CH624228A5 - - Google Patents
Download PDFInfo
- Publication number
- CH624228A5 CH624228A5 CH1108677A CH1108677A CH624228A5 CH 624228 A5 CH624228 A5 CH 624228A5 CH 1108677 A CH1108677 A CH 1108677A CH 1108677 A CH1108677 A CH 1108677A CH 624228 A5 CH624228 A5 CH 624228A5
- Authority
- CH
- Switzerland
- Prior art keywords
- radical
- layer
- dye
- compound
- group
- Prior art date
Links
- -1 silver halide Chemical class 0.000 claims description 136
- 239000000975 dye Substances 0.000 claims description 127
- 150000003254 radicals Chemical class 0.000 claims description 108
- 150000001875 compounds Chemical class 0.000 claims description 95
- 229910052709 silver Inorganic materials 0.000 claims description 70
- 239000004332 silver Substances 0.000 claims description 70
- 239000000243 solution Substances 0.000 claims description 68
- 239000000203 mixture Substances 0.000 claims description 67
- 239000000839 emulsion Substances 0.000 claims description 65
- 238000011282 treatment Methods 0.000 claims description 46
- 125000004432 carbon atom Chemical group C* 0.000 claims description 33
- 229910021645 metal ion Inorganic materials 0.000 claims description 30
- 239000000987 azo dye Substances 0.000 claims description 28
- 229910052757 nitrogen Inorganic materials 0.000 claims description 22
- 238000011161 development Methods 0.000 claims description 21
- 125000004429 atom Chemical group 0.000 claims description 20
- 239000002243 precursor Substances 0.000 claims description 17
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 15
- 230000009920 chelation Effects 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 12
- 239000012670 alkaline solution Substances 0.000 claims description 11
- 125000000623 heterocyclic group Chemical group 0.000 claims description 10
- 239000002775 capsule Substances 0.000 claims description 9
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 9
- 238000007254 oxidation reaction Methods 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 125000002837 carbocyclic group Chemical group 0.000 claims description 7
- 150000005840 aryl radicals Chemical class 0.000 claims description 6
- 238000004040 coloring Methods 0.000 claims description 6
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 230000007062 hydrolysis Effects 0.000 claims description 5
- 238000006460 hydrolysis reaction Methods 0.000 claims description 5
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 claims description 5
- 239000001043 yellow dye Substances 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 230000003647 oxidation Effects 0.000 claims description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 4
- 238000007599 discharging Methods 0.000 claims description 3
- BLNWTAHYTCHDJH-UHFFFAOYSA-O hydroxy(oxo)azanium Chemical compound O[NH+]=O BLNWTAHYTCHDJH-UHFFFAOYSA-O 0.000 claims description 3
- MCSKRVKAXABJLX-UHFFFAOYSA-N pyrazolo[3,4-d]triazole Chemical group N1=NN=C2N=NC=C21 MCSKRVKAXABJLX-UHFFFAOYSA-N 0.000 claims description 3
- 101100294106 Caenorhabditis elegans nhr-3 gene Proteins 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 125000005518 carboxamido group Chemical group 0.000 claims description 2
- 150000001768 cations Chemical class 0.000 claims description 2
- 238000010586 diagram Methods 0.000 claims description 2
- 238000012545 processing Methods 0.000 claims description 2
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical group OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 claims description 2
- 150000004053 quinones Chemical class 0.000 claims description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 150000001555 benzenes Chemical class 0.000 claims 1
- 239000001045 blue dye Substances 0.000 claims 1
- 230000003111 delayed effect Effects 0.000 claims 1
- 238000006386 neutralization reaction Methods 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims 1
- 239000010410 layer Substances 0.000 description 152
- 239000000047 product Substances 0.000 description 87
- 108010010803 Gelatin Proteins 0.000 description 47
- 229920000159 gelatin Polymers 0.000 description 47
- 239000008273 gelatin Substances 0.000 description 47
- 235000019322 gelatine Nutrition 0.000 description 47
- 235000011852 gelatine desserts Nutrition 0.000 description 47
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 38
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 25
- 239000000126 substance Substances 0.000 description 25
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 24
- 239000002131 composite material Substances 0.000 description 23
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 21
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- 239000010949 copper Substances 0.000 description 21
- 239000007787 solid Substances 0.000 description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- 238000003756 stirring Methods 0.000 description 17
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 16
- 238000000034 method Methods 0.000 description 15
- 229920000728 polyester Polymers 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 229920001577 copolymer Polymers 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 238000011160 research Methods 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- 238000012360 testing method Methods 0.000 description 10
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 9
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 9
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 9
- 229920000642 polymer Polymers 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 8
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 8
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 8
- 238000010521 absorption reaction Methods 0.000 description 8
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 8
- 235000019441 ethanol Nutrition 0.000 description 8
- 239000012299 nitrogen atmosphere Substances 0.000 description 8
- 230000008569 process Effects 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 7
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 238000002845 discoloration Methods 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 239000006229 carbon black Substances 0.000 description 6
- 230000000295 complement effect Effects 0.000 description 6
- 239000006185 dispersion Substances 0.000 description 6
- 239000004816 latex Substances 0.000 description 6
- 229920000126 latex Polymers 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 238000002798 spectrophotometry method Methods 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 239000004408 titanium dioxide Substances 0.000 description 6
- 238000012546 transfer Methods 0.000 description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 5
- 235000011054 acetic acid Nutrition 0.000 description 5
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 5
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 5
- 235000011130 ammonium sulphate Nutrition 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 150000004696 coordination complex Chemical class 0.000 description 5
- 239000012954 diazonium Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- CSNNHWWHGAXBCP-UHFFFAOYSA-L magnesium sulphate Substances [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 230000003595 spectral effect Effects 0.000 description 5
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 4
- 229910019142 PO4 Inorganic materials 0.000 description 4
- 239000003086 colorant Substances 0.000 description 4
- 229940126086 compound 21 Drugs 0.000 description 4
- 229910000365 copper sulfate Inorganic materials 0.000 description 4
- 150000001989 diazonium salts Chemical class 0.000 description 4
- 238000009792 diffusion process Methods 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 239000003446 ligand Substances 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- 239000010452 phosphate Substances 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 4
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 230000003381 solubilizing effect Effects 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- OQNCPSHYLBEOGZ-UHFFFAOYSA-N 2,3-didodecylbenzene-1,4-diol Chemical compound CCCCCCCCCCCCC1=C(O)C=CC(O)=C1CCCCCCCCCCCC OQNCPSHYLBEOGZ-UHFFFAOYSA-N 0.000 description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- VQIKSXMEABWWFE-UHFFFAOYSA-N 4-[3-methyl-5-oxo-4-(pyridin-2-yldiazenyl)-4h-pyrazol-1-yl]benzenesulfonyl chloride Chemical compound CC1=NN(C=2C=CC(=CC=2)S(Cl)(=O)=O)C(=O)C1N=NC1=CC=CC=N1 VQIKSXMEABWWFE-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 229910006069 SO3H Inorganic materials 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 3
- BGNXCDMCOKJUMV-UHFFFAOYSA-N Tert-Butylhydroquinone Chemical compound CC(C)(C)C1=CC(O)=CC=C1O BGNXCDMCOKJUMV-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000007853 buffer solution Substances 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 229940125846 compound 25 Drugs 0.000 description 3
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000001046 green dye Substances 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 238000005286 illumination Methods 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- BMGNSKKZFQMGDH-FDGPNNRMSA-L nickel(2+);(z)-4-oxopent-2-en-2-olate Chemical compound [Ni+2].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O BMGNSKKZFQMGDH-FDGPNNRMSA-L 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 230000003071 parasitic effect Effects 0.000 description 3
- CMCWWLVWPDLCRM-UHFFFAOYSA-N phenidone Chemical compound N1C(=O)CCN1C1=CC=CC=C1 CMCWWLVWPDLCRM-UHFFFAOYSA-N 0.000 description 3
- 125000003226 pyrazolyl group Chemical group 0.000 description 3
- NWELCUKYUCBVKK-UHFFFAOYSA-N pyridin-2-ylhydrazine Chemical compound NNC1=CC=CC=N1 NWELCUKYUCBVKK-UHFFFAOYSA-N 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulphite Substances [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- 235000002906 tartaric acid Nutrition 0.000 description 3
- 239000011975 tartaric acid Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- 150000003852 triazoles Chemical group 0.000 description 3
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 2
- QFLWZFQWSBQYPS-AWRAUJHKSA-N (3S)-3-[[(2S)-2-[[(2S)-2-[5-[(3aS,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-[1-bis(4-chlorophenoxy)phosphorylbutylamino]-4-oxobutanoic acid Chemical compound CCCC(NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](NC(=O)CCCCC1SC[C@@H]2NC(=O)N[C@H]12)C(C)C)P(=O)(Oc1ccc(Cl)cc1)Oc1ccc(Cl)cc1 QFLWZFQWSBQYPS-AWRAUJHKSA-N 0.000 description 2
- KBKXDMHYXAJPPM-UHFFFAOYSA-N 2-[4-hydroxy-3-[(5-nitropyridin-2-yl)diazenyl]naphthalen-1-yl]oxypropanoic acid Chemical compound C(=O)(O)C(C)OC1=CC(=C(C2=CC=CC=C12)O)N=NC1=NC=C(C=C1)[N+](=O)[O-] KBKXDMHYXAJPPM-UHFFFAOYSA-N 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 2
- QBWKPGNFQQJGFY-QLFBSQMISA-N 3-[(1r)-1-[(2r,6s)-2,6-dimethylmorpholin-4-yl]ethyl]-n-[6-methyl-3-(1h-pyrazol-4-yl)imidazo[1,2-a]pyrazin-8-yl]-1,2-thiazol-5-amine Chemical compound N1([C@H](C)C2=NSC(NC=3C4=NC=C(N4C=C(C)N=3)C3=CNN=C3)=C2)C[C@H](C)O[C@H](C)C1 QBWKPGNFQQJGFY-QLFBSQMISA-N 0.000 description 2
- CPHGOBGXZQKCKI-UHFFFAOYSA-N 4,5-diphenyl-1h-imidazole Chemical compound N1C=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 CPHGOBGXZQKCKI-UHFFFAOYSA-N 0.000 description 2
- DSVIHYOAKPVFEH-UHFFFAOYSA-N 4-(hydroxymethyl)-4-methyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)(CO)CN1C1=CC=CC=C1 DSVIHYOAKPVFEH-UHFFFAOYSA-N 0.000 description 2
- LRUDIIUSNGCQKF-UHFFFAOYSA-N 5-methyl-1H-benzotriazole Chemical compound C1=C(C)C=CC2=NNN=C21 LRUDIIUSNGCQKF-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical group NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- VEQPNABPJHWNSG-UHFFFAOYSA-N Nickel(2+) Chemical compound [Ni+2] VEQPNABPJHWNSG-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- UUVZSUXVPFUSRB-UHFFFAOYSA-M benzyl-[3-(2,5-dioxopyrrol-1-yl)propyl]-dimethylazanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1C[N+](C)(C)CCCN1C(=O)C=CC1=O UUVZSUXVPFUSRB-UHFFFAOYSA-M 0.000 description 2
- 230000005540 biological transmission Effects 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 229940126208 compound 22 Drugs 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- ZPWVASYFFYYZEW-UHFFFAOYSA-L dipotassium hydrogen phosphate Chemical compound [K+].[K+].OP([O-])([O-])=O ZPWVASYFFYYZEW-UHFFFAOYSA-L 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 125000005647 linker group Chemical group 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 238000001465 metallisation Methods 0.000 description 2
- 238000013508 migration Methods 0.000 description 2
- 230000005012 migration Effects 0.000 description 2
- VVSVSDMTNHEMNF-UHFFFAOYSA-N n-(2-amino-4-nitrophenyl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C([N+]([O-])=O)C=C1N VVSVSDMTNHEMNF-UHFFFAOYSA-N 0.000 description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 2
- 229910001453 nickel ion Inorganic materials 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K potassium phosphate Substances [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000000979 retarding effect Effects 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 238000002791 soaking Methods 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000002562 thickening agent Substances 0.000 description 2
- CNHDIAIOKMXOLK-UHFFFAOYSA-N toluquinol Chemical compound CC1=CC(O)=CC=C1O CNHDIAIOKMXOLK-UHFFFAOYSA-N 0.000 description 2
- 238000003828 vacuum filtration Methods 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 1
- DDWAPSXNXHYQLK-UHFFFAOYSA-N (5-nitropyridin-2-yl)hydrazine Chemical compound NNC1=CC=C([N+]([O-])=O)C=N1 DDWAPSXNXHYQLK-UHFFFAOYSA-N 0.000 description 1
- KKFDJZZADQONDE-UHFFFAOYSA-N (hydridonitrato)hydroxidocarbon(.) Chemical compound O[C]=N KKFDJZZADQONDE-UHFFFAOYSA-N 0.000 description 1
- 229940105324 1,2-naphthoquinone Drugs 0.000 description 1
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 description 1
- KAMCBFNNGGVPPW-UHFFFAOYSA-N 1-(ethenylsulfonylmethoxymethylsulfonyl)ethene Chemical compound C=CS(=O)(=O)COCS(=O)(=O)C=C KAMCBFNNGGVPPW-UHFFFAOYSA-N 0.000 description 1
- TVOSAJHBWQYBKJ-UHFFFAOYSA-N 2-(3,4-dioxonaphthalen-1-yl)oxypropanoic acid Chemical compound C1=CC=C2C(OC(C)C(O)=O)=CC(=O)C(=O)C2=C1 TVOSAJHBWQYBKJ-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- MFSBBXLGJBDALP-UHFFFAOYSA-N 2-(4-hydroxynaphthalen-1-yl)oxypropanoic acid Chemical compound C1=CC=C2C(OC(C)C(O)=O)=CC=C(O)C2=C1 MFSBBXLGJBDALP-UHFFFAOYSA-N 0.000 description 1
- OQZGYMRYZAKXAF-UHFFFAOYSA-N 2-(4-methylcyclohexyl)acetic acid Chemical compound CC1CCC(CC(O)=O)CC1 OQZGYMRYZAKXAF-UHFFFAOYSA-N 0.000 description 1
- JHKKTXXMAQLGJB-UHFFFAOYSA-N 2-(methylamino)phenol Chemical compound CNC1=CC=CC=C1O JHKKTXXMAQLGJB-UHFFFAOYSA-N 0.000 description 1
- MXZROAOUCUVNHX-UHFFFAOYSA-N 2-Aminopropanol Chemical compound CCC(N)O MXZROAOUCUVNHX-UHFFFAOYSA-N 0.000 description 1
- FLEHGUNBLVPSOP-UHFFFAOYSA-N 2-amino-6-[(2-hydroxy-4-nitrophenyl)diazenyl]pyridin-3-ol Chemical compound C1=C(O)C(N)=NC(N=NC=2C(=CC(=CC=2)[N+]([O-])=O)O)=C1 FLEHGUNBLVPSOP-UHFFFAOYSA-N 0.000 description 1
- BMTSZVZQNMNPCT-UHFFFAOYSA-N 2-aminopyridin-3-ol Chemical compound NC1=NC=CC=C1O BMTSZVZQNMNPCT-UHFFFAOYSA-N 0.000 description 1
- BAZVFQBTJPBRTJ-UHFFFAOYSA-N 2-chloro-5-nitropyridine Chemical compound [O-][N+](=O)C1=CC=C(Cl)N=C1 BAZVFQBTJPBRTJ-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- MRIBCCHYZOSDOM-UHFFFAOYSA-N 3-(1-phenyltetrazol-5-yl)sulfanylpropanenitrile Chemical compound N#CCCSC1=NN=NN1C1=CC=CC=C1 MRIBCCHYZOSDOM-UHFFFAOYSA-N 0.000 description 1
- AKNQSSWETWGSFJ-UHFFFAOYSA-N 3-[(2-amino-4-nitrophenyl)-(methanesulfonamido)sulfamoyl]benzenesulfonyl fluoride Chemical compound C=1C=CC(S(F)(=O)=O)=CC=1S(=O)(=O)N(NS(=O)(=O)C)C1=CC=C([N+]([O-])=O)C=C1N AKNQSSWETWGSFJ-UHFFFAOYSA-N 0.000 description 1
- ZPGHDPUCQANFAD-UHFFFAOYSA-N 3-chlorosulfonylbenzenesulfonyl fluoride Chemical compound FS(=O)(=O)C1=CC=CC(S(Cl)(=O)=O)=C1 ZPGHDPUCQANFAD-UHFFFAOYSA-N 0.000 description 1
- ZYZOMPZZWUWKLH-UHFFFAOYSA-N 3-fluorosulfonylbenzoyl chloride Chemical compound FS(=O)(=O)C1=CC=CC(C(Cl)=O)=C1 ZYZOMPZZWUWKLH-UHFFFAOYSA-N 0.000 description 1
- WIHFUBJAJLFZKI-UHFFFAOYSA-N 4,4-dibromo-1h-pyrazol-5-one Chemical compound BrC1(Br)C=NNC1=O WIHFUBJAJLFZKI-UHFFFAOYSA-N 0.000 description 1
- XHVLAPJHAVJEBM-UHFFFAOYSA-N 4-(4,4-dibromo-3-methyl-5-oxopyrazol-1-yl)benzenesulfonic acid Chemical compound O=C1C(Br)(Br)C(C)=NN1C1=CC=C(S(O)(=O)=O)C=C1 XHVLAPJHAVJEBM-UHFFFAOYSA-N 0.000 description 1
- IIBHSFPKACYQBT-UHFFFAOYSA-N 4-benzoyloxy-3-(pyridin-2-yldiazenyl)naphthalene-1-sulfonic acid Chemical compound C=1C=CC=CC=1C(=O)OC=1C2=CC=CC=C2C(S(=O)(=O)O)=CC=1N=NC1=CC=CC=N1 IIBHSFPKACYQBT-UHFFFAOYSA-N 0.000 description 1
- QNGVNLMMEQUVQK-UHFFFAOYSA-N 4-n,4-n-diethylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C=C1 QNGVNLMMEQUVQK-UHFFFAOYSA-N 0.000 description 1
- RAUWPNXIALNKQM-UHFFFAOYSA-N 4-nitro-1,2-phenylenediamine Chemical compound NC1=CC=C([N+]([O-])=O)C=C1N RAUWPNXIALNKQM-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000331231 Amorphocerini gen. n. 1 DAD-2008 Species 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Chemical group CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 238000004566 IR spectroscopy Methods 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 229910006074 SO2NH2 Inorganic materials 0.000 description 1
- FOIXSVOLVBLSDH-UHFFFAOYSA-N Silver ion Chemical compound [Ag+] FOIXSVOLVBLSDH-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 125000000218 acetic acid group Chemical class C(C)(=O)* 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000001166 ammonium sulphate Substances 0.000 description 1
- 229960003116 amyl nitrite Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000012062 aqueous buffer Substances 0.000 description 1
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- KGNDCEVUMONOKF-UGPLYTSKSA-N benzyl n-[(2r)-1-[(2s,4r)-2-[[(2s)-6-amino-1-(1,3-benzoxazol-2-yl)-1,1-dihydroxyhexan-2-yl]carbamoyl]-4-[(4-methylphenyl)methoxy]pyrrolidin-1-yl]-1-oxo-4-phenylbutan-2-yl]carbamate Chemical compound C1=CC(C)=CC=C1CO[C@H]1CN(C(=O)[C@@H](CCC=2C=CC=CC=2)NC(=O)OCC=2C=CC=CC=2)[C@H](C(=O)N[C@@H](CCCCN)C(O)(O)C=2OC3=CC=CC=C3N=2)C1 KGNDCEVUMONOKF-UGPLYTSKSA-N 0.000 description 1
- BARQCCZSFFMSMT-UHFFFAOYSA-N benzyl-[3-(2,5-dioxopyrrol-1-yl)propyl]-dimethylazanium Chemical compound C=1C=CC=CC=1C[N+](C)(C)CCCN1C(=O)C=CC1=O BARQCCZSFFMSMT-UHFFFAOYSA-N 0.000 description 1
- ANPXZSRATHKOGI-UHFFFAOYSA-N benzyl-ethenyl-dimethylazanium Chemical compound C=C[N+](C)(C)CC1=CC=CC=C1 ANPXZSRATHKOGI-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 description 1
- 238000011284 combination treatment Methods 0.000 description 1
- 229940125797 compound 12 Drugs 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 229940125961 compound 24 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 229910001431 copper ion Inorganic materials 0.000 description 1
- JZCCFEFSEZPSOG-UHFFFAOYSA-L copper(II) sulfate pentahydrate Chemical compound O.O.O.O.O.[Cu+2].[O-]S([O-])(=O)=O JZCCFEFSEZPSOG-UHFFFAOYSA-L 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 1
- 229910000396 dipotassium phosphate Inorganic materials 0.000 description 1
- 235000019797 dipotassium phosphate Nutrition 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N hydroquinone methyl ether Natural products COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 229940057952 methanol Drugs 0.000 description 1
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 1
- 235000019796 monopotassium phosphate Nutrition 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- CSDTZUBPSYWZDX-UHFFFAOYSA-N n-pentyl nitrite Chemical compound CCCCCON=O CSDTZUBPSYWZDX-UHFFFAOYSA-N 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- AIYYMMQIMJOTBM-UHFFFAOYSA-L nickel(ii) acetate Chemical compound [Ni+2].CC([O-])=O.CC([O-])=O AIYYMMQIMJOTBM-UHFFFAOYSA-L 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000005022 packaging material Substances 0.000 description 1
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- HRGDZIGMBDGFTC-UHFFFAOYSA-N platinum(2+) Chemical compound [Pt+2] HRGDZIGMBDGFTC-UHFFFAOYSA-N 0.000 description 1
- 229920006267 polyester film Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- GNSKLFRGEWLPPA-UHFFFAOYSA-M potassium dihydrogen phosphate Chemical compound [K+].OP(O)([O-])=O GNSKLFRGEWLPPA-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000004672 propanoic acids Chemical class 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/02—Photosensitive materials characterised by the image-forming section
- G03C8/08—Photosensitive materials characterised by the image-forming section the substances transferred by diffusion consisting of organic compounds
- G03C8/10—Photosensitive materials characterised by the image-forming section the substances transferred by diffusion consisting of organic compounds of dyes or their precursors
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Plural Heterocyclic Compounds (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB37653/76A GB1585178A (en) | 1976-09-10 | 1976-09-10 | Photographic materials |
Publications (1)
Publication Number | Publication Date |
---|---|
CH624228A5 true CH624228A5 (xx) | 1981-07-15 |
Family
ID=10398016
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CH1108677A CH624228A5 (xx) | 1976-09-10 | 1977-09-09 |
Country Status (10)
Country | Link |
---|---|
US (2) | US4142891A (xx) |
JP (1) | JPS5335533A (xx) |
AU (1) | AU516154B2 (xx) |
BE (1) | BE858623A (xx) |
CA (1) | CA1082175A (xx) |
CH (1) | CH624228A5 (xx) |
DE (1) | DE2740719A1 (xx) |
FR (1) | FR2364492A1 (xx) |
GB (1) | GB1585178A (xx) |
NL (1) | NL168960C (xx) |
Families Citing this family (67)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4273853A (en) * | 1979-03-30 | 1981-06-16 | Eastman Kodak Company | Metal complexes of copolymers comprising vinylimidazole and their use in photographic elements |
US4195994A (en) * | 1977-08-05 | 1980-04-01 | Eastman Kodak Company | Photographic products and processes employing nondiffusible 6-arylazo-2-amino-3-pyridinol dye-releasing compounds and precursors thereof |
US4207104A (en) * | 1977-09-12 | 1980-06-10 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible heterocyclylazonaphthol dye-releasing compounds |
US4148643A (en) * | 1978-04-03 | 1979-04-10 | Eastman Kodak Company | Photographic products and processes employing nondiffusible azo dye-releasing compounds |
US4204993A (en) * | 1978-07-24 | 1980-05-27 | Eastman Kodak Company | Nondiffusible 6-arylazo-2-amino-3-pyridinol dye-releasing compounds |
US4239847A (en) * | 1978-09-21 | 1980-12-16 | Eastman Kodak Company | Photographic elements containing polymers which coordinate with metal ions |
US4299895A (en) * | 1978-09-21 | 1981-11-10 | Eastman Kodak Company | Photographic elements containing polymers which coordinate with metal ions |
JPS5559461A (en) * | 1978-10-30 | 1980-05-02 | Fuji Photo Film Co Ltd | Photographic material for color diffusion transfer method |
US4273706A (en) * | 1979-01-09 | 1981-06-16 | Eastman Kodak Company | Nondiffusible heterocyclylazonaphthol dye-releasing compounds |
US4282305A (en) * | 1979-01-15 | 1981-08-04 | Eastman Kodak Company | Receiving elements for image transfer film units |
US4228070A (en) * | 1979-02-28 | 1980-10-14 | Eastman Kodak Company | Purification of photographic image-forming sulfonamido compounds employing immiscible solvents |
US4248956A (en) * | 1979-03-02 | 1981-02-03 | Eastman Kodak Company | Photographic products and processes employing heterocyclic azo dye developer compounds |
JPS5945136B2 (ja) * | 1979-04-05 | 1984-11-05 | 富士写真フイルム株式会社 | カラ−拡散転写用写真感光シ−ト |
US4250238A (en) * | 1979-10-01 | 1981-02-10 | Eastman Kodak Company | Photographic products and processes employing novel dye developer compounds |
US4287292A (en) * | 1980-08-01 | 1981-09-01 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 6-arylazo-3-pyridinol magenta dye-releasing compounds and precursors thereof |
US4358404A (en) * | 1980-08-01 | 1982-11-09 | Eastman Kodak Company | Nondiffusible 6-arylazo-3-pyridinol |
CA1172629A (en) * | 1980-11-24 | 1984-08-14 | Joseph Bailey | Photographic products employing nondiffusible metal- complexed azo dye-releasing compounds and precursors thereof |
DE3115648A1 (de) * | 1981-04-18 | 1982-11-04 | Agfa-Gevaert Ag, 5090 Leverkusen | Farbfotografisches aufzeichnungsmaterial |
JPS57111534A (en) * | 1980-12-27 | 1982-07-12 | Konishiroku Photo Ind Co Ltd | Photographic sensitive element |
DE3107540A1 (de) * | 1981-02-27 | 1982-09-16 | Agfa-Gevaert Ag, 5090 Leverkusen | Farbfotografisches aufzeichnungsmaterial |
US4363865A (en) * | 1981-03-04 | 1982-12-14 | Eastman Kodak Company | Imido methyl blocked photographic dyes and dye releasing compounds |
US4385104A (en) * | 1981-04-29 | 1983-05-24 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 6-(2-thienylazo)-3-pyridinol cyan dye-releasing compounds and precursors thereof |
US4346161A (en) * | 1981-04-29 | 1982-08-24 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 6-(2-thienylazo)-3-pyridinol cyan dye-releasing compounds and precursors thereof |
US4396546A (en) * | 1981-04-29 | 1983-08-02 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 6-(2-thienylazo)-3-pyridinol cyan dye-releasing compounds and precursors thereof |
JPS57189138A (en) * | 1981-05-19 | 1982-11-20 | Fuji Photo Film Co Ltd | Photographic recording material containing novel coordinated polymer |
US4357411A (en) * | 1981-07-13 | 1982-11-02 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 2-(2-pyridylazo)-4,5-bis(tertiary amino)phenol black dye-releasing compounds and precursors thereof |
US4357410A (en) * | 1981-07-13 | 1982-11-02 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible pyridylazo(dialkylamino) phenol magenta dye-releasing compounds and precursors thereof |
US4368249A (en) * | 1981-07-13 | 1983-01-11 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible pyridylazo(dialkylamino)phenol magenta dye-releasing compounds and precursors thereof |
US4368153A (en) * | 1981-07-13 | 1983-01-11 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 2-(2-pyridylazo)-4,5-bis(tertiary amino)phenol black dye-releasing compounds and precursors thereof |
US4357412A (en) * | 1981-07-13 | 1982-11-02 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible bridged azoaminophenol magenta dye-releasing compounds and precursors thereof |
US4368154A (en) * | 1981-07-13 | 1983-01-11 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible bridged azoaminophenol magenta dye-releasing compounds and precursors thereof |
US4368248A (en) * | 1981-07-13 | 1983-01-11 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible 2-(2-pyridylazo)-4,5-bis(tertiary amino)phenol black dye-releasing compounds and precursors thereof |
US4366218A (en) * | 1981-07-13 | 1982-12-28 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible bridged azdaminophenol magenta dye-releasing compounds and precursors thereof |
US4367174A (en) * | 1981-07-13 | 1983-01-04 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible pyridylazo(dialkylamino)phenol magenta dye-releasing compounds and precursors thereof |
CA1247916A (en) * | 1981-09-02 | 1989-01-03 | Jasbir Sidhu | Method of forming a photographic image dye |
DE3200705A1 (de) * | 1982-01-13 | 1983-07-21 | Agfa-Gevaert Ag, 5090 Leverkusen | Farbfotografisches aufzeichnungsmaterial |
JPS58163938A (ja) * | 1982-03-24 | 1983-09-28 | Fuji Photo Film Co Ltd | カラ−拡散転写用写真要素 |
US4419435A (en) * | 1982-05-21 | 1983-12-06 | Eastman Kodak Company | Photographic products and processes employing 6-heterocyclylazo-3-pyridinol nondiffusible cyan dye-releasing compounds and precursors thereof |
US4495100A (en) * | 1982-05-21 | 1985-01-22 | Eastman Kodak Company | Non-diffusible cyan compound capable of releasing a 6-heterocyclylazo-3-pyridinol |
US4436799A (en) | 1982-05-21 | 1984-03-13 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible magenta dye-releasing compounds and precursors thereof |
US4476207A (en) * | 1982-05-21 | 1984-10-09 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible cyan dye-releasing compounds and precursors thereof |
US4420550A (en) * | 1982-05-21 | 1983-12-13 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible magenta dye-releasing compounds and precursors thereof |
US4495098A (en) * | 1982-05-21 | 1985-01-22 | Eastman Kodak Company | Coordination complexes of polyvalent metal ions and cyan dye-releasing compounds comprising a 6-heterocyclazo-3-pyridinol |
US4495099A (en) * | 1982-05-21 | 1985-01-22 | Eastman Kodak Company | Non-diffusible magenta compound capable of releasing a 4-(2-heterocyclazo)phenol having a heterocyclic ring fused thereto |
JPS5948765A (ja) * | 1982-09-13 | 1984-03-21 | Konishiroku Photo Ind Co Ltd | 熱現像カラ−拡散転写画像形成方法 |
DE3332991A1 (de) * | 1982-09-13 | 1984-03-15 | Konishiroku Photo Industry Co., Ltd., Tokyo | Verfahren zur bildung eines farbdiffusionsuebertragungsbildes durch warmentwickeln |
JPS59124337A (ja) * | 1982-12-30 | 1984-07-18 | Konishiroku Photo Ind Co Ltd | 熱現像カラ−拡散転写画像形成方法 |
JPS59164553A (ja) * | 1983-03-08 | 1984-09-17 | Fuji Photo Film Co Ltd | カラ−写真感光材料 |
DE3312500A1 (de) * | 1983-04-07 | 1984-10-11 | Agfa-Gevaert Ag, 5090 Leverkusen | Chelatisierbare azofarbstoffe, deren verwendung zur bilderzeugung und ein farbfotografisches aufzeichnungsmaterial mit farbabspaltern, die die chelatisierbaren farbstoffe freisetzten |
DE3322058A1 (de) * | 1983-06-18 | 1984-12-20 | Agfa-Gevaert Ag, 5090 Leverkusen | Mit metallionen chelatisierbare oder chelatisierte monoazofarbstoffe, deren verwendung zur bilderzeugung, ein farbfotografisches aufzeichnungsmaterial mit farbabspaltern, die die farbstoffe freisetzen, und ein farbbild mit einer bildmaessigen verteilung von nickelkomplexen der farbstoffe |
EP0141920B1 (de) * | 1983-08-18 | 1987-06-24 | Agfa-Gevaert AG | Farbfotografisches Aufzeichnungsmaterial mit Farbabspaltern, die mit Metallionen chelatisierbare 6-Arylazo-2-amino-3-pyridinolfarbstoffe freisetzen, und ein Farbbild mit einer bildmässigen Verteilung von Nickelkomplexen der Farbstoffe |
DE3424899A1 (de) * | 1984-07-06 | 1986-02-06 | Agfa-Gevaert Ag, 5090 Leverkusen | Farbfotografisches aufzeichnungsmaterial |
US4559291A (en) * | 1984-12-28 | 1985-12-17 | Eastman Kodak Company | Ligands for metallizable dyes |
US4680356A (en) * | 1985-01-02 | 1987-07-14 | Eastman Kodak Company | Colorless ligand-releasing monomers and polymers and their use to provide dyes with metal ions |
US4555478A (en) * | 1985-01-02 | 1985-11-26 | Eastman Kodak Company | Photographic element and process for providing metal complex color images |
US4555477A (en) * | 1985-01-02 | 1985-11-26 | Eastman Kodak Company | Photographic element and process utilizing metal complex color masking dyes |
US4557998A (en) * | 1985-01-02 | 1985-12-10 | Eastman Kodak Company | Colorless ligand-releasing monomers and polymers and their use to provide dyes with metal ions |
JPS61170578U (xx) * | 1985-04-15 | 1986-10-22 | ||
JPS61250636A (ja) | 1985-04-30 | 1986-11-07 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
JPS61273542A (ja) * | 1985-05-30 | 1986-12-03 | Fuji Photo Film Co Ltd | カラ−感光材料 |
JPH083621B2 (ja) | 1985-07-31 | 1996-01-17 | 富士写真フイルム株式会社 | 画像形成方法 |
JPS62252483A (ja) * | 1986-04-24 | 1987-11-04 | Fuji Photo Film Co Ltd | 記録液 |
JP2597908B2 (ja) | 1989-04-25 | 1997-04-09 | 富士写真フイルム株式会社 | ハロゲン化銀カラー写真感光材料 |
US5717725A (en) * | 1992-03-12 | 1998-02-10 | Ntp Incorporated | System for wireless transmission and receiving of information through a computer bus interface and method of operation |
US6272190B1 (en) | 1992-03-12 | 2001-08-07 | Ntp Incorporated | System for wireless transmission and receiving of information and method of operation thereof |
US5745532A (en) * | 1992-03-12 | 1998-04-28 | Ntp Incorporated | System for wireless transmission and receiving of information and method of operation thereof |
GB0314368D0 (en) * | 2003-06-20 | 2003-07-23 | Avecia Ltd | Composition, use and process |
Family Cites Families (20)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US2348417A (en) * | 1941-05-21 | 1944-05-09 | Research Corp | Arsanilic acid azo sulphonamide compound |
US2495244A (en) * | 1944-10-06 | 1950-01-24 | Ciba Ltd | Ester-like derivatives of azo dyestuffs |
FR1124882A (fr) | 1954-05-25 | 1956-10-19 | Bayer Ag | Colorants o, o'-dihydroxyazoïques, leurs composés complexes métalliques et leur procédé de production |
US2830042A (en) * | 1955-01-18 | 1958-04-08 | Bayer Ag | Monoazo dyestuffs |
BE571946A (xx) * | 1957-10-11 | |||
FR1200358A (fr) | 1958-04-24 | 1959-12-21 | Cfmc | Nouveaux colorants azoïques métallisables et métallifères; application à la teinture |
US2983608A (en) * | 1958-10-06 | 1961-05-09 | Eastman Kodak Co | Yellow-colored magenta-forming couplers |
NL247649A (xx) * | 1959-01-26 | |||
NL252552A (xx) | 1959-06-12 | |||
US3097196A (en) * | 1959-11-12 | 1963-07-09 | Eastman Kodak Co | Ni complexes of monoazo compounds prepared from a benzothiazole compound and an alphanaphthol compound |
US3453107A (en) * | 1965-09-13 | 1969-07-01 | Polaroid Corp | Novel photographic products,processes and compositions |
US3563739A (en) * | 1965-09-13 | 1971-02-16 | Polaroid Corp | Novel products,processes and compositions comprising metal-complexed dye developers |
US3751406A (en) * | 1967-07-24 | 1973-08-07 | Polaroid Corp | Azo compounds useful in photographic processes |
US3929760A (en) * | 1973-02-12 | 1975-12-30 | Eastman Kodak Co | Cyan image-providing phenylazonaphthyl dyes |
US3931144A (en) * | 1973-02-12 | 1976-01-06 | Eastman Kodak Company | Magenta image-providing phenylazonaphthyl dyes |
US3980479A (en) * | 1974-10-02 | 1976-09-14 | Eastman Kodak Company | Positive-working immobile photographic compounds which cleave by intramolecular nucleophilic displacement in alkali unless oxidized |
US4013635A (en) * | 1975-02-26 | 1977-03-22 | Eastman Kodak Company | Cyan azo dye-providing compounds |
DE2608052C2 (de) * | 1976-02-27 | 1982-12-30 | Vereinigte Glaswerke Gmbh, 5100 Aachen | Flüssigkeitspumpe für das schmelzflüssige Metall einer Floatglasanlage |
US4148641A (en) * | 1977-09-12 | 1979-04-10 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible pyridylazopyrazole or pyrimidylazopyrazole dye-releasing compounds |
US4147544A (en) * | 1977-09-12 | 1979-04-03 | Eastman Kodak Company | Photographic products and processes employing novel nondiffusible pyridylazonaphthol dye-releasing compounds |
-
1976
- 1976-09-10 GB GB37653/76A patent/GB1585178A/en not_active Expired
-
1977
- 1977-08-05 US US05/822,188 patent/US4142891A/en not_active Expired - Lifetime
- 1977-08-18 CA CA284,981A patent/CA1082175A/en not_active Expired
- 1977-09-09 NL NLAANVRAGE7709926,A patent/NL168960C/xx not_active IP Right Cessation
- 1977-09-09 DE DE19772740719 patent/DE2740719A1/de not_active Withdrawn
- 1977-09-09 CH CH1108677A patent/CH624228A5/fr not_active IP Right Cessation
- 1977-09-10 JP JP10838677A patent/JPS5335533A/ja active Granted
- 1977-09-12 FR FR7727422A patent/FR2364492A1/fr active Granted
- 1977-09-12 BE BE180846A patent/BE858623A/xx not_active IP Right Cessation
- 1977-09-12 AU AU28709/77A patent/AU516154B2/en not_active Expired
-
1979
- 1979-03-23 US US06/023,430 patent/US4272434A/en not_active Expired - Lifetime
Also Published As
Publication number | Publication date |
---|---|
US4272434A (en) | 1981-06-09 |
CA1082175A (en) | 1980-07-22 |
FR2364492A1 (fr) | 1978-04-07 |
US4142891A (en) | 1979-03-06 |
JPS5335533A (en) | 1978-04-03 |
DE2740719A1 (de) | 1978-03-16 |
NL168960B (nl) | 1981-12-16 |
BE858623A (fr) | 1978-03-13 |
JPS6131861B2 (xx) | 1986-07-23 |
NL7709926A (nl) | 1978-03-14 |
NL168960C (nl) | 1982-05-17 |
GB1585178A (en) | 1981-02-25 |
FR2364492B1 (xx) | 1983-03-18 |
AU2870977A (en) | 1979-03-22 |
AU516154B2 (en) | 1981-05-21 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
CH624228A5 (xx) | ||
CH628745A5 (fr) | Produit photographique contenant des composes lestes accepteurs d'electrons, aptes a subir un deplacement nucleophile. | |
JPH0727192B2 (ja) | 写真要素 | |
JPS6314345B2 (xx) | ||
EP0045633B1 (en) | Photographic elements employing nondiffusible 6-arylazo-3-pyridinol magenta dye-releasing compounds and precursors thereof | |
US4204870A (en) | Photographic products and processes employing novel nondiffusible heterocyclyazonaphthol dye-releasing compounds | |
DE2607440C2 (de) | Photographisches Aufzeichnungsmaterial für das Farbdiffusionsübertragungsverfahren | |
US4499181A (en) | Photographic recording material with indole redox releaser | |
US4207104A (en) | Photographic products and processes employing novel nondiffusible heterocyclylazonaphthol dye-releasing compounds | |
US4148643A (en) | Photographic products and processes employing nondiffusible azo dye-releasing compounds | |
DE2626821A1 (de) | Farbphotographisches aufzeichnungsmaterial | |
US4147544A (en) | Photographic products and processes employing novel nondiffusible pyridylazonaphthol dye-releasing compounds | |
US4273706A (en) | Nondiffusible heterocyclylazonaphthol dye-releasing compounds | |
US4149892A (en) | Color diffusion transfer photographic elements | |
US4195994A (en) | Photographic products and processes employing nondiffusible 6-arylazo-2-amino-3-pyridinol dye-releasing compounds and precursors thereof | |
US4269924A (en) | Photographic material suited for the production of multicolor images by means of diffusion transfer of complexed silver halide | |
CH634933A5 (fr) | Produit photographique contenant des composes liberant des groupes actifs par oxydo-reduction. | |
JPS6175346A (ja) | 染料拡散転写法において使用するための有機化合物およびそれを混入した写真材料 | |
US4183755A (en) | Photographic products and processes employing metal complexable nondiffusible azo dye-releasing compounds | |
US4461827A (en) | Color photographic recording material containing a non-diffusible dye releaser from which a complexible azo dye is released during development | |
US4368260A (en) | Photographic light sensitive element | |
US4204993A (en) | Nondiffusible 6-arylazo-2-amino-3-pyridinol dye-releasing compounds | |
US4148641A (en) | Photographic products and processes employing novel nondiffusible pyridylazopyrazole or pyrimidylazopyrazole dye-releasing compounds | |
US4418143A (en) | Color photographic recording material | |
JPS6330617B2 (xx) |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
PL | Patent ceased | ||
PL | Patent ceased |