CH637103A5 - Verfahren zur herstellung von alkyliden-bis-beta-ketocarbonsaeureestern aus niederen alkanoylessigsaeurealkylestern und aldehyden. - Google Patents
Verfahren zur herstellung von alkyliden-bis-beta-ketocarbonsaeureestern aus niederen alkanoylessigsaeurealkylestern und aldehyden. Download PDFInfo
- Publication number
- CH637103A5 CH637103A5 CH1466277A CH1466277A CH637103A5 CH 637103 A5 CH637103 A5 CH 637103A5 CH 1466277 A CH1466277 A CH 1466277A CH 1466277 A CH1466277 A CH 1466277A CH 637103 A5 CH637103 A5 CH 637103A5
- Authority
- CH
- Switzerland
- Prior art keywords
- esters
- aldehydes
- amine
- different
- takes place
- Prior art date
Links
- 239000002253 acid Substances 0.000 title claims description 15
- 150000002148 esters Chemical class 0.000 title claims description 9
- 150000001299 aldehydes Chemical class 0.000 title claims description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 title 3
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000006243 chemical reaction Methods 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 16
- 150000001412 amines Chemical class 0.000 claims description 11
- -1 aliphatic tertiary amine Chemical class 0.000 claims description 7
- 125000005907 alkyl ester group Chemical group 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 claims description 5
- 238000009833 condensation Methods 0.000 claims description 5
- 230000005494 condensation Effects 0.000 claims description 5
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 239000003701 inert diluent Substances 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims 2
- HUMNYLRZRPPJDN-KWCOIAHCSA-N benzaldehyde Chemical group O=[11CH]C1=CC=CC=C1 HUMNYLRZRPPJDN-KWCOIAHCSA-N 0.000 claims 1
- 238000006798 ring closing metathesis reaction Methods 0.000 claims 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 7
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- 238000006114 decarboxylation reaction Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 3
- FWFSEYBSWVRWGL-UHFFFAOYSA-N cyclohex-2-enone Chemical class O=C1CCCC=C1 FWFSEYBSWVRWGL-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000007127 saponification reaction Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- 150000003934 aromatic aldehydes Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- YPHNBVARBFSRAZ-UHFFFAOYSA-N 5-methyl-3,7-dioxononanedioic acid Chemical compound OC(=O)CC(=O)CC(C)CC(=O)CC(O)=O YPHNBVARBFSRAZ-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- 238000006000 Knoevenagel condensation reaction Methods 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 238000005882 aldol condensation reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000003935 benzaldehydes Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000003262 carboxylic acid ester group Chemical group [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 description 1
- 150000001733 carboxylic acid esters Chemical group 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- CRVGTESFCCXCTH-UHFFFAOYSA-N methyl diethanolamine Chemical compound OCCN(C)CCO CRVGTESFCCXCTH-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/587—Unsaturated compounds containing a keto groups being part of a ring
- C07C49/603—Unsaturated compounds containing a keto groups being part of a ring of a six-membered ring, e.g. quinone methides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/72—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction of compounds containing >C = O groups with the same or other compounds containing >C = O groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/72—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction of compounds containing >C = O groups with the same or other compounds containing >C = O groups
- C07C45/75—Reactions with formaldehyde
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2654850A DE2654850C2 (de) | 1976-12-03 | 1976-12-03 | Verfahren zur Herstellung von Kondensationsprodukten aus niederen Alkanoylessigsäurealkylestern und aliphatischen oder Benzaldehyden in Gegenwart von niederen Trialkylaminen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH637103A5 true CH637103A5 (de) | 1983-07-15 |
Family
ID=5994611
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1466277A CH637103A5 (de) | 1976-12-03 | 1977-11-30 | Verfahren zur herstellung von alkyliden-bis-beta-ketocarbonsaeureestern aus niederen alkanoylessigsaeurealkylestern und aldehyden. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4220799A (enExample) |
| JP (1) | JPS5371020A (enExample) |
| CH (1) | CH637103A5 (enExample) |
| DE (1) | DE2654850C2 (enExample) |
| FR (1) | FR2372787A1 (enExample) |
| GB (1) | GB1577070A (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2941625A1 (de) * | 1979-10-13 | 1981-04-23 | Hoechst Ag, 6000 Frankfurt | Cyclohexanone und cyclohexenone, verfahren zu ihrer herstellung und ihre verwendung |
| KR950024036A (ko) * | 1994-01-03 | 1995-08-21 | 심명기 | Led 디스플레이를 설한 아나로그 및 lcd 손목시계 |
| US5965767A (en) * | 1997-04-10 | 1999-10-12 | Procter & Gamble Company | Beta ketoester compositions and method of manufacture |
| AT407249B (de) * | 1997-12-29 | 2001-01-25 | Chemie Linz Gmbh | Verbessertes verfahren zur herstellung von 2-acetylcarbonsäureestern |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2798793A (en) * | 1954-09-09 | 1957-07-09 | Carl E Moore | Polynitrophenols |
-
1976
- 1976-12-03 DE DE2654850A patent/DE2654850C2/de not_active Expired
-
1977
- 1977-11-30 CH CH1466277A patent/CH637103A5/de not_active IP Right Cessation
- 1977-12-01 US US05/856,737 patent/US4220799A/en not_active Expired - Lifetime
- 1977-12-02 JP JP14409477A patent/JPS5371020A/ja active Granted
- 1977-12-02 GB GB50339/77A patent/GB1577070A/en not_active Expired
- 1977-12-05 FR FR7736518A patent/FR2372787A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5371020A (en) | 1978-06-24 |
| DE2654850A1 (de) | 1978-06-08 |
| JPS623142B2 (enExample) | 1987-01-23 |
| GB1577070A (en) | 1980-10-15 |
| FR2372787A1 (fr) | 1978-06-30 |
| FR2372787B1 (enExample) | 1984-03-30 |
| US4220799A (en) | 1980-09-02 |
| DE2654850C2 (de) | 1984-04-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69132892T2 (de) | Verfahren zur Herstellung von 4-Hydroxystyrol | |
| EP0317909B1 (de) | Verfahren zur Herstellung von alpha-Alkylacroleinen | |
| CH635308A5 (de) | Verfahren zur denitrosierung von n-nitrosoverbindungen. | |
| CH637103A5 (de) | Verfahren zur herstellung von alkyliden-bis-beta-ketocarbonsaeureestern aus niederen alkanoylessigsaeurealkylestern und aldehyden. | |
| DE3403696C2 (de) | Verfahren zur gleichzeitigen Herstellung von 2,2,4-Trimethyl-1,3-pentandiol sowie dessen Monoisobutyrat | |
| WO2002024621A1 (de) | Verfahren zur herstellung von verzweigten alkoholen und/oder kohlenwasserstoffen | |
| DE1059904B (de) | Verfahren zur Herstellung von Cyclododecanderivaten | |
| EP0144885A2 (de) | Verfahren zur gleichzeitigen Herstellung von Nitrilen und Acrylamid bzw. Methacrylamid | |
| DE1793512C3 (de) | Verfahren zur Herstellung von 2,2- Dimethyl-3-hydroxypropanal | |
| EP0648733B1 (de) | Verfahren zur Herstellung von Zwischenprodukten der Chinacridonsynthese | |
| DE2941625A1 (de) | Cyclohexanone und cyclohexenone, verfahren zu ihrer herstellung und ihre verwendung | |
| EP0151967B1 (de) | Verfahren zur Herstellung von N-substituierten, alpha, beta-ungesättigten Carbonsäureamiden | |
| DE2348536C3 (de) | Verfahren zur Herstellung von 5-Oxocarbonsäuren | |
| DE2649711C2 (de) | Verfahren zur Herstellung von ungesättigten Carbonsäuren | |
| DE2107958C3 (de) | Verfahren zur Herstellung von a -Naphtholen | |
| DE960813C (de) | Verfahren zur Herstellung von ungesaettigten ª†- und ª€-Laktonen | |
| EP0433883B1 (de) | Verfahren zur Herstellung von alpha-Formylaminonitrilen | |
| DE3338547C2 (de) | Verfahren zur Herstellung von 2,2,4-Trimethyl-1,3-pentandioldiisobutyrat | |
| EP0587533B1 (de) | Verfahren zur Herstellung von alpha-Aminoketonsalzen | |
| DE3630553A1 (de) | Verfahren zur herstellung von 2-carboxydibenzoylmethanen | |
| EP0841332A1 (de) | Verfahren zur Herstellung von Alpha-Methylen-Beta-Methyl-Gamma-Butyrolacton und als Zwischenprodukt wertvolle 4-Hydroxy-Butyraldehyde sowie 2-Hydroxy-3-Methylen-4-Methyltetrahydrofuran | |
| DE2115944A1 (de) | Verfahren zur Herstellung von o Sulfobenzimiden | |
| AT203474B (de) | Verfahren zur Herstellung von α,β-ungesättigten Aldehyden | |
| DD227434A1 (de) | Verfahren zur herstellung neuer hexahydrophenanthridine | |
| DE1493572A1 (de) | Verfahren zur Herstellung von Cycloacetal- und Cycloketalestern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |