CH449009A - Verfahren zur Herstellung von heteroacetylenischen Verbindungen - Google Patents
Verfahren zur Herstellung von heteroacetylenischen VerbindungenInfo
- Publication number
- CH449009A CH449009A CH1525162A CH1525162A CH449009A CH 449009 A CH449009 A CH 449009A CH 1525162 A CH1525162 A CH 1525162A CH 1525162 A CH1525162 A CH 1525162A CH 449009 A CH449009 A CH 449009A
- Authority
- CH
- Switzerland
- Prior art keywords
- bis
- reaction
- metal
- complex
- compounds
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 74
- 238000000034 method Methods 0.000 title claims description 19
- 238000002360 preparation method Methods 0.000 title claims description 13
- 230000008569 process Effects 0.000 title claims description 10
- -1 ethinyl hydrocarbon Chemical class 0.000 claims description 120
- 238000006243 chemical reaction Methods 0.000 claims description 60
- 150000001412 amines Chemical class 0.000 claims description 39
- 150000003839 salts Chemical class 0.000 claims description 36
- 229930195733 hydrocarbon Natural products 0.000 claims description 35
- 229910052751 metal Inorganic materials 0.000 claims description 33
- 239000002184 metal Substances 0.000 claims description 33
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 31
- 239000001301 oxygen Substances 0.000 claims description 31
- 229910052760 oxygen Inorganic materials 0.000 claims description 31
- 239000004215 Carbon black (E152) Substances 0.000 claims description 27
- 125000005842 heteroatom Chemical group 0.000 claims description 10
- 150000002738 metalloids Chemical group 0.000 claims description 10
- 150000000475 acetylene derivatives Chemical class 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- BLRXYTIIKIPJQL-UHFFFAOYSA-N dicarbide(1-) Chemical compound [C-]#C BLRXYTIIKIPJQL-UHFFFAOYSA-N 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 3
- 229910052752 metalloid Inorganic materials 0.000 claims description 2
- XMIJDTGORVPYLW-UHFFFAOYSA-N [SiH2] Chemical group [SiH2] XMIJDTGORVPYLW-UHFFFAOYSA-N 0.000 claims 1
- 239000000047 product Substances 0.000 description 47
- 229910052757 nitrogen Inorganic materials 0.000 description 46
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 38
- 229920000642 polymer Polymers 0.000 description 33
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- 150000002430 hydrocarbons Chemical class 0.000 description 32
- 239000000243 solution Substances 0.000 description 27
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 24
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 19
- 239000000126 substance Substances 0.000 description 19
- 229910052744 lithium Inorganic materials 0.000 description 17
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 16
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 16
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 16
- 239000010949 copper Substances 0.000 description 16
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 16
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 15
- 229910052802 copper Inorganic materials 0.000 description 15
- 239000002904 solvent Substances 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- 239000007787 solid Substances 0.000 description 11
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 10
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 10
- 238000007254 oxidation reaction Methods 0.000 description 10
- YWWDBCBWQNCYNR-UHFFFAOYSA-N trimethylphosphine Chemical compound CP(C)C YWWDBCBWQNCYNR-UHFFFAOYSA-N 0.000 description 10
- 239000002585 base Substances 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 150000001879 copper Chemical class 0.000 description 9
- 229940045803 cuprous chloride Drugs 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 238000005691 oxidative coupling reaction Methods 0.000 description 9
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 8
- JJLJMEJHUUYSSY-UHFFFAOYSA-L Copper hydroxide Chemical compound [OH-].[OH-].[Cu+2] JJLJMEJHUUYSSY-UHFFFAOYSA-L 0.000 description 8
- 150000001247 metal acetylides Chemical class 0.000 description 8
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 8
- 229920000768 polyamine Polymers 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- HTDIUWINAKAPER-UHFFFAOYSA-N trimethylarsine Chemical compound C[As](C)C HTDIUWINAKAPER-UHFFFAOYSA-N 0.000 description 8
- 125000001931 aliphatic group Chemical group 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 150000003512 tertiary amines Chemical class 0.000 description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 6
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 6
- 230000003647 oxidation Effects 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 125000005843 halogen group Chemical group 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 150000002894 organic compounds Chemical class 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- BYLOHCRAPOSXLY-UHFFFAOYSA-N dichloro(diethyl)silane Chemical compound CC[Si](Cl)(Cl)CC BYLOHCRAPOSXLY-UHFFFAOYSA-N 0.000 description 4
- SMBQBQBNOXIFSF-UHFFFAOYSA-N dilithium Chemical class [Li][Li] SMBQBQBNOXIFSF-UHFFFAOYSA-N 0.000 description 4
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 229920006158 high molecular weight polymer Polymers 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 150000002739 metals Chemical class 0.000 description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 3
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 229940076286 cupric acetate Drugs 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- 229960002523 mercuric chloride Drugs 0.000 description 3
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- INIOZDBICVTGEO-UHFFFAOYSA-L palladium(ii) bromide Chemical compound Br[Pd]Br INIOZDBICVTGEO-UHFFFAOYSA-L 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 230000001105 regulatory effect Effects 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 150000003335 secondary amines Chemical class 0.000 description 3
- BPLUKJNHPBNVQL-UHFFFAOYSA-N triphenylarsine Chemical compound C1=CC=CC=C1[As](C=1C=CC=CC=1)C1=CC=CC=C1 BPLUKJNHPBNVQL-UHFFFAOYSA-N 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- NURQLCJSMXZBPC-UHFFFAOYSA-N 3,4-dimethylpyridine Chemical compound CC1=CC=NC=C1C NURQLCJSMXZBPC-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 229910000074 antimony hydride Inorganic materials 0.000 description 2
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical compound [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 229910000072 bismuth hydride Inorganic materials 0.000 description 2
- BPBOBPIKWGUSQG-UHFFFAOYSA-N bismuthane Chemical compound [BiH3] BPBOBPIKWGUSQG-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 239000003575 carbonaceous material Substances 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 2
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 230000001427 coherent effect Effects 0.000 description 2
- 150000004699 copper complex Chemical class 0.000 description 2
- BERDEBHAJNAUOM-UHFFFAOYSA-N copper(I) oxide Inorganic materials [Cu]O[Cu] BERDEBHAJNAUOM-UHFFFAOYSA-N 0.000 description 2
- WIVXEZIMDUGYRW-UHFFFAOYSA-L copper(i) sulfate Chemical compound [Cu+].[Cu+].[O-]S([O-])(=O)=O WIVXEZIMDUGYRW-UHFFFAOYSA-L 0.000 description 2
- LBJNMUFDOHXDFG-UHFFFAOYSA-N copper;hydrate Chemical compound O.[Cu].[Cu] LBJNMUFDOHXDFG-UHFFFAOYSA-N 0.000 description 2
- 229960003280 cupric chloride Drugs 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 239000002274 desiccant Substances 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- SRIHMZCTDWKFTQ-UHFFFAOYSA-N dibromo(diethyl)silane Chemical compound CC[Si](Br)(Br)CC SRIHMZCTDWKFTQ-UHFFFAOYSA-N 0.000 description 2
- VWWMOACCGFHMEV-UHFFFAOYSA-N dicarbide(2-) Chemical compound [C-]#[C-] VWWMOACCGFHMEV-UHFFFAOYSA-N 0.000 description 2
- 125000003963 dichloro group Chemical group Cl* 0.000 description 2
- OSXYHAQZDCICNX-UHFFFAOYSA-N dichloro(diphenyl)silane Chemical compound C=1C=CC=CC=1[Si](Cl)(Cl)C1=CC=CC=C1 OSXYHAQZDCICNX-UHFFFAOYSA-N 0.000 description 2
- XCIJVXCLNQFBEY-UHFFFAOYSA-N diethyl(methyl)stibane Chemical compound CC[Sb](C)CC XCIJVXCLNQFBEY-UHFFFAOYSA-N 0.000 description 2
- IZGYEHWMAUNJHX-UHFFFAOYSA-N diiodo(phenyl)arsane Chemical compound I[As](I)C1=CC=CC=C1 IZGYEHWMAUNJHX-UHFFFAOYSA-N 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 150000005171 halobenzenes Chemical class 0.000 description 2
- YFIBSNDOVCWPBL-UHFFFAOYSA-N hexa-1,5-diyne Chemical compound C#CCCC#C YFIBSNDOVCWPBL-UHFFFAOYSA-N 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 239000003446 ligand Substances 0.000 description 2
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 2
- ARNWQMJQALNBBV-UHFFFAOYSA-N lithium carbide Chemical compound [Li+].[Li+].[C-]#[C-] ARNWQMJQALNBBV-UHFFFAOYSA-N 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 229910001507 metal halide Inorganic materials 0.000 description 2
- 150000005309 metal halides Chemical class 0.000 description 2
- FXHJGPDCPMCUKW-UHFFFAOYSA-N n,n-dimethyl-2-pyridin-2-ylethanamine Chemical compound CN(C)CCC1=CC=CC=N1 FXHJGPDCPMCUKW-UHFFFAOYSA-N 0.000 description 2
- GVWISOJSERXQBM-UHFFFAOYSA-N n-methylpropan-1-amine Chemical compound CCCNC GVWISOJSERXQBM-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- BHZSLLSDZFAPFH-UHFFFAOYSA-L palladium(2+);difluoride Chemical compound F[Pd]F BHZSLLSDZFAPFH-UHFFFAOYSA-L 0.000 description 2
- HNNUTDROYPGBMR-UHFFFAOYSA-L palladium(ii) iodide Chemical compound [Pd+2].[I-].[I-] HNNUTDROYPGBMR-UHFFFAOYSA-L 0.000 description 2
- RDOWQLZANAYVLL-UHFFFAOYSA-N phenanthridine Chemical compound C1=CC=C2C3=CC=CC=C3C=NC2=C1 RDOWQLZANAYVLL-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- 150000003053 piperidines Chemical class 0.000 description 2
- CLSUSRZJUQMOHH-UHFFFAOYSA-L platinum dichloride Chemical compound Cl[Pt]Cl CLSUSRZJUQMOHH-UHFFFAOYSA-L 0.000 description 2
- 229920001197 polyacetylene Polymers 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 150000003233 pyrroles Chemical class 0.000 description 2
- 150000003235 pyrrolidines Chemical class 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000004449 solid propellant Substances 0.000 description 2
- KXCAEQNNTZANTK-UHFFFAOYSA-N stannane Chemical compound [SnH4] KXCAEQNNTZANTK-UHFFFAOYSA-N 0.000 description 2
- 229910000080 stannane Inorganic materials 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 125000003039 tetrahydroisoquinolinyl group Chemical class C1(NCCC2=CC=CC=C12)* 0.000 description 2
- 150000003530 tetrahydroquinolines Chemical class 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- PORFVJURJXKREL-UHFFFAOYSA-N trimethylstibine Chemical compound C[Sb](C)C PORFVJURJXKREL-UHFFFAOYSA-N 0.000 description 2
- 125000005023 xylyl group Chemical group 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- BNBLWPUWMNURAX-UHFFFAOYSA-N 1-(2-methylpropyl)piperidine Chemical compound CC(C)CN1CCCCC1 BNBLWPUWMNURAX-UHFFFAOYSA-N 0.000 description 1
- OXHNLMTVIGZXSG-UHFFFAOYSA-N 1-Methylpyrrole Chemical compound CN1C=CC=C1 OXHNLMTVIGZXSG-UHFFFAOYSA-N 0.000 description 1
- FYAHQWZVWQIJAN-UHFFFAOYSA-N 1-N,1-N,2-N,2-N-tetrabenzylbut-3-ene-1,2-diamine Chemical compound C(C1=CC=CC=C1)N(CC(C=C)N(CC1=CC=CC=C1)CC1=CC=CC=C1)CC1=CC=CC=C1 FYAHQWZVWQIJAN-UHFFFAOYSA-N 0.000 description 1
- MSZMECSLCUDYQA-UHFFFAOYSA-N 1-decyl-2-methylpiperidine Chemical compound C(CCCCCCCCC)N1C(CCCC1)C MSZMECSLCUDYQA-UHFFFAOYSA-N 0.000 description 1
- PZBKBMNDNCCFDH-UHFFFAOYSA-N 1-decylpyrrolidine Chemical compound CCCCCCCCCCN1CCCC1 PZBKBMNDNCCFDH-UHFFFAOYSA-N 0.000 description 1
- MWZDIEIXRBWPLG-UHFFFAOYSA-N 1-methyl-1,2,4-triazole Chemical compound CN1C=NC=N1 MWZDIEIXRBWPLG-UHFFFAOYSA-N 0.000 description 1
- MCTWTZJPVLRJOU-UHFFFAOYSA-N 1-methyl-1H-imidazole Chemical compound CN1C=CN=C1 MCTWTZJPVLRJOU-UHFFFAOYSA-N 0.000 description 1
- PQMWKAXQYMNZOD-UHFFFAOYSA-N 1-methyl-3,4,4a,5-tetrahydro-2h-quinoline Chemical compound C1C=CC=C2N(C)CCCC21 PQMWKAXQYMNZOD-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- DVDGHRQOLYEZAE-UHFFFAOYSA-N 1-n,1-n,2-n,2-n-tetramethylcyclohexane-1,2-diamine Chemical compound CN(C)C1CCCCC1N(C)C DVDGHRQOLYEZAE-UHFFFAOYSA-N 0.000 description 1
- BSFGTZJUEHNQPB-UHFFFAOYSA-N 1-n,1-n,3-n,3-n-tetra(propan-2-yl)butane-1,3-diamine Chemical compound CC(C)N(C(C)C)CCC(C)N(C(C)C)C(C)C BSFGTZJUEHNQPB-UHFFFAOYSA-N 0.000 description 1
- AXFVIWBTKYFOCY-UHFFFAOYSA-N 1-n,1-n,3-n,3-n-tetramethylbutane-1,3-diamine Chemical compound CN(C)C(C)CCN(C)C AXFVIWBTKYFOCY-UHFFFAOYSA-N 0.000 description 1
- GUANVAUATHUDQB-UHFFFAOYSA-N 1-n,1-n,3-n,3-n-tetramethylcyclopentane-1,3-diamine Chemical compound CN(C)C1CCC(N(C)C)C1 GUANVAUATHUDQB-UHFFFAOYSA-N 0.000 description 1
- RNSVQNMGXFXULJ-UHFFFAOYSA-N 1-n,1-n,4-n,4-n-tetramethylcyclohexane-1,4-diamine Chemical compound CN(C)C1CCC(N(C)C)CC1 RNSVQNMGXFXULJ-UHFFFAOYSA-N 0.000 description 1
- YQOPNAOQGQSUHF-UHFFFAOYSA-N 1-propan-2-ylpyrrolidine Chemical compound CC(C)N1CCCC1 YQOPNAOQGQSUHF-UHFFFAOYSA-N 0.000 description 1
- VQCRAICFMJLVLF-UHFFFAOYSA-N 2,2-dichloroethenylarsane Chemical compound ClC(=C[AsH2])Cl VQCRAICFMJLVLF-UHFFFAOYSA-N 0.000 description 1
- NFLBXEMHFUDAJI-UHFFFAOYSA-N 2,2-dichloroethenylphosphane Chemical compound PC=C(Cl)Cl NFLBXEMHFUDAJI-UHFFFAOYSA-N 0.000 description 1
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical class C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 1
- FSHOYFLJXMSRNC-UHFFFAOYSA-N 2-chloro-n,n,n',n'-tetraethylpropane-1,3-diamine Chemical compound CCN(CC)CC(Cl)CN(CC)CC FSHOYFLJXMSRNC-UHFFFAOYSA-N 0.000 description 1
- HWYSEHXFINJBBF-UHFFFAOYSA-N 2-methyl-3,4,4a,5-tetrahydro-1h-isoquinoline Chemical compound C1C=CC=C2CN(C)CCC21 HWYSEHXFINJBBF-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- VCJOMHSIIOWCPQ-UHFFFAOYSA-N 3,5-diphenylpyridine Chemical compound C1=CC=CC=C1C1=CN=CC(C=2C=CC=CC=2)=C1 VCJOMHSIIOWCPQ-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- GOPKKFVNKWSSGW-UHFFFAOYSA-N 8,8-dichlorooctylphosphane Chemical compound PCCCCCCCC(Cl)Cl GOPKKFVNKWSSGW-UHFFFAOYSA-N 0.000 description 1
- BARKGNUWQRYXNP-UHFFFAOYSA-N 8,8-dichlorooctylstibane Chemical compound ClC(CCCCCCC[SbH2])Cl BARKGNUWQRYXNP-UHFFFAOYSA-N 0.000 description 1
- PGCZZOGBJNJDCF-UHFFFAOYSA-L Br[Ni]Br.CP(C)C.CP(C)C Chemical compound Br[Ni]Br.CP(C)C.CP(C)C PGCZZOGBJNJDCF-UHFFFAOYSA-L 0.000 description 1
- RKKWWROEIUZFHU-UHFFFAOYSA-L C1(CCCCC1)[Sb](Cl)Cl Chemical compound C1(CCCCC1)[Sb](Cl)Cl RKKWWROEIUZFHU-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- PFPIEBUNKSCRNN-UHFFFAOYSA-N ClC(Cl)[BiH2] Chemical compound ClC(Cl)[BiH2] PFPIEBUNKSCRNN-UHFFFAOYSA-N 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- TXOFSCODFRHERQ-UHFFFAOYSA-N N,N-Dimethylphenethylamine Chemical compound CN(C)CCC1=CC=CC=C1 TXOFSCODFRHERQ-UHFFFAOYSA-N 0.000 description 1
- DJEQZVQFEPKLOY-UHFFFAOYSA-N N,N-dimethylbutylamine Chemical compound CCCCN(C)C DJEQZVQFEPKLOY-UHFFFAOYSA-N 0.000 description 1
- SVYKKECYCPFKGB-UHFFFAOYSA-N N,N-dimethylcyclohexylamine Chemical compound CN(C)C1CCCCC1 SVYKKECYCPFKGB-UHFFFAOYSA-N 0.000 description 1
- CMQBVXIXSVEUCG-UHFFFAOYSA-N N-chloro-N-octyl-9-phenylnonan-1-amine Chemical compound ClN(CCCCCCCCCC1=CC=CC=C1)CCCCCCCC CMQBVXIXSVEUCG-UHFFFAOYSA-N 0.000 description 1
- DSSKLTAHHALFRW-UHFFFAOYSA-N N-cyclohexylpiperidine Chemical class C1CCCCC1N1CCCCC1 DSSKLTAHHALFRW-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- QCOGKXLOEWLIDC-UHFFFAOYSA-N N-methylbutylamine Chemical compound CCCCNC QCOGKXLOEWLIDC-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 241000589614 Pseudomonas stutzeri Species 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical class C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000000476 acetylides Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 229940111121 antirheumatic drug quinolines Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- VUTNILBUSSZAIE-UHFFFAOYSA-N azane;sulfuric acid Chemical compound N.N.N.N.OS(O)(=O)=O VUTNILBUSSZAIE-UHFFFAOYSA-N 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- LLCSWKVOHICRDD-UHFFFAOYSA-N buta-1,3-diyne Chemical group C#CC#C LLCSWKVOHICRDD-UHFFFAOYSA-N 0.000 description 1
- JADMTAKJPYAWOT-UHFFFAOYSA-N butyl(dichloro)arsane Chemical compound CCCC[As](Cl)Cl JADMTAKJPYAWOT-UHFFFAOYSA-N 0.000 description 1
- SFIGJSJNXUEHSY-UHFFFAOYSA-L butyl(dichloro)bismuthane Chemical compound CCCC[Bi](Cl)Cl SFIGJSJNXUEHSY-UHFFFAOYSA-L 0.000 description 1
- IKNPUBSFLQLSLS-UHFFFAOYSA-N butyl(dichloro)phosphane Chemical compound CCCCP(Cl)Cl IKNPUBSFLQLSLS-UHFFFAOYSA-N 0.000 description 1
- JDZZRLAGJYWAQS-UHFFFAOYSA-L butyl(dichloro)stibane Chemical compound C(CCC)[Sb](Cl)Cl JDZZRLAGJYWAQS-UHFFFAOYSA-L 0.000 description 1
- 238000003763 carbonization Methods 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000012707 chemical precursor Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- RPJAQOVNRDOGAY-UHFFFAOYSA-L copper(1+);sulfite Chemical compound [Cu+].[Cu+].[O-]S([O-])=O RPJAQOVNRDOGAY-UHFFFAOYSA-L 0.000 description 1
- XTVVROIMIGLXTD-UHFFFAOYSA-N copper(II) nitrate Chemical compound [Cu+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O XTVVROIMIGLXTD-UHFFFAOYSA-N 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 1
- OMZSGWSJDCOLKM-UHFFFAOYSA-N copper(II) sulfide Chemical compound [S-2].[Cu+2] OMZSGWSJDCOLKM-UHFFFAOYSA-N 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 1
- 125000004956 cyclohexylene group Chemical group 0.000 description 1
- 125000004979 cyclopentylene group Chemical group 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004891 diazines Chemical class 0.000 description 1
- 125000000950 dibromo group Chemical group Br* 0.000 description 1
- UZYVCPJTSNLBQL-UHFFFAOYSA-N dibromomethylphosphane Chemical compound PC(Br)Br UZYVCPJTSNLBQL-UHFFFAOYSA-N 0.000 description 1
- AOQHHQJCHPTWRM-UHFFFAOYSA-N dichloro(cyclohexyl)arsane Chemical compound Cl[As](Cl)C1CCCCC1 AOQHHQJCHPTWRM-UHFFFAOYSA-N 0.000 description 1
- MJEQIIGWDHUZJW-UHFFFAOYSA-N dichloro(cyclohexyl)phosphane Chemical compound ClP(Cl)C1CCCCC1 MJEQIIGWDHUZJW-UHFFFAOYSA-N 0.000 description 1
- MRSJAYZIPFDKQV-UHFFFAOYSA-N dichloro(dicyclohexyl)germane Chemical compound C1CCCCC1[Ge](Cl)(Cl)C1CCCCC1 MRSJAYZIPFDKQV-UHFFFAOYSA-N 0.000 description 1
- SRDFHTKMCLVROL-UHFFFAOYSA-L dichloro(dicyclohexyl)plumbane Chemical compound C1(CCCCC1)[Pb](C1CCCCC1)(Cl)Cl SRDFHTKMCLVROL-UHFFFAOYSA-L 0.000 description 1
- IESPKCNRKMAVIB-UHFFFAOYSA-N dichloro(dicyclohexyl)silane Chemical compound C1CCCCC1[Si](Cl)(Cl)C1CCCCC1 IESPKCNRKMAVIB-UHFFFAOYSA-N 0.000 description 1
- BFRHAAYMQFJEEX-UHFFFAOYSA-N dichloro(dihexyl)germane Chemical compound CCCCCC[Ge](Cl)(Cl)CCCCCC BFRHAAYMQFJEEX-UHFFFAOYSA-N 0.000 description 1
- PCOLSRZRXWRTMQ-UHFFFAOYSA-L dichloro(dihexyl)plumbane Chemical compound CCCCCC[Pb](Cl)(Cl)CCCCCC PCOLSRZRXWRTMQ-UHFFFAOYSA-L 0.000 description 1
- NRAYZPGATNMOSB-UHFFFAOYSA-N dichloro(dihexyl)silane Chemical compound CCCCCC[Si](Cl)(Cl)CCCCCC NRAYZPGATNMOSB-UHFFFAOYSA-N 0.000 description 1
- YQECBLVSMFAWIZ-UHFFFAOYSA-N dichloro(dimethyl)germane Chemical compound C[Ge](C)(Cl)Cl YQECBLVSMFAWIZ-UHFFFAOYSA-N 0.000 description 1
- DBPAIFATCNQGFH-UHFFFAOYSA-L dichloro(dimethyl)plumbane Chemical compound C[Pb](C)(Cl)Cl DBPAIFATCNQGFH-UHFFFAOYSA-L 0.000 description 1
- PKKGKUDPKRTKLJ-UHFFFAOYSA-L dichloro(dimethyl)stannane Chemical compound C[Sn](C)(Cl)Cl PKKGKUDPKRTKLJ-UHFFFAOYSA-L 0.000 description 1
- PFPTYRFVUHDUIN-UHFFFAOYSA-N dichloro(diphenyl)germane Chemical compound C=1C=CC=CC=1[Ge](Cl)(Cl)C1=CC=CC=C1 PFPTYRFVUHDUIN-UHFFFAOYSA-N 0.000 description 1
- ISXUHJXWYNONDI-UHFFFAOYSA-L dichloro(diphenyl)stannane Chemical compound C=1C=CC=CC=1[Sn](Cl)(Cl)C1=CC=CC=C1 ISXUHJXWYNONDI-UHFFFAOYSA-L 0.000 description 1
- CDPKWOKGVUHZFR-UHFFFAOYSA-N dichloro(methyl)phosphane Chemical compound CP(Cl)Cl CDPKWOKGVUHZFR-UHFFFAOYSA-N 0.000 description 1
- NJFYHZGHWCKUBI-UHFFFAOYSA-N dichloro(naphthalen-1-yl)phosphane Chemical compound C1=CC=C2C(P(Cl)Cl)=CC=CC2=C1 NJFYHZGHWCKUBI-UHFFFAOYSA-N 0.000 description 1
- YKLQULRUZFJECG-UHFFFAOYSA-L dichloro(phenyl)stibane Chemical compound Cl[Sb](Cl)C1=CC=CC=C1 YKLQULRUZFJECG-UHFFFAOYSA-L 0.000 description 1
- QGFYRVFPAUWAJS-UHFFFAOYSA-N dichloro-(2,3-dimethylphenyl)phosphane Chemical compound CC1=CC=CC(P(Cl)Cl)=C1C QGFYRVFPAUWAJS-UHFFFAOYSA-N 0.000 description 1
- CKAKOBYFFZWNMZ-UHFFFAOYSA-N dichloro-(2-methylphenyl)arsane Chemical compound CC1=CC=CC=C1[As](Cl)Cl CKAKOBYFFZWNMZ-UHFFFAOYSA-N 0.000 description 1
- QSEFDNZNUGUMHS-UHFFFAOYSA-L dichloro-(2-methylphenyl)bismuthane Chemical compound CC1=CC=CC=C1[Bi](Cl)Cl QSEFDNZNUGUMHS-UHFFFAOYSA-L 0.000 description 1
- REJUONUIORHCPY-UHFFFAOYSA-N dichloro-(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(Cl)Cl REJUONUIORHCPY-UHFFFAOYSA-N 0.000 description 1
- WBWNWHGATZTKLR-UHFFFAOYSA-L dichloro-(2-methylphenyl)stibane Chemical compound Cl[Sb](C1=C(C=CC=C1)C)Cl WBWNWHGATZTKLR-UHFFFAOYSA-L 0.000 description 1
- FFSIVPSUWWOPRQ-UHFFFAOYSA-N dichloro-bis(ethenyl)germane Chemical compound C=C[Ge](Cl)(Cl)C=C FFSIVPSUWWOPRQ-UHFFFAOYSA-N 0.000 description 1
- JJYDMCCXFUKIHV-UHFFFAOYSA-L dichloro-bis(ethenyl)plumbane Chemical compound C=C[Pb](Cl)(Cl)C=C JJYDMCCXFUKIHV-UHFFFAOYSA-L 0.000 description 1
- MAYIDWCWWMOISO-UHFFFAOYSA-N dichloro-bis(ethenyl)silane Chemical compound C=C[Si](Cl)(Cl)C=C MAYIDWCWWMOISO-UHFFFAOYSA-N 0.000 description 1
- VTEHVUWHCBXMPI-UHFFFAOYSA-N dichloro-bis(prop-2-enyl)silane Chemical compound C=CC[Si](Cl)(Cl)CC=C VTEHVUWHCBXMPI-UHFFFAOYSA-N 0.000 description 1
- PNECSTWRDNQOLT-UHFFFAOYSA-N dichloro-ethyl-methylsilane Chemical compound CC[Si](C)(Cl)Cl PNECSTWRDNQOLT-UHFFFAOYSA-N 0.000 description 1
- GNEPOXWQWFSSOU-UHFFFAOYSA-N dichloro-methyl-phenylsilane Chemical compound C[Si](Cl)(Cl)C1=CC=CC=C1 GNEPOXWQWFSSOU-UHFFFAOYSA-N 0.000 description 1
- LPXOEQAYLJDGQC-UHFFFAOYSA-L dichlorobismuthane Chemical compound Cl[BiH]Cl LPXOEQAYLJDGQC-UHFFFAOYSA-L 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- MYICKRXVEKXHOX-UHFFFAOYSA-N dichloromethylarsane Chemical compound ClC(Cl)[AsH2] MYICKRXVEKXHOX-UHFFFAOYSA-N 0.000 description 1
- OLOCQYUKESOKNM-UHFFFAOYSA-N dichloromethylstibane Chemical compound ClC(Cl)[SbH2] OLOCQYUKESOKNM-UHFFFAOYSA-N 0.000 description 1
- RZHIALGQQJESEK-UHFFFAOYSA-L dichloronickel;triethylphosphane Chemical compound Cl[Ni]Cl.CCP(CC)CC.CCP(CC)CC RZHIALGQQJESEK-UHFFFAOYSA-L 0.000 description 1
- IMDXZWRLUZPMDH-UHFFFAOYSA-N dichlorophenylphosphine Chemical compound ClP(Cl)C1=CC=CC=C1 IMDXZWRLUZPMDH-UHFFFAOYSA-N 0.000 description 1
- WPWLTKRUFHHDLP-UHFFFAOYSA-L dichloroplatinum;triethylphosphane Chemical compound Cl[Pt]Cl.CCP(CC)CC.CCP(CC)CC WPWLTKRUFHHDLP-UHFFFAOYSA-L 0.000 description 1
- APJMLTHOYVZJNW-UHFFFAOYSA-L dichloroplatinum;trimethylphosphane Chemical compound Cl[Pt]Cl.CP(C)C.CP(C)C APJMLTHOYVZJNW-UHFFFAOYSA-L 0.000 description 1
- BRRZMRFAZGCJSD-UHFFFAOYSA-L dichloroplatinum;triphenylarsane Chemical compound Cl[Pt]Cl.C1=CC=CC=C1[As](C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1[As](C=1C=CC=CC=1)C1=CC=CC=C1 BRRZMRFAZGCJSD-UHFFFAOYSA-L 0.000 description 1
- USLGACHLVXUMLR-UHFFFAOYSA-L dichloroplatinum;triphenylstibane Chemical compound Cl[Pt]Cl.C1=CC=CC=C1[Sb](C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1[Sb](C=1C=CC=CC=1)C1=CC=CC=C1 USLGACHLVXUMLR-UHFFFAOYSA-L 0.000 description 1
- LHZBUNFTTJMVIN-UHFFFAOYSA-L dichlorostibane Chemical compound Cl[SbH]Cl LHZBUNFTTJMVIN-UHFFFAOYSA-L 0.000 description 1
- NXLNBJXGFFFGIT-UHFFFAOYSA-L dicyclohexyltin(2+);dichloride Chemical compound C1CCCCC1[Sn](Cl)(Cl)C1CCCCC1 NXLNBJXGFFFGIT-UHFFFAOYSA-L 0.000 description 1
- SOFNXTVVVUDTGB-UHFFFAOYSA-N diethyl(methyl)arsane Chemical compound CC[As](C)CC SOFNXTVVVUDTGB-UHFFFAOYSA-N 0.000 description 1
- HZHUAESPXGNNFV-UHFFFAOYSA-N diethyl(methyl)phosphane Chemical compound CCP(C)CC HZHUAESPXGNNFV-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- ZPMWHAQIUVHVRA-UHFFFAOYSA-N difluoro(dipropyl)germane Chemical compound F[Ge](CCC)(CCC)F ZPMWHAQIUVHVRA-UHFFFAOYSA-N 0.000 description 1
- OAQGIXCRNDHFCD-UHFFFAOYSA-N difluoro(dipropyl)silane Chemical compound CCC[Si](F)(F)CCC OAQGIXCRNDHFCD-UHFFFAOYSA-N 0.000 description 1
- FMSYTQMJOCCCQS-UHFFFAOYSA-L difluoromercury Chemical compound F[Hg]F FMSYTQMJOCCCQS-UHFFFAOYSA-L 0.000 description 1
- HGVLQMWHKAMCMG-UHFFFAOYSA-N difluoromethylphosphane Chemical compound FC(F)P HGVLQMWHKAMCMG-UHFFFAOYSA-N 0.000 description 1
- AXQSJCWCXATTNE-UHFFFAOYSA-L dihexyltin(2+);dichloride Chemical compound CCCCCC[Sn](Cl)(Cl)CCCCCC AXQSJCWCXATTNE-UHFFFAOYSA-L 0.000 description 1
- UYZARHCMSBEPFF-UHFFFAOYSA-N diiodo(dimethyl)silane Chemical compound C[Si](C)(I)I UYZARHCMSBEPFF-UHFFFAOYSA-N 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- IOHYCLXFDVVYDO-UHFFFAOYSA-N dimethylstibane Chemical compound C[SbH]C IOHYCLXFDVVYDO-UHFFFAOYSA-N 0.000 description 1
- VCYWRKSVJFJVTB-UHFFFAOYSA-L diphenyllead(2+);dichloride Chemical compound C=1C=CC=CC=1[Pb](Cl)(Cl)C1=CC=CC=C1 VCYWRKSVJFJVTB-UHFFFAOYSA-L 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- DVVJEEGECYXPEC-UHFFFAOYSA-N dodeca-1,11-diyne Chemical compound C#CCCCCCCCCC#C DVVJEEGECYXPEC-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- MLZRWUATEDUZJJ-UHFFFAOYSA-N ethane;2-methylpiperidine Chemical compound CC.CC1CCCCN1 MLZRWUATEDUZJJ-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- MVYYIFZQBWAJJG-UHFFFAOYSA-N ethyl(dimethyl)arsane Chemical compound CC[As](C)C MVYYIFZQBWAJJG-UHFFFAOYSA-N 0.000 description 1
- LEMQFDHLRUSMPZ-UHFFFAOYSA-N ethyl(dimethyl)phosphane Chemical compound CCP(C)C LEMQFDHLRUSMPZ-UHFFFAOYSA-N 0.000 description 1
- HURLBGBBXSZDEK-UHFFFAOYSA-N ethyl-methyl-propylarsane Chemical compound C(C)[As](CCC)C HURLBGBBXSZDEK-UHFFFAOYSA-N 0.000 description 1
- OEORZVZQADBBST-UHFFFAOYSA-N ethyl-methyl-propylphosphane Chemical compound CCCP(C)CC OEORZVZQADBBST-UHFFFAOYSA-N 0.000 description 1
- LIWAQLJGPBVORC-UHFFFAOYSA-N ethylmethylamine Chemical compound CCNC LIWAQLJGPBVORC-UHFFFAOYSA-N 0.000 description 1
- KOMNWRCQOPFQLX-UHFFFAOYSA-N ethylthallium Chemical compound CC[Tl] KOMNWRCQOPFQLX-UHFFFAOYSA-N 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000003349 gelling agent Substances 0.000 description 1
- 230000008570 general process Effects 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 150000005826 halohydrocarbons Chemical class 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- SVPXILQIPWCHSK-UHFFFAOYSA-N hepta-1,3-diyne Chemical compound CCCC#CC#C SVPXILQIPWCHSK-UHFFFAOYSA-N 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AUBDSFLQOBEOPX-UHFFFAOYSA-N hexa-1,5-dien-3-yne Chemical group C=CC#CC=C AUBDSFLQOBEOPX-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 150000002537 isoquinolines Chemical class 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000002642 lithium compounds Chemical class 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- NGYIMTKLQULBOO-UHFFFAOYSA-L mercury dibromide Chemical compound Br[Hg]Br NGYIMTKLQULBOO-UHFFFAOYSA-L 0.000 description 1
- QKEOZZYXWAIQFO-UHFFFAOYSA-M mercury(1+);iodide Chemical compound [Hg]I QKEOZZYXWAIQFO-UHFFFAOYSA-M 0.000 description 1
- TWXDDNPPQUTEOV-FVGYRXGTSA-N methamphetamine hydrochloride Chemical compound Cl.CN[C@@H](C)CC1=CC=CC=C1 TWXDDNPPQUTEOV-FVGYRXGTSA-N 0.000 description 1
- PQIOSYKVBBWRRI-UHFFFAOYSA-N methylphosphonyl difluoride Chemical group CP(F)(F)=O PQIOSYKVBBWRRI-UHFFFAOYSA-N 0.000 description 1
- ANPDUOJXONVTGB-UHFFFAOYSA-N methylthallium Chemical compound [Tl]C ANPDUOJXONVTGB-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 150000002780 morpholines Chemical class 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- YUKZJEQIDOFUPV-UHFFFAOYSA-N n',n'-diethyl-n,n-dimethylethane-1,2-diamine Chemical compound CCN(CC)CCN(C)C YUKZJEQIDOFUPV-UHFFFAOYSA-N 0.000 description 1
- OPWGBHZROLQPCZ-UHFFFAOYSA-N n'-butyl-n,n-dimethyl-n'-octylethane-1,2-diamine Chemical compound CCCCCCCCN(CCCC)CCN(C)C OPWGBHZROLQPCZ-UHFFFAOYSA-N 0.000 description 1
- IHFOKWPYAWVPAK-UHFFFAOYSA-N n,n',n'-triethyl-n-methylethane-1,2-diamine Chemical compound CCN(C)CCN(CC)CC IHFOKWPYAWVPAK-UHFFFAOYSA-N 0.000 description 1
- DNJDQMRARVPSHZ-UHFFFAOYSA-N n,n,n',n'-tetrabutylethane-1,2-diamine Chemical compound CCCCN(CCCC)CCN(CCCC)CCCC DNJDQMRARVPSHZ-UHFFFAOYSA-N 0.000 description 1
- DIHKMUNUGQVFES-UHFFFAOYSA-N n,n,n',n'-tetraethylethane-1,2-diamine Chemical compound CCN(CC)CCN(CC)CC DIHKMUNUGQVFES-UHFFFAOYSA-N 0.000 description 1
- WYLDDLXJLXYQPH-UHFFFAOYSA-N n,n,n',n'-tetrahexylethane-1,2-diamine Chemical compound CCCCCCN(CCCCCC)CCN(CCCCCC)CCCCCC WYLDDLXJLXYQPH-UHFFFAOYSA-N 0.000 description 1
- KZGORJUPSSNLAT-UHFFFAOYSA-N n,n,n',n'-tetrakis(2-methylpropyl)ethane-1,2-diamine Chemical compound CC(C)CN(CC(C)C)CCN(CC(C)C)CC(C)C KZGORJUPSSNLAT-UHFFFAOYSA-N 0.000 description 1
- FFDFQBBNDKGBGI-UHFFFAOYSA-N n,n,n',n'-tetramethylbut-2-yne-1,4-diamine Chemical compound CN(C)CC#CCN(C)C FFDFQBBNDKGBGI-UHFFFAOYSA-N 0.000 description 1
- DMQSHEKGGUOYJS-UHFFFAOYSA-N n,n,n',n'-tetramethylpropane-1,3-diamine Chemical compound CN(C)CCCN(C)C DMQSHEKGGUOYJS-UHFFFAOYSA-N 0.000 description 1
- HVBXZPOGJMBMLN-UHFFFAOYSA-N n,n,n',n'-tetrapropylethane-1,2-diamine Chemical compound CCCN(CCC)CCN(CCC)CCC HVBXZPOGJMBMLN-UHFFFAOYSA-N 0.000 description 1
- MXHTZQSKTCCMFG-UHFFFAOYSA-N n,n-dibenzyl-1-phenylmethanamine Chemical compound C=1C=CC=CC=1CN(CC=1C=CC=CC=1)CC1=CC=CC=C1 MXHTZQSKTCCMFG-UHFFFAOYSA-N 0.000 description 1
- FRQONEWDWWHIPM-UHFFFAOYSA-N n,n-dicyclohexylcyclohexanamine Chemical compound C1CCCCC1N(C1CCCCC1)C1CCCCC1 FRQONEWDWWHIPM-UHFFFAOYSA-N 0.000 description 1
- JRHGZGWIJIJJTE-UHFFFAOYSA-N n,n-diethyl-2-methylbutan-1-amine Chemical compound CCC(C)CN(CC)CC JRHGZGWIJIJJTE-UHFFFAOYSA-N 0.000 description 1
- AJFDBNQQDYLMJN-UHFFFAOYSA-N n,n-diethylacetamide Chemical compound CCN(CC)C(C)=O AJFDBNQQDYLMJN-UHFFFAOYSA-N 0.000 description 1
- JWAJUTZQGZBKFS-UHFFFAOYSA-N n,n-diethylprop-2-en-1-amine Chemical compound CCN(CC)CC=C JWAJUTZQGZBKFS-UHFFFAOYSA-N 0.000 description 1
- ULWOJODHECIZAU-UHFFFAOYSA-N n,n-diethylpropan-2-amine Chemical compound CCN(CC)C(C)C ULWOJODHECIZAU-UHFFFAOYSA-N 0.000 description 1
- JFNWQFWYAAPODB-UHFFFAOYSA-N n,n-dimethyl-2-phenylpropan-1-amine Chemical compound CN(C)CC(C)C1=CC=CC=C1 JFNWQFWYAAPODB-UHFFFAOYSA-N 0.000 description 1
- ZUHZZVMEUAUWHY-UHFFFAOYSA-N n,n-dimethylpropan-1-amine Chemical compound CCCN(C)C ZUHZZVMEUAUWHY-UHFFFAOYSA-N 0.000 description 1
- ABRGFZIXRKAUJS-UHFFFAOYSA-N n-benzyl-n-methylethanamine Chemical compound CCN(C)CC1=CC=CC=C1 ABRGFZIXRKAUJS-UHFFFAOYSA-N 0.000 description 1
- FXMGLWYTXDUDLS-UHFFFAOYSA-N n-benzyl-n-octyloctan-1-amine Chemical compound CCCCCCCCN(CCCCCCCC)CC1=CC=CC=C1 FXMGLWYTXDUDLS-UHFFFAOYSA-N 0.000 description 1
- HVAAHUDGWQAAOJ-UHFFFAOYSA-N n-benzylethanamine Chemical compound CCNCC1=CC=CC=C1 HVAAHUDGWQAAOJ-UHFFFAOYSA-N 0.000 description 1
- VRYPROVLGPMATH-UHFFFAOYSA-N n-benzyloctan-1-amine Chemical compound CCCCCCCCNCC1=CC=CC=C1 VRYPROVLGPMATH-UHFFFAOYSA-N 0.000 description 1
- GNVRJGIVDSQCOP-UHFFFAOYSA-N n-ethyl-n-methylethanamine Chemical compound CCN(C)CC GNVRJGIVDSQCOP-UHFFFAOYSA-N 0.000 description 1
- PUUULGNNRPBVBA-UHFFFAOYSA-N n-ethylprop-2-en-1-amine Chemical compound CCNCC=C PUUULGNNRPBVBA-UHFFFAOYSA-N 0.000 description 1
- RIVIDPPYRINTTH-UHFFFAOYSA-N n-ethylpropan-2-amine Chemical compound CCNC(C)C RIVIDPPYRINTTH-UHFFFAOYSA-N 0.000 description 1
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 description 1
- DYFFAVRFJWYYQO-UHFFFAOYSA-N n-methyl-n-phenylaniline Chemical compound C=1C=CC=CC=1N(C)C1=CC=CC=C1 DYFFAVRFJWYYQO-UHFFFAOYSA-N 0.000 description 1
- SQULHOYRZBAPJF-UHFFFAOYSA-N n-methylpent-4-en-1-amine Chemical compound CNCCCC=C SQULHOYRZBAPJF-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- KPFOFXWYYUNJOZ-UHFFFAOYSA-L nickel(2+);tributylphosphane;dichloride Chemical compound Cl[Ni]Cl.CCCCP(CCCC)CCCC.CCCCP(CCCC)CCCC KPFOFXWYYUNJOZ-UHFFFAOYSA-L 0.000 description 1
- KYHNNWWCXIOTKC-UHFFFAOYSA-L nickel(2+);trimethylphosphane;dichloride Chemical compound Cl[Ni]Cl.CP(C)C.CP(C)C KYHNNWWCXIOTKC-UHFFFAOYSA-L 0.000 description 1
- ZBRJXVVKPBZPAN-UHFFFAOYSA-L nickel(2+);triphenylphosphane;dichloride Chemical compound [Cl-].[Cl-].[Ni+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 ZBRJXVVKPBZPAN-UHFFFAOYSA-L 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- DSOJWVLXZNRKCS-UHFFFAOYSA-N octa-1,7-diyne Chemical compound C#CCCCCC#C DSOJWVLXZNRKCS-UHFFFAOYSA-N 0.000 description 1
- YLWUPCQZCQHRCH-UHFFFAOYSA-N octadeca-1,17-diyne Chemical compound C#CCCCCCCCCCCCCCCC#C YLWUPCQZCQHRCH-UHFFFAOYSA-N 0.000 description 1
- 238000013021 overheating Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- MDROPVLMRLHTDK-UHFFFAOYSA-N penta-1,4-diyne Chemical compound C#CCC#C MDROPVLMRLHTDK-UHFFFAOYSA-N 0.000 description 1
- KJOMYNHMBRNCNY-UHFFFAOYSA-N pentane-1,1-diamine Chemical compound CCCCC(N)N KJOMYNHMBRNCNY-UHFFFAOYSA-N 0.000 description 1
- 150000005041 phenanthrolines Chemical class 0.000 description 1
- AUFSOOYCQYDGES-UHFFFAOYSA-N phenpromethamine Chemical compound CNCC(C)C1=CC=CC=C1 AUFSOOYCQYDGES-UHFFFAOYSA-N 0.000 description 1
- ZBGDFICUSOCSOP-UHFFFAOYSA-L phenylbismuth(2+);dichloride Chemical compound Cl[Bi](Cl)C1=CC=CC=C1 ZBGDFICUSOCSOP-UHFFFAOYSA-L 0.000 description 1
- UDHDFEGCOJAVRE-UHFFFAOYSA-N phenyldichloroarsine Chemical compound Cl[As](Cl)C1=CC=CC=C1 UDHDFEGCOJAVRE-UHFFFAOYSA-N 0.000 description 1
- LZEARXDWARRDEF-UHFFFAOYSA-N phenylthallium Chemical compound [Tl]C1=CC=CC=C1 LZEARXDWARRDEF-UHFFFAOYSA-N 0.000 description 1
- XAFJSPPHVXDRIE-UHFFFAOYSA-L platinum(2+);triphenylphosphane;dichloride Chemical compound [Cl-].[Cl-].[Pt+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 XAFJSPPHVXDRIE-UHFFFAOYSA-L 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- UIVBYQGBSFLFCW-UHFFFAOYSA-N prop-1-ene-1,1-diamine Chemical compound CC=C(N)N UIVBYQGBSFLFCW-UHFFFAOYSA-N 0.000 description 1
- GGHDAUPFEBTORZ-UHFFFAOYSA-N propane-1,1-diamine Chemical compound CCC(N)N GGHDAUPFEBTORZ-UHFFFAOYSA-N 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 150000003248 quinolines Chemical class 0.000 description 1
- SBYHFKPVCBCYGV-UHFFFAOYSA-N quinuclidine Chemical compound C1CC2CCN1CC2 SBYHFKPVCBCYGV-UHFFFAOYSA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 239000012261 resinous substance Substances 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- OUULRIDHGPHMNQ-UHFFFAOYSA-N stibane Chemical compound [SbH3] OUULRIDHGPHMNQ-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- FWMUJAIKEJWSSY-UHFFFAOYSA-N sulfur dichloride Chemical compound ClSCl FWMUJAIKEJWSSY-UHFFFAOYSA-N 0.000 description 1
- QTJXVIKNLHZIKL-UHFFFAOYSA-N sulfur difluoride Chemical compound FSF QTJXVIKNLHZIKL-UHFFFAOYSA-N 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- XAZAQTBGMXGTBD-UHFFFAOYSA-N tributylarsane Chemical compound CCCC[As](CCCC)CCCC XAZAQTBGMXGTBD-UHFFFAOYSA-N 0.000 description 1
- BXJWDOYMROEHEN-UHFFFAOYSA-N tributylstibane Chemical compound CCCC[Sb](CCCC)CCCC BXJWDOYMROEHEN-UHFFFAOYSA-N 0.000 description 1
- WWVNWQJKWKSDQM-UHFFFAOYSA-N triethylarsane Chemical compound CC[As](CC)CC WWVNWQJKWKSDQM-UHFFFAOYSA-N 0.000 description 1
- RXJKFRMDXUJTEX-UHFFFAOYSA-N triethylphosphine Chemical compound CCP(CC)CC RXJKFRMDXUJTEX-UHFFFAOYSA-N 0.000 description 1
- KKOFCVMVBJXDFP-UHFFFAOYSA-N triethylstibane Chemical compound CC[Sb](CC)CC KKOFCVMVBJXDFP-UHFFFAOYSA-N 0.000 description 1
- 239000013638 trimer Substances 0.000 description 1
- HVYVMSPIJIWUNA-UHFFFAOYSA-N triphenylstibine Chemical compound C1=CC=CC=C1[Sb](C=1C=CC=CC=1)C1=CC=CC=C1 HVYVMSPIJIWUNA-UHFFFAOYSA-N 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- PEYLMUGWODRKPS-UHFFFAOYSA-N tripropylarsane Chemical compound CCC[As](CCC)CCC PEYLMUGWODRKPS-UHFFFAOYSA-N 0.000 description 1
- KCTAHLRCZMOTKM-UHFFFAOYSA-N tripropylphosphane Chemical compound CCCP(CCC)CCC KCTAHLRCZMOTKM-UHFFFAOYSA-N 0.000 description 1
- FECHVIJLJQUVMZ-UHFFFAOYSA-N tripropylstibane Chemical compound CCC[Sb](CCC)CCC FECHVIJLJQUVMZ-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G79/00—Macromolecular compounds obtained by reactions forming a linkage containing atoms other than silicon, sulfur, nitrogen, oxygen, and carbon with or without the latter elements in the main chain of the macromolecule
- C08G79/02—Macromolecular compounds obtained by reactions forming a linkage containing atoms other than silicon, sulfur, nitrogen, oxygen, and carbon with or without the latter elements in the main chain of the macromolecule a linkage containing phosphorus
- C08G79/06—Phosphorus linked to carbon only
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F1/00—Compounds containing elements of Groups 1 or 11 of the Periodic Table
- C07F1/02—Lithium compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F3/00—Compounds containing elements of Groups 2 or 12 of the Periodic Table
- C07F3/10—Mercury compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F7/00—Compounds containing elements of Groups 4 or 14 of the Periodic Table
- C07F7/02—Silicon compounds
- C07F7/08—Compounds having one or more C—Si linkages
- C07F7/0803—Compounds with Si-C or Si-Si linkages
- C07F7/0805—Compounds with Si-C or Si-Si linkages comprising only Si, C or H atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/66—Arsenic compounds
- C07F9/70—Organo-arsenic compounds
- C07F9/74—Aromatic compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/60—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule in which all the silicon atoms are connected by linkages other than oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G79/00—Macromolecular compounds obtained by reactions forming a linkage containing atoms other than silicon, sulfur, nitrogen, oxygen, and carbon with or without the latter elements in the main chain of the macromolecule
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Silicon Polymers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US16391062A | 1962-01-02 | 1962-01-02 | |
| US239318A US3332916A (en) | 1962-01-02 | 1962-11-21 | Heteroacetylenic compounds and polymers thereof |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH449009A true CH449009A (de) | 1967-12-31 |
Family
ID=26860065
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1525162A CH449009A (de) | 1962-01-02 | 1962-12-28 | Verfahren zur Herstellung von heteroacetylenischen Verbindungen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3332916A (enExample) |
| CH (1) | CH449009A (enExample) |
| DE (2) | DE1495898A1 (enExample) |
| GB (1) | GB1027021A (enExample) |
| NL (1) | NL287353A (enExample) |
| SE (1) | SE322054B (enExample) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3519611A (en) * | 1967-03-02 | 1970-07-07 | Gen Electric | Aromatic polymers containing pyrazole units and process therefor |
| GB1286817A (en) * | 1968-12-04 | 1972-08-23 | Dow Corning Ltd | Organosilicon compounds |
| GB1314531A (en) * | 1969-07-30 | 1973-04-26 | Dow Corning Ltd | Organosilicon compounds |
| US3899574A (en) * | 1970-11-02 | 1975-08-12 | Gen Electric | Method for making graphite fiber and ribbon |
| US3709863A (en) * | 1971-02-24 | 1973-01-09 | Gen Electric | Method for extruding polyacetylenes to produce high strength graphite precursors |
| US3928516A (en) * | 1972-11-30 | 1975-12-23 | Gen Electric | Continuous method for making spinnable polyacetylene solutions convertible to high strength carbon fiber |
| JPS52112700A (en) * | 1976-02-28 | 1977-09-21 | Tohoku Daigaku Kinzoku Zairyo | Amorphous organopolysilicone composite for preparing silicone carbide |
| US5576375A (en) * | 1988-06-15 | 1996-11-19 | Aerojet- General Corporation | Poly (phenylene-vinylene) resins from vinylethynylbenzene and diethynylbenzene |
| GB2233660A (en) * | 1989-06-22 | 1991-01-16 | Dow Corning | Method of making organosilbutadiyne polymers |
| US5247039A (en) * | 1990-01-08 | 1993-09-21 | Dow Corning Limited | Method of making silethynyl polymers |
| GB9000387D0 (en) * | 1990-01-08 | 1990-03-07 | Dow Corning | Method of making silethynyl polymers |
| US5420000A (en) * | 1990-04-09 | 1995-05-30 | Jp Laboratories, Inc. | Heat fixable high energy radiation imaging film |
| US5672465A (en) * | 1990-04-09 | 1997-09-30 | Jp Laboratories, Inc. | Polyethyleneimine binder complex films |
| US5453169A (en) * | 1991-08-21 | 1995-09-26 | The Ohio State University | Glassy carbon containing metal particles and its use on an electrode in an electrochemical cell where the particles are less than 10 nm |
| US9095898B2 (en) | 2008-09-15 | 2015-08-04 | Lockheed Martin Corporation | Stabilized metal nanoparticles and methods for production thereof |
| US8486305B2 (en) * | 2009-11-30 | 2013-07-16 | Lockheed Martin Corporation | Nanoparticle composition and methods of making the same |
| US9011570B2 (en) | 2009-07-30 | 2015-04-21 | Lockheed Martin Corporation | Articles containing copper nanoparticles and methods for production and use thereof |
| US9072185B2 (en) | 2009-07-30 | 2015-06-30 | Lockheed Martin Corporation | Copper nanoparticle application processes for low temperature printable, flexible/conformal electronics and antennas |
| US8834747B2 (en) * | 2010-03-04 | 2014-09-16 | Lockheed Martin Corporation | Compositions containing tin nanoparticles and methods for use thereof |
| US10544483B2 (en) | 2010-03-04 | 2020-01-28 | Lockheed Martin Corporation | Scalable processes for forming tin nanoparticles, compositions containing tin nanoparticles, and applications utilizing same |
| WO2013120110A1 (en) | 2012-02-10 | 2013-08-15 | Lockheed Martin Corporation | Nanoparticle paste formulations and methods for production and use thereof |
| SG11201404758YA (en) | 2012-02-10 | 2014-09-26 | Lockheed Corp | Photovoltaic cells having electrical contacts formed from metal nanoparticles and methods for production thereof |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1963935A (en) * | 1931-11-11 | 1934-06-19 | Du Pont | Vinylethinyl derivatives and processes for preparing same |
| US2848520A (en) * | 1953-11-09 | 1958-08-19 | Air Reduction | Preparation of methylacetylene and ethylacetylene |
-
0
- NL NL287353D patent/NL287353A/xx unknown
-
1962
- 1962-11-21 US US239318A patent/US3332916A/en not_active Expired - Lifetime
- 1962-12-27 DE DE19621495898 patent/DE1495898A1/de active Pending
- 1962-12-28 SE SE14022/62A patent/SE322054B/xx unknown
- 1962-12-28 CH CH1525162A patent/CH449009A/de unknown
-
1963
- 1963-01-02 GB GB302/63A patent/GB1027021A/en not_active Expired
-
1966
- 1966-02-11 DE DE19661595726 patent/DE1595726A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| NL287353A (enExample) | 1900-01-01 |
| SE322054B (enExample) | 1970-03-23 |
| GB1027021A (en) | 1966-04-20 |
| DE1495898A1 (de) | 1969-10-02 |
| DE1595726A1 (de) | 1970-02-12 |
| US3332916A (en) | 1967-07-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH449009A (de) | Verfahren zur Herstellung von heteroacetylenischen Verbindungen | |
| US3300456A (en) | Polymeric acetylenes and process for producing the same | |
| DE60012571T2 (de) | Metallkomplexe als hyrdosilylierungskatalysatoren | |
| DE2559833C2 (de) | Aromatische Oniumsalze und deren Verwendung | |
| DE2517142C2 (enExample) | ||
| DE2635895A1 (de) | Verfahren zur isolierung von polymeren | |
| DE3884069T2 (de) | Polysilazan und Verfahren zu dessen Herstellung. | |
| DE69018488T2 (de) | Katalysator-Zusammensetzungen. | |
| DE2813659A1 (de) | Hochleitende, organometallische polymere | |
| DE2137273A1 (enExample) | ||
| DE3414882A1 (de) | Verfahren zur herstellung von substituierten polyarylethern | |
| DE2431796C2 (de) | Verfahren zur Herstellung von N,N, N',N'-Tetraarylchinondiimonium-Salzen | |
| DE2037412A1 (de) | Komplexbildende Polymere | |
| DE3538327A1 (de) | Freiradikalische initiatoren und verfahren zu ihrer herstellung | |
| DE1954255C3 (de) | Polymere mit einem System von konjugierten Doppelbindungen in der Hauptkette und Verfahren zu deren Herstellung | |
| DE2226774A1 (de) | Verfahren zur Herstellung von Distannanen | |
| DE3047085A1 (de) | Verfahren zur herstellung von elektrisch leitfaehigen polymeren und deren verwendung in der elektrotechnik und zur antistatischen ausruestung von kunststoffen | |
| DE68912820T2 (de) | Verfahren zum Herstellen leitender heterozyklischer Polymere, neuer heterozyklischer leitender Polymere, neuer Zwischenerzeugnisse zur Herstellung der Polymere und Synthese der Zwischenerzeugnisse. | |
| DE1520013A1 (de) | Poly(2-butindiol-1,4) sowie Verfahren zu dessen Herstellung | |
| DE2200984A1 (de) | Derivate von Isocyanursaeure und Verfahren zu ihrer Herstellung | |
| EP0297037A1 (de) | Poly(arylensulfide) | |
| DE3637402A1 (de) | Blockpolymere, die polysilan- und organische polymer-bloecke enthalten | |
| DE2914496C3 (de) | Verfahren zur Herstellung von olidomeren Iminoalanen mit einer dreidimensionalen offenen Käfig-Struktur | |
| DE69103549T2 (de) | Polyquinoxalinmischungen und Verfahren zu deren Herstellung. | |
| DE1920690C (de) | Verfahren zur Herstellung von Biallyl verbindungen |