CH647541A5 - Fluessigkristallgemisch. - Google Patents
Fluessigkristallgemisch. Download PDFInfo
- Publication number
- CH647541A5 CH647541A5 CH284/82A CH28482A CH647541A5 CH 647541 A5 CH647541 A5 CH 647541A5 CH 284/82 A CH284/82 A CH 284/82A CH 28482 A CH28482 A CH 28482A CH 647541 A5 CH647541 A5 CH 647541A5
- Authority
- CH
- Switzerland
- Prior art keywords
- liquid crystal
- dye
- formula
- mixture according
- mixture
- Prior art date
Links
- 239000004973 liquid crystal related substance Substances 0.000 title claims description 90
- 239000000203 mixture Substances 0.000 title claims description 67
- 239000000975 dye Substances 0.000 claims description 90
- 125000003118 aryl group Chemical group 0.000 claims description 23
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims description 18
- 150000004056 anthraquinones Chemical class 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 239000000463 material Substances 0.000 claims description 8
- 239000004988 Nematic liquid crystal Substances 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 3
- 125000005083 alkoxyalkoxy group Chemical group 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 125000005160 aryl oxy alkyl group Chemical group 0.000 claims description 3
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- IGARGHRYKHJQSM-UHFFFAOYSA-N cyclohexylbenzene Chemical compound C1CCCCC1C1=CC=CC=C1 IGARGHRYKHJQSM-UHFFFAOYSA-N 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052717 sulfur Chemical group 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 239000001045 blue dye Substances 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 25
- -1 aralkoxy Chemical group 0.000 description 21
- 238000010521 absorption reaction Methods 0.000 description 20
- 238000004040 coloring Methods 0.000 description 8
- 238000002844 melting Methods 0.000 description 7
- 230000008018 melting Effects 0.000 description 7
- 238000010586 diagram Methods 0.000 description 5
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- 238000002835 absorbance Methods 0.000 description 3
- 238000000862 absorption spectrum Methods 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 235000010290 biphenyl Nutrition 0.000 description 3
- 239000004305 biphenyl Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 2
- 125000004423 acyloxy group Chemical group 0.000 description 2
- 239000000987 azo dye Substances 0.000 description 2
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- DZVCFNFOPIZQKX-LTHRDKTGSA-M merocyanine Chemical compound [Na+].O=C1N(CCCC)C(=O)N(CCCC)C(=O)C1=C\C=C\C=C/1N(CCCS([O-])(=O)=O)C2=CC=CC=C2O\1 DZVCFNFOPIZQKX-LTHRDKTGSA-M 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 229920006122 polyamide resin Polymers 0.000 description 2
- 125000006850 spacer group Chemical group 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- DTGKSKDOIYIVQL-NQMVMOMDSA-N (+)-Borneol Natural products C1C[C@]2(C)[C@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-NQMVMOMDSA-N 0.000 description 1
- DTGKSKDOIYIVQL-WEDXCCLWSA-N (+)-borneol Chemical compound C1C[C@@]2(C)[C@@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-WEDXCCLWSA-N 0.000 description 1
- DSSYKIVIOFKYAU-XCBNKYQSSA-N (R)-camphor Chemical compound C1C[C@@]2(C)C(=O)C[C@@H]1C2(C)C DSSYKIVIOFKYAU-XCBNKYQSSA-N 0.000 description 1
- ZWKNLRXFUTWSOY-QPJJXVBHSA-N (e)-3-phenylprop-2-enenitrile Chemical class N#C\C=C\C1=CC=CC=C1 ZWKNLRXFUTWSOY-QPJJXVBHSA-N 0.000 description 1
- YJTKZCDBKVTVBY-UHFFFAOYSA-N 1,3-Diphenylbenzene Chemical group C1=CC=CC=C1C1=CC=CC(C=2C=CC=CC=2)=C1 YJTKZCDBKVTVBY-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical class COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- 239000004904 UV filter Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- 125000005337 azoxy group Chemical group [N+]([O-])(=N*)* 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- NEHNMFOYXAPHSD-UHFFFAOYSA-N beta-citronellal Natural products O=CCC(C)CCC=C(C)C NEHNMFOYXAPHSD-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000006226 butoxyethyl group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 230000003098 cholesteric effect Effects 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- VJCWGXGMXAVKJU-UHFFFAOYSA-N cyclohexyl cyclohexanecarboxylate Chemical class C1CCCCC1C(=O)OC1CCCCC1 VJCWGXGMXAVKJU-UHFFFAOYSA-N 0.000 description 1
- WVIIMZNLDWSIRH-UHFFFAOYSA-N cyclohexylcyclohexane Chemical compound C1CCCCC1C1CCCCC1 WVIIMZNLDWSIRH-UHFFFAOYSA-N 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229940041616 menthol Drugs 0.000 description 1
- UAEPNZWRGJTJPN-UHFFFAOYSA-N methylcyclohexane Chemical compound CC1CCCCC1 UAEPNZWRGJTJPN-UHFFFAOYSA-N 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- OPYYWWIJPHKUDZ-UHFFFAOYSA-N phenyl cyclohexanecarboxylate Chemical class C1CCCCC1C(=O)OC1=CC=CC=C1 OPYYWWIJPHKUDZ-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000007970 thio esters Chemical class 0.000 description 1
- 230000036962 time dependent Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B1/00—Dyes with anthracene nucleus not condensed with any other ring
- C09B1/56—Mercapto-anthraquinones
- C09B1/58—Mercapto-anthraquinones with mercapto groups substituted by aliphatic, cycloaliphatic, araliphatic or aryl radicals
- C09B1/60—Mercapto-anthraquinones with mercapto groups substituted by aliphatic, cycloaliphatic, araliphatic or aryl radicals substituted by aliphatic, cycloaliphatic or araliphatic radicals
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/52—Liquid crystal materials characterised by components which are not liquid crystals, e.g. additives with special physical aspect: solvents, solid particles
- C09K19/60—Pleochroic dyes
- C09K19/603—Anthroquinonic
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Liquid Crystal (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP574981A JPS57119976A (en) | 1981-01-17 | 1981-01-17 | Liquid crystal composition |
| JP575081A JPS57119977A (en) | 1981-01-17 | 1981-01-17 | Liquid crystal composition |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH647541A5 true CH647541A5 (de) | 1985-01-31 |
Family
ID=26339751
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH284/82A CH647541A5 (de) | 1981-01-17 | 1982-01-18 | Fluessigkristallgemisch. |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4434072A (enExample) |
| CH (1) | CH647541A5 (enExample) |
| DE (1) | DE3201120A1 (enExample) |
| GB (1) | GB2094825B (enExample) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5857488A (ja) * | 1981-10-02 | 1983-04-05 | Mitsubishi Chem Ind Ltd | ゲスト−ホスト型液晶組成物 |
| EP0110205B1 (de) * | 1982-11-29 | 1987-12-09 | F. HOFFMANN-LA ROCHE & CO. Aktiengesellschaft | Farbige Flüssigkristallmischungen enthaltend Phenyläthane |
| DE3485232D1 (de) * | 1983-03-23 | 1991-12-12 | Hitachi Ltd | Anthrachinonfarbstoffe und dieselben enthaltende fluessigkristalline zusammensetzungen. |
| JPH02143563A (ja) * | 1988-11-25 | 1990-06-01 | Fuji Electric Co Ltd | サイリスタ |
| JP2002327176A (ja) | 2001-03-01 | 2002-11-15 | Toshiba Corp | ゲスト−ホスト液晶組成物および液晶表示素子 |
| CN104837959B (zh) | 2012-12-13 | 2017-09-19 | 默克专利股份有限公司 | 液晶介质 |
| EP2965147B1 (de) | 2013-03-05 | 2020-01-01 | Merck Patent GmbH | Fenster mit vorrichtung zur regulierung des energie-durchtritts |
| KR102266840B1 (ko) | 2013-05-08 | 2021-06-18 | 메르크 파텐트 게엠베하 | 광 에너지의 통과를 조절하기 위한 2개의 액정 스위칭 층을 포함하는 장치 |
| WO2014187529A1 (de) | 2013-05-24 | 2014-11-27 | Merck Patent Gmbh | Vorrichtung zur regulierung des energie-durchtritts enthaltend eine dichroitische farbstoffverbindung |
| WO2015090506A1 (de) | 2013-12-19 | 2015-06-25 | Merck Patent Gmbh | Vorrichtung zur regulierung des lichtdurchtritts |
| DE102015005800A1 (de) | 2015-05-06 | 2016-11-10 | Merck Patent Gmbh | Thiadiazolochinoxalinderivate |
| WO2017008880A1 (de) | 2015-07-10 | 2017-01-19 | Merck Patent Gmbh | Dithioalkylpyrrolopyrrole und ihre verwendung als farbstoffe |
| US10982150B2 (en) | 2016-06-28 | 2021-04-20 | Merck Patent Gmbh | Liquid crystalline medium |
| EP3487955B1 (en) | 2016-07-19 | 2020-05-20 | Merck Patent GmbH | Liquid crystalline medium |
| US11667845B2 (en) | 2018-06-11 | 2023-06-06 | Merck Patent Gmbh | Liquid crystalline medium |
| KR102756999B1 (ko) | 2018-06-20 | 2025-01-22 | 메르크 파텐트 게엠베하 | 액정 매질 |
| JP7447099B2 (ja) | 2018-09-25 | 2024-03-11 | メルク パテント ゲゼルシャフト ミット ベシュレンクテル ハフツング | アゾ色素 |
| US11939512B2 (en) | 2018-11-23 | 2024-03-26 | Merck Patent Gmbh | Dichroic dye composition |
| EP3898893B1 (en) | 2018-12-19 | 2025-01-15 | Merck Patent GmbH | Switching layers for use in a switching element |
| EP3983501B1 (en) | 2019-06-17 | 2025-02-26 | Merck Patent GmbH | Liquid crystal-based light valve |
| EP3839620B1 (en) | 2019-12-16 | 2025-02-26 | Merck Patent GmbH | Device for the regulation of light transmission |
| KR20220014170A (ko) * | 2020-07-28 | 2022-02-04 | 현대모비스 주식회사 | 폴리카보네이트 수지 조성물 및 이를 포함하는 성형품 |
| US20240134218A1 (en) | 2020-12-11 | 2024-04-25 | Merck Patent Gmbh | Device for the regulation of light transmission |
| WO2023094404A1 (en) | 2021-11-24 | 2023-06-01 | Merck Patent Gmbh | Liquid crystal medium and liquid crystal display |
| CN121311566A (zh) | 2023-06-05 | 2026-01-09 | 默克专利股份有限公司 | 液晶介质 |
| WO2025061649A1 (en) | 2023-09-20 | 2025-03-27 | Merck Patent Gmbh | Liquid crystal medium |
| US20250236795A1 (en) | 2024-01-18 | 2025-07-24 | Merck Patent Gmbh | Liquid-crystalline medium |
| WO2025190813A1 (en) | 2024-03-11 | 2025-09-18 | Merck Patent Gmbh | Liquid-crystal medium |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5328102B2 (enExample) * | 1973-04-16 | 1978-08-12 | ||
| US3960751A (en) * | 1973-09-19 | 1976-06-01 | Matsushita Electric Industrial Co., Ltd. | Electro-optical display element |
| GB1507030A (en) * | 1974-10-21 | 1978-04-12 | Secr Defence | Liquid crystal display devices |
| GB2024844B (en) * | 1978-05-23 | 1983-03-30 | Minnesota Mining & Mfg | Pleochroic dyes and electro-optical displays therewith |
| CH638828A5 (de) | 1978-12-21 | 1983-10-14 | Bbc Brown Boveri & Cie | Fluessigkristallmischung. |
| US4232950A (en) | 1979-02-23 | 1980-11-11 | Minnesota Mining And Manufacturing Company | Liquid crystal compositions including pleochroic dye |
| GB2043097B (en) * | 1979-02-23 | 1983-08-17 | Minnesota Mining & Mfg | Liquid crystal compositions containing pleochroic dye |
| US4232949A (en) * | 1979-02-23 | 1980-11-11 | Minnesota Mining And Manufacturing Company | Liquid crystal compositions containing pleochroic dye |
| US4360447A (en) * | 1979-03-16 | 1982-11-23 | Mitsui Toatsu Chemicals, Inc. | Composition for liquid crystal color display elements |
| US4304683A (en) * | 1979-03-16 | 1981-12-08 | Mitsui Toatsu Chemicals, Inc. | Composition for liquid crystal color display element |
| CH641828A5 (fr) * | 1979-08-17 | 1984-03-15 | Ebauches Sa | Composition a base de cristal liquide pour dispositif electro-optique. |
| EP0025809A1 (de) * | 1979-09-21 | 1981-04-01 | BBC Aktiengesellschaft Brown, Boveri & Cie. | Flüssigkristallmischung |
| CH642393A5 (fr) * | 1979-10-02 | 1984-04-13 | Ebauches Sa | Composition a base de cristal liquide pour dispositif electro-optique. |
| GB2065695B (en) * | 1979-10-12 | 1984-07-25 | Hitachi Ltd | Guest-host type liquid crystal composition and liquid crystal display device using the same |
| DE3007198A1 (de) * | 1980-02-26 | 1981-09-03 | Siemens AG, 1000 Berlin und 8000 München | Pleochroitischer anthrachinon-farbstoff, verfahren zu seiner herstellung und verwendung des farbstoffs |
| CH643291A5 (fr) | 1980-03-21 | 1984-05-30 | Asulab Sa | Composition a base de cristal liquide pour dispositif electro-optique. |
| DE3014933A1 (de) * | 1980-04-18 | 1981-10-29 | Bayer Ag, 5090 Leverkusen | Fluessigkristalline materialien enthaltend anthrachinonfarbstoffe |
| EP0044893B1 (en) * | 1980-07-29 | 1984-09-19 | Imperial Chemical Industries Plc | Anthraquinone compounds and process for their preparation |
| US4405211A (en) * | 1980-07-29 | 1983-09-20 | The Secretary Of State For Defence In Her Britannic Majesty's Government Of The United Kingdom Of Great Britain And Northern Ireland | Liquid crystal compositions with pleochroic anthraquinone dyes |
| GB2081736B (en) | 1980-07-29 | 1985-02-20 | Secr Defence | Liquid crystal materials containing diamino-dihydroxy anthraquinone pleochroic dyes |
| GB2082196B (en) | 1980-07-29 | 1985-01-23 | Secr Defence | Liquid crystal materials containing anthraquinone pleochroic dyes |
| US4391489A (en) * | 1980-07-29 | 1983-07-05 | The Secretary Of State For Defence In Her Britannic Majesty's Government Of The United Kingdom Of Great Britain And Northern Ireland | Liquid crystal materials containing pleochroic anthraquinone dyes |
-
1982
- 1982-01-15 DE DE19823201120 patent/DE3201120A1/de active Granted
- 1982-01-15 GB GB8201113A patent/GB2094825B/en not_active Expired
- 1982-01-18 CH CH284/82A patent/CH647541A5/de not_active IP Right Cessation
- 1982-01-18 US US06/340,547 patent/US4434072A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| GB2094825B (en) | 1984-09-12 |
| DE3201120C2 (enExample) | 1990-04-26 |
| US4434072A (en) | 1984-02-28 |
| GB2094825A (en) | 1982-09-22 |
| DE3201120A1 (de) | 1982-10-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH647541A5 (de) | Fluessigkristallgemisch. | |
| DE2920730C2 (enExample) | ||
| DE3038372C2 (de) | Flüssigkristallzusammensetzungen und ihre Verwendung | |
| EP0038460B1 (de) | Flüssigkristalline Materialien enthaltend Anthrachinonfarbstoffe | |
| EP0026004B1 (de) | Flüssigkristallmischung | |
| DE2627215C2 (de) | Flüssigkristallmaterialien mit pleochroitischen Azofarbstoffen und ihre Verwendung | |
| DE2631428A1 (de) | Verwendung von farbstoffen | |
| CH643289A5 (de) | Gemisch fuer farbig anzeigende, nematische fluessigkristall-anzeigeelemente. | |
| EP0054217A1 (de) | Anthrachinonfarbstoffe, Verfahren zu ihrer Herstellung, ihre Verwendung sowie flüssigkristalline Materialien enthaltend Anthrachinonfarbstoffe | |
| DE3040102A1 (de) | Dichroitische anthrachinonfarbstoffe, diese enthaltende fluessigkristalline dielektrika und elektrooptisches anzeigeelement | |
| DE2834846C2 (de) | Zweifarbige Flüssigkeitskristall-Zusammensetzungen | |
| DE3125183A1 (de) | "neue trisazofarbstoffe und damit hergestellte fluessigkristallzusammensetzungen" | |
| CH642345A5 (de) | 2,3-dicyano-hydrochinon derivate. | |
| CH639113A5 (de) | Pleochroitische farbstoffe, ein diese enthaltendes fluessigkristallgemisch sowie eine elektrooptische anzeigevorrichtung. | |
| DD200090A5 (de) | Fluessigkristallzusammensetzungen und ihre verwendung in anzeigevorrichtungen | |
| DE68912191T2 (de) | Azoverbindungen und Flüssigkristallzusammensetzung, die diese enthält. | |
| CH645916A5 (de) | Pleochroitische farbstoffe enthaltende fluessigkristallmassen. | |
| DE3141309C2 (enExample) | ||
| EP0111197A2 (de) | Anthrachinonfarbstoffe, ihre Herstellung und Verwendung sowie dichroitisches Material enthaltend Anthrachinonfarbstoffe | |
| DE2640624A1 (de) | Dichroitische azofarbstoffe | |
| DE69931792T2 (de) | UV absorbierender Film und Verwendung als Schutzfolie | |
| DE3880012T2 (de) | Fluessigkristallzusammensetzung, die eine verbindung des pleochroic-azo-typs enthaelt. | |
| DE3416515C2 (enExample) | ||
| DE3034249A1 (de) | Fluessigkristall-zusammensetzung | |
| EP0074523B1 (de) | Flüssigkristallines Material enthaltend Anthrachinonfarbstoffe sowie neue Anthrachinonfarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PFA | Name/firm changed |
Owner name: MITSUBISHI KASEI CORPORATION |
|
| PL | Patent ceased |