CH631730A5 - Verfahren zur herstellung von dispersionsfarbstoffen. - Google Patents
Verfahren zur herstellung von dispersionsfarbstoffen. Download PDFInfo
- Publication number
- CH631730A5 CH631730A5 CH134778A CH134778A CH631730A5 CH 631730 A5 CH631730 A5 CH 631730A5 CH 134778 A CH134778 A CH 134778A CH 134778 A CH134778 A CH 134778A CH 631730 A5 CH631730 A5 CH 631730A5
- Authority
- CH
- Switzerland
- Prior art keywords
- mixture
- anthraquinone
- compounds
- formula
- dimethylamino
- Prior art date
Links
- 239000000975 dye Substances 0.000 title description 24
- 239000006185 dispersion Substances 0.000 title description 2
- 238000004519 manufacturing process Methods 0.000 title description 2
- 239000000203 mixture Chemical group 0.000 claims description 31
- 238000000034 method Methods 0.000 claims description 17
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 8
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims description 5
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 5
- 239000004327 boric acid Substances 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 239000000986 disperse dye Substances 0.000 claims description 5
- -1 anthraquinone compounds Chemical class 0.000 claims description 4
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 claims description 4
- QJNHOQQOVIYAID-UHFFFAOYSA-N 1,5-dibromo-4-(dimethylamino)anthracene-9,10-dione Chemical compound O=C1C2=CC=CC(Br)=C2C(=O)C2=C1C(Br)=CC=C2N(C)C QJNHOQQOVIYAID-UHFFFAOYSA-N 0.000 claims description 3
- 125000001246 bromo group Chemical group Br* 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 238000006396 nitration reaction Methods 0.000 claims description 2
- 238000004043 dyeing Methods 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 229920000728 polyester Polymers 0.000 description 9
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 6
- 239000002202 Polyethylene glycol Substances 0.000 description 5
- BAVYZALUXZFZLV-UHFFFAOYSA-N mono-methylamine Natural products NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 5
- 229920001223 polyethylene glycol Polymers 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 4
- QPPBADVBJDDEBZ-UHFFFAOYSA-N 1,5-dibromo-4,8-bis(methylamino)anthracene-9,10-dione Chemical compound O=C1C2=C(NC)C=CC(Br)=C2C(=O)C2=C1C(Br)=CC=C2NC QPPBADVBJDDEBZ-UHFFFAOYSA-N 0.000 description 3
- MBIJFIUDKPXMAV-UHFFFAOYSA-N 1,8-dinitroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC([N+]([O-])=O)=C2C(=O)C2=C1C=CC=C2[N+](=O)[O-] MBIJFIUDKPXMAV-UHFFFAOYSA-N 0.000 description 3
- YCANAXVBJKNANM-UHFFFAOYSA-N 1-nitroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2[N+](=O)[O-] YCANAXVBJKNANM-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- IYHIKYZDSVTAPF-UHFFFAOYSA-N 1,2-diamino-3,4-dihydroxyanthracene-9,10-dione Chemical class O=C1C2=CC=CC=C2C(=O)C2=C1C(N)=C(N)C(O)=C2O IYHIKYZDSVTAPF-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 2
- XVMVHWDCRFNPQR-UHFFFAOYSA-N 1,5-dinitroanthracene-9,10-dione Chemical compound O=C1C=2C([N+](=O)[O-])=CC=CC=2C(=O)C2=C1C=CC=C2[N+]([O-])=O XVMVHWDCRFNPQR-UHFFFAOYSA-N 0.000 description 2
- 229920002284 Cellulose triacetate Polymers 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 2
- 150000004056 anthraquinones Chemical class 0.000 description 2
- LLEMOWNGBBNAJR-UHFFFAOYSA-N biphenyl-2-ol Chemical compound OC1=CC=CC=C1C1=CC=CC=C1 LLEMOWNGBBNAJR-UHFFFAOYSA-N 0.000 description 2
- 230000031709 bromination Effects 0.000 description 2
- 238000005893 bromination reaction Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 229940117389 dichlorobenzene Drugs 0.000 description 2
- 230000000802 nitrating effect Effects 0.000 description 2
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000001256 steam distillation Methods 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- NMNSBFYYVHREEE-UHFFFAOYSA-N 1,2-dinitroanthracene-9,10-dione Chemical class C1=CC=C2C(=O)C3=C([N+]([O-])=O)C([N+](=O)[O-])=CC=C3C(=O)C2=C1 NMNSBFYYVHREEE-UHFFFAOYSA-N 0.000 description 1
- DHHMIZCURSKKQM-UHFFFAOYSA-N 1,8-dibromo-4,5-bis(methylamino)anthracene-9,10-dione Chemical compound O=C1C2=C(Br)C=CC(NC)=C2C(=O)C2=C1C(Br)=CC=C2NC DHHMIZCURSKKQM-UHFFFAOYSA-N 0.000 description 1
- AQXYVFBSOOBBQV-UHFFFAOYSA-N 1-amino-4-hydroxyanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(O)=CC=C2N AQXYVFBSOOBBQV-UHFFFAOYSA-N 0.000 description 1
- KHUFHLFHOQVFGB-UHFFFAOYSA-N 1-aminoanthracene-9,10-dione Chemical class O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2N KHUFHLFHOQVFGB-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000005696 Diammonium phosphate Substances 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 235000005811 Viola adunca Nutrition 0.000 description 1
- 240000009038 Viola odorata Species 0.000 description 1
- 235000013487 Viola odorata Nutrition 0.000 description 1
- 235000002254 Viola papilionacea Nutrition 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 229910000388 diammonium phosphate Inorganic materials 0.000 description 1
- 235000019838 diammonium phosphate Nutrition 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000010292 orthophenyl phenol Nutrition 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 210000004243 sweat Anatomy 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 230000009044 synergistic interaction Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B1/00—Dyes with anthracene nucleus not condensed with any other ring
- C09B1/50—Amino-hydroxy-anthraquinones; Ethers and esters thereof
- C09B1/51—N-substituted amino-hydroxy anthraquinone
- C09B1/515—N-alkyl, N-aralkyl or N-cycloalkyl derivatives
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH134778A CH631730A5 (de) | 1978-02-07 | 1978-02-07 | Verfahren zur herstellung von dispersionsfarbstoffen. |
| DE19792904226 DE2904226A1 (de) | 1978-02-07 | 1979-02-05 | Verfahren zur herstellung von dispersionsfarbstoffen |
| FR7903046A FR2416248A1 (fr) | 1978-02-07 | 1979-02-06 | Procede pour la preparation de colorants disperses |
| GB7904123A GB2015020B (en) | 1978-02-07 | 1979-02-06 | Process for producing disperse dyes |
| JP1233779A JPS54120639A (en) | 1978-02-07 | 1979-02-07 | Preparation of dispersed dye |
| US06/148,444 US4304725A (en) | 1978-02-07 | 1980-05-09 | Process for producing disperse dyes |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH134778A CH631730A5 (de) | 1978-02-07 | 1978-02-07 | Verfahren zur herstellung von dispersionsfarbstoffen. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH631730A5 true CH631730A5 (de) | 1982-08-31 |
Family
ID=4208349
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH134778A CH631730A5 (de) | 1978-02-07 | 1978-02-07 | Verfahren zur herstellung von dispersionsfarbstoffen. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4304725A (cg-RX-API-DMAC10.html) |
| JP (1) | JPS54120639A (cg-RX-API-DMAC10.html) |
| CH (1) | CH631730A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2904226A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2416248A1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB2015020B (cg-RX-API-DMAC10.html) |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE604720A (cg-RX-API-DMAC10.html) * | 1960-06-09 | |||
| FR1320920A (fr) * | 1962-02-02 | 1963-03-15 | Cfmc | Nouveaux colorants anthraquinoniques, leur procédé de préparation et leurs applications |
| GB977608A (en) * | 1962-02-15 | 1964-12-09 | Acna | Dyeing compositions of the anthraquinone series |
| CH510722A (de) * | 1968-10-30 | 1971-07-31 | Ciba Geigy Ag | Verfahren zur Herstellung blauer Dispersionsfarbstoffe |
| DE2450287A1 (de) * | 1974-10-23 | 1976-04-29 | Bayer Ag | Anthrachinonfarbstoffe |
-
1978
- 1978-02-07 CH CH134778A patent/CH631730A5/de not_active IP Right Cessation
-
1979
- 1979-02-05 DE DE19792904226 patent/DE2904226A1/de not_active Withdrawn
- 1979-02-06 FR FR7903046A patent/FR2416248A1/fr active Granted
- 1979-02-06 GB GB7904123A patent/GB2015020B/en not_active Expired
- 1979-02-07 JP JP1233779A patent/JPS54120639A/ja active Pending
-
1980
- 1980-05-09 US US06/148,444 patent/US4304725A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| JPS54120639A (en) | 1979-09-19 |
| FR2416248A1 (fr) | 1979-08-31 |
| US4304725A (en) | 1981-12-08 |
| FR2416248B1 (cg-RX-API-DMAC10.html) | 1981-07-24 |
| GB2015020A (en) | 1979-09-05 |
| GB2015020B (en) | 1982-07-21 |
| DE2904226A1 (de) | 1979-08-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0088048B1 (de) | Küpenfarbstoffe, erhältlich durch Bromieren von Dibenzanthron und Umsetzung mit 1-Aminoanthrachinon | |
| DE1279252B (de) | Verfahren zur Herstellung von Anthrachinonfarbstoffen | |
| CH631730A5 (de) | Verfahren zur herstellung von dispersionsfarbstoffen. | |
| EP0140062B1 (de) | Perfluoralkyl-anthranilsäureester, Verfahren zu deren Herstellung und ihre Verwendung als schmutzabweisendes Mittel | |
| DE2334657C2 (de) | Verfahren zur Herstellung von Brom enthaltenden anthrachinoiden Dispersionsfarbstoffen | |
| DE2024780C3 (de) | Verfahren zur Herstellung von blauen Anthrachinonfarbstoffen | |
| EP0086388B1 (de) | Farbstoffmischungen | |
| DE1094699B (de) | Nachbehandlungsmittel fuer Faerbungen | |
| DE2327013A1 (de) | Anthrachinonfarbstoffe | |
| DE2318783A1 (de) | Anthrachinonfarbstoffe, verfahren zu deren herstellung und verwendung derselben | |
| EP0279774A1 (de) | Anthrimidcarbazolverbindung mit Thenoylaminogruppen | |
| DE819888C (de) | Verfahren zur Herstellung von schwefelhaltigen Kuepenfarbstoffen | |
| DE3022783A1 (de) | Verfahren zur herstellung von 4-acylamido-2-nitro-1-alkoxybenzol-verbindungen | |
| DE964084C (de) | Verfahren zur Herstellung von Kuepenfarbstoffen | |
| CH291422A (de) | Verfahren zur Herstellung eines neuen Küpenfarbstoffes. | |
| CH291418A (de) | Verfahren zur Herstellung eines neuen Küpenfarbstoffes. | |
| CH291421A (de) | Verfahren zur Herstellung eines neuen Küpenfarbstoffes. | |
| CH291417A (de) | Verfahren zur Herstellung eines neuen Küpenfarbstoffes. | |
| CH285775A (de) | Verfahren zur Herstellung eines neuen Küpenfarbstoffes. | |
| CH291419A (de) | Verfahren zur Herstellung eines neuen Küpenfarbstoffes. | |
| DD227150A1 (de) | Verfahren zur herstellung neuer schwefelfarbstoffe ii | |
| CH317472A (de) | Verfahren zur Herstellung halogenierter Naphthochinonimine | |
| CH300804A (de) | Verfahren zur Herstellung eines Schwefelfarbstoffes. | |
| DE1644531A1 (de) | Neue Farbstoffe,deren Herstellung und Verwendung | |
| CH480405A (de) | Verfahren zur Herstellung von Anthrachinonfarbstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |