CH472835A - Schädlingsbekämpfungsmittel - Google Patents
SchädlingsbekämpfungsmittelInfo
- Publication number
- CH472835A CH472835A CH1297565A CH1297565A CH472835A CH 472835 A CH472835 A CH 472835A CH 1297565 A CH1297565 A CH 1297565A CH 1297565 A CH1297565 A CH 1297565A CH 472835 A CH472835 A CH 472835A
- Authority
- CH
- Switzerland
- Prior art keywords
- sep
- phenyl
- methyl
- urea
- active component
- Prior art date
Links
- 239000000575 pesticide Substances 0.000 title claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 239000004202 carbamide Substances 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052717 sulfur Chemical group 0.000 claims description 3
- 239000011593 sulfur Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 description 25
- 150000001875 compounds Chemical class 0.000 description 18
- 235000013877 carbamide Nutrition 0.000 description 15
- 150000001412 amines Chemical class 0.000 description 12
- 230000000844 anti-bacterial effect Effects 0.000 description 11
- 239000000047 product Substances 0.000 description 10
- 150000003672 ureas Chemical class 0.000 description 8
- 239000000344 soap Substances 0.000 description 7
- 239000003599 detergent Substances 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 6
- 241000233866 Fungi Species 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- 238000004140 cleaning Methods 0.000 description 5
- -1 halocarbon ester Chemical class 0.000 description 5
- 241000894006 Bacteria Species 0.000 description 4
- 241000237858 Gastropoda Species 0.000 description 4
- 241000238631 Hexapoda Species 0.000 description 4
- 241000607479 Yersinia pestis Species 0.000 description 4
- 239000012459 cleaning agent Substances 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- 230000000249 desinfective effect Effects 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 244000005700 microbiome Species 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- 229920003023 plastic Polymers 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 150000003585 thioureas Chemical class 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 239000003899 bactericide agent Substances 0.000 description 3
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 3
- 230000002538 fungal effect Effects 0.000 description 3
- 230000000855 fungicidal effect Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000004659 sterilization and disinfection Methods 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- YMVFJGSXZNNUDW-UHFFFAOYSA-N (4-chlorophenyl)methanamine Chemical compound NCC1=CC=C(Cl)C=C1 YMVFJGSXZNNUDW-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- 230000000895 acaricidal effect Effects 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 230000000843 anti-fungal effect Effects 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000003115 biocidal effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000645 desinfectant Substances 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- FLKPEMZONWLCSK-UHFFFAOYSA-N diethyl phthalate Chemical compound CCOC(=O)C1=CC=CC=C1C(=O)OCC FLKPEMZONWLCSK-UHFFFAOYSA-N 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 230000036074 healthy skin Effects 0.000 description 2
- 230000000749 insecticidal effect Effects 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- 238000004321 preservation Methods 0.000 description 2
- 235000018102 proteins Nutrition 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- IBKDNYJEYFQCER-UHFFFAOYSA-N (2,4,6-trichlorophenyl)methanamine Chemical compound NCC1=C(Cl)C=C(Cl)C=C1Cl IBKDNYJEYFQCER-UHFFFAOYSA-N 0.000 description 1
- SJUKJZSTBBSGHF-UHFFFAOYSA-N (2,4-dichlorophenyl)methanamine Chemical compound NCC1=CC=C(Cl)C=C1Cl SJUKJZSTBBSGHF-UHFFFAOYSA-N 0.000 description 1
- UXMFUBINPABFSZ-UHFFFAOYSA-N (3,4-dibromophenyl)methanamine Chemical compound NCC1=CC=C(Br)C(Br)=C1 UXMFUBINPABFSZ-UHFFFAOYSA-N 0.000 description 1
- IXHNFOOSLAWRBQ-UHFFFAOYSA-N (3,4-dichlorophenyl)methanamine Chemical compound NCC1=CC=C(Cl)C(Cl)=C1 IXHNFOOSLAWRBQ-UHFFFAOYSA-N 0.000 description 1
- FVJIUQSKXOYFKG-UHFFFAOYSA-N (3,4-dichlorophenyl)methanol Chemical compound OCC1=CC=C(Cl)C(Cl)=C1 FVJIUQSKXOYFKG-UHFFFAOYSA-N 0.000 description 1
- XRNVSPDQTPVECU-UHFFFAOYSA-N (4-bromophenyl)methanamine Chemical compound NCC1=CC=C(Br)C=C1 XRNVSPDQTPVECU-UHFFFAOYSA-N 0.000 description 1
- NBJZEUQTGLSUOB-UHFFFAOYSA-N 1-chloro-4-isocyanato-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC(N=C=O)=CC=C1Cl NBJZEUQTGLSUOB-UHFFFAOYSA-N 0.000 description 1
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical class CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 1
- GUMCAKKKNKYFEB-UHFFFAOYSA-N 2,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C=C1Cl GUMCAKKKNKYFEB-UHFFFAOYSA-N 0.000 description 1
- XOGYQVITULCUGU-UHFFFAOYSA-N 3,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C(Cl)=C1 XOGYQVITULCUGU-UHFFFAOYSA-N 0.000 description 1
- XFKLCOFARDPKCT-UHFFFAOYSA-N 3,4-dibromo-2-hydroxy-n-phenylbenzamide Chemical compound OC1=C(Br)C(Br)=CC=C1C(=O)NC1=CC=CC=C1 XFKLCOFARDPKCT-UHFFFAOYSA-N 0.000 description 1
- HJTHJFPEAHKOBL-UHFFFAOYSA-N 3,4-dichloro-2-hydroxy-N-phenylbenzamide Chemical compound ClC=1C(=C(C(C(=O)NC2=CC=CC=C2)=CC=1)O)Cl HJTHJFPEAHKOBL-UHFFFAOYSA-N 0.000 description 1
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 1
- JPVKCHIPRSQDKL-UHFFFAOYSA-N 3-aminobenzenesulfonamide Chemical compound NC1=CC=CC(S(N)(=O)=O)=C1 JPVKCHIPRSQDKL-UHFFFAOYSA-N 0.000 description 1
- XQVCBOLNTSUFGD-UHFFFAOYSA-N 3-chloro-4-methoxyaniline Chemical compound COC1=CC=C(N)C=C1Cl XQVCBOLNTSUFGD-UHFFFAOYSA-N 0.000 description 1
- RQKFYFNZSHWXAW-UHFFFAOYSA-N 3-chloro-p-toluidine Chemical compound CC1=CC=C(N)C=C1Cl RQKFYFNZSHWXAW-UHFFFAOYSA-N 0.000 description 1
- LYUQWQRTDLVQGA-UHFFFAOYSA-N 3-phenylpropylamine Chemical class NCCCC1=CC=CC=C1 LYUQWQRTDLVQGA-UHFFFAOYSA-N 0.000 description 1
- QIKYZXDTTPVVAC-UHFFFAOYSA-N 4-Aminobenzamide Chemical compound NC(=O)C1=CC=C(N)C=C1 QIKYZXDTTPVVAC-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- OZRGLPAXIYOWIG-HZPUXBNGSA-N 4-nitrobenzylamine Chemical compound CC(C)C(CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4=CCCC[C@]4(C)[C@H]3CC[C@]12C)=O OZRGLPAXIYOWIG-HZPUXBNGSA-N 0.000 description 1
- ASPDJZINBYYZRU-UHFFFAOYSA-N 5-amino-2-chlorobenzotrifluoride Chemical compound NC1=CC=C(Cl)C(C(F)(F)F)=C1 ASPDJZINBYYZRU-UHFFFAOYSA-N 0.000 description 1
- VRFMFQHSDWKYDM-UHFFFAOYSA-N 6-o-benzyl 1-o-butyl hexanedioate Chemical compound CCCCOC(=O)CCCCC(=O)OCC1=CC=CC=C1 VRFMFQHSDWKYDM-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- 241000228212 Aspergillus Species 0.000 description 1
- 241000228245 Aspergillus niger Species 0.000 description 1
- 241000237358 Biomphalaria glabrata Species 0.000 description 1
- 208000035985 Body Odor Diseases 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- KROPAYFIHAIPLB-UHFFFAOYSA-N ClC=1C=C(N)C=C(C1)Cl.ClC=1C=C(N)C=CC1Cl Chemical compound ClC=1C=C(N)C=C(C1)Cl.ClC=1C=C(N)C=CC1Cl KROPAYFIHAIPLB-UHFFFAOYSA-N 0.000 description 1
- VOWAEIGWURALJQ-UHFFFAOYSA-N Dicyclohexyl phthalate Chemical compound C=1C=CC=C(C(=O)OC2CCCCC2)C=1C(=O)OC1CCCCC1 VOWAEIGWURALJQ-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical class C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 241000237852 Mollusca Species 0.000 description 1
- SUZRRICLUFMAQD-UHFFFAOYSA-N N-Methyltaurine Chemical compound CNCCS(O)(=O)=O SUZRRICLUFMAQD-UHFFFAOYSA-N 0.000 description 1
- 241000244206 Nematoda Species 0.000 description 1
- 206010067482 No adverse event Diseases 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical class NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 1
- 241000235527 Rhizopus Species 0.000 description 1
- 241000235546 Rhizopus stolonifer Species 0.000 description 1
- 206010040880 Skin irritation Diseases 0.000 description 1
- 206010040904 Skin odour abnormal Diseases 0.000 description 1
- 241000295644 Staphylococcaceae Species 0.000 description 1
- 241000191940 Staphylococcus Species 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- KYPYTERUKNKOLP-UHFFFAOYSA-N Tetrachlorobisphenol A Chemical compound C=1C(Cl)=C(O)C(Cl)=CC=1C(C)(C)C1=CC(Cl)=C(O)C(Cl)=C1 KYPYTERUKNKOLP-UHFFFAOYSA-N 0.000 description 1
- 241001459572 Trichophyton interdigitale Species 0.000 description 1
- YKNZTUQUXUXTLE-UHFFFAOYSA-N [3-(trifluoromethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(C(F)(F)F)=C1 YKNZTUQUXUXTLE-UHFFFAOYSA-N 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- VJHCJDRQFCCTHL-UHFFFAOYSA-N acetic acid 2,3,4,5,6-pentahydroxyhexanal Chemical compound CC(O)=O.OCC(O)C(O)C(O)C(O)C=O VJHCJDRQFCCTHL-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 230000001857 anti-mycotic effect Effects 0.000 description 1
- 230000002141 anti-parasite Effects 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000003096 antiparasitic agent Substances 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- UREZNYTWGJKWBI-UHFFFAOYSA-M benzethonium chloride Chemical compound [Cl-].C1=CC(C(C)(C)CC(C)(C)C)=CC=C1OCCOCC[N+](C)(C)CC1=CC=CC=C1 UREZNYTWGJKWBI-UHFFFAOYSA-M 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 150000003939 benzylamines Chemical class 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001714 carbamic acid halides Chemical class 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- HDFRDWFLWVCOGP-UHFFFAOYSA-N carbonothioic O,S-acid Chemical compound OC(S)=O HDFRDWFLWVCOGP-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000005018 casein Substances 0.000 description 1
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 1
- 235000021240 caseins Nutrition 0.000 description 1
- 150000001767 cationic compounds Chemical class 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- YMKDRGPMQRFJGP-UHFFFAOYSA-M cetylpyridinium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 YMKDRGPMQRFJGP-UHFFFAOYSA-M 0.000 description 1
- 229960001927 cetylpyridinium chloride Drugs 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 235000013365 dairy product Nutrition 0.000 description 1
- 229940100539 dibutyl adipate Drugs 0.000 description 1
- CEJLBZWIKQJOAT-UHFFFAOYSA-N dichloroisocyanuric acid Chemical compound ClN1C(=O)NC(=O)N(Cl)C1=O CEJLBZWIKQJOAT-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- FBSAITBEAPNWJG-UHFFFAOYSA-N dimethyl phthalate Natural products CC(=O)OC1=CC=CC=C1OC(C)=O FBSAITBEAPNWJG-UHFFFAOYSA-N 0.000 description 1
- REQPQFUJGGOFQL-UHFFFAOYSA-N dimethylcarbamothioyl n,n-dimethylcarbamodithioate Chemical compound CN(C)C(=S)SC(=S)N(C)C REQPQFUJGGOFQL-UHFFFAOYSA-N 0.000 description 1
- 229960001826 dimethylphthalate Drugs 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- 244000053095 fungal pathogen Species 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- ACGUYXCXAPNIKK-UHFFFAOYSA-N hexachlorophene Chemical compound OC1=C(Cl)C=C(Cl)C(Cl)=C1CC1=C(O)C(Cl)=CC(Cl)=C1Cl ACGUYXCXAPNIKK-UHFFFAOYSA-N 0.000 description 1
- 229960004068 hexachlorophene Drugs 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 230000002147 killing effect Effects 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 239000002324 mouth wash Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- QKFJKGMPGYROCL-UHFFFAOYSA-N phenyl isothiocyanate Chemical class S=C=NC1=CC=CC=C1 QKFJKGMPGYROCL-UHFFFAOYSA-N 0.000 description 1
- 150000007925 phenylethylamine derivatives Chemical class 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- WKEDVNSFRWHDNR-UHFFFAOYSA-N salicylanilide Chemical compound OC1=CC=CC=C1C(=O)NC1=CC=CC=C1 WKEDVNSFRWHDNR-UHFFFAOYSA-N 0.000 description 1
- 229950000975 salicylanilide Drugs 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 239000002453 shampoo Substances 0.000 description 1
- 230000036556 skin irritation Effects 0.000 description 1
- 231100000475 skin irritation Toxicity 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000009182 swimming Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- BDOBMVIEWHZYDL-UHFFFAOYSA-N tetrachlorosalicylanilide Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C(=O)NC1=CC=CC=C1 BDOBMVIEWHZYDL-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 1
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical compound CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 1
- 229960002447 thiram Drugs 0.000 description 1
- 239000000606 toothpaste Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000007056 transamidation reaction Methods 0.000 description 1
- KVSKGMLNBAPGKH-UHFFFAOYSA-N tribromosalicylanilide Chemical compound OC1=C(Br)C=C(Br)C=C1C(=O)NC1=CC=C(Br)C=C1 KVSKGMLNBAPGKH-UHFFFAOYSA-N 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- 244000045561 useful plants Species 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/16—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/30—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by halogen atoms, or by nitro or nitroso groups
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S516/00—Colloid systems and wetting agents; subcombinations thereof; processes of
- Y10S516/01—Wetting, emulsifying, dispersing, or stabilizing agents
- Y10S516/07—Organic amine, amide, or n-base containing
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1297565A CH472835A (de) | 1964-12-17 | 1964-12-17 | Schädlingsbekämpfungsmittel |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1297565A CH472835A (de) | 1964-12-17 | 1964-12-17 | Schädlingsbekämpfungsmittel |
| CH1631464A CH429291A (de) | 1964-12-17 | 1964-12-17 | Verfahren zum Schützen von Textilien gegen Schädlinge |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH472835A true CH472835A (de) | 1969-05-31 |
Family
ID=4416233
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1297565A CH472835A (de) | 1964-12-17 | 1964-12-17 | Schädlingsbekämpfungsmittel |
| CH1631464A CH429291A (de) | 1964-12-17 | 1964-12-17 | Verfahren zum Schützen von Textilien gegen Schädlinge |
| CH1631464D CH1631464A4 (enExample) | 1964-12-17 | 1964-12-17 |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1631464A CH429291A (de) | 1964-12-17 | 1964-12-17 | Verfahren zum Schützen von Textilien gegen Schädlinge |
| CH1631464D CH1631464A4 (enExample) | 1964-12-17 | 1964-12-17 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3660484A (enExample) |
| JP (1) | JPS49171B1 (enExample) |
| AT (2) | AT269555B (enExample) |
| BE (1) | BE673848A (enExample) |
| BR (1) | BR6575803D0 (enExample) |
| CH (3) | CH472835A (enExample) |
| DE (1) | DE1518688A1 (enExample) |
| ES (1) | ES320818A1 (enExample) |
| FR (1) | FR1488231A (enExample) |
| GB (1) | GB1057966A (enExample) |
| IL (1) | IL24772A (enExample) |
| NL (1) | NL6516437A (enExample) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4078913A (en) * | 1970-04-08 | 1978-03-14 | Tetsuo Takematsu | Herbicidal 3-(2-phenylisopropyl)urea derivatives |
| DE2200325C2 (de) * | 1971-12-31 | 1986-10-30 | Showa Denko K.K., Tokio/Tokyo | Verwendung von 3-(1-Phenylisopropyl)-harnstoff-Derivaten als Herbizide |
| JPS5224104B2 (enExample) * | 1974-10-07 | 1977-06-29 | ||
| JPS5312844A (en) * | 1976-07-20 | 1978-02-04 | Nippon Tokushu Noyaku Seizo Kk | Nn44halogenobenzyllnnmethyl*or nonsubstitutedd*cycloalkylln**phenylurea or thiourea compounds* their preparation and fungicides containing the same as active constituents |
| JPS5419943A (en) * | 1977-07-12 | 1979-02-15 | Nippon Tokushu Noyaku Seizo Kk | Urea or thiourea compounds, their preparation, and agricultural and horticultural fungicides comprising them as active constituents |
| US4237166A (en) * | 1978-02-06 | 1980-12-02 | Abbott Laboratories | 1-Acryloyl-3-(substituted) phenyl ureas |
| US4332821A (en) * | 1978-02-06 | 1982-06-01 | Abbott Laboratories | 1-Acryloyl-3-(substituted)phenyl ureas |
| US4203921A (en) * | 1978-10-30 | 1980-05-20 | Technicon Instruments Corporation | Stabilized reagents |
| FR2477537A1 (fr) * | 1980-03-07 | 1981-09-11 | Francaise Sucrerie | Nouvelles guanidines acylees, urees et urees substituees, leur procede de fabrication et leur application en tant que medicaments |
| DE3132690A1 (de) * | 1981-08-19 | 1983-03-17 | Bayer Ag, 5090 Leverkusen | (thio)-harnstoffe, ein verfahren zu ihrer herstellung, ihre verwendung als pflanzenschutzmittel und zwischenprodukte zu ihrer herstellung |
| US4465509A (en) * | 1982-08-30 | 1984-08-14 | The Japan Carlit Co., Ltd. | Urea compounds and herbicidal compositions containing them |
| JPS59101443A (ja) * | 1982-12-03 | 1984-06-12 | Nippon Tokushu Noyaku Seizo Kk | 置換ベンジルシクロアルケニルウレア誘導体その製法及び農園芸用殺菌剤 |
| US5003106A (en) * | 1983-07-19 | 1991-03-26 | American Cyanamid Company | Antiatherosclerotic ureas and thioureas |
| US4659736A (en) * | 1984-01-21 | 1987-04-21 | Bayer Aktiengesellschaft | Benzoyl urea compounds as agents for repelling snails and slugs |
| FR2578392B1 (fr) * | 1985-03-07 | 1990-07-06 | Bayer Ag | Produits a base de benzoylurees pour la protection des vegetaux contre les escargots et les limaces |
| IT1201113B (it) * | 1986-01-10 | 1989-01-27 | Fmc Corp | Composti erbicidi |
| US4846882A (en) * | 1986-01-10 | 1989-07-11 | Fmc Corporation | Herbicidal aryl tetrahydrophthalimides |
| JPH0678298B2 (ja) * | 1988-03-30 | 1994-10-05 | ワーナー‐ランバート・コンパニー | Ｎ‐〔〔（２，６‐ジ置換）フエニル〕‐ｎ′‐アリールアルキル〕尿素 |
| US5593993A (en) * | 1991-08-02 | 1997-01-14 | Medivir Ab | Method for inhibition of HIV related viruses |
| IL102548A (en) * | 1991-08-02 | 1998-08-16 | Medivir Ab | Thiourea derivatives for use in the preparation of medicaments for the inhibition of hiv and the treatment of aids and some such novel compounds |
| JP2003524574A (ja) * | 1997-08-05 | 2003-08-19 | ノボ ノルディスク アクティーゼルスカブ | ２，５−及び３，５−二置換アニリン誘導体、その調製及び使用 |
| WO2008043840A2 (en) * | 2006-10-13 | 2008-04-17 | Lica Pharmaceuticals | Anti-infective thiourea compounds |
| US10609933B2 (en) | 2015-03-13 | 2020-04-07 | Gea Food Solutions Bakel B.V. | Method for cleaning and storing of a mould drum |
| CN111100038A (zh) * | 2019-12-27 | 2020-05-05 | 中国农业大学 | 一种具有赤霉素功能抑制活性的脲类化合物及其制备方法与应用 |
-
1964
- 1964-12-17 CH CH1297565A patent/CH472835A/de not_active IP Right Cessation
- 1964-12-17 CH CH1631464A patent/CH429291A/de unknown
- 1964-12-17 CH CH1631464D patent/CH1631464A4/xx unknown
-
1965
- 1965-11-16 ES ES0320818A patent/ES320818A1/es not_active Expired
- 1965-11-26 AT AT1066265A patent/AT269555B/de active
- 1965-11-26 AT AT303768A patent/AT290736B/de not_active IP Right Cessation
- 1965-12-08 FR FR41427A patent/FR1488231A/fr not_active Expired
- 1965-12-09 DE DE19651518688 patent/DE1518688A1/de active Pending
- 1965-12-12 IL IL24772A patent/IL24772A/xx unknown
- 1965-12-14 GB GB53093/65A patent/GB1057966A/en not_active Expired
- 1965-12-16 BE BE673848A patent/BE673848A/xx unknown
- 1965-12-16 NL NL6516437A patent/NL6516437A/xx unknown
- 1965-12-17 BR BR175803/65A patent/BR6575803D0/pt unknown
- 1965-12-17 JP JP40077344A patent/JPS49171B1/ja active Pending
-
1969
- 1969-10-02 US US863769A patent/US3660484A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CH429291A (de) | 1966-10-15 |
| BE673848A (enExample) | 1966-06-16 |
| AT269555B (de) | 1969-03-25 |
| IL24772A (en) | 1970-02-19 |
| CH1631464A4 (enExample) | 1966-10-15 |
| GB1057966A (en) | 1967-02-08 |
| DE1518688A1 (de) | 1969-03-13 |
| US3660484A (en) | 1972-05-02 |
| BR6575803D0 (pt) | 1973-11-29 |
| ES320818A1 (es) | 1966-07-16 |
| AT290736B (de) | 1971-06-11 |
| FR1488231A (fr) | 1967-07-13 |
| JPS49171B1 (enExample) | 1974-01-05 |
| NL6516437A (enExample) | 1966-06-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH472835A (de) | Schädlingsbekämpfungsmittel | |
| DE1693156C3 (de) | N-iDichlorbenzyl^N·-^dichlorphenyl)-thioharnstoffe und diese enthaltende biocide Mittel | |
| DE1695670C3 (de) | Isothiazolone und ihre Verwendung zur Bekämpfung von Bakterien und Pilzen | |
| DE1802739A1 (de) | Neue biozide Mittel | |
| DE69028461T2 (de) | Triazin-derivate und unkrautvertilgungsmittel daraus | |
| DE1168606B (de) | Insektizides und bakterizides Mittel | |
| DE2312956A1 (de) | Mittel zum bekaempfen von flunguserkrankungen bei pflanzen | |
| DE2422243A1 (de) | Carbanilide und deren herstellung | |
| DE1542739A1 (de) | Schaedlingsbekaempfungsmittel | |
| CH486841A (de) | Schädlingsbekämpfungsmittel bzw. ein vor dem Befall durch Schädlinge geschütztes nichttextiles Erzeugnis | |
| DE2108975B2 (de) | N-Acyl-Diurethane sowie diese enthaltendes herbizides Mittel | |
| DE1492307A1 (de) | Schaedlingsbekaempfungsmittel | |
| DE1904004A1 (de) | Schaedlingsbekaempfungsmittel | |
| DE2210540C2 (de) | Cyanphenylcarbonate, Verfahren zu deren Herstellung sowie diese enthaltende herbizide Mittel | |
| DE1932370A1 (de) | Neue keimtoetende Mittel | |
| DE1617982A1 (de) | Mittel zur Bekaempfung von schaedlichen Mikroorganismen | |
| CH539599A (de) | Verfahren zur Herstellung von bakterizid wirksamen Kohlensäure-bis-(phenoxyphenyl)-estern und ihre Verwendung | |
| CH480008A (de) | Schädlingsbekämpfungsmittel | |
| DE1617992A1 (de) | Antimikrobielles Mittel | |
| CH480011A (de) | Biocides Mittel | |
| DE2549417A1 (de) | Neue benzolderivate | |
| DE1542842A1 (de) | Schaedlingsbekaempfungsmittel | |
| DE1024284B (de) | Schaedlingsbekaempfungsmittel | |
| US3829485A (en) | Thiourea compounds and biocidal preparations containing them | |
| CH411449A (de) | Verfahren zur Bekämpfung von Schädlingen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |