CH624009A5 - - Google Patents
Download PDFInfo
- Publication number
- CH624009A5 CH624009A5 CH46576A CH46576A CH624009A5 CH 624009 A5 CH624009 A5 CH 624009A5 CH 46576 A CH46576 A CH 46576A CH 46576 A CH46576 A CH 46576A CH 624009 A5 CH624009 A5 CH 624009A5
- Authority
- CH
- Switzerland
- Prior art keywords
- preparation according
- cationic
- amount
- agent
- weight
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 claims description 43
- -1 anionic phosphate esters Chemical class 0.000 claims description 37
- 239000000203 mixture Substances 0.000 claims description 21
- 125000002091 cationic group Chemical group 0.000 claims description 19
- 239000003242 anti bacterial agent Substances 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 239000003795 chemical substances by application Substances 0.000 claims description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- 230000000844 anti-bacterial effect Effects 0.000 claims description 11
- 229910019142 PO4 Inorganic materials 0.000 claims description 7
- 239000010452 phosphate Substances 0.000 claims description 7
- 239000004094 surface-active agent Substances 0.000 claims description 7
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- 229960001950 benzethonium chloride Drugs 0.000 claims description 5
- UREZNYTWGJKWBI-UHFFFAOYSA-M benzethonium chloride Chemical compound [Cl-].C1=CC(C(C)(C)CC(C)(C)C)=CC=C1OCCOCC[N+](C)(C)CC1=CC=CC=C1 UREZNYTWGJKWBI-UHFFFAOYSA-M 0.000 claims description 5
- 150000005690 diesters Chemical class 0.000 claims description 5
- 238000005187 foaming Methods 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 150000003856 quaternary ammonium compounds Chemical class 0.000 claims description 3
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 claims description 2
- 241000194019 Streptococcus mutans Species 0.000 claims description 2
- 150000001409 amidines Chemical group 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- 125000000129 anionic group Chemical group 0.000 claims description 2
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 240000001046 Lactobacillus acidophilus Species 0.000 claims 1
- 235000013956 Lactobacillus acidophilus Nutrition 0.000 claims 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 claims 1
- 241000191967 Staphylococcus aureus Species 0.000 claims 1
- 150000001450 anions Chemical class 0.000 claims 1
- 229940039695 lactobacillus acidophilus Drugs 0.000 claims 1
- 244000005700 microbiome Species 0.000 claims 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 claims 1
- ZBJVLWIYKOAYQH-UHFFFAOYSA-N naphthalen-2-yl 2-hydroxybenzoate Chemical compound OC1=CC=CC=C1C(=O)OC1=CC=C(C=CC=C2)C2=C1 ZBJVLWIYKOAYQH-UHFFFAOYSA-N 0.000 description 22
- 239000000551 dentifrice Substances 0.000 description 19
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 17
- 150000001875 compounds Chemical class 0.000 description 17
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 9
- 239000000796 flavoring agent Substances 0.000 description 9
- 235000019634 flavors Nutrition 0.000 description 9
- 239000000499 gel Substances 0.000 description 9
- 235000011187 glycerol Nutrition 0.000 description 8
- 238000005498 polishing Methods 0.000 description 8
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 6
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 6
- 239000002324 mouth wash Substances 0.000 description 6
- 229940051866 mouthwash Drugs 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 150000004684 trihydrates Chemical class 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 4
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- SNKKBYWIYDOXGC-IYEMJOQQSA-N hexane;(2r,3s,4r,5r)-2,3,4,5,6-pentahydroxyhexanoic acid Chemical compound CCCCCC.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O SNKKBYWIYDOXGC-IYEMJOQQSA-N 0.000 description 4
- 239000000600 sorbitol Substances 0.000 description 4
- 239000000606 toothpaste Substances 0.000 description 4
- 229940034610 toothpaste Drugs 0.000 description 4
- XGRSAFKZAGGXJV-UHFFFAOYSA-N 3-azaniumyl-3-cyclohexylpropanoate Chemical compound OC(=O)CC(N)C1CCCCC1 XGRSAFKZAGGXJV-UHFFFAOYSA-N 0.000 description 3
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 229960002798 cetrimide Drugs 0.000 description 3
- 229940091249 fluoride supplement Drugs 0.000 description 3
- 235000003599 food sweetener Nutrition 0.000 description 3
- 239000003349 gelling agent Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 239000006072 paste Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229960004711 sodium monofluorophosphate Drugs 0.000 description 3
- 239000003765 sweetening agent Substances 0.000 description 3
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- GHXZTYHSJHQHIJ-UHFFFAOYSA-N Chlorhexidine Chemical compound C=1C=C(Cl)C=CC=1NC(N)=NC(N)=NCCCCCCN=C(N)N=C(N)NC1=CC=C(Cl)C=C1 GHXZTYHSJHQHIJ-UHFFFAOYSA-N 0.000 description 2
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 229960003260 chlorhexidine Drugs 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 239000003906 humectant Substances 0.000 description 2
- GVALZJMUIHGIMD-UHFFFAOYSA-H magnesium phosphate Chemical compound [Mg+2].[Mg+2].[Mg+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O GVALZJMUIHGIMD-UHFFFAOYSA-H 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- YUOWTJMRMWQJDA-UHFFFAOYSA-J tin(iv) fluoride Chemical compound [F-].[F-].[F-].[F-].[Sn+4] YUOWTJMRMWQJDA-UHFFFAOYSA-J 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- BHHYHSUAOQUXJK-UHFFFAOYSA-L zinc fluoride Chemical compound F[Zn]F BHHYHSUAOQUXJK-UHFFFAOYSA-L 0.000 description 2
- OWEGMIWEEQEYGQ-UHFFFAOYSA-N 100676-05-9 Natural products OC1C(O)C(O)C(CO)OC1OCC1C(O)C(O)C(O)C(OC2C(OC(O)C(O)C2O)CO)O1 OWEGMIWEEQEYGQ-UHFFFAOYSA-N 0.000 description 1
- HTYFFCPFVMJTKM-UHFFFAOYSA-N 2-(4-chlorophenyl)-1-(diaminomethylidene)guanidine Chemical compound NC(N)=NC(N)=NC1=CC=C(Cl)C=C1 HTYFFCPFVMJTKM-UHFFFAOYSA-N 0.000 description 1
- WLAMNBDJUVNPJU-UHFFFAOYSA-N 2-methylbutyric acid Chemical compound CCC(C)C(O)=O WLAMNBDJUVNPJU-UHFFFAOYSA-N 0.000 description 1
- UBLAMKHIFZBBSS-UHFFFAOYSA-N 3-Methylbutyl pentanoate Chemical compound CCCCC(=O)OCCC(C)C UBLAMKHIFZBBSS-UHFFFAOYSA-N 0.000 description 1
- DDFHBQSCUXNBSA-UHFFFAOYSA-N 5-(5-carboxythiophen-2-yl)thiophene-2-carboxylic acid Chemical compound S1C(C(=O)O)=CC=C1C1=CC=C(C(O)=O)S1 DDFHBQSCUXNBSA-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical compound OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 241000206575 Chondrus crispus Species 0.000 description 1
- 229910021594 Copper(II) fluoride Inorganic materials 0.000 description 1
- UDIPTWFVPPPURJ-UHFFFAOYSA-M Cyclamate Chemical compound [Na+].[O-]S(=O)(=O)NC1CCCCC1 UDIPTWFVPPPURJ-UHFFFAOYSA-M 0.000 description 1
- 239000005696 Diammonium phosphate Substances 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 235000019501 Lemon oil Nutrition 0.000 description 1
- GUBGYTABKSRVRQ-PICCSMPSSA-N Maltose Natural products O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-PICCSMPSSA-N 0.000 description 1
- 244000024873 Mentha crispa Species 0.000 description 1
- 235000014749 Mentha crispa Nutrition 0.000 description 1
- MXRIRQGCELJRSN-UHFFFAOYSA-N O.O.O.[Al] Chemical compound O.O.O.[Al] MXRIRQGCELJRSN-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 235000011203 Origanum Nutrition 0.000 description 1
- 240000000783 Origanum majorana Species 0.000 description 1
- 229910003873 O—P—O Inorganic materials 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- HVUMOYIDDBPOLL-XWVZOOPGSA-N Sorbitan monostearate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O HVUMOYIDDBPOLL-XWVZOOPGSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- HFIGWKOFZLNOQK-UHFFFAOYSA-K [O-]P([O-])(=O)OP(=O)([O-])O.[Ca+2].[Na+] Chemical class [O-]P([O-])(=O)OP(=O)([O-])O.[Ca+2].[Na+] HFIGWKOFZLNOQK-UHFFFAOYSA-K 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 229910001515 alkali metal fluoride Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 229940027983 antiseptic and disinfectant quaternary ammonium compound Drugs 0.000 description 1
- 229960003093 antiseptics and disinfectants Drugs 0.000 description 1
- OYLGJCQECKOTOL-UHFFFAOYSA-L barium fluoride Chemical compound [F-].[F-].[Ba+2] OYLGJCQECKOTOL-UHFFFAOYSA-L 0.000 description 1
- 229910001632 barium fluoride Inorganic materials 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 229960000686 benzalkonium chloride Drugs 0.000 description 1
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QUYVBRFLSA-N beta-maltose Chemical compound OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O GUBGYTABKSRVRQ-QUYVBRFLSA-N 0.000 description 1
- 150000004287 bisbiguanides Chemical class 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- JUNWLZAGQLJVLR-UHFFFAOYSA-J calcium diphosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])(=O)OP([O-])([O-])=O JUNWLZAGQLJVLR-UHFFFAOYSA-J 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229940043256 calcium pyrophosphate Drugs 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- ATNHDLDRLWWWCB-AENOIHSZSA-M chlorophyll a Chemical class C1([C@@H](C(=O)OC)C(=O)C2=C3C)=C2N2C3=CC(C(CC)=C3C)=[N+]4C3=CC3=C(C=C)C(C)=C5N3[Mg-2]42[N+]2=C1[C@@H](CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C)C2=C5 ATNHDLDRLWWWCB-AENOIHSZSA-M 0.000 description 1
- 239000010630 cinnamon oil Substances 0.000 description 1
- 239000010634 clove oil Substances 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- GWFAVIIMQDUCRA-UHFFFAOYSA-L copper(ii) fluoride Chemical compound [F-].[F-].[Cu+2] GWFAVIIMQDUCRA-UHFFFAOYSA-L 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 229910002026 crystalline silica Inorganic materials 0.000 description 1
- 229910021488 crystalline silicon dioxide Inorganic materials 0.000 description 1
- 239000000625 cyclamic acid and its Na and Ca salt Substances 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- 229910000388 diammonium phosphate Inorganic materials 0.000 description 1
- 235000019838 diammonium phosphate Nutrition 0.000 description 1
- 235000019821 dicalcium diphosphate Nutrition 0.000 description 1
- DGTVXEHQMSJRPE-UHFFFAOYSA-N difluorophosphinic acid Chemical compound OP(F)(F)=O DGTVXEHQMSJRPE-UHFFFAOYSA-N 0.000 description 1
- 239000010642 eucalyptus oil Substances 0.000 description 1
- 229940044949 eucalyptus oil Drugs 0.000 description 1
- 238000005189 flocculation Methods 0.000 description 1
- 230000016615 flocculation Effects 0.000 description 1
- 150000004673 fluoride salts Chemical class 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000002357 guanidines Chemical class 0.000 description 1
- 229910001385 heavy metal Chemical class 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 229910001506 inorganic fluoride Inorganic materials 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000010501 lemon oil Substances 0.000 description 1
- 229910000400 magnesium phosphate tribasic Inorganic materials 0.000 description 1
- 239000001525 mentha piperita l. herb oil Substances 0.000 description 1
- 229960001047 methyl salicylate Drugs 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 235000019477 peppermint oil Nutrition 0.000 description 1
- 229920001983 poloxamer Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- ZMRUPTIKESYGQW-UHFFFAOYSA-N propranolol hydrochloride Chemical compound [H+].[Cl-].C1=CC=C2C(OCC(O)CNC(C)C)=CC=CC2=C1 ZMRUPTIKESYGQW-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 229940081974 saccharin Drugs 0.000 description 1
- 235000019204 saccharin Nutrition 0.000 description 1
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 1
- 239000010670 sage oil Substances 0.000 description 1
- 239000010672 sassafras oil Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229960001462 sodium cyclamate Drugs 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 239000001587 sorbitan monostearate Substances 0.000 description 1
- 235000011076 sorbitan monostearate Nutrition 0.000 description 1
- 229940035048 sorbitan monostearate Drugs 0.000 description 1
- ANOBYBYXJXCGBS-UHFFFAOYSA-L stannous fluoride Chemical compound F[Sn]F ANOBYBYXJXCGBS-UHFFFAOYSA-L 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- 239000009637 wintergreen oil Substances 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/55—Phosphorus compounds
- A61K8/556—Derivatives containing from 2 to 10 oxyalkylene groups
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/40—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing nitrogen
- A61K8/41—Amines
- A61K8/416—Quaternary ammonium compounds
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q11/00—Preparations for care of the teeth, of the oral cavity or of dentures; Dentifrices, e.g. toothpastes; Mouth rinses
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Oral & Maxillofacial Surgery (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB179775A GB1475251A (en) | 1975-01-15 | 1975-01-15 | Oral preparations |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH624009A5 true CH624009A5 (enExample) | 1981-07-15 |
Family
ID=9728184
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH46576A CH624009A5 (enExample) | 1975-01-15 | 1976-01-15 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4036950A (enExample) |
| AU (1) | AU502488B2 (enExample) |
| BE (1) | BE837579A (enExample) |
| CA (1) | CA1047929A (enExample) |
| CH (1) | CH624009A5 (enExample) |
| DE (1) | DE2600708C2 (enExample) |
| DK (1) | DK137785B (enExample) |
| FR (1) | FR2357253A1 (enExample) |
| GB (1) | GB1475251A (enExample) |
| IT (1) | IT1052935B (enExample) |
| SE (1) | SE418053B (enExample) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5927323B2 (ja) * | 1976-10-12 | 1984-07-05 | 花王株式会社 | 歯みがき組成物 |
| US4118471A (en) * | 1977-06-09 | 1978-10-03 | Colgate-Palmolive Company | Stable dentifrice |
| JPS6019723B2 (ja) * | 1978-01-27 | 1985-05-17 | 而至歯科工業株式会社 | 歯科用組成物 |
| GB1594878A (en) * | 1978-05-19 | 1981-08-05 | Colgate Palmolive Co | Dentifrices |
| GB1599689A (en) * | 1978-05-25 | 1981-10-07 | Colgate Palmolive Co | Dental cream composition |
| DK219779A (da) * | 1978-05-31 | 1979-12-01 | Nicholas Pty Ltd | Anti-caries praeparater |
| US4304766A (en) * | 1979-04-02 | 1981-12-08 | Minnesota Mining And Manufacturing Company | Compositions for reducing elution of therapeutic agents from teeth |
| USRE31787E (en) * | 1979-04-02 | 1985-01-01 | Minnesota Mining And Manufacturing Company | Compositions for reducing elution of therapeutic agents from teeth |
| US4264580A (en) * | 1979-04-23 | 1981-04-28 | Barberio Giacinto G | Dental cream composition |
| US4301143A (en) * | 1979-12-17 | 1981-11-17 | Colgate-Palmolive Company | Dental cream composition |
| AU555948B2 (en) * | 1980-08-19 | 1986-10-16 | Colgate-Palmolive Pty. Ltd. | Stable dentifrice |
| GB2084463B (en) * | 1980-09-24 | 1984-05-31 | Colgate Palmolive Co | Dentifrices |
| GB2098063B (en) * | 1981-05-08 | 1984-12-12 | Colgate Palmolive Co | Dentifrice composition containing anionic phosphate esters |
| US4323552A (en) * | 1981-05-11 | 1982-04-06 | Basf Wyandotte Corporation | High foaming dentifrice compositions |
| US4526778A (en) * | 1981-11-19 | 1985-07-02 | Colgate-Palmolive Company | Stable dentifrice containing neutral siliceouse polishing agent |
| GB2109683B (en) * | 1981-11-19 | 1985-09-11 | Colgate Palmolive Co | Stable dentifrice |
| GB2109682B (en) * | 1981-11-19 | 1985-09-11 | Colgate Palmolive Co | Stable dentifrice |
| US4448766A (en) * | 1982-04-29 | 1984-05-15 | Colgate-Palmolive Company | Dentifrice composition |
| US4528182A (en) * | 1983-07-13 | 1985-07-09 | Colgate-Palmolive Company | Stable antiplaque dentifrice with improved foaming |
| US4490353A (en) * | 1983-07-13 | 1984-12-25 | Colgate-Palmolive Company | Antiplaque dentifrice with improved fluoride stability |
| IN161843B (enExample) * | 1983-07-13 | 1988-02-13 | Colgate Palmolive Co | |
| WO1987003476A1 (en) * | 1985-12-13 | 1987-06-18 | Micro-Map, Inc. | Composition for the treatment of periodontal disease |
| GB8828018D0 (en) * | 1988-12-01 | 1989-01-05 | Unilever Plc | Topical composition |
| US5374418A (en) * | 1992-02-13 | 1994-12-20 | Kao Corporation | Composition for use in oral cavity |
| US5370865A (en) | 1992-05-15 | 1994-12-06 | Kao Corporation | Composition for use in oral cavity |
| CN1104196C (zh) * | 1995-12-08 | 2003-04-02 | 花王株式会社 | 杀菌组合物 |
| US5827503A (en) * | 1996-08-08 | 1998-10-27 | Collagenex Pharmaceuticals, Inc. | Method and composition for treating periodontitis |
| FR2777459A1 (fr) * | 1998-04-20 | 1999-10-22 | Francois Darne | Pate dentifrice concentree |
| JP3523107B2 (ja) * | 1999-03-17 | 2004-04-26 | 株式会社東芝 | Cmp用スラリおよびcmp法 |
| US9139731B2 (en) | 1999-11-12 | 2015-09-22 | The Procter & Gamble Company | Compositions and methods for improving overall tooth health and appearance |
| KR20050105230A (ko) | 2003-02-21 | 2005-11-03 | 로디아 인코포레이티드 | 항-민감성, 항-충치, 항-착색, 항-플라크의 매우 순한 구강위생제 |
| CA2690744A1 (en) * | 2007-06-12 | 2008-12-24 | Rhodia, Inc. | Mono-, di- and polyol alkoxylate phosphate esters in oral care formulations and methods for using same |
| AU2010292276B2 (en) * | 2009-09-11 | 2014-07-17 | The Procter & Gamble Company | Methods and compositions for hydrophobic modification of oral cavity surfaces |
| KR101764516B1 (ko) * | 2013-03-13 | 2017-08-02 | 파나소닉 아이피 매니지먼트 가부시키가이샤 | 구리 복합 산화티탄 분산액, 코팅제 조성물 및 항균·항바이러스성 부재 |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB719445A (en) * | 1951-12-22 | 1954-12-01 | Gen Aniline & Film Corp | Branched chain alcohol derivatives |
| GB825577A (en) * | 1957-01-22 | 1959-12-16 | Internat Chemical Company Ltd | Improvements in or relating to dentifrices |
| US3060098A (en) * | 1957-11-18 | 1962-10-23 | Lever Brothers Ltd | Dentifrice |
| GB1277585A (en) * | 1968-10-29 | 1972-06-14 | Unilever Ltd | Toothpastes |
| GB1277586A (en) * | 1968-10-29 | 1972-06-14 | Unilever Ltd | Toothpastes |
| US3956478A (en) * | 1968-12-20 | 1976-05-11 | Colgate-Palmolive Company | Dentifrice composition |
| US3670076A (en) * | 1970-03-31 | 1972-06-13 | Indiana University Foundation | Dental prophylaxis composition comprising alumina of particular particle size |
| US3937805A (en) * | 1971-11-10 | 1976-02-10 | Colgate-Palmolive Company | Method of making dentifrice compositions containing insolubilized salts of 1,6-di-(p-chlorophenyl biguanido) hexane |
| US3842168A (en) * | 1971-03-22 | 1974-10-15 | Colgate Palmolive Co | Method of preparing stable dentifrice |
| US3843779A (en) * | 1971-03-22 | 1974-10-22 | Colgate Palmolive Co | Process for preparing stable dentifrice |
| JPS4837824A (enExample) * | 1971-09-20 | 1973-06-04 | ||
| LU65735A1 (enExample) * | 1972-07-17 | 1974-01-28 | ||
| GB1424034A (en) * | 1973-01-29 | 1976-02-04 | Colgate Palmolive Co | Dentifrices |
| US3957968A (en) * | 1973-08-20 | 1976-05-18 | Colgate-Palmolive Company | Dentifrices containing flat flakes of alpha-alumina |
| US3925543A (en) * | 1973-11-01 | 1975-12-09 | Colgate Palmolive Co | Antibacterial oral compositions containing preservative-antioxidants |
| US3887701A (en) * | 1974-11-01 | 1975-06-03 | Colgate Palmolive Co | Antibacterial oral compositions containing preservative-antioxidants |
-
1975
- 1975-01-15 GB GB179775A patent/GB1475251A/en not_active Expired
- 1975-12-30 SE SE7514748A patent/SE418053B/xx not_active IP Right Cessation
- 1975-12-31 AU AU87993/75A patent/AU502488B2/en not_active Expired
- 1975-12-31 US US05/645,744 patent/US4036950A/en not_active Expired - Lifetime
-
1976
- 1976-01-09 DE DE2600708A patent/DE2600708C2/de not_active Expired
- 1976-01-12 FR FR7600544A patent/FR2357253A1/fr active Granted
- 1976-01-14 DK DK14476AA patent/DK137785B/da unknown
- 1976-01-14 CA CA243,515A patent/CA1047929A/en not_active Expired
- 1976-01-14 IT IT47629/76A patent/IT1052935B/it active
- 1976-01-15 CH CH46576A patent/CH624009A5/de not_active IP Right Cessation
- 1976-01-15 BE BE163521A patent/BE837579A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1475251A (en) | 1977-06-01 |
| FR2357253A1 (fr) | 1978-02-03 |
| DK14476A (enExample) | 1976-07-16 |
| DE2600708C2 (de) | 1985-03-14 |
| SE7514748L (sv) | 1976-07-16 |
| DK137785C (enExample) | 1978-10-16 |
| CA1047929A (en) | 1979-02-06 |
| FR2357253B1 (enExample) | 1981-12-04 |
| IT1052935B (it) | 1981-08-31 |
| DK137785B (da) | 1978-05-08 |
| BE837579A (fr) | 1976-05-03 |
| AU8799375A (en) | 1977-07-07 |
| AU502488B2 (en) | 1979-07-26 |
| DE2600708A1 (de) | 1976-07-22 |
| US4036950A (en) | 1977-07-19 |
| SE418053B (sv) | 1981-05-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH624009A5 (enExample) | ||
| CH620360A5 (enExample) | ||
| DE3221503A1 (de) | Zahnpflegemittel mit doppelter wirkung | |
| DE3017417A1 (de) | Antibakterielle zusammensetzung fuer die mundhygiene | |
| CH649214A5 (de) | Oral anwendbare zusammensetzung fuer die foerderung der mundhygiene. | |
| CH645536A5 (de) | Gegen zahnfleischentzuendungen wirkendes mundpflegemittel. | |
| DE3533492A1 (de) | Zahnbelag verhinderndes zahnpflegemittel | |
| CH649000A5 (de) | Zahnpflegemittel. | |
| DE3151910A1 (de) | Gegen zahnfleischentzuendung wirksames copolymer, dessen herstellung und diese enthaltendes mittel | |
| DE60005307T2 (de) | Zusammensetzung zur behandlung von hypersensitiven zähnen enthaltend zinnfluorid | |
| CH653886A5 (de) | Zahnpflegemittel. | |
| DE3046770C2 (enExample) | ||
| DE3874071T2 (de) | Zahnsteinverhindernde zusammensetzung. | |
| DE3241653A1 (de) | Stabile zahnpasta mit einem gehalt an einem neutralen kieselsaeurepoliermittel | |
| DE3046442A1 (de) | "zahnpastenzusammensetzung" | |
| CH641040A5 (de) | Zahnpasten. | |
| DE2146224B2 (de) | Zahnpflegemittel | |
| CH651204A5 (de) | Mittel zur foerderung der mundhygiene. | |
| DE2755847A1 (de) | Antibakterielles mundpflegemittel | |
| DE2402273C2 (de) | Zahnreinigungsmittel | |
| DE3531337A1 (de) | Stabiles zahnbelag verhinderndes zahnpflegemittel und verfahren zur herstellung desselben | |
| DE2842182A1 (de) | Mundpflegemittel | |
| AT390190B (de) | Zahncreme | |
| DE3239976A1 (de) | Gegen zahnstein wirkendes mundpflegemittel | |
| DE2158149A1 (de) | Zahnreinigungsmittel mit einem Gehalt an l,6-Di-(p-chlorphenyl-biguagiido)hexan |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |