CS198150B2 - Method for the isolation of crystalline terephthalic acid as a product with p-toluyl acid content up to 150 ppm from liquid water solutions - Google Patents
Method for the isolation of crystalline terephthalic acid as a product with p-toluyl acid content up to 150 ppm from liquid water solutions Download PDFInfo
- Publication number
- CS198150B2 CS198150B2 CS745779A CS577974A CS198150B2 CS 198150 B2 CS198150 B2 CS 198150B2 CS 745779 A CS745779 A CS 745779A CS 577974 A CS577974 A CS 577974A CS 198150 B2 CS198150 B2 CS 198150B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- terephthalic acid
- temperature
- acid
- ppm
- product
- Prior art date
Links
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title claims abstract description 336
- 238000000034 method Methods 0.000 title claims abstract description 50
- 239000007788 liquid Substances 0.000 title claims abstract description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title claims description 30
- 239000002253 acid Substances 0.000 title claims description 22
- 238000002955 isolation Methods 0.000 title claims description 3
- 125000005440 p-toluyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C(*)=O)C([H])([H])[H] 0.000 title 1
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 claims abstract description 140
- 239000002904 solvent Substances 0.000 claims abstract description 18
- 239000007864 aqueous solution Substances 0.000 claims abstract description 12
- 229920006395 saturated elastomer Polymers 0.000 claims abstract description 5
- 230000003247 decreasing effect Effects 0.000 claims abstract description 4
- 238000002425 crystallisation Methods 0.000 claims description 71
- 230000008025 crystallization Effects 0.000 claims description 70
- 239000000047 product Substances 0.000 claims description 44
- 239000012527 feed solution Substances 0.000 claims description 20
- 238000001704 evaporation Methods 0.000 claims description 18
- 230000008020 evaporation Effects 0.000 claims description 18
- 238000001816 cooling Methods 0.000 claims description 16
- 239000012467 final product Substances 0.000 claims description 3
- 239000002002 slurry Substances 0.000 claims description 3
- 238000011084 recovery Methods 0.000 abstract 3
- 239000000243 solution Substances 0.000 description 31
- 230000000052 comparative effect Effects 0.000 description 10
- 238000011109 contamination Methods 0.000 description 9
- 238000000935 solvent evaporation Methods 0.000 description 9
- 239000013078 crystal Substances 0.000 description 8
- 230000001419 dependent effect Effects 0.000 description 7
- 239000002245 particle Substances 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- 239000007791 liquid phase Substances 0.000 description 6
- 238000009826 distribution Methods 0.000 description 5
- 238000000926 separation method Methods 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- GOUHYARYYWKXHS-UHFFFAOYSA-N 4-formylbenzoic acid Chemical compound OC(=O)C1=CC=C(C=O)C=C1 GOUHYARYYWKXHS-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 238000010924 continuous production Methods 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 238000009834 vaporization Methods 0.000 description 4
- 230000008016 vaporization Effects 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- 230000002902 bimodal effect Effects 0.000 description 2
- 238000005422 blasting Methods 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000003504 terephthalic acids Chemical class 0.000 description 2
- HLLSOEKIMZEGFV-UHFFFAOYSA-N 4-(dibutylsulfamoyl)benzoic acid Chemical compound CCCCN(CCCC)S(=O)(=O)C1=CC=C(C(O)=O)C=C1 HLLSOEKIMZEGFV-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000002547 anomalous effect Effects 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical compound C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- YLQWCDOCJODRMT-UHFFFAOYSA-N fluoren-9-one Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C2=C1 YLQWCDOCJODRMT-UHFFFAOYSA-N 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical compound CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- -1 p- toluyl Chemical group 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/42—Separation; Purification; Stabilisation; Use of additives
- C07C51/43—Separation; Purification; Stabilisation; Use of additives by change of the physical state, e.g. crystallisation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/389,717 US3931305A (en) | 1973-08-20 | 1973-08-20 | Terephthalic acid recovery by continuous flash crystallization |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS198150B2 true CS198150B2 (en) | 1980-05-30 |
Family
ID=23539427
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS745779A CS198150B2 (en) | 1973-08-20 | 1974-08-20 | Method for the isolation of crystalline terephthalic acid as a product with p-toluyl acid content up to 150 ppm from liquid water solutions |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US3931305A (fr) |
| JP (1) | JPS5324057B2 (fr) |
| BE (1) | BE818228A (fr) |
| BG (1) | BG31071A3 (fr) |
| BR (1) | BR7406531D0 (fr) |
| CA (1) | CA1019342A (fr) |
| CS (1) | CS198150B2 (fr) |
| DD (1) | DD115109A5 (fr) |
| DE (1) | DE2437846A1 (fr) |
| EG (1) | EG11555A (fr) |
| ES (1) | ES429400A1 (fr) |
| FR (1) | FR2241529B1 (fr) |
| GB (1) | GB1476436A (fr) |
| HU (1) | HU180065B (fr) |
| IN (1) | IN142341B (fr) |
| IT (1) | IT1018896B (fr) |
| NL (1) | NL7409866A (fr) |
| PL (1) | PL100195B1 (fr) |
| RO (1) | RO66116A (fr) |
| SU (1) | SU869554A3 (fr) |
| TR (1) | TR18050A (fr) |
| YU (1) | YU41043B (fr) |
Families Citing this family (80)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS51132395U (fr) * | 1975-04-14 | 1976-10-25 | ||
| GB1582255A (en) * | 1976-08-11 | 1981-01-07 | Ici Ltd | Crystallisation of terephthalic acid |
| DE3037045C2 (de) * | 1980-10-01 | 1987-02-26 | Dynamit Nobel Ag, 5210 Troisdorf | Verfahren zur Kristallisation in einem Lösungsmittel bis zur Sättigung gelöster Terephthalsäure und Kristallisationsvorrichtung |
| IT1163145B (it) * | 1983-03-11 | 1987-04-08 | Friuli Chim Spa | Preparazione di acido benzoico puro |
| US5567842A (en) * | 1994-11-16 | 1996-10-22 | Mitsubishi Chemical Corporation | Process for producing terephthalic acid |
| US5502247A (en) * | 1994-11-17 | 1996-03-26 | Amoco Corporation | Process for recovery of aromatic acid or ester and polyol from waste polyester resins |
| US5929274A (en) * | 1995-06-07 | 1999-07-27 | Hfm International, Inc. | Method to reduce carboxybenzaldehyde isomers in terephthalic acid or isophthalic acid |
| US5840968A (en) * | 1995-06-07 | 1998-11-24 | Hfm International, Inc. | Method and apparatus for preparing purified terephthalic acid |
| US5767311A (en) * | 1995-06-07 | 1998-06-16 | Glitsch International, Inc. | Method and apparatus for preparing purified terephtalic acid |
| US6054610A (en) * | 1995-06-07 | 2000-04-25 | Hfm International, Inc. | Method and apparatus for preparing purified terephthalic acid and isophthalic acid from mixed xylenes |
| US6013835A (en) * | 1995-06-07 | 2000-01-11 | Hfm International, Inc. | Method and apparatus for preparing purified terephthalic acid |
| US7485747B2 (en) * | 2001-06-04 | 2009-02-03 | Eastman Chemical Company | Two stage oxidation process for the production of aromatic dicarboxylic acids |
| US7196215B2 (en) * | 2001-06-04 | 2007-03-27 | Eastman Chemical Company | Process for the production of purified terephthalic acid |
| US6689903B2 (en) | 2001-06-04 | 2004-02-10 | Eastman Chemical Company | Crystallization method for production of purified aromatic dicarboxylic acids |
| US7276625B2 (en) * | 2002-10-15 | 2007-10-02 | Eastman Chemical Company | Process for production of a carboxylic acid/diol mixture suitable for use in polyester production |
| AU2003292740A1 (en) * | 2003-01-10 | 2004-08-10 | Mitsubishi Chemical Corporation | Process for producing aromatic carboxylic acid and process for producing terephthalic acid |
| US7193109B2 (en) * | 2003-03-06 | 2007-03-20 | Eastman Chemical Company | Process for production of a carboxylic acid/diol mixture suitable for use in polyester production |
| US20040215036A1 (en) * | 2003-04-25 | 2004-10-28 | Robert Lin | Method for heating a crude carboxylic acid slurry in a post oxidation zone by the addition of steam |
| US7214760B2 (en) * | 2004-01-15 | 2007-05-08 | Eastman Chemical Company | Process for production of a carboxylic acid/diol mixture suitable for use in polyester production |
| US7546747B2 (en) * | 2004-01-15 | 2009-06-16 | Eastman Chemical Company | Process for production of a dried carboxylic acid cake suitable for use in polyester production |
| BRPI0508880A (pt) | 2004-03-17 | 2007-09-04 | Novartis Ag | uso de compostos orgánicos |
| US7692036B2 (en) | 2004-11-29 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7381836B2 (en) * | 2004-09-02 | 2008-06-03 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7361784B2 (en) * | 2004-09-02 | 2008-04-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572932B2 (en) * | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7482482B2 (en) * | 2004-09-02 | 2009-01-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7371894B2 (en) * | 2004-09-02 | 2008-05-13 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7568361B2 (en) * | 2004-09-02 | 2009-08-04 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7504535B2 (en) * | 2004-09-02 | 2009-03-17 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608733B2 (en) * | 2004-09-02 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7586000B2 (en) * | 2004-09-02 | 2009-09-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7495125B2 (en) * | 2004-09-02 | 2009-02-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7582793B2 (en) | 2004-09-02 | 2009-09-01 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7507857B2 (en) * | 2004-09-02 | 2009-03-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7399882B2 (en) * | 2004-09-02 | 2008-07-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7563926B2 (en) * | 2004-09-02 | 2009-07-21 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7390921B2 (en) * | 2004-09-02 | 2008-06-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US20060047153A1 (en) * | 2004-09-02 | 2006-03-02 | Wonders Alan G | Optimized liquid-phase oxidation |
| US7910769B2 (en) * | 2004-09-02 | 2011-03-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7683210B2 (en) * | 2004-09-02 | 2010-03-23 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7589231B2 (en) * | 2004-09-02 | 2009-09-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608732B2 (en) * | 2005-03-08 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7741515B2 (en) * | 2004-09-02 | 2010-06-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692037B2 (en) * | 2004-09-02 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572936B2 (en) * | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| JP4747544B2 (ja) * | 2004-09-30 | 2011-08-17 | 株式会社日立プラントテクノロジー | テレフタル酸の精製方法 |
| US7897809B2 (en) * | 2005-05-19 | 2011-03-01 | Eastman Chemical Company | Process to produce an enrichment feed |
| US7557243B2 (en) | 2005-05-19 | 2009-07-07 | Eastman Chemical Company | Enriched terephthalic acid composition |
| US20060264656A1 (en) * | 2005-05-19 | 2006-11-23 | Fujitsu Limited | Enrichment process using compounds useful in a polyester process |
| US20060264664A1 (en) * | 2005-05-19 | 2006-11-23 | Parker Kenny R | Esterification of an exchange solvent enriched composition |
| US7919652B2 (en) * | 2005-05-19 | 2011-04-05 | Eastman Chemical Company | Process to produce an enriched composition through the use of a catalyst removal zone and an enrichment zone |
| US7834208B2 (en) * | 2005-05-19 | 2010-11-16 | Eastman Chemical Company | Process to produce a post catalyst removal composition |
| US7880031B2 (en) * | 2005-05-19 | 2011-02-01 | Eastman Chemical Company | Process to produce an enrichment feed |
| US7741516B2 (en) | 2005-05-19 | 2010-06-22 | Eastman Chemical Company | Process to enrich a carboxylic acid composition |
| US7432395B2 (en) * | 2005-05-19 | 2008-10-07 | Eastman Chemical Company | Enriched carboxylic acid composition |
| US7884231B2 (en) | 2005-05-19 | 2011-02-08 | Eastman Chemical Company | Process to produce an enriched composition |
| US20060264662A1 (en) * | 2005-05-19 | 2006-11-23 | Gibson Philip E | Esterification of an enriched composition |
| US7304178B2 (en) * | 2005-05-19 | 2007-12-04 | Eastman Chemical Company | Enriched isophthalic acid composition |
| US7884232B2 (en) * | 2005-06-16 | 2011-02-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7355068B2 (en) | 2006-01-04 | 2008-04-08 | Eastman Chemical Company | Oxidation system with internal secondary reactor |
| US7358389B2 (en) * | 2006-01-04 | 2008-04-15 | Eastman Chemical Company | Oxidation system employing internal structure for enhanced hydrodynamics |
| US20070155987A1 (en) * | 2006-01-04 | 2007-07-05 | O'meadhra Ruairi S | Oxidative digestion with optimized agitation |
| US20070179312A1 (en) * | 2006-02-02 | 2007-08-02 | O'meadhra Ruairi Seosamh | Process for the purification of a crude carboxylic axid slurry |
| US7501537B2 (en) * | 2006-03-01 | 2009-03-10 | Eastman Chemical Company | Polycarboxylic acid production system employing oxidative digestion with reduced or eliminated upstream liquor exchange |
| US7847121B2 (en) * | 2006-03-01 | 2010-12-07 | Eastman Chemical Company | Carboxylic acid production process |
| US20070208194A1 (en) * | 2006-03-01 | 2007-09-06 | Woodruff Thomas E | Oxidation system with sidedraw secondary reactor |
| US7326807B2 (en) | 2006-03-01 | 2008-02-05 | Eastman Chemical Company | Polycarboxylic acid production system with enhanced heating for oxidative digestion |
| US7888529B2 (en) * | 2006-03-01 | 2011-02-15 | Eastman Chemical Company | Process to produce a post catalyst removal composition |
| US7863483B2 (en) * | 2006-03-01 | 2011-01-04 | Eastman Chemical Company | Carboxylic acid production process |
| US7772424B2 (en) * | 2006-03-01 | 2010-08-10 | Eastman Chemical Company | Polycarboxylic acid production system employing enhanced evaporative concentration downstream of oxidative digestion |
| US7816556B2 (en) * | 2006-03-01 | 2010-10-19 | Eastman Chemical Company | Polycarboxylic acid production system employing enhanced multistage oxidative digestion |
| US7326808B2 (en) * | 2006-03-01 | 2008-02-05 | Eastman Chemical Company | Polycarboxylic acid production system employing cooled mother liquor from oxidative digestion as feed to impurity purge system |
| US7420082B2 (en) | 2006-03-01 | 2008-09-02 | Eastman Chemical Company | Polycarboxylic acid production system employing hot liquor removal downstream of oxidative digestion |
| US7462736B2 (en) * | 2006-03-01 | 2008-12-09 | Eastman Chemical Company | Methods and apparatus for isolating carboxylic acid |
| US7393973B2 (en) * | 2006-03-01 | 2008-07-01 | Eastman Chemical Company | Polycarboxylic acid production system with enhanced residence time distribution for oxidative digestion |
| US9205388B2 (en) * | 2007-06-27 | 2015-12-08 | H R D Corporation | High shear system and method for the production of acids |
| US8455680B2 (en) | 2008-01-15 | 2013-06-04 | Eastman Chemical Company | Carboxylic acid production process employing solvent from esterification of lignocellulosic material |
| US8614350B2 (en) | 2008-01-15 | 2013-12-24 | Eastman Chemical Company | Carboxylic acid production process employing solvent from esterification of lignocellulosic material |
| US8969404B2 (en) * | 2012-06-22 | 2015-03-03 | Eastman Chemical Company | Purifying crude furan 2,5-dicarboxylic acid by hydrogenation |
| US9029580B2 (en) | 2012-07-20 | 2015-05-12 | Eastman Chemical Company | Oxidation process to produce a purified carboxylic acid product via solvent displacement and post oxidation |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3639465A (en) * | 1968-06-18 | 1972-02-01 | Standard Oil Co | Purification of aromatic polycarboxylic acids by catalytic reduction using prehumidified hydrogen |
| US3655729A (en) * | 1968-07-18 | 1972-04-11 | Gen Tire & Rubber Co | Process for preparing esters of terephthalic acid |
| US3708532A (en) * | 1968-11-04 | 1973-01-02 | Teijin Ltd | Process for the continuous purification of crude terephthalic acid |
| DE1925038C3 (de) * | 1969-05-16 | 1980-10-23 | Standard Oil Co., Chicago, Ill. (V.St.A.) | Verfahren zur Gewinnung von Terephthalsäure |
-
1973
- 1973-08-20 US US05/389,717 patent/US3931305A/en not_active Expired - Lifetime
-
1974
- 1974-07-22 NL NL7409866A patent/NL7409866A/xx active Search and Examination
- 1974-07-26 IN IN1669/CAL/1974A patent/IN142341B/en unknown
- 1974-07-29 BE BE147065A patent/BE818228A/fr not_active IP Right Cessation
- 1974-08-06 DE DE2437846A patent/DE2437846A1/de active Granted
- 1974-08-07 CA CA206,504A patent/CA1019342A/en not_active Expired
- 1974-08-08 IT IT52518/74A patent/IT1018896B/it active
- 1974-08-08 BR BR6531/74A patent/BR7406531D0/pt unknown
- 1974-08-13 FR FR7428072A patent/FR2241529B1/fr not_active Expired
- 1974-08-14 RO RO7479767A patent/RO66116A/fr unknown
- 1974-08-15 TR TR18050A patent/TR18050A/xx unknown
- 1974-08-15 YU YU2241/74A patent/YU41043B/xx unknown
- 1974-08-17 HU HU74SA2682A patent/HU180065B/hu unknown
- 1974-08-19 SU SU742055522A patent/SU869554A3/ru active
- 1974-08-19 DD DD180583A patent/DD115109A5/xx unknown
- 1974-08-19 GB GB3644974A patent/GB1476436A/en not_active Expired
- 1974-08-20 ES ES429400A patent/ES429400A1/es not_active Expired
- 1974-08-20 BG BG027525A patent/BG31071A3/xx unknown
- 1974-08-20 EG EG345/74A patent/EG11555A/xx active
- 1974-08-20 CS CS745779A patent/CS198150B2/cs unknown
- 1974-08-20 JP JP9545574A patent/JPS5324057B2/ja not_active Expired
- 1974-08-20 PL PL1974173574A patent/PL100195B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| TR18050A (tr) | 1976-09-23 |
| BG31071A3 (en) | 1981-10-15 |
| FR2241529B1 (fr) | 1978-08-11 |
| ES429400A1 (es) | 1976-09-01 |
| IT1018896B (it) | 1977-10-20 |
| SU869554A3 (ru) | 1981-09-30 |
| DD115109A5 (fr) | 1975-09-12 |
| DE2437846C2 (fr) | 1989-12-28 |
| DE2437846A1 (de) | 1975-03-06 |
| YU41043B (en) | 1986-10-31 |
| JPS5324057B2 (fr) | 1978-07-18 |
| FR2241529A1 (fr) | 1975-03-21 |
| US3931305A (en) | 1976-01-06 |
| BR7406531D0 (pt) | 1975-06-03 |
| BE818228A (fr) | 1975-01-29 |
| RO66116A (fr) | 1980-03-15 |
| IN142341B (fr) | 1977-06-25 |
| PL100195B1 (pl) | 1978-09-30 |
| HU180065B (en) | 1983-01-28 |
| GB1476436A (en) | 1977-06-16 |
| CA1019342A (en) | 1977-10-18 |
| NL7409866A (nl) | 1975-02-24 |
| EG11555A (en) | 1977-08-15 |
| JPS5049248A (fr) | 1975-05-01 |
| YU224174A (en) | 1982-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CS198150B2 (en) | Method for the isolation of crystalline terephthalic acid as a product with p-toluyl acid content up to 150 ppm from liquid water solutions | |
| EP0754169B1 (fr) | Cristallisation a une seule etape de mise en temperature pour recuperer du paraxylene | |
| US3850983A (en) | Separation of terephthalic from paratoluic acid from solutions thereof in water and/or acetic acid | |
| KR100452021B1 (ko) | 정제테레프탈산의제조방법및그장치 | |
| US3029278A (en) | Process for separation of phthalic acids | |
| US4053506A (en) | Production of fiber-grade terephthalic acid | |
| US5175355A (en) | Improved process for recovery of purified terephthalic acid | |
| EP0105524B1 (fr) | Procédé de cristallisation de refroidissement en contre-courant et de purification d'une fusion de composants multiples | |
| KR100332945B1 (ko) | 고순도파라크실렌공급물로부터파라크실렌을결정화시키는방법 | |
| WO2002098835A1 (fr) | Procede de cristallisation pour la production d'acides dicarboxyliques aromatiques purifies | |
| DE60117860T2 (de) | Kristallisierungsverfahren zur herstellung von sehr reinem para-xylol | |
| US2866833A (en) | Paraxylene purification system | |
| JPS63185402A (ja) | 液状混合物から純粋な物質を結晶化によつて回収する方法および装置 | |
| EP1193237B1 (fr) | Procédé de préparation de 2,6-diméthylnaphthalène | |
| KR102876408B1 (ko) | 입도가 조절된 헥사나이트로스틸벤 타입 iv의 제조방법 | |
| US3917681A (en) | Purification of isophthalic acid | |
| EP1003708B1 (fr) | Procede ameliore de separation d'acide terephtalique pur | |
| PL81410B1 (fr) | ||
| KR810001026B1 (ko) | 연속 순간 결정화에 의한 테레프탈산의 회수방법 | |
| US2767224A (en) | Hexachlorocyclohexane isomer separation | |
| US4350828A (en) | Crystallization of isophthalic acid | |
| US2889376A (en) | Isolation of gamma benzene hexachloride | |
| US2743282A (en) | Production of pure gamma-hexachloro-cyclohexane | |
| JPS6113460B2 (fr) | ||
| MXPA00001550A (es) | Proceso mejorado para separar acido tereftalico puro |