CS228920B2 - Method of preparing chloromethylester of penicillanic acid derivative - Google Patents
Method of preparing chloromethylester of penicillanic acid derivative Download PDFInfo
- Publication number
- CS228920B2 CS228920B2 CS822015A CS201582A CS228920B2 CS 228920 B2 CS228920 B2 CS 228920B2 CS 822015 A CS822015 A CS 822015A CS 201582 A CS201582 A CS 201582A CS 228920 B2 CS228920 B2 CS 228920B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- penicillanic acid
- formula
- chloromethyl
- concentrated
- methylene chloride
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 18
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical class OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 title claims abstract description 11
- -1 halomethyl ester Chemical class 0.000 claims abstract description 28
- JPOXNPPZZKNXOV-UHFFFAOYSA-N bromochloromethane Chemical compound ClCBr JPOXNPPZZKNXOV-UHFFFAOYSA-N 0.000 claims abstract description 22
- PJGJQVRXEUVAFT-UHFFFAOYSA-N chloroiodomethane Chemical compound ClCI PJGJQVRXEUVAFT-UHFFFAOYSA-N 0.000 claims abstract description 17
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 claims abstract description 12
- 150000001875 compounds Chemical class 0.000 claims description 14
- 238000006243 chemical reaction Methods 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- FKENQMMABCRJMK-RITPCOANSA-N sulbactam Chemical compound O=S1(=O)C(C)(C)[C@H](C(O)=O)N2C(=O)C[C@H]21 FKENQMMABCRJMK-RITPCOANSA-N 0.000 abstract description 13
- 238000001727 in vivo Methods 0.000 abstract description 7
- 229930182555 Penicillin Natural products 0.000 abstract description 6
- 239000002253 acid Substances 0.000 abstract description 6
- 238000002360 preparation method Methods 0.000 abstract description 5
- 239000003781 beta lactamase inhibitor Substances 0.000 abstract description 4
- 229940126813 beta-lactamase inhibitor Drugs 0.000 abstract description 4
- 150000005621 tetraalkylammonium salts Chemical class 0.000 abstract description 4
- 229940126085 β‑Lactamase Inhibitor Drugs 0.000 abstract description 4
- 150000007513 acids Chemical class 0.000 abstract description 3
- 150000002960 penicillins Chemical class 0.000 abstract description 3
- 230000000844 anti-bacterial effect Effects 0.000 abstract description 2
- 230000015572 biosynthetic process Effects 0.000 abstract description 2
- 238000003786 synthesis reaction Methods 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 57
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 54
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- 239000000203 mixture Substances 0.000 description 17
- 239000000047 product Substances 0.000 description 17
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 13
- 239000010410 layer Substances 0.000 description 13
- 239000002904 solvent Substances 0.000 description 12
- VDZOOKBUILJEDG-UHFFFAOYSA-M tetrabutylammonium hydroxide Chemical compound [OH-].CCCC[N+](CCCC)(CCCC)CCCC VDZOOKBUILJEDG-UHFFFAOYSA-M 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000000543 intermediate Substances 0.000 description 9
- DZLFLBLQUQXARW-UHFFFAOYSA-N tetrabutylammonium Chemical class CCCC[N+](CCCC)(CCCC)CCCC DZLFLBLQUQXARW-UHFFFAOYSA-N 0.000 description 9
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 8
- 235000011152 sodium sulphate Nutrition 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000003242 anti bacterial agent Substances 0.000 description 6
- 239000003480 eluent Substances 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 229940088710 antibiotic agent Drugs 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 150000003457 sulfones Chemical class 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 229940049954 penicillin Drugs 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 108090000204 Dipeptidase 1 Proteins 0.000 description 2
- XLYOFNOQVPJJNP-ZSJDYOACSA-N Heavy water Chemical compound [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 102000006635 beta-lactamase Human genes 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- ZXUCBXRTRRIBSO-UHFFFAOYSA-L tetrabutylazanium;sulfate Chemical compound [O-]S([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC ZXUCBXRTRRIBSO-UHFFFAOYSA-L 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- 150000003952 β-lactams Chemical class 0.000 description 2
- 208000035143 Bacterial infection Diseases 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 239000003782 beta lactam antibiotic agent Substances 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- AKDMNWSBLXHXGL-RQJHMYQMSA-N chloromethyl (2s,5r)-3,3-dimethyl-4,4,7-trioxo-4$l^{6}-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound O=S1(=O)C(C)(C)[C@H](C(=O)OCCl)N2C(=O)C[C@H]21 AKDMNWSBLXHXGL-RQJHMYQMSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000004970 halomethyl group Chemical group 0.000 description 1
- VHHHONWQHHHLTI-UHFFFAOYSA-N hexachloroethane Chemical compound ClC(Cl)(Cl)C(Cl)(Cl)Cl VHHHONWQHHHLTI-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- IDGRWZVETHXBNT-UHFFFAOYSA-N methyl 3-[(2-amino-2-oxo-1-phenylethyl)amino]but-2-enoate Chemical compound COC(=O)C=C(C)NC(C(N)=O)C1=CC=CC=C1 IDGRWZVETHXBNT-UHFFFAOYSA-N 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- LVCJBUWIZQQMSU-IBTYICNHSA-M sodium;(2s,5r)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound [Na+].[O-]C(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 LVCJBUWIZQQMSU-IBTYICNHSA-M 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- LPSKDVINWQNWFE-UHFFFAOYSA-M tetrapropylazanium;hydroxide Chemical compound [OH-].CCC[N+](CCC)(CCC)CCC LPSKDVINWQNWFE-UHFFFAOYSA-M 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000002132 β-lactam antibiotic Substances 0.000 description 1
- 229940124586 β-lactam antibiotics Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Cephalosporin Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS831991A CS228947B2 (cs) | 1981-03-23 | 1983-03-23 | Způsob výroby pznicilanoyloxymathylderivátfi 1,1-dioiúdu penicilanové kyseliny |
| CS831992A CS228948B2 (cs) | 1981-03-23 | 1983-03-23 | Způsob výroby penicilanoyloxymethylderivátů 1,1-dioxidu penicilanové kyseliny |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US24648281A | 1981-03-23 | 1981-03-23 | |
| US06/341,081 US4381263A (en) | 1981-03-23 | 1982-01-25 | Process for the preparation of penicillanic acid esters |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS228920B2 true CS228920B2 (en) | 1984-05-14 |
Family
ID=26938011
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS822015A CS228920B2 (en) | 1981-03-23 | 1982-03-23 | Method of preparing chloromethylester of penicillanic acid derivative |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US4381263A (OSRAM) |
| EP (1) | EP0061284B1 (OSRAM) |
| KR (1) | KR860001367B1 (OSRAM) |
| AU (1) | AU535417B2 (OSRAM) |
| BG (2) | BG38938A3 (OSRAM) |
| CA (1) | CA1182107A (OSRAM) |
| CS (1) | CS228920B2 (OSRAM) |
| DD (2) | DD202435A5 (OSRAM) |
| DE (1) | DE3270720D1 (OSRAM) |
| DK (1) | DK161969C (OSRAM) |
| EG (1) | EG15908A (OSRAM) |
| ES (2) | ES8305771A1 (OSRAM) |
| FI (1) | FI75165C (OSRAM) |
| GB (1) | GB2095665A (OSRAM) |
| GR (1) | GR75939B (OSRAM) |
| HU (1) | HU189124B (OSRAM) |
| IE (1) | IE52813B1 (OSRAM) |
| IL (1) | IL65309A (OSRAM) |
| IN (1) | IN157712B (OSRAM) |
| MX (1) | MX174205B (OSRAM) |
| NO (2) | NO164598C (OSRAM) |
| NZ (1) | NZ200067A (OSRAM) |
| PH (2) | PH18608A (OSRAM) |
| PL (1) | PL130866B1 (OSRAM) |
| PT (1) | PT74622B (OSRAM) |
| RO (2) | RO87039B1 (OSRAM) |
| YU (2) | YU42762B (OSRAM) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4704456A (en) * | 1985-11-22 | 1987-11-03 | Pfizer Inc. | Process for sultamicillin intermediate |
| JPH01139584A (ja) * | 1987-11-25 | 1989-06-01 | Yoshitomi Pharmaceut Ind Ltd | ペニシラン酸化合物の製造法 |
| GB8808701D0 (en) * | 1988-04-13 | 1988-05-18 | Erba Carlo Spa | Beta-lactam derivatives |
| ATE108797T1 (de) * | 1990-04-13 | 1994-08-15 | Pfizer | Verfahren für sultamicillinzwischenprodukt. |
| ES2161602B1 (es) * | 1999-04-08 | 2003-02-16 | Asturpharma S A | Sintesis de 6-(d-alfa-(bencilidenaminofenilacetamido))penicilanato de 1,1-dioxopenicilanoiloximetilo y analogos. nuevos intermedios para la sintesis de sultamicilina. |
| RU2167162C1 (ru) * | 2000-02-28 | 2001-05-20 | Савельев Евгений Александрович | Способ получения гидроиодида диэтиламиноэтилового эфира бензилпенициллина |
| CN100384857C (zh) * | 2003-11-28 | 2008-04-30 | 浙江永宁制药厂 | 耐β-内酰胺酶的头孢菌素酯化合物及其盐 |
| CN112724162B (zh) * | 2020-12-28 | 2022-06-10 | 华南农业大学 | 一种阿莫西林-舒巴坦杂合分子的合成方法及应用 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5248992B1 (OSRAM) * | 1971-07-08 | 1977-12-14 | ||
| US4234579A (en) * | 1977-06-07 | 1980-11-18 | Pfizer Inc. | Penicillanic acid 1,1-dioxides as β-lactamase inhibitors |
| KR830001903B1 (ko) | 1979-02-13 | 1983-09-19 | 레오 파마슈티칼 프로덕츠 리미티드 | 페니실란산유도체의 제조방법 |
| IE49880B1 (en) | 1979-02-13 | 1986-01-08 | Leo Pharm Prod Ltd | Penicillin derivatives |
| US4244951A (en) * | 1979-05-16 | 1981-01-13 | Pfizer Inc. | Bis-esters of methanediol with penicillins and penicillanic acid 1,1-dioxide |
| IE50650B1 (en) * | 1979-10-11 | 1986-06-11 | Leo Pharm Prod Ltd | Method for producing penicillanic acid derivatives |
-
1982
- 1982-01-25 US US06/341,081 patent/US4381263A/en not_active Expired - Lifetime
- 1982-02-16 IN IN127/DEL/82A patent/IN157712B/en unknown
- 1982-03-15 BG BG055783A patent/BG38938A3/xx unknown
- 1982-03-15 BG BG068275A patent/BG38940A3/xx unknown
- 1982-03-16 DE DE8282301323T patent/DE3270720D1/de not_active Expired
- 1982-03-16 EP EP82301323A patent/EP0061284B1/en not_active Expired
- 1982-03-16 GB GB8207651A patent/GB2095665A/en active Pending
- 1982-03-18 GR GR67645A patent/GR75939B/el unknown
- 1982-03-19 DD DD82238309A patent/DD202435A5/de not_active IP Right Cessation
- 1982-03-19 NZ NZ200067A patent/NZ200067A/en unknown
- 1982-03-19 DD DD82251832A patent/DD209835A5/de not_active IP Right Cessation
- 1982-03-21 EG EG147/82A patent/EG15908A/xx active
- 1982-03-22 YU YU621/82A patent/YU42762B/xx unknown
- 1982-03-22 PH PH27038A patent/PH18608A/en unknown
- 1982-03-22 KR KR8201221A patent/KR860001367B1/ko not_active Expired
- 1982-03-22 NO NO820924A patent/NO164598C/no not_active IP Right Cessation
- 1982-03-22 IE IE658/82A patent/IE52813B1/en unknown
- 1982-03-22 HU HU82853A patent/HU189124B/hu unknown
- 1982-03-22 ES ES510658A patent/ES8305771A1/es not_active Expired
- 1982-03-22 MX MX005355A patent/MX174205B/es unknown
- 1982-03-22 RO RO112622A patent/RO87039B1/ro unknown
- 1982-03-22 AU AU81765/82A patent/AU535417B2/en not_active Expired
- 1982-03-22 PT PT74622A patent/PT74622B/pt unknown
- 1982-03-22 FI FI820993A patent/FI75165C/fi not_active IP Right Cessation
- 1982-03-22 CA CA000398978A patent/CA1182107A/en not_active Expired
- 1982-03-22 IL IL65309A patent/IL65309A/xx not_active IP Right Cessation
- 1982-03-22 DK DK127282A patent/DK161969C/da not_active IP Right Cessation
- 1982-03-22 RO RO106987A patent/RO83707B/ro unknown
- 1982-03-23 PL PL1982235577A patent/PL130866B1/pl unknown
- 1982-03-23 CS CS822015A patent/CS228920B2/cs unknown
-
1983
- 1983-01-17 ES ES519053A patent/ES519053A0/es active Granted
- 1983-03-24 NO NO831057A patent/NO831057L/no unknown
- 1983-10-06 PH PH29662A patent/PH18487A/en unknown
-
1984
- 1984-09-21 YU YU1629/84A patent/YU42904B/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU1436882A3 (ru) | Способ получени дифенилметилового эфира 7-бензилиденамино-3-(3-хлор-1-пропен-1-ил)-3-цефем-4-карбоновой кислоты | |
| CS228920B2 (en) | Method of preparing chloromethylester of penicillanic acid derivative | |
| US3875146A (en) | Process to prepare intermediates for the preparation of cephalosporins and penicillins | |
| US3998817A (en) | Process for producing cephalosporanic acid derivatives | |
| US3996236A (en) | Methoxymethyl D-6-(2,2-dimethyl-5-oxo-4-phenyl-1-imidazolidinyl)penicillanate | |
| EP0022326B1 (en) | Process for chemically removing the acyl sidechain from cephalosporins and penicillins | |
| US4258183A (en) | Process for the preparation of cephalosporin compounds | |
| EP0054397B1 (en) | Process for preparing esters of penicillanic acid sulfone | |
| EP0096496B1 (en) | Preparation of penicillin and cephalosporin compounds and novel intermediates useful therein | |
| CS228948B2 (cs) | Způsob výroby penicilanoyloxymethylderivátů 1,1-dioxidu penicilanové kyseliny | |
| EP0117872A1 (en) | Process for preparing cephalosporin compounds | |
| JPH0446958B2 (OSRAM) | ||
| US3978053A (en) | Process for producing cephalosporins | |
| US3971776A (en) | Thio-β-lactam penicillins | |
| CS203983B2 (en) | Method of preparing ester of 7-acylamido-3-methyl-3-cephem-4-carboxylic acid | |
| EP0120094B1 (en) | Azetidinone compounds | |
| US3994911A (en) | Intermediate for producing semi-synthetic penicillins and cephalosporins | |
| US4035502A (en) | Acylaminopenicillanic acids and process for preparing them | |
| US3933810A (en) | Intermediates for producing semi-synthetic cephalosporins | |
| CA1040192A (en) | Intermediates for producing semi-synthetic penicillins and methods of production | |
| KR860001369B1 (ko) | 페니실란산 에스테르류의 제조 방법 | |
| FI75167B (fi) | Foerbaettrat foerfarande foer framstaellning av 6-beta-substituerad penicillanoyloximetyl-penicillanat- 1,1-dioxid. | |
| US4206211A (en) | Cephalosporins | |
| GB2047682A (en) | 3-carbamoyloxymethyl- cephalosporins | |
| IE41636B1 (en) | Penicillin-type antibiotic and process for producing same |