CH640872A5 - Formbare und vulkanisierbare, kautschuk aufweisende mischung. - Google Patents
Formbare und vulkanisierbare, kautschuk aufweisende mischung. Download PDFInfo
- Publication number
- CH640872A5 CH640872A5 CH421979A CH421979A CH640872A5 CH 640872 A5 CH640872 A5 CH 640872A5 CH 421979 A CH421979 A CH 421979A CH 421979 A CH421979 A CH 421979A CH 640872 A5 CH640872 A5 CH 640872A5
- Authority
- CH
- Switzerland
- Prior art keywords
- rubber
- parts
- weight
- mixture
- accelerators
- Prior art date
Links
- 229920001971 elastomer Polymers 0.000 title description 64
- 239000005060 rubber Substances 0.000 title description 64
- 239000000203 mixture Substances 0.000 description 78
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 35
- 239000000945 filler Substances 0.000 description 27
- 150000002367 halogens Chemical group 0.000 description 22
- 229910052736 halogen Inorganic materials 0.000 description 21
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 19
- 238000004073 vulcanization Methods 0.000 description 18
- -1 methoxyethyl Chemical group 0.000 description 17
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 15
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 14
- 238000004132 cross linking Methods 0.000 description 14
- 239000000047 product Substances 0.000 description 13
- 239000000377 silicon dioxide Substances 0.000 description 12
- 235000012245 magnesium oxide Nutrition 0.000 description 11
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 11
- 238000012360 testing method Methods 0.000 description 11
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 10
- 239000003921 oil Substances 0.000 description 10
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 9
- 239000003795 chemical substances by application Substances 0.000 description 9
- 239000000395 magnesium oxide Substances 0.000 description 9
- 239000011787 zinc oxide Substances 0.000 description 9
- 150000004760 silicates Chemical class 0.000 description 8
- 235000021355 Stearic acid Nutrition 0.000 description 7
- 230000006835 compression Effects 0.000 description 7
- 238000007906 compression Methods 0.000 description 7
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 7
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 7
- 239000008117 stearic acid Substances 0.000 description 7
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 6
- 239000006229 carbon black Substances 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- KSCAZPYHLGGNPZ-UHFFFAOYSA-N 3-chloropropyl(triethoxy)silane Chemical compound CCO[Si](OCC)(OCC)CCCCl KSCAZPYHLGGNPZ-UHFFFAOYSA-N 0.000 description 5
- PDQAZBWRQCGBEV-UHFFFAOYSA-N Ethylenethiourea Chemical compound S=C1NCCN1 PDQAZBWRQCGBEV-UHFFFAOYSA-N 0.000 description 5
- 241001441571 Hiodontidae Species 0.000 description 5
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 5
- 238000005299 abrasion Methods 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 229910000077 silane Inorganic materials 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- 239000011593 sulfur Substances 0.000 description 5
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 5
- 229960002447 thiram Drugs 0.000 description 5
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 4
- 230000003712 anti-aging effect Effects 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 229920005556 chlorobutyl Polymers 0.000 description 4
- 239000003974 emollient agent Substances 0.000 description 4
- 238000005516 engineering process Methods 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- 239000003365 glass fiber Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000004014 plasticizer Substances 0.000 description 4
- 239000011164 primary particle Substances 0.000 description 4
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 4
- 239000004071 soot Substances 0.000 description 4
- 239000011701 zinc Substances 0.000 description 4
- VLRGXXKFHVJQOL-UHFFFAOYSA-N 3-chloropentane-2,4-dione Chemical compound CC(=O)C(Cl)C(C)=O VLRGXXKFHVJQOL-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 3
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 3
- 235000012211 aluminium silicate Nutrition 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 230000001055 chewing effect Effects 0.000 description 3
- AFZSMODLJJCVPP-UHFFFAOYSA-N dibenzothiazol-2-yl disulfide Chemical compound C1=CC=C2SC(SSC=3SC4=CC=CC=C4N=3)=NC2=C1 AFZSMODLJJCVPP-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 229910044991 metal oxide Inorganic materials 0.000 description 3
- 150000004706 metal oxides Chemical class 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 150000004756 silanes Chemical class 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 3
- 229940099259 vaseline Drugs 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 2
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229920004394 Baypren® Polymers 0.000 description 2
- 239000005046 Chlorosilane Substances 0.000 description 2
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 2
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 241000700605 Viruses Species 0.000 description 2
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 239000010425 asbestos Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- DKVNPHBNOWQYFE-UHFFFAOYSA-N carbamodithioic acid Chemical compound NC(S)=S DKVNPHBNOWQYFE-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical class Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 2
- AUZONCFQVSMFAP-UHFFFAOYSA-N disulfiram Chemical compound CCN(CC)C(=S)SSC(=S)N(CC)CC AUZONCFQVSMFAP-UHFFFAOYSA-N 0.000 description 2
- 239000012990 dithiocarbamate Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 229910000464 lead oxide Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 150000001282 organosilanes Chemical class 0.000 description 2
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000011814 protection agent Substances 0.000 description 2
- 239000003223 protective agent Substances 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 239000012763 reinforcing filler Substances 0.000 description 2
- 229910052895 riebeckite Inorganic materials 0.000 description 2
- 229960004889 salicylic acid Drugs 0.000 description 2
- 238000007493 shaping process Methods 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- QAZLUNIWYYOJPC-UHFFFAOYSA-M sulfenamide Chemical compound [Cl-].COC1=C(C)C=[N+]2C3=NC4=CC=C(OC)C=C4N3SCC2=C1C QAZLUNIWYYOJPC-UHFFFAOYSA-M 0.000 description 2
- OPNUROKCUBTKLF-UHFFFAOYSA-N 1,2-bis(2-methylphenyl)guanidine Chemical compound CC1=CC=CC=C1N\C(N)=N\C1=CC=CC=C1C OPNUROKCUBTKLF-UHFFFAOYSA-N 0.000 description 1
- OWRCNXZUPFZXOS-UHFFFAOYSA-N 1,3-diphenylguanidine Chemical compound C=1C=CC=CC=1NC(=N)NC1=CC=CC=C1 OWRCNXZUPFZXOS-UHFFFAOYSA-N 0.000 description 1
- WGJCBBASTRWVJL-UHFFFAOYSA-N 1,3-thiazolidine-2-thione Chemical compound SC1=NCCS1 WGJCBBASTRWVJL-UHFFFAOYSA-N 0.000 description 1
- QQONDXKKAWOWJF-UHFFFAOYSA-N 1-chloroethyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)C(C)Cl QQONDXKKAWOWJF-UHFFFAOYSA-N 0.000 description 1
- VORLTHPZWVELIX-UHFFFAOYSA-N 1-methyl-2h-quinoline Chemical compound C1=CC=C2N(C)CC=CC2=C1 VORLTHPZWVELIX-UHFFFAOYSA-N 0.000 description 1
- HAZJTCQWIDBCCE-UHFFFAOYSA-N 1h-triazine-6-thione Chemical compound SC1=CC=NN=N1 HAZJTCQWIDBCCE-UHFFFAOYSA-N 0.000 description 1
- ZNRLMGFXSPUZNR-UHFFFAOYSA-N 2,2,4-trimethyl-1h-quinoline Chemical compound C1=CC=C2C(C)=CC(C)(C)NC2=C1 ZNRLMGFXSPUZNR-UHFFFAOYSA-N 0.000 description 1
- JZAMVYIJHKWFAI-UHFFFAOYSA-N 2-bromoethyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)CCBr JZAMVYIJHKWFAI-UHFFFAOYSA-N 0.000 description 1
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 description 1
- IKBFHCBHLOZDKH-UHFFFAOYSA-N 2-chloroethyl(triethoxy)silane Chemical compound CCO[Si](CCCl)(OCC)OCC IKBFHCBHLOZDKH-UHFFFAOYSA-N 0.000 description 1
- CPGFMWPQXUXQRX-UHFFFAOYSA-N 3-amino-3-(4-fluorophenyl)propanoic acid Chemical compound OC(=O)CC(N)C1=CC=C(F)C=C1 CPGFMWPQXUXQRX-UHFFFAOYSA-N 0.000 description 1
- BUZICZZQJDLXJN-UHFFFAOYSA-N 3-azaniumyl-4-hydroxybutanoate Chemical compound OCC(N)CC(O)=O BUZICZZQJDLXJN-UHFFFAOYSA-N 0.000 description 1
- JMFBXUMHVSZUKY-UHFFFAOYSA-N 3-bromopropyl(triethoxy)silane Chemical compound CCO[Si](OCC)(OCC)CCCBr JMFBXUMHVSZUKY-UHFFFAOYSA-N 0.000 description 1
- GLISZRPOUBOZDL-UHFFFAOYSA-N 3-bromopropyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)CCCBr GLISZRPOUBOZDL-UHFFFAOYSA-N 0.000 description 1
- ZXUPDVHDDIFSEP-UHFFFAOYSA-N 3-bromopropyl(tripentoxy)silane Chemical compound CCCCCO[Si](CCCBr)(OCCCCC)OCCCCC ZXUPDVHDDIFSEP-UHFFFAOYSA-N 0.000 description 1
- QMOURSXDRYVWHW-UHFFFAOYSA-N 3-bromopropyl-tris[(2-methylpropan-2-yl)oxy]silane Chemical compound CC(C)(C)O[Si](OC(C)(C)C)(OC(C)(C)C)CCCBr QMOURSXDRYVWHW-UHFFFAOYSA-N 0.000 description 1
- UMDGFWKUXADMBO-UHFFFAOYSA-N 3-chloropropyl(dimethoxymethyl)silane Chemical compound COC(OC)[SiH2]CCCCl UMDGFWKUXADMBO-UHFFFAOYSA-N 0.000 description 1
- YZAHKILJHJDHAX-UHFFFAOYSA-N 3-chloropropyl-ethoxy-(2-phenoxyethyl)silane Chemical compound ClCCC[SiH](CCOC1=CC=CC=C1)OCC YZAHKILJHJDHAX-UHFFFAOYSA-N 0.000 description 1
- NILZGRNPRBIQOG-UHFFFAOYSA-N 3-iodopropyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)CCCI NILZGRNPRBIQOG-UHFFFAOYSA-N 0.000 description 1
- CKEZAUDJDIPPIB-UHFFFAOYSA-N 4-chlorobutyl(trimethoxy)silane Chemical compound CO[Si](OC)(OC)CCCCCl CKEZAUDJDIPPIB-UHFFFAOYSA-N 0.000 description 1
- BBHYMRLYCSRVOS-UHFFFAOYSA-N 4-n,6-n-bis(cyclohexylsulfanyl)-2-n,2-n-diethyl-1,3,5-triazine-2,4,6-triamine Chemical compound N=1C(NSC2CCCCC2)=NC(N(CC)CC)=NC=1NSC1CCCCC1 BBHYMRLYCSRVOS-UHFFFAOYSA-N 0.000 description 1
- LSAUHWRNBBMZIC-UHFFFAOYSA-N 4-sulfanyl-1h-triazine-6-thione Chemical class SC1=CC(=S)NN=N1 LSAUHWRNBBMZIC-UHFFFAOYSA-N 0.000 description 1
- VBWWCYYBZFKCEX-UHFFFAOYSA-N 6-amino-1h-1,3,5-triazine-2-thione Chemical compound NC1=NC=NC(=S)N1 VBWWCYYBZFKCEX-UHFFFAOYSA-N 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OWAMHAWEEZFJKY-UHFFFAOYSA-N C(C)NN1NC(=CC(=N1)N(CC)CC)SSC1=CC(=NN(N1)NCC)N(CC)CC Chemical compound C(C)NN1NC(=CC(=N1)N(CC)CC)SSC1=CC(=NN(N1)NCC)N(CC)CC OWAMHAWEEZFJKY-UHFFFAOYSA-N 0.000 description 1
- VEUATSBQTGLOLT-UHFFFAOYSA-N CNN1NC(=CC(=N1)N(C(C)C)C(C)C)SSC1=CC(=NN(N1)NC)N(C(C)C)C(C)C Chemical compound CNN1NC(=CC(=N1)N(C(C)C)C(C)C)SSC1=CC(=NN(N1)NC)N(C(C)C)C(C)C VEUATSBQTGLOLT-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 229920002943 EPDM rubber Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000006237 Intermediate SAF Substances 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- FCSHMCFRCYZTRQ-UHFFFAOYSA-N N,N'-diphenylthiourea Chemical compound C=1C=CC=CC=1NC(=S)NC1=CC=CC=C1 FCSHMCFRCYZTRQ-UHFFFAOYSA-N 0.000 description 1
- KEQFTVQCIQJIQW-UHFFFAOYSA-N N-Phenyl-2-naphthylamine Chemical compound C=1C=C2C=CC=CC2=CC=1NC1=CC=CC=C1 KEQFTVQCIQJIQW-UHFFFAOYSA-N 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229920005557 bromobutyl Polymers 0.000 description 1
- ULHIDKVNBFIQKP-UHFFFAOYSA-N butanal;butan-1-amine Chemical compound CCCCN.CCCC=O ULHIDKVNBFIQKP-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000000378 calcium silicate Substances 0.000 description 1
- 229910052918 calcium silicate Inorganic materials 0.000 description 1
- JHLNERQLKQQLRZ-UHFFFAOYSA-N calcium silicate Chemical compound [Ca+2].[Ca+2].[O-][Si]([O-])([O-])[O-] JHLNERQLKQQLRZ-UHFFFAOYSA-N 0.000 description 1
- OYACROKNLOSFPA-UHFFFAOYSA-N calcium;dioxido(oxo)silane Chemical compound [Ca+2].[O-][Si]([O-])=O OYACROKNLOSFPA-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- ZDOBWJOCPDIBRZ-UHFFFAOYSA-N chloromethyl(triethoxy)silane Chemical compound CCO[Si](CCl)(OCC)OCC ZDOBWJOCPDIBRZ-UHFFFAOYSA-N 0.000 description 1
- 101150116749 chuk gene Proteins 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- BRCPCVZZSYHXEK-UHFFFAOYSA-N cyclopentyl-(3-iodopropyl)-dimethoxysilane Chemical compound ICCC[Si](OC)(OC)C1CCCC1 BRCPCVZZSYHXEK-UHFFFAOYSA-N 0.000 description 1
- 238000013016 damping Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- JWYGLBSNXMQPFL-UHFFFAOYSA-N dimethoxy-phenyl-propylsilane Chemical compound CCC[Si](OC)(OC)C1=CC=CC=C1 JWYGLBSNXMQPFL-UHFFFAOYSA-N 0.000 description 1
- 238000010292 electrical insulation Methods 0.000 description 1
- ZOOODBUHSVUZEM-UHFFFAOYSA-N ethoxymethanedithioic acid Chemical compound CCOC(S)=S ZOOODBUHSVUZEM-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- 229940083094 guanine derivative acting on arteriolar smooth muscle Drugs 0.000 description 1
- 229920005555 halobutyl Polymers 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000020169 heat generation Effects 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 229920002681 hypalon Polymers 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- ARYZCSRUUPFYMY-UHFFFAOYSA-N methoxysilane Chemical compound CO[SiH3] ARYZCSRUUPFYMY-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- DEQZTKGFXNUBJL-UHFFFAOYSA-N n-(1,3-benzothiazol-2-ylsulfanyl)cyclohexanamine Chemical compound C1CCCCC1NSC1=NC2=CC=CC=C2S1 DEQZTKGFXNUBJL-UHFFFAOYSA-N 0.000 description 1
- LPXPSTWBTULMJE-UHFFFAOYSA-N n-phenylbutan-1-imine Chemical compound CCCC=NC1=CC=CC=C1 LPXPSTWBTULMJE-UHFFFAOYSA-N 0.000 description 1
- 230000006855 networking Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000000962 organic group Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 238000004525 petroleum distillation Methods 0.000 description 1
- PFOWLPUJPOQMAL-UHFFFAOYSA-N piperidine-1-carbothioyl piperidine-1-carbodithioate Chemical compound C1CCCCN1C(=S)SC(=S)N1CCCCC1 PFOWLPUJPOQMAL-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- ZMYXZXUHYAGGKG-UHFFFAOYSA-N propoxysilane Chemical compound CCCO[SiH3] ZMYXZXUHYAGGKG-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000003252 repetitive effect Effects 0.000 description 1
- 238000010057 rubber processing Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- FZHAPNGMFPVSLP-UHFFFAOYSA-N silanamine Chemical class [SiH3]N FZHAPNGMFPVSLP-UHFFFAOYSA-N 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- TXDNPSYEJHXKMK-UHFFFAOYSA-N sulfanylsilane Chemical class S[SiH3] TXDNPSYEJHXKMK-UHFFFAOYSA-N 0.000 description 1
- IKRMQEUTISXXQP-UHFFFAOYSA-N tetrasulfane Chemical class SSSS IKRMQEUTISXXQP-UHFFFAOYSA-N 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- OLMXXIFEBRCMBR-UHFFFAOYSA-N tributoxy(2-iodoethyl)silane Chemical compound CCCCO[Si](CCI)(OCCCC)OCCCC OLMXXIFEBRCMBR-UHFFFAOYSA-N 0.000 description 1
- VTHOKNTVYKTUPI-UHFFFAOYSA-N triethoxy-[3-(3-triethoxysilylpropyltetrasulfanyl)propyl]silane Chemical compound CCO[Si](OCC)(OCC)CCCSSSSCCC[Si](OCC)(OCC)OCC VTHOKNTVYKTUPI-UHFFFAOYSA-N 0.000 description 1
- YUYCVXFAYWRXLS-UHFFFAOYSA-N trimethoxysilane Chemical compound CO[SiH](OC)OC YUYCVXFAYWRXLS-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- UKRDPEFKFJNXQM-UHFFFAOYSA-N vinylsilane Chemical class [SiH3]C=C UKRDPEFKFJNXQM-UHFFFAOYSA-N 0.000 description 1
- 239000004636 vulcanized rubber Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000012991 xanthate Substances 0.000 description 1
- WPZFNRZRCODGMX-UHFFFAOYSA-L zinc;ethoxymethanedithioate Chemical compound [Zn+2].CCOC([S-])=S.CCOC([S-])=S WPZFNRZRCODGMX-UHFFFAOYSA-L 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/54—Silicon-containing compounds
- C08K5/5406—Silicon-containing compounds containing elements other than oxygen or nitrogen
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/54—Silicon-containing compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Processes Of Treating Macromolecular Substances (AREA)
- Sealing Material Composition (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2819638A DE2819638C3 (de) | 1978-05-05 | 1978-05-05 | Vulkanisierbare Halogenkautschuk-Mischungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH640872A5 true CH640872A5 (de) | 1984-01-31 |
Family
ID=6038680
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH421979A CH640872A5 (de) | 1978-05-05 | 1979-05-04 | Formbare und vulkanisierbare, kautschuk aufweisende mischung. |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4222915A (enExample) |
| JP (2) | JPS54146843A (enExample) |
| BE (1) | BE876061A (enExample) |
| BR (1) | BR7902679A (enExample) |
| CA (1) | CA1136309A (enExample) |
| CH (1) | CH640872A5 (enExample) |
| DE (1) | DE2819638C3 (enExample) |
| ES (1) | ES480218A1 (enExample) |
| FR (1) | FR2424935B1 (enExample) |
| GB (1) | GB2020293B (enExample) |
| IT (1) | IT1164678B (enExample) |
| MY (1) | MY8500420A (enExample) |
| NL (1) | NL185670C (enExample) |
| SG (1) | SG5184G (enExample) |
| YU (2) | YU40552B (enExample) |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4269746A (en) | 1979-03-01 | 1981-05-26 | Ford Motor Company | Compounding polychloroprene rubber |
| DE2933345C2 (de) * | 1979-08-17 | 1983-01-20 | Degussa Ag, 6000 Frankfurt | Vulkanisierbare Kautschuk-Mischung auf Basis von halogenfreien Kautschuken und Verfahren zum Vulkanisieren dieser Kautschukmischungen |
| DE3462338D1 (en) * | 1983-03-23 | 1987-03-12 | Nippon Zeon Co | Scorch-inhibited elastomeric composition |
| DE3314742C2 (de) * | 1983-04-23 | 1987-04-02 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von an der Oberfläche modifizierten natürlichen, oxidischen oder silikatischen Füllstoffen und deren Verwendung |
| DE3319251C1 (de) * | 1983-05-27 | 1984-04-19 | Degussa Ag, 6000 Frankfurt | Vulkanisierbare Halogenkautschukmischungen und Verfahren zum Vulkanisieren bzw. Vernetzen |
| DE3430442A1 (de) * | 1984-08-18 | 1986-02-27 | Degussa Ag, 6000 Frankfurt | Vulkanisierbare 2-sek.amino-4,6-dimercapto-s-triazinhaltige halogenkautschukmischungen |
| US4764549A (en) * | 1984-09-07 | 1988-08-16 | Vulkor, Incorporated | Low temperature curing of elastomer |
| US4756851A (en) * | 1985-05-09 | 1988-07-12 | Minnesota Mining And Manufacturing Company | Soap-thickened reenterable gelled encapsulants |
| US4639483A (en) * | 1985-05-09 | 1987-01-27 | Minnesota Mining And Manufacturing Company | Soap-thickened reenterable gelled encapsulants |
| US4711673A (en) * | 1985-10-03 | 1987-12-08 | Aluminum Company Of America | Combination of surface modifiers for powdered inorganic fillers |
| JPS62246951A (ja) * | 1986-04-18 | 1987-10-28 | Mitsuboshi Belting Ltd | 耐熱性動力伝動用vベルト |
| MY101701A (en) * | 1986-12-23 | 1991-12-31 | Nitto Electric Ind Co | Mold-releasing sheet and method for applying mold- releasing agent onto mold surface using said sheet. |
| DE3821463A1 (de) * | 1988-06-25 | 1989-12-28 | Degussa | Vulkanisierbare organyloxysilylfunktionelle thioharnstoffe enthaltende halogenkautschukmischungen |
| DE3908399A1 (de) * | 1989-03-15 | 1990-09-20 | Uniroyal Englebert Gmbh | Fahrzeugluftreifen |
| US5070130A (en) * | 1990-09-19 | 1991-12-03 | The B. F. Goodrich Company | Alkaline earth oxides and hydroxides to reduce nitrosamine formation from vulcanization accelerators |
| US5162409B1 (en) * | 1991-08-02 | 1997-08-26 | Pirelli Armstrong Tire Corp | Tire tread rubber composition |
| DE4128203C1 (enExample) * | 1991-08-26 | 1993-05-13 | Degussa Ag, 6000 Frankfurt, De | |
| JPH07119617A (ja) * | 1993-10-18 | 1995-05-09 | Yoshiro Nakamatsu | 反撥動力装置 |
| US6147147A (en) * | 1998-05-08 | 2000-11-14 | Flow Polymers, Inc. | Coupling agent composition |
| US6337041B1 (en) * | 1999-10-20 | 2002-01-08 | Chih-Hsiung Kuo | Method for making a vulcanized elastomer capable of combining with polyurethane without use of adhesive and method of using the elastomer so made |
| JP5164298B2 (ja) * | 2000-08-11 | 2013-03-21 | 横浜ゴム株式会社 | ゴム組成物およびその製造方法 |
| US6359046B1 (en) | 2000-09-08 | 2002-03-19 | Crompton Corporation | Hydrocarbon core polysulfide silane coupling agents for filled elastomer compositions |
| US6635700B2 (en) | 2000-12-15 | 2003-10-21 | Crompton Corporation | Mineral-filled elastomer compositions |
| US7737202B2 (en) | 2006-12-28 | 2010-06-15 | Momentive Performance Materials Inc. | Free-flowing filler composition and rubber composition containing same |
| US8592506B2 (en) | 2006-12-28 | 2013-11-26 | Continental Ag | Tire compositions and components containing blocked mercaptosilane coupling agent |
| US7960460B2 (en) | 2006-12-28 | 2011-06-14 | Momentive Performance Materials, Inc. | Free-flowing filler composition and rubber composition containing same |
| US7696269B2 (en) | 2006-12-28 | 2010-04-13 | Momentive Performance Materials Inc. | Silated core polysulfides, their preparation and use in filled elastomer compositions |
| US7968634B2 (en) | 2006-12-28 | 2011-06-28 | Continental Ag | Tire compositions and components containing silated core polysulfides |
| US7781606B2 (en) | 2006-12-28 | 2010-08-24 | Momentive Performance Materials Inc. | Blocked mercaptosilane coupling agents, process for making and uses in rubber |
| US7968636B2 (en) | 2006-12-28 | 2011-06-28 | Continental Ag | Tire compositions and components containing silated cyclic core polysulfides |
| US7968633B2 (en) | 2006-12-28 | 2011-06-28 | Continental Ag | Tire compositions and components containing free-flowing filler compositions |
| US7968635B2 (en) | 2006-12-28 | 2011-06-28 | Continental Ag | Tire compositions and components containing free-flowing filler compositions |
| US7687558B2 (en) | 2006-12-28 | 2010-03-30 | Momentive Performance Materials Inc. | Silated cyclic core polysulfides, their preparation and use in filled elastomer compositions |
| US7625965B2 (en) * | 2007-02-08 | 2009-12-01 | Momentive Performance Materials Inc. | Rubber composition, process of preparing same and articles made therefrom |
| BR112014009843A2 (pt) | 2011-10-24 | 2017-04-18 | Bridgestone Americas Tire Operations Llc | composição de borracha prenchida por sílica e o método para fazer a mesma |
| JP5838089B2 (ja) * | 2011-12-26 | 2015-12-24 | 株式会社ブリヂストン | ゴム組成物の製造方法 |
| US9011196B2 (en) | 2013-03-15 | 2015-04-21 | Global Marketing Enterprise (Gme) Ltd. | Developmental activity gym for babies |
| BE1024119B1 (fr) * | 2016-12-16 | 2017-11-16 | Societe Industrielle Liegeoise Des Oxydes Sa | Composition pulverulente durable |
| CN109337119B (zh) * | 2018-09-25 | 2020-06-09 | 广东省稀有金属研究所 | 一种硫化活性剂及其制备方法 |
| CN109503883A (zh) * | 2018-11-23 | 2019-03-22 | 江门市烨信塑料科技实业有限公司 | 一种脂肪酸锌的生产工艺 |
| BE1027627B1 (fr) * | 2020-04-14 | 2021-04-30 | Soc Ind Liegeoise Des Oxydes | Composition activatrice de vulcanisation |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1669954A1 (de) | 1951-01-28 | 1970-08-20 | Degussa | Verfahren zur Verbesserung der Gebrauchseigenschaften von Vulkanisaten |
| US2897173A (en) * | 1951-12-12 | 1959-07-28 | Us Rubber Co | Process for compounding a conjugated diolefin polymer with a siliceous filler and an organohalosilane |
| SE355820B (enExample) * | 1963-05-31 | 1973-05-07 | Monsanto Co | |
| DE1298706B (de) | 1964-12-24 | 1969-07-03 | Degussa | Verfahren zum Vulkanisieren von verstaerkende Fuellstoffe enthaltenden synthetischen Kautschuken |
| GB1289083A (enExample) | 1969-01-30 | 1972-09-13 | ||
| BE757587A (fr) * | 1969-12-17 | 1971-04-15 | Voys Inc Le | Ensemble de mise en place pour |
| AU2222370A (en) * | 1970-05-04 | 1972-05-18 | Dow Corning Corporation | Chloropropylsilane coupling agents |
| DE2029899A1 (de) | 1970-06-18 | 1971-12-30 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zum Vernetzen von Füllstoffen enthaltendem natürlichem und synthetischem Kautschuk bzw. diese enthaltenden Mischungen |
| GB1310379A (en) | 1970-12-10 | 1973-03-21 | Ppg Industries Inc | Tire tread |
| US3873489A (en) * | 1971-08-17 | 1975-03-25 | Degussa | Rubber compositions containing silica and an organosilane |
| US4036807A (en) * | 1972-05-22 | 1977-07-19 | Imperial Chemical Industries Limited | Fluorine-containing organosilicon compounds |
| BG25805A3 (en) | 1972-11-13 | 1978-12-12 | Degussa Ag | A rubber mixture |
-
1978
- 1978-05-05 DE DE2819638A patent/DE2819638C3/de not_active Expired
-
1979
- 1979-03-29 YU YU741/79A patent/YU40552B/xx unknown
- 1979-04-20 NL NLAANVRAGE7903143,A patent/NL185670C/xx not_active IP Right Cessation
- 1979-04-24 FR FR7910307A patent/FR2424935B1/fr not_active Expired
- 1979-05-01 GB GB7915181A patent/GB2020293B/en not_active Expired
- 1979-05-02 BR BR7902679A patent/BR7902679A/pt unknown
- 1979-05-02 US US06/035,234 patent/US4222915A/en not_active Expired - Lifetime
- 1979-05-03 IT IT48921/79A patent/IT1164678B/it active
- 1979-05-04 JP JP5413479A patent/JPS54146843A/ja active Granted
- 1979-05-04 CH CH421979A patent/CH640872A5/de not_active IP Right Cessation
- 1979-05-04 ES ES480218A patent/ES480218A1/es not_active Expired
- 1979-05-04 BE BE6/46819A patent/BE876061A/xx not_active IP Right Cessation
- 1979-05-04 CA CA000326954A patent/CA1136309A/en not_active Expired
-
1982
- 1982-03-24 JP JP57045749A patent/JPS57168927A/ja active Granted
- 1982-10-14 YU YU2314/82A patent/YU44033B/xx unknown
-
1984
- 1984-01-18 SG SG51/84A patent/SG5184G/en unknown
-
1985
- 1985-12-30 MY MY420/85A patent/MY8500420A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| YU74179A (en) | 1983-02-28 |
| NL185670C (nl) | 1990-06-18 |
| YU44033B (en) | 1990-02-28 |
| DE2819638C3 (de) | 1986-11-13 |
| SG5184G (en) | 1985-02-01 |
| BE876061A (fr) | 1979-11-05 |
| NL7903143A (nl) | 1979-11-07 |
| JPS6156251B2 (enExample) | 1986-12-01 |
| NL185670B (nl) | 1990-01-16 |
| US4222915A (en) | 1980-09-16 |
| FR2424935A1 (enExample) | 1979-11-30 |
| GB2020293B (en) | 1982-09-15 |
| FR2424935B1 (enExample) | 1981-05-08 |
| GB2020293A (en) | 1979-11-14 |
| DE2819638A1 (de) | 1979-11-08 |
| YU40552B (en) | 1986-02-28 |
| IT7948921A0 (it) | 1979-05-03 |
| BR7902679A (pt) | 1979-11-27 |
| JPS57168927A (en) | 1982-10-18 |
| YU231482A (en) | 1984-02-29 |
| CA1136309A (en) | 1982-11-23 |
| ES480218A1 (es) | 1980-05-16 |
| IT1164678B (it) | 1987-04-15 |
| JPS54146843A (en) | 1979-11-16 |
| JPS5749579B2 (enExample) | 1982-10-22 |
| DE2819638B2 (de) | 1980-11-27 |
| MY8500420A (en) | 1985-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH640872A5 (de) | Formbare und vulkanisierbare, kautschuk aufweisende mischung. | |
| DE2536674C3 (de) | Vernetzbare Mischungen auf Basis von Kautschuk, Organosilanen und silikatischen Füllstoffen | |
| EP1533336B1 (de) | Kautschukmischungen | |
| DE2933345C2 (de) | Vulkanisierbare Kautschuk-Mischung auf Basis von halogenfreien Kautschuken und Verfahren zum Vulkanisieren dieser Kautschukmischungen | |
| DE2848559C2 (de) | Reversionsfreie Vulkanisate ergebende Kautschukmischungen und deren Verwendung | |
| EP0519188B1 (de) | Verfahren zur Herstellung von vulkanisierbaren, mit Russ gefüllten Kunststoff- und Kautschukmischungen | |
| DE2933346C2 (de) | Silan/Füllstoff-Präparationen, Verfahren zu deren Herstellung und Anwendung derselben | |
| EP1285926B1 (de) | Organosiliciumverbindungen | |
| DE4023537A1 (de) | Mit organosiliciumverbindungen chemisch modifizierte russe, verfahren zu deren herstellung und deren verwendung | |
| DE60306779T3 (de) | Organosilankonzentrat | |
| DE19844607A1 (de) | Sulfanylsilane | |
| DE3319251C1 (de) | Vulkanisierbare Halogenkautschukmischungen und Verfahren zum Vulkanisieren bzw. Vernetzen | |
| DE4415658A1 (de) | Schwefelhaltige Organosiliciumverbindungen enthaltende Kautschukmischungen | |
| EP0997489A2 (de) | Schwefelfunktionelle Polyorganosiloxane | |
| EP1043357A1 (de) | Kautschukmischungen | |
| EP0931812A1 (de) | Verfahren zur Herstellung von hydrophobierten oxidischen oder silikatischen Füllstoffen enthaltenden Kautschukmischungen sowie deren Verwendung zur Herstellung von Reifen | |
| DE102008037593B4 (de) | Kautschukmischung und deren Verwendung für Laufstreifen und Reifen | |
| DE4417354A1 (de) | Kieselsäure-gefüllte Kautschukmischungen mit verbesserter Vulkanisationskinetik | |
| EP0846722B1 (de) | Reversionsarme Vernetzer | |
| EP0947548A1 (de) | Trimethylolpropan-Destillationsrückstände enthaltende Kautschukmischungen | |
| EP0351500B1 (de) | Vulkanisierbare organyloxysilylfunktionelle Thioharnstoffe enthaltende Halogenkautschukmischungen | |
| EP0590457B1 (de) | Benzothiazolderivate als Vulkanisationsbeschleuniger, die sich zur Einführung von polaren Substituenten eignen | |
| EP0937745A1 (de) | Hydrophobierte, oxidische oder silikatische Füllstoffe und ihre Verwendung | |
| WO2024240312A1 (de) | Verbindung als alterungsschutzmittel in kautschukmischungen und fahrzeugreifen | |
| DD258821A5 (de) | Verfahren zur Herstellung von vulkanisierbaren Kautschukmischungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |