CH658062A5 - Verfahren zur herstellung von blockpolyetheresteramiden. - Google Patents
Verfahren zur herstellung von blockpolyetheresteramiden. Download PDFInfo
- Publication number
- CH658062A5 CH658062A5 CH4228/83A CH422883A CH658062A5 CH 658062 A5 CH658062 A5 CH 658062A5 CH 4228/83 A CH4228/83 A CH 4228/83A CH 422883 A CH422883 A CH 422883A CH 658062 A5 CH658062 A5 CH 658062A5
- Authority
- CH
- Switzerland
- Prior art keywords
- polyether ester
- polycondensation
- block polyether
- carboxyl
- minutes
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 4
- 229920006146 polyetheresteramide block copolymer Polymers 0.000 description 28
- 239000003054 catalyst Substances 0.000 description 26
- 238000006068 polycondensation reaction Methods 0.000 description 22
- 230000032050 esterification Effects 0.000 description 17
- 238000005886 esterification reaction Methods 0.000 description 17
- 238000000034 method Methods 0.000 description 17
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 13
- 239000004952 Polyamide Substances 0.000 description 12
- 229920002647 polyamide Polymers 0.000 description 12
- 239000007787 solid Substances 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 9
- QHGNHLZPVBIIPX-UHFFFAOYSA-N tin(ii) oxide Chemical compound [Sn]=O QHGNHLZPVBIIPX-UHFFFAOYSA-N 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- 239000000178 monomer Substances 0.000 description 7
- 229920000642 polymer Polymers 0.000 description 7
- IUTCEZPPWBHGIX-UHFFFAOYSA-N tin(2+) Chemical class [Sn+2] IUTCEZPPWBHGIX-UHFFFAOYSA-N 0.000 description 6
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 239000011261 inert gas Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 150000002009 diols Chemical class 0.000 description 4
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 229920002292 Nylon 6 Polymers 0.000 description 3
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 3
- -1 aromatic carboxylic acids Chemical class 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 229920000570 polyether Polymers 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000010936 titanium Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 229910052726 zirconium Inorganic materials 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- JHWNWJKBPDFINM-UHFFFAOYSA-N Laurolactam Chemical compound O=C1CCCCCCCCCCCN1 JHWNWJKBPDFINM-UHFFFAOYSA-N 0.000 description 2
- 229920000571 Nylon 11 Polymers 0.000 description 2
- 229920000299 Nylon 12 Polymers 0.000 description 2
- 239000004721 Polyphenylene oxide Substances 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 150000004770 chalcogenides Chemical class 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- TVIDDXQYHWJXFK-UHFFFAOYSA-N dodecanedioic acid Chemical compound OC(=O)CCCCCCCCCCC(O)=O TVIDDXQYHWJXFK-UHFFFAOYSA-N 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- 229920006149 polyester-amide block copolymer Polymers 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 229920000909 polytetrahydrofuran Polymers 0.000 description 2
- 239000007790 solid phase Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 229920001169 thermoplastic Polymers 0.000 description 2
- 239000004416 thermosoftening plastic Substances 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- WKGSVIBLXUJCRR-UHFFFAOYSA-L dibenzoyloxytin Chemical compound [Sn+2].[O-]C(=O)C1=CC=CC=C1.[O-]C(=O)C1=CC=CC=C1 WKGSVIBLXUJCRR-UHFFFAOYSA-L 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 229910052735 hafnium Inorganic materials 0.000 description 1
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 description 1
- 239000012760 heat stabilizer Substances 0.000 description 1
- 238000000265 homogenisation Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- XPGAWFIWCWKDDL-UHFFFAOYSA-N propan-1-olate;zirconium(4+) Chemical compound [Zr+4].CCC[O-].CCC[O-].CCC[O-].CCC[O-] XPGAWFIWCWKDDL-UHFFFAOYSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/44—Polyester-amides
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyamides (AREA)
- Polyesters Or Polycarbonates (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH4228/83A CH658062A5 (de) | 1983-08-04 | 1983-08-04 | Verfahren zur herstellung von blockpolyetheresteramiden. |
| DE19843428404 DE3428404A1 (de) | 1983-08-04 | 1984-08-01 | Verfahren zur herstellung von blockpolyetheresteramiden |
| JP59161639A JPS6099127A (ja) | 1983-08-04 | 1984-08-02 | 熱可塑性ブロツクポリエ−テルエステルアミドの製造法 |
| GB08419801A GB2144441B (en) | 1983-08-04 | 1984-08-03 | Process for the preparation of block polyetheresteramides |
| FR8412371A FR2550211B1 (fr) | 1983-08-04 | 1984-08-03 | Procede de preparation de polyetheresteramides sequences |
| US06/829,470 US4689393A (en) | 1983-08-04 | 1986-02-13 | Preparation of block polyetherester amide from carboxy terminated polyamide and dihydroxy polyether with tin compound catalyst |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH4228/83A CH658062A5 (de) | 1983-08-04 | 1983-08-04 | Verfahren zur herstellung von blockpolyetheresteramiden. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH658062A5 true CH658062A5 (de) | 1986-10-15 |
Family
ID=4272198
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH4228/83A CH658062A5 (de) | 1983-08-04 | 1983-08-04 | Verfahren zur herstellung von blockpolyetheresteramiden. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4689393A (enExample) |
| JP (1) | JPS6099127A (enExample) |
| CH (1) | CH658062A5 (enExample) |
| DE (1) | DE3428404A1 (enExample) |
| FR (1) | FR2550211B1 (enExample) |
| GB (1) | GB2144441B (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS60170624A (ja) * | 1984-02-14 | 1985-09-04 | Toray Ind Inc | ポリエ−テルエステルアミドの製法 |
| CH668600A5 (de) * | 1986-03-20 | 1989-01-13 | Inventa Ag | Verfahren zur herstellung von thermoplastisch verarbeitbaren blockpolyurethanamiden mit durch esterbindung verknuepften polyurethan- und polyamidsegmenten und deren verwendung. |
| CH669678A5 (enExample) * | 1986-11-17 | 1989-03-31 | Inventa Ag | |
| FR2639644A1 (fr) * | 1988-11-25 | 1990-06-01 | Atochem | Film elastomere thermoplastique permeable a la vapeur d'eau a base de polyetheresteramide, son procede de fabrication et articles comprenant un tel film |
| DE3917017A1 (de) * | 1989-05-24 | 1990-11-29 | Inventa Ag | Thermoplastisch verarbeitbare elastomere blockcopolyetheresteretheramide, verfahren zu ihrer herstellung und ihre verwendung |
| JPH04501124A (ja) * | 1989-08-09 | 1992-02-27 | ドクトル フリッシェ ゲーエムベーハー | プラスチック製造に適した新規なモノマー |
| US5652326A (en) * | 1993-03-03 | 1997-07-29 | Sanyo Chemical Industries, Ltd. | Polyetheresteramide and antistatic resin composition |
| US6673873B1 (en) | 1999-08-25 | 2004-01-06 | Cyro Industries | Electrostatic-dissipative multipolymer compositions |
| FR2897355B1 (fr) * | 2006-02-16 | 2012-07-20 | Arkema | Copolymeres comportant des blocs polyamide et des blocs polyether, ayant des proprietes optiques et thermiques ameliorees |
| US8581000B2 (en) * | 2011-06-06 | 2013-11-12 | Xerox Corporation | Process for preparing amide gellant compounds with aromatic end groups |
| RU2630310C1 (ru) * | 2016-11-22 | 2017-09-07 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Юго-Западный государственный университет" (ЮЗГУ) | Способ получения бензоата олова (II) |
| RU2650893C1 (ru) * | 2017-02-28 | 2018-04-18 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Юго-Западный государственный университет" (ЮЗГУ) | Способ получения основного бензоата олова (II) |
| RU2678092C1 (ru) * | 2017-08-17 | 2019-01-23 | Федеральное государственное бюджетное образовательное учреждение высшего образования " Юго-Западный государственный университет" (ЮЗГУ) | Двухстадийный способ получения карбоксилатов олова (II) из металла |
| RU2670199C1 (ru) * | 2017-11-15 | 2018-10-19 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Юго-Западный государственный университет" (ЮЗГУ) | Способ получения карбоксилатов олова (II) |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3057824A (en) * | 1959-03-31 | 1962-10-09 | Pittsburgh Plate Glass Co | Tin salts as catalysts in forming polyesters |
| US3162616A (en) * | 1959-06-10 | 1964-12-22 | Nopco Chem Co | Esterification process |
| US3055869A (en) * | 1959-12-21 | 1962-09-25 | Eastman Kodak Co | Process for preparing polyesters using free acids |
| US3194791A (en) * | 1962-02-23 | 1965-07-13 | Eastman Kodak Co | Tin salts catalysts for polyesterification process |
| GB1137209A (en) * | 1965-04-05 | 1968-12-18 | Eastman Kodak Co | Polyesteramides |
| GB1282422A (en) * | 1968-12-12 | 1972-07-19 | Ici Ltd | New polyester manufacturing process |
| US3546178A (en) * | 1968-12-23 | 1970-12-08 | Eastman Kodak Co | Preparation of linear poly(ester-amides) |
| DE1921738A1 (de) * | 1969-04-29 | 1970-11-12 | Bayer Ag | Polyesteramidelastomere mit Polyaethersegmenten |
| US3716523A (en) * | 1970-10-21 | 1973-02-13 | Basf Wyandotte Corp | Low concentration stannous carboxylate catalysis of polyesterification |
| FR2273021B1 (enExample) * | 1974-05-31 | 1977-03-11 | Ato Chimie | |
| FR2307834A1 (fr) * | 1975-04-15 | 1976-11-12 | Ato Chimie | Copolyesteramides sequences comme produits a mouler |
| FR2401947A1 (fr) * | 1977-09-02 | 1979-03-30 | Ato Chimie | Procede de preparation de polyether-ester-amides sequences utilisables, entre autres, comme produits a mouler, a extruder ou a filer |
| FR2418250A1 (fr) * | 1978-02-24 | 1979-09-21 | Ato Chimie | Enveloppe en matiere polymere thermoplastique pour balles de golf et balles de golf comportant une telle enveloppe |
| DE2932234C2 (de) * | 1979-08-09 | 1982-01-28 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur Herstellung von Polyether(ester)amiden |
| DE2936976C2 (de) * | 1979-09-13 | 1986-09-18 | Hüls AG, 4370 Marl | Verfahren zur Herstellung von Polyether(ester)amiden |
| DE2936977C2 (de) * | 1979-09-13 | 1986-06-12 | Hüls AG, 4370 Marl | Verfahren zur Herstellung von Polyether(ester)amiden |
| JPS5645419A (en) * | 1979-09-21 | 1981-04-25 | Teijin Yuka Kk | Preparation of p-xylene |
| FR2466478B2 (fr) * | 1979-10-02 | 1986-03-14 | Ato Chimie | Procede de preparation de copolyetheresteramides aliphatiques elastomeres |
| GB2063279B (en) * | 1979-10-02 | 1984-01-11 | Ato Chimie | Thermoplastic elastomers based on aliphatic copolyetheresteramide blocks of high molecular weight |
| JPS5790017A (en) * | 1980-11-25 | 1982-06-04 | Toray Ind Inc | Production of polyether-ester-amide |
| JPS6026028A (ja) * | 1983-07-25 | 1985-02-08 | Daicel Chem Ind Ltd | ポリアミドエラストマ−の製造法 |
-
1983
- 1983-08-04 CH CH4228/83A patent/CH658062A5/de not_active IP Right Cessation
-
1984
- 1984-08-01 DE DE19843428404 patent/DE3428404A1/de active Granted
- 1984-08-02 JP JP59161639A patent/JPS6099127A/ja active Granted
- 1984-08-03 GB GB08419801A patent/GB2144441B/en not_active Expired
- 1984-08-03 FR FR8412371A patent/FR2550211B1/fr not_active Expired
-
1986
- 1986-02-13 US US06/829,470 patent/US4689393A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| FR2550211A1 (fr) | 1985-02-08 |
| GB2144441A (en) | 1985-03-06 |
| US4689393A (en) | 1987-08-25 |
| JPS6099127A (ja) | 1985-06-03 |
| FR2550211B1 (fr) | 1987-08-21 |
| DE3428404A1 (de) | 1985-02-21 |
| JPH0516454B2 (enExample) | 1993-03-04 |
| GB8419801D0 (en) | 1984-09-05 |
| DE3428404C2 (enExample) | 1990-02-22 |
| GB2144441B (en) | 1987-01-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69225946T2 (de) | Transparente Polyamid-Mischungen mit hoher Beständigkeit gegenüber chemischen Mitteln | |
| DE2837687C2 (de) | Verfahren zur Herstellung von Polyätheresteramiden | |
| DE69803601T2 (de) | Hochmolekulares polyamid | |
| DE69915741T2 (de) | Verfahren zur Herstellung von Polyamiden | |
| DE69209036T2 (de) | Verfahren zur Herstellung von Copolyamiden | |
| CH658062A5 (de) | Verfahren zur herstellung von blockpolyetheresteramiden. | |
| EP0818491B1 (de) | Witterungsstabile Polyamide und Verfahren zu deren Herstellung | |
| DE2523991A1 (de) | Verfahren zur herstellung von polyaether-ester-amid-blockmischpolymerisaten als verformbare oder extrudierbare produkte | |
| DE19503053A1 (de) | Verfahren zur direkten Herstellung von Polyester-Verpackungen | |
| DE2936977C2 (de) | Verfahren zur Herstellung von Polyether(ester)amiden | |
| DE4329676A1 (de) | Verfahren zur stufenweisen kontinuierlichen Polykondensation von hochviskosen, insbesondere amorphen und teilaromatischen Copolyamiden sowie nach diesem Verfahren herstellbare amorphe teilaromatische Copolyamide | |
| EP0399415B1 (de) | Thermoplastische verarbeitbare elastomere Blockcopolyetheresteretheramide, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0360060A1 (de) | Verzweigte (Co)Polyamide durch Polykondensation in Gegenwart von Lysin-Komponenten/Polycarbonsäure-Gemischen | |
| DE60038573T2 (de) | Polyamid-kettenverlängerungsverfahren | |
| DE4208005C2 (de) | Aromatische Polyamide und Verfahren zu deren Herstellung | |
| DE3428405C2 (enExample) | ||
| EP0345649A1 (de) | Verfahren zur Herstellung von vernetzten Polyamidformkörpern | |
| EP0288894A1 (de) | Alpha-amino-epsilon-caprolactam modifizierte Polyamide | |
| EP0023248A1 (de) | Formmasse aus einem hochmolekularen linearen Polyester | |
| DE1545138A1 (de) | Verfahren zur Herstellung modifizierter Polyester aus Terephthalsaeurediglykolestern | |
| DE2846514A1 (de) | Transparente polyamide | |
| DE2311982B2 (de) | Verfahren zur Herstellung von homogenen modifizierten Polycaprolactamen und deren Verwendung für Fäden und Fasern | |
| DE3917926C2 (enExample) | ||
| DE2119776A1 (de) | Hochmolekulare lineare Copolyamide | |
| DE2734161C3 (de) | Wärme- und alterungsbeständige Copolyätheresteramide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |