CS207365B2 - Fungicide means - Google Patents
Fungicide means Download PDFInfo
- Publication number
- CS207365B2 CS207365B2 CS765664A CS566476A CS207365B2 CS 207365 B2 CS207365 B2 CS 207365B2 CS 765664 A CS765664 A CS 765664A CS 566476 A CS566476 A CS 566476A CS 207365 B2 CS207365 B2 CS 207365B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- group
- alkyl
- carbon atoms
- cyano
- hydrogen atom
- Prior art date
Links
- 239000000417 fungicide Substances 0.000 title abstract 2
- 230000000855 fungicidal effect Effects 0.000 title description 9
- 239000000203 mixture Substances 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 18
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- 239000004094 surface-active agent Substances 0.000 claims description 8
- 239000004480 active ingredient Substances 0.000 claims description 7
- 238000009835 boiling Methods 0.000 claims description 6
- PDPXDCJIWXCDKC-UHFFFAOYSA-N 2-pyridin-3-yl-1,2-oxazolidine Chemical class C1CCON1C1=CC=CN=C1 PDPXDCJIWXCDKC-UHFFFAOYSA-N 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 150000001408 amides Chemical class 0.000 claims description 3
- 150000001336 alkenes Chemical class 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000005110 aryl thio group Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 3
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 2
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims 1
- 241001611408 Nebo Species 0.000 claims 1
- CRXWWEHMNMUKQQ-UHFFFAOYSA-N 2-phenyl-3-pyridin-3-yl-1,2-oxazolidine Chemical class O1CCC(C=2C=NC=CC=2)N1C1=CC=CC=C1 CRXWWEHMNMUKQQ-UHFFFAOYSA-N 0.000 abstract 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- 229910052739 hydrogen Inorganic materials 0.000 description 12
- -1 acyl radical Chemical class 0.000 description 8
- 229910052799 carbon Inorganic materials 0.000 description 8
- 125000001309 chloro group Chemical group Cl* 0.000 description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 8
- 201000010099 disease Diseases 0.000 description 7
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 7
- 231100000331 toxic Toxicity 0.000 description 7
- 230000002588 toxic effect Effects 0.000 description 7
- 239000007787 solid Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- 238000004458 analytical method Methods 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 241000209219 Hordeum Species 0.000 description 4
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 4
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 206010017711 Gangrene Diseases 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- CWGBFIRHYJNILV-UHFFFAOYSA-N (1,4-diphenyl-1,2,4-triazol-4-ium-3-yl)-phenylazanide Chemical compound C=1C=CC=CC=1[N-]C1=NN(C=2C=CC=CC=2)C=[N+]1C1=CC=CC=C1 CWGBFIRHYJNILV-UHFFFAOYSA-N 0.000 description 2
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- 241001480061 Blumeria graminis Species 0.000 description 2
- 241000196324 Embryophyta Species 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- FJKIXWOMBXYWOQ-UHFFFAOYSA-N ethenoxyethane Chemical compound CCOC=C FJKIXWOMBXYWOQ-UHFFFAOYSA-N 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 238000011081 inoculation Methods 0.000 description 2
- 239000000391 magnesium silicate Substances 0.000 description 2
- 235000012243 magnesium silicates Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 230000000149 penetrating effect Effects 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000004546 suspension concentrate Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 1
- 125000006823 (C1-C6) acyl group Chemical group 0.000 description 1
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- DGXRGGUNBXNJRI-UHFFFAOYSA-N 2-methyl-4-octylphenol Chemical compound CCCCCCCCC1=CC=C(O)C(C)=C1 DGXRGGUNBXNJRI-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- NTDQQZYCCIDJRK-UHFFFAOYSA-N 4-octylphenol Chemical compound CCCCCCCCC1=CC=C(O)C=C1 NTDQQZYCCIDJRK-UHFFFAOYSA-N 0.000 description 1
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 101100515516 Arabidopsis thaliana XI-H gene Proteins 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 239000004141 Sodium laurylsulphate Substances 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- LCIIOYPBHIZBOD-JMVBYTIWSA-N albonoursin Chemical compound N1C(=O)C(=C/C(C)C)/NC(=O)\C1=C\C1=CC=CC=C1 LCIIOYPBHIZBOD-JMVBYTIWSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000006350 alkyl thio alkyl group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- SNAAJJQQZSMGQD-UHFFFAOYSA-N aluminum magnesium Chemical compound [Mg].[Al] SNAAJJQQZSMGQD-UHFFFAOYSA-N 0.000 description 1
- 230000002528 anti-freeze Effects 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical class [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000011737 fluorine Chemical group 0.000 description 1
- 229910052731 fluorine Chemical group 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 150000002546 isoxazolidines Chemical class 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 239000011344 liquid material Substances 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 239000012184 mineral wax Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- GMFTWYLJGUKTPW-UHFFFAOYSA-N n-(4-chlorophenyl)-1-pyridin-3-ylmethanimine oxide Chemical compound C=1C=C(Cl)C=CC=1[N+]([O-])=CC1=CC=CN=C1 GMFTWYLJGUKTPW-UHFFFAOYSA-N 0.000 description 1
- CYUFEUPOIZWLMY-UHFFFAOYSA-N n-(4-fluorophenyl)-1-pyridin-3-ylmethanimine oxide Chemical compound C=1C=C(F)C=CC=1[N+]([O-])=CC1=CC=CN=C1 CYUFEUPOIZWLMY-UHFFFAOYSA-N 0.000 description 1
- ZGEPURVLQPMQKC-UHFFFAOYSA-N n-phenyl-1-pyridin-3-ylmethanimine oxide Chemical compound C=1C=CC=CC=1[N+]([O-])=CC1=CC=CN=C1 ZGEPURVLQPMQKC-UHFFFAOYSA-N 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 230000028070 sporulation Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical class OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000002426 superphosphate Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 235000019354 vermiculite Nutrition 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/80—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with one nitrogen atom and either one oxygen atom or one sulfur atom in positions 1,2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB36093/75A GB1540580A (en) | 1975-09-02 | 1975-09-02 | Fungicidal isoxazolidines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS207365B2 true CS207365B2 (en) | 1981-07-31 |
Family
ID=10384878
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS765664A CS207365B2 (en) | 1975-09-02 | 1976-08-31 | Fungicide means |
Country Status (29)
| Country | Link |
|---|---|
| US (1) | US4066770A (enExample) |
| JP (2) | JPS6025405B2 (enExample) |
| AR (1) | AR219285A1 (enExample) |
| AT (1) | AT349266B (enExample) |
| AU (1) | AU503962B2 (enExample) |
| BE (1) | BE845519A (enExample) |
| BG (1) | BG24935A3 (enExample) |
| BR (1) | BR7605763A (enExample) |
| CA (2) | CA1087189A (enExample) |
| CH (1) | CH621684A5 (enExample) |
| CS (1) | CS207365B2 (enExample) |
| DD (1) | DD126880A5 (enExample) |
| DE (1) | DE2639189A1 (enExample) |
| DK (2) | DK394176A (enExample) |
| ES (1) | ES451117A1 (enExample) |
| FR (1) | FR2322541A1 (enExample) |
| GB (1) | GB1540580A (enExample) |
| HU (1) | HU175665B (enExample) |
| IE (1) | IE44163B1 (enExample) |
| IL (1) | IL50387A (enExample) |
| IT (1) | IT1074027B (enExample) |
| LU (1) | LU75696A1 (enExample) |
| NL (1) | NL7609664A (enExample) |
| NZ (1) | NZ181904A (enExample) |
| PL (1) | PL101382B1 (enExample) |
| PT (1) | PT65535B (enExample) |
| RO (1) | RO70349A (enExample) |
| SU (1) | SU621301A3 (enExample) |
| ZA (1) | ZA765219B (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4138402A (en) * | 1976-08-26 | 1979-02-06 | Shell Oil Company | 3-Pyrid-3-ylisoxazolidine fungicides |
| US4443455A (en) * | 1978-02-17 | 1984-04-17 | Imperial Chemical Industries Plc | Fungidical thiazolidinones |
| US4443454A (en) * | 1978-02-17 | 1984-04-17 | Imperial Chemical Industries Plc | Thiazolidinones |
| US4239889A (en) * | 1978-06-27 | 1980-12-16 | Shell Oil Company | 3-(N-Heterocyclyl)isoxazolidine fungicides |
| US4436739A (en) | 1978-10-16 | 1984-03-13 | Eli Lilly And Company | Substituted 1-thia-3-aza-4-ones |
| US4482712A (en) * | 1978-10-16 | 1984-11-13 | Eli Lilly And Company | Substituted 1-thia-3-aza-4-ones |
| JPS56114536A (en) * | 1980-02-13 | 1981-09-09 | Toshiba Corp | Joining device of sheet material |
| JPS58202942A (ja) * | 1982-05-24 | 1983-11-26 | Amada Co Ltd | 金属板接合方法 |
| JPS62104633A (ja) * | 1985-11-01 | 1987-05-15 | Alps Electric Co Ltd | 板状部材の固定方法 |
| DE3643957A1 (de) * | 1986-12-22 | 1988-06-30 | Bayer Ag | Substituierte n-methylisoxazolidine |
| DE3934743A1 (de) * | 1989-10-18 | 1991-04-25 | Eckold Vorrichtung | Verfahren zum verbinden zweier bauteile |
| GB2264299B (en) * | 1992-02-19 | 1995-07-26 | British Tech Group | Iso-oxazolidine derivatives |
| GB9226857D0 (en) * | 1992-12-23 | 1993-02-17 | Boyd Edward A | Pharmaceutical compositions |
| AU770077B2 (en) * | 1999-03-11 | 2004-02-12 | Dow Agrosciences Llc | Heterocyclic substituted isoxazolidines and their use as fungicides |
| CN1091444C (zh) * | 1999-07-14 | 2002-09-25 | 沈阳化工研究院 | 用作杀菌剂的杂环取代的异噁唑啉类化合物 |
| US8980892B2 (en) | 2009-03-26 | 2015-03-17 | Syngenta Crop Protection Llc | Insecticidal compounds |
| RU2634717C2 (ru) * | 2015-12-10 | 2017-11-03 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Российский химико-технологический университет имени Д.И. Менделеева (РХТУ им. Д.И. Менделеева) | Замещенные 3-(3-пиридил)изоксазолидины, обладающие фунгицидной активностью |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE569324A (enExample) * | 1957-07-11 | |||
| US3849423A (en) * | 1971-03-22 | 1974-11-19 | Lilly Co Eli | 3-benzylpyridines |
| DE2445645C3 (de) * | 1974-09-25 | 1982-03-04 | Alfred Teves Gmbh, 6000 Frankfurt | Selbsttätige Nachstellvorrichtung für den Betätigungskolben eines mit Druckmittel beaufschlagbaren Bremszylinders, insbesondere für Teilbelag-Scheibenbremsen von Fahrzeugen |
-
1975
- 1975-09-02 GB GB36093/75A patent/GB1540580A/en not_active Expired
-
1976
- 1976-08-09 CA CA258,730A patent/CA1087189A/en not_active Expired
- 1976-08-26 US US05/717,803 patent/US4066770A/en not_active Expired - Lifetime
- 1976-08-26 BE BE1007580A patent/BE845519A/xx unknown
- 1976-08-31 PL PL1976192123A patent/PL101382B1/pl unknown
- 1976-08-31 NL NL7609664A patent/NL7609664A/xx not_active Application Discontinuation
- 1976-08-31 ES ES451117A patent/ES451117A1/es not_active Expired
- 1976-08-31 CS CS765664A patent/CS207365B2/cs unknown
- 1976-08-31 IL IL50387A patent/IL50387A/xx unknown
- 1976-08-31 AR AR264536A patent/AR219285A1/es active
- 1976-08-31 FR FR7626239A patent/FR2322541A1/fr active Granted
- 1976-08-31 AT AT645976A patent/AT349266B/de not_active IP Right Cessation
- 1976-08-31 PT PT65535A patent/PT65535B/pt unknown
- 1976-08-31 BR BR7605763A patent/BR7605763A/pt unknown
- 1976-08-31 ZA ZA765219A patent/ZA765219B/xx unknown
- 1976-08-31 IT IT26724/76A patent/IT1074027B/it active
- 1976-08-31 LU LU75696A patent/LU75696A1/xx unknown
- 1976-08-31 IE IE1932/76A patent/IE44163B1/en unknown
- 1976-08-31 JP JP51103268A patent/JPS6025405B2/ja not_active Expired
- 1976-08-31 BG BG034119A patent/BG24935A3/xx unknown
- 1976-08-31 RO RO7687408A patent/RO70349A/ro unknown
- 1976-08-31 DK DK394176A patent/DK394176A/da unknown
- 1976-08-31 CH CH1102976A patent/CH621684A5/de not_active IP Right Cessation
- 1976-08-31 AU AU17322/76A patent/AU503962B2/en not_active Expired
- 1976-08-31 DE DE19762639189 patent/DE2639189A1/de not_active Withdrawn
- 1976-08-31 NZ NZ181904A patent/NZ181904A/xx unknown
- 1976-08-31 SU SU762392302A patent/SU621301A3/ru active
- 1976-09-02 HU HU76SE1843A patent/HU175665B/hu unknown
- 1976-09-02 DD DD194577A patent/DD126880A5/xx unknown
-
1980
- 1980-02-13 CA CA345,472A patent/CA1104056A/en not_active Expired
- 1980-02-29 DK DK89380A patent/DK89380A/da unknown
-
1983
- 1983-08-30 JP JP58157262A patent/JPS59130287A/ja active Pending
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS207365B2 (en) | Fungicide means | |
| RU2126408C1 (ru) | Производные триазолопиримидина, способ их получения, фунгицидный состав, способ борьбы с грибами | |
| JPH05271207A (ja) | 置換ニトログアニジン誘導体、その製造方法及び殺虫剤 | |
| EP0013581B1 (en) | Tetrahydrofuran derivatives, a process for their preparation, herbicidal compositions containing them and a method of controlling undesired plant growth using them | |
| US2953491A (en) | Fungicide | |
| JPH0676394B2 (ja) | 1、3―チアゾール誘導体、それらの製造方法および殺虫組成物 | |
| US3564606A (en) | 3-amino-5-halogenated aryloxymethyl-1,2,4-oxadiazoles | |
| EP0514987A1 (en) | Herbicidal compounds | |
| DK156439B (da) | 7-substituerede 2,3-dihydrobenzofuranderivater samt pesticidpraeparater indeholdende disse og en fremgangsmaade til bekaempelse af skadelige organismer | |
| EP0191514B1 (en) | Imidazole derivatives, their preparation and their use as fungicides | |
| JPS62267277A (ja) | ベンゾチアジノン誘導体 | |
| US2971884A (en) | Method for the control of fungal organisms | |
| SU741773A3 (ru) | Акарицидный состав | |
| EP0300574B1 (en) | Phosphonium salts | |
| US3780052A (en) | Triazoline phosphates | |
| EP0120480B1 (en) | 4h-3,1-benzoxazine derivatives, process for producing the same and agricultural or horticultural fungicide containing the same | |
| US4138402A (en) | 3-Pyrid-3-ylisoxazolidine fungicides | |
| US4239889A (en) | 3-(N-Heterocyclyl)isoxazolidine fungicides | |
| IL26433A (en) | Oregano complex compounds - tin that are the result of phosphoric acid and their preparation | |
| KR800000490B1 (ko) | 3-피리딜 이소옥사졸리딘류의 제조방법 | |
| EP0091148B1 (en) | Fungicidal heterocyclic compounds | |
| US3213103A (en) | New biocidal bis (dimethylamido) phosphorylamino-triazole-1, 2, 4 derivatives | |
| US3694434A (en) | 2,6-diorgano-1,5-dithia-2,6-diazacyclooctane-3,4,7,8-tetraones and their manufacture | |
| US3694435A (en) | 4,4,8,8-tetrachloro-2,6-diorgano-15-dithia-2,6-diazacyclo-octane-3,7-diones and their manufacture | |
| IL26979A (en) | 4-phosphinothioyl-1,3,4-thiadiazol-5(4h)-one derivatives and pesticidal compositions containing them |