CH639644A5 - Verfahren zur herstellung von isocyanaten. - Google Patents
Verfahren zur herstellung von isocyanaten. Download PDFInfo
- Publication number
- CH639644A5 CH639644A5 CH1002177A CH1002177A CH639644A5 CH 639644 A5 CH639644 A5 CH 639644A5 CH 1002177 A CH1002177 A CH 1002177A CH 1002177 A CH1002177 A CH 1002177A CH 639644 A5 CH639644 A5 CH 639644A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- tert
- isocyanato
- acid
- compounds
- Prior art date
Links
- 239000012948 isocyanate Substances 0.000 title claims description 20
- 150000002513 isocyanates Chemical class 0.000 title claims description 20
- 238000004519 manufacturing process Methods 0.000 title description 3
- 239000002253 acid Substances 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 24
- 150000002148 esters Chemical class 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 12
- -1 aromatic hydrocarbon radical Chemical class 0.000 claims description 11
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 10
- 239000007858 starting material Substances 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 4
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 21
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 239000011734 sodium Substances 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 8
- 230000032050 esterification Effects 0.000 description 7
- 238000005886 esterification reaction Methods 0.000 description 7
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 6
- 230000002152 alkylating effect Effects 0.000 description 6
- 229940117389 dichlorobenzene Drugs 0.000 description 6
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 6
- WLJVXDMOQOGPHL-UHFFFAOYSA-N benzyl-alpha-carboxylic acid Natural products OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 5
- 229960003424 phenylacetic acid Drugs 0.000 description 5
- 239000003279 phenylacetic acid Substances 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Inorganic materials [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 125000002130 sulfonic acid ester group Chemical group 0.000 description 5
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 239000002981 blocking agent Substances 0.000 description 4
- 238000005829 trimerization reaction Methods 0.000 description 4
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- MSXVEPNJUHWQHW-UHFFFAOYSA-N 2-methylbutan-2-ol Chemical compound CCC(C)(C)O MSXVEPNJUHWQHW-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical class OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 3
- 150000004707 phenolate Chemical class 0.000 description 3
- 229940031826 phenolate Drugs 0.000 description 3
- 239000004814 polyurethane Substances 0.000 description 3
- 229920002635 polyurethane Polymers 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 150000003459 sulfonic acid esters Chemical class 0.000 description 3
- XAQCYASNAMYTQA-UHFFFAOYSA-N 2,4-diamino-5-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=C(N)C=C1N XAQCYASNAMYTQA-UHFFFAOYSA-N 0.000 description 2
- WFRBDWRZVBPBDO-UHFFFAOYSA-N 2-methyl-2-pentanol Chemical compound CCCC(C)(C)O WFRBDWRZVBPBDO-UHFFFAOYSA-N 0.000 description 2
- HNVRRHSXBLFLIG-UHFFFAOYSA-N 3-hydroxy-3-methylbut-1-ene Chemical compound CC(C)(O)C=C HNVRRHSXBLFLIG-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- PFNWLGLUWUKHNF-UHFFFAOYSA-N methyl 3-isocyanatobenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=CC(N=C=O)=C1 PFNWLGLUWUKHNF-UHFFFAOYSA-N 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 2
- 229920001228 polyisocyanate Polymers 0.000 description 2
- 239000005056 polyisocyanate Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 2
- JBQGNCQLVMYWBX-UHFFFAOYSA-N (2,6-diisocyanatophenyl)methanesulfonyl chloride Chemical compound ClS(=O)(=O)CC1=C(N=C=O)C=CC=C1N=C=O JBQGNCQLVMYWBX-UHFFFAOYSA-N 0.000 description 1
- GWEHVDNNLFDJLR-UHFFFAOYSA-N 1,3-diphenylurea Chemical compound C=1C=CC=CC=1NC(=O)NC1=CC=CC=C1 GWEHVDNNLFDJLR-UHFFFAOYSA-N 0.000 description 1
- VTBOTOBFGSVRMA-UHFFFAOYSA-N 1-Methylcyclohexanol Chemical compound CC1(O)CCCCC1 VTBOTOBFGSVRMA-UHFFFAOYSA-N 0.000 description 1
- BUCJHJXFXUZJHL-UHFFFAOYSA-N 1-ethylcyclohexan-1-ol Chemical compound CCC1(O)CCCCC1 BUCJHJXFXUZJHL-UHFFFAOYSA-N 0.000 description 1
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 1
- HEAHMJLHQCESBZ-UHFFFAOYSA-N 2,5-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(N)C(S(O)(=O)=O)=C1 HEAHMJLHQCESBZ-UHFFFAOYSA-N 0.000 description 1
- CZFHJGAIDYWZTB-UHFFFAOYSA-N 2,5-diisocyanatobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC(N=C=O)=CC=C1N=C=O CZFHJGAIDYWZTB-UHFFFAOYSA-N 0.000 description 1
- WZLXCJRMZVZVTB-UHFFFAOYSA-N 2-amino-3-methylbenzenesulfonic acid Chemical compound CC1=CC=CC(S(O)(=O)=O)=C1N WZLXCJRMZVZVTB-UHFFFAOYSA-N 0.000 description 1
- ZCGVPUAAMCMLTM-UHFFFAOYSA-N 2-amino-5-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(Cl)C=C1S(O)(=O)=O ZCGVPUAAMCMLTM-UHFFFAOYSA-N 0.000 description 1
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 1
- IPQWXJDRMKGSFI-UHFFFAOYSA-N 3,5-diamino-4-methylbenzenesulfonic acid Chemical compound CC1=C(N)C=C(S(O)(=O)=O)C=C1N IPQWXJDRMKGSFI-UHFFFAOYSA-N 0.000 description 1
- QNYWPSVGLQPXIZ-UHFFFAOYSA-N 3-amino-4-phenoxybenzenesulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1OC1=CC=CC=C1 QNYWPSVGLQPXIZ-UHFFFAOYSA-N 0.000 description 1
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 1
- CFSNFFQWAXHVPZ-UHFFFAOYSA-N 3-isocyanatobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC(N=C=O)=C1 CFSNFFQWAXHVPZ-UHFFFAOYSA-N 0.000 description 1
- DTQVHBIQMCFTSZ-UHFFFAOYSA-N 4-amino-3-chloro-5-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=CC(Cl)=C1N DTQVHBIQMCFTSZ-UHFFFAOYSA-N 0.000 description 1
- WQTCZINVPXJNEL-UHFFFAOYSA-N 4-amino-3-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=CC=C1N WQTCZINVPXJNEL-UHFFFAOYSA-N 0.000 description 1
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 1
- ZBZGGZGVFCIXDE-UHFFFAOYSA-N 5-amino-2-(4-aminophenyl)benzenesulfonic acid Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C=C1S(O)(=O)=O ZBZGGZGVFCIXDE-UHFFFAOYSA-N 0.000 description 1
- GDCAHFTTXXUBKZ-UHFFFAOYSA-N 5-amino-2-[(4-amino-2-sulfophenyl)methyl]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1CC1=CC=C(N)C=C1S(O)(=O)=O GDCAHFTTXXUBKZ-UHFFFAOYSA-N 0.000 description 1
- BRKFTWHPLMMNHF-UHFFFAOYSA-N 5-amino-2-methylbenzenesulfonic acid Chemical compound CC1=CC=C(N)C=C1S(O)(=O)=O BRKFTWHPLMMNHF-UHFFFAOYSA-N 0.000 description 1
- GBWNQBBVSVGAAL-UHFFFAOYSA-N 5-aminobenzene-1,3-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C1 GBWNQBBVSVGAAL-UHFFFAOYSA-N 0.000 description 1
- GHCFYCCXEKHAHC-UHFFFAOYSA-N 5-aminonaphthalene-1,3-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C(N)=CC=CC2=C1S(O)(=O)=O GHCFYCCXEKHAHC-UHFFFAOYSA-N 0.000 description 1
- UWPJYQYRSWYIGZ-UHFFFAOYSA-N 5-aminonaphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(N)=CC=CC2=C1 UWPJYQYRSWYIGZ-UHFFFAOYSA-N 0.000 description 1
- OYFFPEICGBWAFA-UHFFFAOYSA-N 5-isocyanato-2-methylbenzenesulfonyl chloride Chemical compound CC1=CC=C(N=C=O)C=C1S(Cl)(=O)=O OYFFPEICGBWAFA-UHFFFAOYSA-N 0.000 description 1
- YUNBHHWDQDGWHC-UHFFFAOYSA-N 6-aminonaphthalene-1-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC2=CC(N)=CC=C21 YUNBHHWDQDGWHC-UHFFFAOYSA-N 0.000 description 1
- WGAPIALKSXVJAO-UHFFFAOYSA-N 7-isocyanatonaphthalene-1-sulfonyl chloride Chemical compound C1=C(N=C=O)C=C2C(S(=O)(=O)Cl)=CC=CC2=C1 WGAPIALKSXVJAO-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- GHVZOJONCUEWAV-UHFFFAOYSA-N [K].CCO Chemical compound [K].CCO GHVZOJONCUEWAV-UHFFFAOYSA-N 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- HFACYLZERDEVSX-UHFFFAOYSA-N benzidine Chemical group C1=CC(N)=CC=C1C1=CC=C(N)C=C1 HFACYLZERDEVSX-UHFFFAOYSA-N 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- WRJWRGBVPUUDLA-UHFFFAOYSA-N chlorosulfonyl isocyanate Chemical compound ClS(=O)(=O)N=C=O WRJWRGBVPUUDLA-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- UKPOZTCTTIZXDZ-UHFFFAOYSA-N ethyl 5-isocyanato-2-methylbenzenesulfonate Chemical compound CCOS(=O)(=O)C1=CC(N=C=O)=CC=C1C UKPOZTCTTIZXDZ-UHFFFAOYSA-N 0.000 description 1
- RJOCIDSMMUPDGI-UHFFFAOYSA-N ethyl carbamate;2-methylbenzenesulfonyl chloride Chemical compound CCOC(N)=O.CC1=CC=CC=C1S(Cl)(=O)=O RJOCIDSMMUPDGI-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- LOPROKXZHWKSAF-UHFFFAOYSA-N methyl (2,6-diisocyanatophenyl)methanesulfonate Chemical compound COS(=O)(=O)CC1=C(N=C=O)C=CC=C1N=C=O LOPROKXZHWKSAF-UHFFFAOYSA-N 0.000 description 1
- VJDVKPCVHATTRK-UHFFFAOYSA-N methyl 2,5-diisocyanatobenzenesulfonate Chemical compound COS(=O)(=O)C1=CC(N=C=O)=CC=C1N=C=O VJDVKPCVHATTRK-UHFFFAOYSA-N 0.000 description 1
- ZXXIFMLGDQXKCW-UHFFFAOYSA-N methyl 2-(isocyanatomethyl)benzenesulfonate Chemical compound COS(=O)(=O)C1=CC=CC=C1CN=C=O ZXXIFMLGDQXKCW-UHFFFAOYSA-N 0.000 description 1
- BUTJPBNSRQBBRV-UHFFFAOYSA-N methyl 4-isocyanatobenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(N=C=O)C=C1 BUTJPBNSRQBBRV-UHFFFAOYSA-N 0.000 description 1
- JFIQJWQUTKUJSD-UHFFFAOYSA-N methyl 5-isocyanato-2-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC(N=C=O)=CC=C1C JFIQJWQUTKUJSD-UHFFFAOYSA-N 0.000 description 1
- RKGZZKIOFHLCAG-UHFFFAOYSA-N methyl 7-isocyanatonaphthalene-1-sulfonate Chemical compound C1=C(N=C=O)C=C2C(S(=O)(=O)OC)=CC=CC2=C1 RKGZZKIOFHLCAG-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- NRZRRZAVMCAKEP-UHFFFAOYSA-N naphthionic acid Chemical compound C1=CC=C2C(N)=CC=C(S(O)(=O)=O)C2=C1 NRZRRZAVMCAKEP-UHFFFAOYSA-N 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 230000008560 physiological behavior Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 102200014657 rs121434437 Human genes 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- NESLWCLHZZISNB-UHFFFAOYSA-M sodium phenolate Chemical compound [Na+].[O-]C1=CC=CC=C1 NESLWCLHZZISNB-UHFFFAOYSA-M 0.000 description 1
- SYXYWTXQFUUWLP-UHFFFAOYSA-N sodium;butan-1-olate Chemical compound [Na+].CCCC[O-] SYXYWTXQFUUWLP-UHFFFAOYSA-N 0.000 description 1
- HIFJOEJCXUJQBO-UHFFFAOYSA-N sodium;cyclohexanolate Chemical compound [Na+].[O-]C1CCCCC1 HIFJOEJCXUJQBO-UHFFFAOYSA-N 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C303/00—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides
- C07C303/26—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of esters of sulfonic acids
- C07C303/30—Preparation of esters or amides of sulfuric acids; Preparation of sulfonic acids or of their esters, halides, anhydrides or amides of esters of sulfonic acids by reactions not involving the formation of esterified sulfo groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
DE19762637114 DE2637114A1 (de) | 1976-08-18 | 1976-08-18 | Verfahren zur herstellung von isocyanaten |
Publications (1)
Publication Number | Publication Date |
---|---|
CH639644A5 true CH639644A5 (de) | 1983-11-30 |
Family
ID=5985709
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CH1002177A CH639644A5 (de) | 1976-08-18 | 1977-08-16 | Verfahren zur herstellung von isocyanaten. |
Country Status (8)
Families Citing this family (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE2651065A1 (de) * | 1976-11-09 | 1978-05-18 | Bayer Ag | Modifizierte, sulfonsaeureestergruppen aufweisende polyisocyanate |
DE2855938A1 (de) * | 1978-12-23 | 1980-07-10 | Bayer Ag | Isocyanatoarylsulfochloride, ein verfahren zu ihrer herstellung, sowie ihre verwendung bei der herstellung von polyisocyanat-polyadditionsprodukten |
DE3130844A1 (de) * | 1981-08-04 | 1983-02-24 | Bayer Ag, 5090 Leverkusen | Neue n,n-disubstituierte sulfonamidgruppen aufweisende aromatische diisocyanate, verfahren zu ihrer herstellung sowie ihre verwendung als aufbaukomponente bei der herstellung von polyurethanen |
WO2009120492A1 (en) * | 2008-03-27 | 2009-10-01 | General Electric Company | Aromatic halsulfonyl isocyanate compositions and polymers therefrom |
CN116730880B (zh) * | 2023-08-14 | 2023-10-27 | 江苏天合储能有限公司 | 电解液除水添加剂、电解液及锂离子电池 |
Family Cites Families (10)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
GB485761A (en) * | 1936-11-24 | 1938-05-24 | Henry Alfred Piggott | Manufacture of isocyanates |
US3404170A (en) * | 1965-09-27 | 1968-10-01 | Upjohn Co | Preparation of isocyanates |
DE1618441C3 (de) * | 1967-06-21 | 1975-05-07 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von 2-lso-cyanato-2-methyl-propansulfonsäurechlorid |
CH542824A (de) * | 1968-06-06 | 1973-11-30 | Bayer Ag | Verfahren zur Herstellung von Chlorsulfonyl-vinyl-isocyanaten |
CA931688A (en) * | 1968-08-02 | 1973-08-07 | C. Carlson Robert | Sulfonated aromatic polyisocyanates and preparation of stable anionic polyurethane or polyurea latices therefrom |
DE2227111C2 (de) * | 1972-06-03 | 1984-07-26 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von flüssigen, Sulfonsäure- und/oder Sulfonatgruppen aufweisenden, aromatischen Polyisocyanatgemischen und die danach hergestellten Gemische |
US3959329A (en) * | 1973-05-24 | 1976-05-25 | Bayer Aktiengesellschaft | Polyisocyanates containing sulphonic acid or sulphonate groups |
DE2359615A1 (de) * | 1973-11-30 | 1975-06-05 | Bayer Ag | Harzartige sulfonierte polyisocyanate |
DE2359614A1 (de) * | 1973-11-30 | 1975-06-05 | Bayer Ag | Sulfonsaeure- und/oder sulfonatgruppen aufweisende polyisocyanate |
DE2359611C3 (de) * | 1973-11-30 | 1981-09-17 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von durch Harze auf Isocyanatbasis gebundenen Füllstoffen |
-
1976
- 1976-08-18 DE DE19762637114 patent/DE2637114A1/de active Granted
-
1977
- 1977-08-11 IT IT50643/77A patent/IT1079815B/it active
- 1977-08-16 GB GB34321/77A patent/GB1539146A/en not_active Expired
- 1977-08-16 CH CH1002177A patent/CH639644A5/de not_active IP Right Cessation
- 1977-08-17 BE BE180224A patent/BE857853A/xx not_active IP Right Cessation
- 1977-08-18 JP JP52098310A patent/JPS6027664B2/ja not_active Expired
- 1977-08-18 FR FR7725315A patent/FR2362123A1/fr active Granted
-
1979
- 1979-02-26 US US06/015,577 patent/US4259255A/en not_active Expired - Lifetime
-
1983
- 1983-02-10 JP JP58019840A patent/JPS58150550A/ja active Pending
Also Published As
Publication number | Publication date |
---|---|
JPS5323904A (en) | 1978-03-06 |
JPS58150550A (ja) | 1983-09-07 |
IT1079815B (it) | 1985-05-13 |
GB1539146A (en) | 1979-01-24 |
DE2637114C2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1987-12-03 |
DE2637114A1 (de) | 1978-02-23 |
FR2362123A1 (fr) | 1978-03-17 |
US4259255A (en) | 1981-03-31 |
FR2362123B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1980-08-29 |
JPS6027664B2 (ja) | 1985-06-29 |
BE857853A (fr) | 1978-02-17 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
EP0078991B1 (de) | Verfahren zur Herstellung von Mischtrimerisaten organischer Isocyanate, die nach dem Verfahren erhaltenen Mischtrimerisate, sowie ihre Verwendung zur Herstellung von Polyurethanen | |
DE2447348A1 (de) | Verfahren zur herstellung von diarylcarbonaten | |
CH639644A5 (de) | Verfahren zur herstellung von isocyanaten. | |
DE2342603B2 (de) | Verfahren zur Herstellung von Malonsäuredialkylesterblockierten Biuretpolyisocyanaten sowie deren Verwendung | |
EP0183115B1 (de) | Gegebenenfalls in 3-Stellung Methyl-substituierte Bis-(4-isocyanatophenoxy)-alkane, ein Verfahren zu ihrer Herstellung und ihre Verwendung bei der Herstellung von Polyurethankunststoffen | |
DE3789700T2 (de) | Herstellung von Cyclohexylmono- und -diurethanen sowie der entsprechenden Isocyanate durch Addition von Methylcarbamaten an Limonen, Verfahren und Zusammensetzung. | |
DE1943635A1 (de) | s-Triazinyl-isocyanate | |
DE1495845A1 (de) | Verfahren zur Herstellung von durch Einbau von Urethangruppen modifizierten Polycarbonaten | |
EP0270906B1 (de) | Diisocyanate und Diisocyanatgemische, ein Verfahren zu ihrer Herstellung und ihrer Verwendung bei der Herstellung von Polyurethankunststoffen | |
DE2447349A1 (de) | Verfahren zur herstellung von aliphatischen polycarbonaten und aliphatischaromatischen copolycarbonaten | |
DE1568635B2 (de) | Verfahren zur Herstellung vernetzbarer Urethangruppen enthaltender Verbindungen | |
US4325887A (en) | Isocyanatoaryl sulfonic acid esters | |
EP0449110B1 (de) | Neue 2,2-Dialkylpentan-1,5-diisocyanate, -diurethane und -dicarbamidsäure-chloride, Verfahren zu ihrer Herstellung und ihre Verwendung | |
EP0238925B1 (de) | Verfahren zur Herstellung N,N-disubstituierter Mono- und Oligourethane | |
EP0410214B1 (de) | Verfahren zur Herstellung N,N-disubstituierter Mono- und Oligourethane | |
EP0195928B1 (de) | 4,4'-Diisocyanato-phenylbenzylether, ein Verfahren zu seiner Herstellung und seine Verwendung als Isocyanatkomponente bei der Herstellung von Polyurethankunststoffen | |
DD159637A5 (de) | Acylierungsmittel zur acylierung von phenolischen hydroxylgruppen | |
EP0307757A2 (de) | Verfahren zur Herstellung von Polyurethanen mit LC-Eigenschaften und zur Durchführung dieses Verfahrens geeignete Diisocyanate | |
DE2605024A1 (de) | Verfahren zur herstellung neuer aliphatischer polycarbonate | |
DE3525606A1 (de) | Bis-(4-isocyanato-3-methyl-phenoxy)-alkane, ein verfahren zu ihrer herstellung und ihre verwendung bei der herstellung von polyurethankunststoffen | |
DE3442689A1 (de) | Bis-(4-isocyanatophenoxy)-alkane, ein verfahren zu ihrer herstellung und ihre verwendung bei der herstellung von polyurethankunststoffen | |
EP0244727B1 (de) | 1,4-Bis-(4-isocyanatophenoxy)- benzole, ein Verfahren zu ihrer Herstellung und ihre Verwendung bei der Herstellung von Polyurethankunststoffen | |
DE1670667C3 (de) | Verfahren zur Trimerisierung aromatischer Polyisocyanate | |
DE2524475A1 (de) | Neue 1,2,3,5-oxthiadiazin-2-dioxid- 4,6-dione | |
DE19526081A1 (de) | Verfahren zur Herstellung von sterisch gehinderten organischen Mono- und Polyisocyanaten |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
PL | Patent ceased | ||
PL | Patent ceased |