CH641443A5 - Verfahren zur herstellung von substituiertem acetonitril. - Google Patents
Verfahren zur herstellung von substituiertem acetonitril. Download PDFInfo
- Publication number
- CH641443A5 CH641443A5 CH1112079A CH1112079A CH641443A5 CH 641443 A5 CH641443 A5 CH 641443A5 CH 1112079 A CH1112079 A CH 1112079A CH 1112079 A CH1112079 A CH 1112079A CH 641443 A5 CH641443 A5 CH 641443A5
- Authority
- CH
- Switzerland
- Prior art keywords
- acetonitrile
- reactor
- cyanogen chloride
- substituted
- temperature
- Prior art date
Links
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical class CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 title claims description 13
- 238000004519 manufacturing process Methods 0.000 title description 5
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 claims description 25
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 15
- 239000011541 reaction mixture Substances 0.000 claims description 10
- 125000001072 heteroaryl group Chemical group 0.000 claims description 9
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 150000007960 acetonitrile Chemical class 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical class C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims 4
- 239000000126 substance Substances 0.000 description 15
- 239000007789 gas Substances 0.000 description 11
- QENGPZGAWFQWCZ-UHFFFAOYSA-N Methylthiophene Natural products CC=1C=CSC=1 QENGPZGAWFQWCZ-UHFFFAOYSA-N 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- -1 thienyl radical Chemical class 0.000 description 8
- ITQTTZVARXURQS-UHFFFAOYSA-N 3-methylpyridine Chemical compound CC1=CC=CN=C1 ITQTTZVARXURQS-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- 239000012071 phase Substances 0.000 description 5
- AUHZEENZYGFFBQ-UHFFFAOYSA-N 1,3,5-trimethylbenzene Chemical compound CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 4
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 4
- NWPNXBQSRGKSJB-UHFFFAOYSA-N 2-methylbenzonitrile Chemical compound CC1=CC=CC=C1C#N NWPNXBQSRGKSJB-UHFFFAOYSA-N 0.000 description 4
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 4
- NPDACUSDTOMAMK-UHFFFAOYSA-N 4-Chlorotoluene Chemical compound CC1=CC=C(Cl)C=C1 NPDACUSDTOMAMK-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical compound CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- SQNZJJAZBFDUTD-UHFFFAOYSA-N durene Chemical compound CC1=CC(C)=C(C)C=C1C SQNZJJAZBFDUTD-UHFFFAOYSA-N 0.000 description 4
- 150000002390 heteroarenes Chemical class 0.000 description 4
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 4
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical compound CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 4
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000010453 quartz Substances 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- AYKYOOPFBCOXSL-UHFFFAOYSA-N (4-hydroxyphenyl)acetonitrile Chemical compound OC1=CC=C(CC#N)C=C1 AYKYOOPFBCOXSL-UHFFFAOYSA-N 0.000 description 2
- FYGHSUNMUKGBRK-UHFFFAOYSA-N 1,2,3-trimethylbenzene Chemical compound CC1=CC=CC(C)=C1C FYGHSUNMUKGBRK-UHFFFAOYSA-N 0.000 description 2
- APQSQLNWAIULLK-UHFFFAOYSA-N 1,4-dimethylnaphthalene Chemical compound C1=CC=C2C(C)=CC=C(C)C2=C1 APQSQLNWAIULLK-UHFFFAOYSA-N 0.000 description 2
- WJIFKOVZNJTSGO-UHFFFAOYSA-N 1-bromo-3-methylbenzene Chemical compound CC1=CC=CC(Br)=C1 WJIFKOVZNJTSGO-UHFFFAOYSA-N 0.000 description 2
- IBSQPLPBRSHTTG-UHFFFAOYSA-N 1-chloro-2-methylbenzene Chemical compound CC1=CC=CC=C1Cl IBSQPLPBRSHTTG-UHFFFAOYSA-N 0.000 description 2
- FNPVYRJTBXHIPB-UHFFFAOYSA-N 1-chloro-3-fluoro-2-methylbenzene Chemical compound CC1=C(F)C=CC=C1Cl FNPVYRJTBXHIPB-UHFFFAOYSA-N 0.000 description 2
- OSOUNOBYRMOXQQ-UHFFFAOYSA-N 1-chloro-3-methylbenzene Chemical compound CC1=CC=CC(Cl)=C1 OSOUNOBYRMOXQQ-UHFFFAOYSA-N 0.000 description 2
- MMZYCBHLNZVROM-UHFFFAOYSA-N 1-fluoro-2-methylbenzene Chemical compound CC1=CC=CC=C1F MMZYCBHLNZVROM-UHFFFAOYSA-N 0.000 description 2
- BTQZKHUEUDPRST-UHFFFAOYSA-N 1-fluoro-3-methylbenzene Chemical compound CC1=CC=CC(F)=C1 BTQZKHUEUDPRST-UHFFFAOYSA-N 0.000 description 2
- WRWPPGUCZBJXKX-UHFFFAOYSA-N 1-fluoro-4-methylbenzene Chemical compound CC1=CC=C(F)C=C1 WRWPPGUCZBJXKX-UHFFFAOYSA-N 0.000 description 2
- UTBIMNXEDGNJFE-UHFFFAOYSA-N 2,3,6-trimethylpyridine Chemical compound CC1=CC=C(C)C(C)=N1 UTBIMNXEDGNJFE-UHFFFAOYSA-N 0.000 description 2
- HPYNZHMRTTWQTB-UHFFFAOYSA-N 2,3-dimethylpyridine Chemical compound CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 2
- BZYUMXXOAYSFOW-UHFFFAOYSA-N 2,3-dimethylthiophene Chemical compound CC=1C=CSC=1C BZYUMXXOAYSFOW-UHFFFAOYSA-N 0.000 description 2
- BWZVCCNYKMEVEX-UHFFFAOYSA-N 2,4,6-Trimethylpyridine Chemical compound CC1=CC(C)=NC(C)=C1 BWZVCCNYKMEVEX-UHFFFAOYSA-N 0.000 description 2
- JYYNAJVZFGKDEQ-UHFFFAOYSA-N 2,4-Dimethylpyridine Chemical compound CC1=CC=NC(C)=C1 JYYNAJVZFGKDEQ-UHFFFAOYSA-N 0.000 description 2
- GWQOOADXMVQEFT-UHFFFAOYSA-N 2,5-Dimethylthiophene Chemical compound CC1=CC=C(C)S1 GWQOOADXMVQEFT-UHFFFAOYSA-N 0.000 description 2
- YGYNBBAUIYTWBF-UHFFFAOYSA-N 2,6-dimethylnaphthalene Chemical compound C1=C(C)C=CC2=CC(C)=CC=C21 YGYNBBAUIYTWBF-UHFFFAOYSA-N 0.000 description 2
- VPGIYLLXBOUILV-UHFFFAOYSA-N 2-benzylthiophene Chemical compound C=1C=CC=CC=1CC1=CC=CS1 VPGIYLLXBOUILV-UHFFFAOYSA-N 0.000 description 2
- CSARJIQZOSVYHA-UHFFFAOYSA-N 2-chloro-4-fluoro-1-methylbenzene Chemical compound CC1=CC=C(F)C=C1Cl CSARJIQZOSVYHA-UHFFFAOYSA-N 0.000 description 2
- QIMMUPPBPVKWKM-UHFFFAOYSA-N 2-methylnaphthalene Chemical compound C1=CC=CC2=CC(C)=CC=C21 QIMMUPPBPVKWKM-UHFFFAOYSA-N 0.000 description 2
- XQQBUAPQHNYYRS-UHFFFAOYSA-N 2-methylthiophene Chemical compound CC1=CC=CS1 XQQBUAPQHNYYRS-UHFFFAOYSA-N 0.000 description 2
- HWWYDZCSSYKIAD-UHFFFAOYSA-N 3,5-dimethylpyridine Chemical compound CC1=CN=CC(C)=C1 HWWYDZCSSYKIAD-UHFFFAOYSA-N 0.000 description 2
- BOHCMQZJWOGWTA-UHFFFAOYSA-N 3-methylbenzonitrile Chemical compound CC1=CC=CC(C#N)=C1 BOHCMQZJWOGWTA-UHFFFAOYSA-N 0.000 description 2
- JOXXHDGUTVUBDL-UHFFFAOYSA-N 4-chloro-1-fluoro-2-methylbenzene Chemical compound CC1=CC(Cl)=CC=C1F JOXXHDGUTVUBDL-UHFFFAOYSA-N 0.000 description 2
- MKFCYQTVSDCXAQ-UHFFFAOYSA-N 4-chloro-2-fluoro-1-methylbenzene Chemical compound CC1=CC=C(Cl)C=C1F MKFCYQTVSDCXAQ-UHFFFAOYSA-N 0.000 description 2
- VCZNNAKNUVJVGX-UHFFFAOYSA-N 4-methylbenzonitrile Chemical compound CC1=CC=C(C#N)C=C1 VCZNNAKNUVJVGX-UHFFFAOYSA-N 0.000 description 2
- FKNQCJSGGFJEIZ-UHFFFAOYSA-N 4-methylpyridine Chemical compound CC1=CC=NC=C1 FKNQCJSGGFJEIZ-UHFFFAOYSA-N 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- SMUQFGGVLNAIOZ-UHFFFAOYSA-N quinaldine Chemical compound C1=CC=CC2=NC(C)=CC=C21 SMUQFGGVLNAIOZ-UHFFFAOYSA-N 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- WMGVPDQNPUQRND-UHFFFAOYSA-N (2-methylphenyl)acetonitrile Chemical compound CC1=CC=CC=C1CC#N WMGVPDQNPUQRND-UHFFFAOYSA-N 0.000 description 1
- 239000005967 1,4-Dimethylnaphthalene Substances 0.000 description 1
- UDONPJKEOAWFGI-UHFFFAOYSA-N 1-methyl-3-phenoxybenzene Chemical compound CC1=CC=CC(OC=2C=CC=CC=2)=C1 UDONPJKEOAWFGI-UHFFFAOYSA-N 0.000 description 1
- NEBPTMCRLHKPOB-UHFFFAOYSA-N 2,2-diphenylacetonitrile Chemical compound C=1C=CC=CC=1C(C#N)C1=CC=CC=C1 NEBPTMCRLHKPOB-UHFFFAOYSA-N 0.000 description 1
- FUNUTBJJKQIVSY-UHFFFAOYSA-N 2,4-Dichlorotoluene Chemical compound CC1=CC=C(Cl)C=C1Cl FUNUTBJJKQIVSY-UHFFFAOYSA-N 0.000 description 1
- MHOQLIYRCDQTGF-UHFFFAOYSA-N 2,6-dimethylpyridine 4-methylpyridine Chemical compound N1=CC=C(C=C1)C.N1=C(C=CC=C1C)C MHOQLIYRCDQTGF-UHFFFAOYSA-N 0.000 description 1
- MSZOPWWSWGLPST-UHFFFAOYSA-N 2-(2,4,5-trimethylphenyl)acetonitrile Chemical compound CC1=CC(C)=C(CC#N)C=C1C MSZOPWWSWGLPST-UHFFFAOYSA-N 0.000 description 1
- VJARIBGMDPJLCL-UHFFFAOYSA-N 2-(2,4-dichlorophenyl)acetonitrile Chemical compound ClC1=CC=C(CC#N)C(Cl)=C1 VJARIBGMDPJLCL-UHFFFAOYSA-N 0.000 description 1
- GSMCLMKFBYLWRP-UHFFFAOYSA-N 2-(2-chloro-4-fluorophenyl)acetonitrile Chemical compound FC1=CC=C(CC#N)C(Cl)=C1 GSMCLMKFBYLWRP-UHFFFAOYSA-N 0.000 description 1
- ZGSAFMIRVLOISC-UHFFFAOYSA-N 2-(2-chloro-6-fluorophenyl)acetonitrile Chemical compound FC1=CC=CC(Cl)=C1CC#N ZGSAFMIRVLOISC-UHFFFAOYSA-N 0.000 description 1
- MRDUURPIPLIGQX-UHFFFAOYSA-N 2-(2-chlorophenyl)acetonitrile Chemical compound ClC1=CC=CC=C1CC#N MRDUURPIPLIGQX-UHFFFAOYSA-N 0.000 description 1
- DAVJMKMVLKOQQC-UHFFFAOYSA-N 2-(2-fluorophenyl)acetonitrile Chemical compound FC1=CC=CC=C1CC#N DAVJMKMVLKOQQC-UHFFFAOYSA-N 0.000 description 1
- KYYGZZGRYBVPCV-UHFFFAOYSA-N 2-(2-methylthiophen-3-yl)acetonitrile Chemical compound CC=1SC=CC=1CC#N KYYGZZGRYBVPCV-UHFFFAOYSA-N 0.000 description 1
- LMUKNQSVBFEUKR-UHFFFAOYSA-N 2-(3,5-dimethylphenyl)acetonitrile Chemical compound CC1=CC(C)=CC(CC#N)=C1 LMUKNQSVBFEUKR-UHFFFAOYSA-N 0.000 description 1
- UUZYFBXKWIQKTF-UHFFFAOYSA-N 2-(3-bromophenyl)acetonitrile Chemical compound BrC1=CC=CC(CC#N)=C1 UUZYFBXKWIQKTF-UHFFFAOYSA-N 0.000 description 1
- GTIKLPYCSAMPNG-UHFFFAOYSA-N 2-(3-chlorophenyl)acetonitrile Chemical compound ClC1=CC=CC(CC#N)=C1 GTIKLPYCSAMPNG-UHFFFAOYSA-N 0.000 description 1
- DEJPYROXSVVWIE-UHFFFAOYSA-N 2-(3-fluorophenyl)acetonitrile Chemical compound FC1=CC=CC(CC#N)=C1 DEJPYROXSVVWIE-UHFFFAOYSA-N 0.000 description 1
- IEOUEWOHAFNQCO-UHFFFAOYSA-N 2-(3-hydroxyphenyl)acetonitrile Chemical compound OC1=CC=CC(CC#N)=C1 IEOUEWOHAFNQCO-UHFFFAOYSA-N 0.000 description 1
- WOJADIOTNFDWNQ-UHFFFAOYSA-N 2-(3-methylphenyl)acetonitrile Chemical compound CC1=CC=CC(CC#N)=C1 WOJADIOTNFDWNQ-UHFFFAOYSA-N 0.000 description 1
- MISNDAMPLNYJCW-UHFFFAOYSA-N 2-(3-methylthiophen-2-yl)acetonitrile Chemical compound CC=1C=CSC=1CC#N MISNDAMPLNYJCW-UHFFFAOYSA-N 0.000 description 1
- DKGMALJGFUHPGB-UHFFFAOYSA-N 2-(3-phenoxyphenyl)acetonitrile Chemical compound N#CCC1=CC=CC(OC=2C=CC=CC=2)=C1 DKGMALJGFUHPGB-UHFFFAOYSA-N 0.000 description 1
- RTQOANCZEAIDEZ-UHFFFAOYSA-N 2-(4-chloro-2-fluorophenyl)acetonitrile Chemical compound FC1=CC(Cl)=CC=C1CC#N RTQOANCZEAIDEZ-UHFFFAOYSA-N 0.000 description 1
- JHQBLYITVCBGTO-UHFFFAOYSA-N 2-(4-fluorophenyl)acetonitrile Chemical compound FC1=CC=C(CC#N)C=C1 JHQBLYITVCBGTO-UHFFFAOYSA-N 0.000 description 1
- RNHKXHKUKJXLAU-UHFFFAOYSA-N 2-(4-methylphenyl)acetonitrile Chemical compound CC1=CC=C(CC#N)C=C1 RNHKXHKUKJXLAU-UHFFFAOYSA-N 0.000 description 1
- AEGDUGKVESUBLG-UHFFFAOYSA-N 2-(4-methylpyridin-2-yl)acetonitrile Chemical compound CC1=CC=NC(CC#N)=C1 AEGDUGKVESUBLG-UHFFFAOYSA-N 0.000 description 1
- QGPGNOMDUNQMJY-UHFFFAOYSA-N 2-(5-chloro-2-fluorophenyl)acetonitrile Chemical compound FC1=CC=C(Cl)C=C1CC#N QGPGNOMDUNQMJY-UHFFFAOYSA-N 0.000 description 1
- RXBXGHSRAJCLCJ-UHFFFAOYSA-N 2-(5-chloro-2-methylphenyl)acetonitrile Chemical compound CC1=CC=C(Cl)C=C1CC#N RXBXGHSRAJCLCJ-UHFFFAOYSA-N 0.000 description 1
- WUTDBSOUSJRTKE-UHFFFAOYSA-N 2-(5-methylpyridin-3-yl)acetonitrile Chemical compound CC1=CN=CC(CC#N)=C1 WUTDBSOUSJRTKE-UHFFFAOYSA-N 0.000 description 1
- GKHSEDFDYXZGCG-UHFFFAOYSA-N 2-(cyanomethyl)benzonitrile Chemical compound N#CCC1=CC=CC=C1C#N GKHSEDFDYXZGCG-UHFFFAOYSA-N 0.000 description 1
- JZSRHKOFXIACDX-UHFFFAOYSA-N 2-(thiophen-2-ylmethyl)thiophene Chemical compound C=1C=CSC=1CC1=CC=CS1 JZSRHKOFXIACDX-UHFFFAOYSA-N 0.000 description 1
- JSMMZMYGEVUURX-UHFFFAOYSA-N 2-chloro-5-methylthiophene Chemical compound CC1=CC=C(Cl)S1 JSMMZMYGEVUURX-UHFFFAOYSA-N 0.000 description 1
- GXZDYRYYNXYPMQ-UHFFFAOYSA-N 2-chloro-6-methylpyridine Chemical compound CC1=CC=CC(Cl)=N1 GXZDYRYYNXYPMQ-UHFFFAOYSA-N 0.000 description 1
- GWZCLMWEJWPFFA-UHFFFAOYSA-N 2-thiophen-3-ylacetonitrile Chemical compound N#CCC=1C=CSC=1 GWZCLMWEJWPFFA-UHFFFAOYSA-N 0.000 description 1
- YCOXTKKNXUZSKD-UHFFFAOYSA-N 3,4-xylenol Chemical compound CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 description 1
- OQKZSMMMKYJQJP-UHFFFAOYSA-N 3-(cyanomethyl)benzonitrile Chemical compound N#CCC1=CC=CC(C#N)=C1 OQKZSMMMKYJQJP-UHFFFAOYSA-N 0.000 description 1
- MFEIKQPHQINPRI-UHFFFAOYSA-N 3-Ethylpyridine Chemical compound CCC1=CC=CN=C1 MFEIKQPHQINPRI-UHFFFAOYSA-N 0.000 description 1
- QNIZTJWJJFGIDS-UHFFFAOYSA-N 3-benzylthiophene Chemical compound C=1C=CC=CC=1CC=1C=CSC=1 QNIZTJWJJFGIDS-UHFFFAOYSA-N 0.000 description 1
- QILKKAFYAFEWGU-UHFFFAOYSA-N 4-(cyanomethyl)benzonitrile Chemical compound N#CCC1=CC=C(C#N)C=C1 QILKKAFYAFEWGU-UHFFFAOYSA-N 0.000 description 1
- HJSPWKGEPDZNLK-UHFFFAOYSA-N 4-benzylphenol Chemical compound C1=CC(O)=CC=C1CC1=CC=CC=C1 HJSPWKGEPDZNLK-UHFFFAOYSA-N 0.000 description 1
- HNQLMBJUMVLFCF-UHFFFAOYSA-N 4-chloro-1,2-dimethylbenzene Chemical compound CC1=CC=C(Cl)C=C1C HNQLMBJUMVLFCF-UHFFFAOYSA-N 0.000 description 1
- IVYMIRMKXZAHRV-UHFFFAOYSA-N 4-chlorophenylacetonitrile Chemical compound ClC1=CC=C(CC#N)C=C1 IVYMIRMKXZAHRV-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C253/00—Preparation of carboxylic acid nitriles
- C07C253/04—Preparation of carboxylic acid nitriles by reaction of cyanogen halides, e.g. ClCN, with organic compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/57—Nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2854210A DE2854210C2 (de) | 1978-12-15 | 1978-12-15 | Verfahren zur Herstellung von aromatisch oder heteroaromatisch substituierten Acetonitrilen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH641443A5 true CH641443A5 (de) | 1984-02-29 |
Family
ID=6057300
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1112079A CH641443A5 (de) | 1978-12-15 | 1979-12-14 | Verfahren zur herstellung von substituiertem acetonitril. |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4369322A (enExample) |
| JP (1) | JPS5585557A (enExample) |
| AT (1) | AT362775B (enExample) |
| BE (1) | BE880556A (enExample) |
| CH (1) | CH641443A5 (enExample) |
| DE (1) | DE2854210C2 (enExample) |
| FR (1) | FR2444026A1 (enExample) |
| GB (1) | GB2037762B (enExample) |
| IT (1) | IT1207014B (enExample) |
| NL (1) | NL7907364A (enExample) |
| SU (1) | SU1020002A3 (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3006424A1 (de) | 1980-02-21 | 1981-09-03 | Degussa Ag, 6000 Frankfurt | Verfahren zur gewinnung reiner nitrile |
| US4800590A (en) * | 1985-01-14 | 1989-01-24 | Willis E. Higgins | Computer key and computer lock system |
| US4613606A (en) * | 1985-12-02 | 1986-09-23 | Syntex (U.S.A.) Inc. | Tetrahydroisoquinoline derivatives |
| DE3717434C1 (de) * | 1987-05-23 | 1988-09-15 | Degussa | Verfahren zur Herstellung von m-Trifluormethylphenylacetonitril |
| DE10215294A1 (de) * | 2002-04-08 | 2003-10-23 | Bayer Cropscience Ag | Verfahren zur Herstellung von 2,4,5-Trimethylphenylessigsäure |
| CN103351311B (zh) * | 2013-06-17 | 2016-05-11 | 张家港威胜生物医药有限公司 | 一种二苯乙腈的合成方法 |
| CN121471106A (zh) * | 2026-01-12 | 2026-02-06 | 山东海化集团有限公司 | 一种连续化合成全氟异丁腈的方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1033516A (fr) * | 1950-04-08 | 1953-07-13 | American Cyanamid Co | Perfectionnements à la préparation de nitriles aromatiques |
| US2553404A (en) * | 1950-04-08 | 1951-05-15 | American Cyanamid Co | Preparation of aralkyl cyanides |
| US2606917A (en) * | 1951-06-29 | 1952-08-12 | American Cyanamid Co | Preparation of nitriles |
| US3028413A (en) * | 1957-03-22 | 1962-04-03 | Pure Oil Co | Process for the production of acetonitrile |
| CH582655A5 (enExample) * | 1973-10-18 | 1976-12-15 | Lonza Ag |
-
1978
- 1978-12-15 DE DE2854210A patent/DE2854210C2/de not_active Expired
-
1979
- 1979-10-03 NL NL7907364A patent/NL7907364A/nl not_active Application Discontinuation
- 1979-11-19 FR FR7928484A patent/FR2444026A1/fr active Granted
- 1979-12-06 SU SU792850134A patent/SU1020002A3/ru active
- 1979-12-07 GB GB7942397A patent/GB2037762B/en not_active Expired
- 1979-12-11 BE BE6/47032A patent/BE880556A/fr not_active IP Right Cessation
- 1979-12-13 IT IT7951080A patent/IT1207014B/it active
- 1979-12-14 AT AT0789579A patent/AT362775B/de active
- 1979-12-14 CH CH1112079A patent/CH641443A5/de not_active IP Right Cessation
- 1979-12-15 JP JP16220379A patent/JPS5585557A/ja active Granted
-
1981
- 1981-03-09 US US06/241,836 patent/US4369322A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| FR2444026B1 (enExample) | 1984-10-05 |
| FR2444026A1 (fr) | 1980-07-11 |
| IT1207014B (it) | 1989-05-17 |
| NL7907364A (nl) | 1980-06-17 |
| JPS5585557A (en) | 1980-06-27 |
| US4369322A (en) | 1983-01-18 |
| SU1020002A3 (ru) | 1983-05-23 |
| GB2037762A (en) | 1980-07-16 |
| IT7951080A0 (it) | 1979-12-13 |
| DE2854210A1 (de) | 1980-06-26 |
| AT362775B (de) | 1981-06-10 |
| DE2854210C2 (de) | 1984-08-09 |
| BE880556A (fr) | 1980-06-11 |
| ATA789579A (de) | 1980-11-15 |
| GB2037762B (en) | 1983-04-13 |
| JPS639495B2 (enExample) | 1988-02-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0012117B1 (de) | Verfahren zur Herstellung von 2,3,5-Trichlorpyridin, 2,4,4-Trichlor-4-formyl-butyronitril als neue Verbindung und Verfahren zu dessen Herstellung | |
| EP0385210B1 (de) | Amidierung von Pyridinen | |
| CH641443A5 (de) | Verfahren zur herstellung von substituiertem acetonitril. | |
| DE2639701C2 (enExample) | ||
| DE2412371C2 (de) | Herstellung von Resorcin und alkylsubstituierten Resorcinen | |
| DE1470143A1 (de) | Verfahren zur Herstellung von 2-Chlorpyridin | |
| DE1018853B (de) | Verfahren zur Herstellung von 1, 1, 1-Trifluor-2-brom-2-chloraethan | |
| DE69209621T2 (de) | Selektive Gasphasen-Chlorierung von polychlorierten Beta-Pikolinen zur Herstellung von 2,3,5,6-Tetrachlorpyridin sowie dessen Vorprodukte | |
| DE3876446T2 (de) | Verfahren zur herstellung von arylsulfiden. | |
| US2854457A (en) | Process of preparing dipyridyls | |
| DE2819196C2 (enExample) | ||
| DE69123742T2 (de) | Verfahren zur herstellung von 2-methyl-3,5-dialkylpyridinen durch dealkylierung mit schwefel | |
| DE1545750A1 (de) | Verfahren zur Herstellung von Pyridin | |
| DE3853209T2 (de) | Verfahren zur herstellung von 2,3,5,6-tetrachlorpyridin und 2,3,6-trichlorpyridin. | |
| DE2258496C3 (de) | Verfahren zur Herstellung von perchlorierten aromatischen Nitrilen | |
| DE2836477C2 (de) | Verfahren zur Herstellung von ungesättigten Spiro[2.4]-heptanonen und Spiro[2.5]octanonen | |
| DE1595948C (de) | Verfahren zur Herstellung chlorierter Alkylpyridine und Alkylchinoline | |
| EP0159508B1 (de) | Verfahren zur Herstellung von ungesättigten Dichlorisobutenen | |
| DE69207571T2 (de) | Verfahren zum Herstellen von Estern der Halomaleinsäure und Halofumarsäure | |
| DE2256039C3 (de) | Herstellung von 1,4-Dicyanbutenen | |
| DE1470142C (de) | Verfahren zur gleichzeitigen Herstel lung von 2 Brom und 2 Chlorpyndin | |
| CH641442A5 (de) | Verfahren zur herstellung von substituiertem malonsaeuredinitril. | |
| CH631706A5 (de) | Verfahren zur herstellung substituierter pyridine. | |
| DE69908131T2 (de) | Verfahren zur Herstellung von fluoroaromatischen Verbindungen | |
| DE1470143C (de) | Verfahren zur Herstellung von 2 Chlor pyndin |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |