CH616343A5 - - Google Patents
Download PDFInfo
- Publication number
- CH616343A5 CH616343A5 CH751377A CH751377A CH616343A5 CH 616343 A5 CH616343 A5 CH 616343A5 CH 751377 A CH751377 A CH 751377A CH 751377 A CH751377 A CH 751377A CH 616343 A5 CH616343 A5 CH 616343A5
- Authority
- CH
- Switzerland
- Prior art keywords
- pedal
- ski
- holding arm
- bearing
- brake
- Prior art date
Links
- 229910000639 Spring steel Inorganic materials 0.000 claims description 8
- 239000000463 material Substances 0.000 claims description 6
- 230000027455 binding Effects 0.000 description 4
- 238000009739 binding Methods 0.000 description 4
- 230000006978 adaptation Effects 0.000 description 3
- 238000013459 approach Methods 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GHYOCDFICYLMRF-UTIIJYGPSA-N (2S,3R)-N-[(2S)-3-(cyclopenten-1-yl)-1-[(2R)-2-methyloxiran-2-yl]-1-oxopropan-2-yl]-3-hydroxy-3-(4-methoxyphenyl)-2-[[(2S)-2-[(2-morpholin-4-ylacetyl)amino]propanoyl]amino]propanamide Chemical compound C1(=CCCC1)C[C@@H](C(=O)[C@@]1(OC1)C)NC([C@H]([C@@H](C1=CC=C(C=C1)OC)O)NC([C@H](C)NC(CN1CCOCC1)=O)=O)=O GHYOCDFICYLMRF-UTIIJYGPSA-N 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- 229940125797 compound 12 Drugs 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63C—SKATES; SKIS; ROLLER SKATES; DESIGN OR LAYOUT OF COURTS, RINKS OR THE LIKE
- A63C7/00—Devices preventing skis from slipping back; Ski-stoppers or ski-brakes
- A63C7/10—Hinged stoppage blades attachable to the skis in such manner that these blades can be moved out of the operative position
- A63C7/1006—Ski-stoppers
- A63C7/1013—Ski-stoppers actuated by the boot
- A63C7/1033—Ski-stoppers actuated by the boot articulated about at least two transverse axes
- A63C7/104—Ski-stoppers actuated by the boot articulated about at least two transverse axes laterally retractable above the ski surface
Landscapes
- Braking Arrangements (AREA)
- Braking Elements And Transmission Devices (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT468876A AT351985B (de) | 1975-03-07 | 1975-03-07 | Fangeinrichtung fuer skier |
| AT503376A AT358970B (de) | 1975-03-07 | 1976-07-09 | Fangeinrichtung fuer skier |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH616343A5 true CH616343A5 (enExample) | 1980-03-31 |
Family
ID=25601418
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH751377A CH616343A5 (enExample) | 1975-03-07 | 1977-06-20 |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4108466A (enExample) |
| JP (1) | JPS532132A (enExample) |
| CH (1) | CH616343A5 (enExample) |
| FR (1) | FR2355531A1 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS53127039A (en) * | 1977-04-11 | 1978-11-06 | Hope Kk | Ski antiskid |
| US4206499A (en) * | 1977-08-11 | 1980-06-03 | Dominion Auto Accessories Limited | Vehicle marker lamp |
| FR2451754A1 (fr) * | 1979-03-20 | 1980-10-17 | Look Sa | Frein a ski |
| AT368018B (de) * | 1979-10-25 | 1982-08-25 | Tyrolia Freizeitgeraete | Skibremse |
| AT378483B (de) * | 1980-12-12 | 1985-08-12 | Amf Sport Freizeitgeraete | Skibremse |
| DE3110743A1 (de) * | 1981-03-19 | 1982-10-07 | Hannes Marker Sicherheits-Skibindungen GmbH & Co KG, 8100 Garmisch-Partenkirchen | Skistopper |
| DE3145646A1 (de) * | 1981-11-17 | 1983-05-26 | Marker Patentverwertungsgesellschaft mbH, 6340 Baar | Skistopper |
| DE4027712A1 (de) * | 1990-08-31 | 1992-03-05 | Look Sa | Skibremse |
| AT410757B (de) * | 1993-12-10 | 2003-07-25 | Tyrolia Freizeitgeraete | Skibremse |
| AT500306B1 (de) * | 2003-08-06 | 2008-09-15 | Atomic Austria Gmbh | Bremsvorrichtung für einen schi |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH591263A5 (enExample) * | 1974-03-15 | 1977-09-15 | Salomon & Fils F | |
| AT341398B (de) * | 1975-03-07 | 1978-02-10 | Smolka & Co Wiener Metall | Fangeinrichtung fur skier |
| AT367307B (de) * | 1976-09-16 | 1982-06-25 | Tyrolia Freizeitgeraete | Skibremse |
| JPS53127039A (en) * | 1977-04-11 | 1978-11-06 | Hope Kk | Ski antiskid |
-
1977
- 1977-06-20 CH CH751377A patent/CH616343A5/de not_active IP Right Cessation
- 1977-06-23 FR FR7719326A patent/FR2355531A1/fr active Granted
- 1977-06-23 US US05/809,192 patent/US4108466A/en not_active Expired - Lifetime
- 1977-06-24 JP JP7538577A patent/JPS532132A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| FR2355531B1 (enExample) | 1982-03-19 |
| JPS532132A (en) | 1978-01-10 |
| US4108466A (en) | 1978-08-22 |
| FR2355531A1 (fr) | 1978-01-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0199098B1 (de) | Tourenskibindung | |
| DE2502956A1 (de) | Ski-sicherheitsbindung und stiefel fuer dieselbe | |
| DE2756897A1 (de) | Sicherheitsskibindung | |
| DE2610041B2 (enExample) | ||
| DE2402974A1 (de) | Kombination aus skistiefel und skibindung | |
| DE3124993A1 (de) | Backen fuer sicherheitsskibindungen | |
| CH615349A5 (en) | Ski brake | |
| CH616343A5 (enExample) | ||
| DE3876554T2 (de) | Schischuh mit fersenhalterung. | |
| DE2923281A1 (de) | Sohlenauflageeinrichtung fuer skibindungen | |
| DE2448769C2 (de) | Haltevorrichtung für Sicherheitsskibindungen | |
| DE1703054A1 (de) | Sicherheits-Skibindung | |
| DE1018762B (de) | Sicherheitsstrammer fuer Skibindungen | |
| EP0080060B1 (de) | Fersenniederhalter | |
| EP0176952A1 (de) | Skibindung-Skischuh-Kombination | |
| DE1965496C3 (de) | Spannhebelverschluß für Schuhwerk, insbesondere Skistiefel | |
| EP0272317B1 (de) | Sicherheitsskibindung | |
| AT355476B (de) | Skibremse | |
| DE3107035A1 (de) | Fersenstrammer fuer sicherheits-skibindungen | |
| DE2658999A1 (de) | Ausloeseskibindung | |
| DE3821097A1 (de) | Vorderbacken fuer die befestigung eines schuhs auf einem ski | |
| AT363026B (de) | Skibremse | |
| DE2714447A1 (de) | Skibremse | |
| EP0083749B1 (de) | Sicherheitsskibindung | |
| DE3043988A1 (de) | Sohlen- bzw. fersenhalter fuer skibindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |