CH643235A5 - Verfahren zur herstellung von p-aminophenol. - Google Patents
Verfahren zur herstellung von p-aminophenol. Download PDFInfo
- Publication number
- CH643235A5 CH643235A5 CH934479A CH934479A CH643235A5 CH 643235 A5 CH643235 A5 CH 643235A5 CH 934479 A CH934479 A CH 934479A CH 934479 A CH934479 A CH 934479A CH 643235 A5 CH643235 A5 CH 643235A5
- Authority
- CH
- Switzerland
- Prior art keywords
- pap
- aniline
- nitrobenzene
- dimethyldodecylamine
- reaction medium
- Prior art date
Links
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 48
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 claims description 40
- 238000000034 method Methods 0.000 claims description 17
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 12
- 230000008569 process Effects 0.000 claims description 12
- 239000006227 byproduct Substances 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 9
- 239000012429 reaction media Substances 0.000 claims description 9
- VFFDVELHRCMPLY-UHFFFAOYSA-N dimethyldodecyl amine Natural products CC(C)CCCCCCCCCCCN VFFDVELHRCMPLY-UHFFFAOYSA-N 0.000 claims description 8
- YWFWDNVOPHGWMX-UHFFFAOYSA-N n,n-dimethyldodecan-1-amine Chemical compound CCCCCCCCCCCCN(C)C YWFWDNVOPHGWMX-UHFFFAOYSA-N 0.000 claims description 8
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 7
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 5
- 229910052697 platinum Inorganic materials 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- HIWXNYSKAQSEON-UHFFFAOYSA-N n,n-dimethyldodecan-1-amine;sulfuric acid Chemical compound OS(O)(=O)=O.CCCCCCCCCCCCN(C)C HIWXNYSKAQSEON-UHFFFAOYSA-N 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 239000012736 aqueous medium Substances 0.000 claims description 2
- 239000008346 aqueous phase Substances 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N isopropyl alcohol Natural products CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 7
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 239000004094 surface-active agent Substances 0.000 description 6
- DDXLVDQZPFLQMZ-UHFFFAOYSA-M dodecyl(trimethyl)azanium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)C DDXLVDQZPFLQMZ-UHFFFAOYSA-M 0.000 description 5
- 238000005984 hydrogenation reaction Methods 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 4
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000000356 contaminant Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 2
- PZOZYLSYQJYXBI-UHFFFAOYSA-N 2-propan-2-yloxyaniline Chemical compound CC(C)OC1=CC=CC=C1N PZOZYLSYQJYXBI-UHFFFAOYSA-N 0.000 description 2
- QMGBIPKOKCSUCL-UHFFFAOYSA-N 3-propan-2-yloxyaniline Chemical compound CC(C)OC1=CC=CC(N)=C1 QMGBIPKOKCSUCL-UHFFFAOYSA-N 0.000 description 2
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 2
- MLNFMFAMNBGAQT-UHFFFAOYSA-N 4-propan-2-yloxyaniline Chemical compound CC(C)OC1=CC=C(N)C=C1 MLNFMFAMNBGAQT-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CKRZKMFTZCFYGB-UHFFFAOYSA-N N-phenylhydroxylamine Chemical compound ONC1=CC=CC=C1 CKRZKMFTZCFYGB-UHFFFAOYSA-N 0.000 description 2
- 239000003929 acidic solution Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 230000002860 competitive effect Effects 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- KUDPGZONDFORKU-UHFFFAOYSA-N n-chloroaniline Chemical compound ClNC1=CC=CC=C1 KUDPGZONDFORKU-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- -1 temperature Substances 0.000 description 2
- ADVGKWPZRIDURE-UHFFFAOYSA-N 2'-Hydroxyacetanilide Chemical compound CC(=O)NC1=CC=CC=C1O ADVGKWPZRIDURE-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 206010067482 No adverse event Diseases 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 239000012431 aqueous reaction media Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- JNONJXMVMJSMTC-UHFFFAOYSA-N hydron;triethylazanium;sulfate Chemical compound OS(O)(=O)=O.CCN(CC)CC JNONJXMVMJSMTC-UHFFFAOYSA-N 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- BPEQZXOPABVVLH-UHFFFAOYSA-N n,n-dibutylbutan-1-amine;sulfuric acid Chemical compound OS([O-])(=O)=O.CCCC[NH+](CCCC)CCCC BPEQZXOPABVVLH-UHFFFAOYSA-N 0.000 description 1
- YYNTXBIGYMPBKG-UHFFFAOYSA-N n-propan-2-yloxyaniline Chemical class CC(C)ONC1=CC=CC=C1 YYNTXBIGYMPBKG-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/74—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C215/76—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/955,442 US4176138A (en) | 1978-10-27 | 1978-10-27 | Process for preparing p-aminophenol in the presence of dimethyldodecylamine sulfate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH643235A5 true CH643235A5 (de) | 1984-05-30 |
Family
ID=25496830
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH934479A CH643235A5 (de) | 1978-10-27 | 1979-10-17 | Verfahren zur herstellung von p-aminophenol. |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4176138A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5559145A (cg-RX-API-DMAC7.html) |
| BE (1) | BE879663A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1115295A (cg-RX-API-DMAC7.html) |
| CH (1) | CH643235A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2943360A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2439766A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB2032427B (cg-RX-API-DMAC7.html) |
| GR (1) | GR65673B (cg-RX-API-DMAC7.html) |
| IT (1) | IT1120037B (cg-RX-API-DMAC7.html) |
| NL (1) | NL188524C (cg-RX-API-DMAC7.html) |
| SE (1) | SE7907676L (cg-RX-API-DMAC7.html) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4307249A (en) * | 1981-01-07 | 1981-12-22 | Mallinckrodt, Inc. | Process for the selective preparation of p-aminophenol from nitrobenzene |
| US4415753A (en) * | 1982-01-29 | 1983-11-15 | Mallinckrodt, Inc. | Process for preparing p-aminophenol and alkyl substituted p-aminophenol |
| US4571437A (en) * | 1982-01-29 | 1986-02-18 | Mallinckrodt, Inc. | Process for preparing p-aminophenol and alkyl substituted p-aminophenol |
| JPH0261799A (ja) * | 1988-08-26 | 1990-03-01 | Fujitsu Ten Ltd | 車間距離制御装置 |
| FR2688001B1 (fr) * | 1992-02-28 | 1994-05-20 | Rhone Poulenc Chimie | Procede de preparation de p-aminophenols. |
| US5312991A (en) * | 1992-06-09 | 1994-05-17 | Mallinckrodt Specialty Chemicals Company | Surfactant improvement for para-aminophenol process |
| CN115197074A (zh) * | 2022-06-28 | 2022-10-18 | 辽宁世星药化有限公司 | 一种对氨基苯酚的生产方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2198249A (en) * | 1938-10-13 | 1940-04-23 | Du Pont | Reduction of aryl nitro compounds |
| FR1071868A (fr) * | 1951-12-05 | 1954-09-06 | Du Pont | Perfectionnements à la préparation du p-aminophénol |
| US2765342A (en) * | 1952-10-22 | 1956-10-02 | Du Pont | Manufacture of aromatic parahydroxyamines |
| GB856366A (en) * | 1958-05-12 | 1960-12-14 | Ici Ltd | Process for the production of p-aminophenol from nitrobenzene |
| US3383416A (en) * | 1965-07-08 | 1968-05-14 | Roland G. Benner | Process for preparing aminophenol |
| US3535382A (en) * | 1967-11-02 | 1970-10-20 | Cpc International Inc | Amino phenol production |
| FR1559841A (cg-RX-API-DMAC7.html) * | 1968-01-30 | 1969-03-14 |
-
1978
- 1978-10-27 US US05/955,442 patent/US4176138A/en not_active Expired - Lifetime
-
1979
- 1979-09-07 GB GB7931061A patent/GB2032427B/en not_active Expired
- 1979-09-10 FR FR7922588A patent/FR2439766A1/fr active Granted
- 1979-09-14 GR GR60037A patent/GR65673B/el unknown
- 1979-09-14 SE SE7907676A patent/SE7907676L/xx not_active Application Discontinuation
- 1979-09-24 CA CA336,177A patent/CA1115295A/en not_active Expired
- 1979-10-09 IT IT50500/79A patent/IT1120037B/it active
- 1979-10-17 CH CH934479A patent/CH643235A5/de not_active IP Right Cessation
- 1979-10-22 NL NLAANVRAGE7907758,A patent/NL188524C/xx not_active IP Right Cessation
- 1979-10-26 DE DE19792943360 patent/DE2943360A1/de active Granted
- 1979-10-26 JP JP13921079A patent/JPS5559145A/ja active Granted
- 1979-10-26 BE BE0/197839A patent/BE879663A/fr not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| BE879663A (fr) | 1980-02-15 |
| NL188524B (nl) | 1992-02-17 |
| GR65673B (en) | 1980-10-16 |
| IT1120037B (it) | 1986-03-19 |
| IT7950500A0 (it) | 1979-10-09 |
| GB2032427A (en) | 1980-05-08 |
| US4176138A (en) | 1979-11-27 |
| DE2943360C2 (cg-RX-API-DMAC7.html) | 1992-01-16 |
| FR2439766A1 (fr) | 1980-05-23 |
| JPS6228950B2 (cg-RX-API-DMAC7.html) | 1987-06-23 |
| CA1115295A (en) | 1981-12-29 |
| GB2032427B (en) | 1982-11-10 |
| SE7907676L (sv) | 1980-04-28 |
| DE2943360A1 (de) | 1980-05-08 |
| NL188524C (nl) | 1992-07-16 |
| JPS5559145A (en) | 1980-05-02 |
| NL7907758A (nl) | 1980-04-29 |
| FR2439766B1 (cg-RX-API-DMAC7.html) | 1981-11-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1912532C3 (de) | Verfahren zur Herstellung eines Nickel-Kieselsäure-Katalysators | |
| DE4138982A1 (de) | Verfahren zur herstellung von 3-hydroxyalkanalen | |
| DE1667704A1 (de) | Verfahren zur Herstellung eines zur Umwandlung von Kohlenwasserstoffen geeigneten Katalysators | |
| DE3211433A1 (de) | Kristallines alumosilikat, verfahren zu seiner herstellung und verwendung | |
| CH643235A5 (de) | Verfahren zur herstellung von p-aminophenol. | |
| EP0889003A1 (de) | Synthetisches Magnesiumsilikat | |
| DE2502893C2 (de) | Cycloaliphatische Amine | |
| DE19713456B4 (de) | Verfahren zur Herstellung einer für die Synthese von iodierten Kontrastmitteln nützlichen Zwischenverbindung | |
| EP0552130B1 (de) | Verfahren zur Herstellung von Nitrobenzol | |
| EP0322760B1 (de) | Verfahren zur Herstellung von Kobaltkatalysatoren | |
| EP0378081A1 (de) | Verfahren zur Reinigung wässriger Glyoxallösungen | |
| DE3003731C2 (cg-RX-API-DMAC7.html) | ||
| DE4217338C2 (de) | Elektrochemisches Verfahren zur Reduktion von Oxalsäure zu Glyoxylsäure | |
| DE10021790B4 (de) | Verfahren zur Herstellung von ω-Aminoalkansulfonsäuren und deren Verwendung als Biopuffer | |
| DE69313448T2 (de) | Tenside mit verbesserten eigenschaften für die herstellung von para-amoniphenol | |
| DE3137092C2 (de) | Verfahren zur Herstellung von Gemischen aus cis- und trans-4-Aminomethyl-cyclohexancarbonsäure in Form der Salze mit bestimmten Mineralsäuren | |
| DE3628916A1 (de) | Phosphorsaeureester | |
| DE2923930A1 (de) | Verfahren zur abtrennung einer naphthalindisulfonsaeure von einem gemisch von naphthalindisulfonsaeuren | |
| DE2616216A1 (de) | Verfahren zur reinigung von benzolpolykarbonsaeuren | |
| DE69915747T2 (de) | Verfahren zur Behandlung von Früchten und Gemüse nach der Ernte unter Reinigung von mit primären aromatischen Aminen kontaminierten phytosänitaren Produkten | |
| DE1812989A1 (de) | Transalkylierungskatalysator sowie dessen Verwendung bei einem Verfahren zum Transalkylieren von Alkylbenzolen | |
| DE1567832A1 (de) | Verfahren zu der Herstellung einer Hydroxylammoniumsalz enthaltenden Loesung | |
| DE2648054B2 (de) | Verfahren zur Herstellung von Dichlornitroanilinen | |
| DE69107149T2 (de) | Verfahren zur Herstellung von p-Halogenbenzophenonderivaten. | |
| DE809811C (de) | Verfahren zur Herstellung eines Aminoguanidinsalzes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUE | Assignment |
Owner name: MALLINCKRODT, INC. (A DELAWARE CORPORATION) |
|
| PL | Patent ceased |