CH634704A5 - Electrodynamic transducer arrangement - Google Patents
Electrodynamic transducer arrangement Download PDFInfo
- Publication number
- CH634704A5 CH634704A5 CH276678A CH276678A CH634704A5 CH 634704 A5 CH634704 A5 CH 634704A5 CH 276678 A CH276678 A CH 276678A CH 276678 A CH276678 A CH 276678A CH 634704 A5 CH634704 A5 CH 634704A5
- Authority
- CH
- Switzerland
- Prior art keywords
- magnetic
- magnet
- coil
- electrodynamic
- transducer
- Prior art date
Links
- 230000005520 electrodynamics Effects 0.000 title claims description 34
- 238000004804 winding Methods 0.000 claims abstract description 7
- BGPVFRJUHWVFKM-UHFFFAOYSA-N N1=C2C=CC=CC2=[N+]([O-])C1(CC1)CCC21N=C1C=CC=CC1=[N+]2[O-] Chemical compound N1=C2C=CC=CC2=[N+]([O-])C1(CC1)CCC21N=C1C=CC=CC1=[N+]2[O-] BGPVFRJUHWVFKM-UHFFFAOYSA-N 0.000 claims description 13
- 239000004020 conductor Substances 0.000 claims description 12
- 239000012528 membrane Substances 0.000 claims description 6
- 230000007246 mechanism Effects 0.000 claims description 4
- 238000010276 construction Methods 0.000 claims description 3
- 230000008878 coupling Effects 0.000 claims description 3
- 238000010168 coupling process Methods 0.000 claims description 3
- 238000005859 coupling reaction Methods 0.000 claims description 3
- 230000035945 sensitivity Effects 0.000 claims description 3
- 239000013013 elastic material Substances 0.000 claims description 2
- 230000006978 adaptation Effects 0.000 claims 1
- 230000006866 deterioration Effects 0.000 claims 1
- 210000003608 fece Anatomy 0.000 claims 1
- 239000010871 livestock manure Substances 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000000969 carrier Substances 0.000 description 3
- 238000005516 engineering process Methods 0.000 description 3
- 230000036039 immunity Effects 0.000 description 3
- 230000004907 flux Effects 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000012229 microporous material Substances 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04R—LOUDSPEAKERS, MICROPHONES, GRAMOPHONE PICK-UPS OR LIKE ACOUSTIC ELECTROMECHANICAL TRANSDUCERS; DEAF-AID SETS; PUBLIC ADDRESS SYSTEMS
- H04R11/00—Transducers of moving-armature or moving-core type
- H04R11/08—Gramophone pick-ups using a stylus; Recorders using a stylus
- H04R11/12—Gramophone pick-ups using a stylus; Recorders using a stylus signals being recorded or played back by vibration of a stylus in two orthogonal directions simultaneously
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04R—LOUDSPEAKERS, MICROPHONES, GRAMOPHONE PICK-UPS OR LIKE ACOUSTIC ELECTROMECHANICAL TRANSDUCERS; DEAF-AID SETS; PUBLIC ADDRESS SYSTEMS
- H04R11/00—Transducers of moving-armature or moving-core type
- H04R11/04—Microphones
Landscapes
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Engineering & Computer Science (AREA)
- Acoustics & Sound (AREA)
- Signal Processing (AREA)
- Electrophonic Musical Instruments (AREA)
- Audible-Bandwidth Dynamoelectric Transducers Other Than Pickups (AREA)
- Electrostatic, Electromagnetic, Magneto- Strictive, And Variable-Resistance Transducers (AREA)
- Measuring And Recording Apparatus For Diagnosis (AREA)
- Magnetic Resonance Imaging Apparatus (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU772462350A SU883957A1 (ru) | 1977-03-14 | 1977-03-14 | Головка звукоснимател |
| SU2464111 | 1977-03-18 | ||
| SU772517892A SU957258A2 (ru) | 1977-08-16 | 1977-08-16 | Головка электродинамического звукоснимател |
| SU772517970A SU883958A1 (ru) | 1977-08-18 | 1977-08-18 | Электродинамическа головка звукоснимател |
| SU2536988 | 1977-10-24 | ||
| SU2539032 | 1977-11-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH634704A5 true CH634704A5 (en) | 1983-02-15 |
Family
ID=27555333
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH276678A CH634704A5 (en) | 1977-03-14 | 1978-03-14 | Electrodynamic transducer arrangement |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4237347A (enExample) |
| JP (1) | JPS53136804A (enExample) |
| CH (1) | CH634704A5 (enExample) |
| DE (1) | DE2810459C3 (enExample) |
| DK (1) | DK152477C (enExample) |
| FR (1) | FR2384411A1 (enExample) |
| NL (1) | NL177066C (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SU957259A2 (ru) * | 1978-12-26 | 1982-09-07 | За витель | Головка электродинамического звукоснимател |
| JPS5952596B2 (ja) * | 1979-11-01 | 1984-12-20 | 松下電器産業株式会社 | 可動磁石型ピックアップカ−トリッジ |
| DE3027586C2 (de) * | 1980-07-21 | 1985-07-18 | Sennheiser Electronic Kg, 3002 Wedemark | Elektroakustischer Wandler |
| DE3033763C2 (de) * | 1980-09-08 | 1982-11-04 | První brněnská strojírna N.P., Brno | Induktionsgeber zum Abtasten von Vibrationen und Schwingungen |
| NL8101794A (nl) * | 1981-04-13 | 1982-11-01 | Philips Nv | Groeftaster en/of snijder. |
| FR2549335B1 (fr) * | 1983-07-13 | 1985-10-31 | Corselli Laurent | Haut-parleur a modulation magnetique |
| US4901357A (en) * | 1987-01-20 | 1990-02-13 | Albright Eugene A | Electromagnetic transducer |
| JPH0182599U (enExample) * | 1987-11-20 | 1989-06-01 | ||
| DE3843160A1 (de) * | 1988-03-24 | 1990-06-28 | Teves Gmbh Alfred | Sensor zur messung eines weges oder eines bewegungsverhaltens |
| US5276276A (en) * | 1988-07-18 | 1994-01-04 | Gunn Dennis R | Coil transducer |
| DE3933627A1 (de) * | 1989-10-07 | 1990-09-27 | Daimler Benz Ag | Sensor mit einem beweglichen permanentmagnetsystem zur bestimmung einer bewegungsabhaengigen groesse |
| US5199005A (en) * | 1992-08-14 | 1993-03-30 | Argotec, Inc. | Electromagnetic drive assembly for under water sonar transducer |
| US5507511A (en) * | 1994-02-10 | 1996-04-16 | Schueman Enterprises, Inc. | Means for controlling an air powered actuator for retracting the locking pins of a slider |
| US5809157A (en) * | 1996-04-09 | 1998-09-15 | Victor Lavrov | Electromagnetic linear drive |
| US7291780B2 (en) * | 2002-02-26 | 2007-11-06 | Taylor-Listug, Inc. | Transducer for converting between mechanical vibration and electrical signal |
| US7132597B2 (en) | 2002-02-26 | 2006-11-07 | Taylor-Listug, Inc. | Transducer for converting between mechanical vibration and electrical signal |
| US9354748B2 (en) | 2012-02-13 | 2016-05-31 | Microsoft Technology Licensing, Llc | Optical stylus interaction |
| US9870066B2 (en) | 2012-03-02 | 2018-01-16 | Microsoft Technology Licensing, Llc | Method of manufacturing an input device |
| US9075566B2 (en) | 2012-03-02 | 2015-07-07 | Microsoft Technoogy Licensing, LLC | Flexible hinge spine |
| US9158383B2 (en) | 2012-03-02 | 2015-10-13 | Microsoft Technology Licensing, Llc | Force concentrator |
| US20130300590A1 (en) | 2012-05-14 | 2013-11-14 | Paul Henry Dietz | Audio Feedback |
| US8964379B2 (en) * | 2012-08-20 | 2015-02-24 | Microsoft Corporation | Switchable magnetic lock |
| EP3059850A4 (en) * | 2013-10-14 | 2017-06-07 | Sunrising Eco-Friendly Tech. Co., Ltd. | Mobile induction and power-generation device |
| US9173035B2 (en) * | 2013-11-07 | 2015-10-27 | Harman International Industries, Incorporated | Dual coil moving magnet transducer |
| US10120420B2 (en) | 2014-03-21 | 2018-11-06 | Microsoft Technology Licensing, Llc | Lockable display and techniques enabling use of lockable displays |
| US10324733B2 (en) | 2014-07-30 | 2019-06-18 | Microsoft Technology Licensing, Llc | Shutdown notifications |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1667021A (en) * | 1928-04-24 | Translator of electrical energy | ||
| GB833737A (enExample) * | ||||
| BE411755A (enExample) * | 1934-10-19 | |||
| US2110153A (en) * | 1934-10-19 | 1938-03-08 | Philips Nv | Magnetic system |
| US2114471A (en) * | 1936-06-20 | 1938-04-19 | Bell Telephone Labor Inc | Sound recording and reproducing system |
| US2361788A (en) * | 1943-08-02 | 1944-10-31 | Jack & Heintz Inc | Displacement pickup |
| US2639156A (en) * | 1949-10-29 | 1953-05-19 | Gen Electric | Double-twist phonograph stylus assembly |
| US3196216A (en) * | 1959-12-15 | 1965-07-20 | Arthur C Davis | Electrodynamic transducers with flexible ferromagnetic flux paths |
| DE1762107A1 (de) * | 1968-04-08 | 1970-04-30 | Lothar Kuhnert | Rundlautsprecher |
| SE347636B (enExample) * | 1968-08-14 | 1972-08-07 | Audio Technica Kk | |
| NL7007480A (enExample) * | 1969-05-23 | 1970-11-25 | ||
| GB1364669A (en) * | 1971-12-23 | 1974-08-29 | Standard Telephones Cables Ltd | Electro acoustic transducers |
| US3798391A (en) * | 1972-06-22 | 1974-03-19 | Gen Electric | Movable magnet loudspeaker |
| DE2330349A1 (de) * | 1973-06-14 | 1975-01-09 | Magnet Service Muenchen F Und | Schwingsystem fuer lautsprecher und dgl |
| JPS5830798B2 (ja) * | 1973-12-22 | 1983-07-01 | ソニー株式会社 | ム−ビイングマグネツトガタカ−トリツジ |
| US4010334A (en) * | 1975-01-27 | 1977-03-01 | Demeter James K | Moving magnet contact acoustic transducer |
| US4072823A (en) * | 1975-06-06 | 1978-02-07 | Kabushiki Kaisha Mitachi Onkyo Seisakusho | Moving magnet pickup cartridge |
| AT341240B (de) * | 1975-07-29 | 1978-01-25 | Akg Akustische Kino Geraete | Tonabnehmer |
-
1978
- 1978-03-10 DK DK106978A patent/DK152477C/da active
- 1978-03-10 DE DE2810459A patent/DE2810459C3/de not_active Expired
- 1978-03-13 FR FR7807161A patent/FR2384411A1/fr active Granted
- 1978-03-13 NL NLAANVRAGE7802720,A patent/NL177066C/xx not_active IP Right Cessation
- 1978-03-14 JP JP2916678A patent/JPS53136804A/ja active Granted
- 1978-03-14 US US05/886,549 patent/US4237347A/en not_active Expired - Lifetime
- 1978-03-14 CH CH276678A patent/CH634704A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| US4237347A (en) | 1980-12-02 |
| DK152477C (da) | 1988-08-01 |
| DE2810459B2 (de) | 1980-09-25 |
| NL177066B (nl) | 1985-02-18 |
| DE2810459A1 (de) | 1978-09-21 |
| NL177066C (nl) | 1985-07-16 |
| FR2384411A1 (fr) | 1978-10-13 |
| DE2810459C3 (de) | 1986-11-13 |
| FR2384411B1 (enExample) | 1980-08-29 |
| JPS6118400B2 (enExample) | 1986-05-12 |
| DK152477B (da) | 1988-02-29 |
| JPS53136804A (en) | 1978-11-29 |
| DK106978A (da) | 1978-09-15 |
| NL7802720A (nl) | 1978-09-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH634704A5 (en) | Electrodynamic transducer arrangement | |
| DE2533163C3 (de) | Elektrischer Aufnehmer für ein Saiteninstrument, wie beispielsweise eine Gitarre | |
| DE3730305C1 (de) | Lautsprecher | |
| DE4016740C1 (enExample) | ||
| DE1815694C2 (de) | Elektrodynamisches Wandlersystem | |
| DE2222167B2 (de) | Elektroakustischer Wandler | |
| DE1772685C3 (de) | Elektromagnetischer Mehrkanal-Tonabnehmer | |
| DE1210033B (de) | Magnetwandleranordnung | |
| DE2734331A1 (de) | Tonabnehmer | |
| DE2159573A1 (de) | Magnetischer Stereo-Tonabnehmer | |
| DE2748070A1 (de) | Elektromagnetischer messwertgeber mit mehreren wicklungen fuer die drehzahlmessung | |
| DE1112841B (de) | Elektrisch-mechanischer Wandler | |
| DE3705928C2 (enExample) | ||
| DE3724349A1 (de) | Drehtransformator fuer einen recorder | |
| DE3002899C2 (de) | Tonabnehmersystem mit beweglicher Spule | |
| DE2631287A1 (de) | Elektrodynamischer wandler, insbesondere zum wiedergeben von schallplatten | |
| DE3006283C2 (de) | Stereophoner elektrodynamischer Tonabnehmereinsatz | |
| DE1179257B (de) | Klangtreuer Lautsprecher | |
| DE2625463C2 (de) | Elektromagnetischer Tonabnehmer | |
| DE2460217A1 (de) | Tonabnehmer | |
| DE3035676A1 (de) | Geraet zur aufzeichnung und/oder wiedergabe von signalen | |
| DE2132127A1 (de) | Stereophoner Flussueberbrueckungs-Aufnehmer | |
| DE2901714A1 (de) | Tonabnehmer mit sich bewegender spule | |
| DE3233500A1 (de) | Elektrodynamischer tonabnehmer | |
| DE3501316A1 (de) | Schallwiedergabeeinrichtung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |