CN101257798A - Fungicidal mixtures containing substituted 1-methyl pyrazol-4-yl carboxylic acid anilides - Google Patents
Fungicidal mixtures containing substituted 1-methyl pyrazol-4-yl carboxylic acid anilides Download PDFInfo
- Publication number
- CN101257798A CN101257798A CNA2006800289443A CN200680028944A CN101257798A CN 101257798 A CN101257798 A CN 101257798A CN A2006800289443 A CNA2006800289443 A CN A2006800289443A CN 200680028944 A CN200680028944 A CN 200680028944A CN 101257798 A CN101257798 A CN 101257798A
- Authority
- CN
- China
- Prior art keywords
- methyl
- fluorine
- chlorine
- och
- ocf
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 118
- 230000000855 fungicidal effect Effects 0.000 title claims abstract description 13
- JFHRVDCFRWSLLO-UHFFFAOYSA-N 1-methyl-n-phenylpyrazole-4-carboxamide Chemical class C1=NN(C)C=C1C(=O)NC1=CC=CC=C1 JFHRVDCFRWSLLO-UHFFFAOYSA-N 0.000 title claims abstract description 11
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 297
- 150000001875 compounds Chemical class 0.000 claims abstract description 222
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 48
- 150000003851 azoles Chemical class 0.000 claims abstract description 20
- 229910052740 iodine Inorganic materials 0.000 claims abstract description 14
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 12
- 150000002367 halogens Chemical class 0.000 claims abstract description 11
- 239000000417 fungicide Substances 0.000 claims abstract description 9
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims abstract description 8
- 229930182692 Strobilurin Natural products 0.000 claims abstract description 7
- 238000000034 method Methods 0.000 claims abstract description 7
- 150000004657 carbamic acid derivatives Chemical class 0.000 claims abstract description 6
- 150000002391 heterocyclic compounds Chemical class 0.000 claims abstract description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 6
- 239000001257 hydrogen Substances 0.000 claims abstract description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 3
- 239000000460 chlorine Substances 0.000 claims description 795
- 229910052801 chlorine Inorganic materials 0.000 claims description 541
- 229910052731 fluorine Inorganic materials 0.000 claims description 485
- 239000011737 fluorine Substances 0.000 claims description 482
- 241000894006 Bacteria Species 0.000 claims description 273
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 142
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 142
- -1 acid amides azoles Chemical class 0.000 claims description 105
- 239000005785 Fluquinconazole Substances 0.000 claims description 88
- IJJVMEJXYNJXOJ-UHFFFAOYSA-N fluquinconazole Chemical compound C=1C=C(Cl)C=C(Cl)C=1N1C(=O)C2=CC(F)=CC=C2N=C1N1C=NC=N1 IJJVMEJXYNJXOJ-UHFFFAOYSA-N 0.000 claims description 87
- 239000005869 Pyraclostrobin Substances 0.000 claims description 86
- 239000005839 Tebuconazole Substances 0.000 claims description 86
- 239000005859 Triticonazole Substances 0.000 claims description 86
- WUHLVXDDBHWHLQ-UHFFFAOYSA-N pentazole Chemical class N=1N=NNN=1 WUHLVXDDBHWHLQ-UHFFFAOYSA-N 0.000 claims description 86
- PPDBOQMNKNNODG-NTEUORMPSA-N (5E)-5-(4-chlorobenzylidene)-2,2-dimethyl-1-(1,2,4-triazol-1-ylmethyl)cyclopentanol Chemical compound C1=NC=NN1CC1(O)C(C)(C)CC\C1=C/C1=CC=C(Cl)C=C1 PPDBOQMNKNNODG-NTEUORMPSA-N 0.000 claims description 85
- HZRSNVGNWUDEFX-UHFFFAOYSA-N pyraclostrobin Chemical compound COC(=O)N(OC)C1=CC=CC=C1COC1=NN(C=2C=CC(Cl)=CC=2)C=C1 HZRSNVGNWUDEFX-UHFFFAOYSA-N 0.000 claims description 85
- PXMNMQRDXWABCY-UHFFFAOYSA-N 1-(4-chlorophenyl)-4,4-dimethyl-3-(1H-1,2,4-triazol-1-ylmethyl)pentan-3-ol Chemical compound C1=NC=NN1CC(O)(C(C)(C)C)CCC1=CC=C(Cl)C=C1 PXMNMQRDXWABCY-UHFFFAOYSA-N 0.000 claims description 84
- 150000002466 imines Chemical class 0.000 claims description 84
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 83
- PXDIEGGUNGMBBV-UHFFFAOYSA-N CC1(CC(C(=O)O)=CC=C1)C(=O)O.CF Chemical compound CC1(CC(C(=O)O)=CC=C1)C(=O)O.CF PXDIEGGUNGMBBV-UHFFFAOYSA-N 0.000 claims description 81
- TWFZGCMQGLPBSX-UHFFFAOYSA-N Carbendazim Natural products C1=CC=C2NC(NC(=O)OC)=NC2=C1 TWFZGCMQGLPBSX-UHFFFAOYSA-N 0.000 claims description 76
- 239000006013 carbendazim Substances 0.000 claims description 76
- AMSPWOYQQAWRRM-UHFFFAOYSA-N metrafenone Chemical compound COC1=CC=C(Br)C(C)=C1C(=O)C1=C(C)C=C(OC)C(OC)=C1OC AMSPWOYQQAWRRM-UHFFFAOYSA-N 0.000 claims description 76
- 239000005810 Metrafenone Substances 0.000 claims description 75
- JNPZQRQPIHJYNM-UHFFFAOYSA-N carbendazim Chemical compound C1=C[CH]C2=NC(NC(=O)OC)=NC2=C1 JNPZQRQPIHJYNM-UHFFFAOYSA-N 0.000 claims description 75
- 239000005828 Pyrimethanil Substances 0.000 claims description 62
- ZLIBICFPKPWGIZ-UHFFFAOYSA-N pyrimethanil Chemical compound CC1=CC(C)=NC(NC=2C=CC=CC=2)=N1 ZLIBICFPKPWGIZ-UHFFFAOYSA-N 0.000 claims description 62
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 52
- RIOXQFHNBCKOKP-UHFFFAOYSA-N benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 claims description 51
- MITFXPHMIHQXPI-UHFFFAOYSA-N benzoxaprofen Natural products N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1C1=CC=C(Cl)C=C1 MITFXPHMIHQXPI-UHFFFAOYSA-N 0.000 claims description 51
- 239000005842 Thiophanate-methyl Substances 0.000 claims description 50
- QGHREAKMXXNCOA-UHFFFAOYSA-N thiophanate-methyl Chemical group COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC QGHREAKMXXNCOA-UHFFFAOYSA-N 0.000 claims description 50
- 239000001301 oxygen Substances 0.000 claims description 46
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 38
- 239000005807 Metalaxyl Substances 0.000 claims description 36
- ZQEIXNIJLIKNTD-UHFFFAOYSA-N methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate Chemical compound COCC(=O)N(C(C)C(=O)OC)C1=C(C)C=CC=C1C ZQEIXNIJLIKNTD-UHFFFAOYSA-N 0.000 claims description 36
- YTOPFCCWCSOHFV-UHFFFAOYSA-N 2,6-dimethyl-4-tridecylmorpholine Chemical compound CCCCCCCCCCCCCN1CC(C)OC(C)C1 YTOPFCCWCSOHFV-UHFFFAOYSA-N 0.000 claims description 33
- JWUCHKBSVLQQCO-UHFFFAOYSA-N 1-(2-fluorophenyl)-1-(4-fluorophenyl)-2-(1H-1,2,4-triazol-1-yl)ethanol Chemical compound C=1C=C(F)C=CC=1C(C=1C(=CC=CC=1)F)(O)CN1C=NC=N1 JWUCHKBSVLQQCO-UHFFFAOYSA-N 0.000 claims description 32
- FSCWZHGZWWDELK-UHFFFAOYSA-N 3-(3,5-dichlorophenyl)-5-ethenyl-5-methyl-2,4-oxazolidinedione Chemical compound O=C1C(C)(C=C)OC(=O)N1C1=CC(Cl)=CC(Cl)=C1 FSCWZHGZWWDELK-UHFFFAOYSA-N 0.000 claims description 32
- YLJLLELGHSWIDU-UHFFFAOYSA-N 4-cyclododecyl-2,6-dimethylmorpholin-4-ium;acetate Chemical compound CC([O-])=O.C1C(C)OC(C)C[NH+]1C1CCCCCCCCCCC1 YLJLLELGHSWIDU-UHFFFAOYSA-N 0.000 claims description 31
- 239000005787 Flutriafol Substances 0.000 claims description 31
- 239000005820 Prochloraz Substances 0.000 claims description 31
- TVLSRXXIMLFWEO-UHFFFAOYSA-N prochloraz Chemical compound C1=CN=CN1C(=O)N(CCC)CCOC1=C(Cl)C=C(Cl)C=C1Cl TVLSRXXIMLFWEO-UHFFFAOYSA-N 0.000 claims description 31
- QNBTYORWCCMPQP-JXAWBTAJSA-N (Z)-dimethomorph Chemical compound C1=C(OC)C(OC)=CC=C1C(\C=1C=CC(Cl)=CC=1)=C/C(=O)N1CCOCC1 QNBTYORWCCMPQP-JXAWBTAJSA-N 0.000 claims description 30
- 239000005761 Dimethomorph Substances 0.000 claims description 30
- 239000005802 Mancozeb Substances 0.000 claims description 30
- JHIPUJPTQJYEQK-ZLHHXESBSA-N orysastrobin Chemical compound CNC(=O)C(=N\OC)\C1=CC=CC=C1CO\N=C(/C)\C(=N\OC)\C(\C)=N\OC JHIPUJPTQJYEQK-ZLHHXESBSA-N 0.000 claims description 30
- AMHNZOICSMBGDH-UHFFFAOYSA-L zineb Chemical compound [Zn+2].[S-]C(=S)NCCNC([S-])=S AMHNZOICSMBGDH-UHFFFAOYSA-L 0.000 claims description 29
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 claims description 28
- QQVIHTHCMHWDBS-UHFFFAOYSA-N perisophthalic acid Natural products OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 27
- 150000001412 amines Chemical class 0.000 claims description 25
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 24
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims description 22
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 claims description 16
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims description 15
- GTCAXTIRRLKXRU-UHFFFAOYSA-N carbamic acid methyl ester Natural products COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 claims description 15
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 12
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 11
- 241000233866 Fungi Species 0.000 claims description 10
- JMANVNJQNLATNU-UHFFFAOYSA-N oxalonitrile Chemical compound N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 claims description 10
- 239000005784 Fluoxastrobin Substances 0.000 claims description 9
- UFEODZBUAFNAEU-NLRVBDNBSA-N fluoxastrobin Chemical compound C=1C=CC=C(OC=2C(=C(OC=3C(=CC=CC=3)Cl)N=CN=2)F)C=1C(=N/OC)\C1=NOCCO1 UFEODZBUAFNAEU-NLRVBDNBSA-N 0.000 claims description 9
- 229940084434 fungoid Drugs 0.000 claims description 9
- 150000002825 nitriles Chemical class 0.000 claims description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- UDSJPFPDKCMYBD-UHFFFAOYSA-N Metsulfovax Chemical compound S1C(C)=NC(C)=C1C(=O)NC1=CC=CC=C1 UDSJPFPDKCMYBD-UHFFFAOYSA-N 0.000 claims description 8
- 239000005831 Quinoxyfen Substances 0.000 claims description 8
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 claims description 8
- WRPIRSINYZBGPK-UHFFFAOYSA-N quinoxyfen Chemical compound C1=CC(F)=CC=C1OC1=CC=NC2=CC(Cl)=CC(Cl)=C12 WRPIRSINYZBGPK-UHFFFAOYSA-N 0.000 claims description 8
- UCSJYZPVAKXKNQ-HZYVHMACSA-N streptomycin Chemical compound CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@@H]1[C@](C=O)(O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@H](O)[C@H]1O UCSJYZPVAKXKNQ-HZYVHMACSA-N 0.000 claims description 8
- MGNFYQILYYYUBS-UHFFFAOYSA-N 1-[3-(4-tert-butylphenyl)-2-methylpropyl]piperidine Chemical compound C=1C=C(C(C)(C)C)C=CC=1CC(C)CN1CCCCC1 MGNFYQILYYYUBS-UHFFFAOYSA-N 0.000 claims description 7
- SOUGWDPPRBKJEX-UHFFFAOYSA-N 3,5-dichloro-N-(1-chloro-3-methyl-2-oxopentan-3-yl)-4-methylbenzamide Chemical compound ClCC(=O)C(C)(CC)NC(=O)C1=CC(Cl)=C(C)C(Cl)=C1 SOUGWDPPRBKJEX-UHFFFAOYSA-N 0.000 claims description 7
- HKIOYBQGHSTUDB-UHFFFAOYSA-N folpet Chemical compound C1=CC=C2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C2=C1 HKIOYBQGHSTUDB-UHFFFAOYSA-N 0.000 claims description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- NHOWDZOIZKMVAI-UHFFFAOYSA-N (2-chlorophenyl)(4-chlorophenyl)pyrimidin-5-ylmethanol Chemical compound C=1N=CN=CC=1C(C=1C(=CC=CC=1)Cl)(O)C1=CC=C(Cl)C=C1 NHOWDZOIZKMVAI-UHFFFAOYSA-N 0.000 claims description 6
- PZBPKYOVPCNPJY-UHFFFAOYSA-N 1-[2-(allyloxy)-2-(2,4-dichlorophenyl)ethyl]imidazole Chemical compound ClC1=CC(Cl)=CC=C1C(OCC=C)CN1C=NC=C1 PZBPKYOVPCNPJY-UHFFFAOYSA-N 0.000 claims description 6
- UFNOUKDBUJZYDE-UHFFFAOYSA-N 2-(4-chlorophenyl)-3-cyclopropyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol Chemical compound C1=NC=NN1CC(O)(C=1C=CC(Cl)=CC=1)C(C)C1CC1 UFNOUKDBUJZYDE-UHFFFAOYSA-N 0.000 claims description 6
- ZRDUSMYWDRPZRM-UHFFFAOYSA-N 2-sec-butyl-4,6-dinitrophenyl 3-methylbut-2-enoate Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1OC(=O)C=C(C)C ZRDUSMYWDRPZRM-UHFFFAOYSA-N 0.000 claims description 6
- 239000005757 Cyproconazole Substances 0.000 claims description 6
- 239000005760 Difenoconazole Substances 0.000 claims description 6
- HDWLUGYOLUHEMN-UHFFFAOYSA-N Dinobuton Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1OC(=O)OC(C)C HDWLUGYOLUHEMN-UHFFFAOYSA-N 0.000 claims description 6
- 239000005774 Fenamidone Substances 0.000 claims description 6
- 239000005776 Fenhexamid Substances 0.000 claims description 6
- 239000005777 Fenpropidin Substances 0.000 claims description 6
- 239000005780 Fluazinam Substances 0.000 claims description 6
- 239000005789 Folpet Substances 0.000 claims description 6
- 239000005805 Mepanipyrim Substances 0.000 claims description 6
- 239000005822 Propiconazole Substances 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 6
- 239000005864 Sulphur Substances 0.000 claims description 6
- 239000005846 Triadimenol Substances 0.000 claims description 6
- 239000005863 Zoxamide Substances 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 6
- BQYJATMQXGBDHF-UHFFFAOYSA-N difenoconazole Chemical compound O1C(C)COC1(C=1C(=CC(OC=2C=CC(Cl)=CC=2)=CC=1)Cl)CN1N=CN=C1 BQYJATMQXGBDHF-UHFFFAOYSA-N 0.000 claims description 6
- LMVPQMGRYSRMIW-KRWDZBQOSA-N fenamidone Chemical compound O=C([C@@](C)(N=C1SC)C=2C=CC=CC=2)N1NC1=CC=CC=C1 LMVPQMGRYSRMIW-KRWDZBQOSA-N 0.000 claims description 6
- VDLGAVXLJYLFDH-UHFFFAOYSA-N fenhexamid Chemical compound C=1C=C(O)C(Cl)=C(Cl)C=1NC(=O)C1(C)CCCCC1 VDLGAVXLJYLFDH-UHFFFAOYSA-N 0.000 claims description 6
- UZCGKGPEKUCDTF-UHFFFAOYSA-N fluazinam Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=C(Cl)C([N+]([O-])=O)=C1NC1=NC=C(C(F)(F)F)C=C1Cl UZCGKGPEKUCDTF-UHFFFAOYSA-N 0.000 claims description 6
- FQKUGOMFVDPBIZ-UHFFFAOYSA-N flusilazole Chemical compound C=1C=C(F)C=CC=1[Si](C=1C=CC(F)=CC=1)(C)CN1C=NC=N1 FQKUGOMFVDPBIZ-UHFFFAOYSA-N 0.000 claims description 6
- RONFGUROBZGJKP-UHFFFAOYSA-N iminoctadine Chemical compound NC(N)=NCCCCCCCCNCCCCCCCCN=C(N)N RONFGUROBZGJKP-UHFFFAOYSA-N 0.000 claims description 6
- CIFWZNRJIBNXRE-UHFFFAOYSA-N mepanipyrim Chemical compound CC#CC1=CC(C)=NC(NC=2C=CC=CC=2)=N1 CIFWZNRJIBNXRE-UHFFFAOYSA-N 0.000 claims description 6
- WHHIPMZEDGBUCC-UHFFFAOYSA-N probenazole Chemical compound C1=CC=C2C(OCC=C)=NS(=O)(=O)C2=C1 WHHIPMZEDGBUCC-UHFFFAOYSA-N 0.000 claims description 6
- STJLVHWMYQXCPB-UHFFFAOYSA-N propiconazole Chemical compound O1C(CCC)COC1(C=1C(=CC(Cl)=CC=1)Cl)CN1N=CN=C1 STJLVHWMYQXCPB-UHFFFAOYSA-N 0.000 claims description 6
- 229930192474 thiophene Natural products 0.000 claims description 6
- BAZVSMNPJJMILC-UHFFFAOYSA-N triadimenol Chemical compound C1=NC=NN1C(C(O)C(C)(C)C)OC1=CC=C(Cl)C=C1 BAZVSMNPJJMILC-UHFFFAOYSA-N 0.000 claims description 6
- RROQIUMZODEXOR-UHFFFAOYSA-N triforine Chemical compound O=CNC(C(Cl)(Cl)Cl)N1CCN(C(NC=O)C(Cl)(Cl)Cl)CC1 RROQIUMZODEXOR-UHFFFAOYSA-N 0.000 claims description 6
- XERJKGMBORTKEO-VZUCSPMQSA-N (1e)-2-(ethylcarbamoylamino)-n-methoxy-2-oxoethanimidoyl cyanide Chemical compound CCNC(=O)NC(=O)C(\C#N)=N\OC XERJKGMBORTKEO-VZUCSPMQSA-N 0.000 claims description 5
- BKBSMMUEEAWFRX-NBVRZTHBSA-N (E)-flumorph Chemical compound C1=C(OC)C(OC)=CC=C1C(\C=1C=CC(F)=CC=1)=C\C(=O)N1CCOCC1 BKBSMMUEEAWFRX-NBVRZTHBSA-N 0.000 claims description 5
- WKBPZYKAUNRMKP-UHFFFAOYSA-N 1-[2-(2,4-dichlorophenyl)pentyl]1,2,4-triazole Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(CCC)CN1C=NC=N1 WKBPZYKAUNRMKP-UHFFFAOYSA-N 0.000 claims description 5
- NNPRCLUGHFXSOU-UHFFFAOYSA-N 4-chloro-n-[cyano(ethoxy)methyl]benzamide Chemical compound CCOC(C#N)NC(=O)C1=CC=C(Cl)C=C1 NNPRCLUGHFXSOU-UHFFFAOYSA-N 0.000 claims description 5
- 229940123208 Biguanide Drugs 0.000 claims description 5
- 239000005756 Cymoxanil Substances 0.000 claims description 5
- 239000005790 Fosetyl Substances 0.000 claims description 5
- 239000005795 Imazalil Substances 0.000 claims description 5
- 239000005797 Iprovalicarb Substances 0.000 claims description 5
- NWUWYYSKZYIQAE-ZBFHGGJFSA-N L-(R)-iprovalicarb Chemical compound CC(C)OC(=O)N[C@@H](C(C)C)C(=O)N[C@H](C)C1=CC=C(C)C=C1 NWUWYYSKZYIQAE-ZBFHGGJFSA-N 0.000 claims description 5
- 239000005804 Mandipropamid Substances 0.000 claims description 5
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 claims description 5
- 239000005813 Penconazole Substances 0.000 claims description 5
- 239000005823 Propineb Substances 0.000 claims description 5
- JSOJVSBOEOWZJX-UHFFFAOYSA-N [O].N1=CC=CC2=CC=CC=C21 Chemical compound [O].N1=CC=CC2=CC=CC=C21 JSOJVSBOEOWZJX-UHFFFAOYSA-N 0.000 claims description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 5
- RXDMAYSSBPYBFW-PKFCDNJMSA-N carpropamide Chemical compound N([C@@H](C)C=1C=CC(Cl)=CC=1)C(=O)[C@@]1(CC)[C@H](C)C1(Cl)Cl RXDMAYSSBPYBFW-PKFCDNJMSA-N 0.000 claims description 5
- WURGXGVFSMYFCG-UHFFFAOYSA-N dichlofluanid Chemical compound CN(C)S(=O)(=O)N(SC(F)(Cl)Cl)C1=CC=CC=C1 WURGXGVFSMYFCG-UHFFFAOYSA-N 0.000 claims description 5
- PYZSVQVRHDXQSL-UHFFFAOYSA-N dithianon Chemical compound S1C(C#N)=C(C#N)SC2=C1C(=O)C1=CC=CC=C1C2=O PYZSVQVRHDXQSL-UHFFFAOYSA-N 0.000 claims description 5
- 229960002125 enilconazole Drugs 0.000 claims description 5
- JFSPBVWPKOEZCB-UHFFFAOYSA-N fenfuram Chemical compound O1C=CC(C(=O)NC=2C=CC=CC=2)=C1C JFSPBVWPKOEZCB-UHFFFAOYSA-N 0.000 claims description 5
- WHDGWKAJBYRJJL-UHFFFAOYSA-K ferbam Chemical compound [Fe+3].CN(C)C([S-])=S.CN(C)C([S-])=S.CN(C)C([S-])=S WHDGWKAJBYRJJL-UHFFFAOYSA-K 0.000 claims description 5
- GOWLARCWZRESHU-AQTBWJFISA-N ferimzone Chemical compound C=1C=CC=C(C)C=1C(/C)=N\NC1=NC(C)=CC(C)=N1 GOWLARCWZRESHU-AQTBWJFISA-N 0.000 claims description 5
- VUERQRKTYBIULR-UHFFFAOYSA-N fosetyl Chemical compound CCOP(O)=O VUERQRKTYBIULR-UHFFFAOYSA-N 0.000 claims description 5
- UYJUZNLFJAWNEZ-UHFFFAOYSA-N fuberidazole Chemical compound C1=COC(C=2NC3=CC=CC=C3N=2)=C1 UYJUZNLFJAWNEZ-UHFFFAOYSA-N 0.000 claims description 5
- ZQEIXNIJLIKNTD-GFCCVEGCSA-N metalaxyl-M Chemical compound COCC(=O)N([C@H](C)C(=O)OC)C1=C(C)C=CC=C1C ZQEIXNIJLIKNTD-GFCCVEGCSA-N 0.000 claims description 5
- 229940017219 methyl propionate Drugs 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- KKMLIVYBGSAJPM-UHFFFAOYSA-L propineb Chemical compound [Zn+2].[S-]C(=S)NC(C)CNC([S-])=S KKMLIVYBGSAJPM-UHFFFAOYSA-L 0.000 claims description 5
- 150000004867 thiadiazoles Chemical class 0.000 claims description 5
- WOSNCVAPUOFXEH-UHFFFAOYSA-N thifluzamide Chemical compound S1C(C)=NC(C(F)(F)F)=C1C(=O)NC1=C(Br)C=C(OC(F)(F)F)C=C1Br WOSNCVAPUOFXEH-UHFFFAOYSA-N 0.000 claims description 5
- FFSJPOPLSWBGQY-UHFFFAOYSA-N triazol-4-one Chemical compound O=C1C=NN=N1 FFSJPOPLSWBGQY-UHFFFAOYSA-N 0.000 claims description 5
- DQJCHOQLCLEDLL-UHFFFAOYSA-N tricyclazole Chemical compound CC1=CC=CC2=C1N1C=NN=C1S2 DQJCHOQLCLEDLL-UHFFFAOYSA-N 0.000 claims description 5
- SAPGTCDSBGMXCD-UHFFFAOYSA-N (2-chlorophenyl)-(4-fluorophenyl)-pyrimidin-5-ylmethanol Chemical compound C=1N=CN=CC=1C(C=1C(=CC=CC=1)Cl)(O)C1=CC=C(F)C=C1 SAPGTCDSBGMXCD-UHFFFAOYSA-N 0.000 claims description 4
- CKPCAYZTYMHQEX-NBVRZTHBSA-N (e)-1-(2,4-dichlorophenyl)-n-methoxy-2-pyridin-3-ylethanimine Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(=N/OC)/CC1=CC=CN=C1 CKPCAYZTYMHQEX-NBVRZTHBSA-N 0.000 claims description 4
- VGPIBGGRCVEHQZ-UHFFFAOYSA-N 1-(biphenyl-4-yloxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ol Chemical compound C1=NC=NN1C(C(O)C(C)(C)C)OC(C=C1)=CC=C1C1=CC=CC=C1 VGPIBGGRCVEHQZ-UHFFFAOYSA-N 0.000 claims description 4
- YIKWKLYQRFRGPM-UHFFFAOYSA-N 1-dodecylguanidine acetate Chemical compound CC(O)=O.CCCCCCCCCCCCN=C(N)N YIKWKLYQRFRGPM-UHFFFAOYSA-N 0.000 claims description 4
- RQDJADAKIFFEKQ-UHFFFAOYSA-N 4-(4-chlorophenyl)-2-phenyl-2-(1,2,4-triazol-1-ylmethyl)butanenitrile Chemical compound C1=CC(Cl)=CC=C1CCC(C=1C=CC=CC=1)(C#N)CN1N=CN=C1 RQDJADAKIFFEKQ-UHFFFAOYSA-N 0.000 claims description 4
- 239000005739 Bordeaux mixture Substances 0.000 claims description 4
- 239000005740 Boscalid Substances 0.000 claims description 4
- 239000005741 Bromuconazole Substances 0.000 claims description 4
- 239000005746 Carboxin Substances 0.000 claims description 4
- 239000005755 Cyflufenamid Substances 0.000 claims description 4
- 239000005644 Dazomet Substances 0.000 claims description 4
- 239000005766 Dodine Substances 0.000 claims description 4
- 239000005786 Flutolanil Substances 0.000 claims description 4
- 239000005808 Metalaxyl-M Substances 0.000 claims description 4
- 239000005814 Pencycuron Substances 0.000 claims description 4
- 229930182764 Polyoxin Natural products 0.000 claims description 4
- 239000005870 Ziram Substances 0.000 claims description 4
- WHDHEVMINMZADQ-UHFFFAOYSA-N [F].N1C=CC=C1 Chemical compound [F].N1C=CC=C1 WHDHEVMINMZADQ-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 239000011717 all-trans-retinol Substances 0.000 claims description 4
- 235000019169 all-trans-retinol Nutrition 0.000 claims description 4
- 239000004411 aluminium Substances 0.000 claims description 4
- 229910052782 aluminium Inorganic materials 0.000 claims description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 4
- IMHBYKMAHXWHRP-UHFFFAOYSA-N anilazine Chemical compound ClC1=CC=CC=C1NC1=NC(Cl)=NC(Cl)=N1 IMHBYKMAHXWHRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 229940118790 boscalid Drugs 0.000 claims description 4
- WYEMLYFITZORAB-UHFFFAOYSA-N boscalid Chemical compound C1=CC(Cl)=CC=C1C1=CC=CC=C1NC(=O)C1=CC=CN=C1Cl WYEMLYFITZORAB-UHFFFAOYSA-N 0.000 claims description 4
- HJJVPARKXDDIQD-UHFFFAOYSA-N bromuconazole Chemical compound ClC1=CC(Cl)=CC=C1C1(CN2N=CN=C2)OCC(Br)C1 HJJVPARKXDDIQD-UHFFFAOYSA-N 0.000 claims description 4
- GYSSRZJIHXQEHQ-UHFFFAOYSA-N carboxin Chemical compound S1CCOC(C)=C1C(=O)NC1=CC=CC=C1 GYSSRZJIHXQEHQ-UHFFFAOYSA-N 0.000 claims description 4
- ACMXQHFNODYQAT-UHFFFAOYSA-N cyflufenamid Chemical compound FC1=CC=C(C(F)(F)F)C(C(NOCC2CC2)=NC(=O)CC=2C=CC=CC=2)=C1F ACMXQHFNODYQAT-UHFFFAOYSA-N 0.000 claims description 4
- QAYICIQNSGETAS-UHFFFAOYSA-N dazomet Chemical compound CN1CSC(=S)N(C)C1 QAYICIQNSGETAS-UHFFFAOYSA-N 0.000 claims description 4
- UWQMKVBQKFHLCE-UHFFFAOYSA-N diclomezine Chemical compound C1=C(Cl)C(C)=C(Cl)C=C1C1=NNC(=O)C=C1 UWQMKVBQKFHLCE-UHFFFAOYSA-N 0.000 claims description 4
- AWZOLILCOUMRDG-UHFFFAOYSA-N edifenphos Chemical compound C=1C=CC=CC=1SP(=O)(OCC)SC1=CC=CC=C1 AWZOLILCOUMRDG-UHFFFAOYSA-N 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- JLHMVTORNNQCRM-UHFFFAOYSA-N ethylphosphine Chemical compound CCP JLHMVTORNNQCRM-UHFFFAOYSA-N 0.000 claims description 4
- FKLFBQCQQYDUAM-UHFFFAOYSA-N fenpiclonil Chemical compound ClC1=CC=CC(C=2C(=CNC=2)C#N)=C1Cl FKLFBQCQQYDUAM-UHFFFAOYSA-N 0.000 claims description 4
- PTCGDEVVHUXTMP-UHFFFAOYSA-N flutolanil Chemical compound CC(C)OC1=CC=CC(NC(=O)C=2C(=CC=CC=2)C(F)(F)F)=C1 PTCGDEVVHUXTMP-UHFFFAOYSA-N 0.000 claims description 4
- CKAPSXZOOQJIBF-UHFFFAOYSA-N hexachlorobenzene Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl CKAPSXZOOQJIBF-UHFFFAOYSA-N 0.000 claims description 4
- UFHLMYOGRXOCSL-UHFFFAOYSA-N isoprothiolane Chemical compound CC(C)OC(=O)C(C(=O)OC(C)C)=C1SCCS1 UFHLMYOGRXOCSL-UHFFFAOYSA-N 0.000 claims description 4
- YKSNLCVSTHTHJA-UHFFFAOYSA-L maneb Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S YKSNLCVSTHTHJA-UHFFFAOYSA-L 0.000 claims description 4
- 229920000940 maneb Polymers 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- CJPQIRJHIZUAQP-UHFFFAOYSA-N methyl N-(2,6-dimethylphenyl)-N-(phenylacetyl)alaninate Chemical compound CC=1C=CC=C(C)C=1N(C(C)C(=O)OC)C(=O)CC1=CC=CC=C1 CJPQIRJHIZUAQP-UHFFFAOYSA-N 0.000 claims description 4
- 150000002923 oximes Chemical class 0.000 claims description 4
- AMEKQAFGQBKLKX-UHFFFAOYSA-N oxycarboxin Chemical compound O=S1(=O)CCOC(C)=C1C(=O)NC1=CC=CC=C1 AMEKQAFGQBKLKX-UHFFFAOYSA-N 0.000 claims description 4
- OGYFATSSENRIKG-UHFFFAOYSA-N pencycuron Chemical compound C1=CC(Cl)=CC=C1CN(C(=O)NC=1C=CC=CC=1)C1CCCC1 OGYFATSSENRIKG-UHFFFAOYSA-N 0.000 claims description 4
- XRJLAOUDSILTFT-UHFFFAOYSA-N pyroquilon Chemical compound O=C1CCC2=CC=CC3=C2N1CC3 XRJLAOUDSILTFT-UHFFFAOYSA-N 0.000 claims description 4
- 235000015096 spirit Nutrition 0.000 claims description 4
- 229960005322 streptomycin Drugs 0.000 claims description 4
- 230000002195 synergetic effect Effects 0.000 claims description 4
- LITQZINTSYBKIU-UHFFFAOYSA-F tetracopper;hexahydroxide;sulfate Chemical compound [OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[Cu+2].[Cu+2].[Cu+2].[Cu+2].[O-]S([O-])(=O)=O LITQZINTSYBKIU-UHFFFAOYSA-F 0.000 claims description 4
- 239000004308 thiabendazole Substances 0.000 claims description 4
- WJCNZQLZVWNLKY-UHFFFAOYSA-N thiabendazole Chemical compound S1C=NC(C=2NC3=CC=CC=C3N=2)=C1 WJCNZQLZVWNLKY-UHFFFAOYSA-N 0.000 claims description 4
- 235000010296 thiabendazole Nutrition 0.000 claims description 4
- 229960004546 thiabendazole Drugs 0.000 claims description 4
- VJQYLJSMBWXGDV-UHFFFAOYSA-N tiadinil Chemical compound N1=NSC(C(=O)NC=2C=C(Cl)C(C)=CC=2)=C1C VJQYLJSMBWXGDV-UHFFFAOYSA-N 0.000 claims description 4
- HYVWIQDYBVKITD-UHFFFAOYSA-N tolylfluanid Chemical compound CN(C)S(=O)(=O)N(SC(F)(Cl)Cl)C1=CC=C(C)C=C1 HYVWIQDYBVKITD-UHFFFAOYSA-N 0.000 claims description 4
- DUBNHZYBDBBJHD-UHFFFAOYSA-L ziram Chemical compound [Zn+2].CN(C)C([S-])=S.CN(C)C([S-])=S DUBNHZYBDBBJHD-UHFFFAOYSA-L 0.000 claims description 4
- LDVVMCZRFWMZSG-OLQVQODUSA-N (3ar,7as)-2-(trichloromethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)Cl)C(=O)[C@H]21 LDVVMCZRFWMZSG-OLQVQODUSA-N 0.000 claims description 3
- RNSKZDUUNLMFJL-UHFFFAOYSA-N 1,2-thiazole-5-carboxamide Chemical compound NC(=O)C1=CC=NS1 RNSKZDUUNLMFJL-UHFFFAOYSA-N 0.000 claims description 3
- NMWKWBPNKPGATC-UHFFFAOYSA-N 4,5,6,7-tetrachloro-2-benzofuran-1(3H)-one Chemical compound ClC1=C(Cl)C(Cl)=C2COC(=O)C2=C1Cl NMWKWBPNKPGATC-UHFFFAOYSA-N 0.000 claims description 3
- BMTZEAOGFDXDAD-UHFFFAOYSA-M 4-(4,6-dimethoxy-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium;chloride Chemical compound [Cl-].COC1=NC(OC)=NC([N+]2(C)CCOCC2)=N1 BMTZEAOGFDXDAD-UHFFFAOYSA-M 0.000 claims description 3
- WQMVTGCKCKMBSJ-UHFFFAOYSA-N 4-(difluoromethyl)-2-methyl-n-[2-[4-(trifluoromethyl)phenyl]phenyl]-1,3-thiazole-5-carboxamide Chemical compound S1C(C)=NC(C(F)F)=C1C(=O)NC1=CC=CC=C1C1=CC=C(C(F)(F)F)C=C1 WQMVTGCKCKMBSJ-UHFFFAOYSA-N 0.000 claims description 3
- BIHPYCDDPGNWQO-UHFFFAOYSA-N 5-iai Chemical compound C1=C(I)C=C2CC(N)CC2=C1 BIHPYCDDPGNWQO-UHFFFAOYSA-N 0.000 claims description 3
- XNCOSPRUTUOJCJ-UHFFFAOYSA-N Biguanide Chemical compound NC(N)=NC(N)=N XNCOSPRUTUOJCJ-UHFFFAOYSA-N 0.000 claims description 3
- UMIVDQOVSJFWOH-UHFFFAOYSA-N C1(=CC=CC=C1)C1=CC=CC=C1.[F] Chemical group C1(=CC=CC=C1)C1=CC=CC=C1.[F] UMIVDQOVSJFWOH-UHFFFAOYSA-N 0.000 claims description 3
- 239000005745 Captan Substances 0.000 claims description 3
- 150000001336 alkenes Chemical class 0.000 claims description 3
- 229940117949 captan Drugs 0.000 claims description 3
- AEJIMXVJZFYIHN-UHFFFAOYSA-N copper;dihydrate Chemical compound O.O.[Cu] AEJIMXVJZFYIHN-UHFFFAOYSA-N 0.000 claims description 3
- CJHXCRMKMMBYJQ-UHFFFAOYSA-N dimethirimol Chemical compound CCCCC1=C(C)NC(N(C)C)=NC1=O CJHXCRMKMMBYJQ-UHFFFAOYSA-N 0.000 claims description 3
- VMNULHCTRPXWFJ-UJSVPXBISA-N enoxastrobin Chemical compound CO\C=C(\C(=O)OC)C1=CC=CC=C1CO\N=C(/C)\C=C\C1=CC=C(Cl)C=C1 VMNULHCTRPXWFJ-UJSVPXBISA-N 0.000 claims description 3
- GNVDAZSPJWCIQZ-UHFFFAOYSA-N flusulfamide Chemical compound ClC1=CC([N+](=O)[O-])=CC=C1NS(=O)(=O)C1=CC=C(Cl)C(C(F)(F)F)=C1 GNVDAZSPJWCIQZ-UHFFFAOYSA-N 0.000 claims description 3
- IQECZGDVZMVJSH-UHFFFAOYSA-N furan 1H-pyrazole Chemical class O1C=CC=C1.N1N=CC=C1 IQECZGDVZMVJSH-UHFFFAOYSA-N 0.000 claims description 3
- 150000002357 guanidines Chemical class 0.000 claims description 3
- KGVPNLBXJKTABS-UHFFFAOYSA-N hymexazol Chemical compound CC1=CC(O)=NO1 KGVPNLBXJKTABS-UHFFFAOYSA-N 0.000 claims description 3
- FCOAHACKGGIURQ-UHFFFAOYSA-N iprobenfos Chemical compound CC(C)OP(=O)(OC(C)C)SCC1=CC=CC=C1 FCOAHACKGGIURQ-UHFFFAOYSA-N 0.000 claims description 3
- 150000002576 ketones Chemical class 0.000 claims description 3
- CIEXPHRYOLIQQD-UHFFFAOYSA-N methyl N-(2,6-dimethylphenyl)-N-2-furoylalaninate Chemical compound CC=1C=CC=C(C)C=1N(C(C)C(=O)OC)C(=O)C1=CC=CO1 CIEXPHRYOLIQQD-UHFFFAOYSA-N 0.000 claims description 3
- NOTMCFVPRDIUAV-UHFFFAOYSA-N n-[2-(4-bromophenyl)phenyl]-4-(difluoromethyl)-2-methyl-1,3-thiazole-5-carboxamide Chemical compound S1C(C)=NC(C(F)F)=C1C(=O)NC1=CC=CC=C1C1=CC=C(Br)C=C1 NOTMCFVPRDIUAV-UHFFFAOYSA-N 0.000 claims description 3
- WBTYBAGIHOISOQ-UHFFFAOYSA-N pent-4-en-1-yl 2-[(2-furylmethyl)(imidazol-1-ylcarbonyl)amino]butanoate Chemical compound C1=CN=CN1C(=O)N(C(CC)C(=O)OCCCC=C)CC1=CC=CO1 WBTYBAGIHOISOQ-UHFFFAOYSA-N 0.000 claims description 3
- YEBIHIICWDDQOL-YBHNRIQQSA-N polyoxin Polymers O[C@@H]1[C@H](O)[C@@H](C(C=O)N)O[C@H]1N1C(=O)NC(=O)C(C(O)=O)=C1 YEBIHIICWDDQOL-YBHNRIQQSA-N 0.000 claims description 3
- 239000002689 soil Substances 0.000 claims description 3
- 230000001954 sterilising effect Effects 0.000 claims description 3
- 238000004659 sterilization and disinfection Methods 0.000 claims description 3
- SBXWFLISHPUINY-UHFFFAOYSA-N triphenyltin Chemical class C1=CC=CC=C1[Sn](C=1C=CC=CC=1)C1=CC=CC=C1 SBXWFLISHPUINY-UHFFFAOYSA-N 0.000 claims description 3
- ANJYDSPMBISEHY-UHFFFAOYSA-N (4-fluorophenyl) carbamate Chemical compound NC(=O)OC1=CC=C(F)C=C1 ANJYDSPMBISEHY-UHFFFAOYSA-N 0.000 claims description 2
- XNXCINUKGNQCEZ-UHFFFAOYSA-N 3-(difluoromethyl)-1-methylpyrazole-4-carboxamide Chemical compound CN1C=C(C(N)=O)C(C(F)F)=N1 XNXCINUKGNQCEZ-UHFFFAOYSA-N 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 2
- 230000003115 biocidal effect Effects 0.000 claims description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 150000004702 methyl esters Chemical class 0.000 claims description 2
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 2
- 150000004045 organic chlorine compounds Chemical class 0.000 claims description 2
- 150000002902 organometallic compounds Chemical class 0.000 claims description 2
- 150000002903 organophosphorus compounds Chemical class 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 claims description 2
- YWGZBLRRLREJIR-UHFFFAOYSA-N triazole-1-sulfonamide Chemical compound NS(=O)(=O)N1C=CN=N1 YWGZBLRRLREJIR-UHFFFAOYSA-N 0.000 claims description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims 2
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 claims 1
- 230000002538 fungal effect Effects 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- 235000019260 propionic acid Nutrition 0.000 claims 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims 1
- 239000007787 solid Substances 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 abstract 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 2
- 125000004767 (C1-C4) haloalkoxy group Chemical group 0.000 abstract 1
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- 150000003857 carboxamides Chemical class 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 244000053095 fungal pathogen Species 0.000 abstract 1
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 119
- ILKDFYNYRDQIQC-UHFFFAOYSA-N n-[2-(4-chloro-2-fluoro-5-methylphenyl)phenyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide Chemical compound C1=C(Cl)C(C)=CC(C=2C(=CC=CC=2)NC(=O)C=2C(=NN(C)C=2)C(F)(F)F)=C1F ILKDFYNYRDQIQC-UHFFFAOYSA-N 0.000 description 73
- SXSGXWCSHSVPGB-UHFFFAOYSA-N fluxapyroxad Chemical compound FC(F)C1=NN(C)C=C1C(=O)NC1=CC=CC=C1C1=CC(F)=C(F)C(F)=C1 SXSGXWCSHSVPGB-UHFFFAOYSA-N 0.000 description 70
- OXBRSAWHLLAWFH-UHFFFAOYSA-N 3-(difluoromethyl)-1-methyl-n-[2-(2,4,5-trifluorophenyl)phenyl]pyrazole-4-carboxamide Chemical compound FC(F)C1=NN(C)C=C1C(=O)NC1=CC=CC=C1C1=CC(F)=C(F)C=C1F OXBRSAWHLLAWFH-UHFFFAOYSA-N 0.000 description 68
- HDWGAKWQBOMENH-UHFFFAOYSA-N 1-methyl-3-(trifluoromethyl)-n-[2-(3,4,5-trifluorophenyl)phenyl]pyrazole-4-carboxamide Chemical compound FC(F)(F)C1=NN(C)C=C1C(=O)NC1=CC=CC=C1C1=CC(F)=C(F)C(F)=C1 HDWGAKWQBOMENH-UHFFFAOYSA-N 0.000 description 66
- 239000002585 base Substances 0.000 description 45
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 27
- 241000385736 bacterium B Species 0.000 description 24
- 241000196324 Embryophyta Species 0.000 description 20
- 235000013339 cereals Nutrition 0.000 description 19
- 240000007594 Oryza sativa Species 0.000 description 16
- 235000007164 Oryza sativa Nutrition 0.000 description 15
- 240000008042 Zea mays Species 0.000 description 15
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 15
- 235000009566 rice Nutrition 0.000 description 15
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 14
- 235000005822 corn Nutrition 0.000 description 14
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 8
- 241000209140 Triticum Species 0.000 description 7
- 235000021307 Triticum Nutrition 0.000 description 7
- 240000006365 Vitis vinifera Species 0.000 description 7
- 235000014787 Vitis vinifera Nutrition 0.000 description 7
- 235000013311 vegetables Nutrition 0.000 description 7
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 6
- 241000371644 Curvularia ravenelii Species 0.000 description 6
- 235000010469 Glycine max Nutrition 0.000 description 6
- 244000068988 Glycine max Species 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 5
- 229920000742 Cotton Polymers 0.000 description 5
- 241000223218 Fusarium Species 0.000 description 5
- 240000005979 Hordeum vulgare Species 0.000 description 5
- 235000007340 Hordeum vulgare Nutrition 0.000 description 5
- 235000021536 Sugar beet Nutrition 0.000 description 5
- WDQNIWFZKXZFAY-UHFFFAOYSA-M fentin acetate Chemical compound CC([O-])=O.C1=CC=CC=C1[Sn+](C=1C=CC=CC=1)C1=CC=CC=C1 WDQNIWFZKXZFAY-UHFFFAOYSA-M 0.000 description 5
- 241000223600 Alternaria Species 0.000 description 4
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 4
- 240000002791 Brassica napus Species 0.000 description 4
- 235000006008 Brassica napus var napus Nutrition 0.000 description 4
- 241000228437 Cochliobolus Species 0.000 description 4
- 241000221785 Erysiphales Species 0.000 description 4
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 4
- 240000003768 Solanum lycopersicum Species 0.000 description 4
- 235000002595 Solanum tuberosum Nutrition 0.000 description 4
- 244000061456 Solanum tuberosum Species 0.000 description 4
- CHFKUVPQTICASN-UHFFFAOYSA-N [O]CC#C Chemical compound [O]CC#C CHFKUVPQTICASN-UHFFFAOYSA-N 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- 235000014113 dietary fatty acids Nutrition 0.000 description 4
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 4
- 235000013399 edible fruits Nutrition 0.000 description 4
- 239000000194 fatty acid Substances 0.000 description 4
- 229930195729 fatty acid Natural products 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 4
- 229920000151 polyglycol Polymers 0.000 description 4
- 239000010695 polyglycol Substances 0.000 description 4
- YABFPHSQTSFWQB-UHFFFAOYSA-N 2-(4-fluorophenyl)-1-(1,2,4-triazol-1-yl)-3-(trimethylsilyl)propan-2-ol Chemical compound C=1C=C(F)C=CC=1C(O)(C[Si](C)(C)C)CN1C=NC=N1 YABFPHSQTSFWQB-UHFFFAOYSA-N 0.000 description 3
- ZRNSSRODJSSVEJ-UHFFFAOYSA-N 2-methylpentacosane Chemical compound CCCCCCCCCCCCCCCCCCCCCCCC(C)C ZRNSSRODJSSVEJ-UHFFFAOYSA-N 0.000 description 3
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 3
- 241000235349 Ascomycota Species 0.000 description 3
- 241000221198 Basidiomycota Species 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 240000008067 Cucumis sativus Species 0.000 description 3
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 241000219146 Gossypium Species 0.000 description 3
- 244000020551 Helianthus annuus Species 0.000 description 3
- 235000003222 Helianthus annuus Nutrition 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 240000005561 Musa balbisiana Species 0.000 description 3
- 235000018290 Musa x paradisiaca Nutrition 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 241000233654 Oomycetes Species 0.000 description 3
- 241001223281 Peronospora Species 0.000 description 3
- 241000233679 Peronosporaceae Species 0.000 description 3
- 241000228453 Pyrenophora Species 0.000 description 3
- 241000233639 Pythium Species 0.000 description 3
- 235000007238 Secale cereale Nutrition 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- YPHMISFOHDHNIV-FSZOTQKASA-N cycloheximide Chemical compound C1[C@@H](C)C[C@H](C)C(=O)[C@@H]1[C@H](O)CC1CC(=O)NC(=O)C1 YPHMISFOHDHNIV-FSZOTQKASA-N 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 3
- NBVXSUQYWXRMNV-UHFFFAOYSA-N monofluoromethane Natural products FC NBVXSUQYWXRMNV-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- HIIRDDUVRXCDBN-SDXDJHTJSA-N (2z)-2-methoxyimino-n-methyl-2-(2-phenoxyphenyl)acetamide Chemical compound CNC(=O)C(=N/OC)\C1=CC=CC=C1OC1=CC=CC=C1 HIIRDDUVRXCDBN-SDXDJHTJSA-N 0.000 description 2
- CFRPSFYHXJZSBI-DHZHZOJOSA-N (E)-nitenpyram Chemical compound [O-][N+](=O)/C=C(\NC)N(CC)CC1=CC=C(Cl)N=C1 CFRPSFYHXJZSBI-DHZHZOJOSA-N 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 2
- WURBVZBTWMNKQT-UHFFFAOYSA-N 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one Chemical compound C1=NC=NN1C(C(=O)C(C)(C)C)OC1=CC=C(Cl)C=C1 WURBVZBTWMNKQT-UHFFFAOYSA-N 0.000 description 2
- STMIIPIFODONDC-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)-1-(1H-1,2,4-triazol-1-yl)hexan-2-ol Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(O)(CCCC)CN1C=NC=N1 STMIIPIFODONDC-UHFFFAOYSA-N 0.000 description 2
- HZJKXKUJVSEEFU-UHFFFAOYSA-N 2-(4-chlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)hexanenitrile Chemical compound C=1C=C(Cl)C=CC=1C(CCCC)(C#N)CN1C=NC=N1 HZJKXKUJVSEEFU-UHFFFAOYSA-N 0.000 description 2
- IRJQWZWMQCVOLA-ZBKNUEDVSA-N 2-[(z)-n-[(3,5-difluorophenyl)carbamoylamino]-c-methylcarbonimidoyl]pyridine-3-carboxylic acid Chemical compound N=1C=CC=C(C(O)=O)C=1C(/C)=N\NC(=O)NC1=CC(F)=CC(F)=C1 IRJQWZWMQCVOLA-ZBKNUEDVSA-N 0.000 description 2
- WNZQDUSMALZDQF-UHFFFAOYSA-N 2-benzofuran-1(3H)-one Chemical compound C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 description 2
- OWDLFBLNMPCXSD-UHFFFAOYSA-N 2-chloro-N-(2,6-dimethylphenyl)-N-(2-oxotetrahydrofuran-3-yl)acetamide Chemical compound CC1=CC=CC(C)=C1N(C(=O)CCl)C1C(=O)OCC1 OWDLFBLNMPCXSD-UHFFFAOYSA-N 0.000 description 2
- XXUNIGZDNWWYED-UHFFFAOYSA-N 2-methylbenzamide Chemical compound CC1=CC=CC=C1C(N)=O XXUNIGZDNWWYED-UHFFFAOYSA-N 0.000 description 2
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 2
- SBUKOHLFHYSZNG-UHFFFAOYSA-N 4-dodecyl-2,6-dimethylmorpholine Chemical compound CCCCCCCCCCCCN1CC(C)OC(C)C1 SBUKOHLFHYSZNG-UHFFFAOYSA-N 0.000 description 2
- NRTLIYOWLVMQBO-UHFFFAOYSA-N 5-chloro-1,3-dimethyl-N-(1,1,3-trimethyl-1,3-dihydro-2-benzofuran-4-yl)pyrazole-4-carboxamide Chemical compound C=12C(C)OC(C)(C)C2=CC=CC=1NC(=O)C=1C(C)=NN(C)C=1Cl NRTLIYOWLVMQBO-UHFFFAOYSA-N 0.000 description 2
- PCCSBWNGDMYFCW-UHFFFAOYSA-N 5-methyl-5-(4-phenoxyphenyl)-3-(phenylamino)-1,3-oxazolidine-2,4-dione Chemical compound O=C1C(C)(C=2C=CC(OC=3C=CC=CC=3)=CC=2)OC(=O)N1NC1=CC=CC=C1 PCCSBWNGDMYFCW-UHFFFAOYSA-N 0.000 description 2
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 2
- 244000291564 Allium cepa Species 0.000 description 2
- 241001444083 Aphanomyces Species 0.000 description 2
- 241000222195 Ascochyta Species 0.000 description 2
- 235000005340 Asparagus officinalis Nutrition 0.000 description 2
- 241000228212 Aspergillus Species 0.000 description 2
- 241000223678 Aureobasidium pullulans Species 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- 241000123650 Botrytis cinerea Species 0.000 description 2
- 240000007124 Brassica oleracea Species 0.000 description 2
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 2
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 2
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 2
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 2
- 241001157813 Cercospora Species 0.000 description 2
- 241000221955 Chaetomium Species 0.000 description 2
- 241000222290 Cladosporium Species 0.000 description 2
- 241000222356 Coriolus Species 0.000 description 2
- 241000221778 Fusarium fujikuroi Species 0.000 description 2
- 241000238631 Hexapoda Species 0.000 description 2
- 241000223198 Humicola Species 0.000 description 2
- 239000005906 Imidacloprid Substances 0.000 description 2
- 235000003228 Lactuca sativa Nutrition 0.000 description 2
- 240000008415 Lactuca sativa Species 0.000 description 2
- 241000222418 Lentinus Species 0.000 description 2
- 241001330975 Magnaporthe oryzae Species 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- 241000235395 Mucor Species 0.000 description 2
- FTCOKXNKPOUEFH-UHFFFAOYSA-N Myclozolin Chemical compound O=C1C(COC)(C)OC(=O)N1C1=CC(Cl)=CC(Cl)=C1 FTCOKXNKPOUEFH-UHFFFAOYSA-N 0.000 description 2
- 241000131448 Mycosphaerella Species 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- VJAWBEFMCIINFU-UHFFFAOYSA-N Nitrothal-isopropyl Chemical compound CC(C)OC(=O)C1=CC(C(=O)OC(C)C)=CC([N+]([O-])=O)=C1 VJAWBEFMCIINFU-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 241001236817 Paecilomyces <Clavicipitaceae> Species 0.000 description 2
- 241000228143 Penicillium Species 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 241001480007 Phomopsis Species 0.000 description 2
- 241000233614 Phytophthora Species 0.000 description 2
- 241000233616 Phytophthora capsici Species 0.000 description 2
- 241000233622 Phytophthora infestans Species 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 241000222350 Pleurotus Species 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 241000589516 Pseudomonas Species 0.000 description 2
- 241000221300 Puccinia Species 0.000 description 2
- 241000221301 Puccinia graminis Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000918585 Pythium aphanidermatum Species 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 241001361634 Rhizoctonia Species 0.000 description 2
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 2
- 235000014680 Saccharomyces cerevisiae Nutrition 0.000 description 2
- 240000000111 Saccharum officinarum Species 0.000 description 2
- 235000007201 Saccharum officinarum Nutrition 0.000 description 2
- 206010039509 Scab Diseases 0.000 description 2
- 241000221662 Sclerotinia Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 2
- 241000722133 Tilletia Species 0.000 description 2
- 241000223259 Trichoderma Species 0.000 description 2
- 241000221566 Ustilago Species 0.000 description 2
- 244000301083 Ustilago maydis Species 0.000 description 2
- 241000317942 Venturia <ichneumonid wasp> Species 0.000 description 2
- 241000082085 Verticillium <Phyllachorales> Species 0.000 description 2
- 235000009754 Vitis X bourquina Nutrition 0.000 description 2
- 235000012333 Vitis X labruscana Nutrition 0.000 description 2
- 241001360088 Zymoseptoria tritici Species 0.000 description 2
- ZKBNUNIVNISNDB-UHFFFAOYSA-N [Cl].FC Chemical compound [Cl].FC ZKBNUNIVNISNDB-UHFFFAOYSA-N 0.000 description 2
- VLLDIVKWDYJNLM-UHFFFAOYSA-N [Mn].C(N)(S)=S.C=C Chemical compound [Mn].C(N)(S)=S.C=C VLLDIVKWDYJNLM-UHFFFAOYSA-N 0.000 description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 2
- UELITFHSCLAHKR-UHFFFAOYSA-N acibenzolar-S-methyl Chemical group CSC(=O)C1=CC=CC2=C1SN=N2 UELITFHSCLAHKR-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000008052 alkyl sulfonates Chemical class 0.000 description 2
- BREATYVWRHIPIY-UHFFFAOYSA-N amisulbrom Chemical compound CN(C)S(=O)(=O)N1C=NC(S(=O)(=O)N2C3=CC(F)=CC=C3C(Br)=C2C)=N1 BREATYVWRHIPIY-UHFFFAOYSA-N 0.000 description 2
- 210000003323 beak Anatomy 0.000 description 2
- VVSLYIKSEBPRSN-PELKAZGASA-N benthiavalicarb Chemical compound C1=C(F)C=C2SC([C@@H](C)NC(=O)[C@@H](NC(O)=O)C(C)C)=NC2=C1 VVSLYIKSEBPRSN-PELKAZGASA-N 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- VBJZWFWINSGBLK-UHFFFAOYSA-N carbamodithioic acid;ethene;zinc Chemical compound [Zn].C=C.NC(S)=S VBJZWFWINSGBLK-UHFFFAOYSA-N 0.000 description 2
- RXDMAYSSBPYBFW-UHFFFAOYSA-N carpropamid Chemical compound C=1C=C(Cl)C=CC=1C(C)NC(=O)C1(CC)C(C)C1(Cl)Cl RXDMAYSSBPYBFW-UHFFFAOYSA-N 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- YXKMMRDKEKCERS-UHFFFAOYSA-N cyazofamid Chemical compound CN(C)S(=O)(=O)N1C(C#N)=NC(Cl)=C1C1=CC=C(C)C=C1 YXKMMRDKEKCERS-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 125000003963 dichloro group Chemical group Cl* 0.000 description 2
- YEJGPFZQLRMXOI-PKEIRNPWSA-N diclocymet Chemical compound N#CC(C(C)(C)C)C(=O)N[C@H](C)C1=CC=C(Cl)C=C1Cl YEJGPFZQLRMXOI-PKEIRNPWSA-N 0.000 description 2
- MZGNSEAPZQGJRB-UHFFFAOYSA-N dimethyldithiocarbamic acid Chemical compound CN(C)C(S)=S MZGNSEAPZQGJRB-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical group C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000007046 ethoxylation reaction Methods 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 125000003784 fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 2
- DDUHZTYCFQRHIY-RBHXEPJQSA-N griseofulvin Chemical compound COC1=CC(=O)C[C@@H](C)[C@@]11C(=O)C(C(OC)=CC(OC)=C2Cl)=C2O1 DDUHZTYCFQRHIY-RBHXEPJQSA-N 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 229940056881 imidacloprid Drugs 0.000 description 2
- YWTYJOPNNQFBPC-UHFFFAOYSA-N imidacloprid Chemical compound [O-][N+](=O)\N=C1/NCCN1CC1=CC=C(Cl)N=C1 YWTYJOPNNQFBPC-UHFFFAOYSA-N 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- QTYCMDBMOLSEAM-UHFFFAOYSA-N ipconazole Chemical compound C1=NC=NN1CC1(O)C(C(C)C)CCC1CC1=CC=C(Cl)C=C1 QTYCMDBMOLSEAM-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- PVTHJAPFENJVNC-MHRBZPPQSA-N kasugamycin Chemical compound N[C@H]1C[C@H](NC(=N)C(O)=O)[C@@H](C)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O PVTHJAPFENJVNC-MHRBZPPQSA-N 0.000 description 2
- 229920005610 lignin Polymers 0.000 description 2
- HYVVJDQGXFXBRZ-UHFFFAOYSA-N metam Chemical compound CNC(S)=S HYVVJDQGXFXBRZ-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 2
- 150000002790 naphthalenes Chemical class 0.000 description 2
- NCXMLFZGDNKEPB-FFPOYIOWSA-N natamycin Chemical compound O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1/C=C/C=C/C=C/C=C/C[C@@H](C)OC(=O)/C=C/[C@H]2O[C@@H]2C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 NCXMLFZGDNKEPB-FFPOYIOWSA-N 0.000 description 2
- 229940079888 nitenpyram Drugs 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- WZZLDXDUQPOXNW-UHFFFAOYSA-N propamocarb Chemical compound CCCOC(=O)NCCCN(C)C WZZLDXDUQPOXNW-UHFFFAOYSA-N 0.000 description 2
- 150000003230 pyrimidines Chemical class 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 2
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 2
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- WHOZNOZYMBRCBL-OUKQBFOZSA-N (2E)-2-Tetradecenal Chemical compound CCCCCCCCCCC\C=C\C=O WHOZNOZYMBRCBL-OUKQBFOZSA-N 0.000 description 1
- ZMYFCFLJBGAQRS-IRXDYDNUSA-N (2R,3S)-epoxiconazole Chemical compound C1=CC(F)=CC=C1[C@@]1(CN2N=CN=C2)[C@H](C=2C(=CC=CC=2)Cl)O1 ZMYFCFLJBGAQRS-IRXDYDNUSA-N 0.000 description 1
- RYAUSSKQMZRMAI-ALOPSCKCSA-N (2S,6R)-4-[3-(4-tert-butylphenyl)-2-methylpropyl]-2,6-dimethylmorpholine Chemical compound C=1C=C(C(C)(C)C)C=CC=1CC(C)CN1C[C@H](C)O[C@H](C)C1 RYAUSSKQMZRMAI-ALOPSCKCSA-N 0.000 description 1
- WVHAIMKMNMGHMX-UHFFFAOYSA-N (4-fluorophenyl)-methylsilane Chemical compound FC1=CC=C(C=C1)[SiH2]C WVHAIMKMNMGHMX-UHFFFAOYSA-N 0.000 description 1
- WCXDHFDTOYPNIE-RIYZIHGNSA-N (E)-acetamiprid Chemical compound N#C/N=C(\C)N(C)CC1=CC=C(Cl)N=C1 WCXDHFDTOYPNIE-RIYZIHGNSA-N 0.000 description 1
- PGOOBECODWQEAB-UHFFFAOYSA-N (E)-clothianidin Chemical compound [O-][N+](=O)\N=C(/NC)NCC1=CN=C(Cl)S1 PGOOBECODWQEAB-UHFFFAOYSA-N 0.000 description 1
- MTXSIJUGVMTTMU-JTQLQIEISA-N (S)-anabasine Chemical compound N1CCCC[C@H]1C1=CC=CN=C1 MTXSIJUGVMTTMU-JTQLQIEISA-N 0.000 description 1
- HOKKPVIRMVDYPB-UVTDQMKNSA-N (Z)-thiacloprid Chemical compound C1=NC(Cl)=CC=C1CN1C(=N/C#N)/SCC1 HOKKPVIRMVDYPB-UVTDQMKNSA-N 0.000 description 1
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 description 1
- ZPQOPVIELGIULI-UHFFFAOYSA-N 1,3-dichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1 ZPQOPVIELGIULI-UHFFFAOYSA-N 0.000 description 1
- IMLSAISZLJGWPP-UHFFFAOYSA-N 1,3-dithiolane Chemical compound C1CSCS1 IMLSAISZLJGWPP-UHFFFAOYSA-N 0.000 description 1
- LQDARGUHUSPFNL-UHFFFAOYSA-N 1-[2-(2,4-dichlorophenyl)-3-(1,1,2,2-tetrafluoroethoxy)propyl]1,2,4-triazole Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(COC(F)(F)C(F)F)CN1C=NC=N1 LQDARGUHUSPFNL-UHFFFAOYSA-N 0.000 description 1
- 125000006083 1-bromoethyl group Chemical group 0.000 description 1
- 125000001478 1-chloroethyl group Chemical group [H]C([H])([H])C([H])(Cl)* 0.000 description 1
- 125000004776 1-fluoroethyl group Chemical group [H]C([H])([H])C([H])(F)* 0.000 description 1
- PFFIDZXUXFLSSR-UHFFFAOYSA-N 1-methyl-N-[2-(4-methylpentan-2-yl)-3-thienyl]-3-(trifluoromethyl)pyrazole-4-carboxamide Chemical compound S1C=CC(NC(=O)C=2C(=NN(C)C=2)C(F)(F)F)=C1C(C)CC(C)C PFFIDZXUXFLSSR-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- SODQFLRLAOALCF-UHFFFAOYSA-N 1lambda3-bromacyclohexa-1,3,5-triene Chemical compound Br1=CC=CC=C1 SODQFLRLAOALCF-UHFFFAOYSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- QZEDXQFZACVDJE-UHFFFAOYSA-N 2,3-dibutylnaphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(O)(=O)=O)=C(CCCC)C(CCCC)=CC2=C1 QZEDXQFZACVDJE-UHFFFAOYSA-N 0.000 description 1
- UXPRZZZNGFVXRR-UHFFFAOYSA-N 2,3-difluoro-1h-pyrrole Chemical compound FC=1C=CNC=1F UXPRZZZNGFVXRR-UHFFFAOYSA-N 0.000 description 1
- NJUVWIKMOXUXSS-UHFFFAOYSA-N 2-(4-chlorophenyl)-3-methyl-2-(1,2,4-triazol-1-yl)pentanenitrile Chemical compound C1=NC=NN1C(C#N)(C(C)CC)C1=CC=C(Cl)C=C1 NJUVWIKMOXUXSS-UHFFFAOYSA-N 0.000 description 1
- KWLVWJPJKJMCSH-UHFFFAOYSA-N 2-(4-chlorophenyl)-N-{2-[3-methoxy-4-(prop-2-yn-1-yloxy)phenyl]ethyl}-2-(prop-2-yn-1-yloxy)acetamide Chemical compound C1=C(OCC#C)C(OC)=CC(CCNC(=O)C(OCC#C)C=2C=CC(Cl)=CC=2)=C1 KWLVWJPJKJMCSH-UHFFFAOYSA-N 0.000 description 1
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical compound CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 1
- HLSLWZHVCLXIMI-UHFFFAOYSA-N 2-(triazol-1-yl)-1h-quinazolin-4-one Chemical compound N1C2=CC=CC=C2C(=O)N=C1N1C=CN=N1 HLSLWZHVCLXIMI-UHFFFAOYSA-N 0.000 description 1
- MNHVNIJQQRJYDH-UHFFFAOYSA-N 2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2-dihydro-1,2,4-triazole-3-thione Chemical compound N1=CNC(=S)N1CC(C1(Cl)CC1)(O)CC1=CC=CC=C1Cl MNHVNIJQQRJYDH-UHFFFAOYSA-N 0.000 description 1
- JTXMVXSTHSMVQF-UHFFFAOYSA-N 2-acetyloxyethyl acetate Chemical compound CC(=O)OCCOC(C)=O JTXMVXSTHSMVQF-UHFFFAOYSA-N 0.000 description 1
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 description 1
- 125000004779 2-chloro-2-fluoroethyl group Chemical group [H]C([H])(*)C([H])(F)Cl 0.000 description 1
- ONKIWRZLPZCYDL-UHFFFAOYSA-N 2-chloro-4-(4-fluorophenoxy)quinoline Chemical compound C1=CC(F)=CC=C1OC1=CC(Cl)=NC2=CC=CC=C12 ONKIWRZLPZCYDL-UHFFFAOYSA-N 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- AIDLAEPHWROGFI-UHFFFAOYSA-N 2-methylbenzene-1,3-dicarboxylic acid Chemical compound CC1=C(C(O)=O)C=CC=C1C(O)=O AIDLAEPHWROGFI-UHFFFAOYSA-N 0.000 description 1
- 229940044120 2-n-octyl-4-isothiazolin-3-one Drugs 0.000 description 1
- AVGVFDSUDIUXEU-UHFFFAOYSA-N 2-octyl-1,2-thiazolidin-3-one Chemical compound CCCCCCCCN1SCCC1=O AVGVFDSUDIUXEU-UHFFFAOYSA-N 0.000 description 1
- DUIOKRXOKLLURE-UHFFFAOYSA-N 2-octylphenol Chemical compound CCCCCCCCC1=CC=CC=C1O DUIOKRXOKLLURE-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- PFTZLFKMQOYCLG-UHFFFAOYSA-N 3,5-dimethyl-1,3,5-thiadiazinane Chemical compound CN1CSCN(C)C1 PFTZLFKMQOYCLG-UHFFFAOYSA-N 0.000 description 1
- KBRSJPHSCOAFDR-UHFFFAOYSA-N 3-chloro-6-methyl-5,5-dioxo-11h-benzo[c][2,1]benzothiazepin-11-ol Chemical compound O=S1(=O)N(C)C2=CC=CC=C2C(O)C2=CC=C(Cl)C=C21 KBRSJPHSCOAFDR-UHFFFAOYSA-N 0.000 description 1
- QSVVHABHJUTSQN-UHFFFAOYSA-N 3-phosphonothiophene-2-carboxylic acid Chemical compound P(=O)(O)(O)C1=C(SC=C1)C(=O)O QSVVHABHJUTSQN-UHFFFAOYSA-N 0.000 description 1
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 1
- PPDBOQMNKNNODG-UHFFFAOYSA-N 5-[(4-chlorophenyl)methylidene]-2,2-dimethyl-1-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-ol Chemical compound C1=NC=NN1CC1(O)C(C)(C)CCC1=CC1=CC=C(Cl)C=C1 PPDBOQMNKNNODG-UHFFFAOYSA-N 0.000 description 1
- ZOCSXAVNDGMNBV-UHFFFAOYSA-N 5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-[(trifluoromethyl)sulfinyl]-1H-pyrazole-3-carbonitrile Chemical compound NC1=C(S(=O)C(F)(F)F)C(C#N)=NN1C1=C(Cl)C=C(C(F)(F)F)C=C1Cl ZOCSXAVNDGMNBV-UHFFFAOYSA-N 0.000 description 1
- PMZBHPUNQNKBOA-UHFFFAOYSA-N 5-methylbenzene-1,3-dicarboxylic acid Chemical compound CC1=CC(C(O)=O)=CC(C(O)=O)=C1 PMZBHPUNQNKBOA-UHFFFAOYSA-N 0.000 description 1
- 239000005875 Acetamiprid Substances 0.000 description 1
- 239000005964 Acibenzolar-S-methyl Substances 0.000 description 1
- 235000010167 Allium cepa var aggregatum Nutrition 0.000 description 1
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 1
- 241000223602 Alternaria alternata Species 0.000 description 1
- 241000213004 Alternaria solani Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 235000017060 Arachis glabrata Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000018262 Arachis monticola Nutrition 0.000 description 1
- 241000239290 Araneae Species 0.000 description 1
- 244000003416 Asparagus officinalis Species 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 241000209763 Avena sativa Species 0.000 description 1
- 235000007558 Avena sp Nutrition 0.000 description 1
- 239000005730 Azoxystrobin Substances 0.000 description 1
- 239000005734 Benalaxyl Substances 0.000 description 1
- 239000005736 Benthiavalicarb Substances 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 241001465178 Bipolaris Species 0.000 description 1
- 241000228438 Bipolaris maydis Species 0.000 description 1
- 241001450781 Bipolaris oryzae Species 0.000 description 1
- 241000190150 Bipolaris sorokiniana Species 0.000 description 1
- 241001480061 Blumeria graminis Species 0.000 description 1
- 241000233685 Bremia lactucae Species 0.000 description 1
- 239000005742 Bupirimate Substances 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- IXDLAXOVLKNKBP-UHFFFAOYSA-N C(N)(S)=S.C(C[Na])[Na] Chemical compound C(N)(S)=S.C(C[Na])[Na] IXDLAXOVLKNKBP-UHFFFAOYSA-N 0.000 description 1
- XKVXGAYDPAZBCM-UHFFFAOYSA-N CC1=C(C(=O)O)CCC=C1C(=O)O Chemical compound CC1=C(C(=O)O)CCC=C1C(=O)O XKVXGAYDPAZBCM-UHFFFAOYSA-N 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 235000008534 Capsicum annuum var annuum Nutrition 0.000 description 1
- 240000008384 Capsicum annuum var. annuum Species 0.000 description 1
- 239000005747 Chlorothalonil Substances 0.000 description 1
- 240000000560 Citrus x paradisi Species 0.000 description 1
- 239000005888 Clothianidin Substances 0.000 description 1
- 240000007154 Coffea arabica Species 0.000 description 1
- 241000252095 Congridae Species 0.000 description 1
- 241000219112 Cucumis Species 0.000 description 1
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 description 1
- 239000005754 Cyazofamid Substances 0.000 description 1
- 241000723247 Cylindrocarpon Species 0.000 description 1
- 239000005758 Cyprodinil Substances 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- WQZGKKKJIJFFOK-IVMDWMLBSA-N D-allopyranose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@H](O)[C@@H]1O WQZGKKKJIJFFOK-IVMDWMLBSA-N 0.000 description 1
- 239000005759 Diethofencarb Substances 0.000 description 1
- IIUZTXTZRGLYTI-UHFFFAOYSA-N Dihydrogriseofulvin Natural products COC1CC(=O)CC(C)C11C(=O)C(C(OC)=CC(OC)=C2Cl)=C2O1 IIUZTXTZRGLYTI-UHFFFAOYSA-N 0.000 description 1
- ZDQWESQEGGJUCH-UHFFFAOYSA-N Diisopropyl adipate Chemical compound CC(C)OC(=O)CCCCC(=O)OC(C)C ZDQWESQEGGJUCH-UHFFFAOYSA-N 0.000 description 1
- 239000005762 Dimoxystrobin Substances 0.000 description 1
- 239000005764 Dithianon Substances 0.000 description 1
- 239000005765 Dodemorph Substances 0.000 description 1
- 241000591358 Eballistra oryzae Species 0.000 description 1
- 241001063191 Elops affinis Species 0.000 description 1
- 239000005767 Epoxiconazole Substances 0.000 description 1
- 241000221787 Erysiphe Species 0.000 description 1
- 235000002756 Erythrina berteroana Nutrition 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 239000005769 Etridiazole Substances 0.000 description 1
- 241000306559 Exserohilum Species 0.000 description 1
- 239000005772 Famoxadone Substances 0.000 description 1
- 239000005775 Fenbuconazole Substances 0.000 description 1
- 239000005778 Fenpropimorph Substances 0.000 description 1
- 239000005899 Fipronil Substances 0.000 description 1
- 239000005781 Fludioxonil Substances 0.000 description 1
- 235000016623 Fragaria vesca Nutrition 0.000 description 1
- 240000009088 Fragaria x ananassa Species 0.000 description 1
- 235000011363 Fragaria x ananassa Nutrition 0.000 description 1
- 239000005791 Fuberidazole Substances 0.000 description 1
- 241000223194 Fusarium culmorum Species 0.000 description 1
- 241000223195 Fusarium graminearum Species 0.000 description 1
- 241000223221 Fusarium oxysporum Species 0.000 description 1
- 241001149504 Gaeumannomyces Species 0.000 description 1
- 241000123332 Gloeophyllum Species 0.000 description 1
- 241000896246 Golovinomyces cichoracearum Species 0.000 description 1
- UXWOXTQWVMFRSE-UHFFFAOYSA-N Griseoviridin Natural products O=C1OC(C)CC=C(C(NCC=CC=CC(O)CC(O)C2)=O)SCC1NC(=O)C1=COC2=N1 UXWOXTQWVMFRSE-UHFFFAOYSA-N 0.000 description 1
- 241000218228 Humulus Species 0.000 description 1
- 239000005796 Ipconazole Substances 0.000 description 1
- 239000005867 Iprodione Substances 0.000 description 1
- 239000005800 Kresoxim-methyl Substances 0.000 description 1
- 241000228457 Leptosphaeria maculans Species 0.000 description 1
- LTGPFZWZZNUIIK-LURJTMIESA-N Lysol Chemical compound NCCCC[C@H](N)CO LTGPFZWZZNUIIK-LURJTMIESA-N 0.000 description 1
- 241001344131 Magnaporthe grisea Species 0.000 description 1
- 241000318230 Merulius Species 0.000 description 1
- 239000002169 Metam Substances 0.000 description 1
- 239000005868 Metconazole Substances 0.000 description 1
- 239000005809 Metiram Substances 0.000 description 1
- 239000005811 Myclobutanil Substances 0.000 description 1
- IUOKJNROJISWRO-UHFFFAOYSA-N N-(2-cyano-3-methylbutan-2-yl)-2-(2,4-dichlorophenoxy)propanamide Chemical compound CC(C)C(C)(C#N)NC(=O)C(C)OC1=CC=C(Cl)C=C1Cl IUOKJNROJISWRO-UHFFFAOYSA-N 0.000 description 1
- ZKUVPNREOOUZRF-UHFFFAOYSA-N N-(dimethylsulfamoyl)-N-phenylthiohydroxylamine Chemical compound SN(S(=O)(=O)N(C)C)C1=CC=CC=C1 ZKUVPNREOOUZRF-UHFFFAOYSA-N 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical class CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- XFOXDUJCOHBXRC-UHFFFAOYSA-N N-Ethyl-N-methyl-4-(trifluoromethyl)-2-(3,4-dimethoxyphenyl)benzamide Chemical compound CCN(C)C(=O)C1=CC=C(C(F)(F)F)C=C1C1=CC=C(OC)C(OC)=C1 XFOXDUJCOHBXRC-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- WPPOGHDFAVQKLN-UHFFFAOYSA-N N-Octyl-2-pyrrolidone Chemical compound CCCCCCCCN1CCCC1=O WPPOGHDFAVQKLN-UHFFFAOYSA-N 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- NQRFDNJEBWAUBL-UHFFFAOYSA-N N-[cyano(2-thienyl)methyl]-4-ethyl-2-(ethylamino)-1,3-thiazole-5-carboxamide Chemical compound S1C(NCC)=NC(CC)=C1C(=O)NC(C#N)C1=CC=CS1 NQRFDNJEBWAUBL-UHFFFAOYSA-N 0.000 description 1
- QMJXKBRERYEDJJ-UHFFFAOYSA-N N1(N=NC=C1)C1C(CCC1)(O)C Chemical compound N1(N=NC=C1)C1C(CCC1)(O)C QMJXKBRERYEDJJ-UHFFFAOYSA-N 0.000 description 1
- 241000498271 Necator Species 0.000 description 1
- DDUHZTYCFQRHIY-UHFFFAOYSA-N Negwer: 6874 Natural products COC1=CC(=O)CC(C)C11C(=O)C(C(OC)=CC(OC)=C2Cl)=C2O1 DDUHZTYCFQRHIY-UHFFFAOYSA-N 0.000 description 1
- 241000244206 Nematoda Species 0.000 description 1
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical compound NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- 241001668536 Oculimacula yallundae Species 0.000 description 1
- 241000221871 Ophiostoma Species 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 235000001591 Pachyrhizus erosus Nutrition 0.000 description 1
- 244000258470 Pachyrhizus tuberosus Species 0.000 description 1
- 235000018669 Pachyrhizus tuberosus Nutrition 0.000 description 1
- 241000736122 Parastagonospora nodorum Species 0.000 description 1
- 239000005816 Penthiopyrad Substances 0.000 description 1
- 241000143552 Petriella Species 0.000 description 1
- 241000920636 Phaeoacremonium Species 0.000 description 1
- 241000682645 Phakopsora pachyrhizi Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 241000123107 Phellinus Species 0.000 description 1
- 241000420786 Phellinus punctatus Species 0.000 description 1
- 239000005818 Picoxystrobin Substances 0.000 description 1
- 241001287099 Plasmopara destructor Species 0.000 description 1
- 241001281803 Plasmopara viticola Species 0.000 description 1
- 241000317981 Podosphaera fuliginea Species 0.000 description 1
- 241001337928 Podosphaera leucotricha Species 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 241001619461 Poria <basidiomycete fungus> Species 0.000 description 1
- 239000005821 Propamocarb Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 239000005824 Proquinazid Substances 0.000 description 1
- 239000005825 Prothioconazole Substances 0.000 description 1
- 241000087479 Pseudocercospora fijiensis Species 0.000 description 1
- 241000113418 Pseudocercospora humuli Species 0.000 description 1
- 241001281802 Pseudoperonospora Species 0.000 description 1
- 241001281805 Pseudoperonospora cubensis Species 0.000 description 1
- 241000601159 Puccinia asparagi Species 0.000 description 1
- 241000540505 Puccinia dispersa f. sp. tritici Species 0.000 description 1
- 241001123559 Puccinia hordei Species 0.000 description 1
- 241000520648 Pyrenophora teres Species 0.000 description 1
- 241000220324 Pyrus Species 0.000 description 1
- 241000813090 Rhizoctonia solani Species 0.000 description 1
- 241001515790 Rhynchosporium secalis Species 0.000 description 1
- 241000235070 Saccharomyces Species 0.000 description 1
- 241000800292 Sarocladium attenuatum Species 0.000 description 1
- 241000800294 Sarocladium oryzae Species 0.000 description 1
- 244000007853 Sarothamnus scoparius Species 0.000 description 1
- 241000209056 Secale Species 0.000 description 1
- 241001533598 Septoria Species 0.000 description 1
- 241001599571 Serpula <basidiomycete> Species 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 241001250060 Sphacelotheca Species 0.000 description 1
- 239000005837 Spiroxamine Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000005840 Tetraconazole Substances 0.000 description 1
- 241001617088 Thanatephorus sasakii Species 0.000 description 1
- 239000005940 Thiacloprid Substances 0.000 description 1
- 239000005941 Thiamethoxam Substances 0.000 description 1
- 239000005843 Thiram Substances 0.000 description 1
- 239000005845 Tolclofos-methyl Substances 0.000 description 1
- 241001114492 Trichurus Species 0.000 description 1
- 239000005857 Trifloxystrobin Substances 0.000 description 1
- 239000005858 Triflumizole Substances 0.000 description 1
- 235000019714 Triticale Nutrition 0.000 description 1
- 241001646063 Tyromyces Species 0.000 description 1
- 241000510929 Uncinula Species 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 235000015919 Ustilago maydis Nutrition 0.000 description 1
- JARYYMUOCXVXNK-UHFFFAOYSA-N Validamycin A Natural products OC1C(O)C(OC2C(C(O)C(O)C(CO)O2)O)C(CO)CC1NC1C=C(CO)C(O)C(O)C1O JARYYMUOCXVXNK-UHFFFAOYSA-N 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- FJJCIZWZNKZHII-UHFFFAOYSA-N [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]cyanamide Chemical compound N#CNC1=NC(NC#N)=NC(NC#N)=N1 FJJCIZWZNKZHII-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000008062 acetophenones Chemical class 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 244000193174 agave Species 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229930014345 anabasine Natural products 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- WFDXOXNFNRHQEC-GHRIWEEISA-N azoxystrobin Chemical compound CO\C=C(\C(=O)OC)C1=CC=CC=C1OC1=CC(OC=2C(=CC=CC=2)C#N)=NC=N1 WFDXOXNFNRHQEC-GHRIWEEISA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- 150000004283 biguanides Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- OIPMQULDKWSNGX-UHFFFAOYSA-N bis[[ethoxy(oxo)phosphaniumyl]oxy]alumanyloxy-ethoxy-oxophosphanium Chemical compound [Al+3].CCO[P+]([O-])=O.CCO[P+]([O-])=O.CCO[P+]([O-])=O OIPMQULDKWSNGX-UHFFFAOYSA-N 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- DSKJPMWIHSOYEA-UHFFFAOYSA-N bupirimate Chemical compound CCCCC1=C(C)N=C(NCC)N=C1OS(=O)(=O)N(C)C DSKJPMWIHSOYEA-UHFFFAOYSA-N 0.000 description 1
- HKPHPIREJKHECO-UHFFFAOYSA-N butachlor Chemical compound CCCCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC HKPHPIREJKHECO-UHFFFAOYSA-N 0.000 description 1
- JHRWWRDRBPCWTF-OLQVQODUSA-N captafol Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)C(Cl)Cl)C(=O)[C@H]21 JHRWWRDRBPCWTF-OLQVQODUSA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 1
- WCBCMSHWSDPDBE-UHFFFAOYSA-N carbamodithioic acid;zinc Chemical compound [Zn].NC(S)=S WCBCMSHWSDPDBE-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 235000013351 cheese Nutrition 0.000 description 1
- 125000006011 chloroethoxy group Chemical group 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- CRQQGFGUEAVUIL-UHFFFAOYSA-N chlorothalonil Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(C#N)=C1Cl CRQQGFGUEAVUIL-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 235000016213 coffee Nutrition 0.000 description 1
- 235000013353 coffee beverage Nutrition 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- HAORKNGNJCEJBX-UHFFFAOYSA-N cyprodinil Chemical compound N=1C(C)=CC(C2CC2)=NC=1NC1=CC=CC=C1 HAORKNGNJCEJBX-UHFFFAOYSA-N 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 1
- UZBQIPPOMKBLAS-UHFFFAOYSA-N diethylazanide Chemical compound CC[N-]CC UZBQIPPOMKBLAS-UHFFFAOYSA-N 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- MZGNSEAPZQGJRB-UHFFFAOYSA-M dimethyldithiocarbamate Chemical compound CN(C)C([S-])=S MZGNSEAPZQGJRB-UHFFFAOYSA-M 0.000 description 1
- WXUZAHCNPWONDH-DYTRJAOYSA-N dimoxystrobin Chemical compound CNC(=O)C(=N\OC)\C1=CC=CC=C1COC1=CC(C)=CC=C1C WXUZAHCNPWONDH-DYTRJAOYSA-N 0.000 description 1
- FBOUIAKEJMZPQG-BLXFFLACSA-N diniconazole-M Chemical compound C1=NC=NN1/C([C@H](O)C(C)(C)C)=C/C1=CC=C(Cl)C=C1Cl FBOUIAKEJMZPQG-BLXFFLACSA-N 0.000 description 1
- YKBZOVFACRVRJN-UHFFFAOYSA-N dinotefuran Chemical compound [O-][N+](=O)\N=C(/NC)NCC1CCOC1 YKBZOVFACRVRJN-UHFFFAOYSA-N 0.000 description 1
- JMXKCYUTURMERF-UHFFFAOYSA-N dodemorph Chemical compound C1C(C)OC(C)CN1C1CCCCCCCCCCC1 JMXKCYUTURMERF-UHFFFAOYSA-N 0.000 description 1
- 244000309146 drought grass Species 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002168 ethanoic acid esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- BBXXLROWFHWFQY-UHFFFAOYSA-N ethirimol Chemical compound CCCCC1=C(C)NC(NCC)=NC1=O BBXXLROWFHWFQY-UHFFFAOYSA-N 0.000 description 1
- HOCOIDRZLNGZMV-UHFFFAOYSA-N ethoxy(oxido)phosphanium Chemical compound CCO[PH2]=O HOCOIDRZLNGZMV-UHFFFAOYSA-N 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- KQTVWCSONPJJPE-UHFFFAOYSA-N etridiazole Chemical compound CCOC1=NC(C(Cl)(Cl)Cl)=NS1 KQTVWCSONPJJPE-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 229940013764 fipronil Drugs 0.000 description 1
- MUJOIMFVNIBMKC-UHFFFAOYSA-N fludioxonil Chemical compound C=12OC(F)(F)OC2=CC=CC=1C1=CNC=C1C#N MUJOIMFVNIBMKC-UHFFFAOYSA-N 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 125000005816 fluoropropyl group Chemical group [H]C([H])(F)C([H])([H])C([H])([H])* 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-N formic acid Substances OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 1
- 244000000004 fungal plant pathogen Species 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 125000003147 glycosyl group Chemical group 0.000 description 1
- 229960002867 griseofulvin Drugs 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- AGKSTYPVMZODRV-UHFFFAOYSA-N imibenconazole Chemical compound C1=CC(Cl)=CC=C1CSC(CN1N=CN=C1)=NC1=CC=C(Cl)C=C1Cl AGKSTYPVMZODRV-UHFFFAOYSA-N 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- ONUFESLQCSAYKA-UHFFFAOYSA-N iprodione Chemical compound O=C1N(C(=O)NC(C)C)CC(=O)N1C1=CC(Cl)=CC(Cl)=C1 ONUFESLQCSAYKA-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- ZOTBXTZVPHCKPN-HTXNQAPBSA-N kresoxim-methyl Chemical compound CO\N=C(\C(=O)OC)C1=CC=CC=C1COC1=CC=CC=C1C ZOTBXTZVPHCKPN-HTXNQAPBSA-N 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- BCTQJXQXJVLSIG-UHFFFAOYSA-N mepronil Chemical compound CC(C)OC1=CC=CC(NC(=O)C=2C(=CC=CC=2)C)=C1 BCTQJXQXJVLSIG-UHFFFAOYSA-N 0.000 description 1
- XWPZUHJBOLQNMN-UHFFFAOYSA-N metconazole Chemical compound C1=NC=NN1CC1(O)C(C)(C)CCC1CC1=CC=C(Cl)C=C1 XWPZUHJBOLQNMN-UHFFFAOYSA-N 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 229920000257 metiram Polymers 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HYTTWQBLBHRHMF-UHFFFAOYSA-N n-(2-aminoethyl)-4-chloro-2-prop-2-enoxybenzamide Chemical compound NCCNC(=O)C1=CC=C(Cl)C=C1OCC=C HYTTWQBLBHRHMF-UHFFFAOYSA-N 0.000 description 1
- 125000006606 n-butoxy group Chemical group 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229950002366 nafoxidine Drugs 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- PVNIIMVLHYAWGP-UHFFFAOYSA-N nicotinic acid Natural products OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- UWVQIROCRJWDKL-UHFFFAOYSA-N oxadixyl Chemical compound CC=1C=CC=C(C)C=1N(C(=O)COC)N1CCOC1=O UWVQIROCRJWDKL-UHFFFAOYSA-N 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 235000021017 pears Nutrition 0.000 description 1
- LKPLKUMXSAEKID-UHFFFAOYSA-N pentachloronitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl LKPLKUMXSAEKID-UHFFFAOYSA-N 0.000 description 1
- 125000006340 pentafluoro ethyl group Chemical group FC(F)(F)C(F)(F)* 0.000 description 1
- 229940044654 phenolsulfonic acid Drugs 0.000 description 1
- ZXRDVSMSMOZCPT-UHFFFAOYSA-N phosphorodithious acid Chemical compound OP(S)S ZXRDVSMSMOZCPT-UHFFFAOYSA-N 0.000 description 1
- 230000008659 phytopathology Effects 0.000 description 1
- IBSNKSODLGJUMQ-SDNWHVSQSA-N picoxystrobin Chemical compound CO\C=C(\C(=O)OC)C1=CC=CC=C1COC1=CC=CC(C(F)(F)F)=N1 IBSNKSODLGJUMQ-SDNWHVSQSA-N 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- JPFWJDMDPLEUBD-ITJAGOAWSA-N polyoxorim Chemical compound O[C@@H]1[C@H](O)[C@@H]([C@H](NC(=O)[C@H]([C@H](O)[C@@H](O)COC(N)=O)N)C(O)=O)O[C@H]1N1C(=O)NC(=O)C(C(O)=O)=C1 JPFWJDMDPLEUBD-ITJAGOAWSA-N 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- QXJKBPAVAHBARF-BETUJISGSA-N procymidone Chemical compound O=C([C@]1(C)C[C@@]1(C1=O)C)N1C1=CC(Cl)=CC(Cl)=C1 QXJKBPAVAHBARF-BETUJISGSA-N 0.000 description 1
- WHMZYGMQWIBNOC-UHFFFAOYSA-N propan-2-yl n-(3,4-dimethoxyphenyl)carbamate Chemical compound COC1=CC=C(NC(=O)OC(C)C)C=C1OC WHMZYGMQWIBNOC-UHFFFAOYSA-N 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- OSFBJERFMQCEQY-UHFFFAOYSA-N propylidene Chemical group [CH]CC OSFBJERFMQCEQY-UHFFFAOYSA-N 0.000 description 1
- FLVBXVXXXMLMOX-UHFFFAOYSA-N proquinazid Chemical compound C1=C(I)C=C2C(=O)N(CCC)C(OCCC)=NC2=C1 FLVBXVXXXMLMOX-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- JOOMJVFZQRQWKR-UHFFFAOYSA-N pyrazophos Chemical compound N1=C(C)C(C(=O)OCC)=CN2N=C(OP(=S)(OCC)OCC)C=C21 JOOMJVFZQRQWKR-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000004040 pyrrolidinones Chemical class 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- ZEVCJZRMCOYJSP-UHFFFAOYSA-N sodium;2-(dithiocarboxyamino)ethylcarbamodithioic acid Chemical compound [Na+].SC(=S)NCCNC(S)=S ZEVCJZRMCOYJSP-UHFFFAOYSA-N 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- PUYXTUJWRLOUCW-UHFFFAOYSA-N spiroxamine Chemical compound O1C(CN(CC)CCC)COC11CCC(C(C)(C)C)CC1 PUYXTUJWRLOUCW-UHFFFAOYSA-N 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- NWWZPOKUUAIXIW-FLIBITNWSA-N thiamethoxam Chemical compound [O-][N+](=O)\N=C/1N(C)COCN\1CC1=CN=C(Cl)S1 NWWZPOKUUAIXIW-FLIBITNWSA-N 0.000 description 1
- DAUYIKBTMNZABP-UHFFFAOYSA-N thiophene-3-carboxamide Chemical compound NC(=O)C=1C=CSC=1 DAUYIKBTMNZABP-UHFFFAOYSA-N 0.000 description 1
- 229960002447 thiram Drugs 0.000 description 1
- OBZIQQJJIKNWNO-UHFFFAOYSA-N tolclofos-methyl Chemical compound COP(=S)(OC)OC1=C(Cl)C=C(C)C=C1Cl OBZIQQJJIKNWNO-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- ONCZDRURRATYFI-TVJDWZFNSA-N trifloxystrobin Chemical compound CO\N=C(\C(=O)OC)C1=CC=CC=C1CO\N=C(/C)C1=CC=CC(C(F)(F)F)=C1 ONCZDRURRATYFI-TVJDWZFNSA-N 0.000 description 1
- HSMVPDGQOIQYSR-KGENOOAVSA-N triflumizole Chemical compound C1=CN=CN1C(/COCCC)=N/C1=CC=C(Cl)C=C1C(F)(F)F HSMVPDGQOIQYSR-KGENOOAVSA-N 0.000 description 1
- JARYYMUOCXVXNK-CSLFJTBJSA-N validamycin A Chemical compound N([C@H]1C[C@@H]([C@H]([C@H](O)[C@H]1O)O[C@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)O)CO)[C@H]1C=C(CO)[C@@H](O)[C@H](O)[C@H]1O JARYYMUOCXVXNK-CSLFJTBJSA-N 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000011708 vitamin B3 Substances 0.000 description 1
- 235000019160 vitamin B3 Nutrition 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000009333 weeding Methods 0.000 description 1
- 241000228158 x Triticosecale Species 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Abstract
The invention relates to fungicidal mixtures containing the following as active components: 1) at least one 1-methyl pyrazol-4-yl carboxylic acid anilide of formula (I), in which X = O or S, R<1> = C1-C4 alkyl or C1-C4 haloalkyl, R<2> = hydrogen or halogen, R<3>, R<4> and R<5> = independently of one another cyano, nitro, halogen, C1-C4 alkyl, C1-C4 haloalkyl, C1-C4 alkoxy, C1-C4 haloalkoxy or C1-C4 alkylthio; and 2) at least one active ingredient II, selected from the active ingredient groups A) to F) in a synergistically active quantity: A) azoles; B) strobilurins; C) carboxamides; D) heterocyclic compounds; E) carbamates; F) other fungicides.; The invention also relates to a method for controlling pathogenic fungi using mixtures of at least one compound I and at least one active ingredient II, to the use of the compound(s) I and active ingredients II for producing mixtures of this type and to agents and seeds containing said mixtures.
Description
The present invention relates to Fungicidal mixture, it comprises following compound as active component with the Synergistic effective dose:
1) the 1-methyl-pyrazol-4-yl carboxylic acid anilides of at least a formula I:
Wherein each substituting group is following defines:
X is oxygen or sulphur;
R
1Be C
1-C
4Alkyl or C
1-C
4Haloalkyl;
R
2Be hydrogen or halogen;
R
3, R
4And R
5Be cyano group, nitro, halogen, C independently of each other
1-C
4Alkyl, C
1-C
4Haloalkyl, C
1-C
4Alkoxyl, C
1-C
4Halogenated alkoxy or C
1-C
4Alkylthio group;
With
2) the reactive compound II at least a reactive compound group A that is selected from)-F):
A) be selected from following azole: Bitertanol (bitertanol), bromuconazole (bromuconazole), cyproconazole (cyproconazole) Difenoconazole (difenoconazole), alkene azoles alcohol (diniconazole), IMAZALIL (enilconazole), oxole bacterium (epoxiconazole), Fluquinconazole (fluquinconazole), RH-7592 (fenbuconazole), Flusilazole (flusilazole), Flutriafol (flutriafol), own azoles alcohol (hexaconazole), acid amides azoles (imibenconazole), cycltebuconazole (ipconazole), encircle penta azoles bacterium (metconazole), nitrile bacterium azoles (myclobutanil), penconazole (penconazole), propiconazole (propiconazole), prothioconazoles (prothioconazole), simeconazoles (simeconazole), triazolone (triadimefon), triadimenol (triadimenol), Tebuconazole (tebuconazole), fluorine ether azoles (tetraconazole), triticonazole (triticonazole), Prochloraz (prochloraz), pefurazoate (pefurazoate), IMAZALIL (imazalil), fluorine bacterium azoles (triflumizole), cyanogen frost azoles (cyazofamid), benomyl (benomyl), carbendazim (carbendazim), thiabendazole (thiabendazole), furidazol (fuberidazole), Guardian (ethaboxam), kobam (etridiazole) and hydroxyisoxazole (hymexazole);
B) be selected from following strobilurins class (strobilurins): nitrile Fluoxastrobin (azoxystrobin), ether bacterium amine (dimoxystrobin), Enestroburin (enestroburin), fluoxastrobin (fluoxastrobin), imines bacterium (kresoxim-methyl), fork phenalgin acid amides (metominostrobin), orysastrobin (orysastrobin), ZEN 90160 (picoxystrobin), pyraclostrobin (pyraclostrobin), oxime bacterium ester (trifloxystrobin) or (2-chloro-5-[1-(3-methyl benzyloxy imino) ethyl] benzyl) methyl carbamate, (2-chloro-5-[1-(6-picoline-2-base methoxyimino) ethyl] benzyl) methyl carbamate, 2-(neighbour-(2,5-dimethyl phenoxy methylene) phenyl)-3-methoxy-methyl acrylate;
C) be selected from following carboxylic acid amides: carboxin (carboxin), M 9834 (benalaxyl), Boscalid (boscalid), fenhexamid (fenhexamid), flutolanil (flutolanil), furan pyrazoles spirit (furametpyr), third oxygen goes out and embroiders amine (mepronil), metalaxyl (metalaxyl), Metalaxyl-M (mefenoxam), fenfuram (ofurace) Evil frost spirit (oxadixyl), oxycarboxin (oxycarboxin), pyrrole metsulfovax (penthiopyrad), thifluzamide (thifluzamide), tiadinil (tiadinil), 3,4-two chloro-N-(2-cyano-phenyl) isothiazole-5-formamide, dimethomorph (dimethomorph), flumorph (flumorph), fluorine biphenyl bacterium (flumetover), fluorine pyrrole bacterium amine (picobenzamid), zoxamide (zoxamide), carpropamide (carpropamid), two chlorine zarilamids (diclocymet), mandipropamid amine (mandipropamid), N-(2-{4-[3-(4-chlorphenyl) third-2-alkynyloxy group]-the 3-anisyl } ethyl)-2-methanesulfonamido-3-methylbutyryl amine, N-(2-{4-[3-(4-chlorphenyl)-third-2-alkynyloxy group]-the 3-anisyl } ethyl)-2-second sulfonamido-3-methylbutyryl amine, 3-(4-chlorphenyl)-3-(different third oxygen carbonylamino of 2--3-methylbutyryl amino) methyl propionate, the formula III compound:
R wherein
4Be methyl or ethyl,
N-(4 '-bromo biphenyl-2-yl)-4-difluoromethyl-2-methylthiazol-5-formamide, N-(4 '-trifluoromethyl-biphenyl-2-yl)-4-difluoromethyl-2-methylthiazol-5-formamide, N-(4 '-chloro-3 '-fluorine biphenyl-2-yl)-4-difluoromethyl-2-methylthiazol-5-formamide, N-(3 ', 4 '-two chloro-4-fluorine biphenyl-2-yls)-3-difluoromethyl-1-methylpyrazole-4-formamide, N-(3 ', 4 '-two chloro-5-fluorine biphenyl-2-yls)-and 3-difluoromethyl-1-methylpyrazole-4-formamide and N-(2-cyano-phenyl)-3,4-two chloroisothiazoles-5-formamide;
D) be selected from following heterocyclic compound: fluazinam (fluazinam), pyrifenox (pyrifenox), the phonetic bacterium spirit of sulphur (bupirimate), encircle third pyrimidine (cyprodinil), fenarimol (fenarimol), ferimzone (ferimzone), mepanipyrim (mepanipyrim), nuarimol (nuarimol), pyrimethanil (pyrimethanil), triforine (triforine), fenpiclonil (fenpiclonil) Fu Evil bacterium (fludioxonil), 4-dodecyl-2,6-thebaine (aldimorph), dodemorfe (dodemorph); butadiene morpholine (fenpropimorph); tridemorph (tridemorph); fenpropidin (fenpropidin); different third fixed (iprodione); sterilization profit (procymidone); vinclozolin (vinclozolin); azolactone bacterium (famoxadone); Fenamidone (fenamidone); different thiophene bacterium ketone (octhilinone); probenazole (probenazole); 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2; 4; the 6-trifluorophenyl)-[1; 2; 4] triazols [1,5-a] pyrimidine; anilazine (anilazine); diclomezine (diclomezine); pyroquilon (pyroquilon); the third oxygen quinoline (proquinazid); tricyclazole (tricyclazole); formula IV compound (2-butoxy-6-iodo-3-propyl group chromene-4-ketone):
The N of thiadiazoles element (acibenzolar-S-methyl), difoltan (captafol), captan (captan), dazomet (dazomet), folpet (folpet), zarilamid (fenoxanil), quinoxyfen (quinoxyfen) and formula V; N-dimethyl-3-(3-bromo-6-fluoro-2 methyl indole-1-sulfonyl)-[1; 2,4] triazole-1-sulfonamide:
E) be selected from following Carbamates: mancozeb (mancozeb); maneb (maneb); metham-sodium (metam); Carbatene (metiram); ferbam (ferbam); propineb (propineb); tmtd (thiram); zineb (zineb); ziram (ziram); the mould prestige of second (diethofencarb); iprovalicarb (iprovalicarb); benzene metsulfovax (flubenthiavalicarb); hundred dimension spirits (propamocarb); N-(1-(1-(4-cyano-phenyl) ethylsulfonyl) fourth-2-yl) carbamic acid 4-fluorophenyl ester; the 3-of formula VI (4-chlorphenyl)-3-(different third oxygen carbonylamino of 2--3-methylbutyryl amino) methyl propionate:
Carbamic acid lactazone ether with formula VII:
Wherein Z is N or CH;
F) be selected from other following fungicides: the guanidine class: dodine (dodine), biguanide spicy acid salt (iminoctadine), guazatine (guazatine), antibiotic class: spring thunder element (kasugamycin), streptomycin (streptomycin), Polyoxin (polyoxins), jinggangmeisu (validamycin A), nitrophenyl derivative: binapacryl (binapacryl), karathane (dinocap), dinobuton (dinobuton), sulfur heterocyclic ring based compound: Delan (dithianon), Isoprothiolane (isoprothiolane), organo-metallic compound: triphenyltin salt, as fentinacetate (fentinacetate), organic phosphorus compound: Hinosan (edifenphos), iprobenfos (iprobenfos), fosetyl (fosetyl), ethyl phosphine aluminium (fosetyl-aluminum), phosphorous acid and salt thereof, Ppyrazophos (pyrazophos), tolelofos-methyl (tolclofos-methyl), organochlorine compound: tpn (chlorothalonil), Euparen (dichlofluanid), flusulfamide (flusulfamide), hexachloro-benzene (hexachlorobenzene), Rabcide (phthalide), Pencycuron (pencycuron), pcnb (quintozene), thiophanate methyl (thiophanate-methyl), tolyfluanid (tolylfluanid), inorganic active compound: bordeaux mixture (Bordeaux mixture), Schweinfurt green, Kocide SD, Cupravit, basic copper sulfate, sulphur, other: cyflufenamid (cyflufenamid), cymoxanil (cymoxanil), Milcurb (dimethirimol), Milstem (ethirimol), Furalaxyl (furalaxyl), (metrafenone) is with the luxuriant amine of Luo Evil (spiroxamine) for metrafenone.
In addition, the present invention relates to a kind of mixture methods for fighting harmful mushrooms of using at least a Compound I and at least a reactive compound II, Compound I and reactive compound II preparation in such mixture purposes and composition and the seed that comprises these mixtures.
Be called component 1 above) formula I 1-methyl-pyrazol-4-yl carboxylic acid anilides, its preparation and to the effect of harmful fungoid by document known (for example referring to EP-A 545 099, EP-A 589 301 and WO99/09013), perhaps they can wherein said mode prepare.
Wherein X is that the Compound I of sulphur can be that the corresponding Compound I of oxygen prepares (for example referring to D.Petrova﹠amp by vulcanizing X wherein for example; K.Jakobcic, Croat.Chem.Acta
48, 49 (1976) and WO 01/42223).
Yet the 1-methyl-pyrazol-4-yl carboxylic acid anilides of known formula I especially is not entirely satisfactory under low rate of application.
As component 2) above-mentioned reactive compound II, its preparation and to the effect of harmful fungoid normally known (for example referring to
Http:// www.hclrss.demon.co.uk/index.html); They can be commercial.
M 9834, N-(phenyl acetyl)-N-(2, the 6-xylyl)-DL-methyl lactamine (DE 29 03 612);
Metalaxyl, N-(methoxyl group acetyl group)-N-(2, the 6-xylyl)-DL-methyl lactamine (GB 15 00581);
Fenfuram, (RS)-α-(2-chloro-N-2,6-xylyl acetamido)-gamma-butyrolacton [CAS RN58810-48-3];
The spirit of Evil frost, N-(2, the 6-3,5-dimethylphenyl)-2-methoxyl group-N-(2-oxo-3-oxazole alkyl) acetamide (GB20 58 059);
4-dodecyl-2, the 6-thebaine, comprise 65-75%2,6-thebaine and 25-35%2, " the 4-alkyl-2,5 (or 2; 6)-thebaine " of 5-thebaine, wherein surpass 85% be 4-dodecyl-2,5 (or 2,6)-thebaine and wherein " alkyl " comprise that also octyl group, decyl, myristyl and cetyl and wherein suitable/inverse ratio are 1: 1[CAS RN 91315-15-0];
Dodine, 1-dodine acetate (Plant Dis.Rep., the 41st volume, the 1029th page (1957)); Dodemorfe, 4-cyclo-dodecyl-2,6-thebaine (DE-A 1198125);
Butadiene morpholine, (RS)-cis-4-[3-(4-tert-butyl-phenyl)-2-methyl-propyl]-2,6-thebaine (DE-A 27 52 096);
Fenpropidin, (RS)-1-[3-(4-tert-butyl-phenyl)-2-methyl-propyl] piperidines (DE-A 27 52 096);
Guazatine, the mixture of the product that is obtained by the amidatioon of technical grade imino-diacetic (eight methylene) diamines comprises various guanidines and polyamines [CAS RN 108173-90-6];
Biguanide spicy acid salt, 1,1 '-imino-diacetic (eight methylene) biguanides (Congr.Plant Pathol., 1., the 27th page (1968));
The luxuriant amine of Luo Evil, (the 8-tert-butyl group-1,4-dioxo spiro [4.5] last of the ten Heavenly stems-2-yl) diethylamide (EP-A 281 842); Tridemorph, 2,6-dimethyl-4-tridecyl morpholine (DE-A 11 64 152);
Pyrimethanil, 4,6-dimethyl pyrimidine-2-base phenyl amine (DD-A 151 404);
Mepanipyrim, (4-methyl-6-third-1-alkynyl pyrimidine-2-base) phenyl amine (EP-A 224 339);
Encircle third pyrimidine, (4-cyclopropyl-6-methylpyrimidine-2-yl) phenyl amine (EP-A 310 550);
Cycloheximide, 4-{ (2R)-2-[(1S, 3S, 5S)-3,5-dimethyl-2-oxo cyclohexyl]-the 2-hydroxyethyl } piperidines-2,6-diketone [CAS RN 66-81-9];
Griseofulvin, 7-chloro-2 ', 4,6-trimethoxy-6 '-methylspiro [benzofuran-2 (3H), 1 '-hexamethylene-2 '-alkene]-3,4 '-diketone [CAS RN 126-07-8];
The spring thunder element, 3-O-[2-amino-4-[(carboxyl iminomethyl) amino]-2,3,4, the Arabic pyranohexose base of 6-four deoxidations-α-D-]-D-chiro-inositol [CAS RN 6980-18-3];
Myprozine, (8E, 14E, 16E, 18E, 20E)-(1R, 3S, 5R, 7R, 12R, 22R, 24S, 25R, 26S)-and 22-(3-amino-3,6-dideoxy-β-D-mannopyranose base oxygen base)-1,3,26-trihydroxy-12-methyl isophthalic acid 0-oxo-6,11,28-trioxa three ring [22.3.1.0
5,7] 28 carbon-8,14,16,18,20-pentaene-25-formic acid [CASRN 7681-93-8];
Polyoxin, 5-(2-amino-5-O-carbamoyl-2-deoxidation-L-xylonamide base)-1-(5-carboxyl-1,2,3,4-tetrahydrochysene-2,4-dioxo pyrimidine-1-yl)-1,5-dideoxy-β-D-furans allose aldehydic acid [CASRN 22976-86-9];
Streptomycin, 1,1 '-{ 1-L-(1,3,5/2,4,6)-and 4-[5-deoxidation-2-O-(2-deoxidation-2-methylamino-α-L-glycopyranosyl)-3-C-formoxyl-α-L-furans lysol glycosyl oxygen base]-2,5, the inferior hexamethylene-1 of 6-trihydroxy, the 3-yl } biguanides (J.Am.Chem.Soc., the 69th volume, the 1234th page (1947));
Bitertanol, β-([1,1 '-biphenyl]-4-base oxygen base)-α-(1, the 1-dimethyl ethyl)-1H-1,2,4-triazole-1-ethanol (DE 2324020);
Bromuconazole, 1-[[4-bromo-2-(2,4 dichloro benzene base) tetrahydrochysene-2-furyl] methyl]-1H-[1,2,4]-triazole (Proc.1990Br.Crop.Prot.Conf.-Pests Dis., the 1st volume, the 459th page);
Cyproconazole, 2-(4-chlorphenyl)-3-cyclopropyl-1-[1,2,4] triazol-1-yl fourth-2-alcohol (US 4 664 696);
Difenoconazole, 1-{2-[2-chloro-4-(4-chlorophenoxy) phenyl]-4-methyl-[1,3] dioxolanes-2-ylmethyl }-1H-[1,2,4] triazole (GB-A 2 098 607);
Alkene azoles alcohol, (β E)-β-[(2,4 dichloro benzene base) methylene]-α-(1, the 1-dimethyl ethyl)-1H-1,2,4-triazole-1-ethanol (Noyaku Kagaku, 1983, the 8 volumes, the 575th page);
IMAZALIL, 1-[2-(2,4 dichloro benzene base)-2-(2-propenyloxy group) ethyl]-1H-imidazoles (Fruits, 1973, the 28 volumes, the 545th page);
Oxole bacterium, (2RS, 3SR)-1-[3-(2-chlorphenyl)-2,3-epoxy-2-(4-fluorophenyl) propyl group]-1H-1,2,4-triazole (EP-A 196 038);
RH-7592, α-[2-(4-chlorphenyl) ethyl]-4-benzopyrone H-1,2,4-triazole-1-propionitrile (Proc.1988 Br.Crop Prot.Conf.-Pests Dis., the 1st volume, the 33rd page);
Fluquinconazole, 3-(2,4 dichloro benzene base)-6-fluoro-2-[1,2,4] triazol-1-yl-3H-quinazoline-4-one (Proc.Br.Crop Prot.Conf.-Pests Dis., 5-3,411 (1992));
Flusilazole, 1-{[two (4-fluorophenyl) methyl-monosilane base] methyl }-1H-[1,2,4] triazole (Proc.Br.CropProt.Conf.-Pests Dis., the 1st volume, the 413rd page (1984));
Flutriafol, α-(2-fluorophenyl)-α-(4-fluorophenyl)-1H-1,2,4-triazole-1-ethanol (EP-A 15 756);
Own azoles alcohol, 2-(2,4 dichloro benzene base)-1-[1,2,4] triazol-1-yl oneself-2-alcohol (CAS RN 79983-71-4); Cycltebuconazole, the 2-[(4-chlorphenyl) methyl]-5-(1-Methylethyl)-1-(1H-1,2,4-triazol-1-yl methyl) cyclopentanol (EP-A 267 778);
Encircle penta azoles bacterium, 5-(4-benzyl chloride base)-2,2-dimethyl-1-[1,2,4] triazol-1-yl methylcyclopentanol (GB 857383);
Nitrile bacterium azoles, 2-(4-chlorphenyl)-2-[1,2,4] triazol-1-yl methyl valeronitrile (CAS RN 88671-89-0);
Penconazole, 1-[2-(2,4 dichloro benzene base) amyl group]-1H-[1,2,4] triazole (Pesticide Manual, the 12nd edition (2000), the 712nd page);
Propiconazole, 1-[[2-(2,4 dichloro benzene base)-4-propyl group-1,3-dioxolanes-2-yl] methyl]-1H-1,2,4-triazole (BE 835 579);
Prochloraz, N-(propyl group-[2-(2,4, the 6-Trichlorophenoxy) ethyl]) imidazoles-1-formamide (US 3 991 071);
Prothioconazoles, 2-[2-(1-chlorine cyclopropyl)-3-(2-chlorphenyl)-2-hydroxypropyl]-2,4-dihydro [1,2,4] triazole-3-thioketones (WO 96/16048);
Simeconazoles, α-(4-fluorophenyl)-α-[(trimethyl silyl) methyl]-1H-1,2,4-triazole-1-ethanol [CAS RN 149508-90-7],
Tebuconazole, 1-(4-chlorphenyl)-4,4-dimethyl-3-[1,2,4] triazol-1-yl methylpent-3-alcohol (EP-A 40345);
Fluorine ether azoles, 1-[2-(2,4 dichloro benzene base)-3-(1,1,2,2-tetrafluoro ethyoxyl) propyl group]-1H-1,2,4-triazole (EP-A 234 242);
Triazolone, 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)-2-butanone (BE 793867);
Triadimenol, β-(4-chlorophenoxy)-α-(1, the 1-dimethyl ethyl)-1H-1,2,4-triazole-1-ethanol (DE-A 2,324 010);
Fluorine bacterium azoles, (4-chloro-2-trifluoromethyl)-(2-propoxyl group-1-[1,2,4] the triazol-1-yl ethylidene) amine (JP-A 79/,119 462);
Triticonazole, (5E)-the 5-[(4-chlorphenyl) methylene]-2,2-dimethyl-1-(1H-1,2,4-triazol-1-yl methyl) cyclopentanol (FR 26 41 277);
Different third is fixed, N-isopropyl-3-(3, the 5-dichlorophenyl)-2,4-dioxo alkyl imidazole-1-formamide (GB 13 12536);
Myclozolin, (RS)-3-(3, the 5-dichlorophenyl)-5-methoxy-5-methyl isophthalic acid, 3-oxazolidine-2,4-diketone [CAS RN 54864-61-8];
The sterilization profit, N-(3, the 5-dichlorophenyl)-1,2-dimethylcyclopropane-1,2-dicarboximide (US 3 903090);
Vinclozolin, 3-(3, the 5-dichlorophenyl)-5-methyl-5-Yi Xi Ji oxazolidine-2,4-diketone (DE-A22 07 576);
Ferbam, ferric dimethyl dithiocarbamate (3+) (US 1 972 961);
Dithane A40, ethylene (aminodithioformic acid) disodium (US 2 317 765);
Maneb, ethylene (aminodithioformic acid) manganese (US 2 504 404);
Mancozeb, ethylene (aminodithioformic acid) manganese polymer zinc salt complex (GB 996 264);
Metham-sodium, methyl aminodithioformic acid (US 2 791 605);
Carbatene, ethylene (aminodithioformic acid) zinc ammonate (US 3 248 400);
Propineb, propylidene two (aminodithioformic acid) zinc polymer (BE 611 960);
Polycarbamate, two (the dimethyl dithiocarbamic acid root closes-κ S, κ S ') [μ-[[1,2-ethylene [the aminodithioformic acid root closes-κ S, κ S ']] (2-)]] two [zinc] [CAS RN 64440-88-6];
Tmtd, two (dimethyl thiocarbamoyl) disulphide (DE-A 642 532);
Ziram, dimethyl dithiocarbamate [CAS RN 137-30-4];
Zineb, ethylene (aminodithioformic acid) zinc (US 2 45 7674);
Anilazine, 4,6-two chloro-N-(2-chlorphenyl)-1,3,5-triazines-2-amine (US 2 720 480);
Benomyl, N-butyl-2-acetylamino benzo imidazoles-1-formamide (US 3 631 176);
Boscalid, 2-chloro-N-(4 '-chlordiphenyl-2-yl) vitamin PP (EP-A 545 099);
Carbendazim, (the methyl carbamate (US 3 657 443) of 1H-benzimidazolyl-2 radicals-yl);
Carboxin, 5,6-dihydro-2-methyl-N-phenyl-1,4-oxygen thiapyran-3-formamide (US 3 249 499);
Oxycarboxin, 5,6-dihydro-2-methyl isophthalic acid, 4-oxygen thiapyran-3-formailide 4,4-dioxide (US 3,399 214);
Cyanogen frost azoles, 4-chloro-2-cyano group-N, N-dimethyl-5-(4-aminomethyl phenyl)-1H-imidazoles-1-sulfonamide (CASRN 120116-88-3);
Dazomet, 3,5-dimethyl-1,3,5-thiadiazine alkane-2-thioketones (Bull.Soc.Chim.Fr., the 15th volume, the 891st page (1897));
The difluoro pyrrole swells (diflufenzopyr), 2-{1-[4-(3, the 5-difluorophenyl) semicarbazino] ethyl } nicotinic acid [CASRN 109293-97-2];
The Delan, 5,10-dioxo-5,10-dihydro-naphtho [2,3-b] [1,4] two thiophene English-2,3-dimethoxy nitrile (GB857 383);
The azolactone bacterium, (RS)-3-anilino--5-methyl-5-(4-Phenoxyphenyl)-1,3-oxazolidine-2,4-diketone [CAS RN 131807-57-3];
Fenamidone, (S)-1-anilino--4-methyl-2-methyl mercapto-4-benzylimidazoline-5-ketone [CAS RN161326-34-7];
Fenarimol, α-(2-chlorphenyl)-α-(4-chlorphenyl)-5-rubigan (GB 12 18 623); Furidazol, 2-(2-furyl)-1H-benzimidazole (DE-A 12 09 799);
Flutolanil, α, α, α-three fluoro-3 '-isopropoxy-adjacent toluyl aniline (JP 1104514);
The spirit of furan pyrazoles, 5-chloro-N-(1,3-dihydro-1,1,3-trimethyl-4-isobenzofuran-base)-1,3-dimethyl-1H-pyrazole-4-carboxamide [CAS RN 123572-88-3];
Isoprothiolane, 1, the inferior dithiolane of 3--2-propylmalonic acid diisopropyl ester (Proc.Insectic.Fungic.Conf.8., the 2nd volume, the 715th page (1975));
Third oxygen embroidery amine that goes out, 3 '-isopropoxy-adjacent toluyl aniline (US 3 937 840);
Nuarimol, α-(2-chlorphenyl)-α-(4-fluorophenyl)-5-rubigan (GB 12 18 623);
Fluorine pyrrole bacterium amine (picobenzamid), 2,6-two chloro-N-(3-chloro-5-5-flumethiazine-2-ylmethyl) benzamide (WO 99/42447);
Probenazole, 3-allyloxy-1,2-[4-morpholinodithio 1,1-dioxide (Agric.Biol.Chem., the 37th volume, the 737th page (1973));
The third oxygen quinoline, 6-iodo-2-propoxyl group-3-propyl group quinazoline-4 (3H)-ketone (WO 97/48684);
Pyrifenox, 2 ', 4 '-two chloro-2-(3-pyridine radicals) acetophenones (EZ)-O-methyloxime (EP 49 854);
Pyroquilon, 1,2,5, the 6-nafoxidine is [3,2,1-ij] quinoline-4-ketone (GB 13 94 373) also;
Quinoxyfen, 5,7-two chloro-4-(4-fluorophenoxy) quinoline (US 5 24 0940);
The silicon metsulfovax, N-pi-allyl-4,5-dimethyl-2-(trimethyl silyl) thiophene-3-formamide [CAS RN175217-20-6];
Thiabendazole, 2-(1,3-thiazoles-4-yl) benzimidazole (US 3 017 415);
Thifluzamide, 2 ', 6 '-two bromo-2-methyl-4 '-trifluoromethoxy-4-Trifluoromethyl-1s, 3-thiazole-5-formailide [CAS RN 130000-40-7];
Thiophanate methyl, 1,2-phenylene two (imino group thiocarbonyl) two (carbamic acid methyl ester) (DE-A 19 30540);
Tiadinil, 3 '-chloro-4,4 '-dimethyl-1,2,3-thiadiazoles-5-formailide [CAS RN223580-51-6];
Tricyclazole, 5-methyl isophthalic acid, 2,4-triazol [3,4-b] benzothiazole [CAS RN 41814-78-2];
Triforine, N, N '-{ piperazine-1,4-two bases two [(trichloromethyl) methylene] } diformamide (DE-A 19 01421);
5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazol [1,5-a] pyrimidines (WO98/46607);
Bordeaux mixture, CuSO
4* 3Cu (OH)
2* 3CaSO
4Mixture [CAS RN 8011-63-0];
Schweinfurt green, Cu (OCOCH
3)
2[CAS RN 8011-63-0];
Cupravit, Cu
2Cl (OH)
3[CAS RN 1332-40-7];
Basic copper sulfate, CuSO
4[CAS RN 1344-73-6];
Binapacryl, 3-methylcrotonic acid (RS)-2-sec-butyl-4,6-dinitrophenyl ester [CAS RN 485-31-4];
Karathane, crotonic acid 2,6-dinitro-4-octyl phenyl ester and crotonic acid 2, the mixture of 4-dinitro-6-octyl phenyl ester, wherein " octyl group " is the mixture (US2 526 660) of 1-methylheptyl, 1-ethylhexyl and 1-propyl group amyl group;
Dinobuton, carbonic acid (RS)-2-sec-butyl-4,6-dinitrophenyl isopropyl esters [CAS RN 973-21-7];
Different third disappears (nitrothal-isopropyl), 5-nitroisophthalic acid diisopropyl ester (Proc.Br.Insectic.Fungic.Conf.7., the 2nd volume, the 673rd page (1973));
Fenpiclonil, 4-(2, the 3-dichlorophenyl)-1H-pyrroles-3-formonitrile HCN (Proc.1988Br.Crop Prot.Conf.-Pests Dis., the 1st volume, the 65th page);
Fu Evil bacterium, 4-(2,2-difluoro benzo [1,3] Dioxol-4-yl)-1H-pyrroles-3-formonitrile HCN (ThePesticide Manual, publ.The British Crop Protection Council, the 10th edition, 1995, the 482 pages);
The thiadiazoles element, 1,2,3-diazosulfide-7-carbithionic acid methyl ester [CAS RN 135158-54-2];
Benzene metsulfovax (benthiavalicarb), (S)-1-[(1R)-1-(6-fluoro benzothiazole-2-yl) ethylamino formoxyl]-the 2-methyl-propyl } carbamic acid isopropyl ester (JP-A 09/,323 984);
Carpropamide, 2,2-two chloro-N-[1-(4-chlorphenyl) ethyl]-1-ethyl-3-methyl cyclopropane formamide [CAS RN 104030-54-8];
Tpn, 2,4,5,6-termil (US 3 290 353);
Cyflufenamid, (Z)-N-[α-(cyclopropyl methoxyimino)-2,3--two fluoro-6-(trifluoromethyl) benzyls]-2-phenyl-acetamides (WO 96/19442);
Cymoxanil, 1-(2-cyano group-2-methoxyimino acetyl group)-3-ethyl carbamide (US 3 957 847);
Diclomezine, 6-(3,5-dichlorophenyl p-methylphenyl) pyridazine-3 (2H)-ketone (US 4 052 395);
Two chlorine zarilamids, (RS)-2-cyano group-N-[(R)-1-(2,4 dichloro benzene base) ethyl]-3,3-amide dimethyl butyrate [CAS RN 139920-32-4];
The mould prestige of second, 3,4-diethoxybenzene amido formic acid isopropyl esters (EP-A 78 663);
Hinosan, phosphonodithioic acid O-ethyl S, S-diphenyl (DE-A 14 93 736);
Guardian, N-(cyano group-2-thienyl methyl)-4-ethyl-2-(ethylamino)-5-thiazole carboxamides (EP-A639 574);
Fenhexamid, N-(2,3-two chloro-4-hydroxy phenyls)-1-hexahydrotoluene formamide (Proc.Br.CropProt.Conf.-Pests Dis., 1998, the 2 volumes, the 327th page);
Fentinacetate, fentinacetate (US 3 499 086);
Zarilamid, N-(1-cyano group-1,2-dimethyl propyl)-2-(2,4 dichloro benzene oxygen base) propionamide (EP-A262 393);
Ferimzone, (Z)-2 '-methyl acetophenone-4,6-dimethyl pyrimidine-2-base hydrazone [CAS RN 89269-64-7];
Fluazinam, 3-chloro-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl) phenyl]-5-(trifluoromethyl)-2-pyridine amine (The Pesticide Manual, publ.The British Crop Protection Council, the 10th edition (1995), the 474th page);
Fosetyl, ethyl phosphine aluminium, phosphinic acid ethyl ester (FR 22 54 276);
Iprovalicarb, [(1S)-and 2-methyl 1-(1-p-methylphenyl ethylamino formoxyl) propyl group] carbamic acid isopropyl ester (EP-A 472 996);
Hexachloro-benzene (C.R.Seances Acad.Agric.Fr., the 31st volume, the 24th page (1945));
Mandipropamid amine, (RS)-2-(4-chlorphenyl)-N-[3-methoxyl group-4-(Propargyl oxygen base) phenethyl]-2-(Propargyl oxygen base) acetamide (WO 03/042166);
Metrafenone, 3 '-bromo-2,3,4,6 '-tetramethoxy-2 ', 6-dimethyl benzophenone (US 5 945 567);
Pencycuron, 1-(4-benzyl chloride base)-1-cyclopenta-3-phenylurea (DE-A 27 32 257);
The pyrrole metsulfovax, (RS)-N-[2-(1, the 3-dimethylbutyl)-3-thienyl]-1-methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxamide (JP 10/130268);
Hundred dimension spirits, 3-(dimethylamino) propyl carbamic acid propyl ester (DE-A 15 67 169);
Rabcide (DE-A 16 43 347);
Tolelofos-methyl, phosphonothiolic acid O-2,6-dichloro-p-toluene base O, O-dimethyl esters (GB 14 67 561);
Pcnb, pcnb (DE-A 682 048);
Zoxamide, (RS)-3,5-two chloro-N-(3-chloro-1-ethyl-1-methyl-2-oxopropyl)-to toluamide [CAS RN 156052-68-5];
Difoltan, N-(1,1,2,2-tetrachloro ethylmercapto group) hexamethylene-4-alkene-1,2-dicarboximide (Phytopathology, the 52nd volume, the 754th page (1962));
Captan, N-(trichloro-methylthio) hexamethylene-4-alkene-1,2-dicarboximide (US 2 553 770);
Euparen, N-dichloro one fluorine methyl mercapto-N ', N '-dimethyl-N-phenyl-sulfamide (DE-A 11 93 498);
Folpet, N-(trichloro-methylthio) phthalimide (US 2 553 770);
Tolyfluanid, N-dichloro one fluorine methyl mercapto-N ', N '-dimethyl-N-p-methylphenyl sulfonamide (DE-A11 93 498);
Dimethomorph, 3-(4-chlorphenyl)-3-(3, the 4-Dimethoxyphenyl)-1-morpholine-4-base propenone (EP-A 120321);
Fluorine biphenyl bacterium, 2-(3, the 4-Dimethoxyphenyl)-N-ethyl-α, α, α-three fluoro-N-methyl is to toluamide [AGROW no.243,22 (1995)];
Flumorph, 3-(4-fluorophenyl)-3-(3, the 4-Dimethoxyphenyl)-1-morpholine-4-base propenone (EP-A 860438);
N-(4 '-bromo biphenyl-2-yl)-4-difluoromethyl-2-methylthiazol-5-formamide, N-(4 '-trifluoromethyl-biphenyl-2-yl)-4-difluoromethyl-2-methylthiazol-5-formamide, N-(4 '-chloro-3 '-fluorine biphenyl-2-yl)-4-difluoromethyl-2-methylthiazol-5-formamide (WO 03/66610)
N-(3 ', 4 '-two chloro-4-fluorine biphenyl-2-yls)-3-difluoromethyl-1-methylpyrazole-4-formamide and N-(3 ', 4 '-two chloro-5-fluorine biphenyl-2-yls)-3-difluoromethyl-1-methylpyrazole-4-formamide (WO 03/70705);
N-(2-cyano-phenyl)-3,4-two chloroisothiazoles-5-formamide (WO 99/24413);
N-(2-(4-[3-(4-chlorphenyl) Propargyl oxygen base]-3-methoxyphenyl) ethyl)-2-methanesulfonamido-3-methylbutyryl amine, N-(2-(4-[3-(4-chlorphenyl) Propargyl oxygen base]-the 3-methoxyphenyl) ethyl)-2-second sulfonamido-3-methylbutyryl amine (WO 04/49804);
3-[5-(4-chlorphenyl)-2,3-dimethyl isoxazole alkane-3-yl] pyridine (EP-A 10 35 122); 2-butoxy-6-iodo-3-propyl group chromene-4-ketone (WO 03/14103);
N, N-dimethyl-3-(3-bromo-6-fluoro-2 methyl indole-1-sulfonyl)-[1,2,4] triazole-1-sulfonamide (EP-A1031571);
(2-chloro-5-[1-(3-methyl benzyloxy imino) ethyl] benzyl) methyl carbamate, (2-chloro-5-[1-(6-picoline-2-base methoxyimino) ethyl] benzyl) methyl carbamate (EP-A 12 01 648);
3-(4-chlorphenyl)-3-(different third oxygen carbonylamino of 2--3-methylbutyryl amino) methyl propionate (EP-A 10 28125);
The nitrile Fluoxastrobin, 2-{2-[6-(2-cyano group-1-vinyl penta-1,3-diene oxygen base) pyrimidine-4-base oxygen base] phenyl }-3-methoxy-methyl acrylate (EP-A 382 375),
Ether bacterium amine, (E)-2-(methoxyimino)-N-methyl-2-[α-(2, the 5-xylyloxy)-o-tolyl] acetamide (EP-A 477 631);
Fluoxastrobin, (E)-2-[6-(2-chlorophenoxy)-5-fluorine pyrimidine-4-base oxygen base] phenyl } (5,6-dihydro-1,4,2-dioxazine-3-yl) ketone O-methyloxime (WO 97/27189);
The imines bacterium, (E)-methoxyimino [α-(oxy-o-cresyl)-o-tolyl] methyl acetate (EP-A 253 213); Fork phenalgin acid amides, (E)-2-(methoxyimino)-N-methyl-2-(2-Phenoxyphenyl) acetamide (EP-A 398692);
Orysastrobin, (2E)-2-(methoxyimino)-2-{2-[(3E, 5E, 6E)-and 5-(methoxyimino)-4,6-dimethyl-2,8-two oxa-s-3, the 7-diaza ninth of the ten Heavenly Stems-3,6-diene-1-yl] phenyl }-N-methylacetamide (WO97/15552);
ZEN 90160,3-methoxyl group-2-[2-(6-5-flumethiazine-2-base oxygen ylmethyl) phenyl] methyl acrylate (EP-A 278 595);
Pyraclostrobin, N-{2-[1-(4-chlorphenyl)-1H-pyrazole-3-yl oxygen ylmethyl] phenyl } (N-methoxyl group) methyl carbamate (WO 96/01256);
Oxime bacterium ester, (E)-methoxyimino-(E)-α-[1-(α, α, tolyl between α-three fluoro-) ethyleneimino oxygen base]-o-tolyl } methyl acetate (EP-A 460 575);
2-[neighbour-(2,5-dimethyl phenoxy methylene) phenyl]-3-methoxy-methyl acrylate (EP-A 226917);
5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazol [1,5-a] pyrimidines (WO98/46608);
3,4-two chloro-N-(2-cyano-phenyl) isothiazole-5-formamide (WO 99/24413),
Formula III compound (WO 04/049804);
N-(2-(4-[3-(4-chlorphenyl) Propargyl oxygen base]-3-methoxyphenyl) ethyl)-2-methanesulfonamido-3-methylbutyryl amine and N-(2-(4-[3-(4-chlorphenyl) Propargyl oxygen base]-the 3-methoxyphenyl) ethyl)-2-second sulfonamido-3-methylbutyryl amine (WO 03/66609);
2-butoxy-6-iodo-3-propyl group chromene-4-ketone (WO 03/14103);
N, N-dimethyl-3-(3-bromo-6-fluoro-2 methyl indole-1-sulfonyl)-[1,2,4] triazole-1-sulfonamide (WO03/053145);
3-(4-chlorphenyl)-3-(different third oxygen carbonylamino of 2--3-methylbutyryl amino) methyl propionate (EP-A1028125).
For the rate of application that reduces reactive compound I and II and widen its activity profile, the purpose of this invention is to provide under total amount of application of reactive compound reduces harmful fungoid, especially have and improve active mixture for some indication.
Therefore we found that this purpose is realized by the mixture of defined reactive compound I of beginning and II.In addition, we find to compare with the unification compound, simultaneously, i.e. associating or at least a Compound I of separate administration and at least a reactive compound II or administered compound I and at least a reactive compound II can prevent and treat harmful fungoid (Synergistic mixture) better successively.
Compound I can be as the synergetic effect additive of a large amount of different Fungicidal active compounds.Simultaneously, promptly associating or separate administration Compound I and at least a reactive compound II are super adds and ground has increased Fungicidally active.
Compound I may may exist by different crystal formations with various biologically actives.
In formula I, halogen is fluorine, chlorine, bromine or iodine, preferred fluorine or chlorine;
C
1-C
4Alkyl is methyl, ethyl, n-pro-pyl, 1-Methylethyl, normal-butyl, 1-methyl-propyl, 2-methyl-propyl or 1,1-dimethyl ethyl, preferable methyl or ethyl;
C
1-C
4Haloalkyl is the C of halo partially or completely
1-C
4Alkyl, wherein halogen atom especially is fluorine, chlorine and/or bromine, i.e. for example chloromethyl, bromomethyl, dichloromethyl, trichloromethyl, methyl fluoride, difluoromethyl, trifluoromethyl, chlorine methyl fluoride, dichloro one methyl fluoride, a chlorodifluoramethyl-, 1-chloroethyl, 1-bromoethyl, 1-fluoro ethyl, 2-fluoro ethyl, 2,2-two fluoro ethyls, 2,2,2-trifluoroethyl, 2-chloro-2-fluoro ethyl, 2-chloro-2,2-two fluoro ethyls, 2,2-two chloro-2-fluoro ethyls, 2,2,2-three chloroethyls, pentafluoroethyl group, seven fluoropropyls or nine fluorine butyl, especially halogenated methyls, preferred especially CH
2-Cl, CH (Cl)
2, CH
2-F, CHF
2, CF
3, CHFCl, CF
2Cl or CF (Cl)
2, CHF especially
2Or CF
3
C
1-C
4Alkoxyl is OCH
3, OC
2H
5, OCH
2-C
2H
5, OCH (CH
3)
2, n-butoxy, OCH (CH
3)-C
2H
5, OCH
2-CH (CH
3)
2Or OC (CH
3)
3, preferred OCH
3Or OC
2H
5
C
1-C
4Halogenated alkoxy is the C of halo partially or completely
1-C
4Alkoxyl, wherein halogen atom especially is a fluorine, chlorine and/or bromine, i.e. chlorine methoxyl group for example, the bromine methoxyl group, the dichloro methoxyl group, the trichlorine methoxyl group, the fluorine methoxyl group, difluoro-methoxy, trifluoromethoxy, chlorine fluorine methoxyl group, dichloro one fluorine methoxyl group, one chlorine difluoro-methoxy, the 1-chloroethoxy, the 1-bromine oxethyl, 1-fluorine ethyoxyl, 2-fluorine ethyoxyl, 2, the 2-difluoroethoxy, 2,2, the 2-trifluoro ethoxy, 2-chloro-2-fluorine ethyoxyl, 2-chloro-2, the 2-difluoroethoxy, 2,2-two chloro-2-fluorine ethyoxyls, 2,2,2-three chloroethoxies, five fluorine ethyoxyls, seven fluorine propoxyl group or nine fluorine butoxy, especially halogenated methoxies, preferred especially OCH
2-Cl, OCH (Cl)
2, OCH
2-F, OCH (F)
2, OCF
3, OCHFCl, OCF
2Cl or OCF (Cl)
2
C
1-C
4Alkylthio group is SCH
3, SC
2H
5, SCH
2-C
2H
5, SCH (CH
3)
2, positive butylthio, SCH (CH
3)-C
2H
5, SCH
2-CH (CH
3)
2Or SC (CH
3)
3, preferred SCH
3Or SC
2H
5
Preferred 1-methyl-pyrazol-4-yl carboxylic acid anilides I is that wherein X is those of oxygen on the one hand.
On the other hand, preferred compound I is that wherein X is those of sulphur.
For mixture of the present invention, preferred R wherein
1Be methyl or halogenated methyl, especially CH
3, CHF
2, CH
2F, CF
3, CHFCl or CF
2The formula I compound of Cl.
Preferred R wherein in addition
2Compound I for hydrogen, fluorine or chlorine, especially hydrogen.
Preferred R wherein in addition
3Be halogen, C
1-C
4Alkyl, C
1-C
4Haloalkyl, C
1-C
4Alkoxyl, C
1-C
4Halogenated alkoxy or C
1-C
4Alkylthio group, preferred halogen, methyl, halogenated methyl, methoxyl group, halogenated methoxy or methyl mercapto, especially F, Cl, CH
3, CF
3, OCH
3, OCHF
2, OCF
3Or SCH
3, those Compound I of preferred especially fluorine.
Preferred R wherein in addition
4Be halogen, especially those Compound I of fluorine.
Preferred R wherein in addition
5Be halogen, especially those Compound I of fluorine.
The wherein X that especially preferably is listed in the table below in 1 is the Compound I of oxygen.
Table 1
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
1 | CH 3 | H | 2-F | 3-F | 4-F | |
2 | CH 3 | H | 2-F | 3-F | 5-F | |
3 | CH 3 | H | 2-F | 4-F | 5-F | |
4 | CH 3 | H | 2-F | 4-F | 6-F | |
5 | CH 3 | H | 3-F | 4-F | 5-F | |
6 | CH 3 | H | 3-F | 5-F | 6-F | |
7 | CH 2F | H | 2-F | 3-F | 4-F | |
8 | CH 2F | H | 2-F | 3-F | 5-F | |
9 | CH 2F | H | 2-F | 4-F | 5-F | |
10 | CH 2F | H | 2-F | 4-F | 6-F | |
11 | CH 2F | H | 3-F | 4-F | 5-F | |
12 | CH 2F | H | 3-F | 5-F | 6-F | |
13 | CHF 2 | H | 2-F | 3-F | 4-F | |
14 | CHF 2 | H | 2-F | 3-F | 5-F | |
15 | CHF 2 | H | 2-F | 4-F | 5-F | |
16 | CHF 2 | H | 2-F | 4-F | 6-F | |
17 | CHF 2 | H | 3-F | 4-F | 5-F |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [C] |
18 | CHF 2 | H | 3-F | 5-F | 6-F | |
19 | CF 3 | H | 2-F | 3-F | 4-F | |
20 | CF 3 | H | 2-F | 3-F | 5-F | |
21 | CF 3 | H | 2-F | 4-F | 5-F | |
22 | CF 3 | H | 2-F | 4-F | 6-F | |
23 | CF 3 | H | 3-F | 4-F | 5-F | |
24 | CF 3 | H | 3-F | 5-F | 6-F | |
25 | CHFCl | H | 2-F | 3-F | 4-F | |
26 | CHFCl | H | 2-F | 3-F | 5-F | |
27 | CHFCl | H | 2-F | 4-F | 5-F | |
28 | CHFCl | H | 2-F | 4-F | 6-F | |
29 | CHFCl | H | 3-F | 4-F | 5-F | |
30 | CHFCl | H | 3-F | 5-F | 6-F | |
31 | CF 2Cl | H | 2-F | 3-F | 4-F | |
32 | CF 2Cl | H | 2-F | 3-F | 5-F | |
33 | CF 2Cl | H | 2-F | 4-F | 5-F | |
34 | CF 2Cl | H | 2-F | 4-F | 6-F | |
35 | CF 2Cl | H | 3-F | 4-F | 5-F | |
36 | CF 2Cl | H | 3-F | 5-F | 6-F | |
37 | CH 3 | F | 2-F | 3-F | 4-F | |
38 | CH 3 | F | 2-F | 3-F | 5-F | |
39 | CH 3 | F | 2-F | 4-F | 5-F | |
40 | CH 3 | F | 2-F | 4-F | 6-F | |
41 | CH 3 | F | 3-F | 4-F | 5-F | |
42 | CH 3 | F | 3-F | 5-F | 6-F | |
43 | CH 2F | F | 2-F | 3-F | 4-F | |
44 | CH 2F | F | 2-F | 3-F | 5-F | |
45 | CH 2F | F | 2-F | 4-F | 5-F | |
46 | CH 2F | F | 2-F | 4-F | 6-F | |
47 | CH 2F | F | 3-F | 4-F | 5-F | |
48 | CH 2F | F | 3-F | 5-F | 6-F | |
49 | CHF 2 | F | 2-F | 3-F | 4-F | |
50 | CHF 2 | F | 2-F | 3-F | 5-F | |
51 | CHF 2 | F | 2-F | 4-F | 5-F | |
52 | CHF 2 | F | 2-F | 4-F | 6-F | |
53 | CHF 2 | F | 3-F | 4-F | 5-F | |
54 | CHF 2 | F | 3-F | 5-F | 6-F | |
55 | CF 3 | F | 2-F | 3-F | 4-F | |
56 | CF 3 | F | 2-F | 3-F | 5-F | |
57 | CF 3 | F | 2-F | 4-F | 5-F | |
58 | CF 3 | F | 2-F | 4-F | 6-F |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
59 | CF 3 | F | 3-F | 4-F | 5-F | |
60 | CF 3 | F | 3-F | 5-F | 6-F | |
61 | CHFCl | F | 2-F | 3-F | 4-F | |
62 | CHFCl | F | 2-F | 3-F | 5-F | |
63 | CHFCl | F | 2-F | 4-F | 5-F | |
64 | CHFCl | F | 2-F | 4-F | 6-F | |
65 | CHFCl | F | 3-F | 4-F | 5-F | |
66 | CHFCl | F | 3-F | 5-F | 6-F | |
67 | CF 2Cl | F | 2-F | 3-F | 4-F | |
68 | CF 2Cl | F | 2-F | 3-F | 5-F | |
69 | CF 2Cl | F | 2-F | 4-F | 5-F | |
70 | CF 2Cl | F | 2-F | 4-F | 6-F | |
71 | CF 2Cl | F | 3-F | 4-F | 5-F | |
72 | CF 2Cl | F | 3-F | 5-F | 6-F | |
73 | CH 3 | Cl | 2-F | 3-F | 4-F | |
74 | CH 3 | Cl | 2-F | 3-F | 5-F | |
75 | CH 3 | Cl | 2-F | 4-F | 5-F | |
76 | CH 3 | Cl | 2-F | 4-F | 6-F | |
77 | CH 3 | Cl | 3-F | 4-F | 5-F | |
78 | CH 3 | Cl | 3-F | 5-F | 6-F | |
79 | CH 2F | Cl | 2-F | 3-F | 4-F | |
80 | CH 2F | Cl | 2-F | 3-F | 5-F | |
81 | CH 2F | Cl | 2-F | 4-F | 5-F | |
82 | CH 2F | Cl | 2-F | 4-F | 6-F | |
83 | CH 2F | Cl | 3-F | 4-F | 5-F | |
84 | CH 2F | Cl | 3-F | 5-F | 6-F | |
85 | CHF 2 | Cl | 2-F | 3-F | 4-F | |
86 | CHF 2 | Cl | 2-F | 3-F | 5-F | |
87 | CHF 2 | Cl | 2-F | 4-F | 5-F | |
88 | CHF 2 | Cl | 2-F | 4-F | 6-F | |
89 | CHF 2 | Cl | 3-F | 4-F | 5-F | |
90 | CHF 2 | Cl | 3-F | 5-F | 6-F | |
91 | CF 3 | Cl | 2-F | 3-F | 4-F | |
92 | CF 3 | Cl | 2-F | 3-F | 5-F | |
93 | CF 3 | Cl | 2-F | 4-F | 5-F | |
94 | CF 3 | Cl | 2-F | 4-F | 6-F | |
95 | CF 3 | Cl | 3-F | 4-F | 5-F | |
96 | CF 3 | Cl | 3-F | 5-F | 6-F | |
97 | CHFCl | Cl | 2-F | 3-F | 4-F | |
98 | CHFCl | Cl | 2-F | 3-F | 5-F | |
99 | CHFCl | Cl | 2-F | 4-F | 5-F |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
100 | CHFCl | Cl | 2-F | 4-F | 6-F | |
101 | CHFCl | Cl | 3-F | 4-F | 5-F | |
102 | CHFCl | Cl | 3-F | 5-F | 6-F | |
103 | CF 2Cl | Cl | 2-F | 3-F | 4-F | |
104 | CF 2Cl | Cl | 2-F | 3-F | 5-F | |
105 | CF 2Cl | Cl | 2-F | 4-F | 5-F | |
106 | CF 2Cl | Cl | 2-F | 4-F | 6-F | |
107 | CF 2Cl | Cl | 3-F | 4-F | 5-F | |
108 | CF 2Cl | Cl | 3-F | 5-F | 6-F |
In addition, the 1-methyl-pyrazol-4-yl carboxylic acid anilides of special preferred formula Ia (I, X=O wherein, R
1=CF
3And R
2=H):
Especially Ia.1-Ia.1009 in 2 is listed in the table below:
Table 2:
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.1 | CF 3 | H | The 2-fluorine | The 3-fluorine | The 4-fluorine | 123-125 |
Ia.2 | CF 3 | H | The 2-fluorine | 3-chlorine | The 4-fluorine | |
Ia.3 | CF 3 | H | The 2-fluorine | 3-CN | The 4-fluorine | |
Ia.4 | CF 3 | H | The 2-fluorine | The 3-methyl | The 4-fluorine | |
Ia.5 | CF 3 | H | The 2-fluorine | 3-CF 3 | The 4-fluorine | |
Ia.6 | CF 3 | H | The 2-fluorine | 3-OCH 3 | The 4-fluorine | |
Ia.7 | CF 3 | H | The 2-fluorine | 3-OCF 3 | The 4-fluorine | |
Ia.8 | CF 3 | H | 2-chlorine | The 3-fluorine | The 4-fluorine | |
Ia.9 | CF 3 | H | 2-chlorine | 3-chlorine | The 4-fluorine | |
Ia.10 | CF 3 | H | 2-chlorine | 3-CN | The 4-fluorine | |
Ia.11 | CF 3 | H | 2-chlorine | The 3-methyl | The 4-fluorine | |
Ia.12 | CF 3 | H | 2-chlorine | 3-CF 3 | The 4-fluorine | |
Ia.13 | CF 3 | H | 2-chlorine | 3-OCH 3 | The 4-fluorine | |
Ia.14 | CF 3 | H | 2-chlorine | 3-OCF 3 | The 4-fluorine | |
Ia.15 | CF 3 | H | 2-CN | The 3-fluorine | The 4-fluorine | |
Ia.16 | CF 3 | H | 2-CN | 3-chlorine | The 4-fluorine |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.17 | CF 3 | H | 2-CN | 3-CN | The 4-fluorine | |
Ia.18 | CF 3 | H | 2-CN | The 3-methyl | The 4-fluorine | |
Ia.19 | CF 3 | H | 2-CN | 3-CF 3 | The 4-fluorine | |
Ia.20 | CF 3 | H | 2-CN | 3-OCH 3 | The 4-fluorine | |
Ia.21 | CF 3 | H | 2-CN | 3-OCF 3 | The 4-fluorine | |
Ia.22 | CF 3 | H | The 2-methyl | The 3-fluorine | The 4-fluorine | |
Ia.23 | CF 3 | H | The 2-methyl | 3-chlorine | The 4-fluorine | |
Ia.24 | CF 3 | H | The 2-methyl | 3-CN | The 4-fluorine | |
Ia.25 | CF 3 | H | The 2-methyl | The 3-methyl | The 4-fluorine | |
Ia.26 | CF 3 | H | The 2-methyl | 3-CF 3 | The 4-fluorine | |
Ia.27 | CF 3 | H | The 2-methyl | 3-OCH 3 | The 4-fluorine | |
Ia.28 | CF 3 | H | The 2-methyl | 3-OCF 3 | The 4-fluorine | |
Ia.29 | CF 3 | H | 2-CF 3 | The 3-fluorine | The 4-fluorine | |
Ia.30 | CF 3 | H | 2-CF 3 | 3-chlorine | The 4-fluorine | |
Ia.31 | CF 3 | H | 2-CF 3 | 3-CN | The 4-fluorine | |
Ia.32 | CF 3 | H | 2-CF 3 | The 3-methyl | The 4-fluorine | |
Ia.33 | CF 3 | H | 2-CF 3 | 3-CF 3 | The 4-fluorine | |
Ia.34 | CF 3 | H | 2-CF 3 | 3-OCH 3 | The 4-fluorine | |
Ia.35 | CF 3 | H | 2-CF 3 | 3-OCF 3 | The 4-fluorine | |
Ia.36 | CF 3 | H | 2-OCH 3 | The 3-fluorine | The 4-fluorine | |
Ia.37 | CF 3 | H | 2-OCH 3 | 3-chlorine | The 4-fluorine | |
Ia.38 | CF 3 | H | 2-OCH 3 | 3-CN | The 4-fluorine | |
Ia.39 | CF 3 | H | 2-OCH 3 | The 3-methyl | The 4-fluorine | |
Ia.40 | CF 3 | H | 2-OCH 3 | 3-CF 3 | The 4-fluorine | |
Ia.41 | CF 3 | H | 2-OCH 3 | 3-OCH 3 | The 4-fluorine | |
Ia.42 | CF 3 | H | 2-OCH 3 | 3-OCF 3 | The 4-fluorine | |
Ia.43 | CF 3 | H | 2-OCF 3 | The 3-fluorine | The 4-fluorine | |
Ia.44 | CF 3 | H | 2-OCF 3 | 3-chlorine | The 4-fluorine | |
Ia.45 | CF 3 | H | 2-OCF 3 | 3-CN | The 4-fluorine | |
Ia.46 | CF 3 | H | 2-OCF 3 | The 3-methyl | The 4-fluorine | |
Ia.47 | CF 3 | H | 2-OCF 3 | 3-CF 3 | The 4-fluorine | |
Ia.48 | CF 3 | H | 2-OCF 3 | 3-OCH 3 | The 4-fluorine | |
Ia.49 | CF 3 | H | 2-OCF 3 | 3-OCF 3 | The 4-fluorine | |
Ia.50 | CF 3 | H | The 2-fluorine | The 3-fluorine | 4-chlorine |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.51 | CF 3 | H | The 2-fluorine | 3-chlorine | 4-chlorine | |
Ia.52 | CF 3 | H | The 2-fluorine | 3-CN | 4-chlorine | |
Ia.53 | CF 3 | H | The 2-fluorine | The 3-methyl | 4-chlorine | |
Ia.54 | CF 3 | H | The 2-fluorine | 3-CF 3 | 4-chlorine | |
Ia.55 | CF 3 | H | The 2-fluorine | 3-OCH 3 | 4-chlorine | |
Ia.56 | CF 3 | H | The 2-fluorine | 3-OCF 3 | 4-chlorine | |
Ia.57 | CF 3 | H | 2-chlorine | The 3-fluorine | 4-chlorine | |
Ia.58 | CF 3 | H | 2-chlorine | 3-chlorine | 4-chlorine | |
Ia.59 | CF 3 | H | 2-chlorine | 3-CN | 4-chlorine | |
Ia.60 | CF 3 | H | 2-chlorine | The 3-methyl | 4-chlorine | |
Ia.61 | CF 3 | H | 2-chlorine | 3-CF 3 | 4-chlorine | |
Ia.62 | CF 3 | H | 2-chlorine | 3-OCH 3 | 4-chlorine | |
Ia.63 | CF 3 | H | 2-chlorine | 3-OCF 3 | 4-chlorine | |
Ia.64 | CF 3 | H | 2-CN | The 3-fluorine | 4-chlorine | |
Ia.65 | CF 3 | H | 2-CN | 3-chlorine | 4-chlorine | |
Ia.66 | CF 3 | H | 2-CN | 3-CN | 4-chlorine | |
Ia.67 | CF 3 | H | 2-CN | The 3-methyl | 4-chlorine | |
Ia.68 | CF 3 | H | 2-CN | 3-CF 3 | 4-chlorine | |
Ia.69 | CF 3 | H | 2-CN | 3-OCH 3 | 4-chlorine | |
Ia.70 | CF 3 | H | 2-CN | 3-OCF 3 | 4-chlorine | |
Ia.71 | CF 3 | H | The 2-methyl | The 3-fluorine | 4-chlorine | |
Ia.72 | CF 3 | H | The 2-methyl | 3-chlorine | 4-chlorine | |
Ia.73 | CF 3 | H | The 2-methyl | 3-CN | 4-chlorine | |
Ia.74 | CF 3 | H | The 2-methyl | The 3-methyl | 4-chlorine | |
Ia.75 | CF 3 | H | The 2-methyl | 3-CF 3 | 4-chlorine | |
Ia.76 | CF 3 | H | The 2-methyl | 3-OCH 3 | 4-chlorine | |
Ia.77 | CF 3 | H | The 2-methyl | 3-OCF 3 | 4-chlorine | |
Ia.78 | CF 3 | H | 2-CF 3 | The 3-fluorine | 4-chlorine | |
Ia.79 | CF 3 | H | 2-CF 3 | 3-chlorine | 4-chlorine | |
Ia.80 | CF 3 | H | 2-CF 3 | 3-CN | 4-chlorine | |
Ia.81 | CF 3 | H | 2-CF 3 | The 3-methyl | 4-chlorine | |
Ia.82 | CF 3 | H | 2-CF 3 | 3-CF 3 | 4-chlorine | |
Ia.83 | CF 3 | H | 2-CF 3 | 3-OCH 3 | 4-chlorine | |
Ia.84 | CF 3 | H | 2-CF 3 | 3-OCF 3 | 4-chlorine |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.85 | CF 3 | H | 2-OCH 3 | The 3-fluorine | 4-chlorine | |
Ia.86 | CF 3 | H | 2-OCH 3 | 3-chlorine | 4-chlorine | |
Ia.87 | CF 3 | H | 2-OCH 3 | 3-CN | 4-chlorine | |
Ia.88 | CF 3 | H | 2-OCH 3 | The 3-methyl | 4-chlorine | |
Ia.89 | CF 3 | H | 2-OCH 3 | 3-CF 3 | 4-chlorine | |
Ia.90 | CF 3 | H | 2-OCH 3 | 3-OCH 3 | 4-chlorine | |
Ia.91 | CF 3 | H | 2-OCH 3 | 3-OCF 3 | 4-chlorine | |
Ia.92 | CF 3 | H | 2-OCF 3 | The 3-fluorine | 4-chlorine | |
Ia.93 | CF 3 | H | 2-OCF 3 | 3-chlorine | 4-chlorine | |
Ia.94 | CF 3 | H | 2-OCF 3 | 3-CN | 4-chlorine | |
Ia.95 | CF 3 | H | 2-OCF 3 | The 3-methyl | 4-chlorine | |
Ia.96 | CF 3 | H | 2-OCF 3 | 3-CF 3 | 4-chlorine | |
Ia.97 | CF 3 | H | 2-OCF 3 | 3-OCH 3 | 4-chlorine | |
Ia.98 | CF 3 | H | 2-OCF 3 | 3-OCF 3 | 4-chlorine | |
Ia.99 | CF 3 | H | The 2-fluorine | The 3-fluorine | 4-CN | |
Ia.100 | CF 3 | H | The 2-fluorine | 3-chlorine | 4-CN | |
Ia.101 | CF 3 | H | The 2-fluorine | 3-CN | 4-CN | |
Ia.102 | CF 3 | H | The 2-fluorine | The 3-methyl | 4-CN | |
Ia.103 | CF 3 | H | The 2-fluorine | 3-CF 3 | 4-CN | |
Ia.104 | CF 3 | H | The 2-fluorine | 3-OCH 3 | 4-CN | |
Ia.105 | CF 3 | H | The 2-fluorine | 3-OCF 3 | 4-CN | |
Ia.106 | CF 3 | H | 2-chlorine | The 3-fluorine | 4-CN | |
Ia.107 | CF 3 | H | 2-chlorine | 3-chlorine | 4-CN | |
Ia.108 | CF 3 | H | 2-chlorine | 3-CN | 4-CN | |
Ia.109 | CF 3 | H | 2-chlorine | The 3-methyl | 4-CN | |
Ia.110 | CF 3 | H | 2-chlorine | 3-CF 3 | 4-CN | |
Ia.111 | CF 3 | H | 2-chlorine | 3-OCH 3 | 4-CN | |
Ia.112 | CF 3 | H | 2-chlorine | 3-OCF 3 | 4-CN | |
Ia.113 | CF 3 | H | 2-CN | The 3-fluorine | 4-CN | |
Ia.114 | CF 3 | H | 2-CN | 3-chlorine | 4-CN | |
Ia.115 | CF 3 | H | 2-CN | 3-CN | 4-CN | |
Ia.116 | CF 3 | H | 2-CN | The 3-methyl | 4-CN | |
Ia.117 | CF 3 | H | 2-CN | 3-CF 3 | 4-CN | |
Ia.118 | CF 3 | H | 2-CN | 3-OCH 3 | 4-CN |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.119 | CF 3 | H | 2-CN | 3-OCF 3 | 4-CN | |
Ia.120 | CF 3 | H | The 2-methyl | The 3-fluorine | 4-CN | |
Ia.121 | CF 3 | H | The 2-methyl | 3-chlorine | 4-CN | |
Ia.122 | CF 3 | H | The 2-methyl | 3-CN | 4-CN | |
Ia.123 | CF 3 | H | The 2-methyl | The 3-methyl | 4-CN | |
Ia.124 | CF 3 | H | The 2-methyl | 3-CF 3 | 4-CN | |
Ia.125 | CF 3 | H | The 2-methyl | 3-OCH 3 | 4-CN | |
Ia.126 | CF 3 | H | The 2-methyl | 3-OCF 3 | 4-CN | |
Ia.127 | CF 3 | H | 2-CF 3 | The 3-fluorine | 4-CN | |
Ia.128 | CF 3 | H | 2-CF 3 | 3-chlorine | 4-CN | |
Ia.129 | CF 3 | H | 2-CF 3 | 3-CN | 4-CN | |
Ia.130 | CF 3 | H | 2-CF 3 | The 3-methyl | 4-CN | |
Ia.131 | CF 3 | H | 2-CF 3 | 3-CF 3 | 4-CN | |
Ia.132 | CF 3 | H | 2-CF 3 | 3-OCH 3 | 4-CN | |
Ia.133 | CF 3 | H | 2-CF 3 | 3-OCF 3 | 4-CN | |
Ia.134 | CF 3 | H | 2-OCH 3 | The 3-fluorine | 4-CN | |
Ia.135 | CF 3 | H | 2-OCH 3 | 3-chlorine | 4-CN | |
Ia.136 | CF 3 | H | 2-OCH 3 | 3-CN | 4-CN | |
Ia.137 | CF 3 | H | 2-OCH 3 | The 3-methyl | 4-CN | |
Ia.138 | CF 3 | H | 2-OCH 3 | 3-CF 3 | 4-CN | |
Ia.139 | CF 3 | H | 2-OCH 3 | 3-OCH 3 | 4-CN | |
Ia.140 | CF 3 | H | 2-OCH 3 | 3-OCF 3 | 4-CN | |
Ia.141 | CF 3 | H | 2-OCF 3 | The 3-fluorine | 4-CN | |
Ia.142 | CF 3 | H | 2-OCF 3 | 3-chlorine | 4-CN | |
Ia.143 | CF 3 | H | 2-OCF 3 | 3-CN | 4-CN | |
Ia.144 | CF 3 | H | 2-OCF 3 | The 3-methyl | 4-CN | |
Ia.145 | CF 3 | H | 2-OCF 3 | 3-CF 3 | 4-CN | |
Ia.146 | CF 3 | H | 2-OCF 3 | 3-OCH 3 | 4-CN | |
Ia.147 | CF 3 | H | 2-OCF 3 | 3-OCF 3 | 4-CN | |
Ia.148 | CF 3 | H | The 2-fluorine | The 3-fluorine | The 4-methyl | |
Ia.149 | CF 3 | H | The 2-fluorine | 3-chlorine | The 4-methyl | |
Ia.150 | CF 3 | H | The 2-fluorine | 3-CN | The 4-methyl | |
Ia.151 | CF 3 | H | The 2-fluorine | The 3-methyl | The 4-methyl | |
Ia.152 | CF 3 | H | The 2-fluorine | 3-CF 3 | The 4-methyl | |
Ia.153 | CF 3 | H | The 2-fluorine | 3-OCH 3 | The 4-methyl |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.154 | CF 3 | H | The 2-fluorine | 3-OCF 3 | The 4-methyl | |
Ia.155 | CF 3 | H | 2-chlorine | The 3-fluorine | The 4-methyl | |
Ia.156 | CF 3 | H | 2-chlorine | 3-chlorine | The 4-methyl | |
Ia.157 | CF 3 | H | 2-chlorine | 3-CN | The 4-methyl | |
Ia.158 | CF 3 | H | 2-chlorine | The 3-methyl | The 4-methyl | |
Ia.159 | CF 3 | H | 2-chlorine | 3-CF 3 | The 4-methyl | |
Ia.160 | CF 3 | H | 2-chlorine | 3-OCH 3 | The 4-methyl | |
Ia.161 | CF 3 | H | 2-chlorine | 3-OCF 3 | The 4-methyl | |
Ia.162 | CF 3 | H | 2-CN | The 3-fluorine | The 4-methyl | |
Ia.163 | CF 3 | H | 2-CN | 3-chlorine | The 4-methyl | |
Ia.164 | CF 3 | H | 2-CN | 3-CN | The 4-methyl | |
Ia.165 | CF 3 | H | 2-CN | The 3-methyl | The 4-methyl | |
Ia.166 | CF 3 | H | 2-CN | 3-CF 3 | The 4-methyl | |
Ia.167 | CF 3 | H | 2-CN | 3-OCH 3 | The 4-methyl | |
Ia.168 | CF 3 | H | 2-CN | 3-OCF 3 | The 4-methyl | |
Ia.169 | CF 3 | H | The 2-methyl | The 3-fluorine | The 4-methyl | |
Ia.170 | CF 3 | H | The 2-methyl | 3-chlorine | The 4-methyl | |
Ia.171 | CF 3 | H | The 2-methyl | 3-CN | The 4-methyl | |
Ia.172 | CF 3 | H | The 2-methyl | The 3-methyl | The 4-methyl | |
Ia.173 | CF 3 | H | The 2-methyl | 3-CF 3 | The 4-methyl | |
Ia.174 | CF 3 | H | The 2-methyl | 3-OCH 3 | The 4-methyl | |
Ia.175 | CF 3 | H | The 2-methyl | 3-OCF 3 | The 4-methyl | |
Ia.176 | CF 3 | H | 2-CF 3 | The 3-fluorine | The 4-methyl | |
Ia.177 | CF 3 | H | 2-CF 3 | 3-chlorine | The 4-methyl | |
Ia.178 | CF 3 | H | 2-CF 3 | 3-CN | The 4-methyl | |
Ia.179 | CF 3 | H | 2-CF 3 | The 3-methyl | The 4-methyl | |
Ia.180 | CF 3 | H | 2-CF 3 | 3-CF 3 | The 4-methyl | |
Ia.181 | CF 3 | H | 2-CF 3 | 3-OCH 3 | The 4-methyl | |
Ia.182 | CF 3 | H | 2-CF 3 | 3-OCF 3 | The 4-methyl | |
Ia.183 | CF 3 | H | 2-OCH 3 | The 3-fluorine | The 4-methyl | |
Ia.184 | CF 3 | H | 2-OCH 3 | 3-chlorine | The 4-methyl | |
Ia.185 | CF 3 | H | 2-OCH 3 | 3-CN | The 4-methyl | |
Ia.186 | CF 3 | H | 2-OCH 3 | The 3-methyl | The 4-methyl | |
Ia.187 | CF 3 | H | 2-OCH 3 | 3-CF 3 | The 4-methyl |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.188 | CF 3 | H | 2-OCH 3 | 3-OCH 3 | The 4-methyl | |
Ia.189 | CF 3 | H | 2-OCH 3 | 3-OCF 3 | The 4-methyl | |
Ia.190 | CF 3 | H | 2-OCF 3 | The 3-fluorine | The 4-methyl | |
Ia.191 | CF 3 | H | 2-OCF 3 | 3-chlorine | The 4-methyl | |
Ia.192 | CF 3 | H | 2-OCF 3 | 3-CN | The 4-methyl | |
Ia.193 | CF 3 | H | 2-OCF 3 | The 3-methyl | The 4-methyl | |
Ia.194 | CF 3 | H | 2-OCF 3 | 3-CF 3 | The 4-methyl | |
Ia.195 | CF 3 | H | 2-OCF 3 | 3-OCH 3 | The 4-methyl | |
Ia.196 | CF 3 | H | 2-OCF 3 | 3-OCF 3 | The 4-methyl | |
Ia.197 | CF 3 | H | The 2-fluorine | The 3-fluorine | 4-CF3 | |
Ia.198 | CF 3 | H | The 2-fluorine | 3-chlorine | 4-CF3 | |
Ia.199 | CF 3 | H | The 2-fluorine | 3-CN | 4-CF3 | |
Ia.200 | CF 3 | H | The 2-fluorine | The 3-methyl | 4-CF3 | |
Ia.201 | CF 3 | H | The 2-fluorine | 3-CF 3 | 4-CF3 | |
Ia.202 | CF 3 | H | The 2-fluorine | 3-OCH 3 | 4-CF3 | |
Ia.203 | CF 3 | H | The 2-fluorine | 3-OCF 3 | 4-CF3 | |
Ia.204 | CF 3 | H | 2-chlorine | The 3-fluorine | 4-CF 3 | |
Ia.205 | CF 3 | H | 2-chlorine | 3-chlorine | 4-CF 3 | |
Ia.206 | CF 3 | H | 2-chlorine | 3-CN | 4-CF 3 | |
Ia.207 | CF 3 | H | 2-chlorine | The 3-methyl | 4-CF 3 | |
Ia.208 | CF 3 | H | 2-chlorine | 3-CF 3 | 4-CF 3 | |
Ia.209 | CF 3 | H | 2-chlorine | 3-OCH 3 | 4-CF 3 | |
Ia.210 | CF 3 | H | 2-chlorine | 3-OCF 3 | 4-CF 3 | |
Ia.211 | CF 3 | H | 2-CN | The 3-fluorine | 4-CF 3 | |
Ia.212 | CF 3 | H | 2-CN | 3-chlorine | 4-CF 3 | |
Ia.213 | CF 3 | H | 2-CN | 3-CN | 4-CF 3 | |
Ia.214 | CF 3 | H | 2-CN | The 3-methyl | 4-CF 3 | |
Ia.215 | CF 3 | H | 2-CN | 3-CF 3 | 4-CF 3 | |
Ia.216 | CF 3 | H | 2-CN | 3-OCH 3 | 4-CF 3 | |
Ia.217 | CF 3 | H | 2-CN | 3-OCF 3 | 4-CF 3 | |
Ia.218 | CF 3 | H | The 2-methyl | The 3-fluorine | 4-CF3 | |
Ia.219 | CF 3 | H | The 2-methyl | 3-chlorine | 4-CF3 | |
Ia.220 | CF 3 | H | The 2-methyl | 3-CN | 4-CF3 | |
Ia.221 | CF 3 | H | The 2-methyl | The 3-methyl | 4-CF3 |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.222 | CF 3 | H | The 2-methyl | 3-CF 3 | 4-CF3 | |
Ia.223 | CF 3 | H | The 2-methyl | 3-OCH 3 | 4-CF3 | |
Ia.224 | CF 3 | H | The 2-methyl | 3-OCF 3 | 4-CF3 | |
Ia.225 | CF 3 | H | 2-CF 3 | The 3-fluorine | 4-CF3 | |
Ia.226 | CF 3 | H | 2-CF 3 | 3-chlorine | 4-CF 3 | |
Ia.227 | CF 3 | H | 2-CF 3 | 3-CN | 4-CF3 | |
Ia.228 | CF 3 | H | 2-CF 3 | The 3-methyl | 4-CF3 | |
Ia.229 | CF 3 | H | 2-CF 3 | 3-CF 3 | 4-CF3 | |
Ia.230 | CF 3 | H | 2-CF 3 | 3-OCH 3 | 4-CF3 | |
Ia.231 | CF 3 | H | 2-CF 3 | 3-OCF 3 | 4-CF3 | |
Ia.232 | CF 3 | H | 2-OCH 3 | The 3-fluorine | 4-CF3 | |
Ia.233 | CF 3 | H | 2-OCH 3 | 3-chlorine | 4-CF3 | |
Ia.234 | CF 3 | H | 2-OCH 3 | 3-CN | 4-CF3 | |
Ia.235 | CF 3 | H | 2-OCH 3 | The 3-methyl | 4-CF3 | |
Ia.236 | CF 3 | H | 2-OCH 3 | 3-CF 3 | 4-CF3 | |
Ia.237 | CF 3 | H | 2-OCH 3 | 3-OCH 3 | 4-CF 3 | |
Ia.238 | CF 3 | H | 2-OCH 3 | 3-OCF 3 | 4-CF 3 | |
Ia.239 | CF 3 | H | 2-OCF 3 | The 3-fluorine | 4-CF 3 | |
Ia.240 | CF 3 | H | 2-OCF 3 | 3-chlorine | 4-CF 3 | |
Ia.241 | CF 3 | H | 2-OCF 3 | 3-CN | 4-CF 3 | |
Ia.242 | CF 3 | H | 2-OCF 3 | The 3-methyl | 4-CF 3 | |
Ia.243 | CF 3 | H | 2-OCF 3 | 3-CF 3 | 4-CF 3 | |
Ia.244 | CF 3 | H | 2-OCF 3 | 3-OCH 3 | 4-CF 3 | |
Ia.245 | CF 3 | H | 2-OCF 3 | 3-OCF 3 | 4-CF 3 | |
Ia.246 | CF 3 | H | The 2-fluorine | The 3-fluorine | 4-OCH 3 | |
Ia.247 | CF 3 | H | The 2-fluorine | 3-chlorine | 4-OCH 3 | |
Ia.248 | CF 3 | H | The 2-fluorine | 3-CN | 4-OCH 3 | |
Ia.249 | CF 3 | H | The 2-fluorine | The 3-methyl | 4-OCH 3 | |
Ia.250 | CF 3 | H | The 2-fluorine | 3-CF 3 | 4-OCH 3 | |
Ia.251 | CF 3 | H | The 2-fluorine | 3-OCH 3 | 4-OCH 3 | |
Ia.252 | CF 3 | H | The 2-fluorine | 3-OCF 3 | 4-OCH 3 | |
Ia.253 | CF 3 | H | 2-chlorine | The 3-fluorine | 4-OCH 3 | |
Ia.254 | CF 3 | H | 2-chlorine | 3-chlorine | 4-OCH 3 | |
Ia.255 | CF 3 | H | 2-chlorine | 3-CN | 4-OCH 3 | |
Ia.256 | CF 3 | H | 2-chlorine | The 3-methyl | 4-OCH 3 |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.257 | CF 3 | H | 2-chlorine | 3-CF 3 | 4-OCH 3 | |
Ia.258 | CF 3 | H | 2-chlorine | 3-OCH 3 | 4-OCH 3 | |
Ia.259 | CF 3 | H | 2-chlorine | 3-OCF 3 | 4-OCH 3 | |
Ia.260 | CF 3 | H | 2-CN | The 3-fluorine | 4-OCH 3 | |
Ia.261 | CF 3 | H | 2-CN | 3-chlorine | 4-OCH 3 | |
Ia.262 | CF 3 | H | 2-CN | 3-CN | 4-OCH 3 | |
Ia.263 | CF 3 | H | 2-CN | The 3-methyl | 4-OCH 3 | |
Ia.264 | CF 3 | H | 2-CN | 3-CF 3 | 4-OCH 3 | |
Ia.265 | CF 3 | H | 2-CN | 3-OCH 3 | 4-OCH 3 | |
Ia.266 | CF 3 | H | 2-CN | 3-OCF 3 | 4-OCH 3 | |
Ia.267 | CF 3 | H | The 2-methyl | The 3-fluorine | 4-OCH 3 | |
Ia.268 | CF 3 | H | The 2-methyl | 3-chlorine | 4-OCH 3 | |
Ia.269 | CF 3 | H | The 2-methyl | 3-CN | 4-OCH 3 | |
Ia.270 | CF 3 | H | The 2-methyl | The 3-methyl | 4-OCH 3 | |
Ia.271 | CF 3 | H | The 2-methyl | 3-CF 3 | 4-OCH 3 | |
Ia.272 | CF 3 | H | The 2-methyl | 3-OCH 3 | 4-OCH 3 | |
Ia.273 | CF 3 | H | The 2-methyl | 3-OCF 3 | 4-OCH 3 | |
Ia.274 | CF 3 | H | 2-CF 3 | The 3-fluorine | 4-OCH 3 | |
Ia.275 | CF 3 | H | 2-CF 3 | 3-chlorine | 4-OCH 3 | |
Ia.276 | CF 3 | H | 2-CF 3 | 3-CN | 4-OCH 3 | |
Ia.277 | CF 3 | H | 2-CF 3 | The 3-methyl | 4-OCH 3 | |
Ia.278 | CF 3 | H | 2-CF 3 | 3-CF 3 | 4-OCH 3 | |
Ia.279 | CF 3 | H | 2-CF 3 | 3-OCH 3 | 4-OCH 3 | |
Ia.280 | CF 3 | H | 2-CF 3 | 3-OCF 3 | 4-OCH 3 | |
Ia.281 | CF 3 | H | 2-OCH 3 | The 3-fluorine | 4-OCH 3 | |
Ia.282 | CF 3 | H | 2-OCH 3 | 3-chlorine | 4-OCH 3 | |
Ia.283 | CF 3 | H | 2-OCH 3 | 3-CN | 4-OCH 3 | |
Ia.284 | CF 3 | H | 2-OCH 3 | The 3-methyl | 4-OCH 3 | |
Ia.285 | CF 3 | H | 2-OCH 3 | 3-CF 3 | 4-OCH 3 | |
Ia.286 | CF 3 | H | 2-OCH 3 | 3-OCH 3 | 4-OCH 3 | |
Ia.287 | CF 3 | H | 2-OCH 3 | 3-OCF 3 | 4-OCH 3 | |
Ia.288 | CF 3 | H | 2-OCF 3 | The 3-fluorine | 4-OCH 3 | |
Ia.289 | CF 3 | H | 2-OCF 3 | 3-chlorine | 4-OCH 3 | |
Ia.290 | CF 3 | H | 2-OCF 3 | 3-CN | 4-OCH 3 | |
Ia.291 | CF 3 | H | 2-OCF 3 | The 3-methyl | 4-OCH 3 |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.292 | CF 3 | H | 2-OCF 3 | 3-CF 3 | 4-OCH 3 | |
Ia.293 | CF 3 | H | 2-OCF 3 | 3-OCH 3 | 4-OCH 3 | |
Ia.294 | CF 3 | H | 2-OCF 3 | 3-OCF 3 | 4-OCH 3 | |
Ia.295 | CF 3 | H | The 2-fluorine | The 3-fluorine | 4-OCF 3 | |
Ia.296 | CF 3 | H | The 2-fluorine | 3-chlorine | 4-OCF 3 | |
Ia.297 | CF 3 | H | The 2-fluorine | 3-CN | 4-OCF 3 | |
Ia.298 | CF 3 | H | The 2-fluorine | The 3-methyl | 4-OCF 3 | |
Ia.299 | CF 3 | H | The 2-fluorine | 3-CF 3 | 4-OCF 3 | |
Ia.300 | CF 3 | H | The 2-fluorine | 3-OCH 3 | 4-OCF 3 | |
Ia.301 | CF 3 | H | The 2-fluorine | 3-OCF 3 | 4-OCF 3 | |
Ia.302 | CF 3 | H | 2-chlorine | The 3-fluorine | 4-OCF 3 | |
Ia.303 | CF 3 | H | 2-chlorine | 3-chlorine | 4-OCF 3 | |
Ia.304 | CF 3 | H | 2-chlorine | 3-CN | 4-OCF 3 | |
Ia.305 | CF 3 | H | 2-chlorine | The 3-methyl | 4-OCF 3 | |
Ia.306 | CF 3 | H | 2-chlorine | 3-CF 3 | 4-OCF 3 | |
Ia.307 | CF 3 | H | 2-chlorine | 3-OCH 3 | 4-OCF 3 | |
Ia.308 | CF 3 | H | 2-chlorine | 3-OCF 3 | 4-OCF 3 | |
Ia.309 | CF 3 | H | 2-CN | The 3-fluorine | 4-OCF 3 | |
Ia.310 | CF 3 | H | 2-CN | 3-chlorine | 4-OCF 3 | |
Ia.311 | CF 3 | H | 2-CN | 3-CN | 4-OCF 3 | |
Ia.312 | CF 3 | H | 2-CN | The 3-methyl | 4-OCF 3 | |
Ia.313 | CF 3 | H | 2-CN | 3-CF 3 | 4-OCF 3 | |
Ia.314 | CF 3 | H | 2-CN | 3-OCH 3 | 4-OCF 3 | |
Ia.315 | CF 3 | H | 2-CN | 3-OCF 3 | 4-OCF 3 | |
Ia.316 | CF 3 | H | The 2-methyl | The 3-fluorine | 4-OCF 3 | |
Ia.317 | CF 3 | H | The 2-methyl | 3-chlorine | 4-OCF 3 | |
Ia.318 | CF 3 | H | The 2-methyl | 3-CN | 4-OCF 3 | |
Ia.319 | CF 3 | H | The 2-methyl | The 3-methyl | 4-OCF 3 | |
Ia.320 | CF 3 | H | The 2-methyl | 3-CF 3 | 4-OCF 3 | |
Ia.321 | CF 3 | H | The 2-methyl | 3-OCH 3 | 4-OCF 3 | |
Ia.322 | CF 3 | H | The 2-methyl | 3-OCF 3 | 4-OCF 3 | |
Ia.323 | CF 3 | H | 2-CF 3 | The 3-fluorine | 4-OCF 3 | |
Ia.324 | CF 3 | H | 2-CF 3 | 3-chlorine | 4-OCF 3 | |
Ia.325 | CF 3 | H | 2-CF 3 | 3-CN | 4-OCF 3 | |
Ia.326 | CF 3 | H | 2-CF 3 | The 3-methyl | 4-OCF 3 |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.327 | CF 3 | H | 2-CF 3 | 3-CF 3 | 4-OCF 3 | |
Ia.328 | CF 3 | H | 2-CF 3 | 3-OCH 3 | 4-OCF 3 | |
Ia.329 | CF 3 | H | 2-CF 3 | 3-OCF 3 | 4-OCF 3 | |
Ia.330 | CF 3 | H | 2-OCH 3 | The 3-fluorine | 4-OCF 3 | |
Ia.331 | CF 3 | H | 2-OCH 3 | 3-chlorine | 4-OCF 3 | |
Ia.332 | CF 3 | H | 2-OCH 3 | 3-CN | 4-OCF 3 | |
Ia.333 | CF 3 | H | 2-OCH 3 | The 3-methyl | 4-OCF 3 | |
Ia.334 | CF 3 | H | 2-OCH 3 | 3-CF 3 | 4-OCF 3 | |
Ia.335 | CF 3 | H | 2-OCH 3 | 3-OCH 3 | 4-OCF 3 | |
Ia.336 | CF 3 | H | 2-OCH 3 | 3-OCF 3 | 4-OCF 3 | |
Ia.337 | CF 3 | H | 2-OCF 3 | The 3-fluorine | 4-OCF 3 | |
Ia.338 | CF 3 | H | 2-OCF 3 | 3-chlorine | 4-OCF 3 | |
Ia.339 | CF 3 | H | 2-OCF 3 | 3-CN | 4-OCF 3 | |
Ia.340 | CF 3 | H | 2-OCF 3 | The 3-methyl | 4-OCF 3 | |
Ia.341 | CF 3 | H | 2-OCF 3 | 3-CF 3 | 4-OCF 3 | |
Ia.342 | CF 3 | H | 2-OCF 3 | 3-OCH 3 | 4-OCF 3 | |
Ia.343 | CF 3 | H | 2-OCF 3 | 3-OCF 3 | 4-OCF 3 | |
Ia.344 | CF 3 | H | The 3-fluorine | The 4-fluorine | The 5-fluorine | 120-124 |
Ia.345 | CF 3 | H | 3-chlorine | The 4-fluorine | The 5-fluorine | |
Ia.346 | CF 3 | H | 3-CN | The 4-fluorine | The 5-fluorine | |
Ia.347 | CF 3 | H | 3-CH 3 | The 4-fluorine | The 5-fluorine | |
Ia.348 | CF 3 | H | 3-CF 3 | The 4-fluorine | The 5-fluorine | |
Ia.349 | CF 3 | H | 3-OCH 3 | The 4-fluorine | The 5-fluorine | |
Ia.350 | CF 3 | H | 3-OCF 3 | The 4-fluorine | The 5-fluorine | |
Ia.351 | CF 3 | H | The 3-fluorine | The 4-fluorine | 5-chlorine | |
Ia.352 | CF 3 | H | 3-chlorine | The 4-fluorine | 5-chlorine | |
Ia.353 | CF 3 | H | 3-CN | The 4-fluorine | 5-chlorine | |
Ia.354 | CF 3 | H | 3-CH 3 | The 4-fluorine | 5-chlorine | |
Ia.355 | CF 3 | H | 3-CF 3 | The 4-fluorine | 5-chlorine | |
Ia.356 | CF 3 | H | 3-OCH 3 | The 4-fluorine | 5-chlorine | |
Ia.357 | CF 3 | H | 3-OCF 3 | The 4-fluorine | 5-chlorine | |
Ia.358 | CF 3 | H | The 3-fluorine | The 4-fluorine | 5-CN | |
Ia.359 | CF 3 | H | 3-chlorine | The 4-fluorine | 5-CN | |
Ia.360 | CF 3 | H | 3-CN | The 4-fluorine | 5-CN | |
Ia.361 | CF 3 | H | 3-CH 3 | The 4-fluorine | 5-CN |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.362 | CF 3 | H | 3-CF 3 | The 4-fluorine | 5-CN | |
Ia.363 | CF 3 | H | 3-OCH 3 | The 4-fluorine | 5-CN | |
Ia.364 | CF 3 | H | 3-OCF 3 | The 4-fluorine | 5-CN | |
Ia.365 | CF 3 | H | The 3-fluorine | The 4-fluorine | 5-CH 3 | |
Ia.366 | CF 3 | H | 3-chlorine | The 4-fluorine | 5-CH 3 | |
Ia.367 | CF 3 | H | 3-CN | The 4-fluorine | 5-CH 3 | |
Ia.368 | CF 3 | H | 3-CH 3 | The 4-fluorine | 5-CH 3 | |
Ia.369 | CF 3 | H | 3-CF 3 | The 4-fluorine | 5-CH 3 | |
Ia.370 | CF 3 | H | 3-OCH 3 | The 4-fluorine | 5-CH 3 | |
Ia.371 | CF 3 | H | 3-OCF 3 | The 4-fluorine | 5-CH 3 | |
Ia.372 | CF 3 | H | The 3-fluorine | The 4-fluorine | 5-CF 3 | |
Ia.373 | CF 3 | H | 3-chlorine | The 4-fluorine | 5-CF 3 | |
Ia.374 | CF 3 | H | 3-CN | The 4-fluorine | 5-CF 3 | |
Ia.375 | CF 3 | H | 3-CH 3 | The 4-fluorine | 5-CF 3 | |
Ia.376 | CF 3 | H | 3-CF 3 | The 4-fluorine | 5-CF 3 | |
Ia.377 | CF 3 | H | 3-OCH 3 | The 4-fluorine | 5-CF 3 | |
Ia.378 | CF 3 | H | 3-OCF 3 | The 4-fluorine | 5-CF 3 | |
Ia.379 | CF 3 | H | The 3-fluorine | The 4-fluorine | 5-OCH 3 | |
Ia.380 | CF 3 | H | 3-chlorine | The 4-fluorine | 5-OCH 3 | |
Ia.381 | CF 3 | H | 3-CN | The 4-fluorine | 5-OCH 3 | |
Ia.382 | CF 3 | H | 3-CH 3 | The 4-fluorine | 5-OCH 3 | |
Ia.383 | CF 3 | H | 3-CF 3 | The 4-fluorine | 5-OCH 3 | |
Ia.384 | CF 3 | H | 3-OCH 3 | The 4-fluorine | 5-OCH 3 | |
Ia.385 | CF 3 | H | 3-OCF 3 | The 4-fluorine | 5-OCH 3 | |
Ia.386 | CF 3 | H | The 3-fluorine | The 4-fluorine | 5-OCF 3 | |
Ia.387 | CF 3 | H | 3-chlorine | The 4-fluorine | 5-OCF 3 | |
Ia.388 | CF 3 | H | 3-CN | The 4-fluorine | 5-OCF 3 | |
Ia.389 | CF 3 | H | 3-CH 3 | The 4-fluorine | 5-OCF 3 | |
Ia.390 | CF 3 | H | 3-CF 3 | The 4-fluorine | 5-OCF 3 | |
Ia.391 | CF 3 | H | 3-OCH 3 | The 4-fluorine | 5-OCF 3 | |
Ia.392 | CF 3 | H | 3-OCF 3 | The 4-fluorine | 5-OCF 3 | |
Ia.393 | CF 3 | H | The 3-fluorine | 4-chlorine | The 5-fluorine | |
Ia.394 | CF 3 | H | 3-chlorine | 4-chlorine | The 5-fluorine | |
Ia.395 | CF 3 | H | 3-CN | 4-chlorine | The 5-fluorine |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.396 | CF 3 | H | 3-CH 3 | 4-chlorine | The 5-fluorine | |
Ia.397 | CF 3 | H | 3-CF 3 | 4-chlorine | The 5-fluorine | |
Ia.398 | CF 3 | H | 3-OCH 3 | 4-chlorine | The 5-fluorine | |
Ia.399 | CF 3 | H | 3-OCF 3 | 4-chlorine | The 5-fluorine | |
Ia.400 | CF 3 | H | The 3-fluorine | 4-chlorine | 5-chlorine | |
Ia.401 | CF 3 | H | 3-chlorine | 4-chlorine | 5-chlorine | |
Ia.402 | CF 3 | H | 3-CN | 4-chlorine | 5-chlorine | |
Ia.403 | CF 3 | H | 3-CH 3 | 4-chlorine | 5-chlorine | |
Ia.404 | CF 3 | H | 3-CF 3 | 4-chlorine | 5-chlorine | |
Ia.405 | CF 3 | H | 3-OCH 3 | 4-chlorine | 5-chlorine | |
Ia.406 | CF 3 | H | 3-OCF 3 | 4-chlorine | 5-chlorine | |
Ia.407 | CF 3 | H | The 3-fluorine | 4-chlorine | 5-CN | |
Ia.408 | CF 3 | H | 3-chlorine | 4-chlorine | 5-CN | |
Ia.409 | CF 3 | H | 3-CN | 4-chlorine | 5-CN | |
Ia.410 | CF 3 | H | 3-CH 3 | 4-chlorine | 5-CN | |
Ia.411 | CF 3 | H | 3-CF 3 | 4-chlorine | 5-CN | |
Ia.412 | CF 3 | H | 3-OCH 3 | 4-chlorine | 5-CN | |
Ia.413 | CF 3 | H | 3-OCF 3 | 4-chlorine | 5-CN | |
Ia.414 | CF 3 | H | The 3-fluorine | 4-chlorine | 5-CH 3 | |
Ia.415 | CF 3 | H | 3-chlorine | 4-chlorine | 5-CH 3 | |
Ia.416 | CF 3 | H | 3-CN | 4-chlorine | 5-CH 3 | |
Ia.417 | CF 3 | H | 3-CH 3 | 4-chlorine | 5-CH 3 | |
Ia.418 | CF 3 | H | 3-CF 3 | 4-chlorine | 5-CH 3 | |
Ia.419 | CF 3 | H | 3-OCH 3 | 4-chlorine | 5-CH 3 | |
Ia.420 | CF 3 | H | 3-OCF 3 | 4-chlorine | 5-CH 3 | |
Ia.421 | CF 3 | H | The 3-fluorine | 4-chlorine | 5-CF 3 | |
Ia.422 | CF 3 | H | 3-chlorine | 4-chlorine | 5-CF 3 | |
Ia.423 | CF 3 | H | 3-CN | 4-chlorine | 5-CF 3 | |
Ia.424 | CF 3 | H | 3-CH 3 | 4-chlorine | 5-CF 3 | |
Ia.425 | CF 3 | H | 3-CF 3 | 4-chlorine | 5-CF 3 | |
Ia.426 | CF 3 | H | 3-OCH 3 | 4-chlorine | 5-CF 3 | |
Ia.427 | CF 3 | H | 3-OCF 3 | 4-chlorine | 5-CF 3 | |
Ia.428 | CF 3 | H | The 3-fluorine | 4-chlorine | 5-OCH 3 | |
Ia.429 | CF 3 | H | 3-chlorine | 4-chlorine | 5-OCH 3 |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.430 | CF 3 | H | 3-CN | 4-chlorine | 5-OCH 3 | |
Ia.431 | CF 3 | H | 3-CH 3 | 4-chlorine | 5-OCH 3 | |
Ia.432 | CF 3 | H | 3-CF 3 | 4-chlorine | 5-OCH 3 | |
Ia.433 | CF 3 | H | 3-OCH 3 | 4-chlorine | 5-OCH 3 | |
Ia.434 | CF 3 | H | 3-OCF 3 | 4-chlorine | 5-OCH 3 | |
Ia.435 | CF 3 | H | The 3-fluorine | 4-chlorine | 5-OCF 3 | |
Ia.436 | CF 3 | H | 3-chlorine | 4-chlorine | 5-OCF 3 | |
Ia.437 | CF 3 | H | 3-CN | 4-chlorine | 5-OCF 3 | |
Ia.438 | CF 3 | H | 3-CH 3 | 4-chlorine | 5-OCF 3 | |
Ia.439 | CF 3 | H | 3-CF 3 | 4-chlorine | 5-OCF 3 | |
Ia.440 | CF 3 | H | 3-OCH 3 | 4-chlorine | 5-OCF 3 | |
Ia.441 | CF 3 | H | 3-OCF 3 | 4-chlorine | 5-OCF 3 | |
Ia.442 | CF 3 | H | The 3-fluorine | 4-CN | The 5-fluorine | |
Ia.443 | CF 3 | H | 3-chlorine | 4-CN | The 5-fluorine | |
Ia.444 | CF 3 | H | 3-CN | 4-CN | The 5-fluorine | |
Ia.445 | CF 3 | H | 3-CH 3 | 4-CN | The 5-fluorine | |
Ia.446 | CF 3 | H | 3-CF 3 | 4-CN | The 5-fluorine | |
Ia.447 | CF 3 | H | 3-OCH 3 | 4-CN | The 5-fluorine | |
Ia.448 | CF 3 | H | 3-OCF 3 | 4-CN | The 5-fluorine | |
Ia.449 | CF 3 | H | The 3-fluorine | 4-CN | 5-chlorine | |
Ia.450 | CF 3 | H | 3-chlorine | 4-CN | 5-chlorine | |
Ia.451 | CF 3 | H | 3-CN | 4-CN | 5-chlorine | |
Ia.452 | CF 3 | H | 3-CH 3 | 4-CN | 5-chlorine | |
Ia.453 | CF 3 | H | 3-CF 3 | 4-CN | 5-chlorine | |
Ia.454 | CF 3 | H | 3-OCH 3 | 4-CN | 5-chlorine | |
Ia.455 | CF 3 | H | 3-OCF 3 | 4-CN | 5-chlorine | |
Ia.456 | CF 3 | H | The 3-fluorine | 4-CN | 5-CN | |
Ia.457 | CF 3 | H | 3-chlorine | 4-CN | 5-CN | |
Ia.458 | CF 3 | H | 3-CN | 4-CN | 5-CN | |
Ia.459 | CF 3 | H | 3-CH 3 | 4-CN | 5-CN | |
Ia.460 | CF 3 | H | 3-CF 3 | 4-CN | 5-CN | |
Ia.461 | CF 3 | H | 3-OCH 3 | 4-CN | 5-CN | |
Ia.462 | CF 3 | H | 3-OCF 3 | 4-CN | 5-CN | |
Ia.463 | CF 3 | H | The 3-fluorine | 4-CN | 5-CH 3 | |
Ia.464 | CF 3 | H | 3-chlorine | 4-CN | 5-CH 3 |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.465 | CF 3 | H | 3-CN | 4-CN | 5-CH 3 | |
Ia.466 | CF 3 | H | 3-CH 3 | 4-CN | 5-CH 3 | |
Ia.467 | CF 3 | H | 3-CF 3 | 4-CN | 5-CH 3 | |
Ia.468 | CF 3 | H | 3-OCH 3 | 4-CN | 5-CH 3 | |
Ia.469 | CF 3 | H | 3-OCF 3 | 4-CN | 5-CH 3 | |
Ia.470 | CF 3 | H | The 3-fluorine | 4-CN | 5-CF 3 | |
Ia.471 | CF 3 | H | 3-chlorine | 4-CN | 5-CF 3 | |
Ia.472 | CF 3 | H | 3-CN | 4-CN | 5-CF 3 | |
Ia.473 | CF 3 | H | 3-CH 3 | 4-CN | 5-CF 3 | |
Ia.474 | CF 3 | H | 3-CF 3 | 4-CN | 5-CF 3 | |
Ia.475 | CF 3 | H | 3-OCH 3 | 4-CN | 5-CF 3 | |
Ia.476 | CF 3 | H | 3-OCF 3 | 4-CN | 5-CF 3 | |
Ia.477 | CF 3 | H | The 3-fluorine | 4-CN | 5-OCH 3 | |
Ia.478 | CF 3 | H | 3-chlorine | 4-CN | 5-OCH 3 | |
Ia.479 | CF 3 | H | 3-CN | 4-CN | 5-OCH 3 | |
Ia.480 | CF 3 | H | 3-CH 3 | 4-CN | 5-OCH 3 | |
Ia.481 | CF 3 | H | 3-CF 3 | 4-CN | 5-OCH 3 | |
Ia.482 | CF 3 | H | 3-OCH 3 | 4-CN | 5-OCH 3 | |
Ia.483 | CF 3 | H | 3-OCF 3 | 4-CN | 5-OCH 3 | |
Ia.484 | CF 3 | H | The 3-fluorine | 4-CN | 5-OCF 3 | |
Ia.485 | CF 3 | H | 3-chlorine | 4-CN | 5-OCF 3 | |
Ia.486 | CF 3 | H | 3-CN | 4-CN | 5-OCF 3 | |
Ia.487 | CF 3 | H | 3-CH 3 | 4-CN | 5-OCF 3 | |
Ia.488 | CF 3 | H | 3-CF 3 | 4-CN | 5-OCF 3 | |
Ia.489 | CF 3 | H | 3-OCH 3 | 4-CN | 5-OCF 3 | |
Ia.490 | CF 3 | H | 3-OCF 3 | 4-CN | 5-OCF 3 | |
Ia.491 | CF 3 | H | The 3-fluorine | 4-CH 3 | The 5-fluorine | |
Ia.492 | CF 3 | H | 3-chlorine | 4-CH 3 | The 5-fluorine | |
Ia.493 | CF 3 | H | 3-CN | 4-CH 3 | The 5-fluorine | |
Ia.494 | CF 3 | H | 3-CH 3 | 4-CH 3 | The 5-fluorine | |
Ia.495 | CF 3 | H | 3-CF 3 | 4-CH 3 | The 5-fluorine | |
Ia.496 | CF 3 | H | 3-OCH 3 | 4-CH 3 | The 5-fluorine | |
Ia.497 | CF 3 | H | 3-OCF 3 | 4-CH 3 | The 5-fluorine | |
Ia.498 | CF 3 | H | The 3-fluorine | 4-CH 3 | 5-chlorine | |
Ia.499 | CF 3 | H | 3-chlorine | 4-CH 3 | 5-chlorine | |
Ia.500 | CF 3 | H | 3-CN | 4-CH 3 | 5-chlorine |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.501 | CF 3 | H | 3-CH 3 | 4-CH 3 | 5-chlorine | |
Ia.502 | CF 3 | H | 3-CF 3 | 4-CH 3 | 5-chlorine | |
Ia.503 | CF 3 | H | 3-OCH 3 | 4-CH 3 | 5-chlorine | |
Ia.504 | CF 3 | H | 3-OCF 3 | 4-CH 3 | 5-chlorine | |
Ia.505 | CF 3 | H | The 3-fluorine | 4-CH 3 | 5-CN | |
Ia.506 | CF 3 | H | 3-chlorine | 4-CH 3 | 5-CN | |
Ia.507 | CF 3 | H | 3-CN | 4-CH 3 | 5-CN | |
Ia.508 | CF 3 | H | 3-CH 3 | 4-CH 3 | 5-CN | |
Ia.509 | CF 3 | H | 3-CF 3 | 4-CH 3 | 5-CN | |
Ia.510 | CF 3 | H | 3-OCH 3 | 4-CH 3 | 5-CN | |
Ia.511 | CF 3 | H | 3-OCF 3 | 4-CH 3 | 5-CN | |
Ia.512 | CF 3 | H | The 3-fluorine | 4-CH 3 | 5-CH 3 | |
Ia.513 | CF 3 | H | 3-chlorine | 4-CH 3 | 5-CH 3 | |
Ia.514 | CF 3 | H | 3-CN | 4-CH 3 | 5-CH 3 | |
Ia.515 | CF 3 | H | 3-CH 3 | 4-CH 3 | 5-CH 3 | |
Ia.516 | CF 3 | H | 3-CF 3 | 4-CH 3 | 5-CH 3 | |
Ia.517 | CF 3 | H | 3-OCH 3 | 4-CH 3 | 5-CH 3 | |
Ia.518 | CF 3 | H | 3-OCF 3 | 4-CH 3 | 5-CH 3 | |
Ia.519 | CF 3 | H | The 3-fluorine | 4-CH 3 | 5-CF 3 | |
Ia.520 | CF 3 | H | 3-chlorine | 4-CH 3 | 5-CF 3 | |
Ia.521 | CF 3 | H | 3-CN | 4-CH 3 | 5-CF 3 | |
Ia.522 | CF 3 | H | 3-CH 3 | 4-CH 3 | 5-CF 3 | |
Ia.523 | CF 3 | H | 3-CF 3 | 4-CH 3 | 5-CF 3 | |
Ia.524 | CF 3 | H | 3-OCH 3 | 4-CH 3 | 5-CF 3 | |
Ia.525 | CF 3 | H | 3-OCF 3 | 4-CH 3 | 5-CF 3 | |
Ia.526 | CF 3 | H | The 3-fluorine | 4-CH 3 | 5-OCH 3 | |
Ia.527 | CF 3 | H | 3-chlorine | 4-CH 3 | 5-OCH 3 | |
Ia.528 | CF 3 | H | 3-CN | 4-CH 3 | 5-OCH 3 | |
Ia.529 | CF 3 | H | 3-CH 3 | 4-CH 3 | 5-OCH 3 | |
Ia.530 | CF 3 | H | 3-CF 3 | 4-CH 3 | 5-OCH 3 | |
Ia.531 | CF 3 | H | 3-OCH 3 | 4-CH 3 | 5-OCH 3 | |
Ia.532 | CF 3 | H | 3-OCF 3 | 4-CH 3 | 5-OCH 3 | |
Ia.533 | CF 3 | H | The 3-fluorine | 4-CH 3 | 5-OCF 3 | |
Ia.534 | CF 3 | H | 3-chlorine | 4-CH 3 | 5-OCF 3 | |
Ia.535 | CF 3 | H | 3-CN | 4-CH 3 | 5-OCF 3 | |
Ia.536 | CF 3 | H | 3-CH 3 | 4-CH 3 | 5-OCF 3 |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.537 | CF 3 | H | 3-CF 3 | 4-CH 3 | 5-OCF 3 | |
Ia.538 | CF 3 | H | 3-OCH 3 | 4-CH 3 | 5-OCF 3 | |
Ia.539 | CF 3 | H | 3-OCF 3 | 4-CH 3 | 5-OCF 3 | |
Ia.540 | CF 3 | H | The 3-fluorine | 4-CF 3 | The 5-fluorine | |
Ia.541 | CF 3 | H | 3-chlorine | 4-CF 3 | The 5-fluorine | |
Ia.542 | CF 3 | H | 3-CN | 4-CF 3 | The 5-fluorine | |
Ia.543 | CF 3 | H | 3-CH 3 | 4-CF 3 | The 5-fluorine | |
Ia.544 | CF 3 | H | 3-CF 3 | 4-CF 3 | The 5-fluorine | |
Ia.545 | CF 3 | H | 3-OCH 3 | 4-CF 3 | The 5-fluorine | |
Ia.546 | CF 3 | H | 3-OCF 3 | 4-CF 3 | The 5-fluorine | |
Ia.547 | CF 3 | H | The 3-fluorine | 4-CF 3 | 5-chlorine | |
Ia.548 | CF 3 | H | 3-chlorine | 4-CF 3 | 5-chlorine | |
Ia.549 | CF 3 | H | 3-CN | 4-CF 3 | 5-chlorine | |
Ia.550 | CF 3 | H | 3-CH 3 | 4-CF 3 | 5-chlorine | |
Ia.551 | CF 3 | H | 3-CF 3 | 4-CF 3 | 5-chlorine | |
Ia.552 | CF 3 | H | 3-OCH 3 | 4-CF 3 | 5-chlorine | |
Ia.553 | CF 3 | H | 3-OCF 3 | 4-CF 3 | 5-chlorine | |
Ia.554 | CF 3 | H | The 3-fluorine | 4-CF 3 | 5-CN | |
Ia.555 | CF 3 | H | 3-chlorine | 4-CF 3 | 5-CN | |
Ia.556 | CF 3 | H | 3-CN | 4-CF 3 | 5-CN | |
Ia.557 | CF 3 | H | 3-CH 3 | 4-CF 3 | 5-CN | |
Ia.558 | CF 3 | H | 3-CF 3 | 4-CF 3 | 5-CN | |
Ia.559 | CF 3 | H | 3-OCH 3 | 4-CF 3 | 5-CN | |
Ia.560 | CF 3 | H | 3-OCF 3 | 4-CF 3 | 5-CN | |
Ia.561 | CF 3 | H | The 3-fluorine | 4-CF 3 | 5-CH 3 | |
Ia.562 | CF 3 | H | 3-chlorine | 4-CF 3 | 5-CH 3 | |
Ia.563 | CF 3 | H | 3-CN | 4-CF 3 | 5-CH 3 | |
Ia.564 | CF 3 | H | 3-CH 3 | 4-CF 3 | 5-CH 3 | |
Ia.565 | CF 3 | H | 3-CF 3 | 4-CF 3 | 5-CH 3 | |
Ia.566 | CF 3 | H | 3-OCH 3 | 4-CF 3 | 5-CH 3 | |
Ia.567 | CF 3 | H | 3-OCF 3 | 4-CF 3 | 5-CH 3 | |
Ia.568 | CF 3 | H | The 3-fluorine | 4-CF 3 | 5-CF 3 | |
Ia.569 | CF 3 | H | 3-chlorine | 4-CF 3 | 5-CF 3 | |
Ia.570 | CF 3 | H | 3-CN | 4-CF 3 | 5-CF 3 | |
Ia.571 | CF 3 | H | 3-CH 3 | 4-CF 3 | 5-CF 3 | |
Ia.572 | CF 3 | H | 3-CF 3 | 4-CF 3 | 5-CF 3 |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.573 | CF 3 | H | 3-OCH 3 | 4-CF 3 | 5-CF 3 | |
Ia.574 | CF 3 | H | 3-OCF 3 | 4-CF 3 | 5-CF 3 | |
Ia.575 | CF 3 | H | The 3-fluorine | 4-CF 3 | 5-OCH 3 | |
Ia.576 | CF 3 | H | 3-chlorine | 4-CF 3 | 5-OCH 3 | |
Ia.577 | CF 3 | H | 3-CN | 4-CF 3 | 5-OCH 3 | |
Ia.578 | CF 3 | H | 3-CH 3 | 4-CF 3 | 5-OCH 3 | |
Ia.579 | CF 3 | H | 3-CF 3 | 4-CF 3 | 5-OCH 3 | |
Ia.560 | CF 3 | H | 3-OCH 3 | 4-CF 3 | 5-OCH 3 | |
Ia.561 | CF 3 | H | 3-OCF 3 | 4-CF 3 | 5-OCH 3 | |
Ia.562 | CF 3 | H | The 3-fluorine | 4-CF 3 | 5-OCF 3 | |
Ia.563 | CF 3 | H | 3-chlorine | 4-CF 3 | 5-OCF 3 | |
Ia.564 | CF 3 | H | 3-CN | 4-CF 3 | 5-OCF 3 | |
Ia.565 | CF 3 | H | 3-CH 3 | 4-CF 3 | 5-OCF 3 | |
Ia.566 | CF 3 | H | 3-CF 3 | 4-CF 3 | 5-OCF 3 | |
Ia.567 | CF 3 | H | 3-OCH 3 | 4-CF 3 | 5-OCF 3 | |
Ia.568 | CF 3 | H | 3-OCF 3 | 4-CF 3 | 5-OCF 3 | |
Ia.569 | CF 3 | H | The 3-fluorine | 4-OCH 3 | The 5-fluorine | |
Ia.570 | CF 3 | H | 3-chlorine | 4-OCH 3 | The 5-fluorine | |
Ia.571 | CF 3 | H | 3-CN | 4-OCH 3 | The 5-fluorine | |
Ia.572 | CF 3 | H | 3-CH 3 | 4-OCH 3 | The 5-fluorine | |
Ia.573 | CF 3 | H | 3-CF 3 | 4-OCH 3 | The 5-fluorine | |
Ia.574 | CF 3 | H | 3-OCH 3 | 4-OCH 3 | The 5-fluorine | |
Ia.575 | CF 3 | H | 3-OCF 3 | 4-OCH 3 | The 5-fluorine | |
Ia.576 | CF 3 | H | The 3-fluorine | 4-OCH 3 | 5-chlorine | |
Ia.577 | CF 3 | H | 3-chlorine | 4-OCH 3 | 5-chlorine | |
Ia.578 | CF 3 | H | 3-CN | 4-OCH 3 | 5-chlorine | |
Ia.579 | CF 3 | H | 3-CH 3 | 4-OCH 3 | 5-chlorine | |
Ia.580 | CF 3 | H | 3-CF 3 | 4-OCH 3 | 5-chlorine | |
Ia.581 | CF 3 | H | 3-OCH 3 | 4-OCH 3 | 5-chlorine | |
Ia.582 | CF 3 | H | 3-OCF 3 | 4-OCH 3 | 5-chlorine | |
Ia.583 | CF 3 | H | The 3-fluorine | 4-OCH 3 | 5-CN | |
Ia.584 | CF 3 | H | 3-chlorine | 4-OCH 3 | 5-CN | |
Ia.585 | CF 3 | H | 3-CN | 4-OCH 3 | 5-CN | |
Ia.586 | CF 3 | H | 3-CH 3 | 4-OCH 3 | 5-CN | |
Ia.587 | CF 3 | H | 3-CF 3 | 4-OCH 3 | 5-CN | |
Ia.588 | CF 3 | H | 3-OCH 3 | 4-OCH 3 | 5-CN |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.589 | CF 3 | H | 3-OCF 3 | 4-OCH 3 | 5-CN | |
Ia.590 | CF 3 | H | The 3-fluorine | 4-OCH 3 | 5-CH 3 | |
Ia.591 | CF 3 | H | 3-chlorine | 4-OCH 3 | 5-CH 3 | |
Ia.592 | CF 3 | H | 3-CN | 4-OCH 3 | 5-CH 3 | |
Ia.593 | CF 3 | H | 3-CH 3 | 4-OCH 3 | 5-CH 3 | |
Ia.594 | CF 3 | H | 3-CF 3 | 4-OCH 3 | 5-CH 3 | |
Ia.595 | CF 3 | H | 3-OCH 3 | 4-OCH 3 | 5-CH 3 | |
Ia.596 | CF 3 | H | 3-OCF 3 | 4-OCH 3 | 5-CH 3 | |
Ia.597 | CF 3 | H | The 3-fluorine | 4-OCH 3 | 5-CF 3 | |
Ia.598 | CF 3 | H | 3-chlorine | 4-OCH 3 | 5-CF 3 | |
Ia.599 | CF 3 | H | 3-CN | 4-OCH 3 | 5-CF 3 | |
Ia.600 | CF 3 | H | 3-CH 3 | 4-OCH 3 | 5-CF 3 | |
Ia.601 | CF 3 | H | 3-CF 3 | 4-OCH 3 | 5-CF 3 | |
Ia.602 | CF 3 | H | 3-OCH 3 | 4-OCH 3 | 5-CF 3 | |
Ia.603 | CF 3 | H | 3-OCF 3 | 4-OCH 3 | 5-CF 3 | |
Ia.604 | CF 3 | H | The 3-fluorine | 4-OCH 3 | 5-OCH 3 | |
Ia.605 | CF 3 | H | 3-chlorine | 4-OCH 3 | 5-OCH 3 | |
Ia.606 | CF 3 | H | 3-CN | 4-OCH 3 | 5-OCH 3 | |
Ia.607 | CF 3 | H | 3-CH 3 | 4-OCH 3 | 5-OCH 3 | |
Ia.608 | CF 3 | H | 3-CF 3 | 4-OCH 3 | 5-OCH 3 | |
Ia.609 | CF 3 | H | 3-OCH 3 | 4-OCH 3 | 5-OCH 3 | |
Ia.610 | CF 3 | H | 3-OCF 3 | 4-OCH 3 | 5-OCH 3 | |
Ia.611 | CF 3 | H | The 3-fluorine | 4-OCH 3 | 5-OCF 3 | |
Ia.612 | CF 3 | H | 3-chlorine | 4-OCH 3 | 5-OCF 3 | |
Ia.613 | CF 3 | H | 3-CN | 4-OCH 3 | 5-OCF 3 | |
Ia.614 | CF 3 | H | 3-CH 3 | 4-OCH 3 | 5-OCF 3 | |
Ia.615 | CF 3 | H | 3-CF 3 | 4-OCH 3 | 5-OCF 3 | |
Ia.616 | CF 3 | H | 3-OCH 3 | 4-OCH 3 | 5-OCF 3 | |
Ia.617 | CF 3 | H | 3-OCF 3 | 4-OCH 3 | 5-OCF 3 | |
Ia.618 | CF 3 | H | The 3-fluorine | 4-OCF 3 | The 5-fluorine | |
Ia.619 | CF 3 | H | 3-chlorine | 4-OCF 3 | The 5-fluorine | |
Ia.620 | CF 3 | H | 3-CN | 4-OCF 3 | The 5-fluorine | |
Ia.621 | CF 3 | H | 3-CH 3 | 4-OCF 3 | The 5-fluorine | |
Ia.622 | CF 3 | H | 3-CF 3 | 4-OCF 3 | The 5-fluorine | |
Ia.623 | CF 3 | H | 3-OCH 3 | 4-OCF 3 | The 5-fluorine | |
Ia.624 | CF 3 | H | 3-OCF 3 | 4-OCF 3 | The 5-fluorine |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.625 | CF 3 | H | The 3-fluorine | 4-OCF 3 | 5-chlorine | |
Ia.626 | CF 3 | H | 3-chlorine | 4-OCF 3 | 5-chlorine | |
Ia.627 | CF 3 | H | 3-CN | 4-OCF 3 | 5-chlorine | |
Ia.628 | CF 3 | H | 3-CH 3 | 4-OCF 3 | 5-chlorine | |
Ia.629 | CF 3 | H | 3-CF 3 | 4-OCF 3 | 5-chlorine | |
Ia.630 | CF 3 | H | 3-OCH 3 | 4-OCF 3 | 5-chlorine | |
Ia.631 | CF 3 | H | 3-OCF 3 | 4-OCF 3 | 5-chlorine | |
Ia.632 | CF 3 | H | The 3-fluorine | 4-OCF 3 | 5-CN | |
Ia.633 | CF 3 | H | 3-chlorine | 4-OCF 3 | 5-CN | |
Ia.634 | CF 3 | H | 3-CN | 4-OCF 3 | 5-CN | |
Ia.635 | CF 3 | H | 3-CH 3 | 4-OCF 3 | 5-CN | |
Ia.636 | CF 3 | H | 3-CF 3 | 4-OCF 3 | 5-CN | |
Ia.637 | CF 3 | H | 3-OCH 3 | 4-OCF 3 | 5-CN | |
Ia.638 | CF 3 | H | 3-OCF 3 | 4-OCF 3 | 5-CN | |
Ia.639 | CF 3 | H | The 3-fluorine | 4-OCF 3 | 5-CH 3 | |
Ia.640 | CF 3 | H | 3-chlorine | 4-OCF 3 | 5-CH 3 | |
Ia.641 | CF 3 | H | 3-CN | 4-OCF 3 | 5-CH 3 | |
Ia.642 | CF 3 | H | 3-CH 3 | 4-OCF 3 | 5-CH 3 | |
Ia.643 | CF 3 | H | 3-CF3 | 4-OCF 3 | 5-CH 3 | |
Ia.644 | CF 3 | H | 3-OCH 3 | 4-OCF 3 | 5-CH 3 | |
Ia.645 | CF 3 | H | 3-OCF 3 | 4-OCF 3 | 5-CH 3 | |
Ia.646 | CF 3 | H | The 3-fluorine | 4-OCF 3 | 5-CF 3 | |
Ia.647 | CF 3 | H | 3-chlorine | 4-OCF 3 | 5-CF 3 | |
Ia.648 | CF 3 | H | 3-CN | 4-OCF 3 | 5-CF 3 | |
Ia.649 | CF 3 | H | 3-CH 3 | 4-OCF 3 | 5-CF 3 | |
Ia.650 | CF 3 | H | 3-CF 3 | 4-OCF 3 | 5-CF 3 | |
Ia.651 | CF 3 | H | 3-OCH 3 | 4-OCF 3 | 5-CF 3 | |
Ia.652 | CF 3 | H | 3-OCF 3 | 4-OCF 3 | 5-CF 3 | |
Ia.653 | CF 3 | H | The 3-fluorine | 4-OCF 3 | 5-OCH 3 | |
Ia.654 | CF 3 | H | 3-chlorine | 4-OCF 3 | 5-OCH 3 | |
Ia.655 | CF 3 | H | 3-CN | 4-OCF 3 | 5-OCH 3 | |
Ia.656 | CF 3 | H | 3-CH 3 | 4-OCF 3 | 5-OCH 3 | |
Ia.657 | CF 3 | H | 3-CF 3 | 4-OCF 3 | 5-OCH 3 | |
Ia.658 | CF 3 | H | 3-OCH 3 | 4-OCF 3 | 5-OCH 3 | |
Ia.659 | CF 3 | H | 3-OCF 3 | 4-OCF 3 | 5-OCH 3 | |
Ia.660 | CF 3 | H | The 3-fluorine | 4-OCF 3 | 5-OCF 3 |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.661 | CF 3 | H | 3-chlorine | 4-OCF 3 | 5-OCF 3 | |
Ia.662 | CF 3 | H | 3-CN | 4-OCF 3 | 5-OCF 3 | |
Ia.663 | CF 3 | H | 3-CH 3 | 4-OCF 3 | 5-OCF 3 | |
Ia.664 | CF 3 | H | 3-CF 3 | 4-OCF 3 | 5-OCF 3 | |
Ia.665 | CF 3 | H | 3-OCH 3 | 4-OCF 3 | 5-OCF 3 | |
Ia.666 | CF 3 | H | 3-OCF 3 | 4-OCF 3 | 5-OCF 3 | |
Ia.667 | CF 3 | H | The 2-fluorine | The 4-fluorine | The 5-fluorine | 110-113 |
Ia.668 | CF 3 | H | The 2-fluorine | The 4-fluorine | 5-chlorine | |
Ia.669 | CF 3 | H | The 2-fluorine | The 4-fluorine | 5-CN | |
Ia.670 | CF 3 | H | The 2-fluorine | The 4-fluorine | 5-CH 3 | |
Ia.671 | CF 3 | H | The 2-fluorine | The 4-fluorine | 5-CF 3 | |
Ia.672 | CF 3 | H | The 2-fluorine | The 4-fluorine | 5-OCH 3 | |
Ia.673 | CF 3 | H | The 2-fluorine | The 4-fluorine | 5-OCF 3 | |
Ia.674 | CF 3 | H | 2-chlorine | The 4-fluorine | The 5-fluorine | |
Ia.675 | CF 3 | H | 2-chlorine | The 4-fluorine | 5-chlorine | |
Ia.676 | CF 3 | H | 2-chlorine | The 4-fluorine | 5-CN | |
Ia.677 | CF 3 | H | 2-chlorine | The 4-fluorine | 5-CH 3 | |
Ia.678 | CF 3 | H | 2-chlorine | The 4-fluorine | 5-CF 3 | |
Ia.679 | CF 3 | H | 2-chlorine | The 4-fluorine | 5-OCH 3 | |
Ia.680 | CF 3 | H | 2-chlorine | The 4-fluorine | 5-OCF 3 | |
Ia.681 | CF 3 | H | 2-CN | The 4-fluorine | The 5-fluorine | |
Ia.682 | CF 3 | H | 2-CN | The 4-fluorine | 5-chlorine | |
Ia.683 | CF 3 | H | 2-CN | The 4-fluorine | 5-CN | |
Ia.684 | CF 3 | H | 2-CN | The 4-fluorine | 5-CH 3 | |
Ia.685 | CF 3 | H | 2-CN | The 4-fluorine | 5-CF 3 | |
Ia.686 | CF 3 | H | 2-CN | The 4-fluorine | 5-OCH 3 | |
Ia.687 | CF 3 | H | 2-CN | The 4-fluorine | 5-OCF 3 | |
Ia.688 | CF 3 | H | The 2-methyl | The 4-fluorine | The 5-fluorine | |
Ia.689 | CF 3 | H | The 2-methyl | The 4-fluorine | 5-chlorine | |
Ia.690 | CF 3 | H | The 2-methyl | The 4-fluorine | 5-CN | |
Ia.691 | CF 3 | H | The 2-methyl | The 4-fluorine | 5-CH 3 | |
Ia.692 | CF 3 | H | The 2-methyl | The 4-fluorine | 5-CF 3 | |
Ia.693 | CF 3 | H | The 2-methyl | The 4-fluorine | 5-OCH 3 | |
Ia.694 | CF 3 | H | The 2-methyl | The 4-fluorine | 5-OCF 3 | |
Ia.695 | CF 3 | H | 2-CF 3 | The 4-fluorine | The 5-fluorine |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.696 | CF 3 | H | 2-CF 3 | The 4-fluorine | 5-chlorine | |
Ia.697 | CF 3 | H | 2-CF 3 | The 4-fluorine | 5-CN | |
Ia.698 | CF 3 | H | 2-CF 3 | The 4-fluorine | 5-CH 3 | |
Ia.699 | CF 3 | H | 2-CF 3 | The 4-fluorine | 5-CF 3 | |
Ia.700 | CF 3 | H | 2-CF 3 | The 4-fluorine | 5-OCH 3 | |
Ia.701 | CF 3 | H | 2-CF 3 | The 4-fluorine | 5-OCF 3 | |
Ia.702 | CF 3 | H | 2-OCH 3 | The 4-fluorine | The 5-fluorine | |
Ia.703 | CF 3 | H | 2-OCH 3 | The 4-fluorine | 5-chlorine | |
Ia.704 | CF 3 | H | 2-OCH 3 | The 4-fluorine | 5-CN | |
Ia.705 | CF 3 | H | 2-OCH 3 | The 4-fluorine | 5-CH 3 | |
Ia.706 | CF 3 | H | 2-OCH 3 | The 4-fluorine | 5-CF 3 | |
Ia.707 | CF 3 | H | 2-OCH 3 | The 4-fluorine | 5-OCH 3 | |
Ia.708 | CF 3 | H | 2-OCH 3 | The 4-fluorine | 5-OCF 3 | |
Ia.709 | CF 3 | H | 2-OCF 3 | The 4-fluorine | The 5-fluorine | |
Ia.710 | CF 3 | H | 2-OCF 3 | The 4-fluorine | 5-chlorine | |
Ia.711 | CF 3 | H | 2-OCF 3 | The 4-fluorine | 5-CN | |
Ia.712 | CF 3 | H | 2-OCF 3 | The 4-fluorine | 5-CH 3 | |
Ia.713 | CF 3 | H | 2-OCF 3 | The 4-fluorine | 5-CF 3 | |
Ia.714 | CF 3 | H | 2-OCF 3 | The 4-fluorine | 5-OCH 3 | |
Ia.715 | CF 3 | H | 2-OCF 3 | The 4-fluorine | 5-OCF 3 | |
Ia.716 | CF 3 | H | The 2-fluorine | 4-chlorine | The 5-fluorine | |
Ia.717 | CF 3 | H | The 2-fluorine | 4-chlorine | 5-chlorine | |
Ia.718 | CF 3 | H | The 2-fluorine | 4-chlorine | 5-CN | |
Ia.719 | CF 3 | H | The 2-fluorine | 4-chlorine | 5-CH 3 | 106-108 |
Ia.720 | CF 3 | H | The 2-fluorine | 4-chlorine | 5-CF 3 | |
Ia.721 | CF 3 | H | The 2-fluorine | 4-chlorine | 5-OCH 3 | 119-121 |
Ia.722 | CF 3 | H | The 2-fluorine | 4-chlorine | 5-OCF 3 | |
Ia.723 | CF 3 | H | 2-chlorine | 4-chlorine | The 5-fluorine | |
Ia.724 | CF 3 | H | 2-chlorine | 4-chlorine | 5-chlorine | |
Ia.725 | CF 3 | H | 2-chlorine | 4-chlorine | 5-CN | |
Ia.726 | CF 3 | H | 2-chlorine | 4-chlorine | 5-CH 3 | |
Ia.727 | CF 3 | H | 2-chlorine | 4-chlorine | 5-CF 3 | |
Ia.728 | CF 3 | H | 2-chlorine | 4-chlorine | 5-OCH 3 | |
Ia.729 | CF 3 | H | 2-chlorine | 4-chlorine | 5-OCF 3 |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.730 | CF 3 | H | 2-CN | 4-chlorine | The 5-fluorine | |
Ia.731 | CF 3 | H | 2-CN | 4-chlorine | 5-chlorine | |
Ia.732 | CF 3 | H | 2-CN | 4-chlorine | 5-CN | |
Ia.733 | CF 3 | H | 2-CN | 4-chlorine | 5-CH 3 | |
Ia.734 | CF 3 | H | 2-CN | 4-chlorine | 5-CF 3 | |
Ia.735 | CF 3 | H | 2-CN | 4-chlorine | 5-OCH 3 | |
Ia.736 | CF 3 | H | 2-CN | 4-chlorine | 5-OCF 3 | |
Ia.737 | CF 3 | H | The 2-methyl | 4-chlorine | The 5-fluorine | |
Ia.738 | CF 3 | H | The 2-methyl | 4-chlorine | 5-chlorine | |
Ia.739 | CF 3 | H | The 2-methyl | 4-chlorine | 5-CN | |
Ia.740 | CF 3 | H | The 2-methyl | 4-chlorine | 5-CH 3 | |
Ia.741 | CF 3 | H | The 2-methyl | 4-chlorine | 5-CF 3 | |
Ia.742 | CF 3 | H | The 2-methyl | 4-chlorine | 5-OCH 3 | |
Ia.743 | CF 3 | H | The 2-methyl | 4-chlorine | 5-OCF 3 | |
Ia.744 | CF 3 | H | 2-CF 3 | 4-chlorine | The 5-fluorine | |
Ia.745 | CF 3 | H | 2-CF 3 | 4-chlorine | 5-chlorine | |
Ia.746 | CF 3 | H | 2-CF 3 | 4-chlorine | 5-CN | |
Ia.747 | CF 3 | H | 2-CF 3 | 4-chlorine | 5-CH 3 | |
Ia.748 | CF 3 | H | 2-CF 3 | 4-chlorine | 5-CF 3 | |
Ia.749 | CF 3 | H | 2-CF 3 | 4-chlorine | 5-OCH 3 | |
Ia.750 | CF 3 | H | 2-CF 3 | 4-chlorine | 5-OCF 3 | |
Ia.751 | CF 3 | H | 2-OCH 3 | 4-chlorine | The 5-fluorine | |
Ia.752 | CF 3 | H | 2-OCH 3 | 4-chlorine | 5-chlorine | |
Ia.753 | CF 3 | H | 2-OCH 3 | 4-chlorine | 5-CN | |
Ia.754 | CF 3 | H | 2-OCH 3 | 4-chlorine | 5-CH 3 | |
Ia.755 | CF 3 | H | 2-OCH 3 | 4-chlorine | 5-CF 3 | |
Ia.756 | CF 3 | H | 2-OCH 3 | 4-chlorine | 5-OCH 3 | |
Ia.757 | CF 3 | H | 2-OCH 3 | 4-chlorine | 5-OCF 3 | |
Ia.758 | CF 3 | H | 2-OCF 3 | 4-chlorine | The 5-fluorine | |
Ia.759 | CF 3 | H | 2-OCF 3 | 4-chlorine | 5-chlorine | |
Ia.760 | CF 3 | H | 2-OCF 3 | 4-chlorine | 5-CN | |
Ia.761 | CF 3 | H | 2-OCF 3 | 4-chlorine | 5-CH 3 | |
Ia.762 | CF 3 | H | 2-OCF 3 | 4-chlorine | 5-CF 3 | |
Ia.763 | CF 3 | H | 2-OCF 3 | 4-chlorine | 5-OCH 3 |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.764 | CF 3 | H | 2-OCF 3 | 4-chlorine | 5-OCF 3 | |
Ia.765 | CF 3 | H | The 2-fluorine | 4-CN | The 5-fluorine | |
Ia.766 | CF 3 | H | The 2-fluorine | 4-CN | 5-chlorine | |
Ia.767 | CF 3 | H | The 2-fluorine | 4-CN | 5-CN | |
Ia.768 | CF 3 | H | The 2-fluorine | 4-CN | 5-CH 3 | |
Ia.769 | CF 3 | H | The 2-fluorine | 4-CN | 5-CF 3 | |
Ia.770 | CF 3 | H | The 2-fluorine | 4-CN | 5-OCH 3 | |
Ia.771 | CF 3 | H | The 2-fluorine | 4-CN | 5-OCF 3 | |
Ia.772 | CF 3 | H | 2-chlorine | 4-CN | The 5-fluorine | |
Ia.773 | CF 3 | H | 2-chlorine | 4-CN | 5-chlorine | |
Ia.774 | CF 3 | H | 2-chlorine | 4-CN | 5-CN | |
Ia.775 | CF 3 | H | 2-chlorine | 4-CN | 5-CH 3 | |
Ia.776 | CF 3 | H | 2-chlorine | 4-CN | 5-CF 3 | |
Ia.777 | CF 3 | H | 2-chlorine | 4-CN | 5-OCH 3 | |
Ia.778 | CF 3 | H | 2-chlorine | 4-CN | 5-OCF 3 | |
Ia.779 | CF 3 | H | 2-CN | 4-CN | The 5-fluorine | |
Ia.780 | CF 3 | H | 2-CN | 4-CN | 5-chlorine | |
Ia.781 | CF 3 | H | 2-CN | 4-CN | 5-CN | |
Ia.782 | CF 3 | H | 2-CN | 4-CN | 5-CH 3 | |
Ia.783 | CF 3 | H | 2-CN | 4-CN | 5-CF 3 | |
Ia.784 | CF 3 | H | 2-CN | 4-CN | 5-OCH 3 | |
Ia.785 | CF 3 | H | 2-CN | 4-CN | 5-OCF 3 | |
Ia.786 | CF 3 | H | The 2-methyl | 4-CN | The 5-fluorine | |
Ia.787 | CF 3 | H | The 2-methyl | 4-CN | 5-chlorine | |
Ia.788 | CF 3 | H | The 2-methyl | 4-CN | 5-CN | |
Ia.789 | CF 3 | H | The 2-methyl | 4-CN | 5-CH 3 | |
Ia.790 | CF 3 | H | The 2-methyl | 4-CN | 5-CF 3 | |
Ia.791 | CF 3 | H | The 2-methyl | 4-CN | 5-OCH 3 | |
Ia.792 | CF 3 | H | The 2-methyl | 4-CN | 5-OCF 3 | |
Ia.793 | CF 3 | H | 2-CF 3 | 4-CN | The 5-fluorine | |
Ia.794 | CF 3 | H | 2-CF 3 | 4-CN | 5-chlorine | |
Ia.795 | CF 3 | H | 2-CF 3 | 4-CN | 5-CN | |
Ia.796 | CF 3 | H | 2-CF 3 | 4-CN | 5-CH 3 | |
Ia.797 | CF 3 | H | 2-CF 3 | 4-CN | 5-CF 3 | |
Ia.798 | CF 3 | H | 2-CF 3 | 4-CN | 5-OCH 3 |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.799 | CF 3 | H | 2-CF 3 | 4-CN | 5-OCF 3 | |
Ia.800 | CF 3 | H | 2-OCH 3 | 4-CN | The 5-fluorine | |
Ia.801 | CF 3 | H | 2-OCH 3 | 4-CN | 5-chlorine | |
Ia.802 | CF 3 | H | 2-OCH 3 | 4-CN | 5-CN | |
Ia.803 | CF 3 | H | 2-OCH 3 | 4-CN | 5-CH 3 | |
Ia.804 | CF 3 | H | 2-OCH 3 | 4-CN | 5-CF 3 | |
Ia.805 | CF 3 | H | 2-OCH 3 | 4-CN | 5-OCH 3 | |
Ia.806 | CF 3 | H | 2-OCH 3 | 4-CN | 5-OCF 3 | |
Ia.807 | CF 3 | H | 2-OCF 3 | 4-CN | The 5-fluorine | |
Ia.808 | CF 3 | H | 2-OCF 3 | 4-CN | 5-chlorine | |
Ia.809 | CF 3 | H | 2-OCF 3 | 4-CN | 5-CN | |
Ia.810 | CF 3 | H | 2-OCF 3 | 4-CN | 5-CH 3 | |
Ia.811 | CF 3 | H | 2-OCF 3 | 4-CN | 5-CF 3 | |
Ia.812 | CF 3 | H | 2-OCF 3 | 4-CN | 5-OCH 3 | |
Ia.813 | CF 3 | H | 2-OCF 3 | 4-CN | 5-OCF 3 | |
Ia.814 | CF 3 | H | The 2-fluorine | 4-CH 3 | The 5-fluorine | |
Ia.815 | CF 3 | H | The 2-fluorine | 4-CH 3 | 5-chlorine | |
Ia.816 | CF 3 | H | The 2-fluorine | 4-CH 3 | 5-CN | |
Ia.817 | CF 3 | H | The 2-fluorine | 4-CH 3 | 5-CH 3 | |
Ia.818 | CF 3 | H | The 2-fluorine | 4-CH 3 | 5-CF 3 | |
Ia.819 | CF 3 | H | The 2-fluorine | 4-CH 3 | 5-OCH 3 | |
Ia.820 | CF 3 | H | The 2-fluorine | 4-CH 3 | 5-OCF 3 | |
Ia.821 | CF 3 | H | 2-chlorine | 4-CH 3 | The 5-fluorine | |
Ia.822 | CF 3 | H | 2-chlorine | 4-CH 3 | 5-chlorine | |
Ia.823 | CF 3 | H | 2-chlorine | 4-CH 3 | 5-CN | |
Ia.824 | CF 3 | H | 2-chlorine | 4-CH 3 | 5-CH 3 | |
Ia.825 | CF 3 | H | 2-chlorine | 4-CH 3 | 5-CF 3 | |
Ia.826 | CF 3 | H | 2-chlorine | 4-CH 3 | 5-OCH 3 | |
Ia.827 | CF 3 | H | 2-chlorine | 4-CH 3 | 5-OCF 3 | |
Ia.828 | CF 3 | H | 2-CN | 4-CH 3 | The 5-fluorine | |
Ia.829 | CF 3 | H | 2-CN | 4-CH 3 | 5-chlorine | |
Ia.830 | CF 3 | H | 2-CN | 4-CH 3 | 5-CN | |
Ia.831 | CF 3 | H | 2-CN | 4-CH 3 | 5-CH 3 | |
Ia.832 | CF 3 | H | 2-CN | 4-CH 3 | 5-CF 3 | |
Ia.833 | CF 3 | H | 2-CN | 4-CH 3 | 5-OCH 3 | |
Ia.834 | CF 3 | H | 2-CN | 4-CH 3 | 5-OCF 3 |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.835 | CF 3 | H | The 2-methyl | 4-CH 3 | The 5-fluorine | |
Ia.836 | CF 3 | H | The 2-methyl | 4-CH 3 | 5-chlorine | |
Ia.837 | CF 3 | H | The 2-methyl | 4-CH 3 | 5-CN | |
Ia.838 | CF 3 | H | The 2-methyl | 4-CH 3 | 5-CH 3 | |
Ia.839 | CF 3 | H | The 2-methyl | 4-CH 3 | 5-CF 3 | |
Ia.840 | CF 3 | H | The 2-methyl | 4-CH 3 | 5-OCH 3 | |
Ia.841 | CF 3 | H | The 2-methyl | 4-CH 3 | 5-OCF 3 | |
Ia.842 | CF 3 | H | 2-CF 3 | 4-CH 3 | The 5-fluorine | |
Ia.843 | CF 3 | H | 2-CF 3 | 4-CH 3 | 5-chlorine | |
Ia.844 | CF 3 | H | 2-CF 3 | 4-CH 3 | 5-CN | |
Ia.845 | CF 3 | H | 2-CF 3 | 4-CH 3 | 5-CH 3 | |
Ia.846 | CF 3 | H | 2-CF 3 | 4-CH 3 | 5-CF 3 | |
Ia.847 | CF 3 | H | 2-CF 3 | 4-CH 3 | 5-OCH 3 | |
Ia.848 | CF 3 | H | 2-CF 3 | 4-CH 3 | 5-OCF 3 | |
Ia.849 | CF 3 | H | 2-OCH 3 | 4-CH 3 | The 5-fluorine | |
Ia.850 | CF 3 | H | 2-OCH 3 | 4-CH 3 | 5-chlorine | |
Ia.851 | CF 3 | H | 2-OCH 3 | 4-CH 3 | 5-CN | |
Ia.852 | CF 3 | H | 2-OCH 3 | 4-CH 3 | 5-CH 3 | |
Ia.853 | CF 3 | H | 2-OCH 3 | 4-CH 3 | 5-CF 3 | |
Ia.854 | CF 3 | H | 2-OCH 3 | 4-CH 3 | 5-OCH 3 | |
Ia.855 | CF 3 | H | 2-OCH 3 | 4-CH 3 | 5-OCF 3 | |
Ia.856 | CF 3 | H | 2-OCF 3 | 4-CH 3 | The 5-fluorine | |
Ia.857 | CF 3 | H | 2-OCF 3 | 4-CH 3 | 5-chlorine | |
Ia.858 | CF 3 | H | 2-OCF 3 | 4-CH 3 | 5-CN | |
Ia.859 | CF 3 | H | 2-OCF 3 | 4-CH 3 | 5-CH 3 | |
Ia.860 | CF 3 | H | 2-OCF 3 | 4-CH 3 | 5-CF 3 | |
Ia.861 | CF 3 | H | 2-OCF 3 | 4-CH 3 | 5-OCH 3 | |
Ia.862 | CF 3 | H | 2-OCF 3 | 4-CH 3 | 5-OCF 3 | |
Ia.863 | CF 3 | H | The 2-fluorine | 4-CF 3 | The 5-fluorine | |
Ia.864 | CF 3 | H | The 2-fluorine | 4-CF 3 | 5-chlorine | |
Ia.865 | CF 3 | H | The 2-fluorine | 4-CF 3 | 5-CN | |
Ia.866 | CF 3 | H | The 2-fluorine | 4-CF 3 | 5-CH 3 | |
Ia.867 | CF 3 | H | The 2-fluorine | 4-CF 3 | 5-CF 3 | |
Ia.868 | CF 3 | H | The 2-fluorine | 4-CF 3 | 5-OCH 3 | |
Ia.869 | CF 3 | H | The 2-fluorine | 4-CF 3 | 5-OCF 3 | |
Ia.870 | CF 3 | H | 2-chlorine | 4-CF 3 | The 5-fluorine |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.871 | CF 3 | H | 2-chlorine | 4-CF 3 | 5-chlorine | |
Ia.872 | CF 3 | H | 2-chlorine | 4-CF 3 | 5-CN | |
Ia.873 | CF 3 | H | 2-chlorine | 4-CF 3 | 5-CH 3 | |
Ia.874 | CF 3 | H | 2-chlorine | 4-CF 3 | 5-CF 3 | |
Ia.875 | CF 3 | H | 2-chlorine | 4-CF 3 | 5-OCH 3 | |
Ia.876 | CF 3 | H | 2-chlorine | 4-CF 3 | 5-OCF 3 | |
Ia.877 | CF 3 | H | 2-CN | 4-CF 3 | The 5-fluorine | |
Ia.878 | CF 3 | H | 2-CN | 4-CF 3 | 5-chlorine | |
Ia.879 | CF 3 | H | 2-CN | 4-CF 3 | 5-CN | |
Ia.880 | CF 3 | H | 2-CN | 4-CF 3 | 5-CH 3 | |
Ia.881 | CF 3 | H | 2-CN | 4-CF 3 | 5-CF 3 | |
Ia.882 | CF 3 | H | 2-CN | 4-CF 3 | 5-OCH 3 | |
Ia.883 | CF 3 | H | 2-CN | 4-CF 3 | 5-OCF 3 | |
Ia.884 | CF 3 | H | The 2-methyl | 4-CF 3 | The 5-fluorine | |
Ia.885 | CF 3 | H | The 2-methyl | 4-CF 3 | 5-chlorine | |
Ia.886 | CF 3 | H | The 2-methyl | 4-CF 3 | 5-CN | |
Ia.887 | CF 3 | H | The 2-methyl | 4-CF 3 | 5-CH 3 | |
Ia.888 | CF 3 | H | The 2-methyl | 4-CF 3 | 5-CF 3 | |
Ia.889 | CF 3 | H | The 2-methyl | 4-CF 3 | 5-OCH 3 | |
Ia.890 | CF 3 | H | The 2-methyl | 4-CF 3 | 5-OCF 3 | |
Ia.891 | CF 3 | H | 2-CF 3 | 4-CF 3 | The 5-fluorine | |
Ia.892 | CF 3 | H | 2-CF 3 | 4-CF 3 | 5-chlorine | |
Ia.893 | CF 3 | H | 2-CF 3 | 4-CF 3 | 5-CN | |
Ia.894 | CF 3 | H | 2-CF 3 | 4-CF 3 | 5-CH 3 | |
Ia.895 | CF 3 | H | 2-CF 3 | 4-CF 3 | 5-CF 3 | |
Ia.896 | CF 3 | H | 2-CF 3 | 4-CF 3 | 5-OCH 3 | |
Ia.897 | CF 3 | H | 2-CF 3 | 4-CF 3 | 5-OCF 3 | |
Ia.898 | CF 3 | H | 2-OCH 3 | 4-CF 3 | The 5-fluorine | |
Ia.899 | CF 3 | H | 2-OCH 3 | 4-CF 3 | 5-chlorine | |
Ia.900 | CF 3 | H | 2-OCH 3 | 4-CF 3 | 5-CN | |
Ia.901 | CF 3 | H | 2-OCH 3 | 4-CF 3 | 5-CH 3 | |
Ia.902 | CF 3 | H | 2-OCH 3 | 4-CF 3 | 5-CF 3 | |
Ia.903 | CF 3 | H | 2-OCH 3 | 4-CF 3 | 5-OCH 3 | |
Ia.904 | CF 3 | H | 2-OCH 3 | 4-CF 3 | 5-OCF 3 | |
Ia.905 | CF 3 | H | 2-OCF 3 | 4-CF 3 | The 5-fluorine | |
Ia.906 | CF 3 | H | 2-OCF 3 | 4-CF 3 | 5-chlorine |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.907 | CF 3 | H | 2-OCF 3 | 4-CF 3 | 5-CN | |
Ia.908 | CF 3 | H | 2-OCF 3 | 4-CF 3 | 5-CH 3 | |
Ia.909 | CF 3 | H | 2-OCF 3 | 4-CF 3 | 5-CF 3 | |
Ia.910 | CF 3 | H | 2-OCF 3 | 4-CF 3 | 5-OCH 3 | |
Ia.911 | CF 3 | H | 2-OCF 3 | 4-CF 3 | 5-OCF 3 | |
Ia.912 | CF 3 | H | The 2-fluorine | 4-OCH 3 | The 5-fluorine | |
Ia.913 | CF 3 | H | The 2-fluorine | 4-OCH 3 | 5-chlorine | |
Ia.914 | CF 3 | H | The 2-fluorine | 4-OCH 3 | 5-CN | |
Ia.915 | CF 3 | H | The 2-fluorine | 4-OCH 3 | 5-CH 3 | |
Ia.916 | CF 3 | H | The 2-fluorine | 4-OCH 3 | 5-CF 3 | |
Ia.917 | CF 3 | H | The 2-fluorine | 4-OCH 3 | 5-OCH 3 | |
Ia.918 | CF 3 | H | The 2-fluorine | 4-OCH 3 | 5-OCF 3 | |
Ia.919 | CF 3 | H | 2-chlorine | 4-OCH 3 | The 5-fluorine | |
Ia.920 | CF 3 | H | 2-chlorine | 4-OCH 3 | 5-chlorine | |
Ia.921 | CF 3 | H | 2-chlorine | 4-OCH 3 | 5-CN | |
Ia.922 | CF 3 | H | 2-chlorine | 4-OCH 3 | 5-CH 3 | |
Ia.923 | CF 3 | H | 2-chlorine | 4-OCH 3 | 5-CF 3 | |
Ia.924 | CF 3 | H | 2-chlorine | 4-OCH 3 | 5-OCH 3 | |
Ia.925 | CF 3 | H | 2-chlorine | 4-OCH 3 | 5-OCF 3 | |
Ia.926 | CF 3 | H | 2-CN | 4-OCH 3 | The 5-fluorine | |
Ia.927 | CF 3 | H | 2-CN | 4-OCH 3 | 5-chlorine | |
Ia.928 | CF 3 | H | 2-CN | 4-OCH 3 | 5-CN | |
Ia.929 | CF 3 | H | 2-CN | 4-OCH 3 | 5-CH 3 | |
Ia.930 | CF 3 | H | 2-CN | 4-OCH 3 | 5-CF 3 | |
Ia.931 | CF 3 | H | 2-CN | 4-OCH 3 | 5-OCH 3 | |
Ia.932 | CF 3 | H | 2-CN | 4-OCH 3 | 5-OCF 3 | |
Ia.933 | CF 3 | H | The 2-methyl | 4-OCH 3 | The 5-fluorine | |
Ia.934 | CF 3 | H | The 2-methyl | 4-OCH 3 | 5-chlorine | |
Ia.935 | CF 3 | H | The 2-methyl | 4-OCH 3 | 5-CN | |
Ia.936 | CF 3 | H | The 2-methyl | 4-OCH 3 | 5-CH 3 | |
Ia.937 | CF 3 | H | The 2-methyl | 4-OCH 3 | 5-CF 3 | |
Ia.938 | CF 3 | H | The 2-methyl | 4-OCH 3 | 5-OCH 3 | |
Ia.939 | CF 3 | H | The 2-methyl | 4-OCH 3 | 5-OCF 3 | |
Ia.940 | CF 3 | H | 2-CF 3 | 4-OCH 3 | The 5-fluorine | |
Ia.941 | CF 3 | H | 2-CF 3 | 4-OCH 3 | 5-chlorine |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.942 | CF 3 | H | 2-CF 3 | 4-OCH 3 | 5-CN | |
Ia.943 | CF 3 | H | 2-CF 3 | 4-OCH 3 | 5-CH 3 | |
Ia.944 | CF 3 | H | 2-CF 3 | 4-OCH 3 | 5-CF 3 | |
Ia.945 | CF 3 | H | 2-CF 3 | 4-OCH 3 | 5-OCH 3 | |
Ia.946 | CF 3 | H | 2-CF 3 | 4-OCH 3 | 5-OCF 3 | |
Ia.947 | CF 3 | H | 2-OCH 3 | 4-OCH 3 | The 5-fluorine | |
Ia.948 | CF 3 | H | 2-OCH 3 | 4-OCH 3 | 5-chlorine | |
Ia.949 | CF 3 | H | 2-OCH 3 | 4-OCH 3 | 5-CN | |
Ia.950 | CF 3 | H | 2-OCH 3 | 4-OCH 3 | 5-CH 3 | |
Ia.951 | CF 3 | H | 2-OCH 3 | 4-OCH 3 | 5-CF 3 | |
Ia.952 | CF 3 | H | 2-OCH 3 | 4-OCH 3 | 5-OCH 3 | |
Ia.953 | CF 3 | H | 2-OCH 3 | 4-OCH 3 | 5-OCF 3 | |
Ia.954 | CF 3 | H | 2-OCF 3 | 4-OCH 3 | The 5-fluorine | |
Ia.955 | CF 3 | H | 2-OCF 3 | 4-OCH 3 | 5-chlorine | |
Ia.956 | CF 3 | H | 2-OCF 3 | 4-OCH 3 | 5-CN | |
Ia.957 | CF 3 | H | 2-OCF 3 | 4-OCH 3 | 5-CH 3 | |
Ia.958 | CF 3 | H | 2-OCF 3 | 4-OCH 3 | 5-CF 3 | |
Ia.959 | CF 3 | H | 2-OCF 3 | 4-OCH 3 | 5-OCH 3 | |
Ia.960 | CF 3 | H | 2-OCF 3 | 4-OCH 3 | 5-OCF 3 | |
Ia.961 | CF 3 | H | The 2-fluorine | 4-OCF 3 | The 5-fluorine | |
Ia.962 | CF 3 | H | The 2-fluorine | 4-OCF 3 | 5-chlorine | |
Ia.963 | CF 3 | H | The 2-fluorine | 4-OCF 3 | 5-CN | |
Ia.964 | CF 3 | H | The 2-fluorine | 4-OCF 3 | 5-CH 3 | |
Ia.965 | CF 3 | H | The 2-fluorine | 4-OCF 3 | 5-CF 3 | |
Ia.966 | CF 3 | H | The 2-fluorine | 4-OCF 3 | 5-OCH 3 | |
Ia.967 | CF 3 | H | The 2-fluorine | 4-OCF 3 | 5-OCF 3 | |
Ia.968 | CF 3 | H | 2-chlorine | 4-OCF 3 | The 5-fluorine | |
Ia.969 | CF 3 | H | 2-chlorine | 4-OCF 3 | 5-chlorine | |
Ia.970 | CF 3 | H | 2-chlorine | 4-OCF 3 | 5-CN | |
Ia.971 | CF 3 | H | 2-chlorine | 4-OCF 3 | 5-CH 3 | |
Ia.972 | CF 3 | H | 2-chlorine | 4-OCF 3 | 5-CF 3 | |
Ia.973 | CF 3 | H | 2-chlorine | 4-OCF 3 | 5-OCH 3 | |
Ia.974 | CF 3 | H | 2-chlorine | 4-OCF 3 | 5-OCF 3 | |
Ia.975 | CF 3 | H | 2-CN | 4-OCF 3 | The 5-fluorine | |
Ia.976 | CF 3 | H | 2-CN | 4-OCF 3 | 5-chlorine | |
Ia.977 | CF 3 | H | 2-CN | 4-OCF 3 | 5-CN |
The compound sequence number | R 1 | R 2 | R 3 | R 4 | R 5 | Fusing point [℃] |
Ia.978 | CF 3 | H | 2-CN | 4-OCF 3 | 5-CH 3 | |
Ia.979 | CF 3 | H | 2-CN | 4-OCF 3 | 5-CF 3 | |
Ia.980 | CF 3 | H | 2-CN | 4-OCF 3 | 5-OCH 3 | |
Ia.981 | CF 3 | H | 2-CN | 4-OCF 3 | 5-OCF 3 | |
Ia.982 | CF 3 | H | The 2-methyl | 4-OCF 3 | The 5-fluorine | |
Ia.983 | CF 3 | H | The 2-methyl | 4-OCF 3 | 5-chlorine | |
Ia.984 | CF 3 | H | The 2-methyl | 4-OCF 3 | 5-CN | |
Ia.985 | CF 3 | H | The 2-methyl | 4-OCF 3 | 5-CH 3 | |
Ia.986 | CF 3 | H | The 2-methyl | 4-OCF 3 | 5-CF 3 | |
Ia.987 | CF 3 | H | The 2-methyl | 4-OCF 3 | 5-OCH 3 | |
Ia.988 | CF 3 | H | The 2-methyl | 4-OCF 3 | 5-OCF 3 | |
Ia.989 | CF 3 | H | 2-CF 3 | 4-OCF 3 | The 5-fluorine | |
Ia.990 | CF 3 | H | 2-CF 3 | 4-OCF 3 | 5-chlorine | |
Ia.991 | CF 3 | H | 2-CF 3 | 4-OCF 3 | 5-CN | |
Ia.992 | CF 3 | H | 2-CF 3 | 4-OCF 3 | 5-CH 3 | |
Ia.993 | CF 3 | H | 2-CF 3 | 4-OCF 3 | 5-CF 3 | |
Ia.994 | CF 3 | H | 2-CF 3 | 4-OCF 3 | 5-OCH 3 | |
Ia.995 | CF 3 | H | 2-CF 3 | 4-OCF 3 | 5-OCF 3 | |
Ia.996 | CF 3 | H | 2-OCH 3 | 4-OCF 3 | The 5-fluorine | |
Ia.997 | CF 3 | H | 2-OCH 3 | 4-OCF 3 | 5-chlorine | |
Ia.998 | CF 3 | H | 2-OCH 3 | 4-OCF 3 | 5-CN | |
Ia.999 | CF 3 | H | 2-OCH 3 | 4-OCF 3 | 5-CH 3 | |
Ia.1000 | CF 3 | H | 2-OCH 3 | 4-OCF 3 | 5-CF 3 | |
Ia.1001 | CF 3 | H | 2-OCH 3 | 4-OCF 3 | 5-OCH 3 | |
Ia.1002 | CF 3 | H | 2-OCH 3 | 4-OCF 3 | 5-OCF 3 | |
Ia.1003 | CF 3 | H | 2-OCF 3 | 4-OCF 3 | The 5-fluorine | |
Ia.1004 | CF 3 | H | 2-OCF 3 | 4-OCF 3 | 5-chlorine | |
Ia.1005 | CF 3 | H | 2-OCF 3 | 4-OCF 3 | 5-CN | |
Ia.1006 | CF 3 | H | 2-OCF 3 | 4-OCF 3 | 5-CH 3 | |
Ia.1007 | CF 3 | H | 2-OCF 3 | 4-OCF 3 | 5-CF 3 | |
Ia.1008 | CF 3 | H | 2-OCF 3 | 4-OCF 3 | 5-OCH 3 | |
Ia.1009 | CF 3 | H | 2-OCF 3 | 4-OCF 3 | 5-OCF 3 |
In addition, the 1-methyl-pyrazol-4-yl carboxylic acid anilides of special preferred formula Ib-If, especially:
-with the corresponding Compound I different R that only are a.1-Ia.1009
2Compounds ib .1-Ib.1009 for fluorine:
-with the corresponding Compound I different R that only are a.1-Ia.1009
2For the Compound I of chlorine c.1-Ic.1009:
-with the corresponding Compound I different R that only are a.1-Ia.1009
1Compound for difluoromethyl
Id.1-Id.1009:
Compound sequence number fusing point [℃]
Id.721 150-152
Id.719 120-122
Id.667 122-125
Id.344 156-158
-with the corresponding Compound I different R that only are a.1-Ia.1009
1Be difluoromethyl and R
2For the Compound I of fluorine e.1-Ie.1009:
-with the corresponding Compound I different R that only are a.1-Ia.1009
1Be difluoromethyl and R
2For the Compound I of chlorine f.1-If.1009:
-with the corresponding Compound I different R that only are a.1-Ia.1009
1For the Compound I of methyl fluoride g.1-Ig.1009:
Compound sequence number fusing point [℃]
Ig.344 152-156
Ig.1 126-129
-with the corresponding Compound I different R that only are a.1-Ia.1009
1Be CF
2The Compound I of Cl is h.1-Ih.1009:
Compound sequence number fusing point [℃]
Ih.344 158-161
-with the corresponding Compound I different R that only are a.1-Ia.1009
1For the Compound I of chlorine methyl fluoride j.1-Ij.1009:
Compound sequence number fusing point [℃]
Ij.344 154-157
Very particularly preferably following compound: N-(2 '-fluoro-4 '-chloro-5 '-methoxyl biphenyl-2-yl)-3-Trifluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-3-Trifluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-Trifluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-Trifluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(2 '-fluoro-4 '-chloro-5 '-methoxyl biphenyl-2-yl)-3-difluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(2 ', 3 ', 4 '-trifluoro-biphenyl-2-yl)-3-Trifluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-3-difluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-difluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-difluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorodifluoramethyl--1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(2 ', 3 ', 4 '-trifluoro-biphenyl-2-yl)-3-methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide and N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide.
Preferred formula I compound and at least a A that is selected from) mixture of reactive compound of azole.
Also preferred formula I compound and at least a B that is selected from) mixture of reactive compound of strobilurins class.
Preferred formula I compound and at least a C that is selected from) mixture of reactive compound of carboxylic acid amides.
In addition, also preferred formula I compound and at least a D that is selected from) mixture of reactive compound of heterocyclic compound.
In addition, also preferred formula I compound and at least a E that is selected from) mixture of reactive compound of Carbamates.
In addition, also preferred formula I compound and at least a F that is selected from) mixture of reactive compound of other fungicides.
In addition, also preferred formula I compound is selected from following A with at least a) mixture of the reactive compound of azole: cyproconazole, Difenoconazole, oxole bacterium, Fluquinconazole, Flusilazole, Flutriafol, ring penta azoles bacterium, nitrile bacterium azoles, penconazole, propiconazole, prothioconazoles, triazolone, triadimenol, Tebuconazole, fluorine ether azoles, triticonazole, Prochloraz, the white azoles of cyanogen, benomyl, carbendazim and Guardian.
Also special preferred formula I compound is selected from following A with at least a) mixture of the reactive compound of azole: cyproconazole, Difenoconazole, oxole bacterium, Fluquinconazole, Flusilazole, Flutriafol, ring penta azoles bacterium, nitrile bacterium azoles, propiconazole, prothioconazoles, triazolone, triadimenol, Tebuconazole, fluorine ether azoles, triticonazole, Prochloraz, the white azoles of cyanogen, benomyl and carbendazim.
Also very particularly preferably formula I compound and at least aly be selected from following A) mixture of the reactive compound of azole: oxole bacterium, Fluquinconazole, Flutriafol, ring penta azoles bacterium, Tebuconazole, triticonazole, Prochloraz and carbendazim.
Also preferred formula I compound and at least aly be selected from following B) mixture of the reactive compound of strobilurins class: nitrile Fluoxastrobin, ether bacterium amine, fluoxastrobin, imines bacterium, orysastrobin, ZEN 90160, pyraclostrobin and oxime bacterium ester.
Also special preferred formula I compound and at least aly be selected from following B) mixture of the reactive compound of strobilurins class: imines bacterium, orysastrobin and pyraclostrobin.
The mixture of formula I compound and pyraclostrobin very particularly preferably also.
Also preferred formula I compound and at least aly be selected from following C) mixture of the reactive compound of carboxylic acid amides: fenhexamid, metalaxyl, Metalaxyl-M, fenfuram, dimethomorph, flumorph, fluorine pyrrole bacterium amine (picobenzamid), zoxamide, carpropamide and mandipropamid amine.
Also special preferred formula I compound and at least aly be selected from following C) mixture of the reactive compound of carboxylic acid amides: fenhexamid, metalaxyl, Metalaxyl-M, fenfuram, dimethomorph, zoxamide and carpropamide.
Also preferred formula I compound and at least aly be selected from following D) mixture of the reactive compound of heterocyclic compound: fluazinam, encircle third pyrimidine, fenarimol, mepanipyrim, pyrimethanil, triforine Fu Evil bacterium, dodemorfe; butadiene morpholine; tridemorph; fenpropidin; different third is fixed; vinclozolin azolactone bacterium; Fenamidone; probenazole; 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2; 4; the 6-trifluorophenyl)-[1; 2; 4] triazols [1; 5-a] pyrimidine; the third oxygen quinoline; thiadiazoles element; difoltan; folpet; zarilamid and quinoxyfen, especially fluazinam; encircle third pyrimidine; fenarimol; mepanipyrim; pyrimethanil; triforine Fu Evil bacterium; dodemorfe; butadiene morpholine; tridemorph; fenpropidin; different third is fixed; vinclozolin azolactone bacterium; Fenamidone; probenazole; the third oxygen quinoline; thiadiazoles element; difoltan; folpet; zarilamid and quinoxyfen.
Also special preferred formula I compound is selected from following D with at least a) mixture of the reactive compound of heterocyclic compound: pyrimethanil, dodemorfe, butadiene morpholine, tridemorph, different third calmly, vinclozolin, 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazol [1,5-a] pyrimidine and quinoxyfen, especially pyrimethanil, dodemorfe, butadiene morpholine, tridemorph, different third fixed, vinclozolin and quinoxyfen.
Also preferred formula I compound and at least aly be selected from following E) mixture of the reactive compound of Carbamates: mancozeb, Carbatene, propineb, tmtd, iprovalicarb, benzene metsulfovax and hundred dimension spirits.
Also special preferred formula I compound and at least aly be selected from following E) mixture of the reactive compound of Carbamates: mancozeb and Carbatene.
Also preferred formula I compound and at least aly be selected from following F) mixture of the reactive compound of other fungicides: the Delan, triphenyltin salt is as fentinacetate, fosetyl, ethyl phosphine aluminium, phosphorous acid and salt thereof, tpn, Euparen, thiophanate methyl, Schweinfurt green, Kocide SD, Cupravit, basic copper sulfate, sulphur, cymoxanil, metrafenone is with the luxuriant amine of Luo Evil.
Also special preferred formula I compound and at least aly be selected from following F) mixture of the reactive compound of other fungicides: phosphorous acid and salt thereof, tpn and metrafenone.
The ternary mixture of also preferred a kind of formula I compound and two kinds of above-mentioned reactive compound II.
Preferred reactive compound combination is listed in the table below among the 3-9:
Table 3
Compound I and A) the reactive compound combination of group reactive compound II:
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
A.1 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.2 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.3 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.4 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.5 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.6 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.7 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.8 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.9 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.10 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.11 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.12 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.13 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Oxole bacterium |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
A.14 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.15 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.16 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.17 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.18 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.19 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.20 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.21 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.22 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.23 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.24 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Oxole bacterium |
A.25 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.26 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.27 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.28 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.29 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.30 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.31 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.32 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.33 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.34 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.35 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.36 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.37 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.38 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.39 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.40 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.41 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.42 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.43 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.44 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.45 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.46 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.47 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.48 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Encircle penta azoles bacterium |
A.49 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tebuconazole |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
A.50 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.51 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.52 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.53 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.54 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.55 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.56 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.57 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.58 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.59 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.60 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.61 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.62 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.63 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.64 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.65 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.66 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.67 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.68 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.69 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.70 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.71 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.72 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Tebuconazole |
A.73 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.74 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.75 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.76 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.77 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.78 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.79 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.80 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.81 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.82 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.83 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.84 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.85 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Fluquinconazole |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
A.86 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.87 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.88 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.89 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.90 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.91 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.92 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.93 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.94 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.95 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.96 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Fluquinconazole |
A.97 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Flutriafol |
A.98 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Flutriafol |
A.99 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Flutriafol |
A.100 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Flutriafol |
A.101 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Flutriafol |
A.102 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Flutriafol |
A.103 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Flutriafol |
A.104 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Flutriafol |
A.105 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Flutriafol |
A.106 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Flutriafol |
A.107 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Flutriafol |
A.108 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Flutriafol |
A.109 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Flutriafol |
A.110 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Flutriafol |
A.111 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Flutriafol |
A.112 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Flutriafol |
A.113 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Flutriafol |
A.114 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Flutriafol |
A.115 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Flutriafol |
A.116 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Flutriafol |
A.117 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Flutriafol |
A.118 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Flutriafol |
A.119 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Flutriafol |
A.120 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Flutriafol |
A.121 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Triticonazole |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
A.122 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Triticonazole |
A.123 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Triticonazole |
A.124 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Triticonazole |
A.125 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Triticonazole |
A.126 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Triticonazole |
A.127 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Triticonazole |
A.128 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Triticonazole |
A.129 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Triticonazole |
A.130 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Triticonazole |
A.131 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Triticonazole |
A.132 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Triticonazole |
A.133 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Triticonazole |
A.134 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Triticonazole |
A.135 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Triticonazole |
A.136 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Triticonazole |
A.137 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Triticonazole |
A.138 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Triticonazole |
A.139 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Triticonazole |
A.140 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Triticonazole |
A.141 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Triticonazole |
A.142 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Triticonazole |
A.143 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Triticonazole |
A.144 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Triticonazole |
A.145 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Prochloraz |
A.146 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Prochloraz |
A.147 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Prochloraz |
A.148 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Prochloraz |
A.149 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Prochloraz |
A.150 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Prochloraz |
A.151 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Prochloraz |
A.152 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Prochloraz |
A.153 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Prochloraz |
A.154 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Prochloraz |
A.155 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Prochloraz |
A.156 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Prochloraz |
A.157 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Prochloraz |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
A.158 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Prochloraz |
A.159 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Prochloraz |
A.160 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Prochloraz |
A.161 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Prochloraz |
A.162 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Prochloraz |
A.163 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Prochloraz |
A.164 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Prochloraz |
A.165 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Prochloraz |
A.166 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Prochloraz |
A.167 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Prochloraz |
A.168 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Prochloraz |
A.169 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Carbendazim |
A.170 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Carbendazim |
A.171 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Carbendazim |
A.172 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Carbendazim |
A.173 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Carbendazim |
A.174 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Carbendazim |
A.175 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Carbendazim |
A.176 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Carbendazim |
A.177 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Carbendazim |
A.178 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Carbendazim |
A.179 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Carbendazim |
A.180 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Carbendazim |
A.181 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Carbendazim |
A.182 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Carbendazim |
A.183 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Carbendazim |
A.184 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Carbendazim |
A.185 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Carbendazim |
A.186 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Carbendazim |
A.187 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Carbendazim |
A.188 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Carbendazim |
A.189 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Carbendazim |
A.190 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Carbendazim |
A.191 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Carbendazim |
A.192 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Carbendazim |
Table 4
Compound I and B) the reactive compound combination of group reactive compound II:
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
B.1 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.2 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.3 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.4 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.5 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.6 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.7 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.8 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.9 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.10 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.11 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.12 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.13 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.14 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.15 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.16 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.17 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.18 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.19 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.20 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.21 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.22 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.23 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.24 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | The imines bacterium |
B.25 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.26 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.27 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.28 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.29 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.30 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.31 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.32 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.33 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.34 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.35 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
B.36 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.37 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.38 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.39 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.40 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.41 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.42 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.43 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.44 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.45 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.46 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.47 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.48 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Pyraclostrobin |
B.49 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.50 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.51 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.52 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.53 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.54 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.55 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.56 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.57 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.58 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.59 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.60 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.61 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.62 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.63 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.64 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.65 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.66 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.67 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.68 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.69 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.70 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Orysastrobin |
B.71 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Orysastrobin |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
B.72 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Orysastrobin |
Table 5
Compound I and C) the reactive compound combination of group reactive compound II:
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
C.1 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.2 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.3 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.4 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.5 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.6 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.7 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.8 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.9 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.10 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.11 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.12 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.13 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.14 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.15 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.16 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.17 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.18 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.19 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.20 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.21 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.22 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.23 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Dimethomorph |
C.24 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Dimethomorph |
Table 6
Compound I and D) the reactive compound combination of group reactive compound II:
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
D.1 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.2 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.3 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.4 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Pyrimethanil |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
D.5 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.6 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.7 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.8 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.9 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.10 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.11 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.12 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.13 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.14 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4F;R 5=5-F | Pyrimethanil |
D.15 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.16 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.17 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.18 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.19 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.20 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.21 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.22 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.23 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.24 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Pyrimethanil |
D.25 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5a] pyrimidine |
D.26 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5a] pyrimidine |
D.27 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidinyl-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.28 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.29 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1- |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
Base)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | ||
D.30 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.31 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.32 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.33 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.34 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.35 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.36 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.37 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.38 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluoro-benzene |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
Base)-[1,2,4] triazol [1,5-a] pyrimidine | ||
D.39 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.40 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.41 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.42 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.43 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.44 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.45 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.46 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.47 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidines-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
Pyrimidine | ||
D.48 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | 5-chloro-7-(4-methyl-piperidinyl-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
D.49 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.50 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.51 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.52 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.53 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.54 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.55 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.56 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.57 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.58 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.59 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.60 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.61 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.62 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.63 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.64 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.65 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.66 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.67 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.68 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.69 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.70 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.71 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.72 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Dodemorfe |
D.73 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.74 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.75 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.76 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.77 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.78 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.79 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
D.80 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.81 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.82 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.83 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.84 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.85 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.86 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.87 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.88 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.89 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.90 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.91 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.92 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.93 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.94 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.95 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.96 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Butadiene morpholine |
D.97 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tridemorph |
D.98 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Tridemorph |
D.99 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Tridemorph |
D.100 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tridemorph |
D.101 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tridemorph |
D.102 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tridemorph |
D.103 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Tridemorph |
D.104 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Tridemorph |
D.105 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tridemorph |
D.106 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tridemorph |
D.107 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Tridemorph |
D.108 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Tridemorph |
D.109 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tridemorph |
D.110 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Tridemorph |
D.111 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Tridemorph |
D.112 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tridemorph |
D.113 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tridemorph |
D.114 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tridemorph |
D.115 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Tridemorph |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
D.116 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Tridemorph |
D.117 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tridemorph |
D.118 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tridemorph |
D.119 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Tridemorph |
D.120 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Tridemorph |
D.121 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.122 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.123 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.124 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.125 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.126 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.127 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.128 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.129 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.130 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.131 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.132 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.133 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.134 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.135 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.136 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.137 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.138 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.139 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.140 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.141 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.142 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.143 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.144 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Different third is fixed |
D.145 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.146 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.147 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.148 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.149 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.150 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.151 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Vinclozolin |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
D.152 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.153 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.154 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.155 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.156 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.157 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.158 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.159 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.160 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.161 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.162 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.163 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.164 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.165 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.166 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.167 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Vinclozolin |
D.168 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Vinclozolin |
Table 7
Compound I and E) the reactive compound combination of group reactive compound II:
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
E.1 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Mancozeb |
E.2 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Mancozeb |
E.3 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Mancozeb |
E.4 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Mancozeb |
E.5 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Mancozeb |
E.6 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Mancozeb |
E.7 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Mancozeb |
E.8 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Mancozeb |
E.9 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Mancozeb |
E.10 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Mancozeb |
E.11 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Mancozeb |
E.12 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Mancozeb |
E.13 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Mancozeb |
E.14 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Mancozeb |
E.15 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Mancozeb |
E.16 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Mancozeb |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
E.17 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Mancozeb |
E.18 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Mancozeb |
E.19 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Mancozeb |
E.20 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Mancozeb |
E.21 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Mancozeb |
E.22 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Mancozeb |
E.23 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Mancozeb |
E.24 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Mancozeb |
E.25 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Carbatene |
E.26 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Carbatene |
E.27 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Carbatene |
E.28 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Carbatene |
E.29 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Carbatene |
E.30 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Carbatene |
E.31 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Carbatene |
E.32 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Carbatene |
E.33 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Carbatene |
E.34 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Carbatene |
E.35 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Carbatene |
E.36 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Carbatene |
E.37 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Carbatene |
E.38 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Carbatene |
E.39 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Carbatene |
E.40 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Carbatene |
E.41 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Carbatene |
E.42 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Carbatene |
E.43 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Carbatene |
E.44 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Carbatene |
E.45 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Carbatene |
E.46 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Carbatene |
E.47 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Carbatene |
E.48 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Carbatene |
Table 8
Compound I and F) the reactive compound combination of group reactive compound II:
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
F.1 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tpn |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
F.2 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Tpn |
F.3 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Tpn |
F.4 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tpn |
F.5 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tpn |
F.6 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tpn |
F.7 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Tpn |
F.8 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Tpn |
F.9 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tpn |
F.10 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Tpn |
F.11 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Tpn |
F.12 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Tpn |
F.13 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tpn |
F.14 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Tpn |
F.15 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Tpn |
F.16 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tpn |
F.17 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tpn |
F.18 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tpn |
F.19 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Tpn |
F.20 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Tpn |
F.21 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tpn |
F.22 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Tpn |
F.23 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Tpn |
F.24 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Tpn |
F.25 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Metrafenone |
F.26 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Metrafenone |
F.27 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Metrafenone |
F.28 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Metrafenone |
F.29 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Metrafenone |
F.30 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Metrafenone |
F.31 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Metrafenone |
F.32 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Metrafenone |
F.33 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Metrafenone |
F.34 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Metrafenone |
F.35 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Metrafenone |
F.36 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Metrafenone |
F.37 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Metrafenone |
The mixture sequence number | Formula I compound (X=oxygen) | Reactive compound II |
F.38 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Metrafenone |
F.39 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Metrafenone |
F.40 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Metrafenone |
F.41 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Metrafenone |
F.42 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Metrafenone |
F.43 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Metrafenone |
F.44 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Metrafenone |
F.45 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Metrafenone |
F.46 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Metrafenone |
F.47 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Metrafenone |
F.48 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Metrafenone |
F.49 | R 1=CH 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.50 | R 1=CH 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.51 | R 1=CH 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.52 | R 1=CH 2F;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.53 | R 1=CHFCl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.54 | R 1=CHF 2;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.55 | R 1=CHF 2;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.56 | R 1=CHF 2;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.57 | R 1=CF 2Cl;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.58 | R 1=CF 3;R 2=H;R 3=3-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.59 | R 1=CF 3;R 2=F;R 3=3-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.60 | R 1=CF 3;R 2=Cl;R 3=3-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.61 | R 1=CH 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.62 | R 1=CH 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.63 | R 1=CH 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.64 | R 1=CH 2F;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.65 | R 1=CHFCl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.66 | R 1=CHF 2;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.67 | R 1=CHF 2;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.68 | R 1=CHF 2;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.69 | R 1=CF 2Cl;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.70 | R 1=CF 3;R 2=H;R 3=2-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.71 | R 1=CF 3;R 2=F;R 3=2-F;R 4=4-F;R 5=5-F | Phosphorous acid |
F.72 | R 1=CF 3;R 2=Cl;R 3=2-F;R 4=4-F;R 5=5-F | Phosphorous acid |
Table 9
The reactive compound combination of Compound I and two kinds of reactive compound II:
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
I-II-II.1 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Oxole bacterium |
I-II-II.2 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Oxole bacterium |
I-II-II.3 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Oxole bacterium |
I-II-II.4 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Oxole bacterium |
I-II-II.5 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Pyraclostrobin | Oxole bacterium |
I-II-II.6 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Encircle penta azoles bacterium |
I-II-II.7 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Encircle penta azoles bacterium |
I-II-II.8 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Encircle penta azoles bacterium |
I-II-II.9 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Encircle penta azoles bacterium |
I-II-II.10 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Pyraclostrobin | Encircle penta azoles bacterium |
I-II-II.11 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Triticonazole |
I-II-II.12 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Triticonazole |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
I-II-II.13 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Triticonazole |
I-II-II.14 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Triticonazole |
I-II-II.15 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Pyraclostrobin | Triticonazole |
I-II-II.16 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Fluquinconazole |
I-II-II.17 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Fluquinconazole |
I-II-II.18 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Fluquinconazole |
I-II-II.19 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Fluquinconazole |
I-II-II.20 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Pyraclostrobin | Fluquinconazole |
I-II-II.21 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Prothioconazoles |
I-II-II.22 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Prothioconazoles |
I-II-II.23 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Prothioconazoles |
I-II-II.24 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Prothioconazoles |
I-II-II.25 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2- | Pyraclostrobin | Prothioconazoles |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
Base)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | |||
I-II-II.26 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Tebuconazole |
I-II-II.27 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Tebuconazole |
I-II-II.28 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Tebuconazole |
I-II-II.29 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Tebuconazole |
I-II-II.30 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Pyraclostrobin | Tebuconazole |
I-II-II.31 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Carbendazim |
I-II-II.32 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Carbendazim |
I-II-II.33 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Carbendazim |
I-II-II.34 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Carbendazim |
I-II-II.35 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Pyraclostrobin | Carbendazim |
I-II-II.36 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Thiophanate methyl |
I-II-II.37 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-trifluoromethyl | Pyraclostrobin | Thiophanate methyl |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
-1H-pyrazole-4-carboxamide | |||
I-II-II.38 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Thiophanate methyl |
I-II-II.39 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Thiophanate methyl |
I-II-II.40 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Pyraclostrobin | Thiophanate methyl |
I-II-II.41 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Benomyl |
I-II-II.42 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Benomyl |
I-II-II.43 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Benomyl |
I-II-II.44 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Benomyl |
I-II-II.45 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Pyraclostrobin | Benomyl |
I-II-II.46 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Butadiene morpholine |
I-II-II.47 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Butadiene morpholine |
I-II-II.48 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Butadiene morpholine |
I-II-II.49 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Butadiene morpholine |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
I-II-II.50 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Pyraclostrobin | Butadiene morpholine |
I-II-II.51 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Metrafenone |
I-II-II.52 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Pyraclostrobin | Metrafenone |
I-II-II.53 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Metrafenone |
I-II-II.54 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Pyraclostrobin | Metrafenone |
I-II-II.55 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Pyraclostrobin | Metrafenone |
I-II-II.56 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Oxole bacterium |
I-II-II.57 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Oxole bacterium |
I-II-II.58 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Oxole bacterium |
I-II-II.59 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Oxole bacterium |
I-II-II.60 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | The imines bacterium | Oxole bacterium |
I-II-II.61 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Encircle penta azoles bacterium |
I-II-II.62 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2- | The imines bacterium | Encircle penta azoles bacterium |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
Base)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | |||
I-II-II.63 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Encircle penta azoles bacterium |
I-II-II.64 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Encircle penta azoles bacterium |
I-II-II.65 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | The imines bacterium | Encircle penta azoles bacterium |
I-II-II.66 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Triticonazole |
I-II-II.67 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Triticonazole |
I-II-II.68 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Triticonazole |
I-II-II.69 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Triticonazole |
I-II-II.70 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | The imines bacterium | Triticonazole |
I-II-II.71 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Fluquinconazole |
I-II-II.72 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Fluquinconazole |
I-II-II.73 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Fluquinconazole |
I-II-II.74 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl | The imines bacterium | Fluquinconazole |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
-1H-pyrazole-4-carboxamide | |||
I-II-II.75 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | The imines bacterium | Fluquinconazole |
I-II-II.76 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Prothioconazoles |
I-II-II.77 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Prothioconazoles |
I-II-II.78 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Prothioconazoles |
I-II-II.79 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Prothioconazoles |
I-II-II.80 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | The imines bacterium | Prothioconazoles |
I-II-II.81 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Tebuconazole |
I-II-II.82 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Tebuconazole |
I-II-II.83 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Tebuconazole |
I-II-II.84 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Tebuconazole |
I-II-II.85 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | The imines bacterium | Tebuconazole |
I-II-II.86 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Carbendazim |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
I-II-II.87 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Carbendazim |
I-II-II.88 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Carbendazim |
I-II-II.89 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Carbendazim |
I-II-II.90 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | The imines bacterium | Carbendazim |
I-II-II.91 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Thiophanate methyl |
I-II-II.92 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Thiophanate methyl |
I-II-II.93 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Thiophanate methyl |
I-II-II.94 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Thiophanate methyl |
I-II-II.95 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | The imines bacterium | Thiophanate methyl |
I-II-II.96 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Benomyl |
I-II-II.97 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Benomyl |
I-II-II.98 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Benomyl |
I-II-II.99 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2- | The imines bacterium | Benomyl |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
Base)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | |||
I-II-II.100 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | The imines bacterium | Benomyl |
I-II-II.101 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Butadiene morpholine |
I-II-II.102 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Butadiene morpholine |
I-II-II.103 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Butadiene morpholine |
I-II-II.104 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Butadiene morpholine |
I-II-II.105 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | The imines bacterium | Butadiene morpholine |
I-II-II.106 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Metrafenone |
I-II-II.107 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | The imines bacterium | Metrafenone |
I-II-II.108 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Metrafenone |
I-II-II.109 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | The imines bacterium | Metrafenone |
I-II-II.110 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | The imines bacterium | Metrafenone |
I-II-II.111 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-trifluoro | Oxole bacterium | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluoro |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
Methyl isophthalic acid H-pyrazole-4-carboxamide | Phenyl)-[1,2,4] triazol [1,5-a] pyrimidine | ||
I-II-II.112 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Oxole bacterium | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.113 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.114 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.115 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Oxole bacterium | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.116 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Oxole bacterium | Carbendazim |
I-II-II.117 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Oxole bacterium | Carbendazim |
I-II-II.118 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | Carbendazim |
I-II-II.119 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | Carbendazim |
I-II-II.120 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Oxole bacterium | Carbendazim |
I-II-II.121 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Oxole bacterium | Thiophanate methyl |
I-II-II.122 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2- | Oxole bacterium | Thiophanate methyl |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
Base)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | |||
I-II-II.123 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | Thiophanate methyl |
I-II-II.124 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | Thiophanate methyl |
I-II-II.125 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Oxole bacterium | Thiophanate methyl |
I-II-II.126 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Oxole bacterium | Benomyl |
I-II-II.127 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Oxole bacterium | Benomyl |
I-II-II.128 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | Benomyl |
I-II-II.129 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | Benomyl |
I-II-II.130 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Oxole bacterium | Benomyl |
I-II-II.131 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Oxole bacterium | Butadiene morpholine |
I-II-II.132 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Oxole bacterium | Butadiene morpholine |
I-II-II.133 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | Butadiene morpholine |
I-II-II.134 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl | Oxole bacterium | Butadiene morpholine |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
-1H-pyrazole-4-carboxamide | |||
I-II-II.135 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Oxole bacterium | Butadiene morpholine |
I-II-II.136 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Oxole bacterium | Metrafenone |
I-II-II.137 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Oxole bacterium | Metrafenone |
I-II-II.138 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | Metrafenone |
I-II-II.139 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | Metrafenone |
I-II-II.140 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Oxole bacterium | Metrafenone |
I-II-II.141 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Oxole bacterium | Metalaxyl |
I-II-II.142 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Oxole bacterium | Metalaxyl |
I-II-II.143 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | Metalaxyl |
I-II-II.144 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | Metalaxyl |
I-II-II.145 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Oxole bacterium | Metalaxyl |
I-II-II.146 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Oxole bacterium | Different third is fixed |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
I-II-II.147 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Oxole bacterium | Different third is fixed |
I-II-II.148 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | Different third is fixed |
I-II-II.149 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | Different third is fixed |
I-II-II.150 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Oxole bacterium | Different third is fixed |
I-II-II.151 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Oxole bacterium | Pyrimethanil |
I-II-II.152 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Oxole bacterium | Pyrimethanil |
I-II-II.153 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | Pyrimethanil |
I-II-II.154 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Oxole bacterium | Pyrimethanil |
I-II-II.155 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Oxole bacterium | Pyrimethanil |
I-II-II.156 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.157 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.158 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl | Encircle penta azoles bacterium | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluoro |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
-1H-pyrazole-4-carboxamide | Phenyl)-[1,2,4] triazol [1,5-a] pyrimidine | ||
I-II-II.159 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.160 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.161 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Carbendazim |
I-II-II.162 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Carbendazim |
I-II-II.163 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Carbendazim |
I-II-II.164 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Carbendazim |
I-II-II.165 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Carbendazim |
I-II-II.166 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Thiophanate methyl |
I-II-II.167 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Thiophanate methyl |
I-II-II.168 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Thiophanate methyl |
I-II-II.169 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Thiophanate methyl |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
I-II-II.170 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Thiophanate methyl |
I-II-II.171 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Benomyl |
I-II-II.172 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Benomyl |
I-II-II.173 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Benomyl |
I-II-II.174 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Benomyl |
I-II-II.175 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Benomyl |
I-II-II.176 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Butadiene morpholine |
I-II-II.177 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Butadiene morpholine |
I-II-II.178 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Butadiene morpholine |
I-II-II.179 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Butadiene morpholine |
I-II-II.180 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Butadiene morpholine |
I-II-II.181 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Metrafenone |
I-II-II.182 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2- | Encircle penta azoles bacterium | Metrafenone |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
Base)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | |||
I-II-II.183 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Metrafenone |
I-II-II.184 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Metrafenone |
I-II-II.185 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Metrafenone |
I-II-II.186 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Metalaxyl |
I-II-II.187 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Metalaxyl |
I-II-II.188 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Metalaxyl |
I-II-II.189 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Metalaxyl |
I-II-II.190 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Metalaxyl |
I-II-II.191 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Different third is fixed |
I-II-II.192 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Different third is fixed |
I-II-II.193 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Different third is fixed |
I-II-II.194 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl | Encircle penta azoles bacterium | Different third is fixed |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
-1H-pyrazole-4-carboxamide | |||
I-II-II.195 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Different third is fixed |
I-II-II.196 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Pyrimethanil |
I-II-II.197 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Pyrimethanil |
I-II-II.198 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Pyrimethanil |
I-II-II.199 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Pyrimethanil |
I-II-II.200 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Encircle penta azoles bacterium | Pyrimethanil |
I-II-II.201 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Triticonazole | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.202 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Triticonazole | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.203 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.204 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.205 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl | Triticonazole | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluoro |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
-1H-pyrazole-4-carboxamide | Phenyl)-[1,2,4] triazol [1,5-a] pyrimidine | ||
I-II-II.206 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Triticonazole | Carbendazim |
I-II-II.207 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Triticonazole | Carbendazim |
I-II-II.208 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | Carbendazim |
I-II-II.209 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | Carbendazim |
I-II-II.210 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Triticonazole | Carbendazim |
I-II-II.211 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Triticonazole | Thiophanate methyl |
I-II-II.212 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Triticonazole | Thiophanate methyl |
I-II-II.213 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | Thiophanate methyl |
I-II-II.214 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | Thiophanate methyl |
I-II-II.215 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Triticonazole | Thiophanate methyl |
I-II-II.216 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Triticonazole | Benomyl |
I-II-II.217 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-trifluoromethyl | Triticonazole | Benomyl |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
-1H-pyrazole-4-carboxamide | |||
I-II-II.218 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | Benomyl |
I-II-II.219 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | Benomyl |
I-II-II.220 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Triticonazole | Benomyl |
I-II-II.221 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Triticonazole | Butadiene morpholine |
I-II-II.222 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Triticonazole | Butadiene morpholine |
I-II-II.223 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | Butadiene morpholine |
I-II-II.224 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | Butadiene morpholine |
I-II-II.225 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Triticonazole | Butadiene morpholine |
I-II-II.226 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Triticonazole | Metrafenone |
I-II-II.227 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Triticonazole | Metrafenone |
I-II-II.228 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | Metrafenone |
I-II-II.229 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | Metrafenone |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
I-II-II.230 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Triticonazole | Metrafenone |
I-II-II.231 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Triticonazole | Metalaxyl |
I-II-II.232 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Triticonazole | Metalaxyl |
I-II-II.233 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | Metalaxyl |
I-II-II.234 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | Metalaxyl |
I-II-II.235 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Triticonazole | Metalaxyl |
I-II-II.236 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Triticonazole | Different third is fixed |
I-II-II.237 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Triticonazole | Different third is fixed |
I-II-II.238 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | Different third is fixed |
I-II-II.239 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | Different third is fixed |
I-II-II.240 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Triticonazole | Different third is fixed |
I-II-II.241 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Triticonazole | Pyrimethanil |
I-II-II.242 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2- | Triticonazole | Pyrimethanil |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
Base)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | |||
I-II-II.243 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | Pyrimethanil |
I-II-II.244 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Triticonazole | Pyrimethanil |
I-II-II.245 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Fluquinconazole | Pyrimethanil |
I-II-II.246 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.247 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.248 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.249 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.250 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Fluquinconazole | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.251 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | Carbendazim |
I-II-II.252 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | Carbendazim |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
I-II-II.253 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | Carbendazim |
I-II-II.254 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | Carbendazim |
I-II-II.255 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Fluquinconazole | Carbendazim |
I-II-II.256 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | Thiophanate methyl |
I-II-II.257 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | Thiophanate methyl |
I-II-II.258 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | Thiophanate methyl |
I-II-II.259 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | Thiophanate methyl |
I-II-II.260 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Fluquinconazole | Thiophanate methyl |
I-II-II.261 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | Benomyl |
I-II-II.262 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | Benomyl |
I-II-II.263 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | Benomyl |
I-II-II.264 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | Benomyl |
I-II-II.265 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2- | Fluquinconazole | Benomyl |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
Base)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | |||
I-II-II.266 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | Butadiene morpholine |
I-II-II.267 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | Butadiene morpholine |
I-II-II.268 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | Butadiene morpholine |
I-II-II.269 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | Butadiene morpholine |
I-II-II.270 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Fluquinconazole | Butadiene morpholine |
I-II-II.271 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | Metrafenone |
I-II-II.272 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | Metrafenone |
I-II-II.273 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | Metrafenone |
I-II-II.274 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | Metrafenone |
I-II-II.275 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Fluquinconazole | Metrafenone |
I-II-II.276 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | Metalaxyl |
I-II-II.277 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-trifluoromethyl | Fluquinconazole | Metalaxyl |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
-1H-pyrazole-4-carboxamide | |||
I-II-II.278 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | Metalaxyl |
I-II-II.279 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | Metalaxyl |
I-II-II.280 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Fluquinconazole | Metalaxyl |
I-II-II.281 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | Different third is fixed |
I-II-II.282 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | Different third is fixed |
I-II-II.283 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | Different third is fixed |
I-II-II.284 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | Different third is fixed |
I-II-II.285 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Fluquinconazole | Different third is fixed |
I-II-II.286 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | Pyrimethanil |
I-II-II.287 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Fluquinconazole | Pyrimethanil |
I-II-II.288 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | Pyrimethanil |
I-II-II.289 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Fluquinconazole | Pyrimethanil |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
I-II-II.290 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Fluquinconazole | Pyrimethanil |
I-II-II.291 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.292 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.293 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.294 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.295 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Prothioconazoles | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.296 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | Carbendazim |
I-II-II.297 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | Carbendazim |
I-II-II.298 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | Carbendazim |
I-II-II.299 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | Carbendazim |
I-I-II.300 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl | Prothioconazoles | Carbendazim |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
-1H-pyrazole-4-carboxamide | |||
I-II-II.301 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | Thiophanate methyl |
I-II-II.302 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | Thiophanate methyl |
I-II-II.303 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | Thiophanate methyl |
I-II-II.304 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | Thiophanate methyl |
I-II-II.305 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Prothioconazoles | Thiophanate methyl |
I-II-II.306 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | Benomyl |
I-II-II.307 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | Benomyl |
I-II-II.308 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | Benomyl |
I-II-II.309 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | Benomyl |
I-II-II.310 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Prothioconazoles | Benomyl |
I-II-II.311 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | Butadiene morpholine |
I-II-II.312 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | Butadiene morpholine |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
I-II-II.313 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | Butadiene morpholine |
I-II-II.314 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | Butadiene morpholine |
I-II-II.315 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Prothioconazoles | Butadiene morpholine |
I-II-II.316 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | Metrafenone |
I-II-II.317 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | Metrafenone |
I-II-II.318 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | Metrafenone |
I-II-II.319 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | Metrafenone |
I-II-II.320 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Prothioconazoles | Metrafenone |
I-II-II.321 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | Metalaxyl |
I-II-II.322 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | Metalaxyl |
I-II-II.323 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | Metalaxyl |
I-II-II.324 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrrole-4-formamide | Prothioconazoles | Metalaxyl |
I-II-II.325 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2- | Prothioconazoles | Metalaxyl |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
Base)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | |||
I-II-II.326 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | Different third is fixed |
I-II-II.327 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | Different third is fixed |
I-II-II.328 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | Different third is fixed |
I-II-II.329 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | Different third is fixed |
I-II-II.330 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Prothioconazoles | Different third is fixed |
I-II-II.331 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | Pyrimethanil |
I-II-II.332 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Prothioconazoles | Pyrimethanil |
I-II-II.333 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | Pyrimethanil |
I-II-II.334 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Prothioconazoles | Pyrimethanil |
I-II-II.335 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Prothioconazoles | Pyrimethanil |
I-II-II.336 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.337 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2- | Tebuconazole | 5-chloro-7-(4-methyl piperidine |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
Base)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | -1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | ||
I-II-II.338 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.339 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.340 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Tebuconazole | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine |
I-II-II.341 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | Carbendazim |
I-II-II.342 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | Carbendazim |
I-II-II.343 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | Carbendazim |
I-II-II.344 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | Carbendazim |
I-II-II.345 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Tebuconazole | Carbendazim |
I-II-II.346 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | Thiophanate methyl |
I-II-II.347 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | Thiophanate methyl |
I-II-II.348 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2- | Tebuconazole | Thiophanate methyl |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
Base)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | |||
I-II-II.349 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | Thiophanate methyl |
I-II-II.350 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Tebuconazole | Thiophanate methyl |
I-II-II.351 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | Benomyl |
I-II-II.352 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | Benomyl |
I-II-II.353 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | Benomyl |
I-II-II.354 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | Benomyl |
I-II-II.355 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Tebuconazole | Benomyl |
I-II-II.356 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | Butadiene morpholine |
I-II-II.357 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | Butadiene morpholine |
I-II-II.358 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | Butadiene morpholine |
I-II-II.359 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | Butadiene morpholine |
I-II-II.360 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl | Tebuconazole | Butadiene morpholine |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
-1H-pyrazole-4-carboxamide | |||
I-II-II.361 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | Metrafenone |
I-II-II.362 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | Metrafenone |
I-II-II.363 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | Metrafenone |
I-II-II.364 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | Metrafenone |
I-II-II.365 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Tebuconazole | Metrafenone |
I-II-II.366 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | Metalaxyl |
I-II-II.367 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | Metalaxyl |
I-II-II.368 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | Metalaxyl |
I-II-II.369 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | Metalaxyl |
I-II-II.370 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Tebuconazole | Metalaxyl |
I-II-II.371 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | Different third is fixed |
I-II-II.372 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | Different third is fixed |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
I-II-II.373 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | Different third is fixed |
I-II-II.374 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | Different third is fixed |
I-II-II.375 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Tebuconazole | Different third is fixed |
I-II-II.376 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | Pyrimethanil |
I-II-II.377 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | Tebuconazole | Pyrimethanil |
I-II-II.378 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | Pyrimethanil |
I-II-II.379 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Tebuconazole | Pyrimethanil |
I-II-II.380 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | Tebuconazole | Pyrimethanil |
I-II-II.381 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Carbendazim |
I-II-II.382 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Carbendazim |
I-II-II.383 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Carbendazim |
I-II-II.384 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2- | 5-chloro-7-(4-methyl piperidine-1- | Carbendazim |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
Base)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | Base)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | ||
I-II-II.385 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Carbendazim |
I-II-II.386 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Thiophanate methyl |
I-II-II.387 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Thiophanate methyl |
I-II-II.388 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Thiophanate methyl |
I-II-II.389 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Thiophanate methyl |
I-II-II.390 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Thiophanate methyl |
I-II-II.391 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Benomyl |
I-II-II.392 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Benomyl |
I-II-II.393 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluoro-benzene | Benomyl |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
-1H-pyrazole-4-carboxamide | Base)-[1,2,4] triazol [1,5-a] pyrimidine | ||
I-II-II.394 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Benomyl |
I-II-II.395 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Benomyl |
I-II-II.396 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Butadiene morpholine |
I-II-II.397 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Butadiene morpholine |
I-II-II.398 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Butadiene morpholine |
I-II-II.399 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Butadiene morpholine |
I-II-II.400 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Butadiene morpholine |
I-II-II.401 | N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Metrafenone |
I-II-II.402 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] | Metrafenone |
The mixture sequence number | Formula I compound | Reactive compound II | Reactive compound II |
Pyrimidine | |||
I-II-II.403 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Metrafenone |
I-II-II.404 | N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Metrafenone |
I-II-II.405 | N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide | 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | Metrafenone |
The mixture of Compound I and at least a reactive compound II, or simultaneously, i.e. associating or at least a Compound I of separately using and at least a reactive compound II are to the plant pathogenic fungi of wide region, and (synonym: fungi Oomycete (Oomycetes)) has excellent activity especially to be selected from Ascomycetes (Ascomycetes), Basidiomycetes (Basidiomycetes), deuteromycetes (Deuteromycetes) and Peronosporomycetes.The interior suction of in them some is effective and can be used as blade face fungicide, seed dressing is used for crop protection with fungicide and soil fungicide.They can also be used to handle seed.
They are even more important to a large amount of fungies of control in the seed of various cultivated plants such as wheat, rye, barley, oat, rice, corn, lawn, banana, cotton, soybean, coffee, sugarcane, grape vine, fruit and ornamental plants and vegetables such as cucumber, beans, tomato, potato and cucurbitaceous plant and these plants.
They especially are fit to prevent and treat the following plants disease:
● the Alternaria on vegetables, oilseed rape, sugar beet, fruit and the rice (Alternaria), for example epidemic disease chain lattice spores morning (A.solani) on potato and the tomato or chain lattice spore (A.alternata);
● the Aphanomyces on sugar beet and the vegetables (Aphanomyces);
● the Ascochyta on cereal class and the vegetables (Ascochyta);
● flat navel Helminthosporium (Bipolaris) in corn, cereal class, rice and the lawn and interior navel Helminthosporium (Drechslera), for example flat navel of the maize on the corn spore (D.maydis) of wriggling;
● the standing grain powdery mildew on the cereal class (Blumeria graminis) (powdery mildew);
● the Botrytis cinerea on strawberry, vegetables, flowers and the grape vine (Botrytis cinerea) (gray mold),
● the lettuce dish stalk mould (Bremia lactucae) on the lettuce,
● the Cercospora on corn, soybean, rice and the sugar beet (Cercospora);
● cochliobolus on corn, cereal class, the rice belongs to (Cochliobolus), the standing grain cochliobolus on the cereal class (Cochliobolus sativus) for example, the palace portion cochliobolus (Cochliobolusmiyabeanus) on the rice;
● the perverse dish spore on soybean and the cotton belongs to (Colletotricum);
● the interior navel Helminthosporium (Drechslera) on corn, cereal class, rice and the lawn, nuclear cavity Pseudomonas (Pyrenophora), for example wriggle D.tritci-repentis on spore (D.teres) or the wheat of navel in the barley filigree on the barley;
● the Eschka (Esca) on the grape vine that causes by Phaeoacremonium chlamydosporium, Ph.Aleophilum and Formitiporapunctata (synonym spot hole Phellinus (Phellinus punctatus));
● the prominent navel Helminthosporium (Exserohilum) on the corn,
● two spore powdery mildews (Erysiphe cichoracearum) on the cucumber and monofilament shell powdery mildew (Sphaerotheca fuliginea),
● Fusarium on each plant species (Fusarium) and Verticillium (Verticillium), for example fusarium graminaria (F.graminearum) on the cereal class or the sharp sickle spore (F.oxysporum) on machete sickle spore (F.culmorum) or various plants such as the tomato;
● the gaeumannomyce on the cereal class (Gaeumanomyces graminis);
● the Gibberella on cereal class and the rice (Gibberella) (for example gibberella fujikuroi on the rice (Gibberellafujikuroi));
● the Grainstaining complex on the rice;
● the Helminthosporium on corn and the rice (Helminthosporium);
● the Michrodochium nivale on the cereal class;
● the mycosphaerella on cereal class, banana and the peanut (Mycosphaerella), for example standing grain green-ball chamber bacterium (M.graminicola) on the wheat or the Fijian ball chamber bacterium (M.fijiensis) on the banana;
● the Peronospora (Peronospora) on cabbage and the bulb plant, for example rape downy mildew (P.brassicae) on the cabbage or the shallot downy mildew (P.destructor) on the onion;
● yam bean layer rest fungus (Phakopsora pachyrhizi) on the soybean and mountain horseleech layer rest fungus (Phakopsara meibomiae);
● the Phomopsis on soybean and the sunflower (Phomopsis);
● the phytophthora infestans on potato and the tomato (Phytophthora infestans);
● the Phytophthora on each plant species (Phytophthora), for example Phytophthora capsici on the green pepper (P.capsici);
● the grape on the grape vine is given birth to single shaft mould (Plasmopara viticola),
● the apple mildew bacterium on the apple (Podosphaera leucotricha),
● the rotten germ (Pseudocercosporella herpotrichoides) of the wheat-based on the cereal class,
● the false Peronospora (Pseudoperonospora) on each plant species, for example the humulus false frost of grass (P.Humili) on false downy mildew (P.Cubensis) of the Cuba on the cucumber or the lupulus;
● the Puccinia on each plant species (Puccinia), for example the wheat handle rest fungus (P.triticina) on the cereal class, bar shaped handle rust (P.striformis), barley handle rust (P.hordei) or puccinia graminis (P.graminis), or the Asparagus handle rust (P.asparagi) on the asparagus);
● the Pyricularia oryzae on the rice (Pyricularia oryzae), Bamboo grass wood photovoltaicing leather bacteria (Corticium sasakii), broom stalk Cylindrocarpon (Sarocladium oryzae), sheath rot of rice plant (S.attenuatum), rice leaf smut (Entyloma oryzae)
● the piricularia oryzae on lawn and the cereal class (Pyricularia grisea),
● the pythium on lawn, rice, corn, cotton, oilseed rape, sunflower, sugar beet, vegetables and the other plant (Pythium), the ultimate pythium spp (P.ultiumum) on each plant species for example, the melon and fruit corruption on the lawn mould (P.aphanidermatum);
● the Rhizoctonia (Rhizoctonia) on cotton, rice, potato, lawn, corn, oilseed rape, sugar beet, vegetables and each plant species, for example the miliary damping-off germ (R.solani) on beet and each plant species;
● the rye beak spore (Rhynchosporium secalis) on barley, rye and the triticale;
● the Sclerotinia on oilseed rape and the sunflower (Sclerotinia);
● wheat septoria on the wheat (Septoria tritici) and the many spores of clever withered shell (Stagonosporanodorum),
● the grape snag shell on the grape vine (Erysiphe (synonym Uncinula) necator),
● the Setospaeria on corn and the lawn belongs to,
● the silk axle smut (Sphacelotheca reilinia) on the corn,
● the Thiclaviopsis on soybean and the cotton (Thievaliopsis),
● the Tilletia on the cereal class (Tilletia),
● the Ustilago on cereal class, corn and the sugarcane (Ustilago), for example Ustilago maydis on the corn (U.maydis);
● the Venturia on apple and the pears (Venturia) (scab), for example apple scab on the apple (V.inaequalis).
Mixture of the present invention also is suitable for preventing and treating the product of harmful fungoid with protective material (as timber, paper, lacquer dispersion, fiber or fabric) and protection storage.In wood protection, should note following harmful fungoid especially: the Ascomycetes fungi, belong to (Ophiostoma spp.) as line mouth shell, long beak shell belongs to (Ceratocystisspp.), Aureobasidium pullulans (Aureobasidium pullulans), Sclerophoma spp., Chaetomium (Chaetomium spp.), Humicola (Humicola spp.), Peter's shell belongs to (Petriella spp.), the mould genus of pieces (Trichurus spp.); The Basidiomycetes fungi; belong to (Coniophoraspp.) as cellar fungus; Coriolus Qu61 (Coriolus spp.); sticking gill fungus belongs to (Gloeophyllum spp.); Lentinus (Lentinus spp.); Pleurotus (Pleurotus spp.); hole genus (Poria spp.) crouches; Merulius (Serpula spp.) and cheese Pseudomonas (Tyromyces spp.); the deuteromycetes fungi; as aspergillus (Aspergillus spp.); Cladosporium (Cladosporium spp.); Penicillium (Penicillium spp.); trichoderma (Trichoderma spp.), Alternaria (Alternaria spp.), paecilomyces (Paecilomyces spp.) and Zygomycetes (Zygomycetes) fungi; as mucor (Mucor spp.), should note following yeast in this external material protection: candida (Candida spp.) and saccharomyces cerevisiae (Saccharomyces cerevisae).
Compound I and at least a reactive compound II can be simultaneously, i.e. associating or separate administration or use successively, under the situation of separate administration order of administration usually to the prophylactico-therapeutic measures result without any influence.
When the preparation mixture, preferably use pure reactive compound I and II, can be to the reactive compound or activity of weeding or growth regulating-activity compound or the fertilizer that wherein add other antagonism harmful fungoids or other insects such as insect, spider or nematode.
Such mixture of three kinds of reactive compounds for example comprises formula I compound, especially N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide, N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-Trifluoromethyl-1 H-pyrazole-4-carboxamide, N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide, N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-1-methyl-3-difluoromethyl-1H-pyrazole-4-carboxamide or N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide, A) Zu azole, especially oxole bacterium, encircle penta azoles bacterium, triticonazole or Fluquinconazole, and insecticide, especially sharp strength spy of wherein suitable insecticide (fipronil) and anabasine are as pyrrole worm clear (acetamiprid), thiophene worm amine (clothianidin), MTI-446 (dinotefuran), Imidacloprid (imidacloprid), nitenpyram (nitenpyram), thiophene worm quinoline (thiacloprid) and thiophene worm piperazine (thiamethoxam).
Usually use the mixture of at least a Compound I and at least a reactive compound II.Yet the mixture of at least a in some cases Compound I and two kinds or the more kinds of active components of words that need may be particularly advantageous.
Other suitable on above-mentioned meaning active components especially start the reactive compound II that is mentioned, particularly above-mentioned preferred reactive compound II.
Compound I and reactive compound II are usually with 100: 1-1: 100, preferred 20: 1-1: 20, especially 10: 1-1: 10 weight ratio is used.
Need, other active components are with 20: 1-1: 20 ratio adds in the Compound I.
The type and the required effect that depend on Compound I and II, the mixture of the present invention especially rate of application under the situation of agricultural crops zone are 5-2000g/ha, preferred 20-1500g/ha, especially 50-1000g/ha.
Correspondingly, the rate of application of Compound I is generally 1-1000g/ha, preferred 10-900g/ha, especially 20-750g/ha.
Correspondingly, the rate of application of reactive compound II is generally 1-2000g/ha, preferred 10-1500g/ha, especially 40-1000g/ha.
In seed treatment, the rate of application of mixture is generally the 1-1000g/100kg seed, preferred 1-750g/100kg, especially 5-500g/100kg seed.
Methods for fighting harmful mushrooms by before or after the plant seeding or plant emerge before or after by to seed, plant or soil spraying or dusting separates or the mixture of co-administered Compound I and at least a reactive compound II or Compound I and at least a reactive compound II carries out.
Fungicidal mixture of the present invention or Compound I and at least a reactive compound II can be changed into conventional preparaton, for example solution, emulsion, suspension, pulvis, powder, paste or particle.Type of service depends on the specific purpose that is intended to; Should guarantee the meticulous as far as possible and distribution equably of mixture of the present invention in each case.
Preparaton prepares in a manner known way, for example prepares by reactive compound is mixed with solvent and/or carrier, and the words that need are used emulsifier and dispersant.Solvent/the auxiliary agent suitable to this purpose is mainly:
-water, arsol (as
Product, dimethylbenzene), paraffin (as mineral oil fractions), alcohols (as methyl alcohol, butanols, amylalcohol, benzylalcohol), ketone (as cyclohexanone, gamma-butyrolacton), pyrrolidones (N-Methyl pyrrolidone, N-octylpyrrolidone), acetic acid esters (ethylene acetate), dihydroxylic alcohols, fatty acid dimethylformamide, fatty acid and fatty acid ester.Can also use solvent mixture in principle.
-carrier is as natural minerals (as kaolin, clay, talcum, chalk) that grinds and the synthetic mineral (as silica, the silicate of high degree of dispersion) that grinds; Emulsifier such as nonionic and anion emulsifier (as polyoxyethylene aliphatic alcohol ether, alkylsulfonate and arylsulphonate) and dispersant such as lignin sulfite waste liquor and methylcellulose.
Used suitable surfactant is a lignosulphonic acid, naphthalene sulfonic acids, phenolsulfonic acid, the alkali metal salt of dibutyl naphthalene sulfonic acids, alkali salt and ammonium salt, alkylaryl sulfonates, alkyl sulfate, alkylsulfonate, aliphatic alcohol sulfate, fatty acid and sulphated fatty alcohol glycol ether, the condensation product of sulfonated naphthalene and naphthalene derivatives and formaldehyde in addition, the condensation product of naphthalene or naphthalene sulfonic acids and phenol and formaldehyde, NONIN HS 240, the ethoxylation isooctylphenol, octyl phenol, nonyl phenol, the alkyl phenyl polyglycol ether, tributyl phenyl polyglycol ether, three stearyl phenyl polyglycol ethers, alkyl aryl polyether alcohol, pure and mild fatty alcohol/ethylene oxide condensation product, ethoxylated castor oil, polyoxyethylene alkyl ether, ethoxylation polyoxypropylene, laruyl alcohol polyglycol ether acetal, sorbitol ester, lignin sulfite waste liquor and methylcellulose.
Being suitable for preparing directly, the material of spray solution, emulsion, paste or oil dispersion is that mid-boiling point arrives high boiling mineral oil fractions, as kerosene or diesel oil, the oil that also has coal tar and plant or animal origin in addition, aliphatic series, ring-type and aromatic hydrocarbon, for example toluene, dimethylbenzene, paraffin, tetrahydronaphthalene, alkylated naphthalene or derivatives thereof, methyl alcohol, ethanol, propyl alcohol, butanols, cyclohexanol, cyclohexanone, isophorone, intensive polar solvent, for example methyl-sulfoxide, N-Methyl pyrrolidone and water.
But powder, broadcast sowing with material and dusting product can by with active substance with at least-kind of a solid carrier mixes or grinds simultaneously and prepare.
Particle such as coated particle, impregnated granules and homogeneous particle can be by preparing reactive compound and the adhesion of at least a solid carrier.The example of solid carrier is that ore deposit soil is as silica gel, silicate, talcum, kaolin, activated clay (attaclay), lime stone, lime, chalk, bole, loess, clay, dolomite, diatomite, calcium sulphate, magnesium sulfate, magnesia; The synthetic material that grinds; Fertilizer such as ammonium sulfate, ammonium phosphate, ammonium nitrate, urea; The product of plant origin such as flour, bark powder, wood powder and shuck powder, cellulose powder and other solid carrier.
Preparaton comprises 0.01-95 weight % usually, the Compound I of preferred 0.1-90 weight % and the mixture of at least a reactive compound II or Compound I and at least a reactive compound II.Reactive compound is with 90-100%, and the purity of preferred 95-100% (according to NMR or HPLC spectrum) is used.
Under classify the preparaton example as:
1. the product of dilute with water
A) water-soluble concentrate (SL)
10 weight portions mixture of the present invention is dissolved in 90 weight parts waters or the water-soluble solvent.Perhaps, add wetting agent or other auxiliary agent.Reactive compound is through water dilution dissolving.Obtain the preparaton that the reactive compound total content is 10 weight % in this way.
B) dispersed concentrate (DC)
Be dissolved in 20 weight portions mixture of the present invention in the 70 weight portion cyclohexanone and add 10 weight portion dispersant such as PVP(polyvinyl pyrrolidone).Dilute with water obtains dispersion.Reactive compound content is 20 weight %.
C) emulsible concentrate (EC)
Be dissolved in 15 weight portions mixture of the present invention in the 75 weight portion dimethylbenzene and add calcium dodecyl benzene sulfonate and castor oil ethoxylate (being 5 weight portions in each case).Dilute with water obtains emulsion.The reactive compound content of this preparaton is 15 weight %.
D) emulsion (EW, EO)
Be dissolved in 25 weight portions mixture of the present invention in the 35 weight portion dimethylbenzene and add calcium dodecyl benzene sulfonate and castor oil ethoxylate (being 5 weight portions in each case).Introduce this mixture in 30 weight parts waters and make equal phase emulsion by mulser (Ultraturrax).Dilute with water obtains emulsion.The reactive compound content of this preparaton is 25 weight %.
E) suspension (SC, OD)
In the ball mill that stirs, 20 weight portions mixture of the present invention is pulverized and added 10 weight portion dispersants and wetting agent and 70 weight parts waters or organic solvent, obtain reactive compound suspension in small, broken bits.Dilute with water obtains stable reactive compound suspension.Reactive compound content in this preparaton is 20 weight %.
F) water-dispersible granule and water-soluble granular (WG, SG)
With the grinding in small, broken bits of 50 weight portions mixture of the present invention and add 50 weight portion dispersant and wetting agents, be made into water dispersible or water-soluble granular by commercial plant (as extruder, spray tower, fluid bed).Dilute with water obtains stable active compound dispersion or solution.The reactive compound content of this preparaton is 50 weight %.
G) water dispersible pow-ders and water-soluble powder (WP, SP)
75 weight portions mixture of the present invention ground in the rotor-stator grinding machine and add 25 weight portion dispersants, wetting agent and silica gel.Dilute with water obtains stable active compound dispersion or solution.The reactive compound content of this preparaton is 75 weight %.
2. the product of using without dilution
H) but dusting powder (DP)
Fully mix with the grinding in small, broken bits of 5 weight portions mixture of the present invention and with 95 weight portions kaolin in small, broken bits.But this obtains the dusting product that reactive compound content is 5 weight %.
J) particle (GR, FG, GG, MG)
With the grinding in small, broken bits of 0.5 weight portion mixture of the present invention and in conjunction with 99.5 weight portion carriers.Current methods be extrude, atomized drying or bed process.This obtains the particle of using without dilution that reactive compound content is 0.5 weight %.
K) ULV solution (UL)
10 weight portions mixture of the present invention is dissolved in 90 weight portion organic solvents such as the dimethylbenzene.This obtains the product of using without dilution that reactive compound content is 10 weight %.
Reactive compound can be directly, with its preparaton form or type of service prepared therefrom (but as directly spray solution, powder, suspension or dispersion, emulsion, oil dispersion, paste dusting product, broadcast sowing), by spraying, atomizing, dusting, broadcast sowing or water and use with material or particle.Type of service depends on the purpose that is intended to fully; Be intended to guarantee in each case that the best of reactive compound may distribute.
Moisture type of service can be prepared by emulsion concentrates, paste or wettable powder (sprayable powder, oil dispersion) by adding entry.Be preparation emulsion, paste or oil dispersion, can be with this material directly or be dissolved in back homogenizing in water in oil or the solvent by wetting agent, tackifier, dispersant or emulsifier.Yet, can also prepare concentrate and this concentrate formed by active substance, wetting agent, tackifier, dispersant or emulsifier and suitable solvent or oil and be suitable for dilute with water.
Promptly can in relative broad range, change with the activity compound concentration in the preparation.They are generally 0.0001-10%, preferred 0.01-1%.
Reactive compound also can successfully be used for ultra low volume method (ULV), wherein can use to comprise the preparaton that surpasses 95 weight % reactive compounds, or even use the reactive compound that does not contain additive.
Can in reactive compound, add various types of oil, wetting agent, adjuvant, weed killer herbicide, other pest control agent or bactericide, even the words that need only add (bucket mixes) before being close to use.These reagent usually with mixture of the present invention with 1: 100-100: 1, preferred 1: 10-10: 1 weight ratio mixing.
The polysiloxanes that suitable thus adjuvant is especially organically-modified, for example Break ThruS
Alcohol alkoxylates, for example Atplus
Atplus MBA
PlurafacLF
With
ON 30; The EO/PO block polymer, for example
RPE 2035 Hes
B; Alcohol ethoxylate, for example
XP 80; And sulfosuccinic acid dioctyl ester sodium, for example
RA.
Compound I and II or mixture or corresponding preparaton need maybe to prevent that by handle harmful fungoid, its habitat with the mixture of antifungal effective dose or the Compound I under the separate administration situation and II their plant, seed, soil, zone, material or space from using.Use and before or after harmful fungoid infects, to carry out.
Application Example
The fungicidal action of each compound of the present invention and mixture is confirmed by following test:
Use solvent/emulsifier volume ratio is 99: 1 acetone and/or methyl-sulfoxide and an emulsifier
The mixture of EL (wetting agent based on ethoxylated alkylphenol with emulsification and peptizaiton) with reactive compound separately or unite and make the stock solution that comprises the 25mg reactive compound and be made into 10ml.Then this mixture water is made into 100ml.Dilute this stock solution to following activity compound concentration with described solvent/emulsifier/aqueous mixtures.
Perhaps promptly use reactive compound oxole bacterium, triticonazole and pyraclostrobin and they are diluted with water to following activity compound concentration with preparaton with commercially available.
The leaf area percentage that infects that naked eyes are measured changes into the effectiveness of representing with the % with respect to untreated control.
Use the Abbot formula to render a service (E) by following calculating:
E=(1-α/β)·100
α corresponding to the fungal infection percentage of handling plant and
β is corresponding to the fungal infection percentage of (contrast) plant of being untreated.
Effectiveness is that 0 infecting of plant of expression processing is on close level in untreated check plant; Effectiveness is that 100 expression processing plants are infected.
The expection effectiveness use Colby formula (Colby S.R., " Synergistic and the antagonism that calculate combinations of herbicides are corresponding ", Weeds (weeds) 15, the 20-22 pages or leaves, 1967) of reactive compound combination is determined and is compared with the effectiveness of observing.
Colby formula: E=x+y-xy/100
Expection when the E working concentration is the mixture of the reactive compound A of a and b and B is renderd a service, represents with % with respect to untreated control,
Effectiveness when the x working concentration is the reactive compound A of a is represented with the % with respect to untreated control,
Effectiveness when the y working concentration is the reactive compound B of b is represented with the % with respect to untreated control.
Application Example 1-is to the activity of the tomato early blight that caused by epidemic disease chain lattice spore morning (Alternaria solani)
The leaf of potted plant tomato plant is sprayed to the drip point with activity compound concentration aqueous suspension as described below.Leaf infected with the moisture spore suspension of epidemic disease chain lattice spore in 2% biological malt solution early in second day, this suspension has 0.17 * 10
6The density of individual spore/ml.Then plant being placed temperature is 20-22 ℃ steam-laden chamber.After 5 days, the disease on the check plant that is untreated but infects has developed into and can measure the degree that infects with percentage by naked eyes.
Reactive compound/active compound combinations | Concentration [mg/l] | Ratio | Observed activity (% infects) | According to Colby activity calculated (%) |
(contrast) | --- | --- | 0 (90% infects) | --- |
Reactive compound/active compound combinations | Concentration [mg/l] | Ratio | Observed activity (% infects) | According to Colby activity calculated (%) |
The Ia.719 compound | 4 | --- | 0 | --- |
Prochloraz | 16 | --- | 30 | --- |
Pyraclostrobin | 4 | --- | 50 | --- |
Carbatene | 63 | --- | 0 | --- |
Tpn | 63 | --- | 0 | --- |
Ia.719 compound+Prochloraz | 4+16 | 1∶4 | 60 | 30 |
Ia.719 compound+pyraclostrobin | 4+4 | 1∶1 | 93 | 50 |
Ia.719 compound+Carbatene | 4+63 | 1∶4 | 70 | 0 |
Ia.179 compound+tpn | 4+63 | 1∶4 | 70 | 0 |
Application Example 2-is to the activity of the green pepper leaf gray mold that caused by Botrytis cinerea (Botrytis cinerea), and protectiveness was used in 1 day
Cultivar is sprayed to drip point with activity compound concentration aqueous suspension as described below for the green pepper rice shoot of " Neusiedler Ideal Elite " behind the 2-3 sheet leaf that reaches full growth out.To handle plant in second day, to be used in concentration be to contain 1.7 * 10 in 2% the biological malt water solution
6The spore suspension inoculation of the Botrytis cinerea of individual spore/ml.Then test plant is placed the dark climate regulation chamber of 22-24 ℃ and high atmospheric humidity.Can the percentage naked eyes after 5 days measure the fungal infection degree on the leaf.
Reactive compound/active compound combinations | Concentration [mg/l] | Ratio | Observed activity (% infects) | According to Colby activity calculated (%) |
(contrast) | --- | --- | 0 (100% infects) | --- |
The Id.344 compound | 1 | --- | 40 | --- |
The Ia.344 compound | 16 | --- | 60 | --- |
The Ij.344 compound | 4 1 | --- --- | 22 0 | --- --- |
Triticonazole | 4 | --- | 0 | --- |
Prochloraz | 4 | --- | 11 | --- |
Dimethomorph | 63 16 4 | --- --- --- | 0 0 0 | --- --- --- |
Carbatene | 16 | --- | 0 | --- |
Metrafenone | 63 16 4 | --- --- --- | 0 0 0 | --- --- --- |
Id.344 compound+dimethomorph | 1+4 | 1∶4 | 80 | 40 |
Id.344 compound+Carbatene | 1+16 | 1∶ 16 | 70 | 40 |
Reactive compound/active compound combinations | Concentration [mg/l] | Ratio | Observed activity (% infects) | According to Colby activity calculated (%) |
Id.344 compound+metrafenone | 1+4 | 1∶4 | 60 | 40 |
Ia.344 compound+dimethomorph | 16+63 | 1∶4 | 85 | 60 |
Ia.344 compound+metrafenone | 16+63 | 1∶4 | 90 | 60 |
Ij.344 compound+triticonazole | 4+4 | 1∶1 | 78 | 22 |
Ij.344 compound+Prochloraz | 1+4 | 1∶4 | 92 | 11 |
Ij.344 compound+dimethomorph | 4+16 | 1∶4 | 78 | 22 |
Ij.344 compound+metrafenone | 4+16 | 1∶4 | 100 | 22 |
The therapeutic activity of the wheat leaf rust that Application Example 3-Puccinia recondita f. sp. tritici (Puccinia recondita) causes
The leaf of potted plant wheat rice shoot that with cultivar is " Kanzler " is with the spore suspension inoculation of wheat leaf rust bacterium (Puccinia recondita f. sp. tritici).Under 20-22 ℃, basin was placed on then in the chamber of high atmospheric humidity (90-95%) 24 hours.Spore germination and germ tube are penetrated in the leaf texture during this period.The plant that to infect in second day is sprayed to the drip point with activity compound concentration above-mentioned active compounds solution as described below.After the spray-painting drying, it is cultivation 7 days in the greenhouse of 65-70% with relative atmospheric humidity that test plant is 20-22 ℃ in temperature.Measure the development degree of rust fungi on leaf then.
Reactive compound/active compound combinations | Concentration [mg/l] | Ratio | Observed activity (% infects) | According to Colby activity calculated (%) |
(contrast) | --- | --- | 0 (90% infects) | --- |
The Id.344 compound | 1 | --- | 0 | --- |
The Ij.344 compound | 1 | --- | 0 | --- |
The Ia.719 compound | 0.25 | --- | 0 | --- |
Oxole bacterium | 0.063 | --- | 0 | --- |
Triticonazole | 1 | --- | 0 | --- |
Pyraclostrobin | 1 | --- | 0 | --- |
Tpn | 16 | --- | 0 | --- |
5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluorophenyl)-[1,2,4] triazols [1,5-a] pyrimidine | 4 | --- | 40 | --- |
Id.344 compound+triticonazole | 1+1 | 1∶1 | 56 | 0 |
Id.344 compound+pyraclostrobin | 1+1 | 1∶1 | 83 | 0 |
Id.344 compound+tpn | 1+16 | 1∶16 | 78 | 0 |
Ij.344 compound+5-chloro-7-(4-methyl piperidine-1-yl)-6-(2,4, the 6-trifluoro-benzene | 1+4 | 1∶4 | 100 | 40 |
Reactive compound/active compound combinations | Concentration [mg/l] | Ratio | Observed activity (% infects) | According to Colby activity calculated (%) |
Base)-[1,2,4] triazol [1,5-a] pyrimidine | ||||
Ia.719 compound+oxole bacterium | 0.25+0.063 | 4∶1 | 30 | 0 |
Application Example 4-is to the activity of the net blotch of barley that caused by net blotch (Pyrenophora teres), and protectiveness was used in 1 day
The leaf of potted plant barley rice shoot is sprayed to the drip point with activity compound concentration aqueous suspension as described below.Dry back 24 hours of spray-painting is with the moisture spore suspension inoculation of test plant with net blotch (Pyrenophora[synonym Drechslera] teres)-net blotch pathogene.Then test plant is put into temperature and is 20-24 ℃ and relatively atmospheric humidity be the greenhouse of 95-100%.The % naked eyes that infect with whole leaf area after 6 days are measured the development of disease degree.
Reactive compound/active compound combinations | Concentration [mg/l] | Ratio | Observed activity (% infects) | According to Colby activity calculated (%) |
(contrast) | --- | --- | 0 (90% infects) | --- |
The Id.344 compound | 0.25 | --- | 67 | --- |
Oxole bacterium | 0.063 | --- | 0 | --- |
Id.344 compound+oxole bacterium | 0.25+0.063 | 4∶1 | 83 | 67 |
Result of the test shows that owing to the Synergistic phenomenon mixture of the present invention will significantly have more activity with using comparing of Colby formula expection.
Claims (11)
1. Fungicidal mixture that is used to prevent and treat the plant-pathogenic harmful fungoid, this mixture comprises following compound with the Synergistic effective dose:
1) the 1-methyl-pyrazol-4-yl carboxylic acid anilides of at least a formula I:
Wherein each substituting group is following defines:
X is an oxygen;
R
1Be C
1-C
4Alkyl or C
1-C
4Haloalkyl;
R
2Be hydrogen or halogen;
R
3, R
4R
5Be cyano group, nitro, halogen, C independently of each other
1-C
4Alkyl, C
1-C
4Haloalkyl, C
1-C
4Alkoxyl, C
1-C
4Halogenated alkoxy or C
1-C
4Alkylthio group;
With
2) Zu the reactive compound II at least a A that is selected from)-F):
A) be selected from following azole: Bitertanol, bromuconazole, cyproconazole Difenoconazole, alkene azoles alcohol, IMAZALIL, oxole bacterium, Fluquinconazole, RH-7592, Flusilazole, Flutriafol, own azoles alcohol, the acid amides azoles, cycltebuconazole, encircle penta azoles bacterium, nitrile bacterium azoles, penconazole, propiconazole, prothioconazoles, simeconazoles, triazolone, triadimenol, Tebuconazole, fluorine ether azoles, triticonazole, Prochloraz, pefurazoate, IMAZALIL, fluorine bacterium azoles, cyanogen frost azoles, benomyl, carbendazim, thiabendazole, furidazol, Guardian, kobam and hydroxyisoxazole;
B) be selected from following strobilurins class: nitrile Fluoxastrobin, ether bacterium amine, Enestroburin, fluoxastrobin, imines bacterium, fork phenalgin acid amides, orysastrobin, ZEN 90160, pyraclostrobin, oxime bacterium ester, (2-chloro-5-[1-(3-methyl benzyloxy imino) ethyl] benzyl) methyl carbamate, (2-chloro-5-[1-(6-picoline-2-base methoxyimino) ethyl] benzyl) methyl carbamate and 2-(neighbour-(2,5-dimethyl phenoxy methylene) phenyl)-3-methoxy-methyl acrylate;
C) be selected from following carboxylic acid amides: carboxin, M 9834, Boscalid, fenhexamid, flutolanil, the spirit of furan pyrazoles, third oxygen embroidery amine that goes out, metalaxyl, Metalaxyl-M, the spirit of fenfuram Evil frost, oxycarboxin, the pyrrole metsulfovax, thifluzamide, tiadinil, 3,4-two chloro-N-(2-cyano-phenyl) isothiazole-5-formamide, dimethomorph, flumorph, fluorine biphenyl bacterium, fluorine pyrrole bacterium amine, zoxamide, carpropamide, two chlorine zarilamids, mandipropamid amine, N-(2-{4-[3-(4-chlorphenyl) third-2-alkynyloxy group]-the 3-anisyl } ethyl)-2-methanesulfonamido-3-methylbutyryl amine, N-(2-{4-[3-(4-chlorphenyl)-third-2-alkynyloxy group]-the 3-anisyl } ethyl)-2-second sulfonamido-3-methylbutyryl amine, 3-(4-chlorphenyl)-3-(different third oxygen carbonylamino of 2--3-methylbutyryl amino) methyl propionate, the formula III compound:
R wherein
4Be methyl or ethyl,
N-(4 '-bromo biphenyl-2-yl)-4-difluoromethyl-2-methylthiazol-5-formamide, N-(4 '-trifluoromethyl-biphenyl-2-yl)-4-difluoromethyl-2-methylthiazol-5-formamide, N-(4 '-chloro-3 '-fluorine biphenyl-2-yl)-4-difluoromethyl-2-methylthiazol-5-formamide, N-(3 ', 4 '-two chloro-4-fluorine biphenyl-2-yls)-3-difluoromethyl-1-methylpyrazole-4-formamide, N-(3 ', 4 '-two chloro-5-fluorine biphenyl-2-yls)-and 3-difluoromethyl-1-methylpyrazole-4-formamide and N-(2-cyano-phenyl)-3,4-two chloroisothiazoles-5-formamide;
D) be selected from following heterocyclic compound: fluazinam, pyrifenox, the phonetic bacterium spirit of sulphur, encircle third pyrimidine, fenarimol, ferimzone, mepanipyrim, nuarimol, pyrimethanil, triforine, fenpiclonil Fu Evil bacterium, 4-dodecyl-2, the 6-thebaine, dodemorfe; butadiene morpholine; tridemorph; fenpropidin; different third is fixed; sterilization profit; vinclozolin; azolactone bacterium; Fenamidone; different thiophene bacterium ketone; probenazole; 5-chloro-7-(4-methyl piperidine-1-yl)-6-(2; 4; the 6-trifluorophenyl)-[1; 2; 4] triazols [1,5-a] pyrimidine; anilazine; diclomezine; pyroquilon; the third oxygen quinoline; tricyclazole; formula IV compound (2-butoxy-6-iodo-3-propyl group chromene-4-ketone):
The N of thiadiazoles element, difoltan, captan, dazomet, folpet, zarilamid, quinoxyfen and formula V, N-dimethyl-3-(3-bromo-6-fluoro-2 methyl indole-1-sulfonyl)-[1,2,4] triazole-1-sulfonamide:
E) be selected from following Carbamates: 3-(4-chlorphenyl)-3-(different third oxygen carbonylamino of 2--3-methylbutyryl amino) propionic acid of mancozeb, maneb, metham-sodium, Carbatene, ferbam, propineb, tmtd, zineb, ziram, the mould prestige of second, iprovalicarb, benzene metsulfovax, hundred dimension spirits, N-(1-(1-(4-cyano-phenyl) ethylsulfonyl) fourth-2-yl) carbamic acid 4-fluorophenyl ester, formula VI
Methyl esters:
Carbamic acid lactazone ether with formula VII:
Wherein Z is N or CH;
F) be selected from other following fungicides: guanidine class: dodine, biguanide spicy acid salt, guazatine, antibiotic class: spring thunder element, streptomycin, Polyoxin, jinggangmeisu, nitrophenyl derivative: binapacryl, karathane, dinobuton, sulfur heterocyclic ring based compound: Delan, Isoprothiolane, organo-metallic compound: triphenyltin salt, organic phosphorus compound: Hinosan, iprobenfos, fosetyl, ethyl phosphine aluminium, phosphorous acid and salt thereof, Ppyrazophos, tolelofos-methyl, organochlorine compound: tpn, Euparen, flusulfamide, hexachloro-benzene, Rabcide, Pencycuron, pcnb, thiophanate methyl, tolyfluanid, inorganic active compound: bordeaux mixture, Schweinfurt green, Kocide SD, Cupravit, basic copper sulfate, sulphur, other: cyflufenamid, cymoxanil, Milcurb, Milstem, Furalaxyl, metrafenone is with the luxuriant amine of Luo Evil.
2. according to the Fungicidal mixture of claim 1, comprise as component 1) the 1-methyl-pyrazol-4-yl carboxylic acid anilides of formula I, R wherein
1Be methyl or halogenated methyl, R
2Be hydrogen, fluorine or chlorine and R
3, R
4And R
5The halogen of respectively doing for oneself.
3. according to the Fungicidal mixture of claim 1, comprise as component 1) at least a be selected from down the group Compound I: N-(2 '-fluoro-4 '-chloro-5 '-methoxyl biphenyl-2-yl)-3-Trifluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-3-Trifluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-Trifluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-Trifluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(2 '-fluoro-4 '-chloro-5 '-methoxyl biphenyl-2-yl)-3-difluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(2 ', 3 ', 4 '-trifluoro-biphenyl-2-yl)-3-Trifluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(2 '-fluoro-4 '-chloro-5 '-methyl biphenyl-2-yl)-3-difluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-difluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-difluoromethyl-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-one chlorodifluoramethyl--1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(3 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-chlorine methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide, N-(2 ', 3 ', 4 '-trifluoro-biphenyl-2-yl)-3-methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide and N-(2 ', 4 ', 5 '-trifluoro-biphenyl-2-yl)-3-methyl fluoride-1-methyl isophthalic acid H-pyrazole-4-carboxamide.
4. according to each Fungicidal mixture among the claim 1-3, with 100: 1-1: 100 weight ratio comprises component 1) and 2).
5. composition comprises at least a liquid or solid carrier and according to each mixture among the claim 1-3.
6. method of preventing and treating the plant-pathogenic harmful fungoid is wherein handled the maybe needs plant, soil, seed, zone, material or the space that prevent fungal attack of fungi, its habitat with effective dose according to each at least a Compound I and at least a Compound I I among the claim 1-3.
7. according to the method for claim 6, wherein simultaneously, i.e. associating or separate administration or use successively according to each component 1 among the claim 1-3) and 2).
8. according to the method for claim 6 or 7, wherein use according to each component 1 among the claim 1-3 with the amount of 5-2000g/ha) and 2).
9. according to the method for claim 6 or 7, wherein use according to each component 1 among the claim 1-3 with the amount of 1-1000g/100kg seed) and 2).
10. seed comprises according to each mixture among the claim 1-3 with the amount of 1-1000g/100kg seed.
11. be suitable for preventing and treating purposes in the composition of harmful fungoid in preparation according to each Compound I and II among the claim 1-3.
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE102005037677.0 | 2005-08-05 | ||
DE102005037677 | 2005-08-05 | ||
EP06101198.7 | 2006-02-02 |
Related Child Applications (2)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CN201510003771.0A Division CN104604873A (en) | 2005-08-05 | 2006-08-01 | Fungicidal mixtures containing substituted 1-methyl pyrazol-4-yl carboxylic acid anilides |
CN201410148504.8A Division CN103947644A (en) | 2005-08-05 | 2006-08-01 | Fungicidal mixtures containing substituted 1-methyl pyrazol-4-yl carboxylic acid anilides |
Publications (1)
Publication Number | Publication Date |
---|---|
CN101257798A true CN101257798A (en) | 2008-09-03 |
Family
ID=39892148
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CNA2006800289443A Pending CN101257798A (en) | 2005-08-05 | 2006-08-01 | Fungicidal mixtures containing substituted 1-methyl pyrazol-4-yl carboxylic acid anilides |
Country Status (4)
Country | Link |
---|---|
CN (1) | CN101257798A (en) |
CR (1) | CR9730A (en) |
UA (1) | UA90160C2 (en) |
ZA (1) | ZA200801984B (en) |
Cited By (47)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN103081933A (en) * | 2012-12-26 | 2013-05-08 | 海利尔药业集团股份有限公司 | Bactericidal composition containing pyraclostrobin and fluxapyroxad |
CN103081917A (en) * | 2013-01-17 | 2013-05-08 | 湖南农大海特农化有限公司 | Fluxapyroxad-fluazinam sterilization composition |
CN103109844A (en) * | 2013-02-02 | 2013-05-22 | 广东中迅农科股份有限公司 | Fluxapyroxad and flusilazole pesticide composition |
CN103120164A (en) * | 2013-02-04 | 2013-05-29 | 广东中迅农科股份有限公司 | Fluxapyroxad-cyprodinil pesticide composition |
CN103228140A (en) * | 2010-08-05 | 2013-07-31 | 拜耳知识产权有限责任公司 | Active compound combinations comprising prothioconazole and fluxapyroxad |
CN103385256A (en) * | 2012-05-07 | 2013-11-13 | 陕西韦尔奇作物保护有限公司 | Synergistic sterilization composition containing Xemium and triazoles |
CN103385250A (en) * | 2012-05-09 | 2013-11-13 | 陕西韦尔奇作物保护有限公司 | Bactericidal composition containing fluxapyroxad |
CN103385247A (en) * | 2012-05-10 | 2013-11-13 | 陕西韦尔奇作物保护有限公司 | Bactericidal composition containing fluxapyroxad and strobilurin |
CN103385244A (en) * | 2012-05-08 | 2013-11-13 | 陕西韦尔奇作物保护有限公司 | Bactericidal composition comprising fluxapyroxad and thiocarbamate |
CN103392720A (en) * | 2013-07-30 | 2013-11-20 | 江苏龙灯化学有限公司 | Method for preventing and treating septoria lycopersici and brown rust of wheat and rust of soybeans |
CN103416410A (en) * | 2012-05-25 | 2013-12-04 | 陕西韦尔奇作物保护有限公司 | Fluxapyroxad-containing sterilization composition |
CN103416414A (en) * | 2012-05-24 | 2013-12-04 | 陕西韦尔奇作物保护有限公司 | Bactericidal composition containing Xemium and antibiotics |
CN103444753A (en) * | 2012-05-28 | 2013-12-18 | 陕西韦尔奇作物保护有限公司 | High-efficiency bactericidal composition containing fluxapyroxad |
CN103907621A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and tebuconazole, and application thereof |
CN103907608A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and trifloxystrobin and its application |
CN103907618A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and flutriafol, and application thereof |
CN103907622A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and propiconazole, and application thereof |
CN103907614A (en) * | 2012-12-31 | 2014-07-09 | 江苏丰登农药有限公司 | Composite synergic sterilization composition containing bixafen and difenoconazole and application thereof |
CN103907610A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and picoxystrobin, and application thereof |
CN103907609A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and kresoxim methyl and its application |
CN103907611A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and azoxystrobin, and application thereof |
CN103907619A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and hexaconazole, and application thereof |
CN103907620A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and difenoconazole, and application thereof |
CN104488878A (en) * | 2014-10-30 | 2015-04-08 | 东莞市瑞德丰生物科技有限公司 | Bactericidal composition |
CN104604883A (en) * | 2015-01-21 | 2015-05-13 | 浙江泰达作物科技有限公司 | Sterilizing composition containing fluxapyroxad and ipconazole as well as application of sterilizing composition |
CN104663677A (en) * | 2015-01-21 | 2015-06-03 | 浙江泰达作物科技有限公司 | Pesticide composition containing buprofezin and fluxapyroxad and application of pesticide composition |
CN104982439A (en) * | 2015-07-08 | 2015-10-21 | 广东中迅农科股份有限公司 | Pesticide combination for preventing and controlling crop powdery mildew |
CN105230628A (en) * | 2014-01-02 | 2016-01-13 | 海南正业中农高科股份有限公司 | Sterilization composition containing chitosan oligosaccharide and fluxapyroxad |
CN105265443A (en) * | 2014-05-27 | 2016-01-27 | 深圳诺普信农化股份有限公司 | Bactericidal composition containing fluxapyroxad |
CN105432639A (en) * | 2015-12-07 | 2016-03-30 | 河北省农林科学院植物保护研究所 | Sterilization composition for preventing and curing vegetable disease and application |
CN105454245A (en) * | 2016-01-19 | 2016-04-06 | 陕西上格之路生物科学有限公司 | Sterilization composition containing metrafenone and fluxapyroxad |
CN105519538A (en) * | 2015-12-20 | 2016-04-27 | 广东中迅农科股份有限公司 | Sterilization composition containing fluxapyroxad and meptyldinocap |
CN105724386A (en) * | 2012-05-25 | 2016-07-06 | 陕西韦尔奇作物保护有限公司 | Fluxapyroxad-containing bacteriocidal composition |
CN105766930A (en) * | 2016-04-26 | 2016-07-20 | 南京华洲药业有限公司 | Sterilization composition containing isopyrazam and cyflufenamid and application of sterilization composition |
CN105794792A (en) * | 2016-04-26 | 2016-07-27 | 南京华洲药业有限公司 | Bactericidal composition containing fluxapyroxad and oxadixyl and application of bactericidal composition |
CN105794793A (en) * | 2012-05-25 | 2016-07-27 | 陕西韦尔奇作物保护有限公司 | Sterilization composition containing fluxapyroxad |
CN105831139A (en) * | 2016-04-26 | 2016-08-10 | 南京华洲药业有限公司 | Bactericidal composition containing fluxapyroxad and benomyl and application thereof |
CN105831131A (en) * | 2016-04-26 | 2016-08-10 | 南京华洲药业有限公司 | Bactericidal composition containing fluxapyroxad and thiabendazole and application thereof |
CN105961400A (en) * | 2016-04-26 | 2016-09-28 | 南京华洲药业有限公司 | Bactericidal composition containing fluxapyroxad and diniconazole and application thereof |
CN106172453A (en) * | 2015-04-29 | 2016-12-07 | 深圳诺普信农化股份有限公司 | A kind of bactericidal composition and application thereof |
CN106172431A (en) * | 2016-07-12 | 2016-12-07 | 安徽省农业科学院植物保护与农产品质量安全研究所 | A kind of Fluxapyroxad-containsterilization and the bactericidal composition of probenazole |
CN106212474A (en) * | 2016-04-26 | 2016-12-14 | 南京华洲药业有限公司 | A kind of Fluxapyroxad-containsterilization and the bactericidal composition of cycloheximide triazole and application thereof |
CN108013049A (en) * | 2016-11-03 | 2018-05-11 | 深圳诺普信农化股份有限公司 | Bactericidal composition |
CN108013042A (en) * | 2016-11-03 | 2018-05-11 | 深圳诺普信农化股份有限公司 | A kind of bactericidal composition using fluxapyroxad as main component |
CN108013043A (en) * | 2016-11-03 | 2018-05-11 | 深圳诺普信农化股份有限公司 | A kind of bactericidal composition containing fluxapyroxad |
CN109169675A (en) * | 2018-09-29 | 2019-01-11 | 陕西上格之路生物科学有限公司 | A kind of bactericidal composition of Fluxapyroxad-containsterilization and copper 8-hydroxyquinolinate |
CN109221161A (en) * | 2017-07-10 | 2019-01-18 | 江苏龙灯化学有限公司 | A kind of bactericidal composition |
-
2006
- 2006-08-01 UA UAA200802848A patent/UA90160C2/en unknown
- 2006-08-01 CN CNA2006800289443A patent/CN101257798A/en active Pending
-
2008
- 2008-02-14 CR CR9730A patent/CR9730A/en unknown
- 2008-03-03 ZA ZA200801984A patent/ZA200801984B/en unknown
Cited By (68)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN104365610A (en) * | 2010-08-05 | 2015-02-25 | 拜耳知识产权有限责任公司 | Active compounds combinations comprising prothioconazole and fluxapyroxad |
US9155305B2 (en) | 2010-08-05 | 2015-10-13 | Bayer Intellectual Property | Active compounds combinations comprising prothioconazole and fluxapyroxad |
US9167818B2 (en) | 2010-08-05 | 2015-10-27 | Bayer Intellectual Property Gmbh | Active compounds combinations comprising prothioconazole and fluxapyroxad |
CN103228140A (en) * | 2010-08-05 | 2013-07-31 | 拜耳知识产权有限责任公司 | Active compound combinations comprising prothioconazole and fluxapyroxad |
CN104285962A (en) * | 2010-08-05 | 2015-01-21 | 拜耳知识产权有限责任公司 | Active compounds combinations comprising prothioconazole and fluxapyroxad |
CN103385256A (en) * | 2012-05-07 | 2013-11-13 | 陕西韦尔奇作物保护有限公司 | Synergistic sterilization composition containing Xemium and triazoles |
CN103385244A (en) * | 2012-05-08 | 2013-11-13 | 陕西韦尔奇作物保护有限公司 | Bactericidal composition comprising fluxapyroxad and thiocarbamate |
CN103385250A (en) * | 2012-05-09 | 2013-11-13 | 陕西韦尔奇作物保护有限公司 | Bactericidal composition containing fluxapyroxad |
CN103385247A (en) * | 2012-05-10 | 2013-11-13 | 陕西韦尔奇作物保护有限公司 | Bactericidal composition containing fluxapyroxad and strobilurin |
CN103416414A (en) * | 2012-05-24 | 2013-12-04 | 陕西韦尔奇作物保护有限公司 | Bactericidal composition containing Xemium and antibiotics |
CN103416414B (en) * | 2012-05-24 | 2015-11-25 | 陕西韦尔奇作物保护有限公司 | The bactericidal composition of a kind of fluorine-containing azoles bacterium acid amides and antibiotics |
CN103416410A (en) * | 2012-05-25 | 2013-12-04 | 陕西韦尔奇作物保护有限公司 | Fluxapyroxad-containing sterilization composition |
CN105724386A (en) * | 2012-05-25 | 2016-07-06 | 陕西韦尔奇作物保护有限公司 | Fluxapyroxad-containing bacteriocidal composition |
CN105794793A (en) * | 2012-05-25 | 2016-07-27 | 陕西韦尔奇作物保护有限公司 | Sterilization composition containing fluxapyroxad |
CN103416410B (en) * | 2012-05-25 | 2016-08-03 | 陕西韦尔奇作物保护有限公司 | A kind of bactericidal composition of Fluxapyroxad-containsterilization |
CN105724386B (en) * | 2012-05-25 | 2018-06-26 | 陕西韦尔奇作物保护有限公司 | A kind of bactericidal composition of Fluxapyroxad-containsterilization |
CN105794793B (en) * | 2012-05-25 | 2018-11-20 | 陕西韦尔奇作物保护有限公司 | A kind of bactericidal composition of Fluxapyroxad-containsterilization |
CN103444753A (en) * | 2012-05-28 | 2013-12-18 | 陕西韦尔奇作物保护有限公司 | High-efficiency bactericidal composition containing fluxapyroxad |
CN103081933A (en) * | 2012-12-26 | 2013-05-08 | 海利尔药业集团股份有限公司 | Bactericidal composition containing pyraclostrobin and fluxapyroxad |
CN103907614B (en) * | 2012-12-31 | 2016-03-16 | 江苏丰登作物保护股份有限公司 | A kind of composite synergistic bactericidal composition and application thereof containing biphenyl pyrrole bacterium amine and Difenoconazole |
CN103907614A (en) * | 2012-12-31 | 2014-07-09 | 江苏丰登农药有限公司 | Composite synergic sterilization composition containing bixafen and difenoconazole and application thereof |
CN103907620B (en) * | 2013-01-06 | 2016-01-06 | 江苏丰登作物保护股份有限公司 | The bactericidal composition of a kind of fluorine-containing azoles bacterium acid amides and Difenoconazole and application thereof |
CN103907621A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and tebuconazole, and application thereof |
CN103907619A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and hexaconazole, and application thereof |
CN103907611A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and azoxystrobin, and application thereof |
CN103907620A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and difenoconazole, and application thereof |
CN103907610B (en) * | 2013-01-06 | 2016-05-04 | 江苏丰登作物保护股份有限公司 | Bactericidal composition and the application thereof of a kind of fluorine-containing azoles bacterium acid amides and ZEN 90160 |
CN103907622B (en) * | 2013-01-06 | 2016-04-06 | 江苏丰登作物保护股份有限公司 | The bactericidal composition of a kind of fluorine-containing azoles bacterium acid amides and propiconazole and application thereof |
CN103907609A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and kresoxim methyl and its application |
CN103907608A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and trifloxystrobin and its application |
CN103907610A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and picoxystrobin, and application thereof |
CN103907622A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and propiconazole, and application thereof |
CN103907618B (en) * | 2013-01-06 | 2016-01-06 | 江苏丰登作物保护股份有限公司 | The bactericidal composition of a kind of fluorine-containing azoles bacterium acid amides and Flutriafol and application thereof |
CN103907621B (en) * | 2013-01-06 | 2016-01-06 | 江苏丰登作物保护股份有限公司 | The bactericidal composition of a kind of fluorine-containing azoles bacterium acid amides and Tebuconazole and application thereof |
CN103907618A (en) * | 2013-01-06 | 2014-07-09 | 江苏丰登农药有限公司 | Sterilization composition containing fluxapyroxad and flutriafol, and application thereof |
CN103907619B (en) * | 2013-01-06 | 2016-01-06 | 江苏丰登作物保护股份有限公司 | The bactericidal composition of a kind of fluorine-containing azoles bacterium acid amides and own azoles alcohol and application thereof |
CN103081917A (en) * | 2013-01-17 | 2013-05-08 | 湖南农大海特农化有限公司 | Fluxapyroxad-fluazinam sterilization composition |
CN103109844A (en) * | 2013-02-02 | 2013-05-22 | 广东中迅农科股份有限公司 | Fluxapyroxad and flusilazole pesticide composition |
CN103120164A (en) * | 2013-02-04 | 2013-05-29 | 广东中迅农科股份有限公司 | Fluxapyroxad-cyprodinil pesticide composition |
CN103392720A (en) * | 2013-07-30 | 2013-11-20 | 江苏龙灯化学有限公司 | Method for preventing and treating septoria lycopersici and brown rust of wheat and rust of soybeans |
CN105230628A (en) * | 2014-01-02 | 2016-01-13 | 海南正业中农高科股份有限公司 | Sterilization composition containing chitosan oligosaccharide and fluxapyroxad |
CN105230628B (en) * | 2014-01-02 | 2017-11-03 | 海南正业中农高科股份有限公司 | Bactericidal composition containing chitosan oligosaccharide and fluxapyroxad |
CN105265443A (en) * | 2014-05-27 | 2016-01-27 | 深圳诺普信农化股份有限公司 | Bactericidal composition containing fluxapyroxad |
CN104488878A (en) * | 2014-10-30 | 2015-04-08 | 东莞市瑞德丰生物科技有限公司 | Bactericidal composition |
CN104604883A (en) * | 2015-01-21 | 2015-05-13 | 浙江泰达作物科技有限公司 | Sterilizing composition containing fluxapyroxad and ipconazole as well as application of sterilizing composition |
CN104663677A (en) * | 2015-01-21 | 2015-06-03 | 浙江泰达作物科技有限公司 | Pesticide composition containing buprofezin and fluxapyroxad and application of pesticide composition |
CN104663677B (en) * | 2015-01-21 | 2016-08-24 | 浙江泰达作物科技有限公司 | A kind of composition pesticide containing Buprofezin and fluxapyroxad and application thereof |
CN106172453A (en) * | 2015-04-29 | 2016-12-07 | 深圳诺普信农化股份有限公司 | A kind of bactericidal composition and application thereof |
CN104982439A (en) * | 2015-07-08 | 2015-10-21 | 广东中迅农科股份有限公司 | Pesticide combination for preventing and controlling crop powdery mildew |
CN105432639A (en) * | 2015-12-07 | 2016-03-30 | 河北省农林科学院植物保护研究所 | Sterilization composition for preventing and curing vegetable disease and application |
CN105519538A (en) * | 2015-12-20 | 2016-04-27 | 广东中迅农科股份有限公司 | Sterilization composition containing fluxapyroxad and meptyldinocap |
CN105454245A (en) * | 2016-01-19 | 2016-04-06 | 陕西上格之路生物科学有限公司 | Sterilization composition containing metrafenone and fluxapyroxad |
CN105961400A (en) * | 2016-04-26 | 2016-09-28 | 南京华洲药业有限公司 | Bactericidal composition containing fluxapyroxad and diniconazole and application thereof |
CN105831131B (en) * | 2016-04-26 | 2018-07-17 | 南京华洲药业有限公司 | A kind of bactericidal composition and its application of Fluxapyroxad-containsterilization and probenazole |
CN105766930A (en) * | 2016-04-26 | 2016-07-20 | 南京华洲药业有限公司 | Sterilization composition containing isopyrazam and cyflufenamid and application of sterilization composition |
CN106212474A (en) * | 2016-04-26 | 2016-12-14 | 南京华洲药业有限公司 | A kind of Fluxapyroxad-containsterilization and the bactericidal composition of cycloheximide triazole and application thereof |
CN105831139A (en) * | 2016-04-26 | 2016-08-10 | 南京华洲药业有限公司 | Bactericidal composition containing fluxapyroxad and benomyl and application thereof |
CN105961400B (en) * | 2016-04-26 | 2018-08-03 | 南京华洲药业有限公司 | A kind of bactericidal composition and its application of Fluxapyroxad-containsterilization and olefin conversion |
CN105831131A (en) * | 2016-04-26 | 2016-08-10 | 南京华洲药业有限公司 | Bactericidal composition containing fluxapyroxad and thiabendazole and application thereof |
CN105794792A (en) * | 2016-04-26 | 2016-07-27 | 南京华洲药业有限公司 | Bactericidal composition containing fluxapyroxad and oxadixyl and application of bactericidal composition |
CN105794792B (en) * | 2016-04-26 | 2018-05-22 | 南京华洲药业有限公司 | The bactericidal composition and its application of a kind of Fluxapyroxad-containsterilization and Wakil |
CN106172431A (en) * | 2016-07-12 | 2016-12-07 | 安徽省农业科学院植物保护与农产品质量安全研究所 | A kind of Fluxapyroxad-containsterilization and the bactericidal composition of probenazole |
CN108013043A (en) * | 2016-11-03 | 2018-05-11 | 深圳诺普信农化股份有限公司 | A kind of bactericidal composition containing fluxapyroxad |
CN108013042A (en) * | 2016-11-03 | 2018-05-11 | 深圳诺普信农化股份有限公司 | A kind of bactericidal composition using fluxapyroxad as main component |
CN108013049A (en) * | 2016-11-03 | 2018-05-11 | 深圳诺普信农化股份有限公司 | Bactericidal composition |
CN109221161A (en) * | 2017-07-10 | 2019-01-18 | 江苏龙灯化学有限公司 | A kind of bactericidal composition |
CN109169675A (en) * | 2018-09-29 | 2019-01-11 | 陕西上格之路生物科学有限公司 | A kind of bactericidal composition of Fluxapyroxad-containsterilization and copper 8-hydroxyquinolinate |
CN109169675B (en) * | 2018-09-29 | 2020-12-11 | 陕西上格之路生物科学有限公司 | Bactericidal composition containing fluxapyroxad and oxine-copper |
Also Published As
Publication number | Publication date |
---|---|
ZA200801984B (en) | 2009-09-30 |
CR9730A (en) | 2008-07-29 |
UA90160C2 (en) | 2010-04-12 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
CN101257798A (en) | Fungicidal mixtures containing substituted 1-methyl pyrazol-4-yl carboxylic acid anilides | |
JP5618479B2 (en) | Bactericidal mixture comprising substituted 1-methylpyrazol-4-ylcarboxyanilides | |
CN101087530B (en) | Fungicidal mixtures | |
US20090123561A1 (en) | Fungicide mixtures based on 1-methyl-pyrazol-4-ylcarboxanilides | |
US20090239748A1 (en) | Fungicidal Mixtures Based on 2,5-Disubstituted N-Biphenylpyrazolcarboxamides | |
CN101267735A (en) | Fungicidal mixtures comprising N-[2-(haloalk(enyl)oxy)phenyl]carboxamides | |
CN101087529A (en) | Fungicidal mixtures | |
US20090233795A1 (en) | Fungicidal Mixtres Based On 3-Monosubstituted N-Bipenyl-Pyrazolecarboxamides | |
JP2009502860A (en) | Bactericidal mixture based on azolopyrimidinylamine | |
CN101262764A (en) | Fungicide mixtures based on 1-methyl-pyrazol-4-yl carboxylic acid anilides | |
CN1937920A (en) | Ternary fungicidal mixtures | |
US20090042724A1 (en) | Fungicidal mixtures based on 2,4-disubstituted n-biphenylpyrazolecarboxamides | |
US20090203523A1 (en) | Fungicidal Mixtures Made From 1-Methylpyrazol-4-Ylcarboxanilides | |
WO2007003643A1 (en) | Fungicidal mixtures based on 3,4-disubstituted pyrazolecarboxylic acid biphenylamides | |
CN101212902A (en) | Fungicide mixtures based on 3,5-disubstituted pyrazol-carboxylic acid biphenylamides | |
WO2007003564A1 (en) | Fungicide mixtures based on 3,5-disubstituted pyrazol-carboxylic acid biphenylamides | |
CN101217873A (en) | Fungicidal mixtures made from 1-methylpyrazol-4-ylcarboxanilides | |
US20090042725A1 (en) | Fungicidal Mixtures Based on 3,5-Disubstituted N-Biphenyl-Pyrazolcarboxamides | |
CN101212900A (en) | Fungicide mixtures based on 2,4-disubstituted pyrazole carboxylic acid biphenylamides | |
CN101212901A (en) | Fungicidal mixtures based on 2,5-disubstituted pyrazol carboxylic acid biphenylamides | |
CN101247723A (en) | Fungicide mixtures based on 3-monosubstituted pyrazole carboxylic acid biphenyl amides | |
JP2009526745A (en) | Bactericidal mixture based on 2,4-disubstituted N-biphenylpyrazolecarboxamide |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
C06 | Publication | ||
PB01 | Publication | ||
C10 | Entry into substantive examination | ||
SE01 | Entry into force of request for substantive examination | ||
C12 | Rejection of a patent application after its publication | ||
RJ01 | Rejection of invention patent application after publication |
Application publication date: 20080903 |