CH615676A5 - Process for the preparation of novel 1-(beta-aryl)-ethyl-1H-1,2,4-triazol ketals and salts thereof and their use in fungicides - Google Patents
Process for the preparation of novel 1-(beta-aryl)-ethyl-1H-1,2,4-triazol ketals and salts thereof and their use in fungicides Download PDFInfo
- Publication number
- CH615676A5 CH615676A5 CH1496275A CH1496275A CH615676A5 CH 615676 A5 CH615676 A5 CH 615676A5 CH 1496275 A CH1496275 A CH 1496275A CH 1496275 A CH1496275 A CH 1496275A CH 615676 A5 CH615676 A5 CH 615676A5
- Authority
- CH
- Switzerland
- Prior art keywords
- parts
- triazole
- dioxolan
- ylmethyl
- acid
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title claims description 21
- 238000000034 method Methods 0.000 title claims description 13
- 238000002360 preparation method Methods 0.000 title claims description 6
- 239000000417 fungicide Substances 0.000 title claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 49
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 claims description 24
- -1 halogenothienyl Chemical group 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000001544 thienyl group Chemical group 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 60
- 239000000203 mixture Substances 0.000 description 46
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 32
- 241000196324 Embryophyta Species 0.000 description 29
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 27
- 239000000243 solution Substances 0.000 description 25
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 17
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 16
- 238000003756 stirring Methods 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 239000002585 base Substances 0.000 description 15
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 15
- 241000233866 Fungi Species 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 229910002651 NO3 Inorganic materials 0.000 description 12
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 12
- 239000000460 chlorine Substances 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 9
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000004480 active ingredient Substances 0.000 description 9
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 125000005997 bromomethyl group Chemical group 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 239000003480 eluent Substances 0.000 description 7
- XKTYXVDYIKIYJP-UHFFFAOYSA-N 3h-dioxole Chemical compound C1OOC=C1 XKTYXVDYIKIYJP-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 229960001701 chloroform Drugs 0.000 description 6
- 229940125890 compound Ia Drugs 0.000 description 6
- 239000000284 extract Substances 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 230000000069 prophylactic effect Effects 0.000 description 5
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Inorganic materials [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 5
- 150000003852 triazoles Chemical group 0.000 description 5
- 241001480061 Blumeria graminis Species 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 240000008067 Cucumis sativus Species 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 240000005979 Hordeum vulgare Species 0.000 description 4
- 206010061217 Infestation Diseases 0.000 description 4
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 241000896246 Golovinomyces cichoracearum Species 0.000 description 3
- 241000896218 Golovinomyces orontii Species 0.000 description 3
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 3
- 241000896242 Podosphaera Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 230000002538 fungal effect Effects 0.000 description 3
- 230000000855 fungicidal effect Effects 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- 208000015181 infectious disease Diseases 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229940042055 systemic antimycotics triazole derivative Drugs 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 235000005254 Allium ampeloprasum Nutrition 0.000 description 2
- 240000006108 Allium ampeloprasum Species 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 235000009849 Cucumis sativus Nutrition 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- 235000007340 Hordeum vulgare Nutrition 0.000 description 2
- 244000141359 Malus pumila Species 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- 244000061456 Solanum tuberosum Species 0.000 description 2
- 235000002595 Solanum tuberosum Nutrition 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 241000057804 Thielaviopsis sp. Species 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 230000001680 brushing effect Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 150000004862 dioxolanes Chemical group 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 150000002790 naphthalenes Chemical class 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 230000008635 plant growth Effects 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N thiocyanic acid Chemical compound SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 2
- IWYDHOAUDWTVEP-ZETCQYMHSA-N (S)-mandelic acid Chemical compound OC(=O)[C@@H](O)C1=CC=CC=C1 IWYDHOAUDWTVEP-ZETCQYMHSA-N 0.000 description 1
- AWKIVNPHONAAFP-UHFFFAOYSA-N 1-[[2-(2,4-dichlorophenyl)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole Chemical compound O1C(C)C(C)OC1(C=1C(=CC(Cl)=CC=1)Cl)CN1N=CN=C1 AWKIVNPHONAAFP-UHFFFAOYSA-N 0.000 description 1
- KWXXMTITEFYZJX-UHFFFAOYSA-N 1-[[2-(2,6-dichlorophenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole Chemical compound ClC1=CC=CC(Cl)=C1C1(CN2N=CN=C2)OCCO1 KWXXMTITEFYZJX-UHFFFAOYSA-N 0.000 description 1
- WWVJYEALAXQWNY-UHFFFAOYSA-N 1-[[2-(2-chlorophenyl)-4-methyl-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole Chemical compound O1C(C)COC1(C=1C(=CC=CC=1)Cl)CN1N=CN=C1 WWVJYEALAXQWNY-UHFFFAOYSA-N 0.000 description 1
- OTESLOVDNPLKHH-UHFFFAOYSA-N 1-[[2-(3-bromo-4-methylphenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole Chemical compound C1=C(Br)C(C)=CC=C1C1(CN2N=CN=C2)OCCO1 OTESLOVDNPLKHH-UHFFFAOYSA-N 0.000 description 1
- XRZNSGVOZBKWIE-UHFFFAOYSA-N 1-[[2-(3-bromophenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole Chemical compound BrC1=CC=CC(C2(CN3N=CN=C3)OCCO2)=C1 XRZNSGVOZBKWIE-UHFFFAOYSA-N 0.000 description 1
- HAGTYIJQUJCOKV-UHFFFAOYSA-N 1-[[2-(4-bromo-2-methylphenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole Chemical compound CC1=CC(Br)=CC=C1C1(CN2N=CN=C2)OCCO1 HAGTYIJQUJCOKV-UHFFFAOYSA-N 0.000 description 1
- INXAXLYXGDBVCK-UHFFFAOYSA-N 1-[[2-(4-bromophenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole Chemical compound C1=CC(Br)=CC=C1C1(CN2N=CN=C2)OCCO1 INXAXLYXGDBVCK-UHFFFAOYSA-N 0.000 description 1
- KPQBEDVJCNRGRP-UHFFFAOYSA-N 1-[[2-(4-chloro-2-methylphenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole Chemical compound ClC1=CC(=C(C=C1)C1(OCCO1)CN1N=CN=C1)C KPQBEDVJCNRGRP-UHFFFAOYSA-N 0.000 description 1
- NUZINIGQSQSUNE-UHFFFAOYSA-N 1-[[2-(4-chlorophenyl)-4,5-dimethyl-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole Chemical compound O1C(C)C(C)OC1(C=1C=CC(Cl)=CC=1)CN1N=CN=C1 NUZINIGQSQSUNE-UHFFFAOYSA-N 0.000 description 1
- VIQSSHZVJSXEIS-UHFFFAOYSA-N 1-[[2-(4-chlorophenyl)-4-methyl-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole Chemical compound O1C(C)COC1(C=1C=CC(Cl)=CC=1)CN1N=CN=C1 VIQSSHZVJSXEIS-UHFFFAOYSA-N 0.000 description 1
- LCIDVKSWYIZLDI-UHFFFAOYSA-N 1-[[2-(4-methoxyphenyl)-4-methyl-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole Chemical compound C1=CC(OC)=CC=C1C1(CN2N=CN=C2)OC(C)CO1 LCIDVKSWYIZLDI-UHFFFAOYSA-N 0.000 description 1
- IIVXPONYAWYYGS-UHFFFAOYSA-N 1-[[2-(4-methylphenyl)-1,3-dioxan-2-yl]methyl]-1,2,4-triazole Chemical compound C1=CC(C)=CC=C1C1(CN2N=CN=C2)OCCCO1 IIVXPONYAWYYGS-UHFFFAOYSA-N 0.000 description 1
- PWUWDKSOLFJLJH-UHFFFAOYSA-N 1-[[2-(4-nitrophenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1C1(CN2N=CN=C2)OCCO1 PWUWDKSOLFJLJH-UHFFFAOYSA-N 0.000 description 1
- IJMUKNNEMKMARC-UHFFFAOYSA-N 1-[[2-(9h-fluoren-2-yl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole Chemical compound O1CCOC1(C=1C=C2C(C3=CC=CC=C3C2)=CC=1)CN1C=NC=N1 IJMUKNNEMKMARC-UHFFFAOYSA-N 0.000 description 1
- JWOWMEJELPEECK-UHFFFAOYSA-N 1-[[4-methyl-2-(4-methylphenyl)-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole Chemical compound O1C(C)COC1(C=1C=CC(C)=CC=1)CN1N=CN=C1 JWOWMEJELPEECK-UHFFFAOYSA-N 0.000 description 1
- WLXGQMVCYPUOLM-UHFFFAOYSA-N 1-hydroxyethanesulfonic acid Chemical compound CC(O)S(O)(=O)=O WLXGQMVCYPUOLM-UHFFFAOYSA-N 0.000 description 1
- PFSSVZKNVAXVRA-UHFFFAOYSA-N 2-(bromomethyl)-2-(2,3,4-trichlorophenyl)-1,3-dioxolane Chemical compound ClC1=C(Cl)C(Cl)=CC=C1C1(CBr)OCCO1 PFSSVZKNVAXVRA-UHFFFAOYSA-N 0.000 description 1
- KXUZOBLKRVZJOK-UHFFFAOYSA-N 2-(bromomethyl)-2-(2,4-dibromophenyl)-1,3-dioxolane Chemical compound C=1C=C(Br)C=C(Br)C=1C1(CBr)OCCO1 KXUZOBLKRVZJOK-UHFFFAOYSA-N 0.000 description 1
- KSCVSVDHVXNGCH-UHFFFAOYSA-N 2-(bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane Chemical compound ClC1=CC(Cl)=CC=C1C1(CBr)OCCO1 KSCVSVDHVXNGCH-UHFFFAOYSA-N 0.000 description 1
- WVOHJAWNRZYVCS-UHFFFAOYSA-N 2-(bromomethyl)-2-(2,4-dichlorophenyl)-4-ethyl-1,3-dioxolane Chemical compound O1C(CC)COC1(CBr)C1=CC=C(Cl)C=C1Cl WVOHJAWNRZYVCS-UHFFFAOYSA-N 0.000 description 1
- UZODYYMXCMVQFJ-UHFFFAOYSA-N 2-(bromomethyl)-2-(2,4-dichlorophenyl)-4-methyl-1,3-dioxolane Chemical compound O1C(C)COC1(CBr)C1=CC=C(Cl)C=C1Cl UZODYYMXCMVQFJ-UHFFFAOYSA-N 0.000 description 1
- PJVTZAKVRVBCMJ-UHFFFAOYSA-N 2-(bromomethyl)-2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolane Chemical compound O1C(CCC)COC1(CBr)C1=CC=C(Cl)C=C1Cl PJVTZAKVRVBCMJ-UHFFFAOYSA-N 0.000 description 1
- VPMLEWYOOLCQGH-UHFFFAOYSA-N 2-(bromomethyl)-2-(2-chlorophenyl)-1,3-dioxolane Chemical compound ClC1=CC=CC=C1C1(CBr)OCCO1 VPMLEWYOOLCQGH-UHFFFAOYSA-N 0.000 description 1
- XCLLPJSXFBJCSX-UHFFFAOYSA-N 2-(bromomethyl)-2-(2-methoxyphenyl)-1,3-dioxolane Chemical compound COC1=CC=CC=C1C1(CBr)OCCO1 XCLLPJSXFBJCSX-UHFFFAOYSA-N 0.000 description 1
- UAGQBAHCAHZZJQ-UHFFFAOYSA-N 2-(bromomethyl)-2-(3-bromo-4-methylphenyl)-1,3-dioxolane Chemical compound C1=C(Br)C(C)=CC=C1C1(CBr)OCCO1 UAGQBAHCAHZZJQ-UHFFFAOYSA-N 0.000 description 1
- BDIGWTGOEGDCDT-UHFFFAOYSA-N 2-(bromomethyl)-2-(4-bromo-2-methylphenyl)-1,3-dioxolane Chemical compound CC1=CC(Br)=CC=C1C1(CBr)OCCO1 BDIGWTGOEGDCDT-UHFFFAOYSA-N 0.000 description 1
- ZIJLKJSYVNDWCR-UHFFFAOYSA-N 2-(bromomethyl)-2-(4-chloro-2-methoxyphenyl)-1,3-dioxolane Chemical compound BrCC1(OCCO1)C1=C(C=C(C=C1)Cl)OC ZIJLKJSYVNDWCR-UHFFFAOYSA-N 0.000 description 1
- PUALLAUOKVJVIF-UHFFFAOYSA-N 2-(bromomethyl)-2-(4-iodophenyl)-1,3-dioxolane Chemical compound C=1C=C(I)C=CC=1C1(CBr)OCCO1 PUALLAUOKVJVIF-UHFFFAOYSA-N 0.000 description 1
- PTOYHZNVRQUIKP-UHFFFAOYSA-N 2-(bromomethyl)-2-(9h-fluoren-2-yl)-1,3-dioxolane Chemical compound C=1C=C(C2=CC=CC=C2C2)C2=CC=1C1(CBr)OCCO1 PTOYHZNVRQUIKP-UHFFFAOYSA-N 0.000 description 1
- ICBRDCHYCWKNBH-UHFFFAOYSA-N 2-(bromomethyl)-2-naphthalen-2-yl-1,3-dioxolane Chemical compound C=1C=C2C=CC=CC2=CC=1C1(CBr)OCCO1 ICBRDCHYCWKNBH-UHFFFAOYSA-N 0.000 description 1
- NTRATOUBIPAKPQ-UHFFFAOYSA-N 2-(bromomethyl)-2-phenyl-1,3-dioxolane Chemical compound C=1C=CC=CC=1C1(CBr)OCCO1 NTRATOUBIPAKPQ-UHFFFAOYSA-N 0.000 description 1
- IDRUFHLMTBZQBT-IHWYPQMZSA-N 2-[(Z)-prop-1-enyl]propanedioic acid Chemical compound C\C=C/C(C(O)=O)C(O)=O IDRUFHLMTBZQBT-IHWYPQMZSA-N 0.000 description 1
- IDRUFHLMTBZQBT-NSCUHMNNSA-N 2-[(e)-prop-1-enyl]propanedioic acid Chemical compound C\C=C\C(C(O)=O)C(O)=O IDRUFHLMTBZQBT-NSCUHMNNSA-N 0.000 description 1
- PJEXBMOOBWGMBY-UHFFFAOYSA-N 2-bromo-1-(4-bromo-2-methylphenyl)ethanone Chemical compound CC1=CC(Br)=CC=C1C(=O)CBr PJEXBMOOBWGMBY-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- PQAMFDRRWURCFQ-UHFFFAOYSA-N 2-ethyl-1h-imidazole Chemical compound CCC1=NC=CN1 PQAMFDRRWURCFQ-UHFFFAOYSA-N 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- PKRSYEPBQPFNRB-UHFFFAOYSA-N 2-phenoxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OC1=CC=CC=C1 PKRSYEPBQPFNRB-UHFFFAOYSA-N 0.000 description 1
- KNGOKMSCODQKMQ-UHFFFAOYSA-N 3,4-dihydroxyhexanedioic acid Chemical compound OC(=O)CC(O)C(O)CC(O)=O KNGOKMSCODQKMQ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- UPIQMVADUQYNGB-UHFFFAOYSA-N 4-[2-(bromomethyl)-1,3-dioxolan-2-yl]benzonitrile Chemical compound C=1C=C(C#N)C=CC=1C1(CBr)OCCO1 UPIQMVADUQYNGB-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- SCBUQIQXUBOQAI-UHFFFAOYSA-N 4-phenylbut-2-enoic acid Chemical compound OC(=O)C=CCC1=CC=CC=C1 SCBUQIQXUBOQAI-UHFFFAOYSA-N 0.000 description 1
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 241000223600 Alternaria Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241001225321 Aspergillus fumigatus Species 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- 241000222178 Candida tropicalis Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- 241001120669 Colletotrichum lindemuthianum Species 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 201000007336 Cryptococcosis Diseases 0.000 description 1
- 241000221204 Cryptococcus neoformans Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 241000510928 Erysiphe necator Species 0.000 description 1
- 241000896222 Erysiphe polygoni Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000223218 Fusarium Species 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- JVTAAEKCZFNVCJ-REOHCLBHSA-N L-lactic acid Chemical compound C[C@H](O)C(O)=O JVTAAEKCZFNVCJ-REOHCLBHSA-N 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000893980 Microsporum canis Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 241000222831 Phialophora <Chaetothyriales> Species 0.000 description 1
- 241001580842 Podosphaera mors-uvae Species 0.000 description 1
- 241000896203 Podosphaera pannosa Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 241000223238 Trichophyton Species 0.000 description 1
- 241000223229 Trichophyton rubrum Species 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229940091771 aspergillus fumigatus Drugs 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N beta-hydroxyethanesulfonic acid Natural products OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 235000011116 calcium hydroxide Nutrition 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229940095731 candida albicans Drugs 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- UKFXDFUAPNAMPJ-UHFFFAOYSA-N ethylmalonic acid Chemical compound CCC(C(O)=O)C(O)=O UKFXDFUAPNAMPJ-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 229960004275 glycolic acid Drugs 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 244000000010 microbial pathogen Species 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- PHYFQTYBJUILEZ-IUPFWZBJSA-N triolein Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC(OC(=O)CCCCCCC\C=C/CCCCCCCC)COC(=O)CCCCCCC\C=C/CCCCCCCC PHYFQTYBJUILEZ-IUPFWZBJSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/63—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by introduction of halogen; by substitution of halogen atoms by other halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/16—Radicals substituted by halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US52458774A | 1974-11-18 | 1974-11-18 | |
| US05/620,989 US4079062A (en) | 1974-11-18 | 1975-10-09 | Triazole derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH615676A5 true CH615676A5 (en) | 1980-02-15 |
Family
ID=27061544
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1496275A CH615676A5 (en) | 1974-11-18 | 1975-11-18 | Process for the preparation of novel 1-(beta-aryl)-ethyl-1H-1,2,4-triazol ketals and salts thereof and their use in fungicides |
| CH114180A CH625103A5 (en) | 1974-11-18 | 1980-02-12 | Fungicide |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH114180A CH625103A5 (en) | 1974-11-18 | 1980-02-12 | Fungicide |
Country Status (28)
| Country | Link |
|---|---|
| JP (1) | JPS5175073A (OSRAM) |
| AT (1) | AT351861B (OSRAM) |
| AU (1) | AU503503B2 (OSRAM) |
| BR (1) | BR7507608A (OSRAM) |
| CA (1) | CA1094079A (OSRAM) |
| CH (2) | CH615676A5 (OSRAM) |
| CS (1) | CS203098B2 (OSRAM) |
| CY (1) | CY1064A (OSRAM) |
| DD (1) | DD124250A5 (OSRAM) |
| DE (1) | DE2551560C3 (OSRAM) |
| DK (1) | DK143751C (OSRAM) |
| EG (1) | EG11999A (OSRAM) |
| ES (1) | ES442656A1 (OSRAM) |
| FI (1) | FI62080C (OSRAM) |
| FR (1) | FR2290898A1 (OSRAM) |
| GB (1) | GB1522657A (OSRAM) |
| HK (1) | HK39280A (OSRAM) |
| HU (1) | HU177329B (OSRAM) |
| IE (1) | IE42064B1 (OSRAM) |
| IL (1) | IL48481A (OSRAM) |
| IT (1) | IT1052304B (OSRAM) |
| KE (1) | KE3058A (OSRAM) |
| NL (1) | NL162650C (OSRAM) |
| NZ (1) | NZ179111A (OSRAM) |
| SE (2) | SE433495B (OSRAM) |
| SU (1) | SU649316A3 (OSRAM) |
| TR (1) | TR18704A (OSRAM) |
| YU (1) | YU40269B (OSRAM) |
Families Citing this family (54)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4160838A (en) * | 1977-06-02 | 1979-07-10 | Janssen Pharmaceutica N.V. | Antimicrobial and plant-growth-regulating triazole derivatives |
| US4267179A (en) * | 1978-06-23 | 1981-05-12 | Janssen Pharmaceutica, N.V. | Heterocyclic derivatives of (4-phenylpiperazin-1-yl-aryloxymethyl-1,3-dioxolan-2-yl)methyl-1H-imidazoles and 1H-1,2,4-triazoles |
| DE2967202D1 (en) * | 1978-07-03 | 1984-10-11 | Janssen Pharmaceutica Nv | Derivatives of (4-(piperazin-1-yl-phenyloxymethyl)-1.3-dioxolan-2-ylmethyl)-1h-imidazoles and -1h-1.2.4-triazoles, their preparation and use as fungicides and bactericides |
| US4287195A (en) * | 1978-07-14 | 1981-09-01 | Janssen Pharmaceutica, N.V. | Heterocyclic derivatives of [4-(piperazin-1-yl-phenyloxymethyl)-1,3-dioxolan-2-ylmethyl]-1H-imidazoles and 1H-1,2,4-triazoles |
| CH637392A5 (en) * | 1978-07-24 | 1983-07-29 | Janssen Pharmaceutica Nv | 2-Phenyl-2-azolylmethyl-cyclohexa(d)-1,3-dioxolane derivatives, processes for their preparation, compositions containing these active substances as microbicides, and their use |
| CH634842A5 (en) * | 1978-07-25 | 1983-02-28 | Janssen Pharmaceutica Nv | 2-Phenyl-2-(1(H)-imidazolylmethyl)-1,3-dioxane derivatives, processes for their preparation, microbicides containing these active substances, and their use |
| FR2440367A1 (fr) * | 1978-11-01 | 1980-05-30 | Ciba Geigy Ag | Azolylacetals, leur preparation et leur utilisation en tant qu'agents microbicides |
| CA1173449A (en) * | 1979-11-16 | 1984-08-28 | Adolf Hubele | 1-¬2-(4-diphenyl)ethyl|-1h-azolylketals |
| NZ196075A (en) * | 1980-02-04 | 1982-12-07 | Janssen Pharmaceutica Nv | Agent to protect wood coatings and detergents from micro-organisms using a triazole |
| US4259505A (en) * | 1980-03-04 | 1981-03-31 | Ciba-Geigy Corporation | Process for the preparation of 1H-azole derivatives |
| DE3025879A1 (de) * | 1980-07-09 | 1982-02-11 | Basf Ag, 6700 Ludwigshafen | 1,3-dioxan-5-yl-alkyltriazole, ihre herstellung, ihre verwendung zur regulierung des pflanzenwachstums und mittel dafuer |
| DE3026140A1 (de) * | 1980-07-10 | 1982-02-18 | Basf Ag, 6700 Ludwigshafen | 1,3-dioxan-5-yl-alkenyltriazole, ihre herstellung, ihre verwendung zur regulierung des pflanzenwachstums und mittel dafuer |
| DE3040499A1 (de) * | 1980-10-28 | 1982-06-03 | Basf Ag, 6700 Ludwigshafen | Holzschutzmittel |
| TR21964A (tr) * | 1981-05-12 | 1985-12-11 | Ciba Geigy Ag | Mikrobisidler olarak yeni arilfenileter tuerevleri bunlarin hazirlanisi icin usuller ve bunlarin kullanilmalari |
| DE3232737A1 (de) * | 1982-09-03 | 1984-03-08 | Bayer Ag, 5090 Leverkusen | 2-aryl-2-azolylmethyl-1,3-dioxepine |
| GB2176106A (en) * | 1985-06-05 | 1986-12-17 | Uniroyal Ltd | Fungicides comprising carboxamidothiazoles |
| LT2595B (lt) * | 1986-02-14 | 1994-03-25 | Ciba Geigy Ag | Fungicidinis preparatas suspenduojamo koncentrato formoje ir kovos su gribeliais budas |
| EP0235082B1 (de) * | 1986-02-14 | 1989-07-26 | Ciba-Geigy Ag | Mikrobizide |
| LT2604B (lt) * | 1986-03-06 | 1994-03-25 | Ciba Geigy Ag | Fungicidinis preparatas ir kovos su grybeliais budas |
| JPS62212307A (ja) * | 1986-03-06 | 1987-09-18 | チバ−ガイギ− アクチエンゲゼルシヤフト | 殺菌剤組成物及びその使用方法 |
| GB8613913D0 (en) * | 1986-06-07 | 1986-07-09 | Ciba Geigy Ag | Microbicidal agrochemical compositions |
| DE3641555A1 (de) * | 1986-12-05 | 1988-06-16 | Solvay Werke Gmbh | Mittel oder konzentrat zum konservieren von holz und holzwerkstoffen |
| DE3641554C2 (de) * | 1986-12-05 | 1995-04-06 | Solvay Werke Gmbh | Holzschutzmittel |
| US4940799A (en) * | 1987-07-20 | 1990-07-10 | Ciba-Geigy Corporation | Preparation of the diastereomeric mixture 2R,4S-1-[2-(2,4-dichlorophenyl)-4-n-propyl-1,3-dioxolan-2-ylmethyl]-1H-1,2,4-triazole |
| US5250559A (en) * | 1988-11-18 | 1993-10-05 | Ciba-Geigy Corporation | Microbicidal compositions |
| DE3927806A1 (de) * | 1989-08-23 | 1991-04-11 | Desowag Materialschutz Gmbh | Mittel oder konzentrat zum konservieren von holz oder holzwerkstoffen |
| DE4013723A1 (de) * | 1990-04-28 | 1991-10-31 | Basf Ag | 5-(1,2,4-triazol-1-ylmethyl)-isoxazoline |
| MD24B1 (ro) * | 1991-07-09 | 1994-05-31 | Parfumerii Si Cosmetice Vioric | Compozitie de substante odorante |
| DE59206041D1 (de) * | 1991-12-19 | 1996-05-23 | Ciba Geigy Ag | Mikrobizide |
| EP0556157B1 (de) * | 1992-02-13 | 1997-11-26 | Novartis AG | Fungizide Mischungen auf der Basis von Triazol-Fungiziden und 4,6-Dimethyl-N-Phenyl-2-Pyrimidinamin |
| US5342980A (en) | 1992-12-30 | 1994-08-30 | American Cyanamid Company | Fungicidal agents |
| DE122005000047I2 (de) * | 1993-09-24 | 2011-07-21 | Basf Se | Fungizide Mischungen. |
| TW286264B (OSRAM) * | 1994-05-20 | 1996-09-21 | Ciba Geigy Ag | |
| DE19829113A1 (de) | 1998-06-10 | 1999-12-16 | Bayer Ag | Mittel zur Bekämpfung von Pflanzenschädlingen |
| JP2003516979A (ja) * | 1999-12-13 | 2003-05-20 | バイエル アクチェンゲゼルシャフト | 殺菌・殺カビ性活性物質配合剤 |
| RU2005118756A (ru) | 2002-11-12 | 2006-01-20 | БАСФ Акциенгезельшафт (DE) | Способ повышения урожайности бобовых культур |
| DE10347090A1 (de) | 2003-10-10 | 2005-05-04 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE10349501A1 (de) | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| EP2255645A3 (de) | 2005-06-09 | 2011-03-16 | Bayer CropScience AG | Wirkstoffkombinationen |
| DE102005026482A1 (de) | 2005-06-09 | 2006-12-14 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| DE102005035300A1 (de) | 2005-07-28 | 2007-02-01 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| DE102006023263A1 (de) | 2006-05-18 | 2007-11-22 | Bayer Cropscience Ag | Synergistische Wirkstoffkombinationen |
| CA2680351A1 (en) * | 2007-03-23 | 2008-10-02 | Syngenta Limited | Co-crystals of propiconazole |
| EP2000028A1 (de) | 2007-06-06 | 2008-12-10 | Bayer CropScience Aktiengesellschaft | Fungizide Wirkstoffkombinationen |
| DE102007045920B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Synergistische Wirkstoffkombinationen |
| GB0817513D0 (en) * | 2008-09-24 | 2008-10-29 | Syngenta Ltd | Co-crystals |
| WO2010149758A1 (en) | 2009-06-25 | 2010-12-29 | Basf Se | Antifungal 1, 2, 4-triazolyl derivatives |
| BR112012001001A2 (pt) | 2009-07-14 | 2016-11-16 | Basf Se | compositos azol das formulas i e ii, compostos das formulas i e i, compostos de formula ix, composição agricola, uso de um composto farmaceutica, metodo para tratar infecções de câncer ou virus para combater fungos zoopatigênicos ou humanopatogenicos |
| CN103548836A (zh) | 2009-07-16 | 2014-02-05 | 拜尔农作物科学股份公司 | 含苯基三唑的协同活性物质结合物 |
| CN102060850B (zh) * | 2011-01-12 | 2012-12-05 | 周保东 | 一种苯醚甲环唑的制备方法及精制方法 |
| JP5958905B2 (ja) * | 2011-10-20 | 2016-08-02 | 公立大学法人秋田県立大学 | 植物成長調節剤 |
| AR093996A1 (es) | 2012-12-18 | 2015-07-01 | Bayer Cropscience Ag | Combinaciones bactericidas y fungicidas binarias |
| CN104119322B (zh) * | 2014-07-11 | 2016-05-18 | 北京迪尔乐农业高新技术研发中心 | 一种用于杀菌的三唑类化合物及其制备方法和应用 |
| EP2910126A1 (en) | 2015-05-05 | 2015-08-26 | Bayer CropScience AG | Active compound combinations having insecticidal properties |
-
1975
- 1975-10-30 NZ NZ179111A patent/NZ179111A/xx unknown
- 1975-11-11 SE SE7512643A patent/SE433495B/xx not_active IP Right Cessation
- 1975-11-13 CS CS757684A patent/CS203098B2/cs unknown
- 1975-11-14 GB GB47071/75A patent/GB1522657A/en not_active Expired
- 1975-11-14 TR TR18704A patent/TR18704A/xx unknown
- 1975-11-14 ES ES442656A patent/ES442656A1/es not_active Expired
- 1975-11-14 CY CY1064A patent/CY1064A/xx unknown
- 1975-11-15 EG EG670/75A patent/EG11999A/xx active
- 1975-11-17 NL NL7513389.A patent/NL162650C/xx not_active IP Right Cessation
- 1975-11-17 DD DD189503A patent/DD124250A5/xx unknown
- 1975-11-17 JP JP50137351A patent/JPS5175073A/ja active Granted
- 1975-11-17 DE DE2551560A patent/DE2551560C3/de not_active Expired
- 1975-11-17 IL IL48481A patent/IL48481A/xx unknown
- 1975-11-17 CA CA239,758A patent/CA1094079A/en not_active Expired
- 1975-11-17 FI FI753228A patent/FI62080C/fi not_active IP Right Cessation
- 1975-11-17 IE IE2498/75A patent/IE42064B1/en not_active IP Right Cessation
- 1975-11-17 DK DK517175A patent/DK143751C/da not_active IP Right Cessation
- 1975-11-17 IT IT52245/75A patent/IT1052304B/it active
- 1975-11-17 FR FR7535051A patent/FR2290898A1/fr active Granted
- 1975-11-17 BR BR7507608*A patent/BR7507608A/pt unknown
- 1975-11-18 CH CH1496275A patent/CH615676A5/de not_active IP Right Cessation
- 1975-11-18 AT AT877775A patent/AT351861B/de not_active IP Right Cessation
- 1975-11-18 AU AU86719/75A patent/AU503503B2/en not_active Expired
- 1975-11-18 YU YU2929/75A patent/YU40269B/xx unknown
- 1975-11-18 SU SU752189652A patent/SU649316A3/ru active
- 1975-11-18 HU HU75JA745A patent/HU177329B/hu unknown
-
1980
- 1980-02-12 CH CH114180A patent/CH625103A5/de not_active IP Right Cessation
- 1980-06-16 KE KE3058A patent/KE3058A/xx unknown
- 1980-07-31 HK HK392/80A patent/HK39280A/xx unknown
-
1983
- 1983-09-22 SE SE8305128A patent/SE433496B/sv not_active IP Right Cessation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH615676A5 (en) | Process for the preparation of novel 1-(beta-aryl)-ethyl-1H-1,2,4-triazol ketals and salts thereof and their use in fungicides | |
| DD148219A5 (de) | Verfahren zur herstellung von hydroxyethyl-azolen | |
| EP0000752A2 (de) | Alpha-azolysulfide, -sulfoxide und -sulfone, deren Salze und Metallkomplexe, Verfahren zu ihrer Herstellung, sowie sie enthaltende Mittel zur Pilzbekämpfung | |
| DE2851086A1 (de) | Hydroxypropyl-triazole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| CH648843A5 (de) | 1-(2-aryl-1,3-dioxolan-2-ylmethyl)-1h-1,2,4-triazole. | |
| EP0019189B1 (de) | Fungizide Mittel, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| EP0121888B1 (de) | 1-Azolyl-3-pyrazolyl-2-propanol-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide | |
| DE2602770A1 (de) | 1,3-dioxolan-2-ylmethylimidazole, verfahren zu ihrer herstellung und ihre verwendung als biozide | |
| DE3325313A1 (de) | Fungizide mittel, deren herstellung und verwendung | |
| DE3235935A1 (de) | Azolylbutanole | |
| DE3144318A1 (de) | 2-imidazolylmethyl-2-phenyl-1, 3-dioxolane, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide | |
| EP0032561B1 (de) | Triazolylphenacyl-pyridyl-ether-Derivate, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| DE2714290A1 (de) | Fungizide mittel | |
| DE2635666A1 (de) | 1-azolyl-4-hydroxy-butan-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide und bakterizide | |
| DE2334352C3 (de) | Im Heterocyclus halogenierte 1-(1,2,4-Triazol-1-yl)-1-phenoxy-3,3-dimethyl-butan-2-on- Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide | |
| DE2632603C2 (OSRAM) | ||
| EP0009707A1 (de) | Halogenierte 1-Azolyl-1-fluorphenoxy-butan-Derivate, Verfahren zu ihrer Herstellung, sie enthaltende Fungizide Mittel sowie ihre Verwendung als Fungizide | |
| DE2628152A1 (de) | Fungizide und nematizide mittel | |
| CH630370A5 (en) | Process for the preparation of new (1-phenyl-2-triazolylethyl) thioethers, -thiols (mercaptans), sulphoxides and sulphones | |
| DE2851143A1 (de) | Fluorenyl-azolylmethyl-carbinole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| EP0019190B1 (de) | Verwendung von Hydroxyalkyl-imidazolen als Fungizide | |
| EP0092730A2 (de) | Bisazolyl-Verbindungen, ihre Herstellung, ihre Verwendung zur Regulierung des Pflanzenwachstums und Mittel dafür | |
| EP0149814B1 (de) | Azolylmethylcycloacetale, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel | |
| DD158848A5 (de) | Substituierte phenyl-trazolyl-vinyl-ketone,verfahren zu ihrer herstellung sowie ihre verwendung als fungizide | |
| EP0073331B1 (de) | 5-Aryloxy-5-azolyl-3,3-dimethyl-1-penten-4-one und -ole, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |