CH629495A5 - Verfahren zur herstellung von thiophenderivaten und von biotin. - Google Patents
Verfahren zur herstellung von thiophenderivaten und von biotin. Download PDFInfo
- Publication number
- CH629495A5 CH629495A5 CH806277A CH806277A CH629495A5 CH 629495 A5 CH629495 A5 CH 629495A5 CH 806277 A CH806277 A CH 806277A CH 806277 A CH806277 A CH 806277A CH 629495 A5 CH629495 A5 CH 629495A5
- Authority
- CH
- Switzerland
- Prior art keywords
- compound
- formula
- biotin
- acetic anhydride
- general formula
- Prior art date
Links
- YBJHBAHKTGYVGT-ZKWXMUAHSA-N (+)-Biotin Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 title claims description 59
- 239000011616 biotin Substances 0.000 title claims description 36
- 229960002685 biotin Drugs 0.000 title claims description 36
- 235000020958 biotin Nutrition 0.000 title claims description 29
- 238000004519 manufacturing process Methods 0.000 title description 8
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical class C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 title description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 44
- 150000001875 compounds Chemical class 0.000 claims description 36
- 229910052763 palladium Inorganic materials 0.000 claims description 25
- 239000002904 solvent Substances 0.000 claims description 20
- -1 alkane carboxylic acids Chemical class 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 16
- 238000002360 preparation method Methods 0.000 claims description 16
- 238000006722 reduction reaction Methods 0.000 claims description 14
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 239000007868 Raney catalyst Substances 0.000 claims description 9
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims description 9
- 229910000564 Raney nickel Inorganic materials 0.000 claims description 9
- 125000002252 acyl group Chemical group 0.000 claims description 9
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 9
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 150000008064 anhydrides Chemical class 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 claims description 5
- 229910003446 platinum oxide Inorganic materials 0.000 claims description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 150000004678 hydrides Chemical class 0.000 claims description 4
- 235000011007 phosphoric acid Nutrition 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims description 3
- 239000010941 cobalt Substances 0.000 claims description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 3
- 229910052697 platinum Inorganic materials 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Chemical group 0.000 claims description 2
- 239000003638 chemical reducing agent Substances 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 150000003577 thiophenes Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 2
- 239000005046 Chlorosilane Substances 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical class Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 claims 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 claims 1
- PHFFANVCGVJLOM-UHFFFAOYSA-N n-diethylboranylethanamine Chemical compound CCNB(CC)CC PHFFANVCGVJLOM-UHFFFAOYSA-N 0.000 claims 1
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 155
- 229910052757 nitrogen Inorganic materials 0.000 description 40
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 29
- 239000000047 product Substances 0.000 description 25
- 239000003054 catalyst Substances 0.000 description 23
- 239000000203 mixture Substances 0.000 description 17
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- 229960000583 acetic acid Drugs 0.000 description 11
- 238000005984 hydrogenation reaction Methods 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- 150000004702 methyl esters Chemical class 0.000 description 7
- 125000003118 aryl group Chemical group 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 239000011261 inert gas Substances 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 238000004064 recycling Methods 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- UHUFEADBLRCDDV-OBJOEFQTSA-N methyl 5-[(3as,4s,6ar)-1,3-diacetyl-2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-4-yl]pentanoate Chemical compound CC(=O)N1C(=O)N(C(C)=O)[C@@H]2[C@H]1[C@H](CCCCC(=O)OC)SC2 UHUFEADBLRCDDV-OBJOEFQTSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- QHDKBTCHBAWZCR-UHFFFAOYSA-N 6-(1,3-diacetyl-2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-4-yl)hexanoic acid Chemical compound C(C)(=O)N1C(N(C2C1CSC2CCCCCC(=O)O)C(C)=O)=O QHDKBTCHBAWZCR-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000010531 catalytic reduction reaction Methods 0.000 description 3
- 238000006477 desulfuration reaction Methods 0.000 description 3
- 230000023556 desulfurization Effects 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- DCWUHMBVAFFCJQ-UHFFFAOYSA-N methyl 6-(1,3-diacetyl-2-oxo-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-4-yl)hexanoate Chemical compound C(C)(=O)N1C(N(C2C1CSC2CCCCCC(=O)OC)C(C)=O)=O DCWUHMBVAFFCJQ-UHFFFAOYSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 150000002941 palladium compounds Chemical class 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- DJWHLEDTRYAXRS-UHFFFAOYSA-N 6-(1,3-diacetyl-2-oxo-4,6-dihydrothieno[3,4-d]imidazol-4-yl)hexanoyl 6-(1,3-diacetyl-2-oxo-4,6-dihydrothieno[3,4-d]imidazol-4-yl)hexanoate Chemical compound C(C)(=O)N1C(N(C2=C1CSC2CCCCCC(=O)OC(=O)CCCCCC1SCC=2N(C(N(C=21)C(C)=O)=O)C(C)=O)C(C)=O)=O DJWHLEDTRYAXRS-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- QDEUERUYASXZCW-UHFFFAOYSA-N COC(=O)CCCCCC1=CN=CN1 Chemical compound COC(=O)CCCCCC1=CN=CN1 QDEUERUYASXZCW-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000002178 crystalline material Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- JGUQDUKBUKFFRO-CIIODKQPSA-N dimethylglyoxime Chemical compound O/N=C(/C)\C(\C)=N\O JGUQDUKBUKFFRO-CIIODKQPSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 231100000572 poisoning Toxicity 0.000 description 2
- 230000000607 poisoning effect Effects 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- LGYDGTPEVDEQPK-BHQGJQQGSA-N 5-[(3as,4s,6ar)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-2-hydroxypentanoic acid Chemical compound N1C(=O)N[C@@H]2[C@H](CCCC(O)C(O)=O)SC[C@@H]21 LGYDGTPEVDEQPK-BHQGJQQGSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- AWPCTBHSRGTFHR-UHFFFAOYSA-N CC(=O)N1C2=C(C(SC2)CCCCCC(=O)OC)N(C1=O)C(=O)C Chemical compound CC(=O)N1C2=C(C(SC2)CCCCCC(=O)OC)N(C1=O)C(=O)C AWPCTBHSRGTFHR-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZTULNMNIVVMLIU-UHFFFAOYSA-N Methyl 2-methylpentanoate Chemical compound CCCC(C)C(=O)OC ZTULNMNIVVMLIU-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229930003756 Vitamin B7 Natural products 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 238000009739 binding Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001615 biotins Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000006389 diacetylation reaction Methods 0.000 description 1
- WMKGGPCROCCUDY-PHEQNACWSA-N dibenzylideneacetone Chemical compound C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 WMKGGPCROCCUDY-PHEQNACWSA-N 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 239000003102 growth factor Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000002940 palladium Chemical class 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 244000144977 poultry Species 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- VHNQIURBCCNWDN-UHFFFAOYSA-N pyridine-2,6-diamine Chemical compound NC1=CC=CC(N)=N1 VHNQIURBCCNWDN-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003463 sulfur Chemical class 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- ZDHXKXAHOVTTAH-UHFFFAOYSA-N trichlorosilane Chemical class Cl[SiH](Cl)Cl ZDHXKXAHOVTTAH-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 235000011912 vitamin B7 Nutrition 0.000 description 1
- 239000011735 vitamin B7 Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US70415776A | 1976-07-12 | 1976-07-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH629495A5 true CH629495A5 (de) | 1982-04-30 |
Family
ID=24828321
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH806277A CH629495A5 (de) | 1976-07-12 | 1977-06-30 | Verfahren zur herstellung von thiophenderivaten und von biotin. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4130712A (OSRAM) |
| JP (1) | JPS539790A (OSRAM) |
| AT (1) | AT368503B (OSRAM) |
| BE (1) | BE856676A (OSRAM) |
| CH (1) | CH629495A5 (OSRAM) |
| DE (1) | DE2730341A1 (OSRAM) |
| FR (1) | FR2358407A1 (OSRAM) |
| GB (2) | GB1582466A (OSRAM) |
| IT (1) | IT1143742B (OSRAM) |
| NL (1) | NL7707737A (OSRAM) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA2125820C (en) * | 1993-07-08 | 2006-05-02 | Masahiko Mizuno | Process for producing thiophene derivative |
| US20070278453A1 (en) * | 2006-06-02 | 2007-12-06 | Steffen Zahn | Electrically conductive polymers and method of making electrically conductive polymers |
| EP4495123A1 (en) * | 2023-07-19 | 2025-01-22 | DSM IP Assets B.V. | An improved process for producing d-biotin intermediates |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2502422A (en) * | 1945-02-09 | 1950-04-04 | Parke Davis & Co | 2'-keto-3, 4-imidazolido-2-omega-substituted alkyl thiophenes and process for obtaining same |
| US2487051A (en) * | 1945-12-15 | 1949-11-08 | Merck & Co Inc | Biotin intermediate and hydrogenating thiophenes |
| US4054740A (en) * | 1974-12-24 | 1977-10-18 | Hoffmann-La Roche Inc. | Hydroxybiotin |
-
1977
- 1977-06-17 US US05/807,760 patent/US4130712A/en not_active Expired - Lifetime
- 1977-06-30 CH CH806277A patent/CH629495A5/de not_active IP Right Cessation
- 1977-07-05 DE DE19772730341 patent/DE2730341A1/de not_active Withdrawn
- 1977-07-08 FR FR7721148A patent/FR2358407A1/fr active Granted
- 1977-07-11 GB GB29005/77A patent/GB1582466A/en not_active Expired
- 1977-07-11 GB GB50504/77A patent/GB1582467A/en not_active Expired
- 1977-07-11 AT AT0495277A patent/AT368503B/de not_active IP Right Cessation
- 1977-07-11 JP JP8210177A patent/JPS539790A/ja active Pending
- 1977-07-11 BE BE179231A patent/BE856676A/xx unknown
- 1977-07-12 IT IT25635/77A patent/IT1143742B/it active
- 1977-07-12 NL NL7707737A patent/NL7707737A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1582467A (en) | 1981-01-07 |
| FR2358407B1 (OSRAM) | 1981-07-03 |
| DE2730341A1 (de) | 1978-01-26 |
| FR2358407A1 (fr) | 1978-02-10 |
| IT1143742B (it) | 1986-10-22 |
| BE856676A (fr) | 1978-01-11 |
| GB1582466A (en) | 1981-01-07 |
| US4130712A (en) | 1978-12-19 |
| NL7707737A (nl) | 1978-01-16 |
| JPS539790A (en) | 1978-01-28 |
| ATA495277A (de) | 1982-02-15 |
| AT368503B (de) | 1982-10-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69021455T2 (de) | Verfahren zur Herstellung von Ascorbinsäure. | |
| DE69215070T2 (de) | Verfahren zur herstellung von 3-dpa-lacton | |
| DE1468932B2 (de) | Verfahren zur kontinuierlichen herstellung von niedermolekularen aliphatischen acrylsaeureestern | |
| DE3405663A1 (de) | Verfahren zur herstellung von scyllo-inosit | |
| DE2902542C2 (OSRAM) | ||
| CH637618A5 (de) | Verfahren zur herstellung von anthrachinon. | |
| DE2730341A1 (de) | Verfahren zur herstellung von heterocyclischen verbindungen | |
| CH495944A (de) | Verfahren zur Herstellung von a-Methyl-polycyclomethylaminen | |
| DE1178843B (de) | Verfahren zur Herstellung von Abkoemmlingen des 2, 3-Dimethoxy-5-methyl-1, 4-benzohydro-chinons und -chinons | |
| DE1668608A1 (de) | Neues Verfahren zur Herstellung von Zwischenprodukten fuer die Synthese von Steroiden | |
| EP0014478A1 (de) | Verfahren zur Herstellung von Alkyl-4,10-dihydro-10-oxo-thieno-(3,2-c)-(1)-benzoxepin-8-acetat | |
| DE2703077A1 (de) | Verfahren zur herstellung von cyclohexandion-(1,4)-tetramethyl- diketal | |
| CH447147A (de) | Verfahren zur Herstellung von 5-(3-Hydroxypropyl)-5H-dibenzo(a,d)cycloheptenen | |
| DE3320140A1 (de) | Verfahren zur herstellung von d (+) - biotin | |
| DE963519C (de) | Verfahren zur Herstellung von N, N'-Dibenzyl-aethylendiamin | |
| AT226707B (de) | Verfahren zur Herstellung von neuen 11b-Benzo-(a)-chinolizinderivaten | |
| AT216502B (de) | Verfahren zur Herstellung von teilhydrierten Anthrazenderivaten | |
| DE2924334C2 (OSRAM) | ||
| DE2830009A1 (de) | Verfahren zur herstellung substituierter phenylessigsaeurederivate | |
| DE2260447C3 (de) | Verfahren zur Herstellung von Methyljasmonat | |
| DE69409427T2 (de) | Verfahren zur Herstellung von Hydroxyphenylessigsäuren | |
| DE2350710C3 (de) | Verfahren zum Herstellen von Eriodictyol (5,7,3,4'-Tetrahydroxyflavanon) | |
| DE969341C (de) | Verfahren zur Herstellung von Terephthalsaeuredimethylester | |
| DE2701629C2 (OSRAM) | ||
| DE1092003B (de) | Stereospezifisches Verfahren zur Herstellung von 1,3-Dihydroxy-2-amino-alkenen-4 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |