious compositions |
| US10730805B2 (en) | 2017-01-10 | 2020-08-04 | Roman Cement, Llc | Use of quarry fines and/or limestone powder to reduce clinker content of cementitious compositions |
| US11168029B2 (en) | 2017-01-10 | 2021-11-09 | Roman Cement, Llc | Use of mineral fines to reduce clinker content of cementitious compositions |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3062830A (en) * | 1959-11-27 | 1962-11-06 | Gen Aniline & Film Corp | Phthalocyanine dyestuffs |
| NL261956A (enExample) * | 1960-03-05 | |||
| NL130648C (enExample) * | 1964-03-26 | |||
| DE1283997B (de) * | 1965-01-02 | 1968-11-28 | Hoechst Ag | Verfahren zur Herstellung wasserloeslicher Phthalocyaninfarbstoffe |
| BE679914A (enExample) * | 1965-04-24 | 1966-10-03 | ||
| US4033980A (en) * | 1968-08-16 | 1977-07-05 | Hoechst Aktiengesellschaft | Phthalocyanine dyestuffs and process for preparing them |
| JPS5331923B2 (enExample) * | 1972-07-26 | 1978-09-05 | ||
| DE2745480A1 (de) * | 1977-10-10 | 1979-04-19 | Hoechst Ag | Verfahren zur herstellung von faserreaktiven farbstoffen, deren verwendung sowie mit ihnen gefaerbtes leder und fasermaterialien |
| DE2824211B2 (de) * | 1978-06-02 | 1980-03-13 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Hersstellung wasserlöslicher Phthalocyaninfarbstoffe |
-
1981
- 1981-09-30 DE DE19813138864 patent/DE3138864A1/de not_active Withdrawn
-
1982
- 1982-09-23 IN IN1099/CAL/82A patent/IN158854B/en unknown
- 1982-09-25 EP EP82108890A patent/EP0075905B1/de not_active Expired
- 1982-09-25 DE DE8282108890T patent/DE3268573D1/de not_active Expired
- 1982-09-28 KR KR8204372A patent/KR890002349B1/ko not_active Expired
- 1982-09-28 AR AR82290783A patent/AR247234A1/es active
- 1982-09-29 CS CS826949A patent/CS241512B2/cs unknown
- 1982-09-29 BR BR8205709A patent/BR8205709A/pt not_active IP Right Cessation
- 1982-09-29 JP JP57168683A patent/JPS5869257A/ja active Pending
-
1984
- 1984-10-15 US US06/660,266 patent/US4576755A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| EP0075905A2 (de) | 1983-04-06 |
| JPS5869257A (ja) | 1983-04-25 |
| EP0075905B1 (de) | 1986-01-15 |
| KR890002349B1 (ko) | 1989-07-01 |
| IN158854B (enExample) | 1987-02-07 |
| BR8205709A (pt) | 1983-08-30 |
| EP0075905A3 (en) | 1983-08-03 |
| AR247234A1 (es) | 1994-11-30 |
| KR840001611A (ko) | 1984-05-16 |
| CS694982A2 (en) | 1985-08-22 |
| DE3138864A1 (de) | 1983-04-14 |
| DE3268573D1 (en) | 1986-02-27 |
| US4576755A (en) | 1986-03-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS241512B2 (en) | Method of water-soluble and fibre-reactive phthalocyanine derivatives production | |
| JPS6239179B2 (enExample) | ||
| US4237050A (en) | Process for the preparation of water-soluble phthalocyanine dyestuffs | |
| KR100327053B1 (ko) | 아미노나프탈렌계열에서유래한커플링성분을함유한반응성아조염료 | |
| US4745187A (en) | Process for the preparation of water-soluble phthalocyanine dyestuffs | |
| US4033980A (en) | Phthalocyanine dyestuffs and process for preparing them | |
| US4350632A (en) | Water-soluble phthalocyanine compounds | |
| JP2598065B2 (ja) | ホルマザン―銅錯化合物および該化合物を染料として使用する方法 | |
| US4397649A (en) | Water-soluble phthalocyanine sulfonyl cyanamide compounds, process for their manufacture and their use as dyestuffs | |
| US5453501A (en) | Phthalocyanine reactive dyestuffs | |
| US5856472A (en) | Reactive aluminum phthalocyanine dyestuffs, processes for their preparation and their use | |
| EP0611259A1 (en) | Fibre-reactive phthalocyanine dyes | |
| JPS6256188B2 (enExample) | ||
| CA1120209A (en) | Process for the preparation of fiber-reactive dyestuffs | |
| JPH07196938A (ja) | 水溶性の金属不含フタロシアニン染料、その製法及び 使用法 | |
| CA2135555A1 (en) | Water-soluble phthalocyanine dyes, preparation thereof and use thereof | |
| US5359043A (en) | Reactive dyes having a sulphonamido group | |
| US3278548A (en) | Water-soluble phthalocyanine dyestuffs | |
| DE3931140A1 (de) | Reaktivfarbstoffe | |
| GB2024837A (en) | Process for the Preparation of Water-Soluble Phthalocyanine Dyestuffs | |
| KR0131760B1 (ko) | 프탈로시아닌 화합물 및 이를 사용하기 유기 기재를 염색 또는 프린팅하는 방법 | |
| DE2906442A1 (de) | Verfahren zur herstellung wasserloeslicher phthalocyaninfarbstoffe | |
| JPS626591B2 (enExample) | ||
| JPS5949263A (ja) | 水溶性銅錯−ジスアゾ化合物、その製法及び該化合物を染料として使用する方法 | |
| HK1009282B (en) | Fibre-reactive phthalocyanine dyes |