CH629460A5 - Verfahren zur chemischen behandlung von abwaessern. - Google Patents
Verfahren zur chemischen behandlung von abwaessern. Download PDFInfo
- Publication number
- CH629460A5 CH629460A5 CH1477676A CH1477676A CH629460A5 CH 629460 A5 CH629460 A5 CH 629460A5 CH 1477676 A CH1477676 A CH 1477676A CH 1477676 A CH1477676 A CH 1477676A CH 629460 A5 CH629460 A5 CH 629460A5
- Authority
- CH
- Switzerland
- Prior art keywords
- wastewater
- pressure
- waste water
- treatment
- compounds
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 35
- 238000011282 treatment Methods 0.000 title claims description 26
- 239000000126 substance Substances 0.000 title claims description 24
- 239000010865 sewage Substances 0.000 title description 3
- 239000002351 wastewater Substances 0.000 claims description 39
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 22
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 16
- 229910021529 ammonia Inorganic materials 0.000 claims description 12
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 claims description 12
- 230000003301 hydrolyzing effect Effects 0.000 claims description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 9
- 150000001412 amines Chemical class 0.000 claims description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- 239000000975 dye Substances 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 150000002902 organometallic compounds Chemical class 0.000 claims description 5
- 229910052698 phosphorus Inorganic materials 0.000 claims description 5
- 239000011574 phosphorus Substances 0.000 claims description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 150000002825 nitriles Chemical class 0.000 claims description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 3
- 150000002391 heterocyclic compounds Chemical class 0.000 claims description 3
- 230000002045 lasting effect Effects 0.000 claims description 3
- 239000005909 Kieselgur Substances 0.000 claims description 2
- 150000003141 primary amines Chemical class 0.000 claims description 2
- 150000003335 secondary amines Chemical class 0.000 claims description 2
- 150000001913 cyanates Chemical class 0.000 claims 1
- 239000012948 isocyanate Substances 0.000 claims 1
- 150000002513 isocyanates Chemical class 0.000 claims 1
- 150000002736 metal compounds Chemical class 0.000 claims 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 230000007062 hydrolysis Effects 0.000 description 9
- 238000006460 hydrolysis reaction Methods 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 238000006065 biodegradation reaction Methods 0.000 description 5
- 239000012153 distilled water Substances 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000010802 sludge Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- -1 polybenzene Chemical compound 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 238000001514 detection method Methods 0.000 description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 230000036284 oxygen consumption Effects 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- TZXATTMVGZDPHM-UHFFFAOYSA-N 2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-n-ethylanilino]ethyl-trimethylazanium Chemical compound C1=CC(N(CC[N+](C)(C)C)CC)=CC=C1N=NC1=CC=C([N+]([O-])=O)C=C1Cl TZXATTMVGZDPHM-UHFFFAOYSA-N 0.000 description 1
- MJCQFBKIFDVTTR-UHFFFAOYSA-N 2-hydroxyimino-2-phenylacetonitrile Chemical compound ON=C(C#N)C1=CC=CC=C1 MJCQFBKIFDVTTR-UHFFFAOYSA-N 0.000 description 1
- AIARLPIXVMHZLJ-UHFFFAOYSA-N 4,8-diamino-2-bromo-1,5-dihydroxyanthracene-9,10-dione Chemical class O=C1C2=C(N)C=C(Br)C(O)=C2C(=O)C2=C1C(O)=CC=C2N AIARLPIXVMHZLJ-UHFFFAOYSA-N 0.000 description 1
- MLOVXTFKTATMKP-UHFFFAOYSA-N 5-(2-nitro-4-sulfamoylanilino)-2-[4-(2-nitro-4-sulfamoylanilino)anilino]benzenesulfonic acid Chemical class [O-][N+](=O)C1=CC(S(=O)(=O)N)=CC=C1NC(C=C1)=CC=C1NC(C(=C1)S(O)(=O)=O)=CC=C1NC1=CC=C(S(N)(=O)=O)C=C1[N+]([O-])=O MLOVXTFKTATMKP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- ZKUUZYDGDXRTLV-UHFFFAOYSA-N CC(=O)OCCC1(CC=C(C=C1)Cl)Cl Chemical compound CC(=O)OCCC1(CC=C(C=C1)Cl)Cl ZKUUZYDGDXRTLV-UHFFFAOYSA-N 0.000 description 1
- IOJBNVBZZYSKNG-UHFFFAOYSA-N C[ClH]P(=S)(Cl)[ClH]C Chemical compound C[ClH]P(=S)(Cl)[ClH]C IOJBNVBZZYSKNG-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- CZGGKXNYNPJFAX-UHFFFAOYSA-N Dimethyldithiophosphate Chemical compound COP(S)(=S)OC CZGGKXNYNPJFAX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical class O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 206010067482 No adverse event Diseases 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- POJOORKDYOPQLS-UHFFFAOYSA-L barium(2+) 5-chloro-2-[(2-hydroxynaphthalen-1-yl)diazenyl]-4-methylbenzenesulfonate Chemical compound [Ba+2].C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O.C1=C(Cl)C(C)=CC(N=NC=2C3=CC=CC=C3C=CC=2O)=C1S([O-])(=O)=O POJOORKDYOPQLS-UHFFFAOYSA-L 0.000 description 1
- JBIROUFYLSSYDX-UHFFFAOYSA-M benzododecinium chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+](C)(C)CC1=CC=CC=C1 JBIROUFYLSSYDX-UHFFFAOYSA-M 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 230000033558 biomineral tissue development Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- CEZCCHQBSQPRMU-UHFFFAOYSA-L chembl174821 Chemical class [Na+].[Na+].COC1=CC(S([O-])(=O)=O)=C(C)C=C1N=NC1=C(O)C=CC2=CC(S([O-])(=O)=O)=CC=C12 CEZCCHQBSQPRMU-UHFFFAOYSA-L 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 150000004696 coordination complex Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- 229960005215 dichloroacetic acid Drugs 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- WWJJVKAEQGGYHJ-UHFFFAOYSA-N dimethyl thiophosphate Chemical compound COP(O)(=S)OC WWJJVKAEQGGYHJ-UHFFFAOYSA-N 0.000 description 1
- 238000001962 electrophoresis Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- ZJXZSIYSNXKHEA-UHFFFAOYSA-N ethyl dihydrogen phosphate Chemical compound CCOP(O)(O)=O ZJXZSIYSNXKHEA-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- JLYXXMFPNIAWKQ-GNIYUCBRSA-N gamma-hexachlorocyclohexane Chemical compound Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@@H](Cl)[C@H](Cl)[C@H]1Cl JLYXXMFPNIAWKQ-GNIYUCBRSA-N 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 230000009931 harmful effect Effects 0.000 description 1
- 235000019239 indanthrene blue RS Nutrition 0.000 description 1
- UHOKSCJSTAHBSO-UHFFFAOYSA-N indanthrone blue Chemical compound C1=CC=C2C(=O)C3=CC=C4NC5=C6C(=O)C7=CC=CC=C7C(=O)C6=CC=C5NC4=C3C(=O)C2=C1 UHOKSCJSTAHBSO-UHFFFAOYSA-N 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- DCYOBGZUOMKFPA-UHFFFAOYSA-N iron(2+);iron(3+);octadecacyanide Chemical compound [Fe+2].[Fe+2].[Fe+2].[Fe+3].[Fe+3].[Fe+3].[Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] DCYOBGZUOMKFPA-UHFFFAOYSA-N 0.000 description 1
- 229960002809 lindane Drugs 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 239000000434 metal complex dye Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- CAAULPUQFIIOTL-UHFFFAOYSA-L methyl phosphate(2-) Chemical compound COP([O-])([O-])=O CAAULPUQFIIOTL-UHFFFAOYSA-L 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910017464 nitrogen compound Inorganic materials 0.000 description 1
- 150000002830 nitrogen compounds Chemical class 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 150000002896 organic halogen compounds Chemical class 0.000 description 1
- IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachlorophenol Chemical class OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- BQHRKYUXVHKLLZ-UHFFFAOYSA-M sodium 7-amino-2-[[4-[(4-aminophenyl)diazenyl]-2-methoxy-5-methylphenyl]diazenyl]-3-sulfonaphthalen-1-olate Chemical compound [Na+].COc1cc(N=Nc2ccc(N)cc2)c(C)cc1N=Nc1c(O)c2cc(N)ccc2cc1S([O-])(=O)=O BQHRKYUXVHKLLZ-UHFFFAOYSA-M 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- AWDBHOZBRXWRKS-UHFFFAOYSA-N tetrapotassium;iron(6+);hexacyanide Chemical compound [K+].[K+].[K+].[K+].[Fe+6].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] AWDBHOZBRXWRKS-UHFFFAOYSA-N 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- XWSLYQXUTWUIKM-UHFFFAOYSA-N trimethoxy(sulfanylidene)-$l^{5}-phosphane Chemical compound COP(=S)(OC)OC XWSLYQXUTWUIKM-UHFFFAOYSA-N 0.000 description 1
- 238000004065 wastewater treatment Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C02—TREATMENT OF WATER, WASTE WATER, SEWAGE, OR SLUDGE
- C02F—TREATMENT OF WATER, WASTE WATER, SEWAGE, OR SLUDGE
- C02F1/00—Treatment of water, waste water, or sewage
- C02F1/72—Treatment of water, waste water, or sewage by oxidation
- C02F1/725—Treatment of water, waste water, or sewage by oxidation by catalytic oxidation
-
- C—CHEMISTRY; METALLURGY
- C02—TREATMENT OF WATER, WASTE WATER, SEWAGE, OR SLUDGE
- C02F—TREATMENT OF WATER, WASTE WATER, SEWAGE, OR SLUDGE
- C02F1/00—Treatment of water, waste water, or sewage
- C02F1/02—Treatment of water, waste water, or sewage by heating
- C02F1/025—Thermal hydrolysis
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S210/00—Liquid purification or separation
- Y10S210/902—Materials removed
- Y10S210/906—Phosphorus containing
Landscapes
- Chemical & Material Sciences (AREA)
- Water Supply & Treatment (AREA)
- Life Sciences & Earth Sciences (AREA)
- Hydrology & Water Resources (AREA)
- Engineering & Computer Science (AREA)
- Environmental & Geological Engineering (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Physics & Mathematics (AREA)
- Thermal Sciences (AREA)
- Treatment Of Water By Oxidation Or Reduction (AREA)
- Heat Treatment Of Water, Waste Water Or Sewage (AREA)
- Removal Of Specific Substances (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2553840A DE2553840C3 (de) | 1975-11-29 | 1975-11-29 | Druckhydrolytische Behandlung von Abwasser |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH629460A5 true CH629460A5 (de) | 1982-04-30 |
Family
ID=5963085
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1477676A CH629460A5 (de) | 1975-11-29 | 1976-11-24 | Verfahren zur chemischen behandlung von abwaessern. |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4246104A (enExample) |
| JP (1) | JPS5268065A (enExample) |
| BE (1) | BE848846A (enExample) |
| BR (1) | BR7607930A (enExample) |
| CH (1) | CH629460A5 (enExample) |
| DE (1) | DE2553840C3 (enExample) |
| DK (1) | DK534576A (enExample) |
| FR (1) | FR2332959A1 (enExample) |
| GB (1) | GB1567767A (enExample) |
| IT (1) | IT1076843B (enExample) |
| NL (1) | NL7613232A (enExample) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7707081A (nl) * | 1977-06-27 | 1978-12-29 | Stamicarbon | Werkwijze voor het biologisch zuiveren van afvalwater. |
| DE2818680A1 (de) * | 1978-04-27 | 1979-10-31 | Bayer Ag | Verfahren zur aufarbeitung von nitro-hydroxy-aromaten enthaltenden abwaessern |
| FR2472539A1 (fr) * | 1979-11-27 | 1981-07-03 | Metaux Speciaux Sa | Procede de separation du molybdene et/ou d'autres metaux contenus dans des effluents organiques residuaires |
| JPS607557B2 (ja) * | 1980-05-22 | 1985-02-25 | 三菱電線工業株式会社 | ニッケルシアン化合物含有液の処理方法 |
| DE3042193A1 (de) * | 1980-11-08 | 1982-06-24 | Hoechst Ag, 6000 Frankfurt | Verfahren zur reinigung von abwasser |
| JPS6097013A (ja) * | 1983-11-01 | 1985-05-30 | Japan Metals & Chem Co Ltd | 掘削廃泥水の処理方法 |
| US4840731A (en) * | 1985-06-18 | 1989-06-20 | Morris Sheikh | Apparaus for reduction of COD in water |
| US4683065A (en) * | 1985-06-18 | 1987-07-28 | Morris Sheikh | Method for reduction of cod in water |
| US4741833A (en) * | 1985-06-18 | 1988-05-03 | Morris Sheikh | Method for reduction of COD in water |
| US4915849A (en) * | 1988-08-17 | 1990-04-10 | Degussa Aktiegesellschaft | Process for the treatment of effluents containing cyanide and other oxidizable substances |
| DE3909062A1 (de) * | 1989-03-20 | 1990-09-27 | Still Otto Gmbh | Verfahren zur zersetzung von abfallaugen aus absorptionsprozessen |
| DE4002624C1 (enExample) * | 1990-01-30 | 1991-11-28 | Still Otto Gmbh, 4630 Bochum, De | |
| US5386079A (en) * | 1992-05-19 | 1995-01-31 | Ciba-Geigy Corporation | Wastewater treatment process |
| ATE161804T1 (de) * | 1992-09-06 | 1998-01-15 | Solvay Deutschland | Verfahren zur behandlung von organischen stoffen, insbesondere chlororganische verbindungen enthaltenden abwässern aus der epichlorhydrinherstellung |
| DE4306844C2 (de) * | 1993-02-27 | 2000-01-20 | Rolf Hesselmann | Verfahren zur kombinierten physikalisch-chemischen Reinigung von Wässern, die mit den Explosivstoffen 2,4,6-Trinitrotoluol, Hexahydro-1,3,5-trinitro-1,3,5-triazin und Octahydro-1,3,5,7-tetranitro-1,3,5,7-tetraocin verunreinigt sind |
| DE4314108A1 (de) * | 1993-04-29 | 1994-11-03 | Solvay Deutschland | Verfahren zur Behandlung von organische und anorganische Verbindungen enthaltenden Abwässern, vorzugsweise aus der Epichlorhydrin-Herstellung |
| DE4340356A1 (de) * | 1993-11-26 | 1995-06-01 | Wieland Edelmetalle | Verfahren und Vorrichtung zum Abbau von harten Komplexbildnern in wässriger Lösung |
| US5700107A (en) * | 1995-07-25 | 1997-12-23 | Habour Remediation And Transfer Inc. (Hr&T) | Method of soil remediation |
| BE1011880A4 (fr) * | 1998-04-21 | 2000-02-01 | Solvay | Procede d'epuration de saumures. |
| US6372147B1 (en) * | 2001-05-07 | 2002-04-16 | E. I. Du Pont De Nemours And Company | Organoboron waste stream treatment using hydrogen peroxide |
| JP4652359B2 (ja) * | 2007-03-09 | 2011-03-16 | 日本合成化学工業株式会社 | イオン液体の分解処理方法 |
| CN103771657B (zh) * | 2013-12-20 | 2016-08-24 | 安徽国星生物化学有限公司 | 一种毒死蜱废水的处理方法 |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB895741A (en) * | 1957-05-25 | 1962-05-09 | Degussa | Process for apparatus for the treatment of aqueous cyanide solutions |
| DE1517653A1 (de) * | 1963-05-02 | 1969-05-22 | Friedrichsfelder Abwasser Und | Verfahren zur Entgiftung von Abwaessern der petro-chemischen Industrie |
| US3398088A (en) * | 1966-09-09 | 1968-08-20 | Dorr Oliver Inc | Phosphorous removal in membrane waste water treatment |
| US3607738A (en) * | 1969-02-12 | 1971-09-21 | Nalco Chemical Co | Sewage treatment |
| US3676334A (en) * | 1969-05-14 | 1972-07-11 | Envirotech Corp | Wastewater treatment sequence |
| US3586625A (en) * | 1969-12-12 | 1971-06-22 | Texaco Inc | Treatment of aqueous streams for removal of nitrogen and phosphorus compounds |
| JPS4836380B1 (enExample) * | 1970-05-25 | 1973-11-05 | ||
| DE2050874C3 (de) * | 1970-10-16 | 1979-10-18 | Fried. Krupp Gmbh, 4300 Essen | Verfahren zum Reinigen von Abwässern aus der Papier-, Leder-, Textil-, Reinigungs-, Nahrungsmittel- und Kunststoffindustrie |
| FR2126567A5 (enExample) * | 1971-02-11 | 1972-10-06 | Ugilor | |
| US3762989A (en) * | 1971-07-30 | 1973-10-02 | St Regis Paper Co | Pyrolysis of spent pulping liquors |
| DE2141294A1 (de) * | 1971-08-18 | 1973-02-22 | Ulrich Prof Dr Schindewolf | Verfahren zur umweltfreundlichen vernichtung von festen und fluessigen cyanidabfaellen |
| US3862296A (en) * | 1972-02-09 | 1975-01-21 | Gen Electric | Conversion process for waste nitrogen-containing compounds |
| DD109365A1 (enExample) * | 1973-05-10 | 1974-11-05 | ||
| US4042502A (en) * | 1973-05-10 | 1977-08-16 | Veb Jenapharm Jena | Detoxification of cyanides and cyanide-containing solutions |
| NL162616C (nl) * | 1974-05-31 | Ruhrchemie Ag | Werkwijze voor het zuiveren van het bij de bereiding van esterweekmakers verkregen afvalwater. | |
| DE2430193A1 (de) * | 1974-06-24 | 1976-01-15 | Wacker Chemie Gmbh | Verfahren zur entfernung von reaktionsfaehigen chlororganischen verbindungen aus waessrigen loesungen, insbesondere abwaessern |
| US4013757A (en) * | 1975-04-17 | 1977-03-22 | Fmc Corporation | High pressure thermal hydrolysis process to decompose triazines in acid waste streams |
| US4070289A (en) * | 1976-02-23 | 1978-01-24 | Alaeddin Akcasu | Preparation of pyrogen-free water |
-
1975
- 1975-11-29 DE DE2553840A patent/DE2553840C3/de not_active Expired
-
1976
- 1976-11-22 GB GB48556/76A patent/GB1567767A/en not_active Expired
- 1976-11-24 CH CH1477676A patent/CH629460A5/de not_active IP Right Cessation
- 1976-11-25 IT IT52331/76A patent/IT1076843B/it active
- 1976-11-26 NL NL7613232A patent/NL7613232A/xx active Search and Examination
- 1976-11-26 BR BR7607930A patent/BR7607930A/pt unknown
- 1976-11-26 JP JP51141345A patent/JPS5268065A/ja active Pending
- 1976-11-26 DK DK534576A patent/DK534576A/da unknown
- 1976-11-29 BE BE2055490A patent/BE848846A/xx unknown
- 1976-11-29 FR FR7635949A patent/FR2332959A1/fr active Granted
-
1979
- 1979-04-30 US US06/034,713 patent/US4246104A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NL7613232A (nl) | 1977-06-01 |
| JPS5268065A (en) | 1977-06-06 |
| DK534576A (da) | 1977-05-30 |
| GB1567767A (en) | 1980-05-21 |
| DE2553840B2 (de) | 1980-05-22 |
| BR7607930A (pt) | 1977-11-08 |
| IT1076843B (it) | 1985-04-27 |
| BE848846A (fr) | 1977-05-31 |
| FR2332959A1 (fr) | 1977-06-24 |
| FR2332959B1 (enExample) | 1982-06-11 |
| US4246104A (en) | 1981-01-20 |
| DE2553840A1 (de) | 1977-06-08 |
| DE2553840C3 (de) | 1981-01-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH629460A5 (de) | Verfahren zur chemischen behandlung von abwaessern. | |
| DE68902197T2 (de) | Abwasservorbehandlung in einem verfahren zur biologischen reinigung. | |
| DE3032831A1 (de) | Verfahren zur reinigung von farbstoffe enthaltenden abwaessern | |
| DE2521893A1 (de) | Verfahren zur behandlung von abwasser | |
| EP0680931B1 (de) | Verfahren zur Behandlung eines organische Bestandteile enthaltenden Mediums | |
| DE10143600A1 (de) | Verfahren zur biologischen Aufbereitung von farbstoffhaltigen Abwässern aus der Textil- und Lederindustrie | |
| DE102009007761A1 (de) | Verfahren zur Aufarbeitung von Abwässern | |
| DE69324262T2 (de) | Verfahren zur behandlung von abwasser | |
| DE2262754B2 (de) | Verfahren zum Behandeln von Abwasser | |
| DE3834543A1 (de) | Verfahren zur entsorgung von einen hohen gehalt an ammoniumstickstoff aufweisenden abwaessern | |
| DE3050461C2 (de) | Verfahren zur Behandlung einer Ablauge | |
| DE1517657A1 (de) | Verfahren zur Behandlung von Abwaessern | |
| DD207695A5 (de) | Verfahren zur behandlung von aromatische amine enthaltenden abwaessern | |
| DE2531598A1 (de) | Verfahren zur reinigung von abwaessern | |
| DE2835496A1 (de) | Verfahren zur chemisch-biologischen behandlung von abwasser | |
| DE19716939C2 (de) | Verfahren und Abwasserbehandlungsanlage zur biologischen Aufbereitung von farbstoffhaltigen Abwässern aus der Textil- und Lederindustrie | |
| DE2408778C2 (de) | Verfahren zum Abbau von in Abwässern enthaltenen Pseudohalogeniden | |
| DE2321509A1 (de) | Koagulierungsmittel und verfahren zur klaerung von gefaerbten abwaessern | |
| DE3727108C2 (enExample) | ||
| DE4407216C1 (de) | Verfahren zur Nitrifikation und Stickstoffelimination | |
| DE69312361T2 (de) | Wasserbehandlung durch Ozon | |
| DE2462995C2 (de) | Verfahren zum Reinigen von verschmutztem Grund- und Trinkwasser | |
| DE2202660C3 (de) | Verfahren zur Entfernung von Cyanidionen aus Abwasser | |
| CH686729A5 (de) | Verfahren zum Entfaerben ausgedienter Aluminium-Faerbe- und -Spuelbaeder. | |
| DD152528A1 (de) | Verfahren zur nitratentfernung aus abwaessern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |