CH533106A - Verfahren zur Herstellung von substituierten Azabicycloalkanen - Google Patents
Verfahren zur Herstellung von substituierten AzabicycloalkanenInfo
- Publication number
- CH533106A CH533106A CH509072A CH509072A CH533106A CH 533106 A CH533106 A CH 533106A CH 509072 A CH509072 A CH 509072A CH 509072 A CH509072 A CH 509072A CH 533106 A CH533106 A CH 533106A
- Authority
- CH
- Switzerland
- Prior art keywords
- thiocarbonyl
- decahydroquinoline
- cis
- methyl
- octahydroindole
- Prior art date
Links
- 239000004009 herbicide Substances 0.000 title claims description 3
- 239000000417 fungicide Substances 0.000 title 1
- 239000005648 plant growth regulator Substances 0.000 title 1
- 239000002253 acid Substances 0.000 claims abstract description 10
- 239000011230 binding agent Substances 0.000 claims abstract description 9
- 229910052736 halogen Inorganic materials 0.000 claims abstract 2
- -1 methylthio-thiocarbonyl Chemical group 0.000 claims description 35
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 claims description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- 239000001257 hydrogen Substances 0.000 claims description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 12
- 150000003254 radicals Chemical class 0.000 claims description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 11
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- 150000002431 hydrogen Chemical group 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 8
- 238000003756 stirring Methods 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 6
- IAQRGUVFOMOMEM-UHFFFAOYSA-N but-2-ene Chemical compound CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 238000001035 drying Methods 0.000 claims description 5
- 238000001704 evaporation Methods 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical group C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 claims description 4
- 241000233866 Fungi Species 0.000 claims description 3
- 239000002168 alkylating agent Substances 0.000 claims description 3
- 229940100198 alkylating agent Drugs 0.000 claims description 3
- 230000008020 evaporation Effects 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 3
- PDELQDSYLBLPQO-UHFFFAOYSA-N 2,3,3a,4,5,6,7,7a-octahydro-1h-indole Chemical compound C1CCCC2NCCC21 PDELQDSYLBLPQO-UHFFFAOYSA-N 0.000 claims description 2
- FALCMQXTWHPRIH-UHFFFAOYSA-N 2,3-dichloroprop-1-ene Chemical compound ClCC(Cl)=C FALCMQXTWHPRIH-UHFFFAOYSA-N 0.000 claims description 2
- XNMQEEKYCVKGBD-UHFFFAOYSA-N dimethylacetylene Natural products CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 claims description 2
- 230000002363 herbicidal effect Effects 0.000 claims description 2
- 230000003032 phytopathogenic effect Effects 0.000 claims description 2
- 150000002367 halogens Chemical group 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 abstract description 5
- 229910052783 alkali metal Inorganic materials 0.000 abstract description 2
- 229910052794 bromium Inorganic materials 0.000 abstract description 2
- 229910052801 chlorine Inorganic materials 0.000 abstract description 2
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 abstract description 2
- 150000001340 alkali metals Chemical group 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 241000196324 Embryophyta Species 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 230000015572 biosynthetic process Effects 0.000 description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 235000013399 edible fruits Nutrition 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 244000061456 Solanum tuberosum Species 0.000 description 2
- 235000002595 Solanum tuberosum Nutrition 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 235000012015 potatoes Nutrition 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- 230000017260 vegetative to reproductive phase transition of meristem Effects 0.000 description 2
- POTIYWUALSJREP-RKDXNWHRSA-N (4ar,8ar)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline Chemical compound N1CCC[C@H]2CCCC[C@H]21 POTIYWUALSJREP-RKDXNWHRSA-N 0.000 description 1
- POTIYWUALSJREP-DTWKUNHWSA-N (4as,8ar)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline Chemical compound N1CCC[C@@H]2CCCC[C@H]21 POTIYWUALSJREP-DTWKUNHWSA-N 0.000 description 1
- POTIYWUALSJREP-UHFFFAOYSA-N 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline Chemical class N1CCCC2CCCCC21 POTIYWUALSJREP-UHFFFAOYSA-N 0.000 description 1
- KSXNVNXOYIHKGJ-UHFFFAOYSA-N 1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline Chemical compound N1CCCC2CCCCC21.N1CCCC2CCCCC21 KSXNVNXOYIHKGJ-UHFFFAOYSA-N 0.000 description 1
- IIVWHGMLFGNMOW-UHFFFAOYSA-N 2-methylpropane Chemical compound C[C](C)C IIVWHGMLFGNMOW-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical compound ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- 244000144730 Amygdalus persica Species 0.000 description 1
- 244000099147 Ananas comosus Species 0.000 description 1
- 235000007119 Ananas comosus Nutrition 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000195493 Cryptophyta Species 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 244000141359 Malus pumila Species 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 240000008790 Musa x paradisiaca Species 0.000 description 1
- 208000002193 Pain Diseases 0.000 description 1
- 235000006040 Prunus persica var persica Nutrition 0.000 description 1
- 241000220324 Pyrus Species 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 241001148683 Zostera marina Species 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 235000021016 apples Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 235000021015 bananas Nutrition 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 125000004856 decahydroquinolinyl group Chemical group N1(CCCC2CCCCC12)* 0.000 description 1
- 230000035613 defoliation Effects 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 230000028245 fruit abscission Effects 0.000 description 1
- 230000005078 fruit development Effects 0.000 description 1
- 230000004345 fruit ripening Effects 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 230000035784 germination Effects 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 238000003306 harvesting Methods 0.000 description 1
- 235000008216 herbs Nutrition 0.000 description 1
- 150000002390 heteroarenes Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 230000028514 leaf abscission Effects 0.000 description 1
- 235000021374 legumes Nutrition 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 230000001151 other effect Effects 0.000 description 1
- 235000021017 pears Nutrition 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229910052712 strontium Inorganic materials 0.000 description 1
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/04—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms
- C07D215/08—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to the ring carbon atoms with acylated ring nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH509072A CH533106A (de) | 1971-01-14 | 1971-01-14 | Verfahren zur Herstellung von substituierten Azabicycloalkanen |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH55271A CH535537A (de) | 1971-01-14 | 1971-01-14 | Pflanzenbeeinflussendes und fungizides Mittel |
| CH509072A CH533106A (de) | 1971-01-14 | 1971-01-14 | Verfahren zur Herstellung von substituierten Azabicycloalkanen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH533106A true CH533106A (de) | 1973-01-31 |
Family
ID=4189629
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH509072A CH533106A (de) | 1971-01-14 | 1971-01-14 | Verfahren zur Herstellung von substituierten Azabicycloalkanen |
| CH55271A CH535537A (de) | 1971-01-14 | 1971-01-14 | Pflanzenbeeinflussendes und fungizides Mittel |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH55271A CH535537A (de) | 1971-01-14 | 1971-01-14 | Pflanzenbeeinflussendes und fungizides Mittel |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3839337A (enExample) |
| BE (1) | BE777998A (enExample) |
| CH (2) | CH533106A (enExample) |
| DD (1) | DD102563A5 (enExample) |
| DE (1) | DE2201500A1 (enExample) |
| FR (1) | FR2121833B1 (enExample) |
| HU (1) | HU163472B (enExample) |
| IL (1) | IL38482A0 (enExample) |
| IT (1) | IT946559B (enExample) |
| NL (1) | NL7200532A (enExample) |
| ZA (1) | ZA72226B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1400508A1 (de) * | 2002-09-20 | 2004-03-24 | Bayer Aktiengesellschaft | Dithiocarbaminsäureester |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4159902A (en) * | 1977-07-26 | 1979-07-03 | Schering Aktiengesellschaft | 1,3,3-Trimethyl-6-azabicyclo-(3.2.1)-octane-6-carboxylic acid ester, herbicides, process for making same and composition containing same |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1873934A (en) * | 1927-11-08 | 1932-08-23 | Ig Farbenindustrie Ag | Vulcanization accelerator |
| US3305576A (en) * | 1959-07-10 | 1967-02-21 | Monsanto Co | 3-chloropropyl diisopropylthiolcarbamate |
| NL277794A (enExample) * | 1961-05-01 | |||
| US3282978A (en) * | 1962-07-19 | 1966-11-01 | Standard Oil Co | Process for preparing s-(2-hydroxyl) esters |
| GB999806A (en) * | 1962-10-30 | 1965-07-28 | Monsanto Chemicals | New 1,2-dihydroquinoline derivatives |
| FR1571695A (enExample) * | 1967-06-22 | 1969-06-20 | ||
| US3639404A (en) * | 1968-12-13 | 1972-02-01 | Velsicol Chemical Corp | Alkylthiocarbonyldecahydroquinolines |
| FI49164C (fi) * | 1969-07-16 | 1975-04-10 | Agripat Sa | Herbisideissä käytettäviä substituoituja 2-atsabisykloalkaaneja. |
| CH525609A (de) * | 1969-08-01 | 1972-07-31 | Agripat Sa | Mittel zur Bekämpfung von Unkräutern und Ungräsern |
| US3705165A (en) * | 1970-08-05 | 1972-12-05 | Elmar Sturm | N-carbonyl derivatives of azabicyclooctanes |
| OA04064A (fr) * | 1971-01-14 | 1979-10-30 | Agripat Sa | Azabicycloalcanes utilisables comme herbicides. |
| US3557194A (en) * | 1971-01-19 | 1971-01-19 | Ferro Corp | Hydroxydithioaromatic acids,derivatives thereof and process for their manufacture |
-
1971
- 1971-01-14 CH CH509072A patent/CH533106A/de not_active IP Right Cessation
- 1971-01-14 CH CH55271A patent/CH535537A/de not_active IP Right Cessation
- 1971-12-30 DD DD160053A patent/DD102563A5/xx unknown
- 1971-12-30 IL IL38482A patent/IL38482A0/xx unknown
-
1972
- 1972-01-10 US US00216785A patent/US3839337A/en not_active Expired - Lifetime
- 1972-01-13 BE BE777998A patent/BE777998A/xx unknown
- 1972-01-13 ZA ZA720226A patent/ZA72226B/xx unknown
- 1972-01-13 FR FR7201133A patent/FR2121833B1/fr not_active Expired
- 1972-01-13 NL NL7200532A patent/NL7200532A/xx unknown
- 1972-01-13 DE DE19722201500 patent/DE2201500A1/de active Pending
- 1972-01-13 HU HUAI206A patent/HU163472B/hu unknown
- 1972-01-13 IT IT19345/72A patent/IT946559B/it active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1400508A1 (de) * | 2002-09-20 | 2004-03-24 | Bayer Aktiengesellschaft | Dithiocarbaminsäureester |
Also Published As
| Publication number | Publication date |
|---|---|
| BE777998A (fr) | 1972-07-13 |
| DE2201500A1 (de) | 1972-08-17 |
| DD102563A5 (enExample) | 1973-12-20 |
| US3839337A (en) | 1974-10-01 |
| FR2121833B1 (enExample) | 1974-12-13 |
| CH535537A (de) | 1973-04-15 |
| FR2121833A1 (enExample) | 1972-08-25 |
| IL38482A0 (en) | 1972-02-29 |
| NL7200532A (enExample) | 1972-07-18 |
| ZA72226B (en) | 1972-09-27 |
| IT946559B (it) | 1973-05-21 |
| HU163472B (enExample) | 1973-09-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3415820A1 (de) | 1-carbalkoxyalkyl-3-aryloxy-4-(2'-carboxyphenyl)-azet-2-one, diese enthaltende pflanzenwachstumsregulierende mittel und verfahren zum regulieren des pflanzenwachstums | |
| DD149009A5 (de) | Pflanzenwachstumsregulierende und fungizide mittel | |
| DD150424A5 (de) | Mittel zur regulierung des pflanzenwachstums | |
| DE1793229C3 (de) | Cyclohexylpentadiensäurederivate, ihre Herstellung und ihre Verwendung als Wachstumsregulatoren für Pflanzen | |
| DE3613649A1 (de) | Substituierte oximether, ihre verwendung als bioregulatoren zur senkung des endzogenen ethylenspiegels in pflanzen | |
| DE2657380A1 (de) | Halogenaethyl-sulfone, verfahren zu ihrer herstellung sowie ihre verwendung als pflanzenwachstumsregulatoren | |
| DD149935A5 (de) | Verfahren zur herstellung von racemen oder optisch aktivem 2-(propargyloxyimino)-1,7,7-trimethylbicyclo(2,2,1)heptan | |
| DE3226009A1 (de) | Als unkrautvernichtungs- und pflanzenwachstumsregulierungsmittel geeignete 2,4-hexadiensaeurederivate | |
| CH533106A (de) | Verfahren zur Herstellung von substituierten Azabicycloalkanen | |
| DE2706838A1 (de) | Mittel zur regulierung des pflanzenwachstums | |
| DE1955749A1 (de) | Amidophenylguanidine,Verfahren zu ihrer Herstellung und ihre fungizide Verwendung | |
| DE1302649B (de) | Sulfensaeurederivate, ein verfahren zu deren herstellung und deren verwendung | |
| DE3325761A1 (de) | Aroxy-pyrimidinyl-alkanole | |
| DE2601376A1 (de) | Phenoxycarbonsaeure-aryloxy(thio)carbonylaminomethylester, verfahren zu ihrer herstellung sowie ihre verwendung zur regulierung des pflanzenwachstums | |
| DE1642331A1 (de) | Herbizide Zubereitungen | |
| CH533109A (de) | Verfahren zur Herstellung von substituierten Azabicycloalkanen | |
| EP0154806A2 (de) | Substituierte Oxirane | |
| DE2149680C3 (de) | 2-Halogenäthyl-organooxy-sllane, deren Herstelung und Mittel zur Regulierung des Pflanzenwachstums CIBA-GEIGY AG, Basel (Schweiz) | |
| DE2119174C3 (de) | Pyridylimidokohlensäureester, Verfahren zur ihrer Herstellung und ihre Verwendung als Mikrobizide | |
| DE2239412C3 (de) | 2-Halogenäthyl-methyl-diorganooxysilane und Mittet zur Regulierung des Pflanzenwachstums | |
| DE2035184A1 (de) | 3-Aryloxy-l,2-propandiole, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2356892A1 (de) | Alpha-pyron-derivate, ihre herstellung und ihre verwendung als selektivherbicide, pflanzenwachstumsregulatoren und fungicide | |
| DE1542971A1 (de) | Das Pflanzenwachstum beeinflussende Mittel | |
| DE2439104B2 (de) | Cyclohexanderivate, verfahren zu ihrer herstellung und ihre verwendung als herbizide | |
| DE2619841A1 (de) | Mittel zur regulierung des pflanzenwachstums |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |