CH615664A5 - Process for the preparation of novel nitrogen-containing polycyclic compounds - Google Patents
Process for the preparation of novel nitrogen-containing polycyclic compounds Download PDFInfo
- Publication number
- CH615664A5 CH615664A5 CH272775A CH272775A CH615664A5 CH 615664 A5 CH615664 A5 CH 615664A5 CH 272775 A CH272775 A CH 272775A CH 272775 A CH272775 A CH 272775A CH 615664 A5 CH615664 A5 CH 615664A5
- Authority
- CH
- Switzerland
- Prior art keywords
- tetrahydro
- pyrrole
- cyclohepta
- nmr spectrum
- methanodibenzo
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 14
- 230000008569 process Effects 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title description 5
- -1 N-methylsulfamyl Chemical group 0.000 claims description 55
- 150000001875 compounds Chemical class 0.000 claims description 53
- 125000004432 carbon atom Chemical group C* 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 229910052757 nitrogen Inorganic materials 0.000 claims description 11
- 229910052799 carbon Inorganic materials 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 230000002829 reductive effect Effects 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 4
- 125000001889 triflyl group Chemical group FC(F)(F)S(*)(=O)=O 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 3
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 claims description 3
- 125000006216 methylsulfinyl group Chemical group [H]C([H])([H])S(*)=O 0.000 claims description 3
- 125000005034 trifluormethylthio group Chemical group FC(S*)(F)F 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 claims description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims 4
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 65
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 63
- 239000000203 mixture Substances 0.000 description 36
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 35
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 30
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 27
- LNFLVFXWOCZBMF-UHFFFAOYSA-N cyclohepta[c]pyrrole Chemical compound C1=CC=CC=C2C=NC=C21 LNFLVFXWOCZBMF-UHFFFAOYSA-N 0.000 description 27
- 239000000243 solution Substances 0.000 description 27
- 239000002904 solvent Substances 0.000 description 25
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 21
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 20
- 238000004458 analytical method Methods 0.000 description 20
- VHMICKWLTGFITH-UHFFFAOYSA-N 2H-isoindole Chemical compound C1=CC=CC2=CNC=C21 VHMICKWLTGFITH-UHFFFAOYSA-N 0.000 description 19
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- 230000000694 effects Effects 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 238000002844 melting Methods 0.000 description 18
- 230000008018 melting Effects 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 241000699670 Mus sp. Species 0.000 description 15
- 238000012360 testing method Methods 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- 241000699666 Mus <mouse, genus> Species 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- 239000000284 extract Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 10
- 230000009467 reduction Effects 0.000 description 10
- 230000011514 reflex Effects 0.000 description 10
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 238000002425 crystallisation Methods 0.000 description 9
- 230000008025 crystallization Effects 0.000 description 9
- 239000002253 acid Substances 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 241000700159 Rattus Species 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000012458 free base Substances 0.000 description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 6
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 6
- 230000008707 rearrangement Effects 0.000 description 6
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical class CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- 230000000202 analgesic effect Effects 0.000 description 5
- YMNKUHIVVMFOFO-UHFFFAOYSA-N anthracene-9-carbaldehyde Chemical compound C1=CC=C2C(C=O)=C(C=CC=C3)C3=CC2=C1 YMNKUHIVVMFOFO-UHFFFAOYSA-N 0.000 description 5
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 5
- 229960003529 diazepam Drugs 0.000 description 5
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 206010015995 Eyelid ptosis Diseases 0.000 description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 4
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 4
- 206010044565 Tremor Diseases 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 206010007776 catatonia Diseases 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 150000004678 hydrides Chemical class 0.000 description 4
- 210000003205 muscle Anatomy 0.000 description 4
- 201000003004 ptosis Diseases 0.000 description 4
- 239000003204 tranquilizing agent Substances 0.000 description 4
- HOWMQXHGZNQULG-UHFFFAOYSA-N 2-cyclopentanecarbonyl-2,3-dihydro-8h-3a,8-methanodibenzo[3,4:6,7]cyclohepta[1,2-c]pyrrole Chemical compound C1C2(C3=CC=CC=C33)CC3C3=CC=CC=C3C2=CN1C(=O)C1CCCC1 HOWMQXHGZNQULG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 238000005698 Diels-Alder reaction Methods 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 239000000538 analytical sample Substances 0.000 description 3
- REJFOBQJXSGDSB-UHFFFAOYSA-N anthracene-9-carbonyl chloride Chemical compound C1=CC=C2C(C(=O)Cl)=C(C=CC=C3)C3=CC2=C1 REJFOBQJXSGDSB-UHFFFAOYSA-N 0.000 description 3
- 125000001246 bromo group Chemical group Br* 0.000 description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 3
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 description 3
- 229960001076 chlorpromazine Drugs 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 150000002466 imines Chemical class 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 229920000609 methyl cellulose Polymers 0.000 description 3
- 239000001923 methylcellulose Substances 0.000 description 3
- 235000010981 methylcellulose Nutrition 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- JKANAVGODYYCQF-UHFFFAOYSA-N prop-2-yn-1-amine Chemical compound NCC#C JKANAVGODYYCQF-UHFFFAOYSA-N 0.000 description 3
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 229910001220 stainless steel Inorganic materials 0.000 description 3
- 230000002936 tranquilizing effect Effects 0.000 description 3
- 238000005303 weighing Methods 0.000 description 3
- LFDGRWDETVOGDT-UHFFFAOYSA-N 1h-pyrrole;hydrochloride Chemical compound Cl.C=1C=CNC=1 LFDGRWDETVOGDT-UHFFFAOYSA-N 0.000 description 2
- AYRABHFHMLXKBT-UHFFFAOYSA-N 2,6-dimethylanthracene Chemical compound C1=C(C)C=CC2=CC3=CC(C)=CC=C3C=C21 AYRABHFHMLXKBT-UHFFFAOYSA-N 0.000 description 2
- HGZVMRORLAQQED-UHFFFAOYSA-N 2-cyclopentylmethyl-2,3-dihydro-8h-3a,8-methanodibenzo[3,4:6,7]cyclohepta[1,2-c]pyrrole Chemical compound C1C2(C3=CC=CC=C33)CC3C3=CC=CC=C3C2=CN1CC1CCCC1 HGZVMRORLAQQED-UHFFFAOYSA-N 0.000 description 2
- GYMFBYTZOGMSQJ-UHFFFAOYSA-N 2-methylanthracene Chemical compound C1=CC=CC2=CC3=CC(C)=CC=C3C=C21 GYMFBYTZOGMSQJ-UHFFFAOYSA-N 0.000 description 2
- UBYMWJJBRWVSHK-UHFFFAOYSA-N 3-azapentacyclo[10.6.1.01,5.06,11.013,18]nonadeca-6,8,10,13,15,17-hexaene Chemical compound C12=CC=CC=C2C2CNCC32C2=CC=CC=C2C1C3 UBYMWJJBRWVSHK-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 229940035676 analgesics Drugs 0.000 description 2
- 239000000730 antalgic agent Substances 0.000 description 2
- 150000001454 anthracenes Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- WEPUZBYKXNKSDH-UHFFFAOYSA-N cyclopentanecarbonyl chloride Chemical compound ClC(=O)C1CCCC1 WEPUZBYKXNKSDH-UHFFFAOYSA-N 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 210000003128 head Anatomy 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- GJVATGPDFBFDEZ-UHFFFAOYSA-N n-(anthracen-9-ylmethyl)-1-cyclopentylmethanamine Chemical compound C=12C=CC=CC2=CC2=CC=CC=C2C=1CNCC1CCCC1 GJVATGPDFBFDEZ-UHFFFAOYSA-N 0.000 description 2
- ATVVEQSSZMNSTA-UHFFFAOYSA-N n-(anthracen-9-ylmethyl)-n-(cyclopentylmethyl)prop-2-yn-1-amine Chemical compound C=12C=CC=CC2=CC2=CC=CC=C2C=1CN(CC#C)CC1CCCC1 ATVVEQSSZMNSTA-UHFFFAOYSA-N 0.000 description 2
- QAPTWHXHEYAIKG-RCOXNQKVSA-N n-[(1r,2s,5r)-5-(tert-butylamino)-2-[(3s)-2-oxo-3-[[6-(trifluoromethyl)quinazolin-4-yl]amino]pyrrolidin-1-yl]cyclohexyl]acetamide Chemical compound CC(=O)N[C@@H]1C[C@H](NC(C)(C)C)CC[C@@H]1N1C(=O)[C@@H](NC=2C3=CC(=CC=C3N=CN=2)C(F)(F)F)CC1 QAPTWHXHEYAIKG-RCOXNQKVSA-N 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 229910052703 rhodium Inorganic materials 0.000 description 2
- 239000010948 rhodium Substances 0.000 description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 2
- 238000005730 ring rearrangement reaction Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 230000001624 sedative effect Effects 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 230000017105 transposition Effects 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- DIXMBHMNEHPFCX-MCMMXHMISA-N (2r)-2-[5-[6-amino-5-[(1r)-1-[5-fluoro-2-(triazol-2-yl)phenyl]ethoxy]pyridin-3-yl]-4-methyl-1,3-thiazol-2-yl]propane-1,2-diol Chemical compound O([C@H](C)C=1C(=CC=C(F)C=1)N1N=CC=N1)C(C(=NC=1)N)=CC=1C=1SC([C@](C)(O)CO)=NC=1C DIXMBHMNEHPFCX-MCMMXHMISA-N 0.000 description 1
- AHQUJJBQQIJCIB-UHFFFAOYSA-N 1,5-dimethoxyanthracene Chemical compound C1=CC=C2C=C3C(OC)=CC=CC3=CC2=C1OC AHQUJJBQQIJCIB-UHFFFAOYSA-N 0.000 description 1
- WAPSEVALXZJQLL-UHFFFAOYSA-N 1,8-dimethylanthracene Chemical compound C1=CC(C)=C2C=C3C(C)=CC=CC3=CC2=C1 WAPSEVALXZJQLL-UHFFFAOYSA-N 0.000 description 1
- UUZIZRJXGBWYPM-UHFFFAOYSA-N 1-anthracen-1-ylpropan-1-one Chemical compound C1=CC=C2C=C3C(C(=O)CC)=CC=CC3=CC2=C1 UUZIZRJXGBWYPM-UHFFFAOYSA-N 0.000 description 1
- XMWJLKOCNKJERQ-UHFFFAOYSA-N 1-bromoanthracene Chemical compound C1=CC=C2C=C3C(Br)=CC=CC3=CC2=C1 XMWJLKOCNKJERQ-UHFFFAOYSA-N 0.000 description 1
- SRIHSAFSOOUEGL-UHFFFAOYSA-N 1-chloroanthracene Chemical compound C1=CC=C2C=C3C(Cl)=CC=CC3=CC2=C1 SRIHSAFSOOUEGL-UHFFFAOYSA-N 0.000 description 1
- JBYLHICABMOUQN-UHFFFAOYSA-N 1-fluoroanthracene Chemical compound C1=CC=C2C=C3C(F)=CC=CC3=CC2=C1 JBYLHICABMOUQN-UHFFFAOYSA-N 0.000 description 1
- KZNJSFHJUQDYHE-UHFFFAOYSA-N 1-methylanthracene Chemical compound C1=CC=C2C=C3C(C)=CC=CC3=CC2=C1 KZNJSFHJUQDYHE-UHFFFAOYSA-N 0.000 description 1
- OCQAXYHNMWVLRH-UHFFFAOYSA-N 2,3-dibenzoyl-2,3-dihydroxybutanedioic acid Chemical class C=1C=CC=CC=1C(=O)C(O)(C(O)=O)C(O)(C(=O)O)C(=O)C1=CC=CC=C1 OCQAXYHNMWVLRH-UHFFFAOYSA-N 0.000 description 1
- QCFQYVMTVPXVKG-UHFFFAOYSA-N 2,6-dimethoxyanthracene Chemical compound C1=C(OC)C=CC2=CC3=CC(OC)=CC=C3C=C21 QCFQYVMTVPXVKG-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- QHCGFVPJQRBQIT-UHFFFAOYSA-N 2-benzyl-2,3,8,12b-tetrahydro-1h-3a,8-methanodibenzo[3,4:6,7]-cyclohepta[1,2-c]pyrrole Chemical compound C1C2C3=CC=CC=C3C(C3=CC=CC=C33)CC23CN1CC1=CC=CC=C1 QHCGFVPJQRBQIT-UHFFFAOYSA-N 0.000 description 1
- PYXBCVWIECUMDW-UHFFFAOYSA-N 2-bromoanthracene Chemical compound C1=CC=CC2=CC3=CC(Br)=CC=C3C=C21 PYXBCVWIECUMDW-UHFFFAOYSA-N 0.000 description 1
- CSRSJFXWNRLECN-UHFFFAOYSA-N 2-cyclopentylmethyl-2,3,8,12b-tetrahydro1h-3a,8methanodibenzo[3,4:6,7]cyclohepta[1,2-c]pyrrole Chemical compound C1C2C3=CC=CC=C3C(C3=CC=CC=C33)CC23CN1CC1CCCC1 CSRSJFXWNRLECN-UHFFFAOYSA-N 0.000 description 1
- PTDCKZPDRHRAEF-UHFFFAOYSA-N 2-fluoroanthracene Chemical compound C1=CC=CC2=CC3=CC(F)=CC=C3C=C21 PTDCKZPDRHRAEF-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- PDMDSGNZVFEVGS-UHFFFAOYSA-N 3-(1-cyclopentylethyl)-3-azapentacyclo[10.6.1.01,5.06,11.013,18]nonadeca-6,8,10,13,15,17-hexaene Chemical compound C1C2C3=CC=CC=C3C(C3=CC=CC=C33)CC23CN1C(C)C1CCCC1 PDMDSGNZVFEVGS-UHFFFAOYSA-N 0.000 description 1
- CXXPHMUCKRPGQO-UHFFFAOYSA-N 3-(2-adamantylmethyl)-3-azapentacyclo[10.6.1.01,5.06,11.013,18]nonadeca-6,8,10,13,15,17-hexaene Chemical compound C1C2(C3)C4=CC=CC=C4C1C1=CC=CC=C1C2CN3CC1C(C2)CC3CC2CC1C3 CXXPHMUCKRPGQO-UHFFFAOYSA-N 0.000 description 1
- RFELZUFPENTGSE-UHFFFAOYSA-N 3-(2-cyclopent-2-en-1-ylethyl)-3-azapentacyclo[10.6.1.01,5.06,11.013,18]nonadeca-6,8,10,13,15,17-hexaene Chemical compound C1C2C3=CC=CC=C3C(C3=CC=CC=C33)CC23CN1CCC1CCC=C1 RFELZUFPENTGSE-UHFFFAOYSA-N 0.000 description 1
- ZIZQOGIJRMHVSB-UHFFFAOYSA-N 3-(2-ethylbutyl)-3-azapentacyclo[10.6.1.01,5.06,11.013,18]nonadeca-6,8,10,13,15,17-hexaene Chemical compound C12=CC=CC=C2C2C3=CC=CC=C3C3CN(CC(CC)CC)CC31C2 ZIZQOGIJRMHVSB-UHFFFAOYSA-N 0.000 description 1
- SFIVBJLYACGCMV-UHFFFAOYSA-N 3-(3-cyclopentylpropyl)-3-azapentacyclo[10.6.1.01,5.06,11.013,18]nonadeca-6,8,10,13,15,17-hexaene Chemical compound C1C2C3=CC=CC=C3C(C3=CC=CC=C33)CC23CN1CCCC1CCCC1 SFIVBJLYACGCMV-UHFFFAOYSA-N 0.000 description 1
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 description 1
- QRCLPUBJRRYTMC-UHFFFAOYSA-N 3-(cyclohex-3-en-1-ylmethyl)-3-azapentacyclo[10.6.1.01,5.06,11.013,18]nonadeca-6,8,10,13,15,17-hexaene Chemical compound C1C2C3=CC=CC=C3C(C3=CC=CC=C33)CC23CN1CC1CCC=CC1 QRCLPUBJRRYTMC-UHFFFAOYSA-N 0.000 description 1
- PHZSQNBSXIKKMO-UHFFFAOYSA-N 3-(cyclohexen-1-ylmethyl)-3-azapentacyclo[10.6.1.01,5.06,11.013,18]nonadeca-6,8,10,13,15,17-hexaene Chemical compound C1C2C3=CC=CC=C3C(C3=CC=CC=C33)CC23CN1CC1=CCCCC1 PHZSQNBSXIKKMO-UHFFFAOYSA-N 0.000 description 1
- HQCKRNOJOIEFEW-UHFFFAOYSA-N 3-[(2-methylcyclopentyl)methyl]-3-azapentacyclo[10.6.1.01,5.06,11.013,18]nonadeca-6,8,10,13,15,17-hexaene Chemical compound CC1CCCC1CN1CC2(C=3C4=CC=CC=3)CC4C3=CC=CC=C3C2C1 HQCKRNOJOIEFEW-UHFFFAOYSA-N 0.000 description 1
- WECXQTMTZXTNOF-UHFFFAOYSA-N 3-butyl-3-azapentacyclo[10.6.1.01,5.06,11.013,18]nonadeca-6,8,10,13,15,17-hexaene Chemical compound C12=CC=CC=C2C2C3=CC=CC=C3C3CN(CCCC)CC31C2 WECXQTMTZXTNOF-UHFFFAOYSA-N 0.000 description 1
- NNEYKBOKEVXYDM-UHFFFAOYSA-N 3-cyclopentyl-3-azapentacyclo[10.6.1.01,5.06,11.013,18]nonadeca-6,8,10,13,15,17-hexaene Chemical compound C1CCCC1N1CC2(C=3C4=CC=CC=3)CC4C3=CC=CC=C3C2C1 NNEYKBOKEVXYDM-UHFFFAOYSA-N 0.000 description 1
- AWBXWTIUFVDCCT-UHFFFAOYSA-N 3-ethyl-3-azapentacyclo[10.6.1.01,5.06,11.013,18]nonadeca-6,8,10,13,15,17-hexaene Chemical compound C12=CC=CC=C2C2C3=CC=CC=C3C3CN(CC)CC31C2 AWBXWTIUFVDCCT-UHFFFAOYSA-N 0.000 description 1
- WXGAXBVBSUXJGB-UHFFFAOYSA-N 3-heptyl-3-azapentacyclo[10.6.1.01,5.06,11.013,18]nonadeca-6,8,10,13,15,17-hexaene Chemical compound C12=CC=CC=C2C2C3=CC=CC=C3C3CN(CCCCCCC)CC31C2 WXGAXBVBSUXJGB-UHFFFAOYSA-N 0.000 description 1
- NNDHUBGBEYLNOH-UHFFFAOYSA-N 3-methyl-3-azapentacyclo[10.6.1.01,5.06,11.013,18]nonadeca-6,8,10,13,15,17-hexaene Chemical compound C12=CC=CC=C2C2C3=CC=CC=C3C3CN(C)CC31C2 NNDHUBGBEYLNOH-UHFFFAOYSA-N 0.000 description 1
- GZJIKNAIQBDIFU-UHFFFAOYSA-N 3-octyl-3-azapentacyclo[10.6.1.01,5.06,11.013,18]nonadeca-6,8,10,13,15,17-hexaene Chemical compound C12=CC=CC=C2C2C3=CC=CC=C3C3CN(CCCCCCCC)CC31C2 GZJIKNAIQBDIFU-UHFFFAOYSA-N 0.000 description 1
- JHCWBALNJYZZSG-UHFFFAOYSA-N 3-propan-2-yl-3-azapentacyclo[10.6.1.01,5.06,11.013,18]nonadeca-6,8,10,13,15,17-hexaene Chemical compound C12=CC=CC=C2C2C3=CC=CC=C3C3CN(C(C)C)CC31C2 JHCWBALNJYZZSG-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- 208000019901 Anxiety disease Diseases 0.000 description 1
- QUMCIHKVKQYNPA-RUZDIDTESA-N C1(CCCCC1)CN1[C@@H](C=2N(C=3C=NC(=NC1=3)NC1=C(C=C(C(=O)NC3CCN(CC3)C)C=C1)OC)C(=NN=2)C)CC Chemical compound C1(CCCCC1)CN1[C@@H](C=2N(C=3C=NC(=NC1=3)NC1=C(C=C(C(=O)NC3CCN(CC3)C)C=C1)OC)C(=NN=2)C)CC QUMCIHKVKQYNPA-RUZDIDTESA-N 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 229920003091 Methocel™ Polymers 0.000 description 1
- TZCCKCLHNUSAMQ-DUGSHLAESA-N NC(=O)C[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc2ccc(F)cc2)NC(=O)[C@H](Cc3c[nH]c4ccccc34)NC(=O)Cc5cccs5)C(=O)N Chemical compound NC(=O)C[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc2ccc(F)cc2)NC(=O)[C@H](Cc3c[nH]c4ccccc34)NC(=O)Cc5cccs5)C(=O)N TZCCKCLHNUSAMQ-DUGSHLAESA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 238000000692 Student's t-test Methods 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- 210000003489 abdominal muscle Anatomy 0.000 description 1
- ZCHPKWUIAASXPV-UHFFFAOYSA-N acetic acid;methanol Chemical compound OC.CC(O)=O ZCHPKWUIAASXPV-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- MEQDVTFZLJSMPO-UHFFFAOYSA-N anthracen-9-ylmethanamine Chemical class C1=CC=C2C(CN)=C(C=CC=C3)C3=CC2=C1 MEQDVTFZLJSMPO-UHFFFAOYSA-N 0.000 description 1
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Natural products C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 1
- YSXNTXIZPHOURT-UHFFFAOYSA-N anthracene-1,8-disulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=C2C=C3C(S(=O)(=O)O)=CC=CC3=CC2=C1 YSXNTXIZPHOURT-UHFFFAOYSA-N 0.000 description 1
- ILFFFKFZHRGICY-UHFFFAOYSA-N anthracene-1-sulfonic acid Chemical compound C1=CC=C2C=C3C(S(=O)(=O)O)=CC=CC3=CC2=C1 ILFFFKFZHRGICY-UHFFFAOYSA-N 0.000 description 1
- JRMHQNHZQUZWNU-UHFFFAOYSA-N anthracene-2,6-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC3=CC(S(=O)(=O)O)=CC=C3C=C21 JRMHQNHZQUZWNU-UHFFFAOYSA-N 0.000 description 1
- IPQGOTUZADECCY-UHFFFAOYSA-N anthracene-2-sulfonic acid Chemical compound C1=CC=CC2=CC3=CC(S(=O)(=O)O)=CC=C3C=C21 IPQGOTUZADECCY-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 238000006480 benzoylation reaction Methods 0.000 description 1
- 230000002146 bilateral effect Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000036461 convulsion Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- OOFMIUZJZJLORQ-UHFFFAOYSA-N cyclobuta[a]anthracene Chemical compound C1=CC2=CC3=CC=CC=C3C=C2C2=C1C=C2 OOFMIUZJZJLORQ-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000006623 cyclooctylmethyl group Chemical group 0.000 description 1
- UBLYEVLMRSPMOG-UHFFFAOYSA-N cyclopentylmethanamine Chemical compound NCC1CCCC1 UBLYEVLMRSPMOG-UHFFFAOYSA-N 0.000 description 1
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000005695 dehalogenation reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- MYTMXVHNEWBFAL-UHFFFAOYSA-L dipotassium;carbonate;hydrate Chemical compound O.[K+].[K+].[O-]C([O-])=O MYTMXVHNEWBFAL-UHFFFAOYSA-L 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000002635 electroconvulsive therapy Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- XBPOBCXHALHJFP-UHFFFAOYSA-N ethyl 4-bromobutanoate Chemical compound CCOC(=O)CCCBr XBPOBCXHALHJFP-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 210000003414 extremity Anatomy 0.000 description 1
- 210000000744 eyelid Anatomy 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 210000005224 forefinger Anatomy 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 230000004886 head movement Effects 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 210000000548 hind-foot Anatomy 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical class IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 210000003141 lower extremity Anatomy 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 230000037023 motor activity Effects 0.000 description 1
- RSLVJHXLWUUKBL-UHFFFAOYSA-N n-(anthracen-9-ylmethyl)-1-phenylmethanamine Chemical compound C=12C=CC=CC2=CC2=CC=CC=C2C=1CNCC1=CC=CC=C1 RSLVJHXLWUUKBL-UHFFFAOYSA-N 0.000 description 1
- UCMIITIHTZUTSN-UHFFFAOYSA-N n-(anthracen-9-ylmethyl)-n-benzylprop-2-yn-1-amine Chemical compound C=12C=CC=CC2=CC2=CC=CC=C2C=1CN(CC#C)CC1=CC=CC=C1 UCMIITIHTZUTSN-UHFFFAOYSA-N 0.000 description 1
- 230000000701 neuroleptic effect Effects 0.000 description 1
- OMHBVFGZZOIGTM-UHFFFAOYSA-N nitro-2-methyl-2,3,8,12b-tetrahydro-1h-3a,8-methanodibenzo[3,4:6,7]cyclohepta[1,2-c]pyrrole hydrochloride Chemical compound Cl.C1C(C=2C3=CC=CC=2)C2=CC=CC=C2C2C31CN(C)C2[N+]([O-])=O OMHBVFGZZOIGTM-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 238000000053 physical method Methods 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 210000004894 snout Anatomy 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 210000003813 thumb Anatomy 0.000 description 1
- 238000002627 tracheal intubation Methods 0.000 description 1
- 125000000260 trans-2-phenylcyclopropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])[C@]1([H])C([H])([H])[C@@]1([H])* 0.000 description 1
- DBGVGMSCBYYSLD-UHFFFAOYSA-N tributylstannane Chemical compound CCCC[SnH](CCCC)CCCC DBGVGMSCBYYSLD-UHFFFAOYSA-N 0.000 description 1
- 210000001364 upper extremity Anatomy 0.000 description 1
- 238000011179 visual inspection Methods 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/56—Ring systems containing three or more rings
- C07D209/58—[b]- or [c]-condensed
- C07D209/70—[b]- or [c]-condensed containing carbocyclic rings other than six-membered
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/22—Ortho- or ortho- and peri-condensed systems containing three rings containing only six-membered rings
- C07C2603/24—Anthracenes; Hydrogenated anthracenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US44868674A | 1974-03-06 | 1974-03-06 | |
US54500175A | 1975-01-30 | 1975-01-30 |
Publications (1)
Publication Number | Publication Date |
---|---|
CH615664A5 true CH615664A5 (en) | 1980-02-15 |
Family
ID=27035443
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CH272775A CH615664A5 (en) | 1974-03-06 | 1975-03-04 | Process for the preparation of novel nitrogen-containing polycyclic compounds |
Country Status (22)
Families Citing this family (3)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE3069086D1 (de) * | 1979-12-10 | 1984-10-04 | Ciba Geigy Ag | Azatetracyclic carbonitriles |
JPH0676285B2 (ja) * | 1985-11-01 | 1994-09-28 | 三井東圧化学株式会社 | ベンジルアミン誘導体、その製造法およびその用途 |
CN114957090B (zh) * | 2021-12-31 | 2023-09-19 | 淮阴师范学院 | 稠合异吲哚衍生物的制备方法 |
-
1975
- 1975-02-11 SE SE7501519A patent/SE405475B/xx unknown
- 1975-02-28 AU AU78701/75A patent/AU503121B2/en not_active Expired
- 1975-03-04 IE IE450/75A patent/IE40728B1/xx unknown
- 1975-03-04 CH CH272775A patent/CH615664A5/de not_active IP Right Cessation
- 1975-03-04 CA CA221,222A patent/CA1077929A/en not_active Expired
- 1975-03-05 AR AR257851A patent/AR210074A1/es active
- 1975-03-05 DD DD184576A patent/DD118425A5/xx unknown
- 1975-03-05 IL IL46755A patent/IL46755A/xx unknown
- 1975-03-05 AT AT170275A patent/AT346839B/de not_active IP Right Cessation
- 1975-03-05 DK DK89475*#A patent/DK89475A/da unknown
- 1975-03-05 NO NO750731A patent/NO145882C/no unknown
- 1975-03-05 GB GB918575A patent/GB1470900A/en not_active Expired
- 1975-03-05 YU YU00526/75A patent/YU52675A/xx unknown
- 1975-03-05 LU LU71970A patent/LU71970A1/xx unknown
- 1975-03-05 ES ES435329A patent/ES435329A1/es not_active Expired
- 1975-03-05 DE DE19752509617 patent/DE2509617A1/de not_active Withdrawn
- 1975-03-05 FR FR7506878A patent/FR2262981B1/fr not_active Expired
- 1975-03-05 SU SU752111450A patent/SU659088A3/ru active
- 1975-03-06 NL NL7502667A patent/NL7502667A/xx unknown
- 1975-03-06 JP JP50027555A patent/JPS5136451A/ja active Pending
- 1975-03-06 FI FI750645A patent/FI62663C/fi not_active IP Right Cessation
- 1975-03-06 HU HU75DU233A patent/HU173838B/hu unknown
Also Published As
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE69231854T2 (de) | Substituierte (s)-3-phenylpiperidin derivate, deren herstellung und deren verwendung als dopamin autorezeptor antagonisten | |
DE2446010A1 (de) | 4-(monoalkylamino)benzoesaeurederivate und verfahren zu ihrer herstellung | |
DE3744947C2 (enrdf_load_html_response) | ||
DE3402060A1 (de) | Substituierte 5,11-dihydro-6h-dibenz(b,e)azepin-6-one, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
DE69232484T2 (de) | Hydroisochinolinderivate | |
DE2362754C2 (de) | Cyclopropylalkylaminoreste enthaltende Oxazolinverbindungen, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel | |
DE2851416A1 (de) | 2-(4-biphenylyl)-n-(diethylaminoalkyl)- propionamide, verfahren zu ihrer herstellung und diese enthaltende arzneimittel | |
CH615664A5 (en) | Process for the preparation of novel nitrogen-containing polycyclic compounds | |
DE2159324C2 (de) | Benzobicycloalkanamine,-aminoxide, Verfahren zu ihrer Herstellung und pharmazeutische Mittel, welche diese Verbindungen enthalten | |
DE2748466A1 (de) | 4a-aryloctahydro-1h-2-pyrindine | |
DE2513136C3 (de) | N-(1-Benzylpiperid-4-yl)-benzamide, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Präparate | |
DE2522218C3 (de) | Zusammensetzung für die Human- oder Veterinärmedizin, Methylaminderivate und Verfahren zu deren Herstellung | |
DE3226921A1 (de) | Neue bicyclische verbindungen und verfahren zu ihrer herstellung | |
DE2328896A1 (de) | Quaternaere phenylcycloalkylammoniumverbindungen und daraus hergestellte arzneipraeparate | |
DE2428200A1 (de) | Essigsaeurederivate, verfahren zu deren herstellung und diese derivate enthaltende arzneimittel | |
DE2530515C2 (de) | 4- bzw. 7-Hydroxy-4,5,6,7-tetrahydrothieno-[3,2-c] bzw.[2,3-c] pyridine, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittelzubereitungen | |
EP1270576B1 (de) | 3-Phenyl-3,7-diazabicyclo(3,3,1)nonan-Verbindungen sowie Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
DE1518311B1 (de) | N-(2-Diaethylaminoaethyl)-2-methoxy-3,4- bzw. 4,5-methylendioxybenzamid und deren pharmakologisch nicht giftige Saeureadditionssalze | |
DE2911377C3 (de) | 3-Hydroxy-4-hydroxymethyl-phenylglycin (Forphenicinol), dessen Hydrate und Salze, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel | |
CH615170A5 (enrdf_load_html_response) | ||
DE2055264C3 (de) | Thienyl(2) -essigsäurederivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zusammensetzungen | |
DE2636127A1 (de) | 2- eckige klammer auf (dimethylamino)- (3-pyridyl)-methyl eckige klammer zu -cyclohexanol und verwandte verbindungen, verfahren zur herstellung dieser verbindungen und diese enthaltende arzneimittel | |
DE1518311C (de) | N (2 Diathylaminoathyl) 2 methoxy 3,4 bzw 4,5 methylendioxybenzamid und deren pharmakologisch nicht giftige Saureadditions salze | |
DE1768445C (de) | N substituierte beta Oxybutyramid semisuccinate, deren Salze und ihre Her stellung | |
DE1670334C3 (de) | 5-Methyl-11 -(N-methyl-4-piperidylen)-5,6-dihydromorphanthridin und dessen pharmazeutisch geeignete Salze |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
PL | Patent ceased | ||
PL | Patent ceased |