CH648817A5 - Verfahren zur herstellung von p-chloralkylbenzol. - Google Patents
Verfahren zur herstellung von p-chloralkylbenzol. Download PDFInfo
- Publication number
- CH648817A5 CH648817A5 CH4983/80A CH498380A CH648817A5 CH 648817 A5 CH648817 A5 CH 648817A5 CH 4983/80 A CH4983/80 A CH 4983/80A CH 498380 A CH498380 A CH 498380A CH 648817 A5 CH648817 A5 CH 648817A5
- Authority
- CH
- Switzerland
- Prior art keywords
- catalyst
- toluene
- antimony
- tcpt
- chlorination
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 3
- 239000003054 catalyst Substances 0.000 claims description 56
- 238000005660 chlorination reaction Methods 0.000 claims description 33
- 150000004996 alkyl benzenes Chemical class 0.000 claims description 26
- 238000000034 method Methods 0.000 claims description 25
- 239000002841 Lewis acid Substances 0.000 claims description 23
- 150000007517 lewis acids Chemical class 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 18
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 11
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 9
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 claims description 9
- 229910021578 Iron(III) chloride Inorganic materials 0.000 claims description 6
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 6
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 claims description 6
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 6
- 239000012433 hydrogen halide Substances 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 4
- 239000002184 metal Substances 0.000 claims description 4
- 150000002736 metal compounds Chemical class 0.000 claims description 4
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 3
- 229910052787 antimony Inorganic materials 0.000 claims description 3
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 3
- VMPVEPPRYRXYNP-UHFFFAOYSA-I antimony(5+);pentachloride Chemical compound Cl[Sb](Cl)(Cl)(Cl)Cl VMPVEPPRYRXYNP-UHFFFAOYSA-I 0.000 claims description 3
- DAMJCWMGELCIMI-UHFFFAOYSA-N benzyl n-(2-oxopyrrolidin-3-yl)carbamate Chemical compound C=1C=CC=CC=1COC(=O)NC1CCNC1=O DAMJCWMGELCIMI-UHFFFAOYSA-N 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 229910052742 iron Inorganic materials 0.000 claims description 3
- 229910052750 molybdenum Inorganic materials 0.000 claims description 3
- 239000011733 molybdenum Substances 0.000 claims description 3
- OFDISMSWWNOGFW-UHFFFAOYSA-N 1-(4-ethoxy-3-fluorophenyl)ethanamine Chemical compound CCOC1=CC=C(C(C)N)C=C1F OFDISMSWWNOGFW-UHFFFAOYSA-N 0.000 claims description 2
- ODNBVEIAQAZNNM-UHFFFAOYSA-N 1-(6-chloroimidazo[1,2-b]pyridazin-3-yl)ethanone Chemical compound C1=CC(Cl)=NN2C(C(=O)C)=CN=C21 ODNBVEIAQAZNNM-UHFFFAOYSA-N 0.000 claims description 2
- GUNJVIDCYZYFGV-UHFFFAOYSA-K Antimony trifluoride Inorganic materials F[Sb](F)F GUNJVIDCYZYFGV-UHFFFAOYSA-K 0.000 claims description 2
- 229910021577 Iron(II) chloride Inorganic materials 0.000 claims description 2
- LJCFOYOSGPHIOO-UHFFFAOYSA-N antimony pentoxide Chemical compound O=[Sb](=O)O[Sb](=O)=O LJCFOYOSGPHIOO-UHFFFAOYSA-N 0.000 claims description 2
- 238000010924 continuous production Methods 0.000 claims description 2
- NMCUIPGRVMDVDB-UHFFFAOYSA-L iron dichloride Chemical compound Cl[Fe]Cl NMCUIPGRVMDVDB-UHFFFAOYSA-L 0.000 claims description 2
- KAEAMHPPLLJBKF-UHFFFAOYSA-N iron(3+) sulfide Chemical compound [S-2].[S-2].[S-2].[Fe+3].[Fe+3] KAEAMHPPLLJBKF-UHFFFAOYSA-N 0.000 claims description 2
- LIKBJVNGSGBSGK-UHFFFAOYSA-N iron(3+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Fe+3].[Fe+3] LIKBJVNGSGBSGK-UHFFFAOYSA-N 0.000 claims description 2
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 claims description 2
- 229940056932 lead sulfide Drugs 0.000 claims description 2
- 229910052981 lead sulfide Inorganic materials 0.000 claims description 2
- LIYKJALVRPGQTR-UHFFFAOYSA-M oxostibanylium;chloride Chemical compound [Cl-].[Sb+]=O LIYKJALVRPGQTR-UHFFFAOYSA-M 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 125000006575 electron-withdrawing group Chemical group 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 153
- FAPDDOBMIUGHIN-UHFFFAOYSA-K antimony trichloride Chemical compound Cl[Sb](Cl)Cl FAPDDOBMIUGHIN-UHFFFAOYSA-K 0.000 description 30
- 238000006243 chemical reaction Methods 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 10
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 10
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 10
- NPDACUSDTOMAMK-UHFFFAOYSA-N 4-Chlorotoluene Chemical compound CC1=CC=C(Cl)C=C1 NPDACUSDTOMAMK-UHFFFAOYSA-N 0.000 description 9
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 150000003613 toluenes Chemical class 0.000 description 6
- IBSQPLPBRSHTTG-UHFFFAOYSA-N 1-chloro-2-methylbenzene Chemical compound CC1=CC=CC=C1Cl IBSQPLPBRSHTTG-UHFFFAOYSA-N 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- GVIJJXMXTUZIOD-UHFFFAOYSA-N thianthrene Chemical compound C1=CC=C2SC3=CC=CC=C3SC2=C1 GVIJJXMXTUZIOD-UHFFFAOYSA-N 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 238000011084 recovery Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- GJSGGHOYGKMUPT-UHFFFAOYSA-N phenoxathiine Chemical compound C1=CC=C2OC3=CC=CC=C3SC2=C1 GJSGGHOYGKMUPT-UHFFFAOYSA-N 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- CAHQGWAXKLQREW-UHFFFAOYSA-N Benzal chloride Chemical compound ClC(Cl)C1=CC=CC=C1 CAHQGWAXKLQREW-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 2
- -1 oxides Chemical class 0.000 description 2
- PDWVXNLUDMQFCH-UHFFFAOYSA-N oxoantimony;hydrochloride Chemical compound Cl.[Sb]=O PDWVXNLUDMQFCH-UHFFFAOYSA-N 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- GPOFSFLJOIAMSA-UHFFFAOYSA-N 1-chloro-4-ethylbenzene Chemical compound CCC1=CC=C(Cl)C=C1 GPOFSFLJOIAMSA-UHFFFAOYSA-N 0.000 description 1
- JCJOKFLPNGCLSA-UHFFFAOYSA-N 2,3,7,8-tetrachlorothianthrene Chemical compound S1C2=CC(Cl)=C(Cl)C=C2SC2=C1C=C(Cl)C(Cl)=C2 JCJOKFLPNGCLSA-UHFFFAOYSA-N 0.000 description 1
- MNNZINNZIQVULG-UHFFFAOYSA-N 2-chloroethylbenzene Chemical compound ClCCC1=CC=CC=C1 MNNZINNZIQVULG-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- MBMLMWLHJBBADN-UHFFFAOYSA-N Ferrous sulfide Chemical compound [Fe]=S MBMLMWLHJBBADN-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- LTYMSROWYAPPGB-UHFFFAOYSA-N diphenyl sulfide Chemical class C=1C=CC=CC=1SC1=CC=CC=C1 LTYMSROWYAPPGB-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 150000005194 ethylbenzenes Chemical class 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- BICAGYDGRXJYGD-UHFFFAOYSA-N hydrobromide;hydrochloride Chemical compound Cl.Br BICAGYDGRXJYGD-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000011968 lewis acid catalyst Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229910052714 tellurium Inorganic materials 0.000 description 1
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 description 1
- SWLJJEFSPJCUBD-UHFFFAOYSA-N tellurium tetrachloride Chemical compound Cl[Te](Cl)(Cl)Cl SWLJJEFSPJCUBD-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000004065 wastewater treatment Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
- C07C17/10—Preparation of halogenated hydrocarbons by replacement by halogens of hydrogen atoms
- C07C17/12—Preparation of halogenated hydrocarbons by replacement by halogens of hydrogen atoms in the ring of aromatic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8168779A JPS565139A (en) | 1979-06-28 | 1979-06-28 | Chlorination catalyst for alkylbenzene nucleus |
| JP731980A JPS56104827A (en) | 1980-01-24 | 1980-01-24 | Preparation of nucleus-chlorinated alkylbenzene |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH648817A5 true CH648817A5 (de) | 1985-04-15 |
Family
ID=26341595
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH4983/80A CH648817A5 (de) | 1979-06-28 | 1980-06-27 | Verfahren zur herstellung von p-chloralkylbenzol. |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4289916A (enExample) |
| CA (1) | CA1123861A (enExample) |
| CH (1) | CH648817A5 (enExample) |
| DE (1) | DE3023437A1 (enExample) |
| FR (1) | FR2460281A1 (enExample) |
| GB (1) | GB2054571B (enExample) |
| IT (1) | IT1131397B (enExample) |
| NL (1) | NL191313C (enExample) |
| NO (1) | NO152897C (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0399293A1 (de) * | 1989-05-23 | 1990-11-28 | Bayer Ag | Verfahren zur Herstellung von 2-Chlor-4-nitro-alkylbenzol |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4444983A (en) * | 1981-04-21 | 1984-04-24 | Hodogaya Chemical Co., Ltd. | Process for the nuclear chlorination of toluene |
| FR2545004B1 (fr) * | 1983-04-29 | 1987-04-17 | Ugine Kuhlmann | Derive n substitue de la phenothiazine comme catalyseur de chloration sur le noyau des hydrocarbures aromatiques |
| DE3432095A1 (de) * | 1984-08-31 | 1986-03-06 | Hoechst Ag, 6230 Frankfurt | Verfahren zur kernchlorierung von toluol |
| DE3718060A1 (de) * | 1987-05-28 | 1988-12-08 | Bayer Ag | Verfahren zur kernchlorierung von aromatischen kohlenwasserstoffen |
| DE4228134A1 (de) * | 1992-08-25 | 1994-03-03 | Bayer Ag | Verbessertes Verfahren zur Kernchlorierung von aromatischen Kohlenwasserstoffen |
| US5621153A (en) * | 1995-04-21 | 1997-04-15 | Occidental Chemical Corporation | Process for the preparation of chloro-alkylbenzenes and novel cocatalysts therefor |
| DE10242223A1 (de) * | 2002-09-12 | 2004-03-25 | Clariant Gmbh | Verfahren zur Hydrodechlorierung von kernchlorierten ortho-Xylolen |
| DE10242224A1 (de) * | 2002-09-12 | 2004-03-25 | Clariant Gmbh | Verfahren zur Kernchlorierung von ortho-Xylol |
| US7012166B2 (en) | 2003-03-18 | 2006-03-14 | General Electric Company | Catalyst composition and method for chlorinating aromatic compounds |
| US7863209B2 (en) * | 2004-06-16 | 2011-01-04 | Sabic Innovative Plastics Ip B.V. | Methods for recycling catalyst compositions for aromatic ring halogenation |
| US7763760B2 (en) * | 2004-06-16 | 2010-07-27 | Sabic Innovative Plastics Ip B.V. | Catalyst composition and method for halogenating aromatic compounds |
| US7282615B2 (en) * | 2004-06-16 | 2007-10-16 | Sabic Innovative Plastics, Ip Bv | Catalyst compositions and their use for chlorinating aromatic compounds |
| CN102603469A (zh) * | 2012-02-21 | 2012-07-25 | 南通市东昌化工有限公司 | 邻氯甲苯的生产方法 |
| CN104844587B (zh) * | 2015-04-29 | 2018-06-01 | 深圳市华星光电技术有限公司 | 含有吩恶噻结构的共轭化合物及其制备方法与有机电致发光二极管器件 |
| CN114230434B (zh) * | 2021-12-28 | 2024-01-26 | 河南特格纳特科技有限公司 | 一种烷基苯定向氯化生产三氯苄的方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4013730A (en) * | 1975-08-01 | 1977-03-22 | Hooker Chemicals & Plastics Corporation | Process for the preparation of monochlorotoluene |
| US4031147A (en) * | 1975-08-01 | 1977-06-21 | Hooker Chemicals & Plastics Corporation | Process for directed chlorination of alkylbenzenes |
| US4069264A (en) * | 1976-10-04 | 1978-01-17 | Hooker Chemicals & Plastics Corporation | Process for directed chlorination of alkylbenzenes |
| US4069263A (en) * | 1977-01-03 | 1978-01-17 | Hooker Chemicals & Plastics Corporation | Process for directed chlorination of alkylbenzenes |
-
1980
- 1980-05-23 US US06/152,817 patent/US4289916A/en not_active Expired - Lifetime
- 1980-06-12 NL NL8003404A patent/NL191313C/xx not_active IP Right Cessation
- 1980-06-19 CA CA354,382A patent/CA1123861A/en not_active Expired
- 1980-06-23 DE DE19803023437 patent/DE3023437A1/de active Granted
- 1980-06-25 FR FR8014123A patent/FR2460281A1/fr active Granted
- 1980-06-26 IT IT8023087A patent/IT1131397B/it active
- 1980-06-27 CH CH4983/80A patent/CH648817A5/de not_active IP Right Cessation
- 1980-06-27 NO NO801934A patent/NO152897C/no unknown
- 1980-06-27 GB GB8021112A patent/GB2054571B/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0399293A1 (de) * | 1989-05-23 | 1990-11-28 | Bayer Ag | Verfahren zur Herstellung von 2-Chlor-4-nitro-alkylbenzol |
Also Published As
| Publication number | Publication date |
|---|---|
| NO152897B (no) | 1985-09-02 |
| GB2054571B (en) | 1983-06-29 |
| NL8003404A (nl) | 1980-12-30 |
| IT1131397B (it) | 1986-06-18 |
| NO152897C (no) | 1985-12-11 |
| FR2460281A1 (fr) | 1981-01-23 |
| DE3023437A1 (de) | 1981-01-22 |
| NL191313B (nl) | 1994-12-16 |
| NO801934L (no) | 1980-12-29 |
| CA1123861A (en) | 1982-05-18 |
| FR2460281B1 (enExample) | 1983-04-15 |
| NL191313C (nl) | 1995-05-16 |
| IT8023087A0 (it) | 1980-06-26 |
| DE3023437C2 (enExample) | 1992-01-30 |
| GB2054571A (en) | 1981-02-18 |
| US4289916A (en) | 1981-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH648817A5 (de) | Verfahren zur herstellung von p-chloralkylbenzol. | |
| DE3885826T2 (de) | Verfahren zur Herstellung von in den Benzolringen chloriertem Tricyclo[8.2.2.2]hexadeca-4,6,10,12,13,15-hexaen. | |
| DE2516567C3 (de) | Verfahren zum Chlorieren von phenolischen Verbindungen | |
| DE2634338C2 (de) | Verfahren zur Herstellung von im Kern monochlorierten Alkylbenzolen mit einem erhöhten Gehalt an p-Chlor-alkylbenzol | |
| DE1417725B2 (de) | Verwendung eines Katalysators auf der Basis von Halogeniden des Kupfers, des Lanthans oder der Lanthaniden und der Alkalimetalle für die Oxychlorierung bzw. Oxybromierung von Kohlenwasserstoffen | |
| DE3025475C2 (de) | Verfahren zur Herstellung von aromatischen Dialdehyden | |
| DE2634340A1 (de) | Verfahren zur direkten chlorierung von alkylbenzolen | |
| EP0064690B1 (de) | Verfahren zur Herstellung von substituierten Benzaldehyden | |
| DE2739433C2 (enExample) | ||
| DE2604277C2 (de) | Verfahren zur Herstellung von 2,5- Dichlor-p-xylol | |
| DE3875886T2 (de) | Dampfphasen-bromierung von aromatischen verbindungen. | |
| DE10039722A1 (de) | Verfahren zur Kernchlorierung von ortho-Xylol | |
| EP0283833B1 (de) | Verfahren zur Entfernung von m-Chlortoluol aus Chlortoluolgemischen | |
| EP0505874A1 (de) | Verfahren zur Herstellung von p-Dichlorbenzol | |
| EP0136566B1 (de) | Verfahren zur Herstellung von 3,4-Dichlorbenzotrihalogeniden | |
| DE2644641C2 (de) | Verfahren zur Herstellung von bestimmten kernchlorierten Benzotrichloriden | |
| DE3321855C2 (enExample) | ||
| DE10039717A1 (de) | Verfahren zur Kernchlorierung von meta-Xylol | |
| EP0657407B1 (de) | Verfahren zur Herstellung von 3-Fluor-4,6-dichlortoluol | |
| DE69602040T2 (de) | Verfahren zur Herstellung von Alkylbenzoylchlorid | |
| EP1398304B1 (de) | Verfahren zur Kernchlorierung von ortho-Xylol | |
| DE2447932A1 (de) | Verfahren zur halogenierung von aromatischen kohlenwasserstoffen | |
| EP0537540B1 (de) | Verfahren zur radikalischen Chlorierung oder Bromierung von Methylaromaten | |
| DE2162861C3 (de) | Verfahren zur Herstellung von 2,2-Bis-(3,5-dichlor-4-hydroxyphenyl)-propan | |
| DE1964552C3 (de) | Verfahren zur kontinuierlichen Chlorierung von Chloräthylenen im Gemisch mit Chloräthanen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |