CH638479A5 - Verfahren zur herstellung von 1-chlor-3,3-dimethyl-butan-2-on. - Google Patents
Verfahren zur herstellung von 1-chlor-3,3-dimethyl-butan-2-on. Download PDFInfo
- Publication number
- CH638479A5 CH638479A5 CH392778A CH392778A CH638479A5 CH 638479 A5 CH638479 A5 CH 638479A5 CH 392778 A CH392778 A CH 392778A CH 392778 A CH392778 A CH 392778A CH 638479 A5 CH638479 A5 CH 638479A5
- Authority
- CH
- Switzerland
- Prior art keywords
- pinacoline
- reaction
- chlorine
- monochloropinacoline
- process according
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 3
- PJGSXYOJTGTZAV-UHFFFAOYSA-N pinacolone Chemical compound CC(=O)C(C)(C)C PJGSXYOJTGTZAV-UHFFFAOYSA-N 0.000 claims description 37
- 238000000034 method Methods 0.000 claims description 28
- 238000006243 chemical reaction Methods 0.000 claims description 21
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 13
- 239000000460 chlorine Substances 0.000 claims description 13
- 229910052801 chlorine Inorganic materials 0.000 claims description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 238000005660 chlorination reaction Methods 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- WURBVZBTWMNKQT-UHFFFAOYSA-N 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one Chemical compound C1=NC=NN1C(C(=O)C(C)(C)C)OC1=CC=C(Cl)C=C1 WURBVZBTWMNKQT-UHFFFAOYSA-N 0.000 description 1
- ULSAJQMHTGKPIY-UHFFFAOYSA-N 1-chloro-3,3-dimethylbutan-2-one Chemical compound CC(C)(C)C(=O)CCl ULSAJQMHTGKPIY-UHFFFAOYSA-N 0.000 description 1
- SGDKTJPVCKQTHK-UHFFFAOYSA-N 5-bromo-2-fluoro-3-nitropyridine Chemical compound [O-][N+](=O)C1=CC(Br)=CN=C1F SGDKTJPVCKQTHK-UHFFFAOYSA-N 0.000 description 1
- 101150049168 Nisch gene Proteins 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/63—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by introduction of halogen; by substitution of halogen atoms by other halogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2716896A DE2716896B1 (de) | 1977-04-16 | 1977-04-16 | Verfahren zur Herstellung von 1-Chlor-3,3-dimethyl-butan-2-on |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH638479A5 true CH638479A5 (de) | 1983-09-30 |
Family
ID=6006440
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH392778A CH638479A5 (de) | 1977-04-16 | 1978-04-12 | Verfahren zur herstellung von 1-chlor-3,3-dimethyl-butan-2-on. |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4196150A (enExample) |
| JP (1) | JPS53130615A (enExample) |
| BE (1) | BE865972A (enExample) |
| BR (1) | BR7802320A (enExample) |
| CH (1) | CH638479A5 (enExample) |
| CS (1) | CS207718B2 (enExample) |
| DD (1) | DD135823A5 (enExample) |
| DE (1) | DE2716896B1 (enExample) |
| DK (1) | DK170798B1 (enExample) |
| FR (1) | FR2387208A1 (enExample) |
| GB (1) | GB1574548A (enExample) |
| HU (1) | HU174535B (enExample) |
| IL (1) | IL54499A (enExample) |
| IT (1) | IT1105006B (enExample) |
| NL (1) | NL190843C (enExample) |
| SU (1) | SU799644A3 (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3049461A1 (de) * | 1980-12-30 | 1982-09-09 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von monochlormethylketonen |
| DE3204788A1 (de) * | 1982-02-11 | 1983-08-18 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 5-substituierten 1-chlor-3,3-dimethylpentan-2-onen |
| DE3400829A1 (de) * | 1984-01-12 | 1985-07-18 | Basf Ag, 6700 Ludwigshafen | Alpha-halogen-phenoxyalkylketone, phenoxyalkylketone, verfahren zu ihrer herstellung, sowie ihre verwendung als zwischenprodukte zur herstellung von fungiziden |
| US4642385A (en) * | 1985-11-19 | 1987-02-10 | Mobay Corporation | Preparation of monochloropinacolone |
| CN107686443A (zh) * | 2017-09-27 | 2018-02-13 | 南通利奥化工科技有限公司 | 一种一氯频哪酮的生产方法 |
| CN112430180A (zh) * | 2020-10-24 | 2021-03-02 | 湖北山水化工有限公司 | 制备一氯频呐酮的工艺系统及工艺 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE698778C (de) * | 1934-11-11 | 1941-07-10 | I G Farbenindustrie Akt Ges | Verfahren zur Herstellung von organischen Monochlor- oder Monobromverbindungen |
| US2120392A (en) * | 1937-12-30 | 1938-06-14 | Goodrich Co B F | Continuous process for the chlorination of ketones |
| US2235562A (en) * | 1938-09-01 | 1941-03-18 | Eastman Kodak Co | Method for producing chlorinated ketones |
| US2243484A (en) * | 1939-04-28 | 1941-05-27 | Commercial Solvents Corp | Process for the preparation of monohalogenated ketones |
| DE954694C (de) * | 1952-12-28 | 1956-12-20 | Basf Ag | Verfahren zur Chlorierung von nicht oder nur wenig wasserloeslichen Ketonen oder sekundaeren Alkoholen der aliphatischen oder cycloaliphatischen Reihe |
| US3397240A (en) * | 1962-07-24 | 1968-08-13 | Merck & Co Inc | Process for the monohalogenation of acetone |
| JPS53137908A (en) * | 1977-05-10 | 1978-12-01 | Shionogi & Co Ltd | Syntheses of monochloropinacolone and cyanopinacolone |
-
1977
- 1977-04-16 DE DE2716896A patent/DE2716896B1/de active Granted
-
1978
- 1978-03-29 US US05/891,561 patent/US4196150A/en not_active Expired - Lifetime
- 1978-04-11 GB GB14135/78A patent/GB1574548A/en not_active Expired
- 1978-04-12 CH CH392778A patent/CH638479A5/de not_active IP Right Cessation
- 1978-04-12 HU HU78BA3647A patent/HU174535B/hu unknown
- 1978-04-13 IL IL54499A patent/IL54499A/xx unknown
- 1978-04-13 NL NL7803950A patent/NL190843C/xx not_active IP Right Cessation
- 1978-04-14 BE BE2056872A patent/BE865972A/xx not_active IP Right Cessation
- 1978-04-14 SU SU782602549A patent/SU799644A3/ru active
- 1978-04-14 FR FR7811087A patent/FR2387208A1/fr active Granted
- 1978-04-14 DK DK164878A patent/DK170798B1/da not_active IP Right Cessation
- 1978-04-14 CS CS782446A patent/CS207718B2/cs unknown
- 1978-04-14 DD DD78204800A patent/DD135823A5/xx not_active IP Right Cessation
- 1978-04-14 IT IT48903/78A patent/IT1105006B/it active
- 1978-04-14 JP JP4338678A patent/JPS53130615A/ja active Granted
- 1978-04-14 BR BR7802320A patent/BR7802320A/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL54499A0 (en) | 1978-07-31 |
| IL54499A (en) | 1980-10-26 |
| BE865972A (fr) | 1978-10-16 |
| SU799644A3 (ru) | 1981-01-23 |
| GB1574548A (en) | 1980-09-10 |
| CS207718B2 (en) | 1981-08-31 |
| DE2716896B1 (de) | 1978-11-02 |
| NL190843C (nl) | 1994-09-16 |
| US4196150A (en) | 1980-04-01 |
| JPS53130615A (en) | 1978-11-14 |
| FR2387208A1 (fr) | 1978-11-10 |
| BR7802320A (pt) | 1978-12-19 |
| FR2387208B1 (enExample) | 1984-09-14 |
| DK164878A (da) | 1978-10-17 |
| DK170798B1 (da) | 1996-01-22 |
| HU174535B (hu) | 1980-02-28 |
| DD135823A5 (de) | 1979-05-30 |
| NL7803950A (nl) | 1978-10-18 |
| IT1105006B (it) | 1985-10-28 |
| JPS6126769B2 (enExample) | 1986-06-21 |
| DE2716896C2 (enExample) | 1979-06-28 |
| IT7848903A0 (it) | 1978-04-14 |
| NL190843B (nl) | 1994-04-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2418676A1 (de) | Verfahren zur herstellung von trifluoracetylchlorid | |
| DE2716896C2 (enExample) | ||
| EP0083442B1 (de) | Verfahren zur Herstellung von 2,4,6-Trichloranilin | |
| DE1018853B (de) | Verfahren zur Herstellung von 1, 1, 1-Trifluor-2-brom-2-chloraethan | |
| EP0676389B1 (de) | Verfahren zur Herstellung von 0-Chloromethylbenzoesäurechloriden | |
| EP0057844B1 (de) | Verfahren zur Herstellung von Polychlorbenzoylchloriden | |
| EP0037960A1 (de) | Verfahren zur Herstellung von Trichlorbenzolen | |
| EP0076985B1 (de) | Verfahren zur Herstellung von Alpha-Dicyano-trimethyl-silyloxy-Verbindungen (I) | |
| DE2007867B2 (de) | Verfahren zur kontinuierlichen Herstellung von Dichlorpropanolen | |
| DE2756235C2 (de) | Verfahren zur Herstellung von gegebenenfalls substituiertem Benzotrifluorid | |
| EP0022185B1 (de) | Verfahren zur Herstellung von Chloracetylchlorid | |
| EP0417543B1 (de) | Verfahren zur Herstellung von 3-Methylchinolin-8-carbonsäure | |
| EP0413264A1 (de) | Verfahren zur Herstellung von Chlorcarbonsäurechloriden | |
| DE2050562A1 (de) | Verfahren zur Herstellung von Dichloracetylchlorid | |
| DE1418334B1 (de) | Verfahren zur Herstellung von 1,2,3,4,7,7-Hexachlorbicyclo[2,2,1]-2,5-heptadien aus Hexachlorcyclopentadien und Acetylen | |
| DE2910675A1 (de) | Verfahren zur kontinuierlichen herstellung von propylenchlorhydrinen | |
| EP0087701A2 (de) | Verfahren zur Herstellung von 2-Chlorbenzoxazolen | |
| DE69005000T2 (de) | Verfahren zur Herstellung von Acrylsäurechlorid. | |
| EP0078993A1 (de) | Verfahren zur Herstellung von Benzoylchlorid | |
| DE2633459C3 (de) | Verfahren zur Herstellung von Chlorpropenen | |
| DE1670913A1 (de) | Chlorierte N-Methylimidazole | |
| DE2000424C3 (de) | Verfahren zur Herstellung von 1,1,1 Tnchlorathan enthaltenden polychlorierten Athanen | |
| DE1695646C3 (de) | Verfahren zur kontinuierlichen Herstellung von 5,5-Dialkylhydantoinen | |
| DE2349838B1 (de) | Verfahren zur Herstellung von Vinylchlorid | |
| DE1793446A1 (de) | Verfahren zur Herstellung von Dichloracetylchlorid |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |