CH626399A5 - - Google Patents
Download PDFInfo
- Publication number
- CH626399A5 CH626399A5 CH1388076A CH1388076A CH626399A5 CH 626399 A5 CH626399 A5 CH 626399A5 CH 1388076 A CH1388076 A CH 1388076A CH 1388076 A CH1388076 A CH 1388076A CH 626399 A5 CH626399 A5 CH 626399A5
- Authority
- CH
- Switzerland
- Prior art keywords
- bleaching
- weight
- compounds
- per
- bleaching aid
- Prior art date
Links
- 238000004061 bleaching Methods 0.000 claims description 62
- 239000000203 mixture Substances 0.000 claims description 46
- 239000003599 detergent Substances 0.000 claims description 37
- 150000001875 compounds Chemical class 0.000 claims description 31
- 239000012190 activator Substances 0.000 claims description 30
- 239000007844 bleaching agent Substances 0.000 claims description 29
- 239000003381 stabilizer Substances 0.000 claims description 25
- -1 alkali metal salts Chemical class 0.000 claims description 18
- 239000002245 particle Substances 0.000 claims description 15
- NFDRPXJGHKJRLJ-UHFFFAOYSA-N edtmp Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CCN(CP(O)(O)=O)CP(O)(O)=O NFDRPXJGHKJRLJ-UHFFFAOYSA-N 0.000 claims description 14
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 claims description 13
- 239000008187 granular material Substances 0.000 claims description 13
- 238000002844 melting Methods 0.000 claims description 13
- 230000008018 melting Effects 0.000 claims description 13
- 239000011361 granulated particle Substances 0.000 claims description 9
- 150000004965 peroxy acids Chemical class 0.000 claims description 9
- 229910052783 alkali metal Inorganic materials 0.000 claims description 8
- 230000015572 biosynthetic process Effects 0.000 claims description 7
- 238000004140 cleaning Methods 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 claims description 7
- 235000019345 sodium thiosulphate Nutrition 0.000 claims description 7
- 239000004094 surface-active agent Substances 0.000 claims description 7
- 238000005406 washing Methods 0.000 claims description 5
- 239000011149 active material Substances 0.000 claims description 4
- 150000001733 carboxylic acid esters Chemical class 0.000 claims description 4
- 229920000233 poly(alkylene oxides) Polymers 0.000 claims description 4
- 239000000320 mechanical mixture Substances 0.000 claims description 3
- 150000003009 phosphonic acids Chemical class 0.000 claims description 3
- 238000007873 sieving Methods 0.000 claims description 3
- 238000005507 spraying Methods 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 239000002736 nonionic surfactant Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000000843 powder Substances 0.000 description 13
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical compound CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 description 12
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 10
- 229940120146 EDTMP Drugs 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 125000001931 aliphatic group Chemical group 0.000 description 7
- 229940071106 ethylenediaminetetraacetate Drugs 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 238000003860 storage Methods 0.000 description 7
- 239000003760 tallow Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- 229960001922 sodium perborate Drugs 0.000 description 5
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 5
- 239000013543 active substance Substances 0.000 description 4
- 230000007613 environmental effect Effects 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 230000002209 hydrophobic effect Effects 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 238000001694 spray drying Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000012459 cleaning agent Substances 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000008040 ionic compounds Chemical class 0.000 description 2
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- 229920001451 polypropylene glycol Polymers 0.000 description 2
- XTHRMVQDBJOEPD-UHFFFAOYSA-N prop-1-ene;urea Chemical compound CC=C.NC(N)=O.NC(N)=O XTHRMVQDBJOEPD-UHFFFAOYSA-N 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 2
- 229940048086 sodium pyrophosphate Drugs 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- RKHMZKDESOMZLE-UHFFFAOYSA-N (1,3-diacetyl-5-acetyloxyimidazolidin-4-yl) acetate Chemical compound CC(=O)OC1C(OC(C)=O)N(C(C)=O)CN1C(C)=O RKHMZKDESOMZLE-UHFFFAOYSA-N 0.000 description 1
- BVUOEDOMUOJKOY-UHFFFAOYSA-N (2,5-dioxopyrrolidin-1-yl) benzoate Chemical compound C=1C=CC=CC=1C(=O)ON1C(=O)CCC1=O BVUOEDOMUOJKOY-UHFFFAOYSA-N 0.000 description 1
- NIHKFGMYMWGERR-UHFFFAOYSA-N (3-chlorobenzoyl) 3-chlorobenzoate Chemical compound ClC1=CC=CC(C(=O)OC(=O)C=2C=C(Cl)C=CC=2)=C1 NIHKFGMYMWGERR-UHFFFAOYSA-N 0.000 description 1
- WBBAZMPYEDKGEU-UHFFFAOYSA-N (5-acetyloxy-1,3-diformylimidazolidin-4-yl) acetate Chemical compound CC(=O)OC1C(OC(C)=O)N(C=O)CN1C=O WBBAZMPYEDKGEU-UHFFFAOYSA-N 0.000 description 1
- VAVZXZURPCYUHS-RQOWECAXSA-N (z)-3-(hydrazinecarbonyl)-4-oxopent-2-enoic acid Chemical compound OC(=O)/C=C(C(=O)C)\C(=O)NN VAVZXZURPCYUHS-RQOWECAXSA-N 0.000 description 1
- BZJTUOGZUKFLQT-UHFFFAOYSA-N 1,3,5,7-tetramethylcyclooctane Chemical group CC1CC(C)CC(C)CC(C)C1 BZJTUOGZUKFLQT-UHFFFAOYSA-N 0.000 description 1
- CMPBGADGVYNAAG-UHFFFAOYSA-N 1,3-di(propanoyl)imidazolidine-2,4-dione Chemical compound CCC(=O)N1CC(=O)N(C(=O)CC)C1=O CMPBGADGVYNAAG-UHFFFAOYSA-N 0.000 description 1
- HUPQMDDKEZELTH-UHFFFAOYSA-N 1,3-diacetyl-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC(=O)N1C(=O)N(C(C)=O)C(C)(C)C1=O HUPQMDDKEZELTH-UHFFFAOYSA-N 0.000 description 1
- GJBQPJPEBXKJSF-UHFFFAOYSA-N 1,4-di(propanoyl)piperazine-2,5-dione Chemical compound CCC(=O)N1CC(=O)N(C(=O)CC)CC1=O GJBQPJPEBXKJSF-UHFFFAOYSA-N 0.000 description 1
- CBBKKVPJPRZOCM-UHFFFAOYSA-N 1,4-diacetylpiperazine-2,5-dione Chemical compound CC(=O)N1CC(=O)N(C(C)=O)CC1=O CBBKKVPJPRZOCM-UHFFFAOYSA-N 0.000 description 1
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 1
- WFXJWACFHGTNEH-UHFFFAOYSA-N 3,6-dimethyl-1,4-di(propanoyl)piperazine-2,5-dione Chemical compound CCC(=O)N1C(C)C(=O)N(C(=O)CC)C(C)C1=O WFXJWACFHGTNEH-UHFFFAOYSA-N 0.000 description 1
- BTTRMCQEPDPCPA-UHFFFAOYSA-N 4-chlorophthalic anhydride Chemical compound ClC1=CC=C2C(=O)OC(=O)C2=C1 BTTRMCQEPDPCPA-UHFFFAOYSA-N 0.000 description 1
- YNSJJJCTNXHMEW-UHFFFAOYSA-N 4-methoxy-n-methyl-n-methylsulfonylbenzamide Chemical compound COC1=CC=C(C(=O)N(C)S(C)(=O)=O)C=C1 YNSJJJCTNXHMEW-UHFFFAOYSA-N 0.000 description 1
- BUJPYXOTTZPZGS-UHFFFAOYSA-N 4-propoxycarbonyloxybenzenesulfonic acid Chemical compound CCCOC(=O)OC1=CC=C(S(O)(=O)=O)C=C1 BUJPYXOTTZPZGS-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 1
- 229910003252 NaBO2 Inorganic materials 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical group CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 239000001083 [(2R,3R,4S,5R)-1,2,4,5-tetraacetyloxy-6-oxohexan-3-yl] acetate Substances 0.000 description 1
- UAOKXEHOENRFMP-ZJIFWQFVSA-N [(2r,3r,4s,5r)-2,3,4,5-tetraacetyloxy-6-oxohexyl] acetate Chemical compound CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C=O UAOKXEHOENRFMP-ZJIFWQFVSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000007973 cyanuric acids Chemical class 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 229940088598 enzyme Drugs 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 150000001469 hydantoins Chemical class 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- UJPCOKISUIXFFR-UHFFFAOYSA-N n-acetyl-n-(4-methylphenyl)acetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=C(C)C=C1 UJPCOKISUIXFFR-UHFFFAOYSA-N 0.000 description 1
- KBDYPDHUODKDRK-UHFFFAOYSA-N n-acetyl-n-phenylacetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=CC=C1 KBDYPDHUODKDRK-UHFFFAOYSA-N 0.000 description 1
- QGILZBNKDUVXNM-UHFFFAOYSA-N n-methyl-n-methylsulfonyl-4-nitrobenzamide Chemical compound CS(=O)(=O)N(C)C(=O)C1=CC=C([N+]([O-])=O)C=C1 QGILZBNKDUVXNM-UHFFFAOYSA-N 0.000 description 1
- DDNVNUWFESEAHN-UHFFFAOYSA-N n-methyl-n-methylsulfonylacetamide Chemical compound CC(=O)N(C)S(C)(=O)=O DDNVNUWFESEAHN-UHFFFAOYSA-N 0.000 description 1
- FVCXXYLGLXGBDR-UHFFFAOYSA-N n-methyl-n-methylsulfonylbenzamide Chemical compound CS(=O)(=O)N(C)C(=O)C1=CC=CC=C1 FVCXXYLGLXGBDR-UHFFFAOYSA-N 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- LEWPZOGPVRIZMD-UHFFFAOYSA-N nonane-3,7-dione Chemical compound CCC(=O)CCCC(=O)CC LEWPZOGPVRIZMD-UHFFFAOYSA-N 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000011049 pearl Substances 0.000 description 1
- ATGAWOHQWWULNK-UHFFFAOYSA-I pentapotassium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [K+].[K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O ATGAWOHQWWULNK-UHFFFAOYSA-I 0.000 description 1
- 125000005342 perphosphate group Chemical group 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- BXRNXXXXHLBUKK-UHFFFAOYSA-N piperazine-2,5-dione Chemical class O=C1CNC(=O)CN1 BXRNXXXXHLBUKK-UHFFFAOYSA-N 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 239000011253 protective coating Substances 0.000 description 1
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 238000005204 segregation Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229940083542 sodium Drugs 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- NVIFVTYDZMXWGX-UHFFFAOYSA-N sodium metaborate Chemical compound [Na+].[O-]B=O NVIFVTYDZMXWGX-UHFFFAOYSA-N 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- RYCLIXPGLDDLTM-UHFFFAOYSA-J tetrapotassium;phosphonato phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O RYCLIXPGLDDLTM-UHFFFAOYSA-J 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3937—Stabilising agents
- C11D3/394—Organic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Ink Jet (AREA)
- Surgical Instruments (AREA)
- Particle Formation And Scattering Control In Inkjet Printers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB45661/75A GB1561333A (en) | 1975-11-03 | 1975-11-03 | Bleaching assistants |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH626399A5 true CH626399A5 (enExample) | 1981-11-13 |
Family
ID=10438086
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1388076A CH626399A5 (enExample) | 1975-11-03 | 1976-11-03 |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4111826A (enExample) |
| JP (1) | JPS5284189A (enExample) |
| AT (1) | AT357508B (enExample) |
| BE (1) | BE847937A (enExample) |
| CA (1) | CA1071056A (enExample) |
| CH (1) | CH626399A5 (enExample) |
| DE (1) | DE2650429C2 (enExample) |
| DK (1) | DK496576A (enExample) |
| ES (1) | ES452957A1 (enExample) |
| FI (1) | FI62137C (enExample) |
| FR (1) | FR2329747A1 (enExample) |
| GB (1) | GB1561333A (enExample) |
| NL (1) | NL164897C (enExample) |
| NO (1) | NO145802C (enExample) |
| PT (1) | PT65784B (enExample) |
| SE (1) | SE425096B (enExample) |
| ZA (1) | ZA766592B (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2963842D1 (en) * | 1978-06-26 | 1982-11-18 | Procter & Gamble | Particulate detergent additive product |
| FI64639C (fi) * | 1978-09-27 | 1983-12-12 | Unilever Nv | Bleknings- och rengoeringskomposition |
| IE49996B1 (en) * | 1979-07-06 | 1986-01-22 | Unilever Ltd | Particulate bleach compositions |
| ES506859A0 (es) * | 1980-11-06 | 1983-11-01 | Procter & Gamble | Un procedimiento para preparar una composicion granular ac- tivadora del blanqueo. |
| US4529534A (en) * | 1982-08-19 | 1985-07-16 | The Procter & Gamble Company | Peroxyacid bleach compositions |
| GB8321923D0 (en) * | 1983-08-15 | 1983-09-14 | Unilever Plc | Machine-dishwashing compositions |
| GB8334159D0 (en) * | 1983-12-22 | 1984-02-01 | Unilever Plc | Perfume |
| GB8422158D0 (en) * | 1984-09-01 | 1984-10-03 | Procter & Gamble Ltd | Bleach compositions |
| US5580841A (en) * | 1985-05-29 | 1996-12-03 | Zeneca Limited | Solid, phytoactive compositions and method for their preparation |
| US5112514A (en) * | 1986-11-06 | 1992-05-12 | The Clorox Company | Oxidant detergent containing stable bleach activator granules |
| US5002691A (en) * | 1986-11-06 | 1991-03-26 | The Clorox Company | Oxidant detergent containing stable bleach activator granules |
| GB2213159B (en) * | 1987-12-03 | 1992-07-29 | Richardson Vicks Ltd | Cleansing compositions |
| DE3812693A1 (de) * | 1988-03-19 | 1989-09-28 | Reckitt Gmbh | Reinigungstablette fuer zahnprothesen |
| US5269962A (en) * | 1988-10-14 | 1993-12-14 | The Clorox Company | Oxidant composition containing stable bleach activator granules |
| GB8904007D0 (en) * | 1989-02-22 | 1989-04-05 | Procter & Gamble | Stabilized,bleach containing,liquid detergent compositions |
| US4988451A (en) * | 1989-06-14 | 1991-01-29 | Lever Brothers Company, Division Of Conopco, Inc. | Stabilization of particles containing quaternary ammonium bleach precursors |
| US5200236A (en) * | 1989-11-15 | 1993-04-06 | Lever Brothers Company, Division Of Conopco, Inc. | Method for wax encapsulating particles |
| US5258132A (en) * | 1989-11-15 | 1993-11-02 | Lever Brothers Company, Division Of Conopco, Inc. | Wax-encapsulated particles |
| US5230822A (en) * | 1989-11-15 | 1993-07-27 | Lever Brothers Company, Division Of Conopco, Inc. | Wax-encapsulated particles |
| US5055217A (en) * | 1990-11-20 | 1991-10-08 | Lever Brothers Company, Division Of Conopco, Inc. | Polymer protected bleach precursors |
| DE19605526A1 (de) | 1996-02-15 | 1997-08-21 | Hoechst Ag | Ammoniumnitrile und deren Verwendung als Bleichaktivatoren |
| EP0816483A1 (en) * | 1996-06-27 | 1998-01-07 | The Procter & Gamble Company | Granular bleaching compositions |
| DE19719397A1 (de) * | 1997-05-07 | 1998-11-12 | Clariant Gmbh | Bleichaktive Metall-Komplexe |
| DE19728021A1 (de) * | 1997-07-01 | 1999-01-07 | Clariant Gmbh | Metall-Komplexe als Bleichaktivatoren |
| DE19943254A1 (de) | 1999-09-10 | 2001-03-15 | Clariant Gmbh | Bleichaktive Metallkomplexe |
| DE10019877A1 (de) | 2000-04-20 | 2001-10-25 | Clariant Gmbh | Wasch- und Reinigungsmittel enthaltend bleichaktive Dendrimer-Liganden und deren Metall-Komplexe |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL95695C (enExample) * | 1955-10-03 | |||
| CA678942A (en) * | 1959-06-19 | 1964-01-28 | U. Kloosterman Cornelis | Process for the preparation of a washing and/or bleaching agent |
| GB1204123A (en) * | 1966-11-29 | 1970-09-03 | Unilever Ltd | Detergent composition |
| DE2060762A1 (de) * | 1970-12-10 | 1972-06-22 | Henkel & Cie Gmbh | Mittel zur Herstellung von Kaltbleichflotten,insbesondere von kaltbleichwirksamen Waschlaugen |
| DE2115081A1 (en) * | 1971-03-29 | 1972-10-05 | Complexing agent for bleaches - consisting of paraffin-coated disodium ethylenediaminetetraacetate dihydrate particles | |
| GB1392284A (en) * | 1971-03-30 | 1975-04-30 | Unilever Ltd | Stabilisation of active oxygen releasing compounds |
| GB1395006A (en) * | 1971-04-30 | 1975-05-21 | Unilever Ltd | Activators for per compounds |
| DE2141280A1 (de) * | 1971-08-18 | 1973-03-01 | Henkel & Cie Gmbh | Zur verwendung in aktivsauerstoff enthaltenden bleich- und waschmitteln bestimmtes eingehuelltes aethylendiamintetraacetat |
| AT339246B (de) * | 1974-08-14 | 1977-10-10 | Henkel & Cie Gmbh | Als bestandteil von pulverformigen wasch- und bleichmitteln geeignetes bleichhilfsmittel |
| AT326611B (de) * | 1972-07-31 | 1975-12-29 | Henkel & Cie Gmbh | Als bestandteil von pulverförmigen wasch- und bleichmitteln geeignetes bleichhilfsmittel |
-
1975
- 1975-11-03 GB GB45661/75A patent/GB1561333A/en not_active Expired
-
1976
- 1976-11-02 US US05/737,980 patent/US4111826A/en not_active Expired - Lifetime
- 1976-11-02 CA CA264,640A patent/CA1071056A/en not_active Expired
- 1976-11-02 FR FR7633015A patent/FR2329747A1/fr active Granted
- 1976-11-02 PT PT65784A patent/PT65784B/pt unknown
- 1976-11-03 FI FI763142A patent/FI62137C/fi not_active IP Right Cessation
- 1976-11-03 SE SE7612254A patent/SE425096B/xx not_active IP Right Cessation
- 1976-11-03 AT AT813876A patent/AT357508B/de not_active IP Right Cessation
- 1976-11-03 DE DE2650429A patent/DE2650429C2/de not_active Expired
- 1976-11-03 ZA ZA00766592A patent/ZA766592B/xx unknown
- 1976-11-03 BE BE172041A patent/BE847937A/xx not_active IP Right Cessation
- 1976-11-03 CH CH1388076A patent/CH626399A5/de not_active IP Right Cessation
- 1976-11-03 ES ES452957A patent/ES452957A1/es not_active Expired
- 1976-11-03 NO NO763733A patent/NO145802C/no unknown
- 1976-11-03 NL NL7612164.A patent/NL164897C/xx not_active IP Right Cessation
- 1976-11-03 DK DK496576A patent/DK496576A/da not_active Application Discontinuation
- 1976-11-04 JP JP13274376A patent/JPS5284189A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| DE2650429C2 (de) | 1982-09-23 |
| FI763142A7 (enExample) | 1977-05-04 |
| JPS5760400B2 (enExample) | 1982-12-18 |
| CA1071056A (en) | 1980-02-05 |
| DE2650429A1 (de) | 1977-05-05 |
| ES452957A1 (es) | 1978-01-16 |
| NL7612164A (nl) | 1977-05-05 |
| NL164897B (nl) | 1980-09-15 |
| SE425096B (sv) | 1982-08-30 |
| US4111826A (en) | 1978-09-05 |
| ATA813876A (de) | 1979-12-15 |
| JPS5284189A (en) | 1977-07-13 |
| BE847937A (fr) | 1977-05-03 |
| FI62137B (fi) | 1982-07-30 |
| DK496576A (da) | 1977-05-04 |
| PT65784B (de) | 1978-10-10 |
| FI62137C (fi) | 1982-11-10 |
| FR2329747A1 (fr) | 1977-05-27 |
| NO145802C (no) | 1982-06-02 |
| ZA766592B (en) | 1978-06-28 |
| PT65784A (en) | 1976-12-01 |
| NO145802B (no) | 1982-02-22 |
| SE7612254L (sv) | 1977-05-04 |
| AT357508B (de) | 1980-07-10 |
| FR2329747B1 (enExample) | 1980-05-09 |
| NO763733L (enExample) | 1977-05-04 |
| GB1561333A (en) | 1980-02-20 |
| NL164897C (nl) | 1981-02-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2650429C2 (de) | Bleichhilfsmittel, Verfahren zu ihrer Herstellung und ihre Verwendung in Reinigungsmittelbleichzusammensetzungen | |
| DE3012922A1 (de) | Bleich- und reinigungsmittel | |
| DE2338412C2 (de) | Zur Verwendung in Wasch- und Bleichmitteln geeignetes Bleichhilfsmittel und Verfahren zu dessen Herstellung | |
| EP1017773B1 (de) | Gecoatete ammoniumnitril-bleichaktivatorgranulate | |
| EP0835926B1 (de) | Verfahren zur Herstellung eines gecoateten Bleichaktivatorgranulats | |
| EP0375241B1 (en) | Coloring stabilized bleach activator extrudates | |
| DE2138584C3 (de) | Zur Verwendung in Waschmitteln geeignetes lagerbeständiges Bleichmittel und Verfahren zu dessen Herstellung | |
| EP0868396B1 (de) | Durch beschichtung stabilisierte feste peroxo- und peroxy-verbindungen | |
| AT394864B (de) | Im wesentlichen wasserfreies, fluessiges grobwaschmittel und verfahren zu seiner herstellung | |
| DE3321082C2 (de) | Bleich-Reinigungsmittel | |
| DE4040654A1 (de) | Granulat mit umhuelltem bleichaktivator | |
| EP0075751A2 (de) | Triazolidin-3,5-dione als Aktivatoren für Perverbindungen | |
| EP1207195A2 (de) | Teilchenförmige Bleichaktivatoren auf der Basis von Acetonitrilen | |
| EP0552193B1 (de) | Percarbonathaltiges waschmittel | |
| DE2616350A1 (de) | Verfahren zur herstellung von reinigungsmittelpulverzusammensetzungen | |
| DE2365269A1 (de) | Lagerbestaendiger, leichtloeslicher waschmittelzusatz und verfahren zu dessen herstellung | |
| DE2741671C2 (de) | Granulare Waschmittel | |
| DE2141280A1 (de) | Zur verwendung in aktivsauerstoff enthaltenden bleich- und waschmitteln bestimmtes eingehuelltes aethylendiamintetraacetat | |
| AT387401B (de) | Bleich- und reinigungsmittel | |
| DE2224509A1 (de) | Verfahren zur herstellung eines zur verwendung in wasch- und bleichmitteln geeigneten bleichhilfsmittel | |
| DE2061863A1 (en) | Detergent composns - contg optical brightener and bleach activators esp tetraacetyl glycoluril | |
| DE2115081A1 (en) | Complexing agent for bleaches - consisting of paraffin-coated disodium ethylenediaminetetraacetate dihydrate particles | |
| WO2003048289A1 (de) | Verfahren zur herstellung von bleichaktivatorgranulaten | |
| EP0903401A1 (de) | Antimikrobieller Waschmittelzusatz | |
| DE1419360C (de) | Bleichmittelpulver |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |