CH621539A5 - - Google Patents
Download PDFInfo
- Publication number
- CH621539A5 CH621539A5 CH1570276A CH1570276A CH621539A5 CH 621539 A5 CH621539 A5 CH 621539A5 CH 1570276 A CH1570276 A CH 1570276A CH 1570276 A CH1570276 A CH 1570276A CH 621539 A5 CH621539 A5 CH 621539A5
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- compound
- mol
- cation
- anhydride
- Prior art date
Links
- -1 alkali metal cation Chemical class 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 17
- 150000003022 phthalic acids Chemical class 0.000 claims description 9
- 238000002360 preparation method Methods 0.000 claims description 9
- LGRFSURHDFAFJT-UHFFFAOYSA-N phthalic anhydride Chemical class C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 125000006323 alkenyl amino group Chemical group 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 241000251730 Chondrichthyes Species 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 claims description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000011575 calcium Substances 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 229940096405 magnesium cation Drugs 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 29
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 150000008064 anhydrides Chemical class 0.000 description 21
- 229910052757 nitrogen Inorganic materials 0.000 description 20
- 229920000647 polyepoxide Polymers 0.000 description 13
- 239000003822 epoxy resin Substances 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- 239000004593 Epoxy Substances 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 239000002253 acid Substances 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 8
- 229920005989 resin Polymers 0.000 description 8
- 239000011347 resin Substances 0.000 description 8
- 238000005266 casting Methods 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 6
- 238000000465 moulding Methods 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 5
- 125000003700 epoxy group Chemical group 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 150000003949 imides Chemical class 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 3
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 229920000768 polyamine Polymers 0.000 description 3
- 229920001187 thermosetting polymer Polymers 0.000 description 3
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- FKNQFGJONOIPTF-UHFFFAOYSA-N Sodium cation Chemical compound [Na+] FKNQFGJONOIPTF-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- 238000007906 compression Methods 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- YWURKJICYCFAHG-UHFFFAOYSA-L disodium;3-aminophthalate Chemical compound [Na+].[Na+].NC1=CC=CC(C([O-])=O)=C1C([O-])=O YWURKJICYCFAHG-UHFFFAOYSA-L 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 239000004848 polyfunctional curative Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- LIPAXKCLWGVWAG-UHFFFAOYSA-N 2,2-diethylbutanoyl 2,2-diethylbutanoate Chemical compound CCC(CC)(CC)C(=O)OC(=O)C(CC)(CC)CC LIPAXKCLWGVWAG-UHFFFAOYSA-N 0.000 description 1
- OHXAOPZTJOUYKM-UHFFFAOYSA-N 3-Chloro-2-methylpropene Chemical compound CC(=C)CCl OHXAOPZTJOUYKM-UHFFFAOYSA-N 0.000 description 1
- WGLQHUKCXBXUDV-UHFFFAOYSA-N 3-aminophthalic acid Chemical compound NC1=CC=CC(C(O)=O)=C1C(O)=O WGLQHUKCXBXUDV-UHFFFAOYSA-N 0.000 description 1
- ATVJXMYDOSMEPO-UHFFFAOYSA-N 3-prop-2-enoxyprop-1-ene Chemical compound C=CCOCC=C ATVJXMYDOSMEPO-UHFFFAOYSA-N 0.000 description 1
- DQNFPCOVVBRXOY-UHFFFAOYSA-N 4-amino-2-benzofuran-1,3-dione Chemical compound NC1=CC=CC2=C1C(=O)OC2=O DQNFPCOVVBRXOY-UHFFFAOYSA-N 0.000 description 1
- OXSANYRLJHSQEP-UHFFFAOYSA-N 4-aminophthalic acid Chemical compound NC1=CC=C(C(O)=O)C(C(O)=O)=C1 OXSANYRLJHSQEP-UHFFFAOYSA-N 0.000 description 1
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- YOUGRGFIHBUKRS-UHFFFAOYSA-N benzyl(trimethyl)azanium Chemical compound C[N+](C)(C)CC1=CC=CC=C1 YOUGRGFIHBUKRS-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 1
- ABBZJHFBQXYTLU-UHFFFAOYSA-N but-3-enamide Chemical compound NC(=O)CC=C ABBZJHFBQXYTLU-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 description 1
- SDCVQQPDEJTRAS-UHFFFAOYSA-L disodium;4-aminophthalate Chemical compound [Na+].[Na+].NC1=CC=C(C([O-])=O)C(C([O-])=O)=C1 SDCVQQPDEJTRAS-UHFFFAOYSA-L 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000004870 electrical engineering Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000003063 flame retardant Substances 0.000 description 1
- 238000009408 flooring Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 238000010030 laminating Methods 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- GNVRJGIVDSQCOP-UHFFFAOYSA-N n-ethyl-n-methylethanamine Chemical compound CCN(C)CC GNVRJGIVDSQCOP-UHFFFAOYSA-N 0.000 description 1
- 230000008520 organization Effects 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 239000012744 reinforcing agent Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 238000012719 thermal polymerization Methods 0.000 description 1
- 239000013008 thixotropic agent Substances 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical compound CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 description 1
- NRTLTGGGUQIRRT-UHFFFAOYSA-N triethylazanium;bromide Chemical compound [Br-].CC[NH+](CC)CC NRTLTGGGUQIRRT-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- GRPURDFRFHUDSP-UHFFFAOYSA-N tris(prop-2-enyl) benzene-1,2,4-tricarboxylate Chemical compound C=CCOC(=O)C1=CC=C(C(=O)OCC=C)C(C(=O)OCC=C)=C1 GRPURDFRFHUDSP-UHFFFAOYSA-N 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/87—Benzo [c] furans; Hydrogenated benzo [c] furans
- C07D307/89—Benzo [c] furans; Hydrogenated benzo [c] furans with two oxygen atoms directly attached in positions 1 and 3
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/40—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the curing agents used
- C08G59/50—Amines
- C08G59/52—Amino carboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Epoxy Resins (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
- Pyrrole Compounds (AREA)
- Paints Or Removers (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1570276A CH621539A5 (cs) | 1976-12-14 | 1976-12-14 | |
| US05/857,163 US4140703A (en) | 1976-12-14 | 1977-12-05 | Phthalic acid derivatives substituted by alkenylamino groups |
| DE19772755359 DE2755359A1 (de) | 1976-12-14 | 1977-12-12 | Durch alkenylaminogruppen substituierte phthalsaeurederivate |
| CA292,845A CA1080724A (en) | 1976-12-14 | 1977-12-12 | Phthalic acid derivatives substituted by alkenylamino groups |
| GB51873/77A GB1563577A (en) | 1976-12-14 | 1977-12-13 | Phthalic acid derivatives substituted by alkenylamino groups |
| FR7737659A FR2374296A1 (fr) | 1976-12-14 | 1977-12-14 | Derives de l'acide phtalique porteurs de groupes alcenylamino |
| JP15039877A JPS5373535A (en) | 1976-12-14 | 1977-12-14 | Phthalic acid derivative * method of its preparation and hardening mixture containing said compound |
| JP61083212A JPS61281122A (ja) | 1976-12-14 | 1986-04-10 | アルケニルアミノ基によつて置換された無水フタル酸を硬化剤として含むエポキシド樹脂硬化性混合物 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1570276A CH621539A5 (cs) | 1976-12-14 | 1976-12-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH621539A5 true CH621539A5 (cs) | 1981-02-13 |
Family
ID=4411213
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1570276A CH621539A5 (cs) | 1976-12-14 | 1976-12-14 |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4140703A (cs) |
| JP (2) | JPS5373535A (cs) |
| CA (1) | CA1080724A (cs) |
| CH (1) | CH621539A5 (cs) |
| DE (1) | DE2755359A1 (cs) |
| FR (1) | FR2374296A1 (cs) |
| GB (1) | GB1563577A (cs) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH632765A5 (de) * | 1977-09-09 | 1982-10-29 | Ciba Geigy Ag | Verfahren zur herstellung von siliciummodifizierten phthalsaeurederivaten. |
| US4435497A (en) | 1981-06-19 | 1984-03-06 | Ciba-Geigy Corporation | Carboxyl-containing compositions and their polymerization |
| CH656126A5 (de) * | 1983-08-18 | 1986-06-13 | Ciba Geigy Ag | Durch 2-propynyloxygruppen substituierte phthalsaeureanhydride. |
| US4948449A (en) * | 1986-05-07 | 1990-08-14 | Minnesota Mining And Manufacturing Company | Epoxy resin composition |
| US4772645A (en) * | 1986-05-07 | 1988-09-20 | Minnesota Mining And Manufacturing Company | Epoxy resin composition |
| WO2010059683A2 (en) * | 2008-11-20 | 2010-05-27 | Henkel Corporation | Curing agents for epoxy resins |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1049297A (fr) * | 1950-04-29 | 1953-12-29 | Ncr Co | Procédé de fabrication de composés d'anhydride 4-dialkylaminophtalique |
| US2597965A (en) * | 1950-04-29 | 1952-05-27 | Ncr Co | 4-dialkylaminophthalic anhydride |
| USRE29316E (en) | 1967-07-13 | 1977-07-19 | Rhone-Poulenc S.A. | Cross-linked resins |
| FR1555564A (fr) * | 1967-07-13 | 1969-01-31 | Rhone Poulenc Sa | Nouvelles résines thermostables dérivées de bis-imides d'acides dicarboxyliques non saturés |
| FR2094607A5 (cs) * | 1970-06-26 | 1972-02-04 | Rhone Poulenc Sa | |
| US3836571A (en) * | 1970-08-17 | 1974-09-17 | Nat Starch Chem Corp | Ethylenically unsaturated derivatives of 4-aminobenzoic acid |
| US4078142A (en) * | 1976-06-28 | 1978-03-07 | Standard Oil Company | Amino substituted-4-t-butylphthalic acid esters |
-
1976
- 1976-12-14 CH CH1570276A patent/CH621539A5/de not_active IP Right Cessation
-
1977
- 1977-12-05 US US05/857,163 patent/US4140703A/en not_active Expired - Lifetime
- 1977-12-12 CA CA292,845A patent/CA1080724A/en not_active Expired
- 1977-12-12 DE DE19772755359 patent/DE2755359A1/de active Granted
- 1977-12-13 GB GB51873/77A patent/GB1563577A/en not_active Expired
- 1977-12-14 FR FR7737659A patent/FR2374296A1/fr active Granted
- 1977-12-14 JP JP15039877A patent/JPS5373535A/ja active Granted
-
1986
- 1986-04-10 JP JP61083212A patent/JPS61281122A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6141341B2 (cs) | 1986-09-13 |
| JPS6215569B2 (cs) | 1987-04-08 |
| DE2755359C2 (cs) | 1987-06-19 |
| JPS5373535A (en) | 1978-06-30 |
| GB1563577A (en) | 1980-03-26 |
| DE2755359A1 (de) | 1978-06-15 |
| FR2374296A1 (fr) | 1978-07-13 |
| FR2374296B1 (cs) | 1980-05-16 |
| CA1080724A (en) | 1980-07-01 |
| US4140703A (en) | 1979-02-20 |
| JPS61281122A (ja) | 1986-12-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2754631C2 (de) | Heißhärtbare Imidharze | |
| DE3788891T2 (de) | Arylcyclobuten enthaltende Zusammenstellungen und polymerische Zusammenstellungen, die daraus hergestellt werden. | |
| EP0200674B1 (de) | (Acylthiopropyl)-Polyphenole | |
| EP0166693B1 (de) | Substituierte ungesättigte, hydroxylgruppenhaltige bicyclische Imide und deren Polymere | |
| DE2626767A1 (de) | Imidyl-benzoldi- und -tricarbonsaeure-derivate | |
| DE2838842C2 (cs) | ||
| DE2537306A1 (de) | Aromatische dithiodianhydride | |
| DE2459673A1 (de) | Imidyl- bzw. isoimidylphthalsaeureanhydride, verfahren zu deren herstellung sowie deren verwendung zum haerten von epoxidharzen | |
| DE69015864T4 (de) | Sulfoniumverbindungen und die Sulfoniumverbindungen als Hauptbestandteil enthaltende Polymerisierungsinitiatoren. | |
| CH621539A5 (cs) | ||
| DE3246267A1 (de) | Amingruppenhaltige carbonsaeureamide und ihre verwendung als haerter fuer epoxidharze | |
| DE2154624A1 (de) | Neue diglycidylderivate von zwei nheterocyclische ringe enthaltenen verbindungen, verfahren zu ihrer herstellung und anwendung | |
| EP0231149B1 (de) | Mercaptan enthaltende Polyphenole | |
| EP0157740A2 (de) | Glycidyloxydiketone | |
| DE1942836A1 (de) | Neue Diglycidylester von aliphatischen Dicarbonsaeuren,Verfahren zu ihrer Herstellung und ihrer Anwendung | |
| EP0011599B1 (de) | Substituierte 1,11-Diaminoundecane, Verfahren zu deren Herstellung und ihre Verwendung | |
| DE69425288T2 (de) | Katalysatore auf Basis von bizyclischen Amidinen und ihre Verwendung in heisshärtbaren Zusammensetzungen | |
| EP0300329B1 (de) | Bismaleinimid-Harze | |
| DE2147899A1 (de) | Neue Polyglycidylverbindungen, Verfahren zu ihrer Herstellung und Anwendung | |
| DE2155161A1 (de) | Härtbare Zusammensetzungen | |
| EP0226544B1 (de) | Allyl-bicyclo[2.2.1]hept-5-en-2-carbonsäure(derivate) | |
| DE2306403C3 (de) | Verfahren zur Herstellung von imidgruppenhaltigen Diglycidylestern | |
| CH624391A5 (cs) | ||
| DE1645182C (de) | Verfahren zur Herstellung stick stofThaltiger Epoxypolyaddukte | |
| EP0041048B1 (de) | Gemische zur Herstellung von stickstoffhaltigen Polyaddukten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |