CH670703A5 - - Google Patents
Download PDFInfo
- Publication number
- CH670703A5 CH670703A5 CH2309/86A CH230986A CH670703A5 CH 670703 A5 CH670703 A5 CH 670703A5 CH 2309/86 A CH2309/86 A CH 2309/86A CH 230986 A CH230986 A CH 230986A CH 670703 A5 CH670703 A5 CH 670703A5
- Authority
- CH
- Switzerland
- Prior art keywords
- coil
- soft iron
- permanent magnets
- iron yoke
- lever
- Prior art date
Links
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 46
- 229910052742 iron Inorganic materials 0.000 claims description 20
- 238000004804 winding Methods 0.000 claims description 6
- 238000005452 bending Methods 0.000 claims description 3
- 239000000696 magnetic material Substances 0.000 claims 4
- 230000004323 axial length Effects 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 238000005516 engineering process Methods 0.000 claims 1
- 230000006698 induction Effects 0.000 claims 1
- 230000000149 penetrating effect Effects 0.000 claims 1
- 238000006073 displacement reaction Methods 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 238000005303 weighing Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 2
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01G—WEIGHING
- G01G7/00—Weighing apparatus wherein the balancing is effected by magnetic, electromagnetic, or electrostatic action, or by means not provided for in the preceding groups
- G01G7/02—Weighing apparatus wherein the balancing is effected by magnetic, electromagnetic, or electrostatic action, or by means not provided for in the preceding groups by electromagnetic action
Landscapes
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- General Physics & Mathematics (AREA)
- Electromagnets (AREA)
- Magnetic Treatment Devices (AREA)
- Housings And Mounting Of Transformers (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH2309/86A CH670703A5 (enExample) | 1986-06-06 | 1986-06-06 | |
| JP1987029874U JPS62199643U (enExample) | 1986-06-06 | 1987-02-28 | |
| DE19873713636 DE3713636A1 (de) | 1986-06-06 | 1987-04-23 | Elektrische waage |
| DE8705914U DE8705914U1 (de) | 1986-06-06 | 1987-04-23 | Elektrische Waage |
| US07/050,406 US4722409A (en) | 1986-06-06 | 1987-05-18 | Compact weighing apparatus of the electromagnetic load compensation type |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH2309/86A CH670703A5 (enExample) | 1986-06-06 | 1986-06-06 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH670703A5 true CH670703A5 (enExample) | 1989-06-30 |
Family
ID=4230790
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH2309/86A CH670703A5 (enExample) | 1986-06-06 | 1986-06-06 |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4722409A (enExample) |
| JP (1) | JPS62199643U (enExample) |
| CH (1) | CH670703A5 (enExample) |
| DE (2) | DE3713636A1 (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH675158A5 (enExample) * | 1988-06-14 | 1990-08-31 | Mettler Toledo Ag | |
| DE3829637C1 (enExample) * | 1988-09-01 | 1990-04-12 | Sartorius Gmbh, 3400 Goettingen, De | |
| CH675913A5 (enExample) * | 1988-11-15 | 1990-11-15 | Mettler Toledo Ag | |
| US5000274A (en) * | 1989-01-19 | 1991-03-19 | K-Tron International, Inc. | Weight sensor |
| DE3936364A1 (de) * | 1989-11-02 | 1991-05-08 | Sartorius Gmbh | Oberschalige elektronische waage mit parallelfuehrung |
| CH681327A5 (enExample) * | 1990-12-04 | 1993-02-26 | Mettler Toledo Ag | |
| US5856638A (en) * | 1996-07-19 | 1999-01-05 | Mettler-Toledo Gmbh | Weighing apparatus having temperature-modified electromagnetic compensation means |
| DE19729623B4 (de) * | 1997-07-10 | 2004-10-07 | Mettler-Toledo Gmbh | Anordnung zum Befestigen einer Parallelogrammführung in einer Kraftmeßvorrichtung |
| US6693245B2 (en) * | 2000-09-29 | 2004-02-17 | Anritsu Corporation | Electronic balance which is easily assembled, maintained, downsized and improved with respect to weighing performance, and method for manufacturing the same |
| MY136646A (en) * | 2004-05-11 | 2008-11-28 | Toshiba Elevator Kk | Magnet unit, elevator guiding apparatus and weighing apparatus |
| ATE468593T1 (de) * | 2007-03-05 | 2010-06-15 | Mettler Toledo Ag | Spule eines kraftmesssystems und verfahren zu deren herstellung |
| EP2690415B2 (de) * | 2012-07-23 | 2022-05-18 | Mettler-Toledo GmbH | Kraftmessvorrichtung mit Verschiebegewicht |
| EA201890239A3 (ru) | 2013-03-14 | 2018-10-31 | Алкермес Фарма Айэрлэнд Лимитед | Фумараты как пролекарства и их применение при лечении различных заболеваний |
| US8669281B1 (en) | 2013-03-14 | 2014-03-11 | Alkermes Pharma Ireland Limited | Prodrugs of fumarates and their use in treating various diseases |
| JP7223911B1 (ja) * | 2022-11-01 | 2023-02-16 | 株式会社エー・アンド・デイ | 電子天びん |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH652501A5 (de) * | 1980-07-31 | 1985-11-15 | Sartorius Gmbh | Waage mit elektromagnetischer kraftkompensation. |
| CH647322A5 (de) * | 1980-08-22 | 1985-01-15 | Mettler Instrumente Ag | Waage mit elektromagnetischer kraftkompensation. |
| CH654411A5 (de) * | 1981-06-02 | 1986-02-14 | Mettler Instrumente Ag | Elektrische waage. |
| DE3211163A1 (de) * | 1982-03-26 | 1983-09-29 | Sartorius GmbH, 3400 Göttingen | Elektromagnetisch kraftkompensierende waage |
| CH661353A5 (de) * | 1983-12-23 | 1987-07-15 | Mettler Instrumente Ag | Elektrische waage. |
| DE3401857A1 (de) * | 1984-01-20 | 1985-08-01 | Sartorius GmbH, 3400 Göttingen | Elektrische mikrowaage |
| JPS6114524A (ja) * | 1984-06-29 | 1986-01-22 | Shimadzu Corp | 電子天びん |
-
1986
- 1986-06-06 CH CH2309/86A patent/CH670703A5/de not_active IP Right Cessation
-
1987
- 1987-02-28 JP JP1987029874U patent/JPS62199643U/ja active Pending
- 1987-04-23 DE DE19873713636 patent/DE3713636A1/de not_active Withdrawn
- 1987-04-23 DE DE8705914U patent/DE8705914U1/de not_active Expired
- 1987-05-18 US US07/050,406 patent/US4722409A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| US4722409A (en) | 1988-02-02 |
| DE3713636A1 (de) | 1987-12-10 |
| JPS62199643U (enExample) | 1987-12-19 |
| DE8705914U1 (de) | 1987-10-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH670703A5 (enExample) | ||
| DE112017007752B4 (de) | Kombinationsstromerfassungseinrichtung | |
| DE69833953T2 (de) | Selbstgespeister stromfühler | |
| EP0955530A1 (de) | Waage mit einem Ankopplungsbereich für ein Kalibriergewicht | |
| DE4119734A1 (de) | Vorrichtung zur kraftuntersetzung in einer kraftmesseinrichtung, insbesondere einer waage | |
| EP2032954A1 (de) | Kalibriergewichtsanordnung für eine elektronische waage | |
| EP0070442A1 (de) | Magnetoelastischer Kraftmesser zur Messung von Schubspannungen | |
| DE7626124U1 (de) | Praezisionswaage | |
| EP0555876B1 (de) | Kraftmessvorrichtung, insbesondere Waage, mit elektromagnetischem Zeiger | |
| DE19542899B4 (de) | Wechselstromsensor auf der Basis einer Parallelplattengeometrie und mit einem Shunt zur Selbstspeisung | |
| DE10141849B4 (de) | Stromdetektorvorrichtung und Verfahren zum Detektieren von elektrischem Stroms | |
| DE3113617C2 (enExample) | ||
| DE10024017B4 (de) | Wägeaufnehmer mit mehreren Übersetzungshebeln | |
| DE3010402A1 (de) | Elektrische waage | |
| DE102005027003C5 (de) | Elektronische Waage | |
| DE8119043U1 (de) | Waage mit elektromagnetischer kraftkompensation | |
| DE3406942A1 (de) | Drucksensor | |
| DE1959406B2 (de) | Messonde fuer wirbelstroeme | |
| CH643065A5 (de) | Elektromagnetische kraftkompensierende waegevorrichtung. | |
| DE10060189A1 (de) | Kapazitätsabstandssensor für Vorrichtung zur Bestimmung einer Oberflächenkonfiguration | |
| DE3127939C2 (enExample) | ||
| DE3743526C2 (enExample) | ||
| DE3218943C2 (enExample) | ||
| CH652501A5 (de) | Waage mit elektromagnetischer kraftkompensation. | |
| CH591685A5 (en) | Top pan electromagnetic balance - uses load and compensating coils at opposite ends of supporting lever to give wide range |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PFA | Name/firm changed |
Owner name: METTLER-TOLEDO AG |
|
| PL | Patent ceased |