CA3044056A1 - Methods and compositions to detect mutations in plasma using exosomal rna and cell free dna from non-small cell lung cancer patients - Google Patents
Methods and compositions to detect mutations in plasma using exosomal rna and cell free dna from non-small cell lung cancer patients Download PDFInfo
- Publication number
- CA3044056A1 CA3044056A1 CA3044056A CA3044056A CA3044056A1 CA 3044056 A1 CA3044056 A1 CA 3044056A1 CA 3044056 A CA3044056 A CA 3044056A CA 3044056 A CA3044056 A CA 3044056A CA 3044056 A1 CA3044056 A1 CA 3044056A1
- Authority
- CA
- Canada
- Prior art keywords
- nucleic acid
- nucleic acids
- mutation
- egfr
- exon19
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims abstract description 88
- 230000035772 mutation Effects 0.000 title claims abstract description 35
- 208000002154 non-small cell lung carcinoma Diseases 0.000 title claims abstract description 10
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 title claims abstract description 10
- 239000000203 mixture Substances 0.000 title description 3
- 102000001301 EGF receptor Human genes 0.000 claims abstract description 29
- 108060006698 EGF receptor Proteins 0.000 claims abstract description 29
- 238000003780 insertion Methods 0.000 claims abstract description 19
- 230000037431 insertion Effects 0.000 claims abstract description 19
- 239000012472 biological sample Substances 0.000 claims abstract description 18
- 238000012217 deletion Methods 0.000 claims abstract description 18
- 230000037430 deletion Effects 0.000 claims abstract description 18
- 206010028980 Neoplasm Diseases 0.000 claims abstract description 14
- 201000010099 disease Diseases 0.000 claims abstract description 14
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 14
- 201000011510 cancer Diseases 0.000 claims abstract description 8
- 238000012544 monitoring process Methods 0.000 claims abstract description 7
- 238000002560 therapeutic procedure Methods 0.000 claims abstract description 7
- 238000003745 diagnosis Methods 0.000 claims abstract description 5
- 238000004393 prognosis Methods 0.000 claims abstract description 5
- 208000020816 lung neoplasm Diseases 0.000 claims abstract description 3
- 206010058467 Lung neoplasm malignant Diseases 0.000 claims abstract 2
- 201000005202 lung cancer Diseases 0.000 claims abstract 2
- 150000007523 nucleic acids Chemical class 0.000 claims description 79
- 102000039446 nucleic acids Human genes 0.000 claims description 76
- 108020004707 nucleic acids Proteins 0.000 claims description 76
- 238000003199 nucleic acid amplification method Methods 0.000 claims description 23
- 108091032973 (ribonucleotides)n+m Proteins 0.000 claims description 22
- 230000003321 amplification Effects 0.000 claims description 21
- 239000000523 sample Substances 0.000 claims description 19
- 108020004414 DNA Proteins 0.000 claims description 17
- 108090000623 proteins and genes Proteins 0.000 claims description 16
- 238000000605 extraction Methods 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 13
- 238000002955 isolation Methods 0.000 claims description 11
- 210000001124 body fluid Anatomy 0.000 claims description 8
- 238000001514 detection method Methods 0.000 claims description 8
- 229940121647 egfr inhibitor Drugs 0.000 claims description 7
- 230000001338 necrotic effect Effects 0.000 claims description 7
- 238000010839 reverse transcription Methods 0.000 claims description 7
- 230000004048 modification Effects 0.000 claims description 6
- 238000012986 modification Methods 0.000 claims description 6
- -1 trimetroxystilbene Chemical compound 0.000 claims description 6
- 230000005764 inhibitory process Effects 0.000 claims description 5
- 108091034117 Oligonucleotide Proteins 0.000 claims description 4
- 238000010801 machine learning Methods 0.000 claims description 4
- KHQCCEUMCUSZKM-KVQBGUIXSA-N (2r,3s,5r)-5-(6,8-diaminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol Chemical compound NC1=NC2=C(N)N=CN=C2N1[C@H]1C[C@H](O)[C@@H](CO)O1 KHQCCEUMCUSZKM-KVQBGUIXSA-N 0.000 claims description 3
- RVWUFECBVNXJEN-YGOYTEALSA-N 1-[(2s,4s,5r)-4-hydroxy-5-(hydroxymethyl)-2-prop-1-ynyloxolan-2-yl]pyrimidine-2,4-dione Chemical compound C1=CC(=O)NC(=O)N1[C@@]1(C#CC)C[C@H](O)[C@@H](CO)O1 RVWUFECBVNXJEN-YGOYTEALSA-N 0.000 claims description 3
- MWBWWFOAEOYUST-UHFFFAOYSA-N 2-aminopurine Chemical compound NC1=NC=C2N=CNC2=N1 MWBWWFOAEOYUST-UHFFFAOYSA-N 0.000 claims description 3
- XSGZNYKZSOJIAM-XUOJEKSQSA-N 4-amino-1-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;2-(10h-phenoxazin-1-yl)ethanamine Chemical compound O=C1N=C(N)C=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1.O1C2=CC=CC=C2NC2=C1C=CC=C2CCN XSGZNYKZSOJIAM-XUOJEKSQSA-N 0.000 claims description 3
- MSSXOMSJDRHRMC-UHFFFAOYSA-N 9H-purine-2,6-diamine Chemical compound NC1=NC(N)=C2NC=NC2=N1 MSSXOMSJDRHRMC-UHFFFAOYSA-N 0.000 claims description 3
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 claims description 3
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 claims description 3
- JFVJZFMWJVSZNC-KVQBGUIXSA-N [[(2r,3s,5r)-5-(2,6-diaminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate Chemical compound C12=NC(N)=NC(N)=C2N=CN1[C@H]1C[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O1 JFVJZFMWJVSZNC-KVQBGUIXSA-N 0.000 claims description 3
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 3
- 230000003993 interaction Effects 0.000 claims description 3
- 210000002966 serum Anatomy 0.000 claims description 3
- MSHADEGKNJRMIU-YGOYTEALSA-N 4-amino-1-[(2s,4s,5r)-4-hydroxy-5-(hydroxymethyl)-2-prop-1-ynyloxolan-2-yl]pyrimidin-2-one Chemical compound C1=CC(N)=NC(=O)N1[C@@]1(C#CC)C[C@H](O)[C@@H](CO)O1 MSHADEGKNJRMIU-YGOYTEALSA-N 0.000 claims description 2
- 238000007418 data mining Methods 0.000 claims description 2
- 230000002209 hydrophobic effect Effects 0.000 claims description 2
- 238000007619 statistical method Methods 0.000 claims description 2
- 125000003729 nucleotide group Chemical group 0.000 claims 5
- 238000011529 RT qPCR Methods 0.000 claims 4
- 108091028043 Nucleic acid sequence Proteins 0.000 claims 2
- 238000011123 anti-EGFR therapy Methods 0.000 claims 2
- 229940079593 drug Drugs 0.000 claims 2
- 239000003814 drug Substances 0.000 claims 2
- 108091093037 Peptide nucleic acid Proteins 0.000 claims 1
- 239000002773 nucleotide Substances 0.000 claims 1
- 238000012163 sequencing technique Methods 0.000 claims 1
- 230000004083 survival effect Effects 0.000 claims 1
- 239000000090 biomarker Substances 0.000 abstract description 12
- 101150039808 Egfr gene Proteins 0.000 abstract 1
- 108700021358 erbB-1 Genes Proteins 0.000 abstract 1
- 210000004027 cell Anatomy 0.000 description 18
- 239000002245 particle Substances 0.000 description 14
- 102200048955 rs121434569 Human genes 0.000 description 12
- 210000002381 plasma Anatomy 0.000 description 10
- 238000003753 real-time PCR Methods 0.000 description 8
- 210000001808 exosome Anatomy 0.000 description 7
- 210000001519 tissue Anatomy 0.000 description 7
- 239000012530 fluid Substances 0.000 description 6
- 241001534160 Escherichia virus Qbeta Species 0.000 description 4
- 102000016304 Origin Recognition Complex Human genes 0.000 description 4
- 108010067244 Origin Recognition Complex Proteins 0.000 description 4
- 102000008935 SMN Complex Proteins Human genes 0.000 description 4
- 108010049037 SMN Complex Proteins Proteins 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 238000003556 assay Methods 0.000 description 4
- 238000003752 polymerase chain reaction Methods 0.000 description 4
- 238000011002 quantification Methods 0.000 description 4
- 102100040002 Eukaryotic translation initiation factor 6 Human genes 0.000 description 3
- 230000001640 apoptogenic effect Effects 0.000 description 3
- 210000001175 cerebrospinal fluid Anatomy 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 230000002934 lysing effect Effects 0.000 description 3
- 102000004169 proteins and genes Human genes 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 102000040650 (ribonucleotides)n+m Human genes 0.000 description 2
- 102100040973 26S proteasome non-ATPase regulatory subunit 1 Human genes 0.000 description 2
- 102100024385 28S ribosomal protein S35, mitochondrial Human genes 0.000 description 2
- 102100027561 39S ribosomal protein L37, mitochondrial Human genes 0.000 description 2
- 102100024406 60S ribosomal protein L15 Human genes 0.000 description 2
- 102100026926 60S ribosomal protein L4 Human genes 0.000 description 2
- 102100028264 Alanyl-tRNA editing protein Aarsd1 Human genes 0.000 description 2
- 108091093088 Amplicon Proteins 0.000 description 2
- 102100040038 Amyloid beta precursor like protein 2 Human genes 0.000 description 2
- 102000052594 Anaphase-Promoting Complex-Cyclosome Apc2 Subunit Human genes 0.000 description 2
- 102100039723 Aurora kinase A-interacting protein Human genes 0.000 description 2
- 101710132601 Capsid protein Proteins 0.000 description 2
- 102100027667 Carboxy-terminal domain RNA polymerase II polypeptide A small phosphatase 2 Human genes 0.000 description 2
- 102100037182 Cation-independent mannose-6-phosphate receptor Human genes 0.000 description 2
- 101710094648 Coat protein Proteins 0.000 description 2
- 102100021307 Cyclic AMP-responsive element-binding protein 3-like protein 4 Human genes 0.000 description 2
- 102100028717 Cytosolic 5'-nucleotidase 3A Human genes 0.000 description 2
- 102100036951 DNA polymerase subunit gamma-1 Human genes 0.000 description 2
- 102100029094 DNA repair endonuclease XPF Human genes 0.000 description 2
- 102100027700 DNA-directed RNA polymerase I subunit RPA2 Human genes 0.000 description 2
- 102100037458 Dephospho-CoA kinase Human genes 0.000 description 2
- 102100031477 Dolichyl-diphosphooligosaccharide-protein glycosyltransferase 48 kDa subunit Human genes 0.000 description 2
- 102100030695 Electron transfer flavoprotein subunit alpha, mitochondrial Human genes 0.000 description 2
- 102100035549 Eukaryotic translation initiation factor 2 subunit 1 Human genes 0.000 description 2
- 102100021699 Eukaryotic translation initiation factor 3 subunit B Human genes 0.000 description 2
- 108700024394 Exon Proteins 0.000 description 2
- 102100033295 Glial cell line-derived neurotrophic factor Human genes 0.000 description 2
- 102100041034 Glucosamine-6-phosphate isomerase 1 Human genes 0.000 description 2
- 102100036589 Glycine-tRNA ligase Human genes 0.000 description 2
- 102100022102 Histone-lysine N-methyltransferase 2B Human genes 0.000 description 2
- 101000612655 Homo sapiens 26S proteasome non-ATPase regulatory subunit 1 Proteins 0.000 description 2
- 101000590272 Homo sapiens 26S proteasome non-ATPase regulatory subunit 2 Proteins 0.000 description 2
- 101000727483 Homo sapiens 28S ribosomal protein S28, mitochondrial Proteins 0.000 description 2
- 101000689823 Homo sapiens 28S ribosomal protein S35, mitochondrial Proteins 0.000 description 2
- 101001117935 Homo sapiens 60S ribosomal protein L15 Proteins 0.000 description 2
- 101000691203 Homo sapiens 60S ribosomal protein L4 Proteins 0.000 description 2
- 101000724444 Homo sapiens Alanyl-tRNA editing protein Aarsd1 Proteins 0.000 description 2
- 101000890401 Homo sapiens Amyloid beta precursor like protein 2 Proteins 0.000 description 2
- 101000895309 Homo sapiens Cyclic AMP-responsive element-binding protein 3-like protein 4 Proteins 0.000 description 2
- 101000915170 Homo sapiens Cytosolic 5'-nucleotidase 3A Proteins 0.000 description 2
- 101000650600 Homo sapiens DNA-directed RNA polymerase I subunit RPA2 Proteins 0.000 description 2
- 101001130785 Homo sapiens Dolichyl-diphosphooligosaccharide-protein glycosyltransferase 48 kDa subunit Proteins 0.000 description 2
- 101001010541 Homo sapiens Electron transfer flavoprotein subunit alpha, mitochondrial Proteins 0.000 description 2
- 101000959746 Homo sapiens Eukaryotic translation initiation factor 6 Proteins 0.000 description 2
- 101001045848 Homo sapiens Histone-lysine N-methyltransferase 2B Proteins 0.000 description 2
- 101001008894 Homo sapiens Histone-lysine N-methyltransferase 2D Proteins 0.000 description 2
- 101000926535 Homo sapiens Interferon-induced, double-stranded RNA-activated protein kinase Proteins 0.000 description 2
- 101001046974 Homo sapiens KAT8 regulatory NSL complex subunit 1 Proteins 0.000 description 2
- 101001064870 Homo sapiens Lon protease homolog, mitochondrial Proteins 0.000 description 2
- 101000615492 Homo sapiens Methyl-CpG-binding domain protein 4 Proteins 0.000 description 2
- 101000578920 Homo sapiens Microtubule-actin cross-linking factor 1, isoforms 1/2/3/5 Proteins 0.000 description 2
- 101000896414 Homo sapiens Nuclear nucleic acid-binding protein C1D Proteins 0.000 description 2
- 101000886818 Homo sapiens PDZ domain-containing protein GIPC1 Proteins 0.000 description 2
- 101001095329 Homo sapiens POM121 and ZP3 fusion protein Proteins 0.000 description 2
- 101000619805 Homo sapiens Peroxiredoxin-5, mitochondrial Proteins 0.000 description 2
- 101000923320 Homo sapiens Phospholipid-transporting ATPase IF Proteins 0.000 description 2
- 101001105692 Homo sapiens Pre-mRNA-processing factor 6 Proteins 0.000 description 2
- 101000711369 Homo sapiens Probable ribosome biogenesis protein RLP24 Proteins 0.000 description 2
- 101000630284 Homo sapiens Proline-tRNA ligase Proteins 0.000 description 2
- 101001076715 Homo sapiens RNA-binding protein 39 Proteins 0.000 description 2
- 101001099877 Homo sapiens Ras-related protein Rab-43 Proteins 0.000 description 2
- 101001085900 Homo sapiens Ribosomal RNA processing protein 1 homolog B Proteins 0.000 description 2
- 101000674040 Homo sapiens Serine-tRNA ligase, mitochondrial Proteins 0.000 description 2
- 101000628647 Homo sapiens Serine/threonine-protein kinase 24 Proteins 0.000 description 2
- 101000650854 Homo sapiens Small glutamine-rich tetratricopeptide repeat-containing protein alpha Proteins 0.000 description 2
- 101000657845 Homo sapiens Small nuclear ribonucleoprotein-associated proteins B and B' Proteins 0.000 description 2
- 101000735431 Homo sapiens Terminal nucleotidyltransferase 4A Proteins 0.000 description 2
- 101000787286 Homo sapiens Valine-tRNA ligase Proteins 0.000 description 2
- 238000012369 In process control Methods 0.000 description 2
- 102100026819 Inositol polyphosphate 1-phosphatase Human genes 0.000 description 2
- 102100034170 Interferon-induced, double-stranded RNA-activated protein kinase Human genes 0.000 description 2
- 102100022903 KAT8 regulatory NSL complex subunit 1 Human genes 0.000 description 2
- 239000005411 L01XE02 - Gefitinib Substances 0.000 description 2
- 239000005551 L01XE03 - Erlotinib Substances 0.000 description 2
- 102100031955 Lon protease homolog, mitochondrial Human genes 0.000 description 2
- 102100029107 Long chain 3-hydroxyacyl-CoA dehydrogenase Human genes 0.000 description 2
- 101710125418 Major capsid protein Proteins 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 102100021290 Methyl-CpG-binding domain protein 4 Human genes 0.000 description 2
- 102100028322 Microtubule-actin cross-linking factor 1, isoforms 1/2/3/5 Human genes 0.000 description 2
- 102100023198 Mitochondrial carrier homolog 1 Human genes 0.000 description 2
- 102100022450 Mitochondrial tRNA-specific 2-thiouridylase 1 Human genes 0.000 description 2
- 102100034068 Monocarboxylate transporter 1 Human genes 0.000 description 2
- 102100031701 Nuclear factor erythroid 2-related factor 2 Human genes 0.000 description 2
- 102100021713 Nuclear nucleic acid-binding protein C1D Human genes 0.000 description 2
- 102100022883 Nuclear receptor coactivator 3 Human genes 0.000 description 2
- 101710141454 Nucleoprotein Proteins 0.000 description 2
- 102100039983 PDZ domain-containing protein GIPC1 Human genes 0.000 description 2
- 102100037767 POM121 and ZP3 fusion protein Human genes 0.000 description 2
- 102100022078 Peroxiredoxin-5, mitochondrial Human genes 0.000 description 2
- 102100025516 Peroxisome biogenesis factor 2 Human genes 0.000 description 2
- 102100032687 Phospholipid-transporting ATPase IF Human genes 0.000 description 2
- 102100021232 Pre-mRNA-processing factor 6 Human genes 0.000 description 2
- 102100038632 Presequence protease, mitochondrial Human genes 0.000 description 2
- 102100037427 Probable ATP-dependent RNA helicase DDX56 Human genes 0.000 description 2
- 101710083689 Probable capsid protein Proteins 0.000 description 2
- 102100034040 Probable ribosome biogenesis protein RLP24 Human genes 0.000 description 2
- 102100026126 Proline-tRNA ligase Human genes 0.000 description 2
- 108090000748 Prostaglandin-E Synthases Proteins 0.000 description 2
- 102100021037 Protein unc-45 homolog A Human genes 0.000 description 2
- 102100038479 Ras-related protein Rab-43 Human genes 0.000 description 2
- 102100028254 Renin receptor Human genes 0.000 description 2
- 102100029642 Ribosomal RNA processing protein 1 homolog B Human genes 0.000 description 2
- 102100040597 Serine-tRNA ligase, mitochondrial Human genes 0.000 description 2
- 102100026764 Serine/threonine-protein kinase 24 Human genes 0.000 description 2
- 102100027722 Small glutamine-rich tetratricopeptide repeat-containing protein alpha Human genes 0.000 description 2
- 102100034683 Small nuclear ribonucleoprotein-associated proteins B and B' Human genes 0.000 description 2
- 102100034939 Terminal nucleotidyltransferase 4A Human genes 0.000 description 2
- 102100032349 Transforming growth factor-beta receptor-associated protein 1 Human genes 0.000 description 2
- 102100025607 Valine-tRNA ligase Human genes 0.000 description 2
- 241000700605 Viruses Species 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- 238000001574 biopsy Methods 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 230000000875 corresponding effect Effects 0.000 description 2
- 238000002790 cross-validation Methods 0.000 description 2
- 229960001433 erlotinib Drugs 0.000 description 2
- AAKJLRGGTJKAMG-UHFFFAOYSA-N erlotinib Chemical compound C=12C=C(OCCOC)C(OCCOC)=CC2=NC=NC=1NC1=CC=CC(C#C)=C1 AAKJLRGGTJKAMG-UHFFFAOYSA-N 0.000 description 2
- 229960002584 gefitinib Drugs 0.000 description 2
- XGALLCVXEZPNRQ-UHFFFAOYSA-N gefitinib Chemical compound C=12C=C(OCCCN3CCOCC3)C(OC)=CC2=NC=NC=1NC1=CC=C(F)C(Cl)=C1 XGALLCVXEZPNRQ-UHFFFAOYSA-N 0.000 description 2
- 230000037442 genomic alteration Effects 0.000 description 2
- 238000010965 in-process control Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- 108020004999 messenger RNA Proteins 0.000 description 2
- 210000002487 multivesicular body Anatomy 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000011269 tar Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 210000002700 urine Anatomy 0.000 description 2
- UJCHIZDEQZMODR-BYPYZUCNSA-N (2r)-2-acetamido-3-sulfanylpropanamide Chemical compound CC(=O)N[C@@H](CS)C(N)=O UJCHIZDEQZMODR-BYPYZUCNSA-N 0.000 description 1
- HONKEGXLWUDTCF-YFKPBYRVSA-N (2s)-2-amino-2-methyl-4-phosphonobutanoic acid Chemical compound OC(=O)[C@](N)(C)CCP(O)(O)=O HONKEGXLWUDTCF-YFKPBYRVSA-N 0.000 description 1
- JPKJQBJPBRLVTM-OSLIGDBKSA-N (2s)-2-amino-n-[(2s,3r)-3-hydroxy-1-[[(2s)-1-[[(2s)-1-[[(2s)-1-[[(2r)-1-(1h-indol-3-yl)-3-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-1-oxobutan-2-yl]-6-iminohexanamide Chemical compound C([C@H](NC(=O)[C@@H](NC(=O)[C@@H](N)CCCC=N)[C@H](O)C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@H](CC=1C2=CC=CC=C2NC=1)C=O)C1=CC=CC=C1 JPKJQBJPBRLVTM-OSLIGDBKSA-N 0.000 description 1
- KUBDPRSHRVANQQ-NSOVKSMOSA-N (2s,6s)-6-(4-tert-butylphenyl)-2-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2h-pyridine-5-carboxylic acid Chemical compound C1=CC(C)=CC=C1[C@H]1N(S(=O)(=O)C=2C=CC(C)=CC=2)[C@@H](C=2C=CC(=CC=2)C(C)(C)C)C(C(O)=O)=CC1 KUBDPRSHRVANQQ-NSOVKSMOSA-N 0.000 description 1
- QYAPHLRPFNSDNH-MRFRVZCGSA-N (4s,4as,5as,6s,12ar)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride Chemical compound Cl.C1=CC(Cl)=C2[C@](O)(C)[C@H]3C[C@H]4[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C3=C(O)C2=C1O QYAPHLRPFNSDNH-MRFRVZCGSA-N 0.000 description 1
- SVJQCVOKYJWUBC-OWOJBTEDSA-N (e)-3-(2,3,4,5-tetrabromophenyl)prop-2-enoic acid Chemical compound OC(=O)\C=C\C1=CC(Br)=C(Br)C(Br)=C1Br SVJQCVOKYJWUBC-OWOJBTEDSA-N 0.000 description 1
- 102100038368 1-acyl-sn-glycerol-3-phosphate acyltransferase gamma Human genes 0.000 description 1
- 102100035905 1-acylglycerol-3-phosphate O-acyltransferase ABHD5 Human genes 0.000 description 1
- 102100038028 1-phosphatidylinositol 3-phosphate 5-kinase Human genes 0.000 description 1
- 102100038363 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1 Human genes 0.000 description 1
- 102100024341 10 kDa heat shock protein, mitochondrial Human genes 0.000 description 1
- 102100039583 116 kDa U5 small nuclear ribonucleoprotein component Human genes 0.000 description 1
- 102100031592 12S rRNA N4-methylcytidine (m4C) methyltransferase Human genes 0.000 description 1
- 102100020928 14 kDa phosphohistidine phosphatase Human genes 0.000 description 1
- 101710082470 14 kDa phosphohistidine phosphatase Proteins 0.000 description 1
- 102100021408 14-3-3 protein beta/alpha Human genes 0.000 description 1
- 102100025007 14-3-3 protein epsilon Human genes 0.000 description 1
- 102100027832 14-3-3 protein gamma Human genes 0.000 description 1
- 102100027831 14-3-3 protein theta Human genes 0.000 description 1
- 102100040685 14-3-3 protein zeta/delta Human genes 0.000 description 1
- 102100037426 17-beta-hydroxysteroid dehydrogenase type 1 Human genes 0.000 description 1
- 102100031548 18S rRNA aminocarboxypropyltransferase Human genes 0.000 description 1
- LLMLGZUZTFMXSA-UHFFFAOYSA-N 2,3,4,5,6-pentachlorobenzenethiol Chemical compound SC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl LLMLGZUZTFMXSA-UHFFFAOYSA-N 0.000 description 1
- 102100021403 2,4-dienoyl-CoA reductase [(3E)-enoyl-CoA-producing], mitochondrial Human genes 0.000 description 1
- TYIRBZOAKBEYEJ-UHFFFAOYSA-N 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate Chemical compound C1=CC(C)=CC=C1C(=O)C(N1C)=CC=C1CC(=O)OCCN1C(C(=O)N(C)C(=O)N2C)=C2N=C1 TYIRBZOAKBEYEJ-UHFFFAOYSA-N 0.000 description 1
- 102100031599 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Human genes 0.000 description 1
- 102100024830 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Human genes 0.000 description 1
- BFWKKBSHTOEBHL-OFQRWUPVSA-N 2-[(1s,4as,8as)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1h-naphthalen-1-yl]acetaldehyde Chemical compound O=CC[C@H]1C(=C)CC[C@H]2C(C)(C)CCC[C@@]21C BFWKKBSHTOEBHL-OFQRWUPVSA-N 0.000 description 1
- WVAKRQOMAINQPU-UHFFFAOYSA-N 2-[4-[2-[5-(2,2-dimethylbutyl)-1h-imidazol-2-yl]ethyl]phenyl]pyridine Chemical compound N1C(CC(C)(C)CC)=CN=C1CCC1=CC=C(C=2N=CC=CC=2)C=C1 WVAKRQOMAINQPU-UHFFFAOYSA-N 0.000 description 1
- 101710186725 2-acylglycerol O-acyltransferase 2 Proteins 0.000 description 1
- OTJMDLIUFVHKNU-UHFFFAOYSA-N 2-hydroxy-5-methylidene-3-(piperidin-1-ylamino)cyclopent-2-en-1-one Chemical compound C1C(=C)C(=O)C(O)=C1NN1CCCCC1 OTJMDLIUFVHKNU-UHFFFAOYSA-N 0.000 description 1
- 102100027324 2-hydroxyacyl-CoA lyase 1 Human genes 0.000 description 1
- 102100027328 2-hydroxyacyl-CoA lyase 2 Human genes 0.000 description 1
- 102100025425 2-oxoglutarate and iron-dependent oxygenase JMJD4 Human genes 0.000 description 1
- 102100026936 2-oxoglutarate dehydrogenase, mitochondrial Human genes 0.000 description 1
- 102100035352 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial Human genes 0.000 description 1
- 102100035315 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial Human genes 0.000 description 1
- 102100036734 26S proteasome non-ATPase regulatory subunit 10 Human genes 0.000 description 1
- 102100040964 26S proteasome non-ATPase regulatory subunit 11 Human genes 0.000 description 1
- 102100040961 26S proteasome non-ATPase regulatory subunit 12 Human genes 0.000 description 1
- 102100040962 26S proteasome non-ATPase regulatory subunit 13 Human genes 0.000 description 1
- 102100032282 26S proteasome non-ATPase regulatory subunit 14 Human genes 0.000 description 1
- 102100032303 26S proteasome non-ATPase regulatory subunit 2 Human genes 0.000 description 1
- 102100032301 26S proteasome non-ATPase regulatory subunit 3 Human genes 0.000 description 1
- 102100033458 26S proteasome non-ATPase regulatory subunit 4 Human genes 0.000 description 1
- 102100033453 26S proteasome non-ATPase regulatory subunit 5 Human genes 0.000 description 1
- 102100033097 26S proteasome non-ATPase regulatory subunit 6 Human genes 0.000 description 1
- 102100036657 26S proteasome non-ATPase regulatory subunit 7 Human genes 0.000 description 1
- 102100036652 26S proteasome non-ATPase regulatory subunit 8 Human genes 0.000 description 1
- 102100036659 26S proteasome non-ATPase regulatory subunit 9 Human genes 0.000 description 1
- 102100033828 26S proteasome regulatory subunit 10B Human genes 0.000 description 1
- 102100022644 26S proteasome regulatory subunit 4 Human genes 0.000 description 1
- 102100029510 26S proteasome regulatory subunit 6A Human genes 0.000 description 1
- 102100029511 26S proteasome regulatory subunit 6B Human genes 0.000 description 1
- 102100034682 26S proteasome regulatory subunit 7 Human genes 0.000 description 1
- 102100036563 26S proteasome regulatory subunit 8 Human genes 0.000 description 1
- 102100039377 28 kDa heat- and acid-stable phosphoprotein Human genes 0.000 description 1
- 102100021565 28S rRNA (cytosine-C(5))-methyltransferase Human genes 0.000 description 1
- 102100030877 28S ribosomal protein S16, mitochondrial Human genes 0.000 description 1
- 102100034487 28S ribosomal protein S18b, mitochondrial Human genes 0.000 description 1
- 102100027087 28S ribosomal protein S18c, mitochondrial Human genes 0.000 description 1
- 102100030799 28S ribosomal protein S2, mitochondrial Human genes 0.000 description 1
- 102100029443 28S ribosomal protein S23, mitochondrial Human genes 0.000 description 1
- 102100029890 28S ribosomal protein S27, mitochondrial Human genes 0.000 description 1
- 102100029829 28S ribosomal protein S29, mitochondrial Human genes 0.000 description 1
- 102100024419 28S ribosomal protein S31, mitochondrial Human genes 0.000 description 1
- 102100024428 28S ribosomal protein S33, mitochondrial Human genes 0.000 description 1
- 102100035152 28S ribosomal protein S7, mitochondrial Human genes 0.000 description 1
- 102100039358 3-hydroxyacyl-CoA dehydrogenase type-2 Human genes 0.000 description 1
- 102100034767 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial Human genes 0.000 description 1
- 102100023340 3-ketodihydrosphingosine reductase Human genes 0.000 description 1
- 102100037149 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial Human genes 0.000 description 1
- 102100037263 3-phosphoinositide-dependent protein kinase 1 Human genes 0.000 description 1
- 102100020966 39S ribosomal protein L11, mitochondrial Human genes 0.000 description 1
- 102100026163 39S ribosomal protein L12, mitochondrial Human genes 0.000 description 1
- 102100026146 39S ribosomal protein L13, mitochondrial Human genes 0.000 description 1
- 102100033747 39S ribosomal protein L15, mitochondrial Human genes 0.000 description 1
- 102100027559 39S ribosomal protein L16, mitochondrial Human genes 0.000 description 1
- 102100028103 39S ribosomal protein L18, mitochondrial Human genes 0.000 description 1
- 102100028104 39S ribosomal protein L19, mitochondrial Human genes 0.000 description 1
- 102100034036 39S ribosomal protein L22, mitochondrial Human genes 0.000 description 1
- 102100039522 39S ribosomal protein L3, mitochondrial Human genes 0.000 description 1
- 102100039520 39S ribosomal protein L33, mitochondrial Human genes 0.000 description 1
- 102100020967 39S ribosomal protein L35, mitochondrial Human genes 0.000 description 1
- 102100040297 39S ribosomal protein L39, mitochondrial Human genes 0.000 description 1
- 102100039776 39S ribosomal protein L4, mitochondrial Human genes 0.000 description 1
- 102100040298 39S ribosomal protein L40, mitochondrial Human genes 0.000 description 1
- 102100040302 39S ribosomal protein L41, mitochondrial Human genes 0.000 description 1
- 102100034141 39S ribosomal protein L42, mitochondrial Human genes 0.000 description 1
- 102100033746 39S ribosomal protein L48, mitochondrial Human genes 0.000 description 1
- 102100033751 39S ribosomal protein L49, mitochondrial Human genes 0.000 description 1
- 102100021304 39S ribosomal protein L51, mitochondrial Human genes 0.000 description 1
- 102100034488 39S ribosomal protein S18a, mitochondrial Human genes 0.000 description 1
- 102100024420 39S ribosomal protein S30, mitochondrial Human genes 0.000 description 1
- QHXIQBNUQFLDAB-UHFFFAOYSA-N 4-N,6-N-dimethyl-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine Chemical compound CNC1=NC(NC)=NC(NC(C)C)=N1 QHXIQBNUQFLDAB-UHFFFAOYSA-N 0.000 description 1
- 102100027451 4-hydroxybenzoate polyprenyltransferase, mitochondrial Human genes 0.000 description 1
- MXCVHSXCXPHOLP-UHFFFAOYSA-N 4-oxo-6-propylchromene-2-carboxylic acid Chemical compound O1C(C(O)=O)=CC(=O)C2=CC(CCC)=CC=C21 MXCVHSXCXPHOLP-UHFFFAOYSA-N 0.000 description 1
- 102100027278 4-trimethylaminobutyraldehyde dehydrogenase Human genes 0.000 description 1
- 102100026726 40S ribosomal protein S11 Human genes 0.000 description 1
- 102100026357 40S ribosomal protein S13 Human genes 0.000 description 1
- 102100031571 40S ribosomal protein S16 Human genes 0.000 description 1
- 102100023415 40S ribosomal protein S20 Human genes 0.000 description 1
- 102100037710 40S ribosomal protein S21 Human genes 0.000 description 1
- 102100037513 40S ribosomal protein S23 Human genes 0.000 description 1
- 102100033449 40S ribosomal protein S24 Human genes 0.000 description 1
- 102100022721 40S ribosomal protein S25 Human genes 0.000 description 1
- 102100032500 40S ribosomal protein S27-like Human genes 0.000 description 1
- 102100034088 40S ribosomal protein S4, X isoform Human genes 0.000 description 1
- 102100023779 40S ribosomal protein S5 Human genes 0.000 description 1
- 102100033714 40S ribosomal protein S6 Human genes 0.000 description 1
- 102100024088 40S ribosomal protein S7 Human genes 0.000 description 1
- 102100033731 40S ribosomal protein S9 Human genes 0.000 description 1
- 102100022530 45 kDa calcium-binding protein Human genes 0.000 description 1
- 102100033400 4F2 cell-surface antigen heavy chain Human genes 0.000 description 1
- 102100034095 5'(3')-deoxyribonucleotidase, cytosolic type Human genes 0.000 description 1
- 102100036184 5'-3' exonuclease PLD3 Human genes 0.000 description 1
- 102100036962 5'-3' exoribonuclease 1 Human genes 0.000 description 1
- 102100039222 5'-3' exoribonuclease 2 Human genes 0.000 description 1
- 102100024627 5'-AMP-activated protein kinase subunit gamma-1 Human genes 0.000 description 1
- SVDVJBWDBYSQLO-UHFFFAOYSA-N 5-(4-hydroxy-3-methoxyphenyl)-5-phenylimidazolidine-2,4-dione Chemical compound C1=C(O)C(OC)=CC(C2(C(NC(=O)N2)=O)C=2C=CC=CC=2)=C1 SVDVJBWDBYSQLO-UHFFFAOYSA-N 0.000 description 1
- 102100021324 5-azacytidine-induced protein 2 Human genes 0.000 description 1
- 102100023176 52 kDa repressor of the inhibitor of the protein kinase Human genes 0.000 description 1
- 102100027123 55 kDa erythrocyte membrane protein Human genes 0.000 description 1
- 102100038222 60 kDa heat shock protein, mitochondrial Human genes 0.000 description 1
- 102100038954 60S ribosomal export protein NMD3 Human genes 0.000 description 1
- 102100022406 60S ribosomal protein L10a Human genes 0.000 description 1
- 102100035916 60S ribosomal protein L11 Human genes 0.000 description 1
- 102100022289 60S ribosomal protein L13a Human genes 0.000 description 1
- 102100031854 60S ribosomal protein L14 Human genes 0.000 description 1
- 102100023990 60S ribosomal protein L17 Human genes 0.000 description 1
- 102100021206 60S ribosomal protein L19 Human genes 0.000 description 1
- 102100037685 60S ribosomal protein L22 Human genes 0.000 description 1
- 102100038008 60S ribosomal protein L22-like 1 Human genes 0.000 description 1
- 102100021308 60S ribosomal protein L23 Human genes 0.000 description 1
- 102100023247 60S ribosomal protein L23a Human genes 0.000 description 1
- 102100028348 60S ribosomal protein L26 Human genes 0.000 description 1
- 102100028439 60S ribosomal protein L26-like 1 Human genes 0.000 description 1
- 102100025601 60S ribosomal protein L27 Human genes 0.000 description 1
- 102100021927 60S ribosomal protein L27a Human genes 0.000 description 1
- 102100021660 60S ribosomal protein L28 Human genes 0.000 description 1
- 102100038237 60S ribosomal protein L30 Human genes 0.000 description 1
- 102100023777 60S ribosomal protein L31 Human genes 0.000 description 1
- 102100040768 60S ribosomal protein L32 Human genes 0.000 description 1
- 102100040637 60S ribosomal protein L34 Human genes 0.000 description 1
- 102100036116 60S ribosomal protein L35 Human genes 0.000 description 1
- 102100022276 60S ribosomal protein L35a Human genes 0.000 description 1
- 102100031012 60S ribosomal protein L36a-like Human genes 0.000 description 1
- 102100036126 60S ribosomal protein L37a Human genes 0.000 description 1
- 102100026750 60S ribosomal protein L5 Human genes 0.000 description 1
- 102100040924 60S ribosomal protein L6 Human genes 0.000 description 1
- 102100036630 60S ribosomal protein L7a Human genes 0.000 description 1
- 102100035931 60S ribosomal protein L8 Human genes 0.000 description 1
- 102100029405 60S ribosome subunit biogenesis protein NIP7 homolog Human genes 0.000 description 1
- LBJBPGRQRGLKPL-UHFFFAOYSA-N 7-(4-chlorophenyl)-5-naphthalen-2-yl-6-sulfanylidene-2,3-dihydro-1h-pyrrolo[3,4-e][1,4]diazepin-8-one Chemical compound C1=CC(Cl)=CC=C1N1C(=S)C(C(=NCCN2)C=3C=C4C=CC=CC4=CC=3)=C2C1=O LBJBPGRQRGLKPL-UHFFFAOYSA-N 0.000 description 1
- 102100026137 7SK snRNA methylphosphate capping enzyme Human genes 0.000 description 1
- 102100031912 A-kinase anchor protein 1, mitochondrial Human genes 0.000 description 1
- 102100033822 A-kinase anchor protein 10, mitochondrial Human genes 0.000 description 1
- 102100031908 A-kinase anchor protein 7 isoform gamma Human genes 0.000 description 1
- 102100040086 A-kinase anchor protein 8 Human genes 0.000 description 1
- 102100024059 A-kinase anchor protein 8-like Human genes 0.000 description 1
- 102100040084 A-kinase anchor protein 9 Human genes 0.000 description 1
- 102100039720 A-kinase-interacting protein 1 Human genes 0.000 description 1
- 108091007504 ADAM10 Proteins 0.000 description 1
- 108091007505 ADAM17 Proteins 0.000 description 1
- 108010016281 ADP-Ribosylation Factor 1 Proteins 0.000 description 1
- 108090000067 ADP-Ribosylation Factor 6 Proteins 0.000 description 1
- 102000034257 ADP-Ribosylation Factor 6 Human genes 0.000 description 1
- 102100021945 ADP-ribose pyrophosphatase, mitochondrial Human genes 0.000 description 1
- 102100034341 ADP-ribosylation factor 1 Human genes 0.000 description 1
- 102100023826 ADP-ribosylation factor 4 Human genes 0.000 description 1
- 102100023833 ADP-ribosylation factor 5 Human genes 0.000 description 1
- 102100033282 ADP-ribosylation factor GTPase-activating protein 2 Human genes 0.000 description 1
- 102100033281 ADP-ribosylation factor GTPase-activating protein 3 Human genes 0.000 description 1
- 102100040190 ADP-ribosylation factor-binding protein GGA2 Human genes 0.000 description 1
- 102100040193 ADP-ribosylation factor-binding protein GGA3 Human genes 0.000 description 1
- 102100022908 ADP-ribosylation factor-like protein 1 Human genes 0.000 description 1
- 102100023971 ADP-ribosylation factor-like protein 13B Human genes 0.000 description 1
- 102100022912 ADP-ribosylation factor-like protein 16 Human genes 0.000 description 1
- 102100023961 ADP-ribosylation factor-like protein 2-binding protein Human genes 0.000 description 1
- 102100039646 ADP-ribosylation factor-like protein 3 Human genes 0.000 description 1
- 102100022861 ADP-ribosylation factor-like protein 5A Human genes 0.000 description 1
- 102100030675 ADP-ribosylation factor-like protein 6-interacting protein 4 Human genes 0.000 description 1
- 102100028358 ADP-ribosylation factor-like protein 8A Human genes 0.000 description 1
- 102100034119 ADP-ribosylhydrolase ARH1 Human genes 0.000 description 1
- 102100024393 ADP-ribosylhydrolase ARH3 Human genes 0.000 description 1
- 102100026396 ADP/ATP translocase 2 Human genes 0.000 description 1
- 101150012579 ADSL gene Proteins 0.000 description 1
- 102100024381 AF4/FMR2 family member 4 Human genes 0.000 description 1
- 102100034215 AFG3-like protein 2 Human genes 0.000 description 1
- 102100026449 AKT-interacting protein Human genes 0.000 description 1
- 102000010553 ALAD Human genes 0.000 description 1
- 101150082527 ALAD gene Proteins 0.000 description 1
- 102100025676 AMMECR1-like protein Human genes 0.000 description 1
- 102100040800 AN1-type zinc finger protein 1 Human genes 0.000 description 1
- 102100039967 AN1-type zinc finger protein 2B Human genes 0.000 description 1
- 102100036610 AN1-type zinc finger protein 5 Human genes 0.000 description 1
- 102100036605 AN1-type zinc finger protein 6 Human genes 0.000 description 1
- 101150046097 ANAPC11 gene Proteins 0.000 description 1
- 101150060590 ANAPC5 gene Proteins 0.000 description 1
- 102100034482 AP-1 complex subunit beta-1 Human genes 0.000 description 1
- 102100033938 AP-1 complex subunit gamma-1 Human genes 0.000 description 1
- 102100034526 AP-1 complex subunit mu-1 Human genes 0.000 description 1
- 102100028777 AP-1 complex subunit sigma-1A Human genes 0.000 description 1
- 102100022984 AP-2 complex subunit alpha-1 Human genes 0.000 description 1
- 102100022974 AP-2 complex subunit alpha-2 Human genes 0.000 description 1
- 102100033347 AP-2 complex subunit beta Human genes 0.000 description 1
- 102100031315 AP-2 complex subunit mu Human genes 0.000 description 1
- 102100033936 AP-3 complex subunit beta-1 Human genes 0.000 description 1
- 102100033926 AP-3 complex subunit delta-1 Human genes 0.000 description 1
- 102100040005 AP-3 complex subunit mu-1 Human genes 0.000 description 1
- 102100040009 AP-3 complex subunit sigma-1 Human genes 0.000 description 1
- 102100024120 AP-4 complex accessory subunit RUSC1 Human genes 0.000 description 1
- 102100024053 AP-4 complex accessory subunit RUSC2 Human genes 0.000 description 1
- 102100036454 AP-4 complex subunit beta-1 Human genes 0.000 description 1
- 102100036458 AP-4 complex subunit epsilon-1 Human genes 0.000 description 1
- 102100036459 AP-4 complex subunit mu-1 Human genes 0.000 description 1
- 102100040059 AP-5 complex subunit zeta-1 Human genes 0.000 description 1
- 102100038079 AP2-associated protein kinase 1 Human genes 0.000 description 1
- 102100039602 ARF GTPase-activating protein GIT2 Human genes 0.000 description 1
- 102100034571 AT-rich interactive domain-containing protein 1B Human genes 0.000 description 1
- 102100030841 AT-rich interactive domain-containing protein 4A Human genes 0.000 description 1
- 102100030840 AT-rich interactive domain-containing protein 4B Human genes 0.000 description 1
- 102100022933 ATM interactor Human genes 0.000 description 1
- 102100023619 ATP synthase F(0) complex subunit B1, mitochondrial Human genes 0.000 description 1
- 102100023568 ATP synthase F(0) complex subunit C1, mitochondrial Human genes 0.000 description 1
- 102100023587 ATP synthase F(0) complex subunit C2, mitochondrial Human genes 0.000 description 1
- 102100022994 ATP synthase F(0) complex subunit C3, mitochondrial Human genes 0.000 description 1
- 102100027691 ATP synthase membrane subunit K, mitochondrial Human genes 0.000 description 1
- 102100028814 ATP synthase mitochondrial F1 complex assembly factor 1 Human genes 0.000 description 1
- 102100029772 ATP synthase subunit ATP5MJ, mitochondrial Human genes 0.000 description 1
- 102100026788 ATP synthase subunit C lysine N-methyltransferase Human genes 0.000 description 1
- 102100027573 ATP synthase subunit alpha, mitochondrial Human genes 0.000 description 1
- 102100022890 ATP synthase subunit beta, mitochondrial Human genes 0.000 description 1
- 102100027757 ATP synthase subunit d, mitochondrial Human genes 0.000 description 1
- 102100025581 ATP synthase subunit delta, mitochondrial Human genes 0.000 description 1
- 102100027790 ATP synthase subunit e, mitochondrial Human genes 0.000 description 1
- 102100026564 ATP synthase subunit f, mitochondrial Human genes 0.000 description 1
- 102100027787 ATP synthase subunit g, mitochondrial Human genes 0.000 description 1
- 102100032763 ATP synthase subunit gamma, mitochondrial Human genes 0.000 description 1
- 102100030454 ATP synthase subunit s, mitochondrial Human genes 0.000 description 1
- 102100027782 ATP synthase-coupling factor 6, mitochondrial Human genes 0.000 description 1
- 102100028280 ATP-binding cassette sub-family B member 10, mitochondrial Human genes 0.000 description 1
- 102100037128 ATP-binding cassette sub-family C member 10 Human genes 0.000 description 1
- 102100028186 ATP-binding cassette sub-family C member 5 Human genes 0.000 description 1
- 102100024643 ATP-binding cassette sub-family D member 1 Human genes 0.000 description 1
- 102100020973 ATP-binding cassette sub-family D member 3 Human genes 0.000 description 1
- 102100020979 ATP-binding cassette sub-family F member 1 Human genes 0.000 description 1
- 102100022654 ATP-binding cassette sub-family F member 2 Human genes 0.000 description 1
- 102100035623 ATP-citrate synthase Human genes 0.000 description 1
- 102100029160 ATP-dependent (S)-NAD(P)H-hydrate dehydratase Human genes 0.000 description 1
- 102100032921 ATP-dependent 6-phosphofructokinase, liver type Human genes 0.000 description 1
- 102100022284 ATP-dependent Clp protease ATP-binding subunit clpX-like, mitochondrial Human genes 0.000 description 1
- 102100021222 ATP-dependent Clp protease proteolytic subunit, mitochondrial Human genes 0.000 description 1
- 102100027447 ATP-dependent DNA helicase Q1 Human genes 0.000 description 1
- 102100038351 ATP-dependent DNA helicase Q5 Human genes 0.000 description 1
- 102100022410 ATP-dependent DNA/RNA helicase DHX36 Human genes 0.000 description 1
- 102100030088 ATP-dependent RNA helicase A Human genes 0.000 description 1
- 102100021405 ATP-dependent RNA helicase DDX1 Human genes 0.000 description 1
- 102100021407 ATP-dependent RNA helicase DDX18 Human genes 0.000 description 1
- 102100024736 ATP-dependent RNA helicase DDX19B Human genes 0.000 description 1
- 102100033391 ATP-dependent RNA helicase DDX3X Human genes 0.000 description 1
- 102100035720 ATP-dependent RNA helicase DDX42 Human genes 0.000 description 1
- 102100038266 ATP-dependent RNA helicase DDX54 Human genes 0.000 description 1
- 102100023388 ATP-dependent RNA helicase DHX15 Human genes 0.000 description 1
- 102100022413 ATP-dependent RNA helicase DHX30 Human genes 0.000 description 1
- 102100022423 ATP-dependent RNA helicase DHX33 Human genes 0.000 description 1
- 102100030089 ATP-dependent RNA helicase DHX8 Human genes 0.000 description 1
- 102100029005 ATP-dependent RNA helicase SUPV3L1, mitochondrial Human genes 0.000 description 1
- 102100032814 ATP-dependent zinc metalloprotease YME1L1 Human genes 0.000 description 1
- 102100022781 ATP-sensitive inward rectifier potassium channel 15 Human genes 0.000 description 1
- 102100024825 ATPase MORC2 Human genes 0.000 description 1
- 102100032792 ATPase family AAA domain-containing protein 2B Human genes 0.000 description 1
- 102100032787 ATPase family AAA domain-containing protein 3A Human genes 0.000 description 1
- 102100025995 AarF domain-containing protein kinase 1 Human genes 0.000 description 1
- 102100028175 Abasic site processing protein HMCES Human genes 0.000 description 1
- 102100039382 Abscission/NoCut checkpoint regulator Human genes 0.000 description 1
- 241001556567 Acanthamoeba polyphaga mimivirus Species 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 102100028704 Acetyl-CoA acetyltransferase, cytosolic Human genes 0.000 description 1
- 102100030381 Acetyl-coenzyme A synthetase 2-like, mitochondrial Human genes 0.000 description 1
- 102100035709 Acetyl-coenzyme A synthetase, cytoplasmic Human genes 0.000 description 1
- 102100028249 Acetyl-coenzyme A transporter 1 Human genes 0.000 description 1
- 102100027485 Acid sphingomyelinase-like phosphodiesterase 3a Human genes 0.000 description 1
- 102100027863 Acidic fibroblast growth factor intracellular-binding protein Human genes 0.000 description 1
- 102100022997 Acidic leucine-rich nuclear phosphoprotein 32 family member A Human genes 0.000 description 1
- 102100033408 Acidic leucine-rich nuclear phosphoprotein 32 family member B Human genes 0.000 description 1
- 102100033410 Acidic leucine-rich nuclear phosphoprotein 32 family member C Human genes 0.000 description 1
- 102100033404 Acidic leucine-rich nuclear phosphoprotein 32 family member E Human genes 0.000 description 1
- 102100040958 Aconitate hydratase, mitochondrial Human genes 0.000 description 1
- 102100022900 Actin, cytoplasmic 1 Human genes 0.000 description 1
- 102100034064 Actin-like protein 6A Human genes 0.000 description 1
- 102100037278 Actin-related protein 2/3 complex subunit 1A Human genes 0.000 description 1
- 102100021636 Actin-related protein 2/3 complex subunit 2 Human genes 0.000 description 1
- 102100033889 Actin-related protein 2/3 complex subunit 3 Human genes 0.000 description 1
- 102100033888 Actin-related protein 2/3 complex subunit 4 Human genes 0.000 description 1
- 102000003741 Actin-related protein 3 Human genes 0.000 description 1
- 108090000104 Actin-related protein 3 Proteins 0.000 description 1
- 108010085238 Actins Proteins 0.000 description 1
- 102100036409 Activated CDC42 kinase 1 Human genes 0.000 description 1
- 102100028100 Activating signal cointegrator 1 Human genes 0.000 description 1
- 102100021028 Activating signal cointegrator 1 complex subunit 1 Human genes 0.000 description 1
- 102100021031 Activating signal cointegrator 1 complex subunit 2 Human genes 0.000 description 1
- 102100021029 Activating signal cointegrator 1 complex subunit 3 Human genes 0.000 description 1
- 102100038740 Activator of RNA decay Human genes 0.000 description 1
- 102100040431 Activator of basal transcription 1 Human genes 0.000 description 1
- 102100034111 Activin receptor type-1 Human genes 0.000 description 1
- 102100034134 Activin receptor type-1B Human genes 0.000 description 1
- 102100021886 Activin receptor type-2A Human genes 0.000 description 1
- 102100022385 Activity-dependent neuroprotector homeobox protein Human genes 0.000 description 1
- 102100022734 Acyl carrier protein, mitochondrial Human genes 0.000 description 1
- 102100035919 Acyl-CoA-binding domain-containing protein 5 Human genes 0.000 description 1
- 102100036191 Acyl-coenzyme A diphosphatase NUDT19 Human genes 0.000 description 1
- 102100022714 Acyl-coenzyme A thioesterase 13 Human genes 0.000 description 1
- 102100025848 Acyl-coenzyme A thioesterase 8 Human genes 0.000 description 1
- 102100025845 Acyl-coenzyme A thioesterase 9, mitochondrial Human genes 0.000 description 1
- 102100040277 Acyl-protein thioesterase 2 Human genes 0.000 description 1
- 102100032488 Acylamino-acid-releasing enzyme Human genes 0.000 description 1
- 102100029589 Acylpyruvase FAHD1, mitochondrial Human genes 0.000 description 1
- 102100023056 Adaptin ear-binding coat-associated protein 1 Human genes 0.000 description 1
- 102100035886 Adenine DNA glycosylase Human genes 0.000 description 1
- 102100039162 Adenine nucleotide translocase lysine N-methyltransferase Human genes 0.000 description 1
- 102100029457 Adenine phosphoribosyltransferase Human genes 0.000 description 1
- 108010024223 Adenine phosphoribosyltransferase Proteins 0.000 description 1
- 102100032873 Adenosine 3'-phospho 5'-phosphosulfate transporter 2 Human genes 0.000 description 1
- 102100030446 Adenosine 5'-monophosphoramidase HINT1 Human genes 0.000 description 1
- 102100020925 Adenosylhomocysteinase Human genes 0.000 description 1
- 102100025153 Adenylate kinase 9 Human genes 0.000 description 1
- 102100020775 Adenylosuccinate lyase Human genes 0.000 description 1
- 108700040193 Adenylosuccinate lyases Proteins 0.000 description 1
- 102100033497 Adiponectin receptor protein 1 Human genes 0.000 description 1
- 102100024396 Adrenodoxin, mitochondrial Human genes 0.000 description 1
- 102100036775 Afadin Human genes 0.000 description 1
- 102100028443 Aflatoxin B1 aldehyde reductase member 2 Human genes 0.000 description 1
- 102100031815 Aftiphilin Human genes 0.000 description 1
- 102100036457 Akirin-1 Human genes 0.000 description 1
- 102100037399 Alanine-tRNA ligase, cytoplasmic Human genes 0.000 description 1
- 102100039702 Alcohol dehydrogenase class-3 Human genes 0.000 description 1
- 102100026608 Aldehyde dehydrogenase family 3 member A2 Human genes 0.000 description 1
- 102100033816 Aldehyde dehydrogenase, mitochondrial Human genes 0.000 description 1
- 102100026448 Aldo-keto reductase family 1 member A1 Human genes 0.000 description 1
- 102100027265 Aldo-keto reductase family 1 member B1 Human genes 0.000 description 1
- 102100034112 Alkyldihydroxyacetonephosphate synthase, peroxisomal Human genes 0.000 description 1
- 102100033657 All-trans retinoic acid-induced differentiation factor Human genes 0.000 description 1
- 102100034181 Alpha- and gamma-adaptin-binding protein p34 Human genes 0.000 description 1
- 102100026611 Alpha-1,2-mannosyltransferase ALG9 Human genes 0.000 description 1
- 102100037995 Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase B Human genes 0.000 description 1
- 102100024296 Alpha-1,6-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase Human genes 0.000 description 1
- 102100027165 Alpha-2-macroglobulin receptor-associated protein Human genes 0.000 description 1
- 102100029232 Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6 Human genes 0.000 description 1
- 102100034561 Alpha-N-acetylglucosaminidase Human genes 0.000 description 1
- 102100032959 Alpha-actinin-4 Human genes 0.000 description 1
- 102100034033 Alpha-adducin Human genes 0.000 description 1
- 102100034320 Alpha-centractin Human genes 0.000 description 1
- 102100036092 Alpha-endosulfine Human genes 0.000 description 1
- 102100033658 Alpha-globin transcription factor CP2 Human genes 0.000 description 1
- 102100039085 Alpha-ketoglutarate-dependent dioxygenase alkB homolog 4 Human genes 0.000 description 1
- 102100021761 Alpha-mannosidase 2 Human genes 0.000 description 1
- 102100023165 Alpha-mannosidase 2C1 Human genes 0.000 description 1
- 102100021763 Alpha-mannosidase 2x Human genes 0.000 description 1
- 102100033805 Alpha-protein kinase 1 Human genes 0.000 description 1
- 102100038046 Alpha/beta hydrolase domain-containing protein 17A Human genes 0.000 description 1
- 102100020968 Alpha/beta hydrolase domain-containing protein 17B Human genes 0.000 description 1
- 102100040141 Aminopeptidase O Human genes 0.000 description 1
- 102100033972 Amyloid protein-binding protein 2 Human genes 0.000 description 1
- 102100036440 Amyloid-beta A4 precursor protein-binding family A member 3 Human genes 0.000 description 1
- 101150115961 Anapc10 gene Proteins 0.000 description 1
- 102000052593 Anaphase-Promoting Complex-Cyclosome Apc11 Subunit Human genes 0.000 description 1
- 102000052587 Anaphase-Promoting Complex-Cyclosome Apc3 Subunit Human genes 0.000 description 1
- 108700004606 Anaphase-Promoting Complex-Cyclosome Apc3 Subunit Proteins 0.000 description 1
- 108700004605 Anaphase-Promoting Complex-Cyclosome Apc4 Subunit Proteins 0.000 description 1
- 102000052589 Anaphase-Promoting Complex-Cyclosome Apc4 Subunit Human genes 0.000 description 1
- 102000052588 Anaphase-Promoting Complex-Cyclosome Apc5 Subunit Human genes 0.000 description 1
- 108700004604 Anaphase-Promoting Complex-Cyclosome Apc5 Subunit Proteins 0.000 description 1
- 102000052591 Anaphase-Promoting Complex-Cyclosome Apc6 Subunit Human genes 0.000 description 1
- 108700004603 Anaphase-Promoting Complex-Cyclosome Apc6 Subunit Proteins 0.000 description 1
- 102000052584 Anaphase-Promoting Complex-Cyclosome Apc7 Subunit Human genes 0.000 description 1
- 108700004602 Anaphase-Promoting Complex-Cyclosome Apc7 Subunit Proteins 0.000 description 1
- 102000052583 Anaphase-Promoting Complex-Cyclosome Apc8 Subunit Human genes 0.000 description 1
- 102100033973 Anaphase-promoting complex subunit 10 Human genes 0.000 description 1
- 102100033695 Anaphase-promoting complex subunit 13 Human genes 0.000 description 1
- 102100033723 Anaphase-promoting complex subunit 15 Human genes 0.000 description 1
- 102100040043 Anaphase-promoting complex subunit 16 Human genes 0.000 description 1
- 102100040356 Angio-associated migratory cell protein Human genes 0.000 description 1
- 102100036822 Ankyrin repeat and KH domain-containing protein 1 Human genes 0.000 description 1
- 102100039161 Ankyrin repeat and LEM domain-containing protein 2 Human genes 0.000 description 1
- 102100033897 Ankyrin repeat and SOCS box protein 1 Human genes 0.000 description 1
- 102100021625 Ankyrin repeat and SOCS box protein 3 Human genes 0.000 description 1
- 102100021618 Ankyrin repeat and SOCS box protein 6 Human genes 0.000 description 1
- 102100034615 Ankyrin repeat domain-containing protein 10 Human genes 0.000 description 1
- 102100034614 Ankyrin repeat domain-containing protein 11 Human genes 0.000 description 1
- 102100034611 Ankyrin repeat domain-containing protein 12 Human genes 0.000 description 1
- 102100034610 Ankyrin repeat domain-containing protein 16 Human genes 0.000 description 1
- 102100034280 Ankyrin repeat domain-containing protein 26 Human genes 0.000 description 1
- 102100033368 Ankyrin repeat domain-containing protein 39 Human genes 0.000 description 1
- 102100039179 Ankyrin repeat domain-containing protein 46 Human genes 0.000 description 1
- 102100039148 Ankyrin repeat domain-containing protein 49 Human genes 0.000 description 1
- 102100039173 Ankyrin repeat domain-containing protein 50 Human genes 0.000 description 1
- 102100028118 Annexin A11 Human genes 0.000 description 1
- 102100034612 Annexin A4 Human genes 0.000 description 1
- 102100034278 Annexin A6 Human genes 0.000 description 1
- 102100034273 Annexin A7 Human genes 0.000 description 1
- 102100036830 Annexin A9 Human genes 0.000 description 1
- 102100030343 Antigen peptide transporter 2 Human genes 0.000 description 1
- 102100021325 Antizyme inhibitor 1 Human genes 0.000 description 1
- 102100030762 Apolipoprotein L1 Human genes 0.000 description 1
- 102100039986 Apoptosis inhibitor 5 Human genes 0.000 description 1
- 102100040124 Apoptosis-inducing factor 1, mitochondrial Human genes 0.000 description 1
- 102100034342 Apoptosis-resistant E3 ubiquitin protein ligase 1 Human genes 0.000 description 1
- 102100021987 Apoptosis-stimulating of p53 protein 1 Human genes 0.000 description 1
- 102100021986 Apoptosis-stimulating of p53 protein 2 Human genes 0.000 description 1
- 102100035769 Apoptotic chromatin condensation inducer in the nucleus Human genes 0.000 description 1
- 102100024044 Aprataxin Human genes 0.000 description 1
- 101000686547 Arabidopsis thaliana 30S ribosomal protein S1, chloroplastic Proteins 0.000 description 1
- 101100005736 Arabidopsis thaliana APC6 gene Proteins 0.000 description 1
- 101001059203 Arabidopsis thaliana Heterodimeric geranylgeranyl pyrophosphate synthase large subunit 1, chloroplastic Proteins 0.000 description 1
- 101000775252 Arabidopsis thaliana NADPH-dependent oxidoreductase 2-alkenal reductase Proteins 0.000 description 1
- 101100404726 Arabidopsis thaliana NHX7 gene Proteins 0.000 description 1
- 101001127485 Arabidopsis thaliana Probable peroxidase 26 Proteins 0.000 description 1
- 102100040158 Archaemetzincin-2 Human genes 0.000 description 1
- 102100024371 Arf-GAP domain and FG repeat-containing protein 2 Human genes 0.000 description 1
- 102100036783 Arf-GAP with GTPase, ANK repeat and PH domain-containing protein 1 Human genes 0.000 description 1
- 102100036779 Arf-GAP with GTPase, ANK repeat and PH domain-containing protein 3 Human genes 0.000 description 1
- 102100036784 Arf-GAP with GTPase, ANK repeat and PH domain-containing protein 5 Human genes 0.000 description 1
- 102100036787 Arf-GAP with GTPase, ANK repeat and PH domain-containing protein 6 Human genes 0.000 description 1
- 102100024003 Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1 Human genes 0.000 description 1
- 102100030287 Arfaptin-1 Human genes 0.000 description 1
- 102100038779 Arfaptin-2 Human genes 0.000 description 1
- 102100031378 Arginine-hydroxylase NDUFAF5, mitochondrial Human genes 0.000 description 1
- 102100035921 Arginine/serine-rich protein PNISR Human genes 0.000 description 1
- 102100039995 Arginyl-tRNA-protein transferase 1 Human genes 0.000 description 1
- 102100031464 Armadillo repeat protein deleted in velo-cardio-facial syndrome Human genes 0.000 description 1
- 102100034304 Armadillo repeat-containing X-linked protein 3 Human genes 0.000 description 1
- 102100034222 Armadillo repeat-containing X-linked protein 5 Human genes 0.000 description 1
- 102100028493 Armadillo repeat-containing protein 10 Human genes 0.000 description 1
- 102100023180 Armadillo repeat-containing protein 5 Human genes 0.000 description 1
- 102100023186 Armadillo repeat-containing protein 6 Human genes 0.000 description 1
- 102100036875 Armadillo repeat-containing protein 8 Human genes 0.000 description 1
- 102100030907 Aryl hydrocarbon receptor nuclear translocator Human genes 0.000 description 1
- 102100031491 Arylsulfatase B Human genes 0.000 description 1
- 102100033890 Arylsulfatase G Human genes 0.000 description 1
- 101150010890 Asb3 gene Proteins 0.000 description 1
- 102100023245 Asparagine-tRNA ligase, cytoplasmic Human genes 0.000 description 1
- 102100034193 Aspartate aminotransferase, mitochondrial Human genes 0.000 description 1
- 102100028820 Aspartate-tRNA ligase, cytoplasmic Human genes 0.000 description 1
- 102100033261 Aspartyl aminopeptidase Human genes 0.000 description 1
- 102000007372 Ataxin-1 Human genes 0.000 description 1
- 108010032963 Ataxin-1 Proteins 0.000 description 1
- 102100035021 Ataxin-1-like Human genes 0.000 description 1
- 102000002785 Ataxin-10 Human genes 0.000 description 1
- 108010043914 Ataxin-10 Proteins 0.000 description 1
- 102100035022 Ataxin-2-like protein Human genes 0.000 description 1
- 102100021321 Ataxin-3 Human genes 0.000 description 1
- 108010032947 Ataxin-3 Proteins 0.000 description 1
- 108010032953 Ataxin-7 Proteins 0.000 description 1
- 102000007368 Ataxin-7 Human genes 0.000 description 1
- 102100023025 Ataxin-7-like protein 3 Human genes 0.000 description 1
- 102100022512 Ataxin-7-like protein 3B Human genes 0.000 description 1
- 102000007370 Ataxin2 Human genes 0.000 description 1
- 108010032951 Ataxin2 Proteins 0.000 description 1
- 102100027765 Atlastin-2 Human genes 0.000 description 1
- 102100027620 Atlastin-3 Human genes 0.000 description 1
- 102100027936 Attractin Human genes 0.000 description 1
- 102100035952 Atypical kinase COQ8B, mitochondrial Human genes 0.000 description 1
- 102100035553 Autism susceptibility gene 2 protein Human genes 0.000 description 1
- 108010061408 Autophagy-Related Protein 12 Proteins 0.000 description 1
- 102000012035 Autophagy-Related Protein 12 Human genes 0.000 description 1
- 108010092776 Autophagy-Related Protein 5 Proteins 0.000 description 1
- 102000016614 Autophagy-Related Protein 5 Human genes 0.000 description 1
- 108010092778 Autophagy-Related Protein 7 Proteins 0.000 description 1
- 108010032769 Autophagy-Related Protein 8 Family Proteins 0.000 description 1
- 108010014380 Autophagy-Related Protein-1 Homolog Proteins 0.000 description 1
- 102100023898 Autophagy-related protein 101 Human genes 0.000 description 1
- 102100020689 Autophagy-related protein 13 Human genes 0.000 description 1
- 102100040355 Autophagy-related protein 16-1 Human genes 0.000 description 1
- 102100023579 Autophagy-related protein 2 homolog A Human genes 0.000 description 1
- 102100020823 Autophagy-related protein 9A Human genes 0.000 description 1
- 208000031715 Autosomal recessive spastic paraplegia type 21 Diseases 0.000 description 1
- 102100035682 Axin-1 Human genes 0.000 description 1
- 102100032426 B-cell CLL/lymphoma 7 protein family member B Human genes 0.000 description 1
- 102100032481 B-cell CLL/lymphoma 9 protein Human genes 0.000 description 1
- 102100022983 B-cell lymphoma/leukemia 11B Human genes 0.000 description 1
- 102100037586 B-cell receptor-associated protein 29 Human genes 0.000 description 1
- 102100035730 B-cell receptor-associated protein 31 Human genes 0.000 description 1
- 102100037152 BAG family molecular chaperone regulator 1 Human genes 0.000 description 1
- 102100027955 BAG family molecular chaperone regulator 4 Human genes 0.000 description 1
- 102100027360 BAH and coiled-coil domain-containing protein 1 Human genes 0.000 description 1
- 102100026434 BCAS3 microtubule associated cell migration factor Human genes 0.000 description 1
- 102100021247 BCL-6 corepressor Human genes 0.000 description 1
- 102100037135 BCL2/adenovirus E1B 19 kDa protein-interacting protein 2 Human genes 0.000 description 1
- 102100021635 BEN domain-containing protein 3 Human genes 0.000 description 1
- 102100028169 BET1-like protein Human genes 0.000 description 1
- 108091007065 BIRCs Proteins 0.000 description 1
- 102100025143 BLOC-1-related complex subunit 8 Human genes 0.000 description 1
- 102100024507 BMP-2-inducible protein kinase Human genes 0.000 description 1
- 102100037210 BRCA1-A complex subunit RAP80 Human genes 0.000 description 1
- 102100035584 BRCA2 and CDKN1A-interacting protein Human genes 0.000 description 1
- 108091005625 BRD4 Proteins 0.000 description 1
- 102100035755 BRD4-interacting chromatin-remodeling complex-associated protein Human genes 0.000 description 1
- 102100035745 BRD4-interacting chromatin-remodeling complex-associated protein-like Human genes 0.000 description 1
- 102100035647 BRISC and BRCA1-A complex member 1 Human genes 0.000 description 1
- 102100024808 BSD domain-containing protein 1 Human genes 0.000 description 1
- 102100024272 BTB/POZ domain-containing protein 2 Human genes 0.000 description 1
- 102100024281 BTB/POZ domain-containing protein 7 Human genes 0.000 description 1
- 102100033151 BTB/POZ domain-containing protein KCTD21 Human genes 0.000 description 1
- 102100028231 BTB/POZ domain-containing protein KCTD6 Human genes 0.000 description 1
- 102100039958 BUB3-interacting and GLEBS motif-containing protein ZNF207 Human genes 0.000 description 1
- 102100027137 BUD13 homolog Human genes 0.000 description 1
- 108091032955 Bacterial small RNA Proteins 0.000 description 1
- 102100021677 Baculoviral IAP repeat-containing protein 2 Human genes 0.000 description 1
- 102100027515 Baculoviral IAP repeat-containing protein 6 Human genes 0.000 description 1
- 102100037151 Barrier-to-autointegration factor Human genes 0.000 description 1
- 102100037936 Basic helix-loop-helix domain-containing protein USF3 Human genes 0.000 description 1
- 102100021950 Basic immunoglobulin-like variable motif-containing protein Human genes 0.000 description 1
- 102100023973 Bax inhibitor 1 Human genes 0.000 description 1
- 102100032305 Bcl-2 homologous antagonist/killer Human genes 0.000 description 1
- 102100032423 Bcl-2-associated transcription factor 1 Human genes 0.000 description 1
- 102100026596 Bcl-2-like protein 1 Human genes 0.000 description 1
- 102100021895 Bcl-2-like protein 13 Human genes 0.000 description 1
- 102100023932 Bcl-2-like protein 2 Human genes 0.000 description 1
- 101150008012 Bcl2l1 gene Proteins 0.000 description 1
- 102100021251 Beclin-1 Human genes 0.000 description 1
- 102100038189 Beta-1,3-N-acetylglucosaminyltransferase radical fringe Human genes 0.000 description 1
- 102100026341 Beta-1,4-galactosyltransferase 3 Human genes 0.000 description 1
- 102100026340 Beta-1,4-galactosyltransferase 4 Human genes 0.000 description 1
- 102100027387 Beta-1,4-galactosyltransferase 5 Human genes 0.000 description 1
- 102100027321 Beta-1,4-galactosyltransferase 7 Human genes 0.000 description 1
- 102100031680 Beta-catenin-interacting protein 1 Human genes 0.000 description 1
- 102100034321 Beta-centractin Human genes 0.000 description 1
- 102100026031 Beta-glucuronidase Human genes 0.000 description 1
- 102100022549 Beta-hexosaminidase subunit beta Human genes 0.000 description 1
- 102100021257 Beta-secretase 1 Human genes 0.000 description 1
- 102100026151 Bifunctional apoptosis regulator Human genes 0.000 description 1
- 102100023962 Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 Human genes 0.000 description 1
- 102100023960 Bifunctional peptidase and (3S)-lysyl hydroxylase JMJD7 Human genes 0.000 description 1
- 102100037468 Bifunctional peptidase and arginyl-hydroxylase JMJD5 Human genes 0.000 description 1
- 102100035645 Biogenesis of lysosome-related organelles complex 1 subunit 1 Human genes 0.000 description 1
- 102100024527 Biogenesis of lysosome-related organelles complex 1 subunit 4 Human genes 0.000 description 1
- 102100033549 Biogenesis of lysosome-related organelles complex 1 subunit 5 Human genes 0.000 description 1
- 102100033565 Biogenesis of lysosome-related organelles complex 1 subunit 6 Human genes 0.000 description 1
- 102100025442 Biorientation of chromosomes in cell division protein 1 Human genes 0.000 description 1
- 102100033743 Biotin-[acetyl-CoA-carboxylase] ligase Human genes 0.000 description 1
- 102100037674 Bis(5'-adenosyl)-triphosphatase Human genes 0.000 description 1
- 102100036461 Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical] Human genes 0.000 description 1
- 102100036200 Bisphosphoglycerate mutase Human genes 0.000 description 1
- 108010029692 Bisphosphoglycerate mutase Proteins 0.000 description 1
- 102100027058 Bleomycin hydrolase Human genes 0.000 description 1
- 102100028741 BolA-like protein 1 Human genes 0.000 description 1
- 102100028724 BolA-like protein 3 Human genes 0.000 description 1
- 101100237637 Bos taurus APOL gene Proteins 0.000 description 1
- 102100027305 Box C/D snoRNA protein 1 Human genes 0.000 description 1
- 102100026413 Branched-chain-amino-acid aminotransferase, mitochondrial Human genes 0.000 description 1
- 102100024791 Breast cancer metastasis-suppressor 1-like protein Human genes 0.000 description 1
- 102100028573 Brefeldin A-inhibited guanine nucleotide-exchange protein 2 Human genes 0.000 description 1
- 102100022595 Broad substrate specificity ATP-binding cassette transporter ABCG2 Human genes 0.000 description 1
- 102100027359 Bromo adjacent homology domain-containing 1 protein Human genes 0.000 description 1
- 102100027310 Bromodomain adjacent to zinc finger domain protein 1A Human genes 0.000 description 1
- 102100021576 Bromodomain adjacent to zinc finger domain protein 2A Human genes 0.000 description 1
- 102100021574 Bromodomain adjacent to zinc finger domain protein 2B Human genes 0.000 description 1
- 102100021743 Bromodomain and PHD finger-containing protein 3 Human genes 0.000 description 1
- 102100033640 Bromodomain-containing protein 1 Human genes 0.000 description 1
- 102100033641 Bromodomain-containing protein 2 Human genes 0.000 description 1
- 102100033642 Bromodomain-containing protein 3 Human genes 0.000 description 1
- 102100029895 Bromodomain-containing protein 4 Human genes 0.000 description 1
- 102100029897 Bromodomain-containing protein 7 Human genes 0.000 description 1
- 102100029896 Bromodomain-containing protein 8 Human genes 0.000 description 1
- 102100029893 Bromodomain-containing protein 9 Human genes 0.000 description 1
- 102100021714 Bystin Human genes 0.000 description 1
- 102100025905 C-Jun-amino-terminal kinase-interacting protein 4 Human genes 0.000 description 1
- 102100030630 C-myc promoter-binding protein Human genes 0.000 description 1
- 102100021390 C-terminal-binding protein 1 Human genes 0.000 description 1
- 102100032955 C2 domain-containing protein 3 Human genes 0.000 description 1
- 102100024068 C2 domain-containing protein 5 Human genes 0.000 description 1
- 108700030955 C9orf72 Proteins 0.000 description 1
- 101150014718 C9orf72 gene Proteins 0.000 description 1
- 102100022361 CAAX prenyl protease 1 homolog Human genes 0.000 description 1
- 101150006869 CACYBP gene Proteins 0.000 description 1
- 102100025752 CASP8 and FADD-like apoptosis regulator Human genes 0.000 description 1
- 102100039527 CBP80/20-dependent translation initiation factor Human genes 0.000 description 1
- 102100037675 CCAAT/enhancer-binding protein gamma Human genes 0.000 description 1
- 102100037676 CCAAT/enhancer-binding protein zeta Human genes 0.000 description 1
- 108010014064 CCCTC-Binding Factor Proteins 0.000 description 1
- 108060001210 CCDC22 Proteins 0.000 description 1
- 102000014477 CCDC22 Human genes 0.000 description 1
- 102100033849 CCHC-type zinc finger nucleic acid binding protein Human genes 0.000 description 1
- 101710116319 CCHC-type zinc finger nucleic acid binding protein Proteins 0.000 description 1
- 102100031024 CCR4-NOT transcription complex subunit 1 Human genes 0.000 description 1
- 102100031696 CCR4-NOT transcription complex subunit 10 Human genes 0.000 description 1
- 101710138768 CCR4-NOT transcription complex subunit 10 Proteins 0.000 description 1
- 102100031023 CCR4-NOT transcription complex subunit 11 Human genes 0.000 description 1
- 102100031025 CCR4-NOT transcription complex subunit 2 Human genes 0.000 description 1
- 102100031033 CCR4-NOT transcription complex subunit 3 Human genes 0.000 description 1
- 102100032981 CCR4-NOT transcription complex subunit 4 Human genes 0.000 description 1
- 102100032985 CCR4-NOT transcription complex subunit 7 Human genes 0.000 description 1
- 102100032986 CCR4-NOT transcription complex subunit 8 Human genes 0.000 description 1
- 102100032982 CCR4-NOT transcription complex subunit 9 Human genes 0.000 description 1
- 102100027209 CD2-associated protein Human genes 0.000 description 1
- 102100025240 CD320 antigen Human genes 0.000 description 1
- 102100025222 CD63 antigen Human genes 0.000 description 1
- 102100027221 CD81 antigen Human genes 0.000 description 1
- 102100027217 CD82 antigen Human genes 0.000 description 1
- 102100025463 CD99 antigen-like protein 2 Human genes 0.000 description 1
- 101150017278 CDC16 gene Proteins 0.000 description 1
- 101150108242 CDC27 gene Proteins 0.000 description 1
- 102100029348 CDGSH iron-sulfur domain-containing protein 2 Human genes 0.000 description 1
- 102100029356 CDGSH iron-sulfur domain-containing protein 3, mitochondrial Human genes 0.000 description 1
- 102100030933 CDK-activating kinase assembly factor MAT1 Human genes 0.000 description 1
- 102100038451 CDK5 regulatory subunit-associated protein 2 Human genes 0.000 description 1
- 102100029871 CDKN2A-interacting protein Human genes 0.000 description 1
- 108010066050 CDP-diacylglycerol-inositol 3-phosphatidyltransferase Proteins 0.000 description 1
- 102100027194 CDP-diacylglycerol-inositol 3-phosphatidyltransferase Human genes 0.000 description 1
- 108700015925 CELF1 Proteins 0.000 description 1
- 101150107790 CELF1 gene Proteins 0.000 description 1
- 101710112307 CEP120 Proteins 0.000 description 1
- 101700004197 CEP68 Proteins 0.000 description 1
- 101150061077 CERS6 gene Proteins 0.000 description 1
- 102100031198 CGG triplet repeat-binding protein 1 Human genes 0.000 description 1
- 102000014572 CHFR Human genes 0.000 description 1
- 101150108055 CHMP2B gene Proteins 0.000 description 1
- 101150109687 CHMP4A gene Proteins 0.000 description 1
- 102100029396 CLIP-associating protein 1 Human genes 0.000 description 1
- 102100023463 CLK4-associating serine/arginine rich protein Human genes 0.000 description 1
- 102100031973 CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 2 Human genes 0.000 description 1
- 102100033787 CMP-sialic acid transporter Human genes 0.000 description 1
- 102100032932 COBW domain-containing protein 1 Human genes 0.000 description 1
- 102100032934 COBW domain-containing protein 5 Human genes 0.000 description 1
- 102100036047 COMM domain-containing protein 10 Human genes 0.000 description 1
- 102100024311 COMM domain-containing protein 2 Human genes 0.000 description 1
- 102100024301 COMM domain-containing protein 3 Human genes 0.000 description 1
- 102100024305 COMM domain-containing protein 4 Human genes 0.000 description 1
- 102100022620 COMM domain-containing protein 5 Human genes 0.000 description 1
- 102100022617 COMM domain-containing protein 7 Human genes 0.000 description 1
- 108091007903 COMMD10 Proteins 0.000 description 1
- 108091007055 COMMD3-BMI1 Proteins 0.000 description 1
- 102000015347 COP1 Human genes 0.000 description 1
- 108060001826 COP1 Proteins 0.000 description 1
- 102100031629 COP9 signalosome complex subunit 1 Human genes 0.000 description 1
- 102100027652 COP9 signalosome complex subunit 2 Human genes 0.000 description 1
- 102100027648 COP9 signalosome complex subunit 3 Human genes 0.000 description 1
- 102100027997 COP9 signalosome complex subunit 4 Human genes 0.000 description 1
- 102100021824 COP9 signalosome complex subunit 5 Human genes 0.000 description 1
- 102100028372 COP9 signalosome complex subunit 6 Human genes 0.000 description 1
- 102100028879 COP9 signalosome complex subunit 8 Human genes 0.000 description 1
- 102100031187 COP9 signalosome complex subunit 9 Human genes 0.000 description 1
- 101150110330 CRAT gene Proteins 0.000 description 1
- 102000015367 CRBN Human genes 0.000 description 1
- 102100021975 CREB-binding protein Human genes 0.000 description 1
- 102100040775 CREB-regulated transcription coactivator 1 Human genes 0.000 description 1
- 102100040755 CREB-regulated transcription coactivator 3 Human genes 0.000 description 1
- 102100040805 CREB/ATF bZIP transcription factor Human genes 0.000 description 1
- 102100040738 CSC1-like protein 1 Human genes 0.000 description 1
- 102100024523 CTD nuclear envelope phosphatase 1 Human genes 0.000 description 1
- 101710193778 CTD nuclear envelope phosphatase 1 homolog Proteins 0.000 description 1
- 102100028011 CTD small phosphatase-like protein 2 Human genes 0.000 description 1
- 102100039866 CTP synthase 1 Human genes 0.000 description 1
- 102100039914 CTP synthase 2 Human genes 0.000 description 1
- 102100021288 CUE domain-containing protein 1 Human genes 0.000 description 1
- 102100033676 CUGBP Elav-like family member 1 Human genes 0.000 description 1
- 102100036167 CXXC-type zinc finger protein 5 Human genes 0.000 description 1
- 102100024951 Cactin Human genes 0.000 description 1
- 101000690445 Caenorhabditis elegans Aryl hydrocarbon receptor nuclear translocator homolog Proteins 0.000 description 1
- 101000928995 Caenorhabditis elegans Putative deoxyribose-phosphate aldolase Proteins 0.000 description 1
- 101100269328 Caenorhabditis elegans aff-1 gene Proteins 0.000 description 1
- 101100039010 Caenorhabditis elegans dis-3 gene Proteins 0.000 description 1
- 101100424399 Caenorhabditis elegans taf-12 gene Proteins 0.000 description 1
- 101100206927 Caenorhabditis elegans tlk-1 gene Proteins 0.000 description 1
- 102100031277 Calcineurin B homologous protein 1 Human genes 0.000 description 1
- 102100024123 Calcineurin-binding protein cabin-1 Human genes 0.000 description 1
- 102100027557 Calcipressin-1 Human genes 0.000 description 1
- 102100033349 Calcium homeostasis endoplasmic reticulum protein Human genes 0.000 description 1
- 102100023243 Calcium-activated potassium channel subunit beta-3 Human genes 0.000 description 1
- 102100036289 Calcium-binding mitochondrial carrier protein SCaMC-2 Human genes 0.000 description 1
- 102100022533 Calcium-binding protein 39 Human genes 0.000 description 1
- 102100037885 Calcium-independent phospholipase A2-gamma Human genes 0.000 description 1
- 102100029801 Calcium-transporting ATPase type 2C member 1 Human genes 0.000 description 1
- 102100021534 Calcium/calmodulin-dependent protein kinase kinase 2 Human genes 0.000 description 1
- 102100033086 Calcium/calmodulin-dependent protein kinase type 1 Human genes 0.000 description 1
- 102100025228 Calcium/calmodulin-dependent protein kinase type II subunit delta Human genes 0.000 description 1
- 102100039901 Calcyclin-binding protein Human genes 0.000 description 1
- 102100033560 Calmodulin-binding transcription activator 2 Human genes 0.000 description 1
- 102100025592 Calmodulin-regulated spectrin-associated protein 1 Human genes 0.000 description 1
- 102100021868 Calnexin Human genes 0.000 description 1
- 102100029398 Calpain small subunit 1 Human genes 0.000 description 1
- 102100025172 Calpain-1 catalytic subunit Human genes 0.000 description 1
- 102100025168 Calpain-15 Human genes 0.000 description 1
- 102100030010 Calpain-7 Human genes 0.000 description 1
- 102100029968 Calreticulin Human genes 0.000 description 1
- 102100038712 Cap-specific mRNA (nucleoside-2'-O-)-methyltransferase 1 Human genes 0.000 description 1
- 102100038716 Cap-specific mRNA (nucleoside-2'-O-)-methyltransferase 2 Human genes 0.000 description 1
- 241000722721 Capparis Species 0.000 description 1
- 235000017336 Capparis spinosa Nutrition 0.000 description 1
- 102100032581 Caprin-2 Human genes 0.000 description 1
- 102100032196 Carbohydrate sulfotransferase 12 Human genes 0.000 description 1
- 101710134389 Carboxy-terminal domain RNA polymerase II polypeptide A small phosphatase 2 Proteins 0.000 description 1
- 102100035439 Carcinoembryonic antigen-related cell adhesion molecule 19 Human genes 0.000 description 1
- 102100021753 Cardiolipin synthase (CMP-forming) Human genes 0.000 description 1
- 102100036357 Carnitine O-acetyltransferase Human genes 0.000 description 1
- 102100027943 Carnitine O-palmitoyltransferase 1, liver isoform Human genes 0.000 description 1
- 102100034357 Casein kinase I isoform alpha Human genes 0.000 description 1
- 102100037402 Casein kinase I isoform delta Human genes 0.000 description 1
- 102100023060 Casein kinase I isoform gamma-2 Human genes 0.000 description 1
- 102100023067 Casein kinase I isoform gamma-3 Human genes 0.000 description 1
- 102100040751 Casein kinase II subunit alpha Human genes 0.000 description 1
- 102100027808 Casein kinase II subunit alpha 3 Human genes 0.000 description 1
- 102100027992 Casein kinase II subunit beta Human genes 0.000 description 1
- 108090000397 Caspase 3 Proteins 0.000 description 1
- 102100029855 Caspase-3 Human genes 0.000 description 1
- 102100038918 Caspase-6 Human genes 0.000 description 1
- 102100038902 Caspase-7 Human genes 0.000 description 1
- 102100026550 Caspase-9 Human genes 0.000 description 1
- 108020002739 Catechol O-methyltransferase Proteins 0.000 description 1
- 102100040999 Catechol O-methyltransferase Human genes 0.000 description 1
- 102100028906 Catenin delta-1 Human genes 0.000 description 1
- 102100021633 Cathepsin B Human genes 0.000 description 1
- 102100032219 Cathepsin D Human genes 0.000 description 1
- 102100024940 Cathepsin K Human genes 0.000 description 1
- 102100026657 Cathepsin Z Human genes 0.000 description 1
- 101710145225 Cation-independent mannose-6-phosphate receptor Proteins 0.000 description 1
- 102000011068 Cdc42 Human genes 0.000 description 1
- 102000038594 Cdh1/Fizzy-related Human genes 0.000 description 1
- 108091007854 Cdh1/Fizzy-related Proteins 0.000 description 1
- 102100031441 Cell cycle checkpoint protein RAD17 Human genes 0.000 description 1
- 102100026772 Cell cycle control protein 50A Human genes 0.000 description 1
- 102100032346 Cell cycle progression protein 1 Human genes 0.000 description 1
- 102100026866 Cell cycle regulator of non-homologous end joining Human genes 0.000 description 1
- 102100027199 Cell death-inducing p53-target protein 1 Human genes 0.000 description 1
- 102100032860 Cell division cycle 5-like protein Human genes 0.000 description 1
- 102100022006 Cell division cycle protein 123 homolog Human genes 0.000 description 1
- 108010091675 Cellular Apoptosis Susceptibility Protein Proteins 0.000 description 1
- 102100025828 Centromere protein C Human genes 0.000 description 1
- 102100031214 Centromere protein N Human genes 0.000 description 1
- 102100039118 Centromere/kinetochore protein zw10 homolog Human genes 0.000 description 1
- 102100035165 Centrosomal protein CCDC61 Human genes 0.000 description 1
- 101710195848 Centrosomal protein CEP57L1 Proteins 0.000 description 1
- 102100035365 Centrosomal protein CEP57L1 Human genes 0.000 description 1
- 102100033158 Centrosomal protein of 104 kDa Human genes 0.000 description 1
- 101710101016 Centrosomal protein of 104 kDa Proteins 0.000 description 1
- 102100023304 Centrosomal protein of 120 kDa Human genes 0.000 description 1
- 102100036180 Centrosomal protein of 164 kDa Human genes 0.000 description 1
- 101710131445 Centrosomal protein of 164 kDa Proteins 0.000 description 1
- 102100036179 Centrosomal protein of 170 kDa Human genes 0.000 description 1
- 101710142011 Centrosomal protein of 170 kDa Proteins 0.000 description 1
- 102100031220 Centrosomal protein of 44 kDa Human genes 0.000 description 1
- 101710118432 Centrosomal protein of 44 kDa Proteins 0.000 description 1
- 102100031213 Centrosomal protein of 57 kDa Human genes 0.000 description 1
- 101710147964 Centrosomal protein of 57 kDa Proteins 0.000 description 1
- 102100033671 Centrosomal protein of 63 kDa Human genes 0.000 description 1
- 101710120612 Centrosomal protein of 63 kDa Proteins 0.000 description 1
- 102100033228 Centrosomal protein of 68 kDa Human genes 0.000 description 1
- 102100035696 Centrosome-associated protein 350 Human genes 0.000 description 1
- 101710101089 Centrosome-associated protein 350 Proteins 0.000 description 1
- 102100039219 Centrosome-associated protein CEP250 Human genes 0.000 description 1
- 101710110151 Centrosome-associated protein CEP250 Proteins 0.000 description 1
- 102100035434 Ceramide synthase 6 Human genes 0.000 description 1
- 102100035437 Ceramide transfer protein Human genes 0.000 description 1
- 102100024873 Ceramide-1-phosphate transfer protein Human genes 0.000 description 1
- 102100032402 Charged multivesicular body protein 1a Human genes 0.000 description 1
- 102100032401 Charged multivesicular body protein 2a Human genes 0.000 description 1
- 102100038279 Charged multivesicular body protein 2b Human genes 0.000 description 1
- 102100029295 Charged multivesicular body protein 3 Human genes 0.000 description 1
- 102100038275 Charged multivesicular body protein 4a Human genes 0.000 description 1
- 102100026343 Charged multivesicular body protein 5 Human genes 0.000 description 1
- 102100028487 Checkpoint protein HUS1 Human genes 0.000 description 1
- 102100030298 Chitinase domain-containing protein 1 Human genes 0.000 description 1
- 241000839426 Chlamydia virus Chp1 Species 0.000 description 1
- 102100029397 Chloride channel CLIC-like protein 1 Human genes 0.000 description 1
- 102000006786 Chloride-Bicarbonate Antiporters Human genes 0.000 description 1
- 101150076092 Chmp2a gene Proteins 0.000 description 1
- 102100035954 Choline transporter-like protein 2 Human genes 0.000 description 1
- 102100029172 Choline-phosphate cytidylyltransferase A Human genes 0.000 description 1
- 102100031082 Choline/ethanolamine kinase Human genes 0.000 description 1
- 102100025708 Choline/ethanolaminephosphotransferase 1 Human genes 0.000 description 1
- 102100032405 Chromatin accessibility complex protein 1 Human genes 0.000 description 1
- 102100037146 Chromatin complexes subunit BAP18 Human genes 0.000 description 1
- 102100040509 Chromatin modification-related protein MEAF6 Human genes 0.000 description 1
- 102100036956 Chromatin target of PRMT1 protein Human genes 0.000 description 1
- 102100032902 Chromobox protein homolog 3 Human genes 0.000 description 1
- 102100032918 Chromobox protein homolog 5 Human genes 0.000 description 1
- 102100031668 Chromodomain Y-like protein Human genes 0.000 description 1
- 102100031235 Chromodomain-helicase-DNA-binding protein 1 Human genes 0.000 description 1
- 102100031239 Chromodomain-helicase-DNA-binding protein 1-like Human genes 0.000 description 1
- 102100031265 Chromodomain-helicase-DNA-binding protein 2 Human genes 0.000 description 1
- 102100038214 Chromodomain-helicase-DNA-binding protein 4 Human genes 0.000 description 1
- 102100038215 Chromodomain-helicase-DNA-binding protein 7 Human genes 0.000 description 1
- 102100038165 Chromodomain-helicase-DNA-binding protein 8 Human genes 0.000 description 1
- 102100025590 Chromosome transmission fidelity protein 8 homolog Human genes 0.000 description 1
- 102100034701 Cilia- and flagella-associated protein 20 Human genes 0.000 description 1
- 102100024297 Cilia- and flagella-associated protein 410 Human genes 0.000 description 1
- 102100034497 Cip1-interacting zinc finger protein Human genes 0.000 description 1
- 101710149695 Clampless protein 1 Proteins 0.000 description 1
- 102100026127 Clathrin heavy chain 1 Human genes 0.000 description 1
- 102100036444 Clathrin interactor 1 Human genes 0.000 description 1
- 102100034467 Clathrin light chain A Human genes 0.000 description 1
- 102100032559 Clathrin light chain B Human genes 0.000 description 1
- 102100038641 Cleavage and polyadenylation specificity factor subunit 1 Human genes 0.000 description 1
- 102100038642 Cleavage and polyadenylation specificity factor subunit 2 Human genes 0.000 description 1
- 102100030954 Cleavage and polyadenylation specificity factor subunit 3 Human genes 0.000 description 1
- 102100030953 Cleavage and polyadenylation specificity factor subunit 4 Human genes 0.000 description 1
- 102100030871 Cleavage and polyadenylation specificity factor subunit 5 Human genes 0.000 description 1
- 102100026529 Cleavage and polyadenylation specificity factor subunit 6 Human genes 0.000 description 1
- 102100026421 Cleavage and polyadenylation specificity factor subunit 7 Human genes 0.000 description 1
- 102100040268 Cleavage stimulation factor subunit 1 Human genes 0.000 description 1
- 102100040271 Cleavage stimulation factor subunit 2 tau variant Human genes 0.000 description 1
- 102100040267 Cleavage stimulation factor subunit 3 Human genes 0.000 description 1
- 102100021216 Cleft lip and palate transmembrane protein 1 Human genes 0.000 description 1
- 102100030972 Coatomer subunit beta Human genes 0.000 description 1
- 102100022589 Coatomer subunit beta' Human genes 0.000 description 1
- 102100028289 Coatomer subunit delta Human genes 0.000 description 1
- 102100037290 Coatomer subunit gamma-1 Human genes 0.000 description 1
- 102100037291 Coatomer subunit gamma-2 Human genes 0.000 description 1
- 102100024252 Coatomer subunit zeta-1 Human genes 0.000 description 1
- 102100023470 Cobalamin trafficking protein CblD Human genes 0.000 description 1
- 102100021864 Cocaine esterase Human genes 0.000 description 1
- 102000004360 Cofilin 1 Human genes 0.000 description 1
- 108090000996 Cofilin 1 Proteins 0.000 description 1
- 102100035595 Cohesin subunit SA-2 Human genes 0.000 description 1
- 102100024066 Coiled-coil and C2 domain-containing protein 1A Human genes 0.000 description 1
- 102100032376 Coiled-coil domain-containing protein 106 Human genes 0.000 description 1
- 102100032377 Coiled-coil domain-containing protein 107 Human genes 0.000 description 1
- 102100023667 Coiled-coil domain-containing protein 124 Human genes 0.000 description 1
- 102100025737 Coiled-coil domain-containing protein 149 Human genes 0.000 description 1
- 102100025816 Coiled-coil domain-containing protein 152 Human genes 0.000 description 1
- 102100036576 Coiled-coil domain-containing protein 174 Human genes 0.000 description 1
- 102100021981 Coiled-coil domain-containing protein 28A Human genes 0.000 description 1
- 102100021965 Coiled-coil domain-containing protein 32 Human genes 0.000 description 1
- 102100024137 Coiled-coil domain-containing protein 43 Human genes 0.000 description 1
- 102100031048 Coiled-coil domain-containing protein 6 Human genes 0.000 description 1
- 102100034952 Coiled-coil domain-containing protein 66 Human genes 0.000 description 1
- 102100032374 Coiled-coil domain-containing protein 85C Human genes 0.000 description 1
- 102100031088 Coiled-coil domain-containing protein 9 Human genes 0.000 description 1
- 102100038385 Coiled-coil domain-containing protein R3HCC1L Human genes 0.000 description 1
- 102100023692 Coiled-coil-helix-coiled-coil-helix domain-containing protein 2 Human genes 0.000 description 1
- 102100023689 Coiled-coil-helix-coiled-coil-helix domain-containing protein 7 Human genes 0.000 description 1
- 102100023774 Cold-inducible RNA-binding protein Human genes 0.000 description 1
- 102100021645 Complex I assembly factor ACAD9, mitochondrial Human genes 0.000 description 1
- 102100022008 Complex I assembly factor TIMMDC1, mitochondrial Human genes 0.000 description 1
- 102100038256 Complex I intermediate-associated protein 30, mitochondrial Human genes 0.000 description 1
- 102100032978 Condensin-2 complex subunit D3 Human genes 0.000 description 1
- 102100031008 Condensin-2 complex subunit H2 Human genes 0.000 description 1
- 102100030797 Conserved oligomeric Golgi complex subunit 2 Human genes 0.000 description 1
- 102100036044 Conserved oligomeric Golgi complex subunit 4 Human genes 0.000 description 1
- 102100040998 Conserved oligomeric Golgi complex subunit 6 Human genes 0.000 description 1
- 102100029158 Consortin Human genes 0.000 description 1
- 102100023768 Constitutive coactivator of PPAR-gamma-like protein 1 Human genes 0.000 description 1
- 102100039200 Constitutive coactivator of PPAR-gamma-like protein 2 Human genes 0.000 description 1
- 241000761389 Copa Species 0.000 description 1
- 102100032636 Copine-1 Human genes 0.000 description 1
- 102100032648 Copine-3 Human genes 0.000 description 1
- 102000021421 Copper Transporter 1 Human genes 0.000 description 1
- 102100031397 Copper homeostasis protein cutC homolog Human genes 0.000 description 1
- 102100029767 Copper transport protein ATOX1 Human genes 0.000 description 1
- 102000008147 Core Binding Factor beta Subunit Human genes 0.000 description 1
- 108010060313 Core Binding Factor beta Subunit Proteins 0.000 description 1
- 102100034528 Core histone macro-H2A.1 Human genes 0.000 description 1
- 102100023778 Corepressor interacting with RBPJ 1 Human genes 0.000 description 1
- 102100041025 Coronin-1B Human genes 0.000 description 1
- 102100041022 Coronin-1C Human genes 0.000 description 1
- 102100029375 Crk-like protein Human genes 0.000 description 1
- 102100032182 Crooked neck-like protein 1 Human genes 0.000 description 1
- 102100029376 Cryptochrome-1 Human genes 0.000 description 1
- 102100026280 Cryptochrome-2 Human genes 0.000 description 1
- 102100039193 Cullin-2 Human genes 0.000 description 1
- 102100028908 Cullin-3 Human genes 0.000 description 1
- 102100028907 Cullin-4A Human genes 0.000 description 1
- 102100028901 Cullin-4B Human genes 0.000 description 1
- 102100025525 Cullin-5 Human genes 0.000 description 1
- 102100025522 Cullin-7 Human genes 0.000 description 1
- 102100025524 Cullin-9 Human genes 0.000 description 1
- 102100034275 Cx9C motif-containing protein 4 Human genes 0.000 description 1
- 102100023580 Cyclic AMP-dependent transcription factor ATF-4 Human genes 0.000 description 1
- 102100023583 Cyclic AMP-dependent transcription factor ATF-6 alpha Human genes 0.000 description 1
- 102100023581 Cyclic AMP-dependent transcription factor ATF-6 beta Human genes 0.000 description 1
- 102100023578 Cyclic AMP-dependent transcription factor ATF-7 Human genes 0.000 description 1
- 102100026359 Cyclic AMP-responsive element-binding protein 1 Human genes 0.000 description 1
- 108050006400 Cyclin Proteins 0.000 description 1
- 102100024170 Cyclin-C Human genes 0.000 description 1
- 102100035373 Cyclin-D-binding Myb-like transcription factor 1 Human genes 0.000 description 1
- 102100021934 Cyclin-D1-binding protein 1 Human genes 0.000 description 1
- 108010025464 Cyclin-Dependent Kinase 4 Proteins 0.000 description 1
- 102000000577 Cyclin-Dependent Kinase Inhibitor p27 Human genes 0.000 description 1
- 108010016777 Cyclin-Dependent Kinase Inhibitor p27 Proteins 0.000 description 1
- 102100038252 Cyclin-G1 Human genes 0.000 description 1
- 102100036883 Cyclin-H Human genes 0.000 description 1
- 102100036871 Cyclin-J Human genes 0.000 description 1
- 102100036876 Cyclin-K Human genes 0.000 description 1
- 102100021899 Cyclin-L2 Human genes 0.000 description 1
- 102100021898 Cyclin-Q Human genes 0.000 description 1
- 102100024109 Cyclin-T1 Human genes 0.000 description 1
- 102100024112 Cyclin-T2 Human genes 0.000 description 1
- 102100023263 Cyclin-dependent kinase 10 Human genes 0.000 description 1
- 102100038111 Cyclin-dependent kinase 12 Human genes 0.000 description 1
- 102100038114 Cyclin-dependent kinase 13 Human genes 0.000 description 1
- 102100038113 Cyclin-dependent kinase 14 Human genes 0.000 description 1
- 102100033245 Cyclin-dependent kinase 16 Human genes 0.000 description 1
- 102100033234 Cyclin-dependent kinase 17 Human genes 0.000 description 1
- 102100035353 Cyclin-dependent kinase 2-associated protein 1 Human genes 0.000 description 1
- 102100035313 Cyclin-dependent kinase 2-associated protein 2 Human genes 0.000 description 1
- 102100036988 Cyclin-dependent kinase 2-interacting protein Human genes 0.000 description 1
- 102100036252 Cyclin-dependent kinase 4 Human genes 0.000 description 1
- 102100026810 Cyclin-dependent kinase 7 Human genes 0.000 description 1
- 102100024456 Cyclin-dependent kinase 8 Human genes 0.000 description 1
- 102100024457 Cyclin-dependent kinase 9 Human genes 0.000 description 1
- 102100026891 Cystatin-B Human genes 0.000 description 1
- 102100026897 Cystatin-C Human genes 0.000 description 1
- 102100035406 Cysteine desulfurase, mitochondrial Human genes 0.000 description 1
- 102100021903 Cysteine protease ATG4B Human genes 0.000 description 1
- 102100027371 Cysteine-rich PDZ-binding protein Human genes 0.000 description 1
- 102100039924 Cytochrome b-c1 complex subunit 1, mitochondrial Human genes 0.000 description 1
- 102100039925 Cytochrome b-c1 complex subunit 10 Human genes 0.000 description 1
- 102100039441 Cytochrome b-c1 complex subunit 2, mitochondrial Human genes 0.000 description 1
- 102100039455 Cytochrome b-c1 complex subunit 6, mitochondrial Human genes 0.000 description 1
- 102100039458 Cytochrome b-c1 complex subunit 6-like, mitochondrial Human genes 0.000 description 1
- 102100027896 Cytochrome b-c1 complex subunit 7 Human genes 0.000 description 1
- 102100029861 Cytochrome b-c1 complex subunit 8 Human genes 0.000 description 1
- 102100028005 Cytochrome b-c1 complex subunit 9 Human genes 0.000 description 1
- 102100036222 Cytochrome c oxidase assembly factor 3 homolog, mitochondrial Human genes 0.000 description 1
- 102100031596 Cytochrome c oxidase assembly factor 4 homolog, mitochondrial Human genes 0.000 description 1
- 102100031595 Cytochrome c oxidase assembly factor 5 Human genes 0.000 description 1
- 102100029432 Cytochrome c oxidase assembly factor 6 homolog Human genes 0.000 description 1
- 102100041024 Cytochrome c oxidase assembly protein COX11, mitochondrial Human genes 0.000 description 1
- 102100029080 Cytochrome c oxidase assembly protein COX14 Human genes 0.000 description 1
- 102100035955 Cytochrome c oxidase assembly protein COX16 homolog, mitochondrial Human genes 0.000 description 1
- 102100027476 Cytochrome c oxidase assembly protein COX19 Human genes 0.000 description 1
- 102100036035 Cytochrome c oxidase copper chaperone Human genes 0.000 description 1
- 102100022206 Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Human genes 0.000 description 1
- 102100024638 Cytochrome c oxidase subunit 5B, mitochondrial Human genes 0.000 description 1
- 102100031649 Cytochrome c oxidase subunit 6B1 Human genes 0.000 description 1
- 102100028202 Cytochrome c oxidase subunit 6C Human genes 0.000 description 1
- 102100030449 Cytochrome c oxidase subunit 7A-related protein, mitochondrial Human genes 0.000 description 1
- 102100025644 Cytochrome c oxidase subunit 7A2, mitochondrial Human genes 0.000 description 1
- 102100030512 Cytochrome c oxidase subunit 7C, mitochondrial Human genes 0.000 description 1
- 102100039259 Cytochrome c oxidase subunit 8A, mitochondrial Human genes 0.000 description 1
- 102100034031 Cytohesin-2 Human genes 0.000 description 1
- 102100038417 Cytoplasmic FMR1-interacting protein 1 Human genes 0.000 description 1
- 102100031635 Cytoplasmic dynein 1 heavy chain 1 Human genes 0.000 description 1
- 102100028523 Cytoplasmic dynein 1 intermediate chain 2 Human genes 0.000 description 1
- 102100036943 Cytoplasmic protein NCK1 Human genes 0.000 description 1
- 102100025508 Cytoplasmic tRNA 2-thiolation protein 2 Human genes 0.000 description 1
- 102100028629 Cytoskeleton-associated protein 4 Human genes 0.000 description 1
- 102100028624 Cytoskeleton-associated protein 5 Human genes 0.000 description 1
- 102100034560 Cytosol aminopeptidase Human genes 0.000 description 1
- 102100021999 Cytosolic Fe-S cluster assembly factor NUBP2 Human genes 0.000 description 1
- 102100035648 Cytosolic arginine sensor for mTORC1 subunit 1 Human genes 0.000 description 1
- 102100035149 Cytosolic endo-beta-N-acetylglucosaminidase Human genes 0.000 description 1
- 102100023759 Cytosolic iron-sulfur assembly component 2A Human genes 0.000 description 1
- 102100023760 Cytosolic iron-sulfur assembly component 2B Human genes 0.000 description 1
- 102100031007 Cytosolic non-specific dipeptidase Human genes 0.000 description 1
- 102100040628 Cytosolic phospholipase A2 beta Human genes 0.000 description 1
- 102100028712 Cytosolic purine 5'-nucleotidase Human genes 0.000 description 1
- 102100038281 Cytospin-A Human genes 0.000 description 1
- 102100029010 D-aminoacyl-tRNA deacylase 1 Human genes 0.000 description 1
- 102100025901 D-dopachrome decarboxylase-like protein Human genes 0.000 description 1
- 102100028697 D-glucuronyl C5-epimerase Human genes 0.000 description 1
- 102100037856 DALR anticodon-binding domain-containing protein 3 Human genes 0.000 description 1
- 102100036402 DAP3-binding cell death enhancer 1 Human genes 0.000 description 1
- 101150077031 DAXX gene Proteins 0.000 description 1
- 102100024395 DCC-interacting protein 13-alpha Human genes 0.000 description 1
- 102100037098 DCN1-like protein 4 Human genes 0.000 description 1
- 102000012698 DDB1 Human genes 0.000 description 1
- 102100029582 DDB1- and CUL4-associated factor 1 Human genes 0.000 description 1
- 102100025183 DDB1- and CUL4-associated factor 11 Human genes 0.000 description 1
- 102100039771 DDB1- and CUL4-associated factor 12 Human genes 0.000 description 1
- 102100039823 DDB1- and CUL4-associated factor 13 Human genes 0.000 description 1
- 102100029581 DDB1- and CUL4-associated factor 17 Human genes 0.000 description 1
- 102100029584 DDB1- and CUL4-associated factor 4 Human genes 0.000 description 1
- 102100029583 DDB1- and CUL4-associated factor 5 Human genes 0.000 description 1
- 102100024464 DDB1- and CUL4-associated factor 7 Human genes 0.000 description 1
- 102100024460 DDB1- and CUL4-associated factor 8 Human genes 0.000 description 1
- 102100033465 DENN domain-containing protein 11 Human genes 0.000 description 1
- 102100033462 DENN domain-containing protein 1B Human genes 0.000 description 1
- 102100025280 DENN domain-containing protein 4B Human genes 0.000 description 1
- 102000012677 DET1 Human genes 0.000 description 1
- 101150113651 DET1 gene Proteins 0.000 description 1
- 102100037969 DIS3-like exonuclease 1 Human genes 0.000 description 1
- 102100038017 DIS3-like exonuclease 2 Human genes 0.000 description 1
- 108010009540 DNA (Cytosine-5-)-Methyltransferase 1 Proteins 0.000 description 1
- 102100036279 DNA (cytosine-5)-methyltransferase 1 Human genes 0.000 description 1
- 102100033697 DNA cross-link repair 1A protein Human genes 0.000 description 1
- 102100021122 DNA damage-binding protein 2 Human genes 0.000 description 1
- 102100035186 DNA excision repair protein ERCC-1 Human genes 0.000 description 1
- 102100031866 DNA excision repair protein ERCC-5 Human genes 0.000 description 1
- 108010035476 DNA excision repair protein ERCC-5 Proteins 0.000 description 1
- 102100031867 DNA excision repair protein ERCC-6 Human genes 0.000 description 1
- 102100021603 DNA excision repair protein ERCC-6-like 2 Human genes 0.000 description 1
- 102100031868 DNA excision repair protein ERCC-8 Human genes 0.000 description 1
- 102100038026 DNA fragmentation factor subunit alpha Human genes 0.000 description 1
- 102100038830 DNA helicase MCM9 Human genes 0.000 description 1
- 102100033195 DNA ligase 4 Human genes 0.000 description 1
- 102100035925 DNA methyltransferase 1-associated protein 1 Human genes 0.000 description 1
- 102100028849 DNA mismatch repair protein Mlh3 Human genes 0.000 description 1
- 102100034157 DNA mismatch repair protein Msh2 Human genes 0.000 description 1
- 102100037700 DNA mismatch repair protein Msh3 Human genes 0.000 description 1
- 102100021147 DNA mismatch repair protein Msh6 Human genes 0.000 description 1
- 102100039084 DNA oxidative demethylase ALKBH2 Human genes 0.000 description 1
- 102100022307 DNA polymerase alpha catalytic subunit Human genes 0.000 description 1
- 102100036262 DNA polymerase alpha subunit B Human genes 0.000 description 1
- 102100024829 DNA polymerase delta catalytic subunit Human genes 0.000 description 1
- 102100024823 DNA polymerase delta subunit 2 Human genes 0.000 description 1
- 102100020782 DNA polymerase delta subunit 3 Human genes 0.000 description 1
- 102100029905 DNA polymerase epsilon subunit 3 Human genes 0.000 description 1
- 102100035472 DNA polymerase iota Human genes 0.000 description 1
- 102100029766 DNA polymerase theta Human genes 0.000 description 1
- 102100028216 DNA polymerase zeta catalytic subunit Human genes 0.000 description 1
- 102100040795 DNA primase large subunit Human genes 0.000 description 1
- 102100039116 DNA repair protein RAD50 Human genes 0.000 description 1
- 102100034484 DNA repair protein RAD51 homolog 3 Human genes 0.000 description 1
- 102100034483 DNA repair protein RAD51 homolog 4 Human genes 0.000 description 1
- 102100028285 DNA repair protein REV1 Human genes 0.000 description 1
- 102100027828 DNA repair protein XRCC4 Human genes 0.000 description 1
- 102100022286 DNA repair-scaffolding protein Human genes 0.000 description 1
- 102100039606 DNA replication licensing factor MCM3 Human genes 0.000 description 1
- 102100033711 DNA replication licensing factor MCM7 Human genes 0.000 description 1
- 102100024607 DNA topoisomerase 1 Human genes 0.000 description 1
- 102100033589 DNA topoisomerase 2-beta Human genes 0.000 description 1
- 102100040401 DNA topoisomerase 3-alpha Human genes 0.000 description 1
- 102100040398 DNA topoisomerase 3-beta-1 Human genes 0.000 description 1
- 102100037373 DNA-(apurinic or apyrimidinic site) endonuclease Human genes 0.000 description 1
- 102100035619 DNA-(apurinic or apyrimidinic site) lyase Human genes 0.000 description 1
- 102100020986 DNA-binding protein RFX5 Human genes 0.000 description 1
- 102100021044 DNA-binding protein RFXANK Human genes 0.000 description 1
- 102100032881 DNA-binding protein SATB1 Human genes 0.000 description 1
- 102100026816 DNA-dependent metalloprotease SPRTN Human genes 0.000 description 1
- 102100022204 DNA-dependent protein kinase catalytic subunit Human genes 0.000 description 1
- 102100029764 DNA-directed DNA/RNA polymerase mu Human genes 0.000 description 1
- 102100031593 DNA-directed RNA polymerase I subunit RPA1 Human genes 0.000 description 1
- 102100031594 DNA-directed RNA polymerase I subunit RPA12 Human genes 0.000 description 1
- 102100027479 DNA-directed RNA polymerase I subunit RPA34 Human genes 0.000 description 1
- 102100027491 DNA-directed RNA polymerase I subunit RPA43 Human genes 0.000 description 1
- 102100040138 DNA-directed RNA polymerase II subunit GRINL1A, isoforms 4/5 Human genes 0.000 description 1
- 102100021429 DNA-directed RNA polymerase II subunit RPB1 Human genes 0.000 description 1
- 102100039302 DNA-directed RNA polymerase II subunit RPB11-a Human genes 0.000 description 1
- 102100039303 DNA-directed RNA polymerase II subunit RPB2 Human genes 0.000 description 1
- 102100032260 DNA-directed RNA polymerase II subunit RPB4 Human genes 0.000 description 1
- 102100031137 DNA-directed RNA polymerase II subunit RPB7 Human genes 0.000 description 1
- 102100028495 DNA-directed RNA polymerase II subunit RPB9 Human genes 0.000 description 1
- 102100024452 DNA-directed RNA polymerase III subunit RPC1 Human genes 0.000 description 1
- 102100028500 DNA-directed RNA polymerase III subunit RPC10 Human genes 0.000 description 1
- 102100034588 DNA-directed RNA polymerase III subunit RPC2 Human genes 0.000 description 1
- 102100027480 DNA-directed RNA polymerase III subunit RPC3 Human genes 0.000 description 1
- 102100039886 DNA-directed RNA polymerase III subunit RPC4 Human genes 0.000 description 1
- 102100039883 DNA-directed RNA polymerase III subunit RPC5 Human genes 0.000 description 1
- 102100032273 DNA-directed RNA polymerase III subunit RPC6 Human genes 0.000 description 1
- 102100032264 DNA-directed RNA polymerase III subunit RPC8 Human genes 0.000 description 1
- 102100040104 DNA-directed RNA polymerase III subunit RPC9 Human genes 0.000 description 1
- 102100024745 DNA-directed RNA polymerase, mitochondrial Human genes 0.000 description 1
- 102100032254 DNA-directed RNA polymerases I, II, and III subunit RPABC1 Human genes 0.000 description 1
- 102100023349 DNA-directed RNA polymerases I, II, and III subunit RPABC3 Human genes 0.000 description 1
- 102100028473 DNA-directed RNA polymerases I, II, and III subunit RPABC4 Human genes 0.000 description 1
- 102100037831 DNL-type zinc finger protein Human genes 0.000 description 1
- 102100022934 DPH3 homolog Human genes 0.000 description 1
- 101100444936 Danio rerio eif3ha gene Proteins 0.000 description 1
- 101100444938 Danio rerio eif3ja gene Proteins 0.000 description 1
- 101100457345 Danio rerio mapk14a gene Proteins 0.000 description 1
- 101100457347 Danio rerio mapk14b gene Proteins 0.000 description 1
- 102100027887 Deaminated glutathione amidase Human genes 0.000 description 1
- 102100028559 Death domain-associated protein 6 Human genes 0.000 description 1
- 102100038713 Death domain-containing protein CRADD Human genes 0.000 description 1
- 102100037618 Decapping and exoribonuclease protein Human genes 0.000 description 1
- 102100024351 Dedicator of cytokinesis protein 7 Human genes 0.000 description 1
- 102100034022 Dehydrogenase/reductase SDR family member 12 Human genes 0.000 description 1
- 102100020753 Dehydrogenase/reductase SDR family member 4-like 2 Human genes 0.000 description 1
- 102100037699 Dehydrogenase/reductase SDR family member 7B Human genes 0.000 description 1
- 102100040515 Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial Human genes 0.000 description 1
- 102100022692 Density-regulated protein Human genes 0.000 description 1
- 102100037101 Deoxycytidylate deaminase Human genes 0.000 description 1
- 102100039487 Deoxyhypusine hydroxylase Human genes 0.000 description 1
- 102100031242 Deoxyhypusine synthase Human genes 0.000 description 1
- 102100024737 Deoxynucleotidyltransferase terminal-interacting protein 2 Human genes 0.000 description 1
- 102100040259 Deoxyribonuclease TATDN1 Human genes 0.000 description 1
- 102100022882 Deoxyribonuclease-2-alpha Human genes 0.000 description 1
- 102100037802 Deoxyribose-phosphate aldolase Human genes 0.000 description 1
- 102100024469 Dephospho-CoA kinase domain-containing protein Human genes 0.000 description 1
- 102100030440 Derlin-2 Human genes 0.000 description 1
- 102100036898 Desumoylating isopeptidase 1 Human genes 0.000 description 1
- 102100035091 Deubiquitinase MYSM1 Human genes 0.000 description 1
- 102100037711 Developmentally-regulated GTP-binding protein 2 Human genes 0.000 description 1
- 102100037417 Dexamethasone-induced protein Human genes 0.000 description 1
- 102100036495 Di-N-acetylchitobiase Human genes 0.000 description 1
- 102100036869 Diacylglycerol O-acyltransferase 1 Human genes 0.000 description 1
- 102100022733 Diacylglycerol kinase epsilon Human genes 0.000 description 1
- 102100030221 Diacylglycerol kinase theta Human genes 0.000 description 1
- 102100037794 Diacylglycerol lipase-beta Human genes 0.000 description 1
- 101100216227 Dictyostelium discoideum anapc3 gene Proteins 0.000 description 1
- 101100327311 Dictyostelium discoideum anapc6 gene Proteins 0.000 description 1
- 101100226017 Dictyostelium discoideum repD gene Proteins 0.000 description 1
- 101100170004 Dictyostelium discoideum repE gene Proteins 0.000 description 1
- 102100025344 Differentially expressed in FDCP 8 homolog Human genes 0.000 description 1
- 102100027152 Dihydrolipoyllysine-residue acetyltransferase component of pyruvate dehydrogenase complex, mitochondrial Human genes 0.000 description 1
- 102100031920 Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Human genes 0.000 description 1
- 102100040679 Dihydroxyacetone phosphate acyltransferase Human genes 0.000 description 1
- 102100039178 Dimethyladenosine transferase 1, mitochondrial Human genes 0.000 description 1
- 102100020751 Dipeptidyl peptidase 2 Human genes 0.000 description 1
- 102100020750 Dipeptidyl peptidase 3 Human genes 0.000 description 1
- 102100036968 Dipeptidyl peptidase 8 Human genes 0.000 description 1
- 101710087012 Dipeptidyl-peptidase 7 Proteins 0.000 description 1
- 102100029579 Diphosphoinositol polyphosphate phosphohydrolase 1 Human genes 0.000 description 1
- 102100028686 Diphthine methyl ester synthase Human genes 0.000 description 1
- 102100037922 Disco-interacting protein 2 homolog A Human genes 0.000 description 1
- 102100028555 Disheveled-associated activator of morphogenesis 1 Human genes 0.000 description 1
- 102100039673 Disintegrin and metalloproteinase domain-containing protein 10 Human genes 0.000 description 1
- 102100031113 Disintegrin and metalloproteinase domain-containing protein 15 Human genes 0.000 description 1
- 102100031111 Disintegrin and metalloproteinase domain-containing protein 17 Human genes 0.000 description 1
- 102100024361 Disintegrin and metalloproteinase domain-containing protein 9 Human genes 0.000 description 1
- 102100024099 Disks large homolog 1 Human genes 0.000 description 1
- 102100037983 Disks large-associated protein 4 Human genes 0.000 description 1
- 102100035589 Distal membrane-arm assembly complex protein 2 Human genes 0.000 description 1
- 102100037926 Divergent protein kinase domain 2A Human genes 0.000 description 1
- 102100037957 Dixin Human genes 0.000 description 1
- 102100035372 DmX-like protein 1 Human genes 0.000 description 1
- 102100020977 DnaJ homolog subfamily A member 1 Human genes 0.000 description 1
- 102100035966 DnaJ homolog subfamily A member 2 Human genes 0.000 description 1
- 102100029716 DnaJ homolog subfamily A member 3, mitochondrial Human genes 0.000 description 1
- 102100037927 DnaJ homolog subfamily B member 11 Human genes 0.000 description 1
- 102100037888 DnaJ homolog subfamily B member 12 Human genes 0.000 description 1
- 102100023316 DnaJ homolog subfamily B member 14 Human genes 0.000 description 1
- 102100029714 DnaJ homolog subfamily B member 2 Human genes 0.000 description 1
- 102100035419 DnaJ homolog subfamily B member 9 Human genes 0.000 description 1
- 102100023317 DnaJ homolog subfamily C member 10 Human genes 0.000 description 1
- 102100034109 DnaJ homolog subfamily C member 13 Human genes 0.000 description 1
- 102100034115 DnaJ homolog subfamily C member 15 Human genes 0.000 description 1
- 102100034110 DnaJ homolog subfamily C member 16 Human genes 0.000 description 1
- 102100031695 DnaJ homolog subfamily C member 2 Human genes 0.000 description 1
- 102100022265 DnaJ homolog subfamily C member 21 Human genes 0.000 description 1
- 102100026984 DnaJ homolog subfamily C member 25 Human genes 0.000 description 1
- 102100031681 DnaJ homolog subfamily C member 3 Human genes 0.000 description 1
- 102100031682 DnaJ homolog subfamily C member 4 Human genes 0.000 description 1
- 102100022840 DnaJ homolog subfamily C member 7 Human genes 0.000 description 1
- 102100022839 DnaJ homolog subfamily C member 8 Human genes 0.000 description 1
- 102100022845 DnaJ homolog subfamily C member 9 Human genes 0.000 description 1
- 102100031605 Dolichol kinase Human genes 0.000 description 1
- 102100020740 Dolichol phosphate-mannose biosynthesis regulatory protein Human genes 0.000 description 1
- 102100020746 Dolichol-phosphate mannosyltransferase subunit 1 Human genes 0.000 description 1
- 102100032086 Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase Human genes 0.000 description 1
- 102100034583 Dolichyl-diphosphooligosaccharide-protein glycosyltransferase subunit 1 Human genes 0.000 description 1
- 102100039104 Dolichyl-diphosphooligosaccharide-protein glycosyltransferase subunit DAD1 Human genes 0.000 description 1
- 102100027189 Dolichyl-phosphate beta-glucosyltransferase Human genes 0.000 description 1
- 241001669680 Dormitator maculatus Species 0.000 description 1
- 102100029952 Double-strand-break repair protein rad21 homolog Human genes 0.000 description 1
- 102100028028 Double-stranded RNA-binding protein Staufen homolog 2 Human genes 0.000 description 1
- 102100028570 Drebrin-like protein Human genes 0.000 description 1
- 101100242263 Drosophila melanogaster ORMDL gene Proteins 0.000 description 1
- 101001092183 Drosophila melanogaster Regulator of gene activity Proteins 0.000 description 1
- 101100170005 Drosophila melanogaster pic gene Proteins 0.000 description 1
- 102100031480 Dual specificity mitogen-activated protein kinase kinase 1 Human genes 0.000 description 1
- 102100023275 Dual specificity mitogen-activated protein kinase kinase 3 Human genes 0.000 description 1
- 102100023274 Dual specificity mitogen-activated protein kinase kinase 4 Human genes 0.000 description 1
- 102100023272 Dual specificity mitogen-activated protein kinase kinase 5 Human genes 0.000 description 1
- 102100040862 Dual specificity protein kinase CLK1 Human genes 0.000 description 1
- 102100040844 Dual specificity protein kinase CLK2 Human genes 0.000 description 1
- 102100040856 Dual specificity protein kinase CLK3 Human genes 0.000 description 1
- 102100037573 Dual specificity protein phosphatase 12 Human genes 0.000 description 1
- 102100037567 Dual specificity protein phosphatase 14 Human genes 0.000 description 1
- 102100024673 Dual specificity protein phosphatase 3 Human genes 0.000 description 1
- 102100027275 Dual specificity protein phosphatase 7 Human genes 0.000 description 1
- 102100025699 Dual specificity protein phosphatase CDC14B Human genes 0.000 description 1
- 102100036498 Dual specificity testis-specific protein kinase 2 Human genes 0.000 description 1
- 102100028554 Dual specificity tyrosine-phosphorylation-regulated kinase 1A Human genes 0.000 description 1
- 102100023112 Dual specificity tyrosine-phosphorylation-regulated kinase 4 Human genes 0.000 description 1
- 102100036654 Dynactin subunit 1 Human genes 0.000 description 1
- 102100021076 Dynactin subunit 2 Human genes 0.000 description 1
- 102100021073 Dynactin subunit 3 Human genes 0.000 description 1
- 102100021074 Dynactin subunit 4 Human genes 0.000 description 1
- 102100021071 Dynactin subunit 5 Human genes 0.000 description 1
- 102100035834 Dynactin subunit 6 Human genes 0.000 description 1
- 108010044191 Dynamin II Proteins 0.000 description 1
- 102100024827 Dynamin-1-like protein Human genes 0.000 description 1
- 102100021238 Dynamin-2 Human genes 0.000 description 1
- 102100024821 Dynamin-binding protein Human genes 0.000 description 1
- 102100024284 Dynein axonemal assembly factor 10 Human genes 0.000 description 1
- 102100032238 Dynein axonemal assembly factor 5 Human genes 0.000 description 1
- 102100032237 Dynein axonemal assembly factor 9 Human genes 0.000 description 1
- 102100023965 Dynein light chain Tctex-type 3 Human genes 0.000 description 1
- 102100025682 Dystroglycan 1 Human genes 0.000 description 1
- 102100038913 E1A-binding protein p400 Human genes 0.000 description 1
- 102100035989 E3 SUMO-protein ligase PIAS1 Human genes 0.000 description 1
- 102100036254 E3 SUMO-protein ligase PIAS2 Human genes 0.000 description 1
- 102100030837 E3 SUMO-protein ligase PIAS3 Human genes 0.000 description 1
- 102100038912 E3 SUMO-protein ligase RanBP2 Human genes 0.000 description 1
- 102100035863 E3 SUMO-protein ligase ZNF451 Human genes 0.000 description 1
- 102100026620 E3 ubiquitin ligase TRAF3IP2 Human genes 0.000 description 1
- 102100032045 E3 ubiquitin-protein ligase AMFR Human genes 0.000 description 1
- 102100038509 E3 ubiquitin-protein ligase ARIH1 Human genes 0.000 description 1
- 102100038513 E3 ubiquitin-protein ligase ARIH2 Human genes 0.000 description 1
- 102100027415 E3 ubiquitin-protein ligase Arkadia Human genes 0.000 description 1
- 102100021739 E3 ubiquitin-protein ligase BRE1B Human genes 0.000 description 1
- 102100037334 E3 ubiquitin-protein ligase CHIP Human genes 0.000 description 1
- 102100034677 E3 ubiquitin-protein ligase HECTD1 Human genes 0.000 description 1
- 102100034745 E3 ubiquitin-protein ligase HERC2 Human genes 0.000 description 1
- 102100032049 E3 ubiquitin-protein ligase LRSAM1 Human genes 0.000 description 1
- 102100040930 E3 ubiquitin-protein ligase MARCHF2 Human genes 0.000 description 1
- 102100040877 E3 ubiquitin-protein ligase MARCHF5 Human genes 0.000 description 1
- 102100023149 E3 ubiquitin-protein ligase MARCHF6 Human genes 0.000 description 1
- 102100023196 E3 ubiquitin-protein ligase MARCHF8 Human genes 0.000 description 1
- 102100037994 E3 ubiquitin-protein ligase MGRN1 Human genes 0.000 description 1
- 102100022199 E3 ubiquitin-protein ligase MIB2 Human genes 0.000 description 1
- 102100035102 E3 ubiquitin-protein ligase MYCBP2 Human genes 0.000 description 1
- 102000012199 E3 ubiquitin-protein ligase Mdm2 Human genes 0.000 description 1
- 108050002772 E3 ubiquitin-protein ligase Mdm2 Proteins 0.000 description 1
- 102100026246 E3 ubiquitin-protein ligase NRDP1 Human genes 0.000 description 1
- 102100036333 E3 ubiquitin-protein ligase Praja-2 Human genes 0.000 description 1
- 102100025189 E3 ubiquitin-protein ligase RBBP6 Human genes 0.000 description 1
- 102100023877 E3 ubiquitin-protein ligase RBX1 Human genes 0.000 description 1
- 101710095156 E3 ubiquitin-protein ligase RBX1 Proteins 0.000 description 1
- 102100031438 E3 ubiquitin-protein ligase RING1 Human genes 0.000 description 1
- 102100027416 E3 ubiquitin-protein ligase RNF103 Human genes 0.000 description 1
- 102100028152 E3 ubiquitin-protein ligase RNF113A Human genes 0.000 description 1
- 102100028107 E3 ubiquitin-protein ligase RNF115 Human genes 0.000 description 1
- 102100034165 E3 ubiquitin-protein ligase RNF13 Human genes 0.000 description 1
- 102100021766 E3 ubiquitin-protein ligase RNF138 Human genes 0.000 description 1
- 102100021765 E3 ubiquitin-protein ligase RNF139 Human genes 0.000 description 1
- 102100026368 E3 ubiquitin-protein ligase RNF146 Human genes 0.000 description 1
- 102100039627 E3 ubiquitin-protein ligase RNF167 Human genes 0.000 description 1
- 102100039814 E3 ubiquitin-protein ligase RNF170 Human genes 0.000 description 1
- 102100040325 E3 ubiquitin-protein ligase RNF185 Human genes 0.000 description 1
- 102100040326 E3 ubiquitin-protein ligase RNF187 Human genes 0.000 description 1
- 102100039502 E3 ubiquitin-protein ligase RNF34 Human genes 0.000 description 1
- 102100021820 E3 ubiquitin-protein ligase RNF4 Human genes 0.000 description 1
- 102100021810 E3 ubiquitin-protein ligase RNF6 Human genes 0.000 description 1
- 102100029944 E3 ubiquitin-protein ligase SHPRH Human genes 0.000 description 1
- 102100031748 E3 ubiquitin-protein ligase SIAH2 Human genes 0.000 description 1
- 102100038631 E3 ubiquitin-protein ligase SMURF1 Human genes 0.000 description 1
- 102100034596 E3 ubiquitin-protein ligase TRIM23 Human genes 0.000 description 1
- 102100029505 E3 ubiquitin-protein ligase TRIM33 Human genes 0.000 description 1
- 102100028093 E3 ubiquitin-protein ligase TRIP12 Human genes 0.000 description 1
- 102100029211 E3 ubiquitin-protein ligase TTC3 Human genes 0.000 description 1
- 102100037460 E3 ubiquitin-protein ligase Topors Human genes 0.000 description 1
- 102100037240 E3 ubiquitin-protein ligase UBR2 Human genes 0.000 description 1
- 102100040341 E3 ubiquitin-protein ligase UBR5 Human genes 0.000 description 1
- 102100037024 E3 ubiquitin-protein ligase XIAP Human genes 0.000 description 1
- 102100021069 E3 ubiquitin-protein ligase ZFP91 Human genes 0.000 description 1
- 102100033594 E3 ubiquitin-protein ligase makorin-1 Human genes 0.000 description 1
- 102100033612 E3 ubiquitin-protein ligase makorin-2 Human genes 0.000 description 1
- 102100022207 E3 ubiquitin-protein ligase parkin Human genes 0.000 description 1
- 102100030796 E3 ubiquitin-protein ligase rififylin Human genes 0.000 description 1
- 102100021758 E3 ubiquitin-protein transferase MAEA Human genes 0.000 description 1
- 102100034582 E3 ubiquitin/ISG15 ligase TRIM25 Human genes 0.000 description 1
- 102100032058 EARP and GARP complex-interacting protein 1 Human genes 0.000 description 1
- 101150115146 EEF2 gene Proteins 0.000 description 1
- 102100029652 EH domain-binding protein 1 Human genes 0.000 description 1
- 101150061947 EIF2D gene Proteins 0.000 description 1
- 101150039757 EIF3E gene Proteins 0.000 description 1
- 101150073788 EIF3K gene Proteins 0.000 description 1
- 101150100259 EIF3L gene Proteins 0.000 description 1
- 101150015614 EIF3M gene Proteins 0.000 description 1
- 102100020865 EKC/KEOPS complex subunit LAGE3 Human genes 0.000 description 1
- 102100029493 EKC/KEOPS complex subunit TP53RK Human genes 0.000 description 1
- 108700015856 ELAV-Like Protein 1 Proteins 0.000 description 1
- 102100034235 ELAV-like protein 1 Human genes 0.000 description 1
- 102100027108 ELMO domain-containing protein 3 Human genes 0.000 description 1
- 208000037595 EN1-related dorsoventral syndrome Diseases 0.000 description 1
- 102100030081 EPM2A-interacting protein 1 Human genes 0.000 description 1
- 102100039368 ER lumen protein-retaining receptor 2 Human genes 0.000 description 1
- 102100021650 ER membrane protein complex subunit 1 Human genes 0.000 description 1
- 102100037527 ER membrane protein complex subunit 2 Human genes 0.000 description 1
- 102100035084 ER membrane protein complex subunit 4 Human genes 0.000 description 1
- 102100023464 ER membrane protein complex subunit 6 Human genes 0.000 description 1
- 102100034240 ER membrane protein complex subunit 8 Human genes 0.000 description 1
- 102100034232 ER membrane protein complex subunit 9 Human genes 0.000 description 1
- 101150105460 ERCC2 gene Proteins 0.000 description 1
- 102100030787 ERI1 exoribonuclease 2 Human genes 0.000 description 1
- 102100029994 ERO1-like protein alpha Human genes 0.000 description 1
- 101150017533 ERP44 gene Proteins 0.000 description 1
- 102100032057 ETS domain-containing protein Elk-1 Human genes 0.000 description 1
- 102100023792 ETS domain-containing protein Elk-4 Human genes 0.000 description 1
- 102100039562 ETS translocation variant 3 Human genes 0.000 description 1
- 102100035078 ETS-related transcription factor Elf-2 Human genes 0.000 description 1
- 102100027245 EVI5-like protein Human genes 0.000 description 1
- 108010051542 Early Growth Response Protein 1 Proteins 0.000 description 1
- 102100023226 Early growth response protein 1 Human genes 0.000 description 1
- 102100027126 Echinoderm microtubule-associated protein-like 2 Human genes 0.000 description 1
- 102100027100 Echinoderm microtubule-associated protein-like 4 Human genes 0.000 description 1
- 102100027261 Ecotropic viral integration site 5 protein homolog Human genes 0.000 description 1
- 102100029724 Ectonucleoside triphosphate diphosphohydrolase 4 Human genes 0.000 description 1
- 102100036437 Ectonucleoside triphosphate diphosphohydrolase 6 Human genes 0.000 description 1
- 101150107333 Eif3g gene Proteins 0.000 description 1
- 101150028132 Eif3h gene Proteins 0.000 description 1
- 101150011861 Elavl1 gene Proteins 0.000 description 1
- 102100037067 Electron transfer flavoprotein beta subunit lysine methyltransferase Human genes 0.000 description 1
- 102100031799 Electron transfer flavoprotein regulatory factor 1 Human genes 0.000 description 1
- 102100027262 Electron transfer flavoprotein subunit beta Human genes 0.000 description 1
- 102100040465 Elongation factor 1-beta Human genes 0.000 description 1
- 102100031334 Elongation factor 2 Human genes 0.000 description 1
- 102100021309 Elongation factor Ts, mitochondrial Human genes 0.000 description 1
- 102100033238 Elongation factor Tu, mitochondrial Human genes 0.000 description 1
- 102100031417 Elongation factor-like GTPase 1 Human genes 0.000 description 1
- 102100032055 Elongation of very long chain fatty acids protein 1 Human genes 0.000 description 1
- 102100039246 Elongator complex protein 1 Human genes 0.000 description 1
- 102100034241 Elongator complex protein 2 Human genes 0.000 description 1
- 101710167764 Elongator complex protein 2 Proteins 0.000 description 1
- 102100021666 Elongator complex protein 5 Human genes 0.000 description 1
- 102100021649 Elongator complex protein 6 Human genes 0.000 description 1
- 102100030208 Elongin-A Human genes 0.000 description 1
- 102100030209 Elongin-B Human genes 0.000 description 1
- 102100037114 Elongin-C Human genes 0.000 description 1
- 102100028779 Endonuclease 8-like 2 Human genes 0.000 description 1
- 102100021008 Endonuclease G, mitochondrial Human genes 0.000 description 1
- 102100021710 Endonuclease III-like protein 1 Human genes 0.000 description 1
- 102100037696 Endonuclease V Human genes 0.000 description 1
- 102100028401 Endophilin-A2 Human genes 0.000 description 1
- 102100032670 Endophilin-B1 Human genes 0.000 description 1
- 108700041152 Endoplasmic Reticulum Chaperone BiP Proteins 0.000 description 1
- 102100021598 Endoplasmic reticulum aminopeptidase 1 Human genes 0.000 description 1
- 102100021451 Endoplasmic reticulum chaperone BiP Human genes 0.000 description 1
- 102100039609 Endoplasmic reticulum lectin 1 Human genes 0.000 description 1
- 102100021771 Endoplasmic reticulum mannosyl-oligosaccharide 1,2-alpha-mannosidase Human genes 0.000 description 1
- 102100031702 Endoplasmic reticulum membrane sensor NFE2L1 Human genes 0.000 description 1
- 102100031853 Endoplasmic reticulum resident protein 44 Human genes 0.000 description 1
- 102100031862 Endoplasmic reticulum-Golgi intermediate compartment protein 1 Human genes 0.000 description 1
- 102100031863 Endoplasmic reticulum-Golgi intermediate compartment protein 2 Human genes 0.000 description 1
- 102100029988 Endoplasmic reticulum-Golgi intermediate compartment protein 3 Human genes 0.000 description 1
- 102100023387 Endoribonuclease Dicer Human genes 0.000 description 1
- 102100024604 Endoribonuclease LACTB2 Human genes 0.000 description 1
- 102100025654 Endosome-associated-trafficking regulator 1 Human genes 0.000 description 1
- 102100032450 Endothelial differentiation-related factor 1 Human genes 0.000 description 1
- 102100029112 Endothelin-converting enzyme 1 Human genes 0.000 description 1
- 101150102649 Engase gene Proteins 0.000 description 1
- 102100037374 Enhancer of mRNA-decapping protein 3 Human genes 0.000 description 1
- 102100021805 Enhancer of mRNA-decapping protein 4 Human genes 0.000 description 1
- 102100031948 Enhancer of polycomb homolog 1 Human genes 0.000 description 1
- 102100031941 Enhancer of polycomb homolog 2 Human genes 0.000 description 1
- 102100021821 Enoyl-CoA delta isomerase 1, mitochondrial Human genes 0.000 description 1
- 102100021823 Enoyl-CoA delta isomerase 2 Human genes 0.000 description 1
- 102100021822 Enoyl-CoA hydratase, mitochondrial Human genes 0.000 description 1
- 101710180035 Enoyl-CoA hydratase, mitochondrial Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102100039369 Epidermal growth factor receptor substrate 15 Human genes 0.000 description 1
- 102100023164 Epididymis-specific alpha-mannosidase Human genes 0.000 description 1
- 102100030082 Epsin-1 Human genes 0.000 description 1
- 102100029987 Erbin Human genes 0.000 description 1
- 102100039607 Erlin-1 Human genes 0.000 description 1
- 102100036823 Erlin-2 Human genes 0.000 description 1
- 102100036825 Erythroid membrane-associated protein Human genes 0.000 description 1
- 102100033175 Ethanolamine kinase 1 Human genes 0.000 description 1
- 102100029106 Ethylmalonyl-CoA decarboxylase Human genes 0.000 description 1
- 108010089791 Eukaryotic Initiation Factor-2 Proteins 0.000 description 1
- 108010082945 Eukaryotic Initiation Factor-2B Proteins 0.000 description 1
- 102000005233 Eukaryotic Initiation Factor-4E Human genes 0.000 description 1
- 108060002636 Eukaryotic Initiation Factor-4E Proteins 0.000 description 1
- 102100021808 Eukaryotic elongation factor 2 kinase Human genes 0.000 description 1
- 102100039950 Eukaryotic initiation factor 4A-I Human genes 0.000 description 1
- 102100022461 Eukaryotic initiation factor 4A-III Human genes 0.000 description 1
- 102100036816 Eukaryotic peptide chain release factor GTP-binding subunit ERF3A Human genes 0.000 description 1
- 102100030667 Eukaryotic peptide chain release factor subunit 1 Human genes 0.000 description 1
- 102100021381 Eukaryotic translation elongation factor 1 epsilon-1 Human genes 0.000 description 1
- 102100034174 Eukaryotic translation initiation factor 2-alpha kinase 3 Human genes 0.000 description 1
- 102100038075 Eukaryotic translation initiation factor 2D Human genes 0.000 description 1
- 102100035045 Eukaryotic translation initiation factor 3 subunit C Human genes 0.000 description 1
- 102100029776 Eukaryotic translation initiation factor 3 subunit D Human genes 0.000 description 1
- 102100033132 Eukaryotic translation initiation factor 3 subunit E Human genes 0.000 description 1
- 102100034255 Eukaryotic translation initiation factor 3 subunit F Human genes 0.000 description 1
- 102100023236 Eukaryotic translation initiation factor 3 subunit G Human genes 0.000 description 1
- 102100037115 Eukaryotic translation initiation factor 3 subunit H Human genes 0.000 description 1
- 102100029782 Eukaryotic translation initiation factor 3 subunit I Human genes 0.000 description 1
- 102100034226 Eukaryotic translation initiation factor 3 subunit J Human genes 0.000 description 1
- 102100037110 Eukaryotic translation initiation factor 3 subunit K Human genes 0.000 description 1
- 102100038085 Eukaryotic translation initiation factor 3 subunit L Human genes 0.000 description 1
- 102100029777 Eukaryotic translation initiation factor 3 subunit M Human genes 0.000 description 1
- 102100039735 Eukaryotic translation initiation factor 4 gamma 1 Human genes 0.000 description 1
- 102100039737 Eukaryotic translation initiation factor 4 gamma 2 Human genes 0.000 description 1
- 102100040022 Eukaryotic translation initiation factor 4 gamma 3 Human genes 0.000 description 1
- 102100029602 Eukaryotic translation initiation factor 4B Human genes 0.000 description 1
- 102100033399 Eukaryotic translation initiation factor 4E transporter Human genes 0.000 description 1
- 102100029922 Eukaryotic translation initiation factor 4E type 2 Human genes 0.000 description 1
- 102100022447 Eukaryotic translation initiation factor 4E-binding protein 2 Human genes 0.000 description 1
- 102100020987 Eukaryotic translation initiation factor 5 Human genes 0.000 description 1
- 102100026761 Eukaryotic translation initiation factor 5A-1 Human genes 0.000 description 1
- 102100039952 Eukaryotic translation initiation factor 5A-1-like Human genes 0.000 description 1
- 102100039466 Eukaryotic translation initiation factor 5B Human genes 0.000 description 1
- 101710204615 Eukaryotic translation initiation factor 6 Proteins 0.000 description 1
- 102100031627 Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial Human genes 0.000 description 1
- 102100030844 Exocyst complex component 1 Human genes 0.000 description 1
- 102100030860 Exocyst complex component 3 Human genes 0.000 description 1
- 102100026979 Exocyst complex component 4 Human genes 0.000 description 1
- 102100026976 Exocyst complex component 6 Human genes 0.000 description 1
- 102100039540 Exocyst complex component 7 Human genes 0.000 description 1
- 102100029908 Exonuclease 3'-5' domain-containing protein 2 Human genes 0.000 description 1
- 102100038195 Exonuclease mut-7 homolog Human genes 0.000 description 1
- 102100037123 Exosome RNA helicase MTR4 Human genes 0.000 description 1
- 102100038980 Exosome complex component CSL4 Human genes 0.000 description 1
- 102100038984 Exosome complex component RRP4 Human genes 0.000 description 1
- 102100038982 Exosome complex component RRP40 Human genes 0.000 description 1
- 102100026045 Exosome complex component RRP42 Human genes 0.000 description 1
- 102100026060 Exosome component 10 Human genes 0.000 description 1
- 102100029074 Exostosin-2 Human genes 0.000 description 1
- 102100035976 Exostosin-like 3 Human genes 0.000 description 1
- 102100029091 Exportin-2 Human genes 0.000 description 1
- 102100039207 Exportin-T Human genes 0.000 description 1
- 102100036763 Extended synaptotagmin-1 Human genes 0.000 description 1
- 108091007413 Extracellular RNA Proteins 0.000 description 1
- 102100030861 Eyes absent homolog 3 Human genes 0.000 description 1
- 102100040650 F-BAR and double SH3 domains protein 2 Human genes 0.000 description 1
- 102100025971 F-actin-capping protein subunit alpha-2 Human genes 0.000 description 1
- 102100029956 F-actin-capping protein subunit beta Human genes 0.000 description 1
- 102100026339 F-box-like/WD repeat-containing protein TBL1X Human genes 0.000 description 1
- 102100039836 F-box/LRR-repeat protein 12 Human genes 0.000 description 1
- 102100027747 F-box/LRR-repeat protein 20 Human genes 0.000 description 1
- 102100037315 F-box/LRR-repeat protein 3 Human genes 0.000 description 1
- 102100037316 F-box/LRR-repeat protein 4 Human genes 0.000 description 1
- 102100037338 F-box/LRR-repeat protein 5 Human genes 0.000 description 1
- 102100037343 F-box/LRR-repeat protein 6 Human genes 0.000 description 1
- 102100038577 F-box/WD repeat-containing protein 11 Human genes 0.000 description 1
- 102100038576 F-box/WD repeat-containing protein 1A Human genes 0.000 description 1
- 102100028146 F-box/WD repeat-containing protein 2 Human genes 0.000 description 1
- 102100028138 F-box/WD repeat-containing protein 7 Human genes 0.000 description 1
- 102100028137 F-box/WD repeat-containing protein 8 Human genes 0.000 description 1
- 102100025637 FACT complex subunit SPT16 Human genes 0.000 description 1
- 102100028166 FACT complex subunit SSRP1 Human genes 0.000 description 1
- 102100034545 FAD synthase region Human genes 0.000 description 1
- 102100036335 FAD-dependent oxidoreductase domain-containing protein 1 Human genes 0.000 description 1
- 102100036315 FAD-dependent oxidoreductase domain-containing protein 2 Human genes 0.000 description 1
- 102100039111 FAD-linked sulfhydryl oxidase ALR Human genes 0.000 description 1
- 102100026693 FAS-associated death domain protein Human genes 0.000 description 1
- 102100022354 FAS-associated factor 2 Human genes 0.000 description 1
- 102100037581 FAST kinase domain-containing protein 2, mitochondrial Human genes 0.000 description 1
- 102100037584 FAST kinase domain-containing protein 4 Human genes 0.000 description 1
- 102000013339 FBXL17 Human genes 0.000 description 1
- 101150000662 FBXL17 gene Proteins 0.000 description 1
- 102100037577 FERM, ARHGEF and pleckstrin domain-containing protein 2 Human genes 0.000 description 1
- 102100038665 FGGY carbohydrate kinase domain-containing protein Human genes 0.000 description 1
- 102100037683 FHF complex subunit HOOK interacting protein 1B Human genes 0.000 description 1
- 102100037673 FHF complex subunit HOOK interacting protein 2A Human genes 0.000 description 1
- 102100040351 FK506-binding protein 15 Human genes 0.000 description 1
- 102100036136 FLYWCH family member 2 Human genes 0.000 description 1
- 102100027284 Fanconi-associated nuclease 1 Human genes 0.000 description 1
- 102100036118 Far upstream element-binding protein 1 Human genes 0.000 description 1
- 102100036123 Far upstream element-binding protein 2 Human genes 0.000 description 1
- 102100036113 Far upstream element-binding protein 3 Human genes 0.000 description 1
- 102100035111 Farnesyl pyrophosphate synthase Human genes 0.000 description 1
- 102100037819 Fas apoptotic inhibitory molecule 1 Human genes 0.000 description 1
- 102100029531 Fas-activated serine/threonine kinase Human genes 0.000 description 1
- 102100037679 Fasciculation and elongation protein zeta-2 Human genes 0.000 description 1
- 102100034334 Fatty acid CoA ligase Acsl3 Human genes 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 102100026117 Ferredoxin-2, mitochondrial Human genes 0.000 description 1
- 102100020760 Ferritin heavy chain Human genes 0.000 description 1
- 102100030771 Ferrochelatase, mitochondrial Human genes 0.000 description 1
- 102100021066 Fibroblast growth factor receptor substrate 2 Human genes 0.000 description 1
- 102100026545 Fibronectin type III domain-containing protein 3B Human genes 0.000 description 1
- 102100026542 Fibronectin type-III domain-containing protein 3A Human genes 0.000 description 1
- 102100024459 Fibrosin-1-like protein Human genes 0.000 description 1
- 102100026559 Filamin-B Human genes 0.000 description 1
- 102100026121 Flap endonuclease 1 Human genes 0.000 description 1
- 108090000652 Flap endonucleases Proteins 0.000 description 1
- 101001067614 Flaveria pringlei Serine hydroxymethyltransferase 2, mitochondrial Proteins 0.000 description 1
- 102100027944 Flavin reductase (NADPH) Human genes 0.000 description 1
- 102100032790 Flotillin-1 Human genes 0.000 description 1
- 102100023513 Flotillin-2 Human genes 0.000 description 1
- 102100027560 Focadhesin Human genes 0.000 description 1
- 102100028819 Folliculin-interacting protein 1 Human genes 0.000 description 1
- 101710161408 Folylpolyglutamate synthase Proteins 0.000 description 1
- 102100035067 Folylpolyglutamate synthase, mitochondrial Human genes 0.000 description 1
- 101710200122 Folylpolyglutamate synthase, mitochondrial Proteins 0.000 description 1
- 102100035129 Forkhead box protein K2 Human genes 0.000 description 1
- 102100023359 Forkhead box protein N3 Human genes 0.000 description 1
- 102100027579 Forkhead box protein P4 Human genes 0.000 description 1
- 102100040988 Formin-binding protein 4 Human genes 0.000 description 1
- 102100036334 Fragile X mental retardation syndrome-related protein 1 Human genes 0.000 description 1
- 102100036336 Fragile X mental retardation syndrome-related protein 2 Human genes 0.000 description 1
- 241000195522 Fucales Species 0.000 description 1
- 102100037047 Fucose-1-phosphate guanylyltransferase Human genes 0.000 description 1
- 102100022351 Fumarylacetoacetate hydrolase domain-containing protein 2A Human genes 0.000 description 1
- 102100035233 Furin Human genes 0.000 description 1
- 101150111025 Furin gene Proteins 0.000 description 1
- 102100024016 G patch domain and ankyrin repeat-containing protein 1 Human genes 0.000 description 1
- 102100039830 G patch domain-containing protein 4 Human genes 0.000 description 1
- 102100022148 G protein pathway suppressor 2 Human genes 0.000 description 1
- 102100030393 G-patch domain and KOW motifs-containing protein Human genes 0.000 description 1
- 102100030656 G-protein coupled receptor-associated protein LMBRD2 Human genes 0.000 description 1
- 102100035237 GA-binding protein alpha chain Human genes 0.000 description 1
- 102100035205 GA-binding protein subunit beta-1 Human genes 0.000 description 1
- 102100022688 GATOR complex protein DEPDC5 Human genes 0.000 description 1
- 102100022360 GATOR complex protein NPRL2 Human genes 0.000 description 1
- 102100022357 GATOR complex protein NPRL3 Human genes 0.000 description 1
- 108010003163 GDP dissociation inhibitor 1 Proteins 0.000 description 1
- 102100040779 GDP-D-glucose phosphorylase 1 Human genes 0.000 description 1
- 102100024515 GDP-L-fucose synthase Human genes 0.000 description 1
- 102100033821 GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase Human genes 0.000 description 1
- 102100027149 GDP-fucose protein O-fucosyltransferase 1 Human genes 0.000 description 1
- 102100030125 GDP-fucose protein O-fucosyltransferase 2 Human genes 0.000 description 1
- 102100035226 GDP-fucose transporter 1 Human genes 0.000 description 1
- 108010062427 GDP-mannose 4,6-dehydratase Proteins 0.000 description 1
- 102000002312 GDPmannose 4,6-dehydratase Human genes 0.000 description 1
- 102100040014 GH3 domain-containing protein Human genes 0.000 description 1
- 102000018134 GID8 Human genes 0.000 description 1
- 101150039487 GID8 gene Proteins 0.000 description 1
- 102100021189 GMP reductase 2 Human genes 0.000 description 1
- 102100025328 GON-4-like protein Human genes 0.000 description 1
- 102100035189 GPI ethanolamine phosphate transferase 1 Human genes 0.000 description 1
- 102100035190 GPI ethanolamine phosphate transferase 3 Human genes 0.000 description 1
- 102100038722 GPI mannosyltransferase 2 Human genes 0.000 description 1
- 102100036080 GPI mannosyltransferase 3 Human genes 0.000 description 1
- 102100038726 GPI transamidase component PIG-T Human genes 0.000 description 1
- 102100036858 GPI-anchor transamidase Human genes 0.000 description 1
- 102100025089 GPN-loop GTPase 1 Human genes 0.000 description 1
- 102100033884 GPN-loop GTPase 3 Human genes 0.000 description 1
- 102100038392 GRAM domain-containing protein 4 Human genes 0.000 description 1
- 108700031835 GRB10 Adaptor Proteins 0.000 description 1
- 102100040178 GRB10-interacting GYF protein 1 Human genes 0.000 description 1
- 102100040196 GRB10-interacting GYF protein 2 Human genes 0.000 description 1
- 102100023448 GTP-binding protein 1 Human genes 0.000 description 1
- 102100036482 GTP-binding protein 10 Human genes 0.000 description 1
- 102100023745 GTP-binding protein 4 Human genes 0.000 description 1
- 102100036483 GTP-binding protein 8 Human genes 0.000 description 1
- 108050007570 GTP-binding protein Rad Proteins 0.000 description 1
- 102100027541 GTP-binding protein Rheb Human genes 0.000 description 1
- 102100032174 GTP-binding protein SAR1a Human genes 0.000 description 1
- 102100032170 GTP-binding protein SAR1b Human genes 0.000 description 1
- 102100029974 GTPase HRas Human genes 0.000 description 1
- 102100039788 GTPase NRas Human genes 0.000 description 1
- 102100031692 GTPase-activating protein and VPS9 domain-containing protein 1 Human genes 0.000 description 1
- 102100028496 Galactocerebrosidase Human genes 0.000 description 1
- 102100039554 Galectin-8 Human genes 0.000 description 1
- 102100025614 Galectin-related protein Human genes 0.000 description 1
- 241000287828 Gallus gallus Species 0.000 description 1
- 102100035695 Gamma-aminobutyric acid receptor-associated protein Human genes 0.000 description 1
- 102100022510 Gamma-aminobutyric acid receptor-associated protein-like 2 Human genes 0.000 description 1
- 102100040004 Gamma-glutamylcyclotransferase Human genes 0.000 description 1
- 102100022951 Gamma-secretase subunit APH-1A Human genes 0.000 description 1
- 102100030916 Gamma-soluble NSF attachment protein Human genes 0.000 description 1
- 102100024582 Gamma-taxilin Human genes 0.000 description 1
- 102100028605 Gamma-tubulin complex component 2 Human genes 0.000 description 1
- 102100028592 Gamma-tubulin complex component 3 Human genes 0.000 description 1
- 102100028593 Gamma-tubulin complex component 4 Human genes 0.000 description 1
- 102100033432 Gamma-tubulin complex component 5 Human genes 0.000 description 1
- 102100023364 Ganglioside GM2 activator Human genes 0.000 description 1
- 102100024084 Ganglioside-induced differentiation-associated protein 2 Human genes 0.000 description 1
- 102100031885 General transcription and DNA repair factor IIH helicase subunit XPB Human genes 0.000 description 1
- 102100035184 General transcription and DNA repair factor IIH helicase subunit XPD Human genes 0.000 description 1
- 102100036529 General transcription factor 3C polypeptide 1 Human genes 0.000 description 1
- 102100036536 General transcription factor 3C polypeptide 2 Human genes 0.000 description 1
- 102100036531 General transcription factor 3C polypeptide 3 Human genes 0.000 description 1
- 102100036530 General transcription factor 3C polypeptide 4 Human genes 0.000 description 1
- 102100038073 General transcription factor II-I Human genes 0.000 description 1
- 102100022967 General transcription factor II-I repeat domain-containing protein 1 Human genes 0.000 description 1
- 102100034936 General transcription factor IIE subunit 1 Human genes 0.000 description 1
- 102100033840 General transcription factor IIF subunit 1 Human genes 0.000 description 1
- 102100033842 General transcription factor IIF subunit 2 Human genes 0.000 description 1
- 102100038308 General transcription factor IIH subunit 1 Human genes 0.000 description 1
- 102100032863 General transcription factor IIH subunit 3 Human genes 0.000 description 1
- 102100032862 General transcription factor IIH subunit 4 Human genes 0.000 description 1
- 102100037390 Genetic suppressor element 1 Human genes 0.000 description 1
- 102100039291 Geranylgeranyl pyrophosphate synthase Human genes 0.000 description 1
- 102100033264 Geranylgeranyl transferase type-1 subunit beta Human genes 0.000 description 1
- 102100033236 Geranylgeranyl transferase type-2 subunit alpha Human genes 0.000 description 1
- 102100031103 Geranylgeranyl transferase type-2 subunit beta Human genes 0.000 description 1
- 102100037412 Germinal-center associated nuclear protein Human genes 0.000 description 1
- 101710194542 Germinal-center associated nuclear protein Proteins 0.000 description 1
- 102100041013 Glia maturation factor beta Human genes 0.000 description 1
- 108091010837 Glial cell line-derived neurotrophic factor Proteins 0.000 description 1
- 102100033417 Glucocorticoid receptor Human genes 0.000 description 1
- 102100021223 Glucosidase 2 subunit beta Human genes 0.000 description 1
- 102100023525 Glucoside xylosyltransferase 1 Human genes 0.000 description 1
- 102100034009 Glutamate dehydrogenase 1, mitochondrial Human genes 0.000 description 1
- 102100039696 Glutamate-cysteine ligase catalytic subunit Human genes 0.000 description 1
- 102100033398 Glutamate-cysteine ligase regulatory subunit Human genes 0.000 description 1
- 102100020972 Glutamine amidotransferase-like class 1 domain-containing protein 3, mitochondrial Human genes 0.000 description 1
- 102100038676 Glutamine and serine-rich protein 1 Human genes 0.000 description 1
- 102100033429 Glutamine-fructose-6-phosphate aminotransferase [isomerizing] 1 Human genes 0.000 description 1
- 102100036596 Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial Human genes 0.000 description 1
- 102100039332 Glutaredoxin-2, mitochondrial Human genes 0.000 description 1
- 102100036424 Glutaredoxin-3 Human genes 0.000 description 1
- 102100023889 Glutaredoxin-related protein 5, mitochondrial Human genes 0.000 description 1
- 102100028603 Glutaryl-CoA dehydrogenase, mitochondrial Human genes 0.000 description 1
- 102100023523 Glutathione S-transferase Mu 4 Human genes 0.000 description 1
- 102100039651 Glutathione S-transferase kappa 1 Human genes 0.000 description 1
- 102100033039 Glutathione peroxidase 1 Human genes 0.000 description 1
- 102100031181 Glyceraldehyde-3-phosphate dehydrogenase Human genes 0.000 description 1
- 108010051975 Glycogen Synthase Kinase 3 beta Proteins 0.000 description 1
- 102100038104 Glycogen synthase kinase-3 beta Human genes 0.000 description 1
- 102100034551 Glycolipid transfer protein Human genes 0.000 description 1
- 101710094738 Glycolipid transfer protein Proteins 0.000 description 1
- 102100037825 Glycosaminoglycan xylosylkinase Human genes 0.000 description 1
- 102100036716 Glycosylphosphatidylinositol anchor attachment 1 protein Human genes 0.000 description 1
- 102100026256 Glycosylphosphatidylinositol-anchored high density lipoprotein-binding protein 1 Human genes 0.000 description 1
- 102100028698 Glycosyltransferase 8 domain-containing protein 1 Human genes 0.000 description 1
- 102100037474 Glycosyltransferase-like domain-containing protein 1 Human genes 0.000 description 1
- 102100023122 Glycylpeptide N-tetradecanoyltransferase 2 Human genes 0.000 description 1
- 102100025989 Glyoxalase domain-containing protein 4 Human genes 0.000 description 1
- 102100030648 Glyoxylate reductase/hydroxypyruvate reductase Human genes 0.000 description 1
- 102100023324 Golgi SNAP receptor complex member 1 Human genes 0.000 description 1
- 102100024013 Golgi SNAP receptor complex member 2 Human genes 0.000 description 1
- 102100031340 Golgi apparatus membrane protein TVP23 homolog B Human genes 0.000 description 1
- 102100034223 Golgi apparatus protein 1 Human genes 0.000 description 1
- 102100021182 Golgi integral membrane protein 4 Human genes 0.000 description 1
- 102100021181 Golgi phosphoprotein 3 Human genes 0.000 description 1
- 102100036700 Golgi reassembly-stacking protein 2 Human genes 0.000 description 1
- 102100040000 Golgi to ER traffic protein 4 homolog Human genes 0.000 description 1
- 102100036675 Golgi-associated PDZ and coiled-coil motif-containing protein Human genes 0.000 description 1
- 102100021613 Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Human genes 0.000 description 1
- 102100033325 Golgi-specific brefeldin A-resistance guanine nucleotide exchange factor 1 Human genes 0.000 description 1
- 102100032564 Golgin subfamily A member 2 Human genes 0.000 description 1
- 102100032565 Golgin subfamily A member 3 Human genes 0.000 description 1
- 102100032560 Golgin subfamily A member 4 Human genes 0.000 description 1
- 102100041032 Golgin subfamily A member 5 Human genes 0.000 description 1
- 102100041036 Golgin subfamily A member 7 Human genes 0.000 description 1
- 102100041033 Golgin subfamily B member 1 Human genes 0.000 description 1
- 102100033505 Granule associated Rac and RHOG effector protein 1 Human genes 0.000 description 1
- 101150090959 Grb10 gene Proteins 0.000 description 1
- 102100023910 Growth factor receptor-bound protein 10 Human genes 0.000 description 1
- 102100040017 Growth hormone-inducible transmembrane protein Human genes 0.000 description 1
- 102100029301 Guanine nucleotide exchange factor C9orf72 Human genes 0.000 description 1
- 102100027675 Guanine nucleotide exchange factor subunit RIC1 Human genes 0.000 description 1
- 102100035354 Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-1 Human genes 0.000 description 1
- 102100035341 Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-2 Human genes 0.000 description 1
- 102100034264 Guanine nucleotide-binding protein G(i) subunit alpha-3 Human genes 0.000 description 1
- 102100025334 Guanine nucleotide-binding protein G(q) subunit alpha Human genes 0.000 description 1
- 102100032610 Guanine nucleotide-binding protein G(s) subunit alpha isoforms XLas Human genes 0.000 description 1
- 102100036703 Guanine nucleotide-binding protein subunit alpha-13 Human genes 0.000 description 1
- 102100021185 Guanine nucleotide-binding protein-like 3 Human genes 0.000 description 1
- 102100021187 Guanine nucleotide-binding protein-like 3-like protein Human genes 0.000 description 1
- 102100040468 Guanylate kinase Human genes 0.000 description 1
- 102100034058 Gypsy retrotransposon integrase-like protein 1 Human genes 0.000 description 1
- 102100034477 H(+)/Cl(-) exchange transporter 3 Human genes 0.000 description 1
- 102100034473 H(+)/Cl(-) exchange transporter 6 Human genes 0.000 description 1
- 102100028685 H(+)/Cl(-) exchange transporter 7 Human genes 0.000 description 1
- 102100034411 H/ACA ribonucleoprotein complex subunit 2 Human genes 0.000 description 1
- 102100031249 H/ACA ribonucleoprotein complex subunit DKC1 Human genes 0.000 description 1
- 102100039333 HAUS augmin-like complex subunit 2 Human genes 0.000 description 1
- 102100039336 HAUS augmin-like complex subunit 4 Human genes 0.000 description 1
- 102100039318 HAUS augmin-like complex subunit 6 Human genes 0.000 description 1
- 102100039321 HAUS augmin-like complex subunit 7 Human genes 0.000 description 1
- 102100027377 HBS1-like protein Human genes 0.000 description 1
- 102100034445 HCLS1-associated protein X-1 Human genes 0.000 description 1
- 102100028490 HEAT repeat-containing protein 5A Human genes 0.000 description 1
- 102100035944 HERV-H LTR-associating protein 3 Human genes 0.000 description 1
- 102100032812 HIG1 domain family member 1A, mitochondrial Human genes 0.000 description 1
- 102100031610 HIRA-interacting protein 3 Human genes 0.000 description 1
- 102100028151 HMG domain-containing protein 3 Human genes 0.000 description 1
- 102100028150 HMG domain-containing protein 4 Human genes 0.000 description 1
- 108010001860 HMGB Proteins Proteins 0.000 description 1
- 102000000849 HMGB Proteins Human genes 0.000 description 1
- 101150112743 HSPA5 gene Proteins 0.000 description 1
- 101150106066 HSPBP1 gene Proteins 0.000 description 1
- 102100034680 Haloacid dehalogenase-like hydrolase domain-containing 5 Human genes 0.000 description 1
- 102100021410 Heat shock 70 kDa protein 14 Human genes 0.000 description 1
- 102100028765 Heat shock 70 kDa protein 4 Human genes 0.000 description 1
- 102100027421 Heat shock cognate 71 kDa protein Human genes 0.000 description 1
- 102100032606 Heat shock factor protein 1 Human genes 0.000 description 1
- 102100027529 Heat shock factor-binding protein 1 Human genes 0.000 description 1
- 102100032510 Heat shock protein HSP 90-beta Human genes 0.000 description 1
- 102100023158 Helicase ARIP4 Human genes 0.000 description 1
- 102100029977 Helicase SKI2W Human genes 0.000 description 1
- 102100031880 Helicase SRCAP Human genes 0.000 description 1
- 102100028008 Heme oxygenase 2 Human genes 0.000 description 1
- 102100027618 Heme transporter HRG1 Human genes 0.000 description 1
- 102100031497 Heparan sulfate N-sulfotransferase 1 Human genes 0.000 description 1
- 102100031496 Heparan sulfate N-sulfotransferase 2 Human genes 0.000 description 1
- 102100039383 Heparan-sulfate 6-O-sulfotransferase 1 Human genes 0.000 description 1
- 102100031000 Hepatoma-derived growth factor Human genes 0.000 description 1
- 102100031001 Hepatoma-derived growth factor-related protein 2 Human genes 0.000 description 1
- 102100028902 Hermansky-Pudlak syndrome 1 protein Human genes 0.000 description 1
- 102100037848 Heterochromatin protein 1-binding protein 3 Human genes 0.000 description 1
- 102100035617 Heterogeneous nuclear ribonucleoprotein A/B Human genes 0.000 description 1
- 102100027706 Heterogeneous nuclear ribonucleoprotein D-like Human genes 0.000 description 1
- 102100033985 Heterogeneous nuclear ribonucleoprotein D0 Human genes 0.000 description 1
- 102100034000 Heterogeneous nuclear ribonucleoprotein F Human genes 0.000 description 1
- 102100027738 Heterogeneous nuclear ribonucleoprotein H Human genes 0.000 description 1
- 102100027703 Heterogeneous nuclear ribonucleoprotein H2 Human genes 0.000 description 1
- 102100033997 Heterogeneous nuclear ribonucleoprotein H3 Human genes 0.000 description 1
- 102100028909 Heterogeneous nuclear ribonucleoprotein K Human genes 0.000 description 1
- 102100028818 Heterogeneous nuclear ribonucleoprotein L Human genes 0.000 description 1
- 102100033993 Heterogeneous nuclear ribonucleoprotein L-like Human genes 0.000 description 1
- 102100028895 Heterogeneous nuclear ribonucleoprotein M Human genes 0.000 description 1
- 102100028896 Heterogeneous nuclear ribonucleoprotein Q Human genes 0.000 description 1
- 102100023999 Heterogeneous nuclear ribonucleoprotein R Human genes 0.000 description 1
- 102100024002 Heterogeneous nuclear ribonucleoprotein U Human genes 0.000 description 1
- 102100033999 Heterogeneous nuclear ribonucleoprotein U-like protein 2 Human genes 0.000 description 1
- 102100033994 Heterogeneous nuclear ribonucleoproteins C1/C2 Human genes 0.000 description 1
- 102100024228 High affinity cAMP-specific and IBMX-insensitive 3',5'-cyclic phosphodiesterase 8A Human genes 0.000 description 1
- 102100031336 High mobility group nucleosome-binding domain-containing protein 3 Human genes 0.000 description 1
- 102100031004 Histidine-tRNA ligase, cytoplasmic Human genes 0.000 description 1
- 102100030673 Histone H2A.V Human genes 0.000 description 1
- 102100023919 Histone H2A.Z Human genes 0.000 description 1
- 102100034533 Histone H2AX Human genes 0.000 description 1
- 102100030690 Histone H2B type 1-C/E/F/G/I Human genes 0.000 description 1
- 102100030445 Histone H4 transcription factor Human genes 0.000 description 1
- 102100024023 Histone PARylation factor 1 Human genes 0.000 description 1
- 102100022823 Histone RNA hairpin-binding protein Human genes 0.000 description 1
- 102100022846 Histone acetyltransferase KAT2B Human genes 0.000 description 1
- 102100022893 Histone acetyltransferase KAT5 Human genes 0.000 description 1
- 102100033071 Histone acetyltransferase KAT6A Human genes 0.000 description 1
- 102100033070 Histone acetyltransferase KAT6B Human genes 0.000 description 1
- 102100033068 Histone acetyltransferase KAT7 Human genes 0.000 description 1
- 102100038885 Histone acetyltransferase p300 Human genes 0.000 description 1
- 102100021467 Histone acetyltransferase type B catalytic subunit Human genes 0.000 description 1
- 102100032838 Histone chaperone ASF1A Human genes 0.000 description 1
- 102100039999 Histone deacetylase 2 Human genes 0.000 description 1
- 102100021455 Histone deacetylase 3 Human genes 0.000 description 1
- 102100022537 Histone deacetylase 6 Human genes 0.000 description 1
- 102100038715 Histone deacetylase 8 Human genes 0.000 description 1
- 102100025539 Histone deacetylase complex subunit SAP18 Human genes 0.000 description 1
- 102100023357 Histone deacetylase complex subunit SAP30 Human genes 0.000 description 1
- 102100025190 Histone-binding protein RBBP4 Human genes 0.000 description 1
- 102100023584 Histone-binding protein RBBP7 Human genes 0.000 description 1
- 102100035043 Histone-lysine N-methyltransferase EHMT1 Human genes 0.000 description 1
- 102100035042 Histone-lysine N-methyltransferase EHMT2 Human genes 0.000 description 1
- 102100027770 Histone-lysine N-methyltransferase KMT5B Human genes 0.000 description 1
- 102100029234 Histone-lysine N-methyltransferase NSD2 Human genes 0.000 description 1
- 102100029768 Histone-lysine N-methyltransferase SETD1A Human genes 0.000 description 1
- 102100030095 Histone-lysine N-methyltransferase SETD1B Human genes 0.000 description 1
- 102100032742 Histone-lysine N-methyltransferase SETD2 Human genes 0.000 description 1
- 102100027711 Histone-lysine N-methyltransferase SETD5 Human genes 0.000 description 1
- 102100023696 Histone-lysine N-methyltransferase SETDB1 Human genes 0.000 description 1
- 102100023676 Histone-lysine N-methyltransferase SETDB2 Human genes 0.000 description 1
- 102100032804 Histone-lysine N-methyltransferase SMYD3 Human genes 0.000 description 1
- 102100028998 Histone-lysine N-methyltransferase SUV39H1 Human genes 0.000 description 1
- 102100025663 Histone-lysine N-trimethyltransferase SMYD5 Human genes 0.000 description 1
- 102100027893 Homeobox protein Nkx-2.1 Human genes 0.000 description 1
- 102100030234 Homeobox protein cut-like 1 Human genes 0.000 description 1
- 102100028171 Homeobox-containing protein 1 Human genes 0.000 description 1
- 102100032826 Homeodomain-interacting protein kinase 3 Human genes 0.000 description 1
- 102100023603 Homer protein homolog 3 Human genes 0.000 description 1
- 101000605576 Homo sapiens 1-acyl-sn-glycerol-3-phosphate acyltransferase gamma Proteins 0.000 description 1
- 101000929840 Homo sapiens 1-acylglycerol-3-phosphate O-acyltransferase ABHD5 Proteins 0.000 description 1
- 101000605587 Homo sapiens 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1 Proteins 0.000 description 1
- 101000980303 Homo sapiens 10 kDa heat shock protein, mitochondrial Proteins 0.000 description 1
- 101000608799 Homo sapiens 116 kDa U5 small nuclear ribonucleoprotein component Proteins 0.000 description 1
- 101001013578 Homo sapiens 12S rRNA N4-methylcytidine (m4C) methyltransferase Proteins 0.000 description 1
- 101000818893 Homo sapiens 14-3-3 protein beta/alpha Proteins 0.000 description 1
- 101000760079 Homo sapiens 14-3-3 protein epsilon Proteins 0.000 description 1
- 101000723517 Homo sapiens 14-3-3 protein gamma Proteins 0.000 description 1
- 101000723543 Homo sapiens 14-3-3 protein theta Proteins 0.000 description 1
- 101000964898 Homo sapiens 14-3-3 protein zeta/delta Proteins 0.000 description 1
- 101000806242 Homo sapiens 17-beta-hydroxysteroid dehydrogenase type 1 Proteins 0.000 description 1
- 101000795618 Homo sapiens 18S rRNA aminocarboxypropyltransferase Proteins 0.000 description 1
- 101001041661 Homo sapiens 2,4-dienoyl-CoA reductase [(3E)-enoyl-CoA-producing], mitochondrial Proteins 0.000 description 1
- 101000866191 Homo sapiens 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Proteins 0.000 description 1
- 101000909233 Homo sapiens 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Proteins 0.000 description 1
- 101001009252 Homo sapiens 2-hydroxyacyl-CoA lyase 1 Proteins 0.000 description 1
- 101001009238 Homo sapiens 2-hydroxyacyl-CoA lyase 2 Proteins 0.000 description 1
- 101000934666 Homo sapiens 2-oxoglutarate and iron-dependent oxygenase JMJD4 Proteins 0.000 description 1
- 101000982656 Homo sapiens 2-oxoglutarate dehydrogenase, mitochondrial Proteins 0.000 description 1
- 101000597665 Homo sapiens 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial Proteins 0.000 description 1
- 101000597680 Homo sapiens 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial Proteins 0.000 description 1
- 101001136581 Homo sapiens 26S proteasome non-ATPase regulatory subunit 10 Proteins 0.000 description 1
- 101000612519 Homo sapiens 26S proteasome non-ATPase regulatory subunit 11 Proteins 0.000 description 1
- 101000612528 Homo sapiens 26S proteasome non-ATPase regulatory subunit 12 Proteins 0.000 description 1
- 101000612536 Homo sapiens 26S proteasome non-ATPase regulatory subunit 13 Proteins 0.000 description 1
- 101000590281 Homo sapiens 26S proteasome non-ATPase regulatory subunit 14 Proteins 0.000 description 1
- 101000590224 Homo sapiens 26S proteasome non-ATPase regulatory subunit 3 Proteins 0.000 description 1
- 101001135231 Homo sapiens 26S proteasome non-ATPase regulatory subunit 4 Proteins 0.000 description 1
- 101001135226 Homo sapiens 26S proteasome non-ATPase regulatory subunit 5 Proteins 0.000 description 1
- 101001135306 Homo sapiens 26S proteasome non-ATPase regulatory subunit 6 Proteins 0.000 description 1
- 101001136696 Homo sapiens 26S proteasome non-ATPase regulatory subunit 7 Proteins 0.000 description 1
- 101001136717 Homo sapiens 26S proteasome non-ATPase regulatory subunit 8 Proteins 0.000 description 1
- 101001136710 Homo sapiens 26S proteasome non-ATPase regulatory subunit 9 Proteins 0.000 description 1
- 101001069718 Homo sapiens 26S proteasome regulatory subunit 10B Proteins 0.000 description 1
- 101000619137 Homo sapiens 26S proteasome regulatory subunit 4 Proteins 0.000 description 1
- 101001125540 Homo sapiens 26S proteasome regulatory subunit 6A Proteins 0.000 description 1
- 101001125524 Homo sapiens 26S proteasome regulatory subunit 6B Proteins 0.000 description 1
- 101001090865 Homo sapiens 26S proteasome regulatory subunit 7 Proteins 0.000 description 1
- 101001136753 Homo sapiens 26S proteasome regulatory subunit 8 Proteins 0.000 description 1
- 101001035654 Homo sapiens 28 kDa heat- and acid-stable phosphoprotein Proteins 0.000 description 1
- 101001108583 Homo sapiens 28S rRNA (cytosine-C(5))-methyltransferase Proteins 0.000 description 1
- 101000635698 Homo sapiens 28S ribosomal protein S16, mitochondrial Proteins 0.000 description 1
- 101000639839 Homo sapiens 28S ribosomal protein S18b, mitochondrial Proteins 0.000 description 1
- 101000694321 Homo sapiens 28S ribosomal protein S18c, mitochondrial Proteins 0.000 description 1
- 101000636137 Homo sapiens 28S ribosomal protein S2, mitochondrial Proteins 0.000 description 1
- 101000699884 Homo sapiens 28S ribosomal protein S23, mitochondrial Proteins 0.000 description 1
- 101000727455 Homo sapiens 28S ribosomal protein S27, mitochondrial Proteins 0.000 description 1
- 101000727490 Homo sapiens 28S ribosomal protein S29, mitochondrial Proteins 0.000 description 1
- 101000689847 Homo sapiens 28S ribosomal protein S31, mitochondrial Proteins 0.000 description 1
- 101000689828 Homo sapiens 28S ribosomal protein S33, mitochondrial Proteins 0.000 description 1
- 101001094504 Homo sapiens 28S ribosomal protein S7, mitochondrial Proteins 0.000 description 1
- 101001035740 Homo sapiens 3-hydroxyacyl-CoA dehydrogenase type-2 Proteins 0.000 description 1
- 101000872461 Homo sapiens 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial Proteins 0.000 description 1
- 101001050680 Homo sapiens 3-ketodihydrosphingosine reductase Proteins 0.000 description 1
- 101001098439 Homo sapiens 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial Proteins 0.000 description 1
- 101000600756 Homo sapiens 3-phosphoinositide-dependent protein kinase 1 Proteins 0.000 description 1
- 101000854451 Homo sapiens 39S ribosomal protein L11, mitochondrial Proteins 0.000 description 1
- 101000691538 Homo sapiens 39S ribosomal protein L12, mitochondrial Proteins 0.000 description 1
- 101000691550 Homo sapiens 39S ribosomal protein L13, mitochondrial Proteins 0.000 description 1
- 101000733945 Homo sapiens 39S ribosomal protein L15, mitochondrial Proteins 0.000 description 1
- 101000650310 Homo sapiens 39S ribosomal protein L16, mitochondrial Proteins 0.000 description 1
- 101001079807 Homo sapiens 39S ribosomal protein L18, mitochondrial Proteins 0.000 description 1
- 101001079803 Homo sapiens 39S ribosomal protein L19, mitochondrial Proteins 0.000 description 1
- 101000670366 Homo sapiens 39S ribosomal protein L2, mitochondrial Proteins 0.000 description 1
- 101000711436 Homo sapiens 39S ribosomal protein L22, mitochondrial Proteins 0.000 description 1
- 101000667433 Homo sapiens 39S ribosomal protein L27, mitochondrial Proteins 0.000 description 1
- 101000670350 Homo sapiens 39S ribosomal protein L3, mitochondrial Proteins 0.000 description 1
- 101000670355 Homo sapiens 39S ribosomal protein L33, mitochondrial Proteins 0.000 description 1
- 101000854456 Homo sapiens 39S ribosomal protein L35, mitochondrial Proteins 0.000 description 1
- 101000650303 Homo sapiens 39S ribosomal protein L37, mitochondrial Proteins 0.000 description 1
- 101001104233 Homo sapiens 39S ribosomal protein L39, mitochondrial Proteins 0.000 description 1
- 101000667416 Homo sapiens 39S ribosomal protein L4, mitochondrial Proteins 0.000 description 1
- 101001104236 Homo sapiens 39S ribosomal protein L40, mitochondrial Proteins 0.000 description 1
- 101001104225 Homo sapiens 39S ribosomal protein L41, mitochondrial Proteins 0.000 description 1
- 101000711517 Homo sapiens 39S ribosomal protein L42, mitochondrial Proteins 0.000 description 1
- 101000733907 Homo sapiens 39S ribosomal protein L48, mitochondrial Proteins 0.000 description 1
- 101000733904 Homo sapiens 39S ribosomal protein L49, mitochondrial Proteins 0.000 description 1
- 101001106921 Homo sapiens 39S ribosomal protein L51, mitochondrial Proteins 0.000 description 1
- 101000639842 Homo sapiens 39S ribosomal protein S18a, mitochondrial Proteins 0.000 description 1
- 101000689854 Homo sapiens 39S ribosomal protein S30, mitochondrial Proteins 0.000 description 1
- 101000725614 Homo sapiens 4-hydroxybenzoate polyprenyltransferase, mitochondrial Proteins 0.000 description 1
- 101000836407 Homo sapiens 4-trimethylaminobutyraldehyde dehydrogenase Proteins 0.000 description 1
- 101001119215 Homo sapiens 40S ribosomal protein S11 Proteins 0.000 description 1
- 101000718313 Homo sapiens 40S ribosomal protein S13 Proteins 0.000 description 1
- 101000706746 Homo sapiens 40S ribosomal protein S16 Proteins 0.000 description 1
- 101001114932 Homo sapiens 40S ribosomal protein S20 Proteins 0.000 description 1
- 101001097814 Homo sapiens 40S ribosomal protein S21 Proteins 0.000 description 1
- 101001097953 Homo sapiens 40S ribosomal protein S23 Proteins 0.000 description 1
- 101000656669 Homo sapiens 40S ribosomal protein S24 Proteins 0.000 description 1
- 101000678929 Homo sapiens 40S ribosomal protein S25 Proteins 0.000 description 1
- 101000731896 Homo sapiens 40S ribosomal protein S27-like Proteins 0.000 description 1
- 101000732165 Homo sapiens 40S ribosomal protein S4, X isoform Proteins 0.000 description 1
- 101000622644 Homo sapiens 40S ribosomal protein S5 Proteins 0.000 description 1
- 101000656896 Homo sapiens 40S ribosomal protein S6 Proteins 0.000 description 1
- 101000690200 Homo sapiens 40S ribosomal protein S7 Proteins 0.000 description 1
- 101000657066 Homo sapiens 40S ribosomal protein S9 Proteins 0.000 description 1
- 101000899406 Homo sapiens 45 kDa calcium-binding protein Proteins 0.000 description 1
- 101000591192 Homo sapiens 5'(3')-deoxyribonucleotidase, cytosolic type Proteins 0.000 description 1
- 101001074389 Homo sapiens 5'-3' exonuclease PLD3 Proteins 0.000 description 1
- 101000804879 Homo sapiens 5'-3' exoribonuclease 1 Proteins 0.000 description 1
- 101000745788 Homo sapiens 5'-3' exoribonuclease 2 Proteins 0.000 description 1
- 101000760992 Homo sapiens 5'-AMP-activated protein kinase subunit gamma-1 Proteins 0.000 description 1
- 101000895045 Homo sapiens 5-azacytidine-induced protein 2 Proteins 0.000 description 1
- 101001113900 Homo sapiens 52 kDa repressor of the inhibitor of the protein kinase Proteins 0.000 description 1
- 101000883686 Homo sapiens 60 kDa heat shock protein, mitochondrial Proteins 0.000 description 1
- 101000603190 Homo sapiens 60S ribosomal export protein NMD3 Proteins 0.000 description 1
- 101001108634 Homo sapiens 60S ribosomal protein L10 Proteins 0.000 description 1
- 101000755323 Homo sapiens 60S ribosomal protein L10a Proteins 0.000 description 1
- 101001073740 Homo sapiens 60S ribosomal protein L11 Proteins 0.000 description 1
- 101000681240 Homo sapiens 60S ribosomal protein L13a Proteins 0.000 description 1
- 101000704267 Homo sapiens 60S ribosomal protein L14 Proteins 0.000 description 1
- 101000682512 Homo sapiens 60S ribosomal protein L17 Proteins 0.000 description 1
- 101001105789 Homo sapiens 60S ribosomal protein L19 Proteins 0.000 description 1
- 101001097555 Homo sapiens 60S ribosomal protein L22 Proteins 0.000 description 1
- 101000661567 Homo sapiens 60S ribosomal protein L22-like 1 Proteins 0.000 description 1
- 101000675833 Homo sapiens 60S ribosomal protein L23 Proteins 0.000 description 1
- 101001115494 Homo sapiens 60S ribosomal protein L23a Proteins 0.000 description 1
- 101000660926 Homo sapiens 60S ribosomal protein L24 Proteins 0.000 description 1
- 101001080179 Homo sapiens 60S ribosomal protein L26 Proteins 0.000 description 1
- 101001080152 Homo sapiens 60S ribosomal protein L26-like 1 Proteins 0.000 description 1
- 101000719728 Homo sapiens 60S ribosomal protein L27 Proteins 0.000 description 1
- 101000753696 Homo sapiens 60S ribosomal protein L27a Proteins 0.000 description 1
- 101000676271 Homo sapiens 60S ribosomal protein L28 Proteins 0.000 description 1
- 101001101319 Homo sapiens 60S ribosomal protein L30 Proteins 0.000 description 1
- 101001113162 Homo sapiens 60S ribosomal protein L31 Proteins 0.000 description 1
- 101000672453 Homo sapiens 60S ribosomal protein L32 Proteins 0.000 description 1
- 101000672659 Homo sapiens 60S ribosomal protein L34 Proteins 0.000 description 1
- 101000715818 Homo sapiens 60S ribosomal protein L35 Proteins 0.000 description 1
- 101001110988 Homo sapiens 60S ribosomal protein L35a Proteins 0.000 description 1
- 101001127258 Homo sapiens 60S ribosomal protein L36a-like Proteins 0.000 description 1
- 101001092424 Homo sapiens 60S ribosomal protein L37a Proteins 0.000 description 1
- 101000691083 Homo sapiens 60S ribosomal protein L5 Proteins 0.000 description 1
- 101000673524 Homo sapiens 60S ribosomal protein L6 Proteins 0.000 description 1
- 101000853243 Homo sapiens 60S ribosomal protein L7a Proteins 0.000 description 1
- 101000853659 Homo sapiens 60S ribosomal protein L8 Proteins 0.000 description 1
- 101001125072 Homo sapiens 60S ribosome subunit biogenesis protein NIP7 homolog Proteins 0.000 description 1
- 101000774717 Homo sapiens A-kinase anchor protein 1, mitochondrial Proteins 0.000 description 1
- 101000779365 Homo sapiens A-kinase anchor protein 10, mitochondrial Proteins 0.000 description 1
- 101000774725 Homo sapiens A-kinase anchor protein 7 isoform gamma Proteins 0.000 description 1
- 101000774727 Homo sapiens A-kinase anchor protein 7 isoforms alpha and beta Proteins 0.000 description 1
- 101000890594 Homo sapiens A-kinase anchor protein 8 Proteins 0.000 description 1
- 101000833668 Homo sapiens A-kinase anchor protein 8-like Proteins 0.000 description 1
- 101000890598 Homo sapiens A-kinase anchor protein 9 Proteins 0.000 description 1
- 101000959553 Homo sapiens A-kinase-interacting protein 1 Proteins 0.000 description 1
- 101001107832 Homo sapiens ADP-ribose pyrophosphatase, mitochondrial Proteins 0.000 description 1
- 101000684189 Homo sapiens ADP-ribosylation factor 4 Proteins 0.000 description 1
- 101000684206 Homo sapiens ADP-ribosylation factor 5 Proteins 0.000 description 1
- 101000927511 Homo sapiens ADP-ribosylation factor GTPase-activating protein 2 Proteins 0.000 description 1
- 101000927505 Homo sapiens ADP-ribosylation factor GTPase-activating protein 3 Proteins 0.000 description 1
- 101001037082 Homo sapiens ADP-ribosylation factor-binding protein GGA2 Proteins 0.000 description 1
- 101001037079 Homo sapiens ADP-ribosylation factor-binding protein GGA3 Proteins 0.000 description 1
- 101000974500 Homo sapiens ADP-ribosylation factor-like protein 1 Proteins 0.000 description 1
- 101000757620 Homo sapiens ADP-ribosylation factor-like protein 13B Proteins 0.000 description 1
- 101000974510 Homo sapiens ADP-ribosylation factor-like protein 16 Proteins 0.000 description 1
- 101000757692 Homo sapiens ADP-ribosylation factor-like protein 2-binding protein Proteins 0.000 description 1
- 101000886004 Homo sapiens ADP-ribosylation factor-like protein 3 Proteins 0.000 description 1
- 101000974441 Homo sapiens ADP-ribosylation factor-like protein 5A Proteins 0.000 description 1
- 101000793548 Homo sapiens ADP-ribosylation factor-like protein 6-interacting protein 4 Proteins 0.000 description 1
- 101000769035 Homo sapiens ADP-ribosylation factor-like protein 8A Proteins 0.000 description 1
- 101000780532 Homo sapiens ADP-ribosylhydrolase ARH1 Proteins 0.000 description 1
- 101000833118 Homo sapiens ADP-ribosylhydrolase ARH3 Proteins 0.000 description 1
- 101000833170 Homo sapiens AF4/FMR2 family member 4 Proteins 0.000 description 1
- 101000780591 Homo sapiens AFG3-like protein 2 Proteins 0.000 description 1
- 101000718065 Homo sapiens AKT-interacting protein Proteins 0.000 description 1
- 101000719174 Homo sapiens AMMECR1-like protein Proteins 0.000 description 1
- 101000964570 Homo sapiens AN1-type zinc finger protein 1 Proteins 0.000 description 1
- 101000744894 Homo sapiens AN1-type zinc finger protein 2B Proteins 0.000 description 1
- 101000782077 Homo sapiens AN1-type zinc finger protein 5 Proteins 0.000 description 1
- 101000782083 Homo sapiens AN1-type zinc finger protein 6 Proteins 0.000 description 1
- 101000779222 Homo sapiens AP-1 complex subunit beta-1 Proteins 0.000 description 1
- 101000779234 Homo sapiens AP-1 complex subunit gamma-1 Proteins 0.000 description 1
- 101000924643 Homo sapiens AP-1 complex subunit mu-1 Proteins 0.000 description 1
- 101000768000 Homo sapiens AP-1 complex subunit sigma-1A Proteins 0.000 description 1
- 101000757299 Homo sapiens AP-2 complex subunit alpha-1 Proteins 0.000 description 1
- 101000757394 Homo sapiens AP-2 complex subunit alpha-2 Proteins 0.000 description 1
- 101000732341 Homo sapiens AP-2 complex subunit beta Proteins 0.000 description 1
- 101000796047 Homo sapiens AP-2 complex subunit mu Proteins 0.000 description 1
- 101000779239 Homo sapiens AP-3 complex subunit beta-1 Proteins 0.000 description 1
- 101000779252 Homo sapiens AP-3 complex subunit delta-1 Proteins 0.000 description 1
- 101000959726 Homo sapiens AP-3 complex subunit mu-1 Proteins 0.000 description 1
- 101000959710 Homo sapiens AP-3 complex subunit sigma-1 Proteins 0.000 description 1
- 101000690135 Homo sapiens AP-4 complex accessory subunit RUSC1 Proteins 0.000 description 1
- 101000690059 Homo sapiens AP-4 complex accessory subunit RUSC2 Proteins 0.000 description 1
- 101000928581 Homo sapiens AP-4 complex subunit beta-1 Proteins 0.000 description 1
- 101000928557 Homo sapiens AP-4 complex subunit epsilon-1 Proteins 0.000 description 1
- 101000928565 Homo sapiens AP-4 complex subunit mu-1 Proteins 0.000 description 1
- 101000890195 Homo sapiens AP-5 complex subunit zeta-1 Proteins 0.000 description 1
- 101000742699 Homo sapiens AP2-associated protein kinase 1 Proteins 0.000 description 1
- 101100323521 Homo sapiens APOL1 gene Proteins 0.000 description 1
- 101000888642 Homo sapiens ARF GTPase-activating protein GIT2 Proteins 0.000 description 1
- 101000924255 Homo sapiens AT-rich interactive domain-containing protein 1B Proteins 0.000 description 1
- 101000792933 Homo sapiens AT-rich interactive domain-containing protein 4A Proteins 0.000 description 1
- 101000792935 Homo sapiens AT-rich interactive domain-containing protein 4B Proteins 0.000 description 1
- 101000902754 Homo sapiens ATM interactor Proteins 0.000 description 1
- 101000905623 Homo sapiens ATP synthase F(0) complex subunit B1, mitochondrial Proteins 0.000 description 1
- 101000905799 Homo sapiens ATP synthase F(0) complex subunit C1, mitochondrial Proteins 0.000 description 1
- 101000905797 Homo sapiens ATP synthase F(0) complex subunit C2, mitochondrial Proteins 0.000 description 1
- 101000974901 Homo sapiens ATP synthase F(0) complex subunit C3, mitochondrial Proteins 0.000 description 1
- 101000937382 Homo sapiens ATP synthase membrane subunit K, mitochondrial Proteins 0.000 description 1
- 101000789413 Homo sapiens ATP synthase mitochondrial F1 complex assembly factor 1 Proteins 0.000 description 1
- 101000727900 Homo sapiens ATP synthase subunit ATP5MJ, mitochondrial Proteins 0.000 description 1
- 101000833848 Homo sapiens ATP synthase subunit C lysine N-methyltransferase Proteins 0.000 description 1
- 101000936262 Homo sapiens ATP synthase subunit alpha, mitochondrial Proteins 0.000 description 1
- 101000903027 Homo sapiens ATP synthase subunit beta, mitochondrial Proteins 0.000 description 1
- 101000936976 Homo sapiens ATP synthase subunit d, mitochondrial Proteins 0.000 description 1
- 101000766510 Homo sapiens ATP synthase subunit delta, mitochondrial Proteins 0.000 description 1
- 101000936958 Homo sapiens ATP synthase subunit e, mitochondrial Proteins 0.000 description 1
- 101000765664 Homo sapiens ATP synthase subunit f, mitochondrial Proteins 0.000 description 1
- 101000936950 Homo sapiens ATP synthase subunit g, mitochondrial Proteins 0.000 description 1
- 101000730170 Homo sapiens ATP synthase subunit gamma, mitochondrial Proteins 0.000 description 1
- 101000701311 Homo sapiens ATP synthase subunit s, mitochondrial Proteins 0.000 description 1
- 101000936965 Homo sapiens ATP synthase-coupling factor 6, mitochondrial Proteins 0.000 description 1
- 101000724360 Homo sapiens ATP-binding cassette sub-family B member 10, mitochondrial Proteins 0.000 description 1
- 101001029059 Homo sapiens ATP-binding cassette sub-family C member 10 Proteins 0.000 description 1
- 101000986622 Homo sapiens ATP-binding cassette sub-family C member 5 Proteins 0.000 description 1
- 101000783770 Homo sapiens ATP-binding cassette sub-family D member 3 Proteins 0.000 description 1
- 101000783783 Homo sapiens ATP-binding cassette sub-family F member 1 Proteins 0.000 description 1
- 101000823289 Homo sapiens ATP-binding cassette sub-family F member 2 Proteins 0.000 description 1
- 101000782969 Homo sapiens ATP-citrate synthase Proteins 0.000 description 1
- 101001124829 Homo sapiens ATP-dependent (S)-NAD(P)H-hydrate dehydratase Proteins 0.000 description 1
- 101000730830 Homo sapiens ATP-dependent 6-phosphofructokinase, liver type Proteins 0.000 description 1
- 101000902038 Homo sapiens ATP-dependent Clp protease ATP-binding subunit clpX-like, mitochondrial Proteins 0.000 description 1
- 101000750222 Homo sapiens ATP-dependent Clp protease proteolytic subunit, mitochondrial Proteins 0.000 description 1
- 101000580659 Homo sapiens ATP-dependent DNA helicase Q1 Proteins 0.000 description 1
- 101000743497 Homo sapiens ATP-dependent DNA helicase Q5 Proteins 0.000 description 1
- 101000901942 Homo sapiens ATP-dependent DNA/RNA helicase DHX36 Proteins 0.000 description 1
- 101000864670 Homo sapiens ATP-dependent RNA helicase A Proteins 0.000 description 1
- 101001041697 Homo sapiens ATP-dependent RNA helicase DDX1 Proteins 0.000 description 1
- 101001041703 Homo sapiens ATP-dependent RNA helicase DDX18 Proteins 0.000 description 1
- 101000830477 Homo sapiens ATP-dependent RNA helicase DDX19B Proteins 0.000 description 1
- 101000870662 Homo sapiens ATP-dependent RNA helicase DDX3X Proteins 0.000 description 1
- 101000874173 Homo sapiens ATP-dependent RNA helicase DDX42 Proteins 0.000 description 1
- 101000883804 Homo sapiens ATP-dependent RNA helicase DDX54 Proteins 0.000 description 1
- 101000907886 Homo sapiens ATP-dependent RNA helicase DHX15 Proteins 0.000 description 1
- 101000901948 Homo sapiens ATP-dependent RNA helicase DHX30 Proteins 0.000 description 1
- 101000901934 Homo sapiens ATP-dependent RNA helicase DHX33 Proteins 0.000 description 1
- 101000864666 Homo sapiens ATP-dependent RNA helicase DHX8 Proteins 0.000 description 1
- 101000696694 Homo sapiens ATP-dependent RNA helicase SUPV3L1, mitochondrial Proteins 0.000 description 1
- 101001047033 Homo sapiens ATP-sensitive inward rectifier potassium channel 14 Proteins 0.000 description 1
- 101001051808 Homo sapiens ATPase MORC2 Proteins 0.000 description 1
- 101000923353 Homo sapiens ATPase family AAA domain-containing protein 2B Proteins 0.000 description 1
- 101000923360 Homo sapiens ATPase family AAA domain-containing protein 3A Proteins 0.000 description 1
- 101000720055 Homo sapiens AarF domain-containing protein kinase 1 Proteins 0.000 description 1
- 101001006387 Homo sapiens Abasic site processing protein HMCES Proteins 0.000 description 1
- 101000961199 Homo sapiens Abscission/NoCut checkpoint regulator Proteins 0.000 description 1
- 101000837584 Homo sapiens Acetyl-CoA acetyltransferase, cytosolic Proteins 0.000 description 1
- 101000773358 Homo sapiens Acetyl-coenzyme A synthetase 2-like, mitochondrial Proteins 0.000 description 1
- 101000783232 Homo sapiens Acetyl-coenzyme A synthetase, cytoplasmic Proteins 0.000 description 1
- 101000936726 Homo sapiens Acid sphingomyelinase-like phosphodiesterase 3a Proteins 0.000 description 1
- 101001060527 Homo sapiens Acidic fibroblast growth factor intracellular-binding protein Proteins 0.000 description 1
- 101000757200 Homo sapiens Acidic leucine-rich nuclear phosphoprotein 32 family member A Proteins 0.000 description 1
- 101000732653 Homo sapiens Acidic leucine-rich nuclear phosphoprotein 32 family member B Proteins 0.000 description 1
- 101000732662 Homo sapiens Acidic leucine-rich nuclear phosphoprotein 32 family member C Proteins 0.000 description 1
- 101000732665 Homo sapiens Acidic leucine-rich nuclear phosphoprotein 32 family member E Proteins 0.000 description 1
- 101000965314 Homo sapiens Aconitate hydratase, mitochondrial Proteins 0.000 description 1
- 101000798882 Homo sapiens Actin-like protein 6A Proteins 0.000 description 1
- 101000806644 Homo sapiens Actin-related protein 2/3 complex subunit 1A Proteins 0.000 description 1
- 101000754220 Homo sapiens Actin-related protein 2/3 complex subunit 2 Proteins 0.000 description 1
- 101000925574 Homo sapiens Actin-related protein 2/3 complex subunit 3 Proteins 0.000 description 1
- 101000925566 Homo sapiens Actin-related protein 2/3 complex subunit 4 Proteins 0.000 description 1
- 101000928956 Homo sapiens Activated CDC42 kinase 1 Proteins 0.000 description 1
- 101000649017 Homo sapiens Activating signal cointegrator 1 Proteins 0.000 description 1
- 101000784207 Homo sapiens Activating signal cointegrator 1 complex subunit 1 Proteins 0.000 description 1
- 101000784204 Homo sapiens Activating signal cointegrator 1 complex subunit 2 Proteins 0.000 description 1
- 101000784211 Homo sapiens Activating signal cointegrator 1 complex subunit 3 Proteins 0.000 description 1
- 101000741919 Homo sapiens Activator of RNA decay Proteins 0.000 description 1
- 101000964349 Homo sapiens Activator of basal transcription 1 Proteins 0.000 description 1
- 101000799140 Homo sapiens Activin receptor type-1 Proteins 0.000 description 1
- 101000799189 Homo sapiens Activin receptor type-1B Proteins 0.000 description 1
- 101000970954 Homo sapiens Activin receptor type-2A Proteins 0.000 description 1
- 101000755474 Homo sapiens Activity-dependent neuroprotector homeobox protein Proteins 0.000 description 1
- 101000678845 Homo sapiens Acyl carrier protein, mitochondrial Proteins 0.000 description 1
- 101000782705 Homo sapiens Acyl-CoA-binding domain-containing protein 5 Proteins 0.000 description 1
- 101000594506 Homo sapiens Acyl-coenzyme A diphosphatase NUDT19 Proteins 0.000 description 1
- 101000678865 Homo sapiens Acyl-coenzyme A thioesterase 13 Proteins 0.000 description 1
- 101000720381 Homo sapiens Acyl-coenzyme A thioesterase 8 Proteins 0.000 description 1
- 101000720385 Homo sapiens Acyl-coenzyme A thioesterase 9, mitochondrial Proteins 0.000 description 1
- 101001038521 Homo sapiens Acyl-protein thioesterase 2 Proteins 0.000 description 1
- 101000798584 Homo sapiens Acylamino-acid-releasing enzyme Proteins 0.000 description 1
- 101000917337 Homo sapiens Acylpyruvase FAHD1, mitochondrial Proteins 0.000 description 1
- 101000979313 Homo sapiens Adaptin ear-binding coat-associated protein 1 Proteins 0.000 description 1
- 101001000351 Homo sapiens Adenine DNA glycosylase Proteins 0.000 description 1
- 101000889392 Homo sapiens Adenine nucleotide translocase lysine N-methyltransferase Proteins 0.000 description 1
- 101000842270 Homo sapiens Adenosine 5'-monophosphoramidase HINT1 Proteins 0.000 description 1
- 101000716952 Homo sapiens Adenosylhomocysteinase Proteins 0.000 description 1
- 101001077066 Homo sapiens Adenylate kinase 9 Proteins 0.000 description 1
- 101001135206 Homo sapiens Adiponectin receptor protein 1 Proteins 0.000 description 1
- 101000833098 Homo sapiens Adrenodoxin, mitochondrial Proteins 0.000 description 1
- 101000928246 Homo sapiens Afadin Proteins 0.000 description 1
- 101000775309 Homo sapiens Aftiphilin Proteins 0.000 description 1
- 101000928511 Homo sapiens Akirin-1 Proteins 0.000 description 1
- 101000879354 Homo sapiens Alanine-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 101000959452 Homo sapiens Alcohol dehydrogenase class-3 Proteins 0.000 description 1
- 101000717967 Homo sapiens Aldehyde dehydrogenase family 3 member A2 Proteins 0.000 description 1
- 101000718007 Homo sapiens Aldo-keto reductase family 1 member A1 Proteins 0.000 description 1
- 101000836540 Homo sapiens Aldo-keto reductase family 1 member B1 Proteins 0.000 description 1
- 101000718041 Homo sapiens Aldo-keto reductase family 1 member B10 Proteins 0.000 description 1
- 101000799143 Homo sapiens Alkyldihydroxyacetonephosphate synthase, peroxisomal Proteins 0.000 description 1
- 101000733623 Homo sapiens All-trans retinoic acid-induced differentiation factor Proteins 0.000 description 1
- 101000799569 Homo sapiens Alpha- and gamma-adaptin-binding protein p34 Proteins 0.000 description 1
- 101000717828 Homo sapiens Alpha-1,2-mannosyltransferase ALG9 Proteins 0.000 description 1
- 101000951413 Homo sapiens Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase B Proteins 0.000 description 1
- 101000836956 Homo sapiens Alpha-2-macroglobulin receptor-associated protein Proteins 0.000 description 1
- 101000634076 Homo sapiens Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6 Proteins 0.000 description 1
- 101000797282 Homo sapiens Alpha-actinin-4 Proteins 0.000 description 1
- 101000799076 Homo sapiens Alpha-adducin Proteins 0.000 description 1
- 101000780227 Homo sapiens Alpha-centractin Proteins 0.000 description 1
- 101000876352 Homo sapiens Alpha-endosulfine Proteins 0.000 description 1
- 101000800875 Homo sapiens Alpha-globin transcription factor CP2 Proteins 0.000 description 1
- 101000959149 Homo sapiens Alpha-ketoglutarate-dependent dioxygenase alkB homolog 4 Proteins 0.000 description 1
- 101000615953 Homo sapiens Alpha-mannosidase 2 Proteins 0.000 description 1
- 101000979029 Homo sapiens Alpha-mannosidase 2C1 Proteins 0.000 description 1
- 101000615966 Homo sapiens Alpha-mannosidase 2x Proteins 0.000 description 1
- 101000779568 Homo sapiens Alpha-protein kinase 1 Proteins 0.000 description 1
- 101000742837 Homo sapiens Alpha/beta hydrolase domain-containing protein 17A Proteins 0.000 description 1
- 101000783847 Homo sapiens Alpha/beta hydrolase domain-containing protein 17B Proteins 0.000 description 1
- 101000889627 Homo sapiens Aminopeptidase O Proteins 0.000 description 1
- 101000779309 Homo sapiens Amyloid protein-binding protein 2 Proteins 0.000 description 1
- 101000928673 Homo sapiens Amyloid-beta A4 precursor protein-binding family A member 3 Proteins 0.000 description 1
- 101000733832 Homo sapiens Anaphase-promoting complex subunit 13 Proteins 0.000 description 1
- 101000733701 Homo sapiens Anaphase-promoting complex subunit 15 Proteins 0.000 description 1
- 101000890308 Homo sapiens Anaphase-promoting complex subunit 16 Proteins 0.000 description 1
- 101000961191 Homo sapiens Anaphase-promoting complex subunit 2 Proteins 0.000 description 1
- 101000964180 Homo sapiens Angio-associated migratory cell protein Proteins 0.000 description 1
- 101000928335 Homo sapiens Ankyrin repeat and KH domain-containing protein 1 Proteins 0.000 description 1
- 101000889389 Homo sapiens Ankyrin repeat and LEM domain-containing protein 2 Proteins 0.000 description 1
- 101000925496 Homo sapiens Ankyrin repeat and SOCS box protein 1 Proteins 0.000 description 1
- 101000754296 Homo sapiens Ankyrin repeat and SOCS box protein 3 Proteins 0.000 description 1
- 101000754305 Homo sapiens Ankyrin repeat and SOCS box protein 6 Proteins 0.000 description 1
- 101000924478 Homo sapiens Ankyrin repeat domain-containing protein 10 Proteins 0.000 description 1
- 101000924476 Homo sapiens Ankyrin repeat domain-containing protein 11 Proteins 0.000 description 1
- 101000924485 Homo sapiens Ankyrin repeat domain-containing protein 12 Proteins 0.000 description 1
- 101000924484 Homo sapiens Ankyrin repeat domain-containing protein 16 Proteins 0.000 description 1
- 101000780116 Homo sapiens Ankyrin repeat domain-containing protein 26 Proteins 0.000 description 1
- 101000732378 Homo sapiens Ankyrin repeat domain-containing protein 39 Proteins 0.000 description 1
- 101000889428 Homo sapiens Ankyrin repeat domain-containing protein 46 Proteins 0.000 description 1
- 101000889457 Homo sapiens Ankyrin repeat domain-containing protein 49 Proteins 0.000 description 1
- 101000889453 Homo sapiens Ankyrin repeat domain-containing protein 50 Proteins 0.000 description 1
- 101000768066 Homo sapiens Annexin A11 Proteins 0.000 description 1
- 101000924461 Homo sapiens Annexin A4 Proteins 0.000 description 1
- 101000780137 Homo sapiens Annexin A6 Proteins 0.000 description 1
- 101000780144 Homo sapiens Annexin A7 Proteins 0.000 description 1
- 101000928294 Homo sapiens Annexin A9 Proteins 0.000 description 1
- 101000959871 Homo sapiens Apoptosis inhibitor 5 Proteins 0.000 description 1
- 101000890622 Homo sapiens Apoptosis-inducing factor 1, mitochondrial Proteins 0.000 description 1
- 101000923549 Homo sapiens Apoptosis-resistant E3 ubiquitin protein ligase 1 Proteins 0.000 description 1
- 101000752722 Homo sapiens Apoptosis-stimulating of p53 protein 1 Proteins 0.000 description 1
- 101000752711 Homo sapiens Apoptosis-stimulating of p53 protein 2 Proteins 0.000 description 1
- 101000929927 Homo sapiens Apoptotic chromatin condensation inducer in the nucleus Proteins 0.000 description 1
- 101000757586 Homo sapiens Aprataxin Proteins 0.000 description 1
- 101000889833 Homo sapiens Archaemetzincin-2 Proteins 0.000 description 1
- 101000833311 Homo sapiens Arf-GAP domain and FG repeat-containing protein 2 Proteins 0.000 description 1
- 101000928218 Homo sapiens Arf-GAP with GTPase, ANK repeat and PH domain-containing protein 1 Proteins 0.000 description 1
- 101000928222 Homo sapiens Arf-GAP with GTPase, ANK repeat and PH domain-containing protein 3 Proteins 0.000 description 1
- 101000928219 Homo sapiens Arf-GAP with GTPase, ANK repeat and PH domain-containing protein 5 Proteins 0.000 description 1
- 101000928209 Homo sapiens Arf-GAP with GTPase, ANK repeat and PH domain-containing protein 6 Proteins 0.000 description 1
- 101000975752 Homo sapiens Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1 Proteins 0.000 description 1
- 101000792706 Homo sapiens Arfaptin-1 Proteins 0.000 description 1
- 101000809446 Homo sapiens Arfaptin-2 Proteins 0.000 description 1
- 101000588484 Homo sapiens Arginine-hydroxylase NDUFAF5, mitochondrial Proteins 0.000 description 1
- 101001000549 Homo sapiens Arginine/serine-rich protein PNISR Proteins 0.000 description 1
- 101000886906 Homo sapiens Arginyl-tRNA-protein transferase 1 Proteins 0.000 description 1
- 101000923072 Homo sapiens Armadillo repeat protein deleted in velo-cardio-facial syndrome Proteins 0.000 description 1
- 101000925948 Homo sapiens Armadillo repeat-containing X-linked protein 3 Proteins 0.000 description 1
- 101000925931 Homo sapiens Armadillo repeat-containing X-linked protein 5 Proteins 0.000 description 1
- 101000769233 Homo sapiens Armadillo repeat-containing protein 10 Proteins 0.000 description 1
- 101000684964 Homo sapiens Armadillo repeat-containing protein 5 Proteins 0.000 description 1
- 101000685097 Homo sapiens Armadillo repeat-containing protein 6 Proteins 0.000 description 1
- 101000927961 Homo sapiens Armadillo repeat-containing protein 8 Proteins 0.000 description 1
- 101000793115 Homo sapiens Aryl hydrocarbon receptor nuclear translocator Proteins 0.000 description 1
- 101000923070 Homo sapiens Arylsulfatase B Proteins 0.000 description 1
- 101000925538 Homo sapiens Arylsulfatase G Proteins 0.000 description 1
- 101000624939 Homo sapiens Asparagine-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 101000799549 Homo sapiens Aspartate aminotransferase, mitochondrial Proteins 0.000 description 1
- 101000696909 Homo sapiens Aspartate-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 101000927708 Homo sapiens Aspartyl aminopeptidase Proteins 0.000 description 1
- 101000873101 Homo sapiens Ataxin-1-like Proteins 0.000 description 1
- 101000873088 Homo sapiens Ataxin-2-like protein Proteins 0.000 description 1
- 101000974945 Homo sapiens Ataxin-7-like protein 3 Proteins 0.000 description 1
- 101000678094 Homo sapiens Ataxin-7-like protein 3B Proteins 0.000 description 1
- 101000936988 Homo sapiens Atlastin-2 Proteins 0.000 description 1
- 101000936990 Homo sapiens Atlastin-3 Proteins 0.000 description 1
- 101000697936 Homo sapiens Attractin Proteins 0.000 description 1
- 101000875775 Homo sapiens Atypical kinase COQ8B, mitochondrial Proteins 0.000 description 1
- 101000959551 Homo sapiens Aurora kinase A-interacting protein Proteins 0.000 description 1
- 101000874361 Homo sapiens Autism susceptibility gene 2 protein Proteins 0.000 description 1
- 101000905423 Homo sapiens Autophagy-related protein 101 Proteins 0.000 description 1
- 101000785138 Homo sapiens Autophagy-related protein 13 Proteins 0.000 description 1
- 101000964092 Homo sapiens Autophagy-related protein 16-1 Proteins 0.000 description 1
- 101000905707 Homo sapiens Autophagy-related protein 2 homolog A Proteins 0.000 description 1
- 101000785057 Homo sapiens Autophagy-related protein 9A Proteins 0.000 description 1
- 101000874566 Homo sapiens Axin-1 Proteins 0.000 description 1
- 101000798484 Homo sapiens B-cell CLL/lymphoma 7 protein family member B Proteins 0.000 description 1
- 101000798495 Homo sapiens B-cell CLL/lymphoma 9 protein Proteins 0.000 description 1
- 101000740057 Homo sapiens B-cell receptor-associated protein 29 Proteins 0.000 description 1
- 101000874270 Homo sapiens B-cell receptor-associated protein 31 Proteins 0.000 description 1
- 101000740062 Homo sapiens BAG family molecular chaperone regulator 1 Proteins 0.000 description 1
- 101000697866 Homo sapiens BAG family molecular chaperone regulator 4 Proteins 0.000 description 1
- 101000937836 Homo sapiens BAH and coiled-coil domain-containing protein 1 Proteins 0.000 description 1
- 101000766273 Homo sapiens BCAS3 microtubule associated cell migration factor Proteins 0.000 description 1
- 101000740576 Homo sapiens BCL2/adenovirus E1B 19 kDa protein-interacting protein 2 Proteins 0.000 description 1
- 101100165236 Homo sapiens BCOR gene Proteins 0.000 description 1
- 101000971215 Homo sapiens BEN domain-containing protein 3 Proteins 0.000 description 1
- 101000697376 Homo sapiens BET1-like protein Proteins 0.000 description 1
- 101000934605 Homo sapiens BLOC-1-related complex subunit 8 Proteins 0.000 description 1
- 101000762370 Homo sapiens BMP-2-inducible protein kinase Proteins 0.000 description 1
- 101000807630 Homo sapiens BRCA1-A complex subunit RAP80 Proteins 0.000 description 1
- 101000874304 Homo sapiens BRCA2 and CDKN1A-interacting protein Proteins 0.000 description 1
- 101000802816 Homo sapiens BRD4-interacting chromatin-remodeling complex-associated protein Proteins 0.000 description 1
- 101000802808 Homo sapiens BRD4-interacting chromatin-remodeling complex-associated protein-like Proteins 0.000 description 1
- 101000874547 Homo sapiens BRISC and BRCA1-A complex member 1 Proteins 0.000 description 1
- 101000761810 Homo sapiens BSD domain-containing protein 1 Proteins 0.000 description 1
- 101000761884 Homo sapiens BTB/POZ domain-containing protein 2 Proteins 0.000 description 1
- 101000761879 Homo sapiens BTB/POZ domain-containing protein 7 Proteins 0.000 description 1
- 101001135507 Homo sapiens BTB/POZ domain-containing protein KCTD21 Proteins 0.000 description 1
- 101001007228 Homo sapiens BTB/POZ domain-containing protein KCTD6 Proteins 0.000 description 1
- 101000744928 Homo sapiens BUB3-interacting and GLEBS motif-containing protein ZNF207 Proteins 0.000 description 1
- 101000985003 Homo sapiens BUD13 homolog Proteins 0.000 description 1
- 101000936081 Homo sapiens Baculoviral IAP repeat-containing protein 6 Proteins 0.000 description 1
- 101000740067 Homo sapiens Barrier-to-autointegration factor Proteins 0.000 description 1
- 101000805924 Homo sapiens Basic helix-loop-helix domain-containing protein USF3 Proteins 0.000 description 1
- 101000970720 Homo sapiens Basic immunoglobulin-like variable motif-containing protein Proteins 0.000 description 1
- 101000903937 Homo sapiens Bax inhibitor 1 Proteins 0.000 description 1
- 101000798320 Homo sapiens Bcl-2 homologous antagonist/killer Proteins 0.000 description 1
- 101000798490 Homo sapiens Bcl-2-associated transcription factor 1 Proteins 0.000 description 1
- 101000971074 Homo sapiens Bcl-2-like protein 13 Proteins 0.000 description 1
- 101000904691 Homo sapiens Bcl-2-like protein 2 Proteins 0.000 description 1
- 101000894649 Homo sapiens Beclin-1 Proteins 0.000 description 1
- 101000665425 Homo sapiens Beta-1,3-N-acetylglucosaminyltransferase radical fringe Proteins 0.000 description 1
- 101000766180 Homo sapiens Beta-1,4-galactosyltransferase 3 Proteins 0.000 description 1
- 101000766179 Homo sapiens Beta-1,4-galactosyltransferase 4 Proteins 0.000 description 1
- 101000937496 Homo sapiens Beta-1,4-galactosyltransferase 5 Proteins 0.000 description 1
- 101000937508 Homo sapiens Beta-1,4-galactosyltransferase 7 Proteins 0.000 description 1
- 101000993469 Homo sapiens Beta-catenin-interacting protein 1 Proteins 0.000 description 1
- 101000780230 Homo sapiens Beta-centractin Proteins 0.000 description 1
- 101000933465 Homo sapiens Beta-glucuronidase Proteins 0.000 description 1
- 101001045433 Homo sapiens Beta-hexosaminidase subunit beta Proteins 0.000 description 1
- 101000894895 Homo sapiens Beta-secretase 1 Proteins 0.000 description 1
- 101000764928 Homo sapiens Bifunctional apoptosis regulator Proteins 0.000 description 1
- 101000975541 Homo sapiens Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 Proteins 0.000 description 1
- 101000975540 Homo sapiens Bifunctional peptidase and (3S)-lysyl hydroxylase JMJD7 Proteins 0.000 description 1
- 101001025948 Homo sapiens Bifunctional peptidase and arginyl-hydroxylase JMJD5 Proteins 0.000 description 1
- 101000803232 Homo sapiens Biogenesis of lysosome-related organelles complex 1 subunit 1 Proteins 0.000 description 1
- 101000762358 Homo sapiens Biogenesis of lysosome-related organelles complex 1 subunit 4 Proteins 0.000 description 1
- 101000872086 Homo sapiens Biogenesis of lysosome-related organelles complex 1 subunit 5 Proteins 0.000 description 1
- 101000872147 Homo sapiens Biogenesis of lysosome-related organelles complex 1 subunit 6 Proteins 0.000 description 1
- 101000934628 Homo sapiens Biorientation of chromosomes in cell division protein 1 Proteins 0.000 description 1
- 101000871771 Homo sapiens Biotin-[acetyl-CoA-carboxylase] ligase Proteins 0.000 description 1
- 101000928573 Homo sapiens Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical] Proteins 0.000 description 1
- 101000984541 Homo sapiens Bleomycin hydrolase Proteins 0.000 description 1
- 101000695294 Homo sapiens BolA-like protein 1 Proteins 0.000 description 1
- 101000695321 Homo sapiens BolA-like protein 3 Proteins 0.000 description 1
- 101000937756 Homo sapiens Box C/D snoRNA protein 1 Proteins 0.000 description 1
- 101000766294 Homo sapiens Branched-chain-amino-acid aminotransferase, mitochondrial Proteins 0.000 description 1
- 101000761839 Homo sapiens Breast cancer metastasis-suppressor 1 Proteins 0.000 description 1
- 101000761835 Homo sapiens Breast cancer metastasis-suppressor 1-like protein Proteins 0.000 description 1
- 101000695920 Homo sapiens Brefeldin A-inhibited guanine nucleotide-exchange protein 2 Proteins 0.000 description 1
- 101000937839 Homo sapiens Bromo adjacent homology domain-containing 1 protein Proteins 0.000 description 1
- 101000937778 Homo sapiens Bromodomain adjacent to zinc finger domain protein 1A Proteins 0.000 description 1
- 101000971147 Homo sapiens Bromodomain adjacent to zinc finger domain protein 2A Proteins 0.000 description 1
- 101000971143 Homo sapiens Bromodomain adjacent to zinc finger domain protein 2B Proteins 0.000 description 1
- 101000896771 Homo sapiens Bromodomain and PHD finger-containing protein 3 Proteins 0.000 description 1
- 101000871846 Homo sapiens Bromodomain-containing protein 1 Proteins 0.000 description 1
- 101000871850 Homo sapiens Bromodomain-containing protein 2 Proteins 0.000 description 1
- 101000871851 Homo sapiens Bromodomain-containing protein 3 Proteins 0.000 description 1
- 101000794019 Homo sapiens Bromodomain-containing protein 7 Proteins 0.000 description 1
- 101000794020 Homo sapiens Bromodomain-containing protein 8 Proteins 0.000 description 1
- 101000794032 Homo sapiens Bromodomain-containing protein 9 Proteins 0.000 description 1
- 101000984916 Homo sapiens Butyrophilin subfamily 3 member A3 Proteins 0.000 description 1
- 101000896419 Homo sapiens Bystin Proteins 0.000 description 1
- 101001076862 Homo sapiens C-Jun-amino-terminal kinase-interacting protein 4 Proteins 0.000 description 1
- 101000584310 Homo sapiens C-myc promoter-binding protein Proteins 0.000 description 1
- 101000867970 Homo sapiens C2 domain-containing protein 3 Proteins 0.000 description 1
- 101000910420 Homo sapiens C2 domain-containing protein 5 Proteins 0.000 description 1
- 101000914211 Homo sapiens CASP8 and FADD-like apoptosis regulator Proteins 0.000 description 1
- 101000746131 Homo sapiens CBP80/20-dependent translation initiation factor Proteins 0.000 description 1
- 101000880590 Homo sapiens CCAAT/enhancer-binding protein gamma Proteins 0.000 description 1
- 101000880588 Homo sapiens CCAAT/enhancer-binding protein zeta Proteins 0.000 description 1
- 101000919672 Homo sapiens CCR4-NOT transcription complex subunit 1 Proteins 0.000 description 1
- 101000919678 Homo sapiens CCR4-NOT transcription complex subunit 11 Proteins 0.000 description 1
- 101000919667 Homo sapiens CCR4-NOT transcription complex subunit 2 Proteins 0.000 description 1
- 101000919663 Homo sapiens CCR4-NOT transcription complex subunit 3 Proteins 0.000 description 1
- 101000942594 Homo sapiens CCR4-NOT transcription complex subunit 4 Proteins 0.000 description 1
- 101000942580 Homo sapiens CCR4-NOT transcription complex subunit 7 Proteins 0.000 description 1
- 101000942586 Homo sapiens CCR4-NOT transcription complex subunit 8 Proteins 0.000 description 1
- 101000942590 Homo sapiens CCR4-NOT transcription complex subunit 9 Proteins 0.000 description 1
- 101000914499 Homo sapiens CD2-associated protein Proteins 0.000 description 1
- 101000934368 Homo sapiens CD63 antigen Proteins 0.000 description 1
- 101000914479 Homo sapiens CD81 antigen Proteins 0.000 description 1
- 101000914469 Homo sapiens CD82 antigen Proteins 0.000 description 1
- 101000984082 Homo sapiens CD99 antigen-like protein 2 Proteins 0.000 description 1
- 101000989662 Homo sapiens CDGSH iron-sulfur domain-containing protein 2 Proteins 0.000 description 1
- 101000989659 Homo sapiens CDGSH iron-sulfur domain-containing protein 3, mitochondrial Proteins 0.000 description 1
- 101000583935 Homo sapiens CDK-activating kinase assembly factor MAT1 Proteins 0.000 description 1
- 101000882873 Homo sapiens CDK5 regulatory subunit-associated protein 2 Proteins 0.000 description 1
- 101000793819 Homo sapiens CDKN2A-interacting protein Proteins 0.000 description 1
- 101000776617 Homo sapiens CGG triplet repeat-binding protein 1 Proteins 0.000 description 1
- 101000990005 Homo sapiens CLIP-associating protein 1 Proteins 0.000 description 1
- 101000906672 Homo sapiens CLK4-associating serine/arginine rich protein Proteins 0.000 description 1
- 101000703758 Homo sapiens CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 2 Proteins 0.000 description 1
- 101000797557 Homo sapiens COBW domain-containing protein 1 Proteins 0.000 description 1
- 101000797561 Homo sapiens COBW domain-containing protein 5 Proteins 0.000 description 1
- 101000909581 Homo sapiens COMM domain-containing protein 2 Proteins 0.000 description 1
- 101000909562 Homo sapiens COMM domain-containing protein 3 Proteins 0.000 description 1
- 101000909571 Homo sapiens COMM domain-containing protein 4 Proteins 0.000 description 1
- 101000899994 Homo sapiens COMM domain-containing protein 5 Proteins 0.000 description 1
- 101000899983 Homo sapiens COMM domain-containing protein 7 Proteins 0.000 description 1
- 101000940485 Homo sapiens COP9 signalosome complex subunit 1 Proteins 0.000 description 1
- 101000726004 Homo sapiens COP9 signalosome complex subunit 2 Proteins 0.000 description 1
- 101000726002 Homo sapiens COP9 signalosome complex subunit 3 Proteins 0.000 description 1
- 101000858667 Homo sapiens COP9 signalosome complex subunit 4 Proteins 0.000 description 1
- 101000896048 Homo sapiens COP9 signalosome complex subunit 5 Proteins 0.000 description 1
- 101000860047 Homo sapiens COP9 signalosome complex subunit 6 Proteins 0.000 description 1
- 101000916502 Homo sapiens COP9 signalosome complex subunit 8 Proteins 0.000 description 1
- 101000922127 Homo sapiens COP9 signalosome complex subunit 9 Proteins 0.000 description 1
- 101000896987 Homo sapiens CREB-binding protein Proteins 0.000 description 1
- 101000891939 Homo sapiens CREB-regulated transcription coactivator 1 Proteins 0.000 description 1
- 101000891906 Homo sapiens CREB-regulated transcription coactivator 3 Proteins 0.000 description 1
- 101000964541 Homo sapiens CREB/ATF bZIP transcription factor Proteins 0.000 description 1
- 101000891989 Homo sapiens CSC1-like protein 1 Proteins 0.000 description 1
- 101000859047 Homo sapiens CTD small phosphatase-like protein 2 Proteins 0.000 description 1
- 101001101919 Homo sapiens CTP synthase 1 Proteins 0.000 description 1
- 101001101885 Homo sapiens CTP synthase 2 Proteins 0.000 description 1
- 101000894809 Homo sapiens CUE domain-containing protein 1 Proteins 0.000 description 1
- 101000947154 Homo sapiens CXXC-type zinc finger protein 5 Proteins 0.000 description 1
- 101000777252 Homo sapiens Calcineurin B homologous protein 1 Proteins 0.000 description 1
- 101000910452 Homo sapiens Calcineurin-binding protein cabin-1 Proteins 0.000 description 1
- 101000580357 Homo sapiens Calcipressin-1 Proteins 0.000 description 1
- 101000943642 Homo sapiens Calcium homeostasis endoplasmic reticulum protein Proteins 0.000 description 1
- 101001049846 Homo sapiens Calcium-activated potassium channel subunit beta-3 Proteins 0.000 description 1
- 101000899411 Homo sapiens Calcium-binding protein 39 Proteins 0.000 description 1
- 101001095970 Homo sapiens Calcium-independent phospholipase A2-gamma Proteins 0.000 description 1
- 101000728145 Homo sapiens Calcium-transporting ATPase type 2C member 1 Proteins 0.000 description 1
- 101000971617 Homo sapiens Calcium/calmodulin-dependent protein kinase kinase 2 Proteins 0.000 description 1
- 101000944250 Homo sapiens Calcium/calmodulin-dependent protein kinase type 1 Proteins 0.000 description 1
- 101001077338 Homo sapiens Calcium/calmodulin-dependent protein kinase type II subunit delta Proteins 0.000 description 1
- 101000945304 Homo sapiens Calmodulin-binding transcription activator 2 Proteins 0.000 description 1
- 101000932956 Homo sapiens Calmodulin-regulated spectrin-associated protein 1 Proteins 0.000 description 1
- 101000898052 Homo sapiens Calnexin Proteins 0.000 description 1
- 101000919194 Homo sapiens Calpain small subunit 1 Proteins 0.000 description 1
- 101000934069 Homo sapiens Calpain-1 catalytic subunit Proteins 0.000 description 1
- 101000934071 Homo sapiens Calpain-15 Proteins 0.000 description 1
- 101000793684 Homo sapiens Calpain-7 Proteins 0.000 description 1
- 101000793651 Homo sapiens Calreticulin Proteins 0.000 description 1
- 101000883304 Homo sapiens Cap-specific mRNA (nucleoside-2'-O-)-methyltransferase 1 Proteins 0.000 description 1
- 101000883291 Homo sapiens Cap-specific mRNA (nucleoside-2'-O-)-methyltransferase 2 Proteins 0.000 description 1
- 101000867742 Homo sapiens Caprin-2 Proteins 0.000 description 1
- 101000775621 Homo sapiens Carbohydrate sulfotransferase 12 Proteins 0.000 description 1
- 101000725947 Homo sapiens Carboxy-terminal domain RNA polymerase II polypeptide A small phosphatase 2 Proteins 0.000 description 1
- 101000737655 Homo sapiens Carcinoembryonic antigen-related cell adhesion molecule 19 Proteins 0.000 description 1
- 101000895518 Homo sapiens Cardiolipin synthase (CMP-forming) Proteins 0.000 description 1
- 101000859570 Homo sapiens Carnitine O-palmitoyltransferase 1, liver isoform Proteins 0.000 description 1
- 101000994700 Homo sapiens Casein kinase I isoform alpha Proteins 0.000 description 1
- 101001026336 Homo sapiens Casein kinase I isoform delta Proteins 0.000 description 1
- 101001049881 Homo sapiens Casein kinase I isoform gamma-2 Proteins 0.000 description 1
- 101001049879 Homo sapiens Casein kinase I isoform gamma-3 Proteins 0.000 description 1
- 101000892026 Homo sapiens Casein kinase II subunit alpha Proteins 0.000 description 1
- 101000859996 Homo sapiens Casein kinase II subunit alpha 3 Proteins 0.000 description 1
- 101000892015 Homo sapiens Casein kinase II subunit alpha' Proteins 0.000 description 1
- 101000858625 Homo sapiens Casein kinase II subunit beta Proteins 0.000 description 1
- 101000741087 Homo sapiens Caspase-6 Proteins 0.000 description 1
- 101000741014 Homo sapiens Caspase-7 Proteins 0.000 description 1
- 101000983523 Homo sapiens Caspase-9 Proteins 0.000 description 1
- 101000916264 Homo sapiens Catenin delta-1 Proteins 0.000 description 1
- 101000898449 Homo sapiens Cathepsin B Proteins 0.000 description 1
- 101000869010 Homo sapiens Cathepsin D Proteins 0.000 description 1
- 101000761509 Homo sapiens Cathepsin K Proteins 0.000 description 1
- 101000740970 Homo sapiens Cathepsin O Proteins 0.000 description 1
- 101000910979 Homo sapiens Cathepsin Z Proteins 0.000 description 1
- 101001028831 Homo sapiens Cation-independent mannose-6-phosphate receptor Proteins 0.000 description 1
- 101001130422 Homo sapiens Cell cycle checkpoint protein RAD17 Proteins 0.000 description 1
- 101000910814 Homo sapiens Cell cycle control protein 50A Proteins 0.000 description 1
- 101000868629 Homo sapiens Cell cycle progression protein 1 Proteins 0.000 description 1
- 101000912020 Homo sapiens Cell cycle regulator of non-homologous end joining Proteins 0.000 description 1
- 101000914537 Homo sapiens Cell death-inducing p53-target protein 1 Proteins 0.000 description 1
- 101000868318 Homo sapiens Cell division cycle 5-like protein Proteins 0.000 description 1
- 101000897353 Homo sapiens Cell division cycle protein 123 homolog Proteins 0.000 description 1
- 101000912124 Homo sapiens Cell division cycle protein 23 homolog Proteins 0.000 description 1
- 101000914241 Homo sapiens Centromere protein C Proteins 0.000 description 1
- 101000776412 Homo sapiens Centromere protein N Proteins 0.000 description 1
- 101000743902 Homo sapiens Centromere/kinetochore protein zw10 homolog Proteins 0.000 description 1
- 101000737080 Homo sapiens Centrosomal protein CCDC61 Proteins 0.000 description 1
- 101000737689 Homo sapiens Centrosomal protein CEP57L1 Proteins 0.000 description 1
- 101000737563 Homo sapiens Ceramide transfer protein Proteins 0.000 description 1
- 101000909309 Homo sapiens Ceramide-1-phosphate transfer protein Proteins 0.000 description 1
- 101000989626 Homo sapiens Charged multivesicular body protein 3 Proteins 0.000 description 1
- 101000913952 Homo sapiens Charged multivesicular body protein 5 Proteins 0.000 description 1
- 101000839968 Homo sapiens Checkpoint protein HUS1 Proteins 0.000 description 1
- 101000851684 Homo sapiens Chimeric ERCC6-PGBD3 protein Proteins 0.000 description 1
- 101000991102 Homo sapiens Chitinase domain-containing protein 1 Proteins 0.000 description 1
- 101000989992 Homo sapiens Chloride channel CLIC-like protein 1 Proteins 0.000 description 1
- 101000988444 Homo sapiens Choline-phosphate cytidylyltransferase A Proteins 0.000 description 1
- 101000777313 Homo sapiens Choline/ethanolamine kinase Proteins 0.000 description 1
- 101000914238 Homo sapiens Choline/ethanolaminephosphotransferase 1 Proteins 0.000 description 1
- 101000943248 Homo sapiens Chromatin accessibility complex protein 1 Proteins 0.000 description 1
- 101000740094 Homo sapiens Chromatin complexes subunit BAP18 Proteins 0.000 description 1
- 101000817406 Homo sapiens Chromatin modification-related protein MEAF6 Proteins 0.000 description 1
- 101000737958 Homo sapiens Chromatin target of PRMT1 protein Proteins 0.000 description 1
- 101000797578 Homo sapiens Chromobox protein homolog 3 Proteins 0.000 description 1
- 101000797581 Homo sapiens Chromobox protein homolog 5 Proteins 0.000 description 1
- 101000777795 Homo sapiens Chromodomain Y-like protein Proteins 0.000 description 1
- 101000777047 Homo sapiens Chromodomain-helicase-DNA-binding protein 1 Proteins 0.000 description 1
- 101000777053 Homo sapiens Chromodomain-helicase-DNA-binding protein 1-like Proteins 0.000 description 1
- 101000777079 Homo sapiens Chromodomain-helicase-DNA-binding protein 2 Proteins 0.000 description 1
- 101000883749 Homo sapiens Chromodomain-helicase-DNA-binding protein 4 Proteins 0.000 description 1
- 101000883739 Homo sapiens Chromodomain-helicase-DNA-binding protein 7 Proteins 0.000 description 1
- 101000883545 Homo sapiens Chromodomain-helicase-DNA-binding protein 8 Proteins 0.000 description 1
- 101000856249 Homo sapiens Chromosome transmission fidelity protein 8 homolog Proteins 0.000 description 1
- 101000946179 Homo sapiens Cilia- and flagella-associated protein 20 Proteins 0.000 description 1
- 101000980066 Homo sapiens Cilia- and flagella-associated protein 410 Proteins 0.000 description 1
- 101000710327 Homo sapiens Cip1-interacting zinc finger protein Proteins 0.000 description 1
- 101000912851 Homo sapiens Clathrin heavy chain 1 Proteins 0.000 description 1
- 101000851951 Homo sapiens Clathrin interactor 1 Proteins 0.000 description 1
- 101000710244 Homo sapiens Clathrin light chain A Proteins 0.000 description 1
- 101000942271 Homo sapiens Clathrin light chain B Proteins 0.000 description 1
- 101000957603 Homo sapiens Cleavage and polyadenylation specificity factor subunit 1 Proteins 0.000 description 1
- 101000957590 Homo sapiens Cleavage and polyadenylation specificity factor subunit 2 Proteins 0.000 description 1
- 101000727101 Homo sapiens Cleavage and polyadenylation specificity factor subunit 3 Proteins 0.000 description 1
- 101000727105 Homo sapiens Cleavage and polyadenylation specificity factor subunit 4 Proteins 0.000 description 1
- 101000727072 Homo sapiens Cleavage and polyadenylation specificity factor subunit 5 Proteins 0.000 description 1
- 101000855366 Homo sapiens Cleavage and polyadenylation specificity factor subunit 6 Proteins 0.000 description 1
- 101000855404 Homo sapiens Cleavage and polyadenylation specificity factor subunit 7 Proteins 0.000 description 1
- 101000891786 Homo sapiens Cleavage stimulation factor subunit 1 Proteins 0.000 description 1
- 101000891773 Homo sapiens Cleavage stimulation factor subunit 2 tau variant Proteins 0.000 description 1
- 101000891801 Homo sapiens Cleavage stimulation factor subunit 3 Proteins 0.000 description 1
- 101000750204 Homo sapiens Cleft lip and palate transmembrane protein 1 Proteins 0.000 description 1
- 101000919970 Homo sapiens Coatomer subunit beta Proteins 0.000 description 1
- 101000899916 Homo sapiens Coatomer subunit beta' Proteins 0.000 description 1
- 101000860881 Homo sapiens Coatomer subunit delta Proteins 0.000 description 1
- 101000952964 Homo sapiens Coatomer subunit gamma-1 Proteins 0.000 description 1
- 101000952951 Homo sapiens Coatomer subunit gamma-2 Proteins 0.000 description 1
- 101000909614 Homo sapiens Coatomer subunit zeta-1 Proteins 0.000 description 1
- 101000977167 Homo sapiens Cobalamin trafficking protein CblD Proteins 0.000 description 1
- 101000898006 Homo sapiens Cocaine esterase Proteins 0.000 description 1
- 101000642971 Homo sapiens Cohesin subunit SA-1 Proteins 0.000 description 1
- 101000642968 Homo sapiens Cohesin subunit SA-2 Proteins 0.000 description 1
- 101000910423 Homo sapiens Coiled-coil and C2 domain-containing protein 1A Proteins 0.000 description 1
- 101000868799 Homo sapiens Coiled-coil domain-containing protein 106 Proteins 0.000 description 1
- 101000868800 Homo sapiens Coiled-coil domain-containing protein 107 Proteins 0.000 description 1
- 101000978248 Homo sapiens Coiled-coil domain-containing protein 124 Proteins 0.000 description 1
- 101000932597 Homo sapiens Coiled-coil domain-containing protein 149 Proteins 0.000 description 1
- 101000932658 Homo sapiens Coiled-coil domain-containing protein 152 Proteins 0.000 description 1
- 101000715221 Homo sapiens Coiled-coil domain-containing protein 174 Proteins 0.000 description 1
- 101000896971 Homo sapiens Coiled-coil domain-containing protein 28A Proteins 0.000 description 1
- 101000897095 Homo sapiens Coiled-coil domain-containing protein 32 Proteins 0.000 description 1
- 101000910679 Homo sapiens Coiled-coil domain-containing protein 43 Proteins 0.000 description 1
- 101000777370 Homo sapiens Coiled-coil domain-containing protein 6 Proteins 0.000 description 1
- 101000946606 Homo sapiens Coiled-coil domain-containing protein 66 Proteins 0.000 description 1
- 101000868816 Homo sapiens Coiled-coil domain-containing protein 85C Proteins 0.000 description 1
- 101000777407 Homo sapiens Coiled-coil domain-containing protein 9 Proteins 0.000 description 1
- 101000743767 Homo sapiens Coiled-coil domain-containing protein R3HCC1L Proteins 0.000 description 1
- 101000906986 Homo sapiens Coiled-coil-helix-coiled-coil-helix domain-containing protein 2 Proteins 0.000 description 1
- 101000906984 Homo sapiens Coiled-coil-helix-coiled-coil-helix domain-containing protein 7 Proteins 0.000 description 1
- 101000906744 Homo sapiens Cold-inducible RNA-binding protein Proteins 0.000 description 1
- 101000677550 Homo sapiens Complex I assembly factor ACAD9, mitochondrial Proteins 0.000 description 1
- 101000753266 Homo sapiens Complex I assembly factor TIMMDC1, mitochondrial Proteins 0.000 description 1
- 101000884127 Homo sapiens Complex I intermediate-associated protein 30, mitochondrial Proteins 0.000 description 1
- 101000942612 Homo sapiens Condensin-2 complex subunit D3 Proteins 0.000 description 1
- 101000919688 Homo sapiens Condensin-2 complex subunit H2 Proteins 0.000 description 1
- 101000920113 Homo sapiens Conserved oligomeric Golgi complex subunit 2 Proteins 0.000 description 1
- 101000876012 Homo sapiens Conserved oligomeric Golgi complex subunit 4 Proteins 0.000 description 1
- 101000748957 Homo sapiens Conserved oligomeric Golgi complex subunit 6 Proteins 0.000 description 1
- 101000771062 Homo sapiens Consortin Proteins 0.000 description 1
- 101001048826 Homo sapiens Constitutive coactivator of PPAR-gamma-like protein 1 Proteins 0.000 description 1
- 101000813315 Homo sapiens Constitutive coactivator of PPAR-gamma-like protein 2 Proteins 0.000 description 1
- 101000941754 Homo sapiens Copine-1 Proteins 0.000 description 1
- 101000941769 Homo sapiens Copine-3 Proteins 0.000 description 1
- 101000941325 Homo sapiens Copper homeostasis protein cutC homolog Proteins 0.000 description 1
- 101000727865 Homo sapiens Copper transport protein ATOX1 Proteins 0.000 description 1
- 101001067929 Homo sapiens Core histone macro-H2A.1 Proteins 0.000 description 1
- 101000906759 Homo sapiens Corepressor interacting with RBPJ 1 Proteins 0.000 description 1
- 101000748846 Homo sapiens Coronin-1B Proteins 0.000 description 1
- 101000748856 Homo sapiens Coronin-1C Proteins 0.000 description 1
- 101000919315 Homo sapiens Crk-like protein Proteins 0.000 description 1
- 101000921063 Homo sapiens Crooked neck-like protein 1 Proteins 0.000 description 1
- 101000919351 Homo sapiens Cryptochrome-1 Proteins 0.000 description 1
- 101000855613 Homo sapiens Cryptochrome-2 Proteins 0.000 description 1
- 101000746072 Homo sapiens Cullin-2 Proteins 0.000 description 1
- 101000916238 Homo sapiens Cullin-3 Proteins 0.000 description 1
- 101000916245 Homo sapiens Cullin-4A Proteins 0.000 description 1
- 101000916231 Homo sapiens Cullin-4B Proteins 0.000 description 1
- 101000856414 Homo sapiens Cullin-5 Proteins 0.000 description 1
- 101000856425 Homo sapiens Cullin-7 Proteins 0.000 description 1
- 101000856395 Homo sapiens Cullin-9 Proteins 0.000 description 1
- 101000711004 Homo sapiens Cx9C motif-containing protein 4 Proteins 0.000 description 1
- 101000974934 Homo sapiens Cyclic AMP-dependent transcription factor ATF-2 Proteins 0.000 description 1
- 101000905743 Homo sapiens Cyclic AMP-dependent transcription factor ATF-4 Proteins 0.000 description 1
- 101000905751 Homo sapiens Cyclic AMP-dependent transcription factor ATF-6 alpha Proteins 0.000 description 1
- 101000905727 Homo sapiens Cyclic AMP-dependent transcription factor ATF-6 beta Proteins 0.000 description 1
- 101000905723 Homo sapiens Cyclic AMP-dependent transcription factor ATF-7 Proteins 0.000 description 1
- 101000855516 Homo sapiens Cyclic AMP-responsive element-binding protein 1 Proteins 0.000 description 1
- 101000855520 Homo sapiens Cyclic AMP-responsive element-binding protein 3 Proteins 0.000 description 1
- 101000980770 Homo sapiens Cyclin-C Proteins 0.000 description 1
- 101000804518 Homo sapiens Cyclin-D-binding Myb-like transcription factor 1 Proteins 0.000 description 1
- 101000897488 Homo sapiens Cyclin-D1-binding protein 1 Proteins 0.000 description 1
- 101000884191 Homo sapiens Cyclin-G1 Proteins 0.000 description 1
- 101000713120 Homo sapiens Cyclin-H Proteins 0.000 description 1
- 101000713131 Homo sapiens Cyclin-J Proteins 0.000 description 1
- 101000713127 Homo sapiens Cyclin-K Proteins 0.000 description 1
- 101000897452 Homo sapiens Cyclin-L2 Proteins 0.000 description 1
- 101000897449 Homo sapiens Cyclin-Q Proteins 0.000 description 1
- 101000910488 Homo sapiens Cyclin-T1 Proteins 0.000 description 1
- 101000910484 Homo sapiens Cyclin-T2 Proteins 0.000 description 1
- 101000908138 Homo sapiens Cyclin-dependent kinase 10 Proteins 0.000 description 1
- 101000884345 Homo sapiens Cyclin-dependent kinase 12 Proteins 0.000 description 1
- 101000884348 Homo sapiens Cyclin-dependent kinase 13 Proteins 0.000 description 1
- 101000884374 Homo sapiens Cyclin-dependent kinase 14 Proteins 0.000 description 1
- 101000944357 Homo sapiens Cyclin-dependent kinase 16 Proteins 0.000 description 1
- 101000944358 Homo sapiens Cyclin-dependent kinase 17 Proteins 0.000 description 1
- 101000737813 Homo sapiens Cyclin-dependent kinase 2-associated protein 1 Proteins 0.000 description 1
- 101000737820 Homo sapiens Cyclin-dependent kinase 2-associated protein 2 Proteins 0.000 description 1
- 101000737869 Homo sapiens Cyclin-dependent kinase 2-interacting protein Proteins 0.000 description 1
- 101000911952 Homo sapiens Cyclin-dependent kinase 7 Proteins 0.000 description 1
- 101000980937 Homo sapiens Cyclin-dependent kinase 8 Proteins 0.000 description 1
- 101000980930 Homo sapiens Cyclin-dependent kinase 9 Proteins 0.000 description 1
- 101000912191 Homo sapiens Cystatin-B Proteins 0.000 description 1
- 101000912205 Homo sapiens Cystatin-C Proteins 0.000 description 1
- 101000943802 Homo sapiens Cysteine and histidine-rich domain-containing protein 1 Proteins 0.000 description 1
- 101001023837 Homo sapiens Cysteine desulfurase, mitochondrial Proteins 0.000 description 1
- 101000753468 Homo sapiens Cysteine protease ATG4B Proteins 0.000 description 1
- 101000726276 Homo sapiens Cysteine-rich PDZ-binding protein Proteins 0.000 description 1
- 101000607486 Homo sapiens Cytochrome b-c1 complex subunit 1, mitochondrial Proteins 0.000 description 1
- 101000607479 Homo sapiens Cytochrome b-c1 complex subunit 10 Proteins 0.000 description 1
- 101000746756 Homo sapiens Cytochrome b-c1 complex subunit 2, mitochondrial Proteins 0.000 description 1
- 101000746783 Homo sapiens Cytochrome b-c1 complex subunit 6, mitochondrial Proteins 0.000 description 1
- 101000746768 Homo sapiens Cytochrome b-c1 complex subunit 6-like, mitochondrial Proteins 0.000 description 1
- 101001060428 Homo sapiens Cytochrome b-c1 complex subunit 7 Proteins 0.000 description 1
- 101000585358 Homo sapiens Cytochrome b-c1 complex subunit 8 Proteins 0.000 description 1
- 101001079630 Homo sapiens Cytochrome b-c1 complex subunit 9 Proteins 0.000 description 1
- 101000874993 Homo sapiens Cytochrome c oxidase assembly factor 3 homolog, mitochondrial Proteins 0.000 description 1
- 101000993410 Homo sapiens Cytochrome c oxidase assembly factor 4 homolog, mitochondrial Proteins 0.000 description 1
- 101000993416 Homo sapiens Cytochrome c oxidase assembly factor 5 Proteins 0.000 description 1
- 101000771290 Homo sapiens Cytochrome c oxidase assembly factor 6 homolog Proteins 0.000 description 1
- 101000748842 Homo sapiens Cytochrome c oxidase assembly protein COX11, mitochondrial Proteins 0.000 description 1
- 101000770621 Homo sapiens Cytochrome c oxidase assembly protein COX14 Proteins 0.000 description 1
- 101000875881 Homo sapiens Cytochrome c oxidase assembly protein COX16 homolog, mitochondrial Proteins 0.000 description 1
- 101000725442 Homo sapiens Cytochrome c oxidase assembly protein COX19 Proteins 0.000 description 1
- 101000875933 Homo sapiens Cytochrome c oxidase copper chaperone Proteins 0.000 description 1
- 101000900394 Homo sapiens Cytochrome c oxidase subunit 4 isoform 1, mitochondrial Proteins 0.000 description 1
- 101000908835 Homo sapiens Cytochrome c oxidase subunit 5B, mitochondrial Proteins 0.000 description 1
- 101000922367 Homo sapiens Cytochrome c oxidase subunit 6B1 Proteins 0.000 description 1
- 101000861049 Homo sapiens Cytochrome c oxidase subunit 6C Proteins 0.000 description 1
- 101000919466 Homo sapiens Cytochrome c oxidase subunit 7A-related protein, mitochondrial Proteins 0.000 description 1
- 101000856741 Homo sapiens Cytochrome c oxidase subunit 7A2, mitochondrial Proteins 0.000 description 1
- 101000919491 Homo sapiens Cytochrome c oxidase subunit 7C, mitochondrial Proteins 0.000 description 1
- 101000745956 Homo sapiens Cytochrome c oxidase subunit 8A, mitochondrial Proteins 0.000 description 1
- 101000870120 Homo sapiens Cytohesin-2 Proteins 0.000 description 1
- 101000956872 Homo sapiens Cytoplasmic FMR1-interacting protein 1 Proteins 0.000 description 1
- 101000866326 Homo sapiens Cytoplasmic dynein 1 heavy chain 1 Proteins 0.000 description 1
- 101000915292 Homo sapiens Cytoplasmic dynein 1 intermediate chain 2 Proteins 0.000 description 1
- 101001024707 Homo sapiens Cytoplasmic protein NCK1 Proteins 0.000 description 1
- 101000856509 Homo sapiens Cytoplasmic tRNA 2-thiolation protein 2 Proteins 0.000 description 1
- 101000766853 Homo sapiens Cytoskeleton-associated protein 4 Proteins 0.000 description 1
- 101000766864 Homo sapiens Cytoskeleton-associated protein 5 Proteins 0.000 description 1
- 101000924389 Homo sapiens Cytosol aminopeptidase Proteins 0.000 description 1
- 101001107795 Homo sapiens Cytosolic Fe-S cluster assembly factor NUBP2 Proteins 0.000 description 1
- 101000947090 Homo sapiens Cytosolic arginine sensor for mTORC1 subunit 1 Proteins 0.000 description 1
- 101000906806 Homo sapiens Cytosolic iron-sulfur assembly component 2A Proteins 0.000 description 1
- 101000906803 Homo sapiens Cytosolic iron-sulfur assembly component 2B Proteins 0.000 description 1
- 101000919690 Homo sapiens Cytosolic non-specific dipeptidase Proteins 0.000 description 1
- 101000614102 Homo sapiens Cytosolic phospholipase A2 beta Proteins 0.000 description 1
- 101000915162 Homo sapiens Cytosolic purine 5'-nucleotidase Proteins 0.000 description 1
- 101000884816 Homo sapiens Cytospin-A Proteins 0.000 description 1
- 101000838688 Homo sapiens D-aminoacyl-tRNA deacylase 1 Proteins 0.000 description 1
- 101000720863 Homo sapiens D-dopachrome decarboxylase-like protein Proteins 0.000 description 1
- 101001058422 Homo sapiens D-glucuronyl C5-epimerase Proteins 0.000 description 1
- 101000951866 Homo sapiens DALR anticodon-binding domain-containing protein 3 Proteins 0.000 description 1
- 101000929221 Homo sapiens DAP3-binding cell death enhancer 1 Proteins 0.000 description 1
- 101001053277 Homo sapiens DCC-interacting protein 13-alpha Proteins 0.000 description 1
- 101001053257 Homo sapiens DCC-interacting protein 13-beta Proteins 0.000 description 1
- 101000954846 Homo sapiens DCN1-like protein 4 Proteins 0.000 description 1
- 101000917426 Homo sapiens DDB1- and CUL4-associated factor 1 Proteins 0.000 description 1
- 101000721268 Homo sapiens DDB1- and CUL4-associated factor 11 Proteins 0.000 description 1
- 101000885459 Homo sapiens DDB1- and CUL4-associated factor 12 Proteins 0.000 description 1
- 101000885476 Homo sapiens DDB1- and CUL4-associated factor 13 Proteins 0.000 description 1
- 101000917433 Homo sapiens DDB1- and CUL4-associated factor 17 Proteins 0.000 description 1
- 101000917421 Homo sapiens DDB1- and CUL4-associated factor 4 Proteins 0.000 description 1
- 101000917422 Homo sapiens DDB1- and CUL4-associated factor 5 Proteins 0.000 description 1
- 101000832322 Homo sapiens DDB1- and CUL4-associated factor 7 Proteins 0.000 description 1
- 101000832316 Homo sapiens DDB1- and CUL4-associated factor 8 Proteins 0.000 description 1
- 101000870898 Homo sapiens DENN domain-containing protein 11 Proteins 0.000 description 1
- 101000870914 Homo sapiens DENN domain-containing protein 1B Proteins 0.000 description 1
- 101000722282 Homo sapiens DENN domain-containing protein 4B Proteins 0.000 description 1
- 101000950656 Homo sapiens DEP domain-containing protein 1B Proteins 0.000 description 1
- 101000951181 Homo sapiens DIS3-like exonuclease 1 Proteins 0.000 description 1
- 101000951062 Homo sapiens DIS3-like exonuclease 2 Proteins 0.000 description 1
- 101000871548 Homo sapiens DNA cross-link repair 1A protein Proteins 0.000 description 1
- 101001041466 Homo sapiens DNA damage-binding protein 2 Proteins 0.000 description 1
- 101000876529 Homo sapiens DNA excision repair protein ERCC-1 Proteins 0.000 description 1
- 101000920783 Homo sapiens DNA excision repair protein ERCC-6 Proteins 0.000 description 1
- 101000898683 Homo sapiens DNA excision repair protein ERCC-6-like 2 Proteins 0.000 description 1
- 101000920778 Homo sapiens DNA excision repair protein ERCC-8 Proteins 0.000 description 1
- 101000950906 Homo sapiens DNA fragmentation factor subunit alpha Proteins 0.000 description 1
- 101000957164 Homo sapiens DNA helicase MCM9 Proteins 0.000 description 1
- 101000927847 Homo sapiens DNA ligase 3 Proteins 0.000 description 1
- 101000927810 Homo sapiens DNA ligase 4 Proteins 0.000 description 1
- 101000930289 Homo sapiens DNA methyltransferase 1-associated protein 1 Proteins 0.000 description 1
- 101000577867 Homo sapiens DNA mismatch repair protein Mlh3 Proteins 0.000 description 1
- 101001134036 Homo sapiens DNA mismatch repair protein Msh2 Proteins 0.000 description 1
- 101001027762 Homo sapiens DNA mismatch repair protein Msh3 Proteins 0.000 description 1
- 101000968658 Homo sapiens DNA mismatch repair protein Msh6 Proteins 0.000 description 1
- 101000959163 Homo sapiens DNA oxidative demethylase ALKBH2 Proteins 0.000 description 1
- 101000902558 Homo sapiens DNA polymerase alpha catalytic subunit Proteins 0.000 description 1
- 101000930855 Homo sapiens DNA polymerase alpha subunit B Proteins 0.000 description 1
- 101000909198 Homo sapiens DNA polymerase delta catalytic subunit Proteins 0.000 description 1
- 101000909189 Homo sapiens DNA polymerase delta subunit 2 Proteins 0.000 description 1
- 101000932004 Homo sapiens DNA polymerase delta subunit 3 Proteins 0.000 description 1
- 101000864175 Homo sapiens DNA polymerase epsilon subunit 3 Proteins 0.000 description 1
- 101001094607 Homo sapiens DNA polymerase eta Proteins 0.000 description 1
- 101001094672 Homo sapiens DNA polymerase iota Proteins 0.000 description 1
- 101000804964 Homo sapiens DNA polymerase subunit gamma-1 Proteins 0.000 description 1
- 101000865085 Homo sapiens DNA polymerase theta Proteins 0.000 description 1
- 101000579381 Homo sapiens DNA polymerase zeta catalytic subunit Proteins 0.000 description 1
- 101000611553 Homo sapiens DNA primase large subunit Proteins 0.000 description 1
- 101000743929 Homo sapiens DNA repair protein RAD50 Proteins 0.000 description 1
- 101001132271 Homo sapiens DNA repair protein RAD51 homolog 3 Proteins 0.000 description 1
- 101001132266 Homo sapiens DNA repair protein RAD51 homolog 4 Proteins 0.000 description 1
- 101000649315 Homo sapiens DNA repair protein XRCC4 Proteins 0.000 description 1
- 101000825159 Homo sapiens DNA repair-scaffolding protein Proteins 0.000 description 1
- 101000963174 Homo sapiens DNA replication licensing factor MCM3 Proteins 0.000 description 1
- 101001018431 Homo sapiens DNA replication licensing factor MCM7 Proteins 0.000 description 1
- 101000830681 Homo sapiens DNA topoisomerase 1 Proteins 0.000 description 1
- 101000611068 Homo sapiens DNA topoisomerase 3-alpha Proteins 0.000 description 1
- 101000611076 Homo sapiens DNA topoisomerase 3-beta-1 Proteins 0.000 description 1
- 101000806846 Homo sapiens DNA-(apurinic or apyrimidinic site) endonuclease Proteins 0.000 description 1
- 101001137256 Homo sapiens DNA-(apurinic or apyrimidinic site) lyase Proteins 0.000 description 1
- 101001075432 Homo sapiens DNA-binding protein RFX5 Proteins 0.000 description 1
- 101001075464 Homo sapiens DNA-binding protein RFXANK Proteins 0.000 description 1
- 101000655234 Homo sapiens DNA-binding protein SATB1 Proteins 0.000 description 1
- 101000629403 Homo sapiens DNA-dependent metalloprotease SPRTN Proteins 0.000 description 1
- 101000619536 Homo sapiens DNA-dependent protein kinase catalytic subunit Proteins 0.000 description 1
- 101000865099 Homo sapiens DNA-directed DNA/RNA polymerase mu Proteins 0.000 description 1
- 101000729474 Homo sapiens DNA-directed RNA polymerase I subunit RPA1 Proteins 0.000 description 1
- 101000729452 Homo sapiens DNA-directed RNA polymerase I subunit RPA12 Proteins 0.000 description 1
- 101000650564 Homo sapiens DNA-directed RNA polymerase I subunit RPA34 Proteins 0.000 description 1
- 101000650570 Homo sapiens DNA-directed RNA polymerase I subunit RPA43 Proteins 0.000 description 1
- 101000870895 Homo sapiens DNA-directed RNA polymerase II subunit GRINL1A Proteins 0.000 description 1
- 101001037037 Homo sapiens DNA-directed RNA polymerase II subunit GRINL1A, isoforms 4/5 Proteins 0.000 description 1
- 101001106401 Homo sapiens DNA-directed RNA polymerase II subunit RPB1 Proteins 0.000 description 1
- 101000669827 Homo sapiens DNA-directed RNA polymerase II subunit RPB11-a Proteins 0.000 description 1
- 101000669831 Homo sapiens DNA-directed RNA polymerase II subunit RPB2 Proteins 0.000 description 1
- 101001088177 Homo sapiens DNA-directed RNA polymerase II subunit RPB4 Proteins 0.000 description 1
- 101000729332 Homo sapiens DNA-directed RNA polymerase II subunit RPB7 Proteins 0.000 description 1
- 101000723873 Homo sapiens DNA-directed RNA polymerase II subunit RPB9 Proteins 0.000 description 1
- 101000689002 Homo sapiens DNA-directed RNA polymerase III subunit RPC1 Proteins 0.000 description 1
- 101000723883 Homo sapiens DNA-directed RNA polymerase III subunit RPC10 Proteins 0.000 description 1
- 101000848675 Homo sapiens DNA-directed RNA polymerase III subunit RPC2 Proteins 0.000 description 1
- 101000650556 Homo sapiens DNA-directed RNA polymerase III subunit RPC3 Proteins 0.000 description 1
- 101000669237 Homo sapiens DNA-directed RNA polymerase III subunit RPC4 Proteins 0.000 description 1
- 101000669240 Homo sapiens DNA-directed RNA polymerase III subunit RPC5 Proteins 0.000 description 1
- 101001088194 Homo sapiens DNA-directed RNA polymerase III subunit RPC6 Proteins 0.000 description 1
- 101001088216 Homo sapiens DNA-directed RNA polymerase III subunit RPC8 Proteins 0.000 description 1
- 101001104144 Homo sapiens DNA-directed RNA polymerase III subunit RPC9 Proteins 0.000 description 1
- 101000686765 Homo sapiens DNA-directed RNA polymerase, mitochondrial Proteins 0.000 description 1
- 101000669171 Homo sapiens DNA-directed RNA polymerases I and III subunit RPAC2 Proteins 0.000 description 1
- 101001088179 Homo sapiens DNA-directed RNA polymerases I, II, and III subunit RPABC1 Proteins 0.000 description 1
- 101000686022 Homo sapiens DNA-directed RNA polymerases I, II, and III subunit RPABC3 Proteins 0.000 description 1
- 101000723789 Homo sapiens DNA-directed RNA polymerases I, II, and III subunit RPABC4 Proteins 0.000 description 1
- 101000950422 Homo sapiens DNL-type zinc finger protein Proteins 0.000 description 1
- 101000902716 Homo sapiens DPH3 homolog Proteins 0.000 description 1
- 101000632167 Homo sapiens Deaminated glutathione amidase Proteins 0.000 description 1
- 101000957914 Homo sapiens Death domain-containing protein CRADD Proteins 0.000 description 1
- 101000881223 Homo sapiens Decapping and exoribonuclease protein Proteins 0.000 description 1
- 101001052952 Homo sapiens Dedicator of cytokinesis protein 7 Proteins 0.000 description 1
- 101000869990 Homo sapiens Dehydrogenase/reductase SDR family member 12 Proteins 0.000 description 1
- 101000931852 Homo sapiens Dehydrogenase/reductase SDR family member 4-like 2 Proteins 0.000 description 1
- 101000880879 Homo sapiens Dehydrogenase/reductase SDR family member 7B Proteins 0.000 description 1
- 101000966982 Homo sapiens Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase, mitochondrial Proteins 0.000 description 1
- 101001044612 Homo sapiens Density-regulated protein Proteins 0.000 description 1
- 101000955042 Homo sapiens Deoxycytidylate deaminase Proteins 0.000 description 1
- 101000844963 Homo sapiens Deoxyhypusine synthase Proteins 0.000 description 1
- 101000626071 Homo sapiens Deoxynucleotidyltransferase terminal-interacting protein 2 Proteins 0.000 description 1
- 101000891564 Homo sapiens Deoxyribonuclease TATDN1 Proteins 0.000 description 1
- 101000902850 Homo sapiens Deoxyribonuclease-2-alpha Proteins 0.000 description 1
- 101000952691 Homo sapiens Dephospho-CoA kinase Proteins 0.000 description 1
- 101000832260 Homo sapiens Dephospho-CoA kinase domain-containing protein Proteins 0.000 description 1
- 101000842603 Homo sapiens Derlin-2 Proteins 0.000 description 1
- 101000928089 Homo sapiens Desumoylating isopeptidase 1 Proteins 0.000 description 1
- 101001023119 Homo sapiens Deubiquitinase MYSM1 Proteins 0.000 description 1
- 101000880940 Homo sapiens Developmentally-regulated GTP-binding protein 2 Proteins 0.000 description 1
- 101000806442 Homo sapiens Dexamethasone-induced protein Proteins 0.000 description 1
- 101000928786 Homo sapiens Di-N-acetylchitobiase Proteins 0.000 description 1
- 101000927974 Homo sapiens Diacylglycerol O-acyltransferase 1 Proteins 0.000 description 1
- 101001044812 Homo sapiens Diacylglycerol kinase epsilon Proteins 0.000 description 1
- 101000864574 Homo sapiens Diacylglycerol kinase theta Proteins 0.000 description 1
- 101000950829 Homo sapiens Diacylglycerol lipase-beta Proteins 0.000 description 1
- 101000722118 Homo sapiens Differentially expressed in FDCP 8 homolog Proteins 0.000 description 1
- 101001122360 Homo sapiens Dihydrolipoyllysine-residue acetyltransferase component of pyruvate dehydrogenase complex, mitochondrial Proteins 0.000 description 1
- 101000992065 Homo sapiens Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Proteins 0.000 description 1
- 101001039272 Homo sapiens Dihydroxyacetone phosphate acyltransferase Proteins 0.000 description 1
- 101000889412 Homo sapiens Dimethyladenosine transferase 1, mitochondrial Proteins 0.000 description 1
- 101000931862 Homo sapiens Dipeptidyl peptidase 3 Proteins 0.000 description 1
- 101000804947 Homo sapiens Dipeptidyl peptidase 8 Proteins 0.000 description 1
- 101000632920 Homo sapiens Diphosphoinositol polyphosphate phosphohydrolase 1 Proteins 0.000 description 1
- 101000837321 Homo sapiens Diphthine methyl ester synthase Proteins 0.000 description 1
- 101000805876 Homo sapiens Disco-interacting protein 2 homolog A Proteins 0.000 description 1
- 101000915413 Homo sapiens Disheveled-associated activator of morphogenesis 1 Proteins 0.000 description 1
- 101000777455 Homo sapiens Disintegrin and metalloproteinase domain-containing protein 15 Proteins 0.000 description 1
- 101000832769 Homo sapiens Disintegrin and metalloproteinase domain-containing protein 9 Proteins 0.000 description 1
- 101001053984 Homo sapiens Disks large homolog 1 Proteins 0.000 description 1
- 101000844774 Homo sapiens Disks large-associated protein 3 Proteins 0.000 description 1
- 101000951335 Homo sapiens Disks large-associated protein 4 Proteins 0.000 description 1
- 101000951365 Homo sapiens Disks large-associated protein 5 Proteins 0.000 description 1
- 101000930307 Homo sapiens Distal membrane-arm assembly complex protein 2 Proteins 0.000 description 1
- 101000805864 Homo sapiens Divergent protein kinase domain 2A Proteins 0.000 description 1
- 101000951250 Homo sapiens Dixin Proteins 0.000 description 1
- 101000804531 Homo sapiens DmX-like protein 1 Proteins 0.000 description 1
- 101000931227 Homo sapiens DnaJ homolog subfamily A member 1 Proteins 0.000 description 1
- 101000931210 Homo sapiens DnaJ homolog subfamily A member 2 Proteins 0.000 description 1
- 101000866012 Homo sapiens DnaJ homolog subfamily A member 3, mitochondrial Proteins 0.000 description 1
- 101000805858 Homo sapiens DnaJ homolog subfamily B member 11 Proteins 0.000 description 1
- 101000805849 Homo sapiens DnaJ homolog subfamily B member 12 Proteins 0.000 description 1
- 101000908034 Homo sapiens DnaJ homolog subfamily B member 14 Proteins 0.000 description 1
- 101000866020 Homo sapiens DnaJ homolog subfamily B member 2 Proteins 0.000 description 1
- 101000804119 Homo sapiens DnaJ homolog subfamily B member 9 Proteins 0.000 description 1
- 101000908042 Homo sapiens DnaJ homolog subfamily C member 10 Proteins 0.000 description 1
- 101000870239 Homo sapiens DnaJ homolog subfamily C member 13 Proteins 0.000 description 1
- 101000870172 Homo sapiens DnaJ homolog subfamily C member 15 Proteins 0.000 description 1
- 101000870184 Homo sapiens DnaJ homolog subfamily C member 16 Proteins 0.000 description 1
- 101000845887 Homo sapiens DnaJ homolog subfamily C member 2 Proteins 0.000 description 1
- 101000902110 Homo sapiens DnaJ homolog subfamily C member 21 Proteins 0.000 description 1
- 101001054519 Homo sapiens DnaJ homolog subfamily C member 25 Proteins 0.000 description 1
- 101000845898 Homo sapiens DnaJ homolog subfamily C member 3 Proteins 0.000 description 1
- 101000845897 Homo sapiens DnaJ homolog subfamily C member 4 Proteins 0.000 description 1
- 101000903053 Homo sapiens DnaJ homolog subfamily C member 7 Proteins 0.000 description 1
- 101000903063 Homo sapiens DnaJ homolog subfamily C member 8 Proteins 0.000 description 1
- 101000903036 Homo sapiens DnaJ homolog subfamily C member 9 Proteins 0.000 description 1
- 101000845698 Homo sapiens Dolichol kinase Proteins 0.000 description 1
- 101000932183 Homo sapiens Dolichol phosphate-mannose biosynthesis regulatory protein Proteins 0.000 description 1
- 101000932202 Homo sapiens Dolichol-phosphate mannosyltransferase subunit 1 Proteins 0.000 description 1
- 101000776319 Homo sapiens Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase Proteins 0.000 description 1
- 101000848781 Homo sapiens Dolichyl-diphosphooligosaccharide-protein glycosyltransferase subunit 1 Proteins 0.000 description 1
- 101000670093 Homo sapiens Dolichyl-diphosphooligosaccharide-protein glycosyltransferase subunit 2 Proteins 0.000 description 1
- 101000884921 Homo sapiens Dolichyl-diphosphooligosaccharide-protein glycosyltransferase subunit DAD1 Proteins 0.000 description 1
- 101000694130 Homo sapiens Dolichyl-phosphate beta-glucosyltransferase Proteins 0.000 description 1
- 101000584942 Homo sapiens Double-strand-break repair protein rad21 homolog Proteins 0.000 description 1
- 101000697573 Homo sapiens Double-stranded RNA-binding protein Staufen homolog 2 Proteins 0.000 description 1
- 101000880945 Homo sapiens Down syndrome cell adhesion molecule Proteins 0.000 description 1
- 101000915399 Homo sapiens Drebrin-like protein Proteins 0.000 description 1
- 101001115394 Homo sapiens Dual specificity mitogen-activated protein kinase kinase 3 Proteins 0.000 description 1
- 101001115395 Homo sapiens Dual specificity mitogen-activated protein kinase kinase 4 Proteins 0.000 description 1
- 101000749294 Homo sapiens Dual specificity protein kinase CLK1 Proteins 0.000 description 1
- 101000749291 Homo sapiens Dual specificity protein kinase CLK2 Proteins 0.000 description 1
- 101000749304 Homo sapiens Dual specificity protein kinase CLK3 Proteins 0.000 description 1
- 101000881110 Homo sapiens Dual specificity protein phosphatase 12 Proteins 0.000 description 1
- 101000881116 Homo sapiens Dual specificity protein phosphatase 14 Proteins 0.000 description 1
- 101000908482 Homo sapiens Dual specificity protein phosphatase 3 Proteins 0.000 description 1
- 101001057603 Homo sapiens Dual specificity protein phosphatase 7 Proteins 0.000 description 1
- 101000932592 Homo sapiens Dual specificity protein phosphatase CDC14B Proteins 0.000 description 1
- 101000714156 Homo sapiens Dual specificity testis-specific protein kinase 2 Proteins 0.000 description 1
- 101000838016 Homo sapiens Dual specificity tyrosine-phosphorylation-regulated kinase 1A Proteins 0.000 description 1
- 101001049983 Homo sapiens Dual specificity tyrosine-phosphorylation-regulated kinase 4 Proteins 0.000 description 1
- 101000929626 Homo sapiens Dynactin subunit 1 Proteins 0.000 description 1
- 101001041190 Homo sapiens Dynactin subunit 2 Proteins 0.000 description 1
- 101001041187 Homo sapiens Dynactin subunit 3 Proteins 0.000 description 1
- 101001041189 Homo sapiens Dynactin subunit 4 Proteins 0.000 description 1
- 101001041180 Homo sapiens Dynactin subunit 5 Proteins 0.000 description 1
- 101000873769 Homo sapiens Dynactin subunit 6 Proteins 0.000 description 1
- 101000909218 Homo sapiens Dynamin-1-like protein Proteins 0.000 description 1
- 101000909230 Homo sapiens Dynamin-binding protein Proteins 0.000 description 1
- 101000831170 Homo sapiens Dynein axonemal assembly factor 10 Proteins 0.000 description 1
- 101000869175 Homo sapiens Dynein axonemal assembly factor 5 Proteins 0.000 description 1
- 101000869152 Homo sapiens Dynein axonemal assembly factor 9 Proteins 0.000 description 1
- 101000904012 Homo sapiens Dynein light chain Tctex-type 3 Proteins 0.000 description 1
- 101000855983 Homo sapiens Dystroglycan 1 Proteins 0.000 description 1
- 101001074629 Homo sapiens E3 SUMO-protein ligase PIAS2 Proteins 0.000 description 1
- 101000583444 Homo sapiens E3 SUMO-protein ligase PIAS3 Proteins 0.000 description 1
- 101000782473 Homo sapiens E3 SUMO-protein ligase ZNF451 Proteins 0.000 description 1
- 101000913784 Homo sapiens E3 ubiquitin ligase TRAF3IP2 Proteins 0.000 description 1
- 101000776154 Homo sapiens E3 ubiquitin-protein ligase AMFR Proteins 0.000 description 1
- 101000808922 Homo sapiens E3 ubiquitin-protein ligase ARIH1 Proteins 0.000 description 1
- 101000808888 Homo sapiens E3 ubiquitin-protein ligase ARIH2 Proteins 0.000 description 1
- 101000650322 Homo sapiens E3 ubiquitin-protein ligase Arkadia Proteins 0.000 description 1
- 101000896080 Homo sapiens E3 ubiquitin-protein ligase BRE1B Proteins 0.000 description 1
- 101000942970 Homo sapiens E3 ubiquitin-protein ligase CHFR Proteins 0.000 description 1
- 101000879619 Homo sapiens E3 ubiquitin-protein ligase CHIP Proteins 0.000 description 1
- 101000872880 Homo sapiens E3 ubiquitin-protein ligase HECTD1 Proteins 0.000 description 1
- 101000872516 Homo sapiens E3 ubiquitin-protein ligase HERC2 Proteins 0.000 description 1
- 101001065747 Homo sapiens E3 ubiquitin-protein ligase LRSAM1 Proteins 0.000 description 1
- 101001040050 Homo sapiens E3 ubiquitin-protein ligase MARCHF2 Proteins 0.000 description 1
- 101001039881 Homo sapiens E3 ubiquitin-protein ligase MARCHF5 Proteins 0.000 description 1
- 101000978676 Homo sapiens E3 ubiquitin-protein ligase MARCHF6 Proteins 0.000 description 1
- 101000978729 Homo sapiens E3 ubiquitin-protein ligase MARCHF8 Proteins 0.000 description 1
- 101000951423 Homo sapiens E3 ubiquitin-protein ligase MGRN1 Proteins 0.000 description 1
- 101000973495 Homo sapiens E3 ubiquitin-protein ligase MIB2 Proteins 0.000 description 1
- 101000692706 Homo sapiens E3 ubiquitin-protein ligase NRDP1 Proteins 0.000 description 1
- 101001001821 Homo sapiens E3 ubiquitin-protein ligase Praja-2 Proteins 0.000 description 1
- 101001077300 Homo sapiens E3 ubiquitin-protein ligase RBBP6 Proteins 0.000 description 1
- 101000707962 Homo sapiens E3 ubiquitin-protein ligase RING1 Proteins 0.000 description 1
- 101001095815 Homo sapiens E3 ubiquitin-protein ligase RING2 Proteins 0.000 description 1
- 101000650319 Homo sapiens E3 ubiquitin-protein ligase RNF103 Proteins 0.000 description 1
- 101001079154 Homo sapiens E3 ubiquitin-protein ligase RNF113A Proteins 0.000 description 1
- 101001079862 Homo sapiens E3 ubiquitin-protein ligase RNF115 Proteins 0.000 description 1
- 101000712021 Homo sapiens E3 ubiquitin-protein ligase RNF13 Proteins 0.000 description 1
- 101001106980 Homo sapiens E3 ubiquitin-protein ligase RNF138 Proteins 0.000 description 1
- 101000712013 Homo sapiens E3 ubiquitin-protein ligase RNF14 Proteins 0.000 description 1
- 101000692993 Homo sapiens E3 ubiquitin-protein ligase RNF146 Proteins 0.000 description 1
- 101000670535 Homo sapiens E3 ubiquitin-protein ligase RNF167 Proteins 0.000 description 1
- 101000667666 Homo sapiens E3 ubiquitin-protein ligase RNF170 Proteins 0.000 description 1
- 101001104290 Homo sapiens E3 ubiquitin-protein ligase RNF185 Proteins 0.000 description 1
- 101001104287 Homo sapiens E3 ubiquitin-protein ligase RNF187 Proteins 0.000 description 1
- 101001103581 Homo sapiens E3 ubiquitin-protein ligase RNF34 Proteins 0.000 description 1
- 101001107086 Homo sapiens E3 ubiquitin-protein ligase RNF4 Proteins 0.000 description 1
- 101001107084 Homo sapiens E3 ubiquitin-protein ligase RNF5 Proteins 0.000 description 1
- 101001107079 Homo sapiens E3 ubiquitin-protein ligase RNF6 Proteins 0.000 description 1
- 101001107071 Homo sapiens E3 ubiquitin-protein ligase RNF8 Proteins 0.000 description 1
- 101000863869 Homo sapiens E3 ubiquitin-protein ligase SHPRH Proteins 0.000 description 1
- 101000707245 Homo sapiens E3 ubiquitin-protein ligase SIAH2 Proteins 0.000 description 1
- 101000664993 Homo sapiens E3 ubiquitin-protein ligase SMURF1 Proteins 0.000 description 1
- 101000801103 Homo sapiens E3 ubiquitin-protein ligase TM129 Proteins 0.000 description 1
- 101000848625 Homo sapiens E3 ubiquitin-protein ligase TRIM23 Proteins 0.000 description 1
- 101000634991 Homo sapiens E3 ubiquitin-protein ligase TRIM33 Proteins 0.000 description 1
- 101000633723 Homo sapiens E3 ubiquitin-protein ligase TTC3 Proteins 0.000 description 1
- 101000662670 Homo sapiens E3 ubiquitin-protein ligase Topors Proteins 0.000 description 1
- 101000671838 Homo sapiens E3 ubiquitin-protein ligase UBR5 Proteins 0.000 description 1
- 101000818429 Homo sapiens E3 ubiquitin-protein ligase ZFP91 Proteins 0.000 description 1
- 101001038784 Homo sapiens E3 ubiquitin-protein ligase listerin Proteins 0.000 description 1
- 101001018965 Homo sapiens E3 ubiquitin-protein ligase makorin-1 Proteins 0.000 description 1
- 101001018973 Homo sapiens E3 ubiquitin-protein ligase makorin-2 Proteins 0.000 description 1
- 101000619542 Homo sapiens E3 ubiquitin-protein ligase parkin Proteins 0.000 description 1
- 101000703348 Homo sapiens E3 ubiquitin-protein ligase rififylin Proteins 0.000 description 1
- 101000616009 Homo sapiens E3 ubiquitin-protein transferase MAEA Proteins 0.000 description 1
- 101000848655 Homo sapiens E3 ubiquitin/ISG15 ligase TRIM25 Proteins 0.000 description 1
- 101000921326 Homo sapiens EARP and GARP complex-interacting protein 1 Proteins 0.000 description 1
- 101001012951 Homo sapiens EH domain-binding protein 1 Proteins 0.000 description 1
- 101001137983 Homo sapiens EKC/KEOPS complex subunit LAGE3 Proteins 0.000 description 1
- 101001125560 Homo sapiens EKC/KEOPS complex subunit TP53RK Proteins 0.000 description 1
- 101000830812 Homo sapiens EKC/KEOPS complex subunit TPRKB Proteins 0.000 description 1
- 101001057868 Homo sapiens ELMO domain-containing protein 3 Proteins 0.000 description 1
- 101001012120 Homo sapiens EPM2A-interacting protein 1 Proteins 0.000 description 1
- 101000812465 Homo sapiens ER lumen protein-retaining receptor 2 Proteins 0.000 description 1
- 101000896333 Homo sapiens ER membrane protein complex subunit 1 Proteins 0.000 description 1
- 101000880998 Homo sapiens ER membrane protein complex subunit 2 Proteins 0.000 description 1
- 101000877430 Homo sapiens ER membrane protein complex subunit 4 Proteins 0.000 description 1
- 101001048668 Homo sapiens ER membrane protein complex subunit 6 Proteins 0.000 description 1
- 101000925848 Homo sapiens ER membrane protein complex subunit 8 Proteins 0.000 description 1
- 101000925833 Homo sapiens ER membrane protein complex subunit 9 Proteins 0.000 description 1
- 101000938751 Homo sapiens ERI1 exoribonuclease 2 Proteins 0.000 description 1
- 101001010853 Homo sapiens ERO1-like protein alpha Proteins 0.000 description 1
- 101001048716 Homo sapiens ETS domain-containing protein Elk-4 Proteins 0.000 description 1
- 101000813726 Homo sapiens ETS translocation variant 3 Proteins 0.000 description 1
- 101000877377 Homo sapiens ETS-related transcription factor Elf-2 Proteins 0.000 description 1
- 101001057163 Homo sapiens EVI5-like protein Proteins 0.000 description 1
- 101001057942 Homo sapiens Echinoderm microtubule-associated protein-like 2 Proteins 0.000 description 1
- 101001057929 Homo sapiens Echinoderm microtubule-associated protein-like 4 Proteins 0.000 description 1
- 101001057141 Homo sapiens Ecotropic viral integration site 5 protein homolog Proteins 0.000 description 1
- 101001012435 Homo sapiens Ectonucleoside triphosphate diphosphohydrolase 4 Proteins 0.000 description 1
- 101000851972 Homo sapiens Ectonucleoside triphosphate diphosphohydrolase 6 Proteins 0.000 description 1
- 101000881931 Homo sapiens Electron transfer flavoprotein beta subunit lysine methyltransferase Proteins 0.000 description 1
- 101000920909 Homo sapiens Electron transfer flavoprotein regulatory factor 1 Proteins 0.000 description 1
- 101001057122 Homo sapiens Electron transfer flavoprotein subunit beta Proteins 0.000 description 1
- 101000967447 Homo sapiens Elongation factor 1-beta Proteins 0.000 description 1
- 101000895350 Homo sapiens Elongation factor Ts, mitochondrial Proteins 0.000 description 1
- 101000866914 Homo sapiens Elongation factor-like GTPase 1 Proteins 0.000 description 1
- 101000921370 Homo sapiens Elongation of very long chain fatty acids protein 1 Proteins 0.000 description 1
- 101000813117 Homo sapiens Elongator complex protein 1 Proteins 0.000 description 1
- 101000896261 Homo sapiens Elongator complex protein 5 Proteins 0.000 description 1
- 101000896299 Homo sapiens Elongator complex protein 6 Proteins 0.000 description 1
- 101001011859 Homo sapiens Elongin-A Proteins 0.000 description 1
- 101001011846 Homo sapiens Elongin-B Proteins 0.000 description 1
- 101000881731 Homo sapiens Elongin-C Proteins 0.000 description 1
- 101001123823 Homo sapiens Endonuclease 8-like 2 Proteins 0.000 description 1
- 101001137538 Homo sapiens Endonuclease G, mitochondrial Proteins 0.000 description 1
- 101000970385 Homo sapiens Endonuclease III-like protein 1 Proteins 0.000 description 1
- 101000880860 Homo sapiens Endonuclease V Proteins 0.000 description 1
- 101000632553 Homo sapiens Endophilin-A2 Proteins 0.000 description 1
- 101000654648 Homo sapiens Endophilin-B1 Proteins 0.000 description 1
- 101000898750 Homo sapiens Endoplasmic reticulum aminopeptidase 1 Proteins 0.000 description 1
- 101000813998 Homo sapiens Endoplasmic reticulum lectin 1 Proteins 0.000 description 1
- 101000615944 Homo sapiens Endoplasmic reticulum mannosyl-oligosaccharide 1,2-alpha-mannosidase Proteins 0.000 description 1
- 101000588298 Homo sapiens Endoplasmic reticulum membrane sensor NFE2L1 Proteins 0.000 description 1
- 101000920804 Homo sapiens Endoplasmic reticulum-Golgi intermediate compartment protein 1 Proteins 0.000 description 1
- 101000920800 Homo sapiens Endoplasmic reticulum-Golgi intermediate compartment protein 2 Proteins 0.000 description 1
- 101001010804 Homo sapiens Endoplasmic reticulum-Golgi intermediate compartment protein 3 Proteins 0.000 description 1
- 101000907904 Homo sapiens Endoribonuclease Dicer Proteins 0.000 description 1
- 101001051467 Homo sapiens Endoribonuclease LACTB2 Proteins 0.000 description 1
- 101001056455 Homo sapiens Endosome-associated-trafficking regulator 1 Proteins 0.000 description 1
- 101001016384 Homo sapiens Endothelial differentiation-related factor 1 Proteins 0.000 description 1
- 101000841259 Homo sapiens Endothelin-converting enzyme 1 Proteins 0.000 description 1
- 101000880050 Homo sapiens Enhancer of mRNA-decapping protein 3 Proteins 0.000 description 1
- 101000895665 Homo sapiens Enhancer of mRNA-decapping protein 4 Proteins 0.000 description 1
- 101000920634 Homo sapiens Enhancer of polycomb homolog 1 Proteins 0.000 description 1
- 101000920664 Homo sapiens Enhancer of polycomb homolog 2 Proteins 0.000 description 1
- 101000896030 Homo sapiens Enoyl-CoA delta isomerase 1, mitochondrial Proteins 0.000 description 1
- 101000896042 Homo sapiens Enoyl-CoA delta isomerase 2 Proteins 0.000 description 1
- 101000967216 Homo sapiens Eosinophil cationic protein Proteins 0.000 description 1
- 101000812517 Homo sapiens Epidermal growth factor receptor substrate 15 Proteins 0.000 description 1
- 101000979031 Homo sapiens Epididymis-specific alpha-mannosidase Proteins 0.000 description 1
- 101001012105 Homo sapiens Epsin-1 Proteins 0.000 description 1
- 101001010810 Homo sapiens Erbin Proteins 0.000 description 1
- 101000814010 Homo sapiens Erlin-1 Proteins 0.000 description 1
- 101000851719 Homo sapiens Erlin-2 Proteins 0.000 description 1
- 101000851733 Homo sapiens Erythroid membrane-associated protein Proteins 0.000 description 1
- 101000851032 Homo sapiens Ethanolamine kinase 1 Proteins 0.000 description 1
- 101000841277 Homo sapiens Ethylmalonyl-CoA decarboxylase Proteins 0.000 description 1
- 101000895759 Homo sapiens Eukaryotic elongation factor 2 kinase Proteins 0.000 description 1
- 101000959666 Homo sapiens Eukaryotic initiation factor 4A-I Proteins 0.000 description 1
- 101001044466 Homo sapiens Eukaryotic initiation factor 4A-III Proteins 0.000 description 1
- 101000851788 Homo sapiens Eukaryotic peptide chain release factor GTP-binding subunit ERF3A Proteins 0.000 description 1
- 101000938790 Homo sapiens Eukaryotic peptide chain release factor subunit 1 Proteins 0.000 description 1
- 101000615221 Homo sapiens Eukaryotic translation elongation factor 1 epsilon-1 Proteins 0.000 description 1
- 101001020112 Homo sapiens Eukaryotic translation initiation factor 2 subunit 1 Proteins 0.000 description 1
- 101000926530 Homo sapiens Eukaryotic translation initiation factor 2-alpha kinase 1 Proteins 0.000 description 1
- 101000926508 Homo sapiens Eukaryotic translation initiation factor 2-alpha kinase 3 Proteins 0.000 description 1
- 101000896557 Homo sapiens Eukaryotic translation initiation factor 3 subunit B Proteins 0.000 description 1
- 101001034825 Homo sapiens Eukaryotic translation initiation factor 4 gamma 1 Proteins 0.000 description 1
- 101001034811 Homo sapiens Eukaryotic translation initiation factor 4 gamma 2 Proteins 0.000 description 1
- 101001034840 Homo sapiens Eukaryotic translation initiation factor 4 gamma 3 Proteins 0.000 description 1
- 101000840282 Homo sapiens Eukaryotic translation initiation factor 4B Proteins 0.000 description 1
- 101000800021 Homo sapiens Eukaryotic translation initiation factor 4E transporter Proteins 0.000 description 1
- 101001011096 Homo sapiens Eukaryotic translation initiation factor 4E type 2 Proteins 0.000 description 1
- 101000678283 Homo sapiens Eukaryotic translation initiation factor 4E-binding protein 2 Proteins 0.000 description 1
- 101001002481 Homo sapiens Eukaryotic translation initiation factor 5 Proteins 0.000 description 1
- 101001054354 Homo sapiens Eukaryotic translation initiation factor 5A-1 Proteins 0.000 description 1
- 101000959651 Homo sapiens Eukaryotic translation initiation factor 5A-1-like Proteins 0.000 description 1
- 101001036496 Homo sapiens Eukaryotic translation initiation factor 5B Proteins 0.000 description 1
- 101000866489 Homo sapiens Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial Proteins 0.000 description 1
- 101000938454 Homo sapiens Exocyst complex component 1 Proteins 0.000 description 1
- 101000938444 Homo sapiens Exocyst complex component 3 Proteins 0.000 description 1
- 101000911699 Homo sapiens Exocyst complex component 4 Proteins 0.000 description 1
- 101000911670 Homo sapiens Exocyst complex component 6 Proteins 0.000 description 1
- 101000813489 Homo sapiens Exocyst complex component 7 Proteins 0.000 description 1
- 101001011220 Homo sapiens Exonuclease 3'-5' domain-containing protein 2 Proteins 0.000 description 1
- 101000958030 Homo sapiens Exonuclease mut-7 homolog Proteins 0.000 description 1
- 101001029120 Homo sapiens Exosome RNA helicase MTR4 Proteins 0.000 description 1
- 101000882169 Homo sapiens Exosome complex component CSL4 Proteins 0.000 description 1
- 101000882168 Homo sapiens Exosome complex component RRP4 Proteins 0.000 description 1
- 101000882159 Homo sapiens Exosome complex component RRP40 Proteins 0.000 description 1
- 101001055992 Homo sapiens Exosome complex component RRP42 Proteins 0.000 description 1
- 101001055976 Homo sapiens Exosome component 10 Proteins 0.000 description 1
- 101000918275 Homo sapiens Exostosin-2 Proteins 0.000 description 1
- 101000875556 Homo sapiens Exostosin-like 3 Proteins 0.000 description 1
- 101000745703 Homo sapiens Exportin-T Proteins 0.000 description 1
- 101000851525 Homo sapiens Extended synaptotagmin-1 Proteins 0.000 description 1
- 101000938441 Homo sapiens Eyes absent homolog 3 Proteins 0.000 description 1
- 101000892420 Homo sapiens F-BAR and double SH3 domains protein 2 Proteins 0.000 description 1
- 101000933166 Homo sapiens F-actin-capping protein subunit alpha-2 Proteins 0.000 description 1
- 101000793778 Homo sapiens F-actin-capping protein subunit beta Proteins 0.000 description 1
- 101000835691 Homo sapiens F-box-like/WD repeat-containing protein TBL1X Proteins 0.000 description 1
- 101000885591 Homo sapiens F-box/LRR-repeat protein 12 Proteins 0.000 description 1
- 101000862163 Homo sapiens F-box/LRR-repeat protein 20 Proteins 0.000 description 1
- 101001026868 Homo sapiens F-box/LRR-repeat protein 3 Proteins 0.000 description 1
- 101001026867 Homo sapiens F-box/LRR-repeat protein 4 Proteins 0.000 description 1
- 101001026853 Homo sapiens F-box/LRR-repeat protein 5 Proteins 0.000 description 1
- 101001026845 Homo sapiens F-box/LRR-repeat protein 6 Proteins 0.000 description 1
- 101001030696 Homo sapiens F-box/WD repeat-containing protein 11 Proteins 0.000 description 1
- 101001030691 Homo sapiens F-box/WD repeat-containing protein 1A Proteins 0.000 description 1
- 101001060245 Homo sapiens F-box/WD repeat-containing protein 2 Proteins 0.000 description 1
- 101001060231 Homo sapiens F-box/WD repeat-containing protein 7 Proteins 0.000 description 1
- 101001060235 Homo sapiens F-box/WD repeat-containing protein 8 Proteins 0.000 description 1
- 101000836111 Homo sapiens FACT complex subunit SPT16 Proteins 0.000 description 1
- 101000697353 Homo sapiens FACT complex subunit SSRP1 Proteins 0.000 description 1
- 101000848289 Homo sapiens FAD synthase region Proteins 0.000 description 1
- 101000930949 Homo sapiens FAD-dependent oxidoreductase domain-containing protein 1 Proteins 0.000 description 1
- 101000930979 Homo sapiens FAD-dependent oxidoreductase domain-containing protein 2 Proteins 0.000 description 1
- 101000959079 Homo sapiens FAD-linked sulfhydryl oxidase ALR Proteins 0.000 description 1
- 101000911074 Homo sapiens FAS-associated death domain protein Proteins 0.000 description 1
- 101000824586 Homo sapiens FAS-associated factor 2 Proteins 0.000 description 1
- 101001028255 Homo sapiens FAST kinase domain-containing protein 2, mitochondrial Proteins 0.000 description 1
- 101001028251 Homo sapiens FAST kinase domain-containing protein 4 Proteins 0.000 description 1
- 101001028283 Homo sapiens FERM, ARHGEF and pleckstrin domain-containing protein 2 Proteins 0.000 description 1
- 101001031630 Homo sapiens FGGY carbohydrate kinase domain-containing protein Proteins 0.000 description 1
- 101001027535 Homo sapiens FHF complex subunit HOOK interacting protein 1B Proteins 0.000 description 1
- 101001027519 Homo sapiens FHF complex subunit HOOK interacting protein 2A Proteins 0.000 description 1
- 101000891018 Homo sapiens FK506-binding protein 15 Proteins 0.000 description 1
- 101000930670 Homo sapiens FLYWCH family member 2 Proteins 0.000 description 1
- 101000914689 Homo sapiens Fanconi-associated nuclease 1 Proteins 0.000 description 1
- 101000930770 Homo sapiens Far upstream element-binding protein 1 Proteins 0.000 description 1
- 101000930766 Homo sapiens Far upstream element-binding protein 2 Proteins 0.000 description 1
- 101000930753 Homo sapiens Far upstream element-binding protein 3 Proteins 0.000 description 1
- 101001023007 Homo sapiens Farnesyl pyrophosphate synthase Proteins 0.000 description 1
- 101000878509 Homo sapiens Fas apoptotic inhibitory molecule 1 Proteins 0.000 description 1
- 101000917570 Homo sapiens Fas-activated serine/threonine kinase Proteins 0.000 description 1
- 101001027414 Homo sapiens Fasciculation and elongation protein zeta-2 Proteins 0.000 description 1
- 101000780194 Homo sapiens Fatty acid CoA ligase Acsl3 Proteins 0.000 description 1
- 101000912981 Homo sapiens Ferredoxin-2, mitochondrial Proteins 0.000 description 1
- 101001002987 Homo sapiens Ferritin heavy chain Proteins 0.000 description 1
- 101000843611 Homo sapiens Ferrochelatase, mitochondrial Proteins 0.000 description 1
- 101000818410 Homo sapiens Fibroblast growth factor receptor substrate 2 Proteins 0.000 description 1
- 101000913642 Homo sapiens Fibronectin type III domain-containing protein 3B Proteins 0.000 description 1
- 101000913670 Homo sapiens Fibronectin type-III domain-containing protein 3A Proteins 0.000 description 1
- 101001052714 Homo sapiens Fibrosin-1-like protein Proteins 0.000 description 1
- 101000913551 Homo sapiens Filamin-B Proteins 0.000 description 1
- 101000935587 Homo sapiens Flavin reductase (NADPH) Proteins 0.000 description 1
- 101000847538 Homo sapiens Flotillin-1 Proteins 0.000 description 1
- 101000828609 Homo sapiens Flotillin-2 Proteins 0.000 description 1
- 101000861534 Homo sapiens Focadhesin Proteins 0.000 description 1
- 101001059623 Homo sapiens Folliculin-interacting protein 1 Proteins 0.000 description 1
- 101001023393 Homo sapiens Forkhead box protein K2 Proteins 0.000 description 1
- 101000907594 Homo sapiens Forkhead box protein N3 Proteins 0.000 description 1
- 101000861403 Homo sapiens Forkhead box protein P4 Proteins 0.000 description 1
- 101000892778 Homo sapiens Formin-binding protein 4 Proteins 0.000 description 1
- 101000930945 Homo sapiens Fragile X mental retardation syndrome-related protein 1 Proteins 0.000 description 1
- 101000930952 Homo sapiens Fragile X mental retardation syndrome-related protein 2 Proteins 0.000 description 1
- 101001029296 Homo sapiens Fucose-1-phosphate guanylyltransferase Proteins 0.000 description 1
- 101000824573 Homo sapiens Fumarylacetoacetate hydrolase domain-containing protein 2A Proteins 0.000 description 1
- 101000904261 Homo sapiens G patch domain and ankyrin repeat-containing protein 1 Proteins 0.000 description 1
- 101001034100 Homo sapiens G patch domain-containing protein 4 Proteins 0.000 description 1
- 101000900320 Homo sapiens G protein pathway suppressor 2 Proteins 0.000 description 1
- 101001009694 Homo sapiens G-patch domain and KOW motifs-containing protein Proteins 0.000 description 1
- 101001064250 Homo sapiens G-protein coupled receptor-associated protein LMBRD2 Proteins 0.000 description 1
- 101001022105 Homo sapiens GA-binding protein alpha chain Proteins 0.000 description 1
- 101001022098 Homo sapiens GA-binding protein subunit beta-1 Proteins 0.000 description 1
- 101001044724 Homo sapiens GATOR complex protein DEPDC5 Proteins 0.000 description 1
- 101001038863 Homo sapiens GDP-D-glucose phosphorylase 1 Proteins 0.000 description 1
- 101001052793 Homo sapiens GDP-L-fucose synthase Proteins 0.000 description 1
- 101000779347 Homo sapiens GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase Proteins 0.000 description 1
- 101001122376 Homo sapiens GDP-fucose protein O-fucosyltransferase 1 Proteins 0.000 description 1
- 101000585708 Homo sapiens GDP-fucose protein O-fucosyltransferase 2 Proteins 0.000 description 1
- 101000886770 Homo sapiens GH3 domain-containing protein Proteins 0.000 description 1
- 101001040774 Homo sapiens GMP reductase 2 Proteins 0.000 description 1
- 101000857895 Homo sapiens GON-4-like protein Proteins 0.000 description 1
- 101001093751 Homo sapiens GPI ethanolamine phosphate transferase 1 Proteins 0.000 description 1
- 101001093756 Homo sapiens GPI ethanolamine phosphate transferase 3 Proteins 0.000 description 1
- 101000604574 Homo sapiens GPI mannosyltransferase 2 Proteins 0.000 description 1
- 101000595504 Homo sapiens GPI mannosyltransferase 3 Proteins 0.000 description 1
- 101000604563 Homo sapiens GPI transamidase component PIG-T Proteins 0.000 description 1
- 101001071309 Homo sapiens GPI-anchor transamidase Proteins 0.000 description 1
- 101000857481 Homo sapiens GPN-loop GTPase 1 Proteins 0.000 description 1
- 101001068964 Homo sapiens GPN-loop GTPase 3 Proteins 0.000 description 1
- 101001033004 Homo sapiens GRAM domain-containing protein 4 Proteins 0.000 description 1
- 101001037074 Homo sapiens GRB10-interacting GYF protein 2 Proteins 0.000 description 1
- 101000828872 Homo sapiens GTP-binding protein 1 Proteins 0.000 description 1
- 101001071647 Homo sapiens GTP-binding protein 10 Proteins 0.000 description 1
- 101000828886 Homo sapiens GTP-binding protein 4 Proteins 0.000 description 1
- 101001071663 Homo sapiens GTP-binding protein 8 Proteins 0.000 description 1
- 101000574654 Homo sapiens GTP-binding protein Rit1 Proteins 0.000 description 1
- 101000637622 Homo sapiens GTP-binding protein SAR1a Proteins 0.000 description 1
- 101000637633 Homo sapiens GTP-binding protein SAR1b Proteins 0.000 description 1
- 101000584633 Homo sapiens GTPase HRas Proteins 0.000 description 1
- 101000744505 Homo sapiens GTPase NRas Proteins 0.000 description 1
- 101001066325 Homo sapiens GTPase-activating protein and VPS9 domain-containing protein 1 Proteins 0.000 description 1
- 101000860395 Homo sapiens Galactocerebrosidase Proteins 0.000 description 1
- 101000608769 Homo sapiens Galectin-8 Proteins 0.000 description 1
- 101001004750 Homo sapiens Galectin-related protein Proteins 0.000 description 1
- 101001001372 Homo sapiens Gamma-aminobutyric acid receptor-associated protein Proteins 0.000 description 1
- 101000886680 Homo sapiens Gamma-glutamylcyclotransferase Proteins 0.000 description 1
- 101000757496 Homo sapiens Gamma-secretase subunit APH-1A Proteins 0.000 description 1
- 101000702693 Homo sapiens Gamma-soluble NSF attachment protein Proteins 0.000 description 1
- 101000760789 Homo sapiens Gamma-taxilin Proteins 0.000 description 1
- 101001058904 Homo sapiens Gamma-tubulin complex component 2 Proteins 0.000 description 1
- 101001058968 Homo sapiens Gamma-tubulin complex component 3 Proteins 0.000 description 1
- 101001058965 Homo sapiens Gamma-tubulin complex component 4 Proteins 0.000 description 1
- 101000926904 Homo sapiens Gamma-tubulin complex component 5 Proteins 0.000 description 1
- 101000685969 Homo sapiens Ganglioside GM2 activator Proteins 0.000 description 1
- 101000833522 Homo sapiens Ganglioside-induced differentiation-associated protein 2 Proteins 0.000 description 1
- 101000920748 Homo sapiens General transcription and DNA repair factor IIH helicase subunit XPB Proteins 0.000 description 1
- 101000714249 Homo sapiens General transcription factor 3C polypeptide 1 Proteins 0.000 description 1
- 101000714246 Homo sapiens General transcription factor 3C polypeptide 2 Proteins 0.000 description 1
- 101000714253 Homo sapiens General transcription factor 3C polypeptide 3 Proteins 0.000 description 1
- 101000714252 Homo sapiens General transcription factor 3C polypeptide 4 Proteins 0.000 description 1
- 101001032427 Homo sapiens General transcription factor II-I Proteins 0.000 description 1
- 101000903798 Homo sapiens General transcription factor II-I repeat domain-containing protein 1 Proteins 0.000 description 1
- 101000658556 Homo sapiens General transcription factor IIE subunit 1 Proteins 0.000 description 1
- 101000640758 Homo sapiens General transcription factor IIF subunit 1 Proteins 0.000 description 1
- 101000640770 Homo sapiens General transcription factor IIF subunit 2 Proteins 0.000 description 1
- 101000666405 Homo sapiens General transcription factor IIH subunit 1 Proteins 0.000 description 1
- 101000655391 Homo sapiens General transcription factor IIH subunit 3 Proteins 0.000 description 1
- 101000655406 Homo sapiens General transcription factor IIH subunit 4 Proteins 0.000 description 1
- 101001026271 Homo sapiens Genetic suppressor element 1 Proteins 0.000 description 1
- 101000888406 Homo sapiens Geranylgeranyl pyrophosphate synthase Proteins 0.000 description 1
- 101001071129 Homo sapiens Geranylgeranyl transferase type-1 subunit beta Proteins 0.000 description 1
- 101001071139 Homo sapiens Geranylgeranyl transferase type-2 subunit alpha Proteins 0.000 description 1
- 101001129567 Homo sapiens Geranylgeranyl transferase type-2 subunit beta Proteins 0.000 description 1
- 101001039387 Homo sapiens Glia maturation factor beta Proteins 0.000 description 1
- 101000997829 Homo sapiens Glial cell line-derived neurotrophic factor Proteins 0.000 description 1
- 101000926939 Homo sapiens Glucocorticoid receptor Proteins 0.000 description 1
- 101001039324 Homo sapiens Glucosamine-6-phosphate isomerase 1 Proteins 0.000 description 1
- 101001040875 Homo sapiens Glucosidase 2 subunit beta Proteins 0.000 description 1
- 101000906417 Homo sapiens Glucoside xylosyltransferase 1 Proteins 0.000 description 1
- 101000870042 Homo sapiens Glutamate dehydrogenase 1, mitochondrial Proteins 0.000 description 1
- 101001034527 Homo sapiens Glutamate-cysteine ligase catalytic subunit Proteins 0.000 description 1
- 101000870644 Homo sapiens Glutamate-cysteine ligase regulatory subunit Proteins 0.000 description 1
- 101001002170 Homo sapiens Glutamine amidotransferase-like class 1 domain-containing protein 3, mitochondrial Proteins 0.000 description 1
- 101001100728 Homo sapiens Glutamine and serine-rich protein 1 Proteins 0.000 description 1
- 101000997929 Homo sapiens Glutamine-fructose-6-phosphate aminotransferase [isomerizing] 1 Proteins 0.000 description 1
- 101000625192 Homo sapiens Glutamine-tRNA ligase Proteins 0.000 description 1
- 101001073064 Homo sapiens Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial Proteins 0.000 description 1
- 101000887983 Homo sapiens Glutaredoxin-2, mitochondrial Proteins 0.000 description 1
- 101001071851 Homo sapiens Glutaredoxin-3 Proteins 0.000 description 1
- 101000905479 Homo sapiens Glutaredoxin-related protein 5, mitochondrial Proteins 0.000 description 1
- 101001058943 Homo sapiens Glutaryl-CoA dehydrogenase, mitochondrial Proteins 0.000 description 1
- 101000906399 Homo sapiens Glutathione S-transferase Mu 4 Proteins 0.000 description 1
- 101001034434 Homo sapiens Glutathione S-transferase kappa 1 Proteins 0.000 description 1
- 101001014936 Homo sapiens Glutathione peroxidase 1 Proteins 0.000 description 1
- 101000805056 Homo sapiens Glycosaminoglycan xylosylkinase Proteins 0.000 description 1
- 101001072432 Homo sapiens Glycosylphosphatidylinositol anchor attachment 1 protein Proteins 0.000 description 1
- 101001058421 Homo sapiens Glycosyltransferase 8 domain-containing protein 1 Proteins 0.000 description 1
- 101001026170 Homo sapiens Glycosyltransferase-like domain-containing protein 1 Proteins 0.000 description 1
- 101000979544 Homo sapiens Glycylpeptide N-tetradecanoyltransferase 2 Proteins 0.000 description 1
- 101000857136 Homo sapiens Glyoxalase domain-containing protein 4 Proteins 0.000 description 1
- 101001010442 Homo sapiens Glyoxylate reductase/hydroxypyruvate reductase Proteins 0.000 description 1
- 101000829933 Homo sapiens Golgi SNAP receptor complex member 1 Proteins 0.000 description 1
- 101000904234 Homo sapiens Golgi SNAP receptor complex member 2 Proteins 0.000 description 1
- 101000795974 Homo sapiens Golgi apparatus membrane protein TVP23 homolog B Proteins 0.000 description 1
- 101001069963 Homo sapiens Golgi apparatus protein 1 Proteins 0.000 description 1
- 101001040736 Homo sapiens Golgi integral membrane protein 4 Proteins 0.000 description 1
- 101001072495 Homo sapiens Golgi reassembly-stacking protein 2 Proteins 0.000 description 1
- 101000886726 Homo sapiens Golgi to ER traffic protein 4 homolog Proteins 0.000 description 1
- 101001072499 Homo sapiens Golgi-associated PDZ and coiled-coil motif-containing protein Proteins 0.000 description 1
- 101001044070 Homo sapiens Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Proteins 0.000 description 1
- 101000926793 Homo sapiens Golgi-specific brefeldin A-resistance guanine nucleotide exchange factor 1 Proteins 0.000 description 1
- 101001014629 Homo sapiens Golgin subfamily A member 2 Proteins 0.000 description 1
- 101001014634 Homo sapiens Golgin subfamily A member 3 Proteins 0.000 description 1
- 101001014636 Homo sapiens Golgin subfamily A member 4 Proteins 0.000 description 1
- 101001039330 Homo sapiens Golgin subfamily A member 5 Proteins 0.000 description 1
- 101001039317 Homo sapiens Golgin subfamily A member 7 Proteins 0.000 description 1
- 101001039321 Homo sapiens Golgin subfamily B member 1 Proteins 0.000 description 1
- 101000870788 Homo sapiens Granule associated Rac and RHOG effector protein 1 Proteins 0.000 description 1
- 101000886768 Homo sapiens Growth hormone-inducible transmembrane protein Proteins 0.000 description 1
- 101000581349 Homo sapiens Guanine nucleotide exchange factor subunit RIC1 Proteins 0.000 description 1
- 101001024316 Homo sapiens Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-1 Proteins 0.000 description 1
- 101001024278 Homo sapiens Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-2 Proteins 0.000 description 1
- 101000997034 Homo sapiens Guanine nucleotide-binding protein G(i) subunit alpha-3 Proteins 0.000 description 1
- 101000857888 Homo sapiens Guanine nucleotide-binding protein G(q) subunit alpha Proteins 0.000 description 1
- 101001014590 Homo sapiens Guanine nucleotide-binding protein G(s) subunit alpha isoforms XLas Proteins 0.000 description 1
- 101001014594 Homo sapiens Guanine nucleotide-binding protein G(s) subunit alpha isoforms short Proteins 0.000 description 1
- 101001072481 Homo sapiens Guanine nucleotide-binding protein subunit alpha-13 Proteins 0.000 description 1
- 101001040748 Homo sapiens Guanine nucleotide-binding protein-like 3 Proteins 0.000 description 1
- 101001040761 Homo sapiens Guanine nucleotide-binding protein-like 3-like protein Proteins 0.000 description 1
- 101000614191 Homo sapiens Guanylate kinase Proteins 0.000 description 1
- 101000926251 Homo sapiens Gypsy retrotransposon integrase-like protein 1 Proteins 0.000 description 1
- 101000710223 Homo sapiens H(+)/Cl(-) exchange transporter 3 Proteins 0.000 description 1
- 101000710240 Homo sapiens H(+)/Cl(-) exchange transporter 6 Proteins 0.000 description 1
- 101000766971 Homo sapiens H(+)/Cl(-) exchange transporter 7 Proteins 0.000 description 1
- 101000994912 Homo sapiens H/ACA ribonucleoprotein complex subunit 2 Proteins 0.000 description 1
- 101000844866 Homo sapiens H/ACA ribonucleoprotein complex subunit DKC1 Proteins 0.000 description 1
- 101001035826 Homo sapiens HAUS augmin-like complex subunit 2 Proteins 0.000 description 1
- 101001035823 Homo sapiens HAUS augmin-like complex subunit 4 Proteins 0.000 description 1
- 101001035815 Homo sapiens HAUS augmin-like complex subunit 6 Proteins 0.000 description 1
- 101001035814 Homo sapiens HAUS augmin-like complex subunit 7 Proteins 0.000 description 1
- 101001009070 Homo sapiens HBS1-like protein Proteins 0.000 description 1
- 101001068173 Homo sapiens HCLS1-associated protein X-1 Proteins 0.000 description 1
- 101000839976 Homo sapiens HEAT repeat-containing protein 5A Proteins 0.000 description 1
- 101001021492 Homo sapiens HERV-H LTR-associating protein 3 Proteins 0.000 description 1
- 101001066429 Homo sapiens HIG1 domain family member 1A, mitochondrial Proteins 0.000 description 1
- 101000993314 Homo sapiens HIRA-interacting protein 3 Proteins 0.000 description 1
- 101001035846 Homo sapiens HMG box-containing protein 1 Proteins 0.000 description 1
- 101001006302 Homo sapiens HMG domain-containing protein 3 Proteins 0.000 description 1
- 101001006303 Homo sapiens HMG domain-containing protein 4 Proteins 0.000 description 1
- 101000872857 Homo sapiens Haloacid dehalogenase-like hydrolase domain-containing 5 Proteins 0.000 description 1
- 101001041756 Homo sapiens Heat shock 70 kDa protein 14 Proteins 0.000 description 1
- 101001078692 Homo sapiens Heat shock 70 kDa protein 4 Proteins 0.000 description 1
- 101001080568 Homo sapiens Heat shock cognate 71 kDa protein Proteins 0.000 description 1
- 101000867525 Homo sapiens Heat shock factor protein 1 Proteins 0.000 description 1
- 101001080298 Homo sapiens Heat shock factor-binding protein 1 Proteins 0.000 description 1
- 101001016856 Homo sapiens Heat shock protein HSP 90-beta Proteins 0.000 description 1
- 101000685287 Homo sapiens Helicase ARIP4 Proteins 0.000 description 1
- 101000863680 Homo sapiens Helicase SKI2W Proteins 0.000 description 1
- 101000704158 Homo sapiens Helicase SRCAP Proteins 0.000 description 1
- 101001079615 Homo sapiens Heme oxygenase 2 Proteins 0.000 description 1
- 101000843842 Homo sapiens Heme-binding protein 1 Proteins 0.000 description 1
- 101000588589 Homo sapiens Heparan sulfate N-sulfotransferase 1 Proteins 0.000 description 1
- 101000588595 Homo sapiens Heparan sulfate N-sulfotransferase 2 Proteins 0.000 description 1
- 101001035618 Homo sapiens Heparan-sulfate 6-O-sulfotransferase 1 Proteins 0.000 description 1
- 101000838926 Homo sapiens Hermansky-Pudlak syndrome 1 protein Proteins 0.000 description 1
- 101001025546 Homo sapiens Heterochromatin protein 1-binding protein 3 Proteins 0.000 description 1
- 101000854036 Homo sapiens Heterogeneous nuclear ribonucleoprotein A/B Proteins 0.000 description 1
- 101001081145 Homo sapiens Heterogeneous nuclear ribonucleoprotein D-like Proteins 0.000 description 1
- 101001017535 Homo sapiens Heterogeneous nuclear ribonucleoprotein D0 Proteins 0.000 description 1
- 101001017544 Homo sapiens Heterogeneous nuclear ribonucleoprotein F Proteins 0.000 description 1
- 101001081149 Homo sapiens Heterogeneous nuclear ribonucleoprotein H Proteins 0.000 description 1
- 101001081143 Homo sapiens Heterogeneous nuclear ribonucleoprotein H2 Proteins 0.000 description 1
- 101001017561 Homo sapiens Heterogeneous nuclear ribonucleoprotein H3 Proteins 0.000 description 1
- 101000838964 Homo sapiens Heterogeneous nuclear ribonucleoprotein K Proteins 0.000 description 1
- 101000839078 Homo sapiens Heterogeneous nuclear ribonucleoprotein L Proteins 0.000 description 1
- 101001017573 Homo sapiens Heterogeneous nuclear ribonucleoprotein L-like Proteins 0.000 description 1
- 101000839073 Homo sapiens Heterogeneous nuclear ribonucleoprotein M Proteins 0.000 description 1
- 101000839069 Homo sapiens Heterogeneous nuclear ribonucleoprotein Q Proteins 0.000 description 1
- 101001047853 Homo sapiens Heterogeneous nuclear ribonucleoprotein R Proteins 0.000 description 1
- 101001047854 Homo sapiens Heterogeneous nuclear ribonucleoprotein U Proteins 0.000 description 1
- 101001017570 Homo sapiens Heterogeneous nuclear ribonucleoprotein U-like protein 2 Proteins 0.000 description 1
- 101001017574 Homo sapiens Heterogeneous nuclear ribonucleoproteins C1/C2 Proteins 0.000 description 1
- 101001117261 Homo sapiens High affinity cAMP-specific and IBMX-insensitive 3',5'-cyclic phosphodiesterase 8A Proteins 0.000 description 1
- 101000866771 Homo sapiens High mobility group nucleosome-binding domain-containing protein 3 Proteins 0.000 description 1
- 101000843187 Homo sapiens Histidine-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 101000696493 Homo sapiens Histidine-tRNA ligase, mitochondrial Proteins 0.000 description 1
- 101001084711 Homo sapiens Histone H2A.V Proteins 0.000 description 1
- 101000905054 Homo sapiens Histone H2A.Z Proteins 0.000 description 1
- 101001067891 Homo sapiens Histone H2AX Proteins 0.000 description 1
- 101001084682 Homo sapiens Histone H2B type 1-C/E/F/G/I Proteins 0.000 description 1
- 101000842273 Homo sapiens Histone H4 transcription factor Proteins 0.000 description 1
- 101001047783 Homo sapiens Histone PARylation factor 1 Proteins 0.000 description 1
- 101000825762 Homo sapiens Histone RNA hairpin-binding protein Proteins 0.000 description 1
- 101001047006 Homo sapiens Histone acetyltransferase KAT2B Proteins 0.000 description 1
- 101001046996 Homo sapiens Histone acetyltransferase KAT5 Proteins 0.000 description 1
- 101000944179 Homo sapiens Histone acetyltransferase KAT6A Proteins 0.000 description 1
- 101000944174 Homo sapiens Histone acetyltransferase KAT6B Proteins 0.000 description 1
- 101000944166 Homo sapiens Histone acetyltransferase KAT7 Proteins 0.000 description 1
- 101000898976 Homo sapiens Histone acetyltransferase type B catalytic subunit Proteins 0.000 description 1
- 101000923139 Homo sapiens Histone chaperone ASF1A Proteins 0.000 description 1
- 101001035011 Homo sapiens Histone deacetylase 2 Proteins 0.000 description 1
- 101000899282 Homo sapiens Histone deacetylase 3 Proteins 0.000 description 1
- 101000899330 Homo sapiens Histone deacetylase 6 Proteins 0.000 description 1
- 101001032118 Homo sapiens Histone deacetylase 8 Proteins 0.000 description 1
- 101000693664 Homo sapiens Histone deacetylase complex subunit SAP18 Proteins 0.000 description 1
- 101000686001 Homo sapiens Histone deacetylase complex subunit SAP30 Proteins 0.000 description 1
- 101000877314 Homo sapiens Histone-lysine N-methyltransferase EHMT1 Proteins 0.000 description 1
- 101000877312 Homo sapiens Histone-lysine N-methyltransferase EHMT2 Proteins 0.000 description 1
- 101001008821 Homo sapiens Histone-lysine N-methyltransferase KMT5B Proteins 0.000 description 1
- 101000634048 Homo sapiens Histone-lysine N-methyltransferase NSD2 Proteins 0.000 description 1
- 101000865038 Homo sapiens Histone-lysine N-methyltransferase SETD1A Proteins 0.000 description 1
- 101000864672 Homo sapiens Histone-lysine N-methyltransferase SETD1B Proteins 0.000 description 1
- 101000654725 Homo sapiens Histone-lysine N-methyltransferase SETD2 Proteins 0.000 description 1
- 101000650669 Homo sapiens Histone-lysine N-methyltransferase SETD5 Proteins 0.000 description 1
- 101000684609 Homo sapiens Histone-lysine N-methyltransferase SETDB1 Proteins 0.000 description 1
- 101000684615 Homo sapiens Histone-lysine N-methyltransferase SETDB2 Proteins 0.000 description 1
- 101000708574 Homo sapiens Histone-lysine N-methyltransferase SMYD3 Proteins 0.000 description 1
- 101000696705 Homo sapiens Histone-lysine N-methyltransferase SUV39H1 Proteins 0.000 description 1
- 101000835819 Homo sapiens Histone-lysine N-trimethyltransferase SMYD5 Proteins 0.000 description 1
- 101000632178 Homo sapiens Homeobox protein Nkx-2.1 Proteins 0.000 description 1
- 101000726740 Homo sapiens Homeobox protein cut-like 1 Proteins 0.000 description 1
- 101001006354 Homo sapiens Homeobox-containing protein 1 Proteins 0.000 description 1
- 101001066389 Homo sapiens Homeodomain-interacting protein kinase 3 Proteins 0.000 description 1
- 101001048461 Homo sapiens Homer protein homolog 3 Proteins 0.000 description 1
- 101001035137 Homo sapiens Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 1 protein Proteins 0.000 description 1
- 101001025416 Homo sapiens Homologous-pairing protein 2 homolog Proteins 0.000 description 1
- 101000988793 Homo sapiens Host cell factor C1 regulator 1 Proteins 0.000 description 1
- 101000777670 Homo sapiens Hsp90 co-chaperone Cdc37 Proteins 0.000 description 1
- 101000777624 Homo sapiens Hsp90 co-chaperone Cdc37-like 1 Proteins 0.000 description 1
- 101001021527 Homo sapiens Huntingtin-interacting protein 1 Proteins 0.000 description 1
- 101000962372 Homo sapiens Huntingtin-interacting protein K Proteins 0.000 description 1
- 101001083553 Homo sapiens Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial Proteins 0.000 description 1
- 101001040270 Homo sapiens Hydroxyacylglutathione hydrolase, mitochondrial Proteins 0.000 description 1
- 101001041112 Homo sapiens Hydroxylysine kinase Proteins 0.000 description 1
- 101001047912 Homo sapiens Hydroxymethylglutaryl-CoA lyase, mitochondrial Proteins 0.000 description 1
- 101000928767 Homo sapiens Hydroxysteroid 11-beta-dehydrogenase 1-like protein Proteins 0.000 description 1
- 101001042781 Homo sapiens Hydroxysteroid dehydrogenase-like protein 2 Proteins 0.000 description 1
- 101000988834 Homo sapiens Hypoxanthine-guanine phosphoribosyltransferase Proteins 0.000 description 1
- 101001082574 Homo sapiens Hypoxia-inducible factor 1-alpha inhibitor Proteins 0.000 description 1
- 101100286226 Homo sapiens IBTK gene Proteins 0.000 description 1
- 101001076297 Homo sapiens IGF-like family receptor 1 Proteins 0.000 description 1
- 101001011412 Homo sapiens IQ calmodulin-binding motif-containing protein 1 Proteins 0.000 description 1
- 101001077644 Homo sapiens IQ motif and SEC7 domain-containing protein 1 Proteins 0.000 description 1
- 101001050487 Homo sapiens IST1 homolog Proteins 0.000 description 1
- 101000994012 Homo sapiens Immediate early response 3-interacting protein 1 Proteins 0.000 description 1
- 101001032368 Homo sapiens Immunity-related GTPase family Q protein Proteins 0.000 description 1
- 101001001478 Homo sapiens Importin subunit alpha-3 Proteins 0.000 description 1
- 101001001473 Homo sapiens Importin subunit alpha-4 Proteins 0.000 description 1
- 101001054793 Homo sapiens Importin subunit alpha-7 Proteins 0.000 description 1
- 101000648617 Homo sapiens Inactive C-alpha-formylglycine-generating enzyme 2 Proteins 0.000 description 1
- 101001042782 Homo sapiens Inactive hydroxysteroid dehydrogenase-like protein 1 Proteins 0.000 description 1
- 101000649963 Homo sapiens Inactive serine/threonine-protein kinase VRK3 Proteins 0.000 description 1
- 101001056180 Homo sapiens Induced myeloid leukemia cell differentiation protein Mcl-1 Proteins 0.000 description 1
- 101001053708 Homo sapiens Inhibitor of growth protein 2 Proteins 0.000 description 1
- 101001001418 Homo sapiens Inhibitor of growth protein 4 Proteins 0.000 description 1
- 101001043764 Homo sapiens Inhibitor of nuclear factor kappa-B kinase subunit alpha Proteins 0.000 description 1
- 101000960484 Homo sapiens Inner centromere protein Proteins 0.000 description 1
- 101001059713 Homo sapiens Inner nuclear membrane protein Man1 Proteins 0.000 description 1
- 101000994880 Homo sapiens Inorganic pyrophosphatase 2, mitochondrial Proteins 0.000 description 1
- 101001056794 Homo sapiens Inosine triphosphate pyrophosphatase Proteins 0.000 description 1
- 101001076642 Homo sapiens Inosine-5'-monophosphate dehydrogenase 2 Proteins 0.000 description 1
- 101000975421 Homo sapiens Inositol 1,4,5-trisphosphate receptor type 2 Proteins 0.000 description 1
- 101001033889 Homo sapiens Inositol 1,4,5-trisphosphate receptor-interacting protein-like 2 Proteins 0.000 description 1
- 101000953492 Homo sapiens Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Proteins 0.000 description 1
- 101000953488 Homo sapiens Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 2 Proteins 0.000 description 1
- 101001011985 Homo sapiens Inositol hexakisphosphate kinase 1 Proteins 0.000 description 1
- 101001011989 Homo sapiens Inositol hexakisphosphate kinase 2 Proteins 0.000 description 1
- 101001054823 Homo sapiens Inositol polyphosphate 1-phosphatase Proteins 0.000 description 1
- 101001053320 Homo sapiens Inositol polyphosphate 5-phosphatase K Proteins 0.000 description 1
- 101000962413 Homo sapiens Inositol polyphosphate-5-phosphatase A Proteins 0.000 description 1
- 101001046674 Homo sapiens Inositol-tetrakisphosphate 1-kinase Proteins 0.000 description 1
- 101000852815 Homo sapiens Insulin receptor Proteins 0.000 description 1
- 101000599629 Homo sapiens Insulin-induced gene 2 protein Proteins 0.000 description 1
- 101000680180 Homo sapiens Insulin-like growth factor-binding protein 3 receptor Proteins 0.000 description 1
- 101000998810 Homo sapiens Insulin-like peptide INSL6 Proteins 0.000 description 1
- 101001003262 Homo sapiens Integral membrane protein DGCR2/IDD Proteins 0.000 description 1
- 101001000784 Homo sapiens Integral membrane protein GPR137 Proteins 0.000 description 1
- 101001039295 Homo sapiens Integral membrane protein GPR155 Proteins 0.000 description 1
- 101001053790 Homo sapiens Integrator complex subunit 1 Proteins 0.000 description 1
- 101001053423 Homo sapiens Integrator complex subunit 11 Proteins 0.000 description 1
- 101000599647 Homo sapiens Integrator complex subunit 12 Proteins 0.000 description 1
- 101001054651 Homo sapiens Integrator complex subunit 14 Proteins 0.000 description 1
- 101001033788 Homo sapiens Integrator complex subunit 6 Proteins 0.000 description 1
- 101001011755 Homo sapiens Integrator complex subunit 7 Proteins 0.000 description 1
- 101001011746 Homo sapiens Integrator complex subunit 8 Proteins 0.000 description 1
- 101001011825 Homo sapiens Integrator complex subunit 9 Proteins 0.000 description 1
- 101001046687 Homo sapiens Integrin alpha-E Proteins 0.000 description 1
- 101001046677 Homo sapiens Integrin alpha-V Proteins 0.000 description 1
- 101000935043 Homo sapiens Integrin beta-1 Proteins 0.000 description 1
- 101000997642 Homo sapiens Integrin beta-1-binding protein 1 Proteins 0.000 description 1
- 101000852870 Homo sapiens Interferon alpha/beta receptor 1 Proteins 0.000 description 1
- 101001001420 Homo sapiens Interferon gamma receptor 1 Proteins 0.000 description 1
- 101001011393 Homo sapiens Interferon regulatory factor 2 Proteins 0.000 description 1
- 101001077842 Homo sapiens Interferon regulatory factor 2-binding protein 1 Proteins 0.000 description 1
- 101001077835 Homo sapiens Interferon regulatory factor 2-binding protein 2 Proteins 0.000 description 1
- 101001011382 Homo sapiens Interferon regulatory factor 3 Proteins 0.000 description 1
- 101001032341 Homo sapiens Interferon regulatory factor 9 Proteins 0.000 description 1
- 101000998500 Homo sapiens Interferon-induced 35 kDa protein Proteins 0.000 description 1
- 101001125123 Homo sapiens Interferon-inducible double-stranded RNA-dependent protein kinase activator A Proteins 0.000 description 1
- 101000999377 Homo sapiens Interferon-related developmental regulator 1 Proteins 0.000 description 1
- 101000999373 Homo sapiens Interferon-related developmental regulator 2 Proteins 0.000 description 1
- 101000852483 Homo sapiens Interleukin-1 receptor-associated kinase 1 Proteins 0.000 description 1
- 101000977771 Homo sapiens Interleukin-1 receptor-associated kinase 4 Proteins 0.000 description 1
- 101001003147 Homo sapiens Interleukin-11 receptor subunit alpha Proteins 0.000 description 1
- 101001003135 Homo sapiens Interleukin-13 receptor subunit alpha-1 Proteins 0.000 description 1
- 101001019602 Homo sapiens Interleukin-17 receptor C Proteins 0.000 description 1
- 101000599056 Homo sapiens Interleukin-6 receptor subunit beta Proteins 0.000 description 1
- 101001056724 Homo sapiens Intersectin-1 Proteins 0.000 description 1
- 101001056699 Homo sapiens Intersectin-2 Proteins 0.000 description 1
- 101001055333 Homo sapiens Intraflagellar transport protein 20 homolog Proteins 0.000 description 1
- 101000961164 Homo sapiens Intraflagellar transport protein 43 homolog Proteins 0.000 description 1
- 101001044432 Homo sapiens Intraflagellar transport protein 46 homolog Proteins 0.000 description 1
- 101000862611 Homo sapiens Intron Large complex component GCFC2 Proteins 0.000 description 1
- 101000998711 Homo sapiens Inversin Proteins 0.000 description 1
- 101001012154 Homo sapiens Inverted formin-2 Proteins 0.000 description 1
- 101001032502 Homo sapiens Iron-sulfur cluster assembly enzyme ISCU, mitochondrial Proteins 0.000 description 1
- 101000677891 Homo sapiens Iron-sulfur clusters transporter ABCB7, mitochondrial Proteins 0.000 description 1
- 101000677562 Homo sapiens Isobutyryl-CoA dehydrogenase, mitochondrial Proteins 0.000 description 1
- 101000994195 Homo sapiens Isochorismatase domain-containing protein 1 Proteins 0.000 description 1
- 101000994186 Homo sapiens Isochorismatase domain-containing protein 2 Proteins 0.000 description 1
- 101001042036 Homo sapiens Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial Proteins 0.000 description 1
- 101001042038 Homo sapiens Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Proteins 0.000 description 1
- 101000960245 Homo sapiens Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial Proteins 0.000 description 1
- 101001081533 Homo sapiens Isopentenyl-diphosphate Delta-isomerase 1 Proteins 0.000 description 1
- 101000975533 Homo sapiens JmjC domain-containing protein 8 Proteins 0.000 description 1
- 101000994432 Homo sapiens Josephin-1 Proteins 0.000 description 1
- 101000994428 Homo sapiens Josephin-2 Proteins 0.000 description 1
- 101001046964 Homo sapiens KAT8 regulatory NSL complex subunit 2 Proteins 0.000 description 1
- 101001026582 Homo sapiens KAT8 regulatory NSL complex subunit 3 Proteins 0.000 description 1
- 101001050616 Homo sapiens KH domain-containing, RNA-binding, signal transduction-associated protein 1 Proteins 0.000 description 1
- 101000971797 Homo sapiens KH homology domain-containing protein 4 Proteins 0.000 description 1
- 101000834851 Homo sapiens KICSTOR complex protein SZT2 Proteins 0.000 description 1
- 101001051753 Homo sapiens KICSTOR complex protein kaptin Proteins 0.000 description 1
- 101001026902 Homo sapiens KRAB domain-containing protein 4 Proteins 0.000 description 1
- 101001026904 Homo sapiens KRAB domain-containing protein 5 Proteins 0.000 description 1
- 101001050038 Homo sapiens Kalirin Proteins 0.000 description 1
- 101001057012 Homo sapiens Katanin-interacting protein Proteins 0.000 description 1
- 101000945438 Homo sapiens Kelch domain-containing protein 2 Proteins 0.000 description 1
- 101000945443 Homo sapiens Kelch domain-containing protein 4 Proteins 0.000 description 1
- 101000997318 Homo sapiens Kelch repeat and BTB domain-containing protein 2 Proteins 0.000 description 1
- 101001047009 Homo sapiens Kelch repeat and BTB domain-containing protein 4 Proteins 0.000 description 1
- 101001049204 Homo sapiens Kelch-like protein 20 Proteins 0.000 description 1
- 101001006878 Homo sapiens Kelch-like protein 24 Proteins 0.000 description 1
- 101000945211 Homo sapiens Kelch-like protein 28 Proteins 0.000 description 1
- 101001008853 Homo sapiens Kelch-like protein 5 Proteins 0.000 description 1
- 101000975474 Homo sapiens Keratin, type I cytoskeletal 10 Proteins 0.000 description 1
- 101001090172 Homo sapiens Kinectin Proteins 0.000 description 1
- 101001006782 Homo sapiens Kinesin-associated protein 3 Proteins 0.000 description 1
- 101001091266 Homo sapiens Kinesin-like protein KIF13A Proteins 0.000 description 1
- 101001091256 Homo sapiens Kinesin-like protein KIF13B Proteins 0.000 description 1
- 101001138875 Homo sapiens Kinesin-like protein KIF3B Proteins 0.000 description 1
- 101001053809 Homo sapiens Kinetochore-associated protein DSN1 homolog Proteins 0.000 description 1
- 101001108770 Homo sapiens Kinetochore-associated protein NSL1 homolog Proteins 0.000 description 1
- 101001006892 Homo sapiens Krueppel-like factor 10 Proteins 0.000 description 1
- 101001006895 Homo sapiens Krueppel-like factor 11 Proteins 0.000 description 1
- 101001139136 Homo sapiens Krueppel-like factor 3 Proteins 0.000 description 1
- 101001139112 Homo sapiens Krueppel-like factor 9 Proteins 0.000 description 1
- 101001021821 Homo sapiens KxDL motif-containing protein 1 Proteins 0.000 description 1
- 101000614821 Homo sapiens Kynurenine-oxoglutarate transaminase 1 Proteins 0.000 description 1
- 101001046999 Homo sapiens Kynurenine-oxoglutarate transaminase 3 Proteins 0.000 description 1
- 101000718476 Homo sapiens L-aminoadipate-semialdehyde dehydrogenase-phosphopantetheinyl transferase Proteins 0.000 description 1
- 101001090713 Homo sapiens L-lactate dehydrogenase A chain Proteins 0.000 description 1
- 101100454393 Homo sapiens LCOR gene Proteins 0.000 description 1
- 101001007417 Homo sapiens LEM domain-containing protein 2 Proteins 0.000 description 1
- 101000956778 Homo sapiens LETM1 domain-containing protein 1 Proteins 0.000 description 1
- 101001004313 Homo sapiens LHFPL tetraspan subfamily member 2 protein Proteins 0.000 description 1
- 101001042351 Homo sapiens LIM and senescent cell antigen-like-containing domain protein 1 Proteins 0.000 description 1
- 101001005528 Homo sapiens LYR motif-containing protein 4 Proteins 0.000 description 1
- 101001138022 Homo sapiens La-related protein 1 Proteins 0.000 description 1
- 101001138020 Homo sapiens La-related protein 4 Proteins 0.000 description 1
- 101001010164 Homo sapiens La-related protein 4B Proteins 0.000 description 1
- 101001008442 Homo sapiens La-related protein 7 Proteins 0.000 description 1
- 101001047746 Homo sapiens Lamina-associated polypeptide 2, isoform alpha Proteins 0.000 description 1
- 101001047731 Homo sapiens Lamina-associated polypeptide 2, isoforms beta/gamma Proteins 0.000 description 1
- 101000896726 Homo sapiens Lanosterol 14-alpha demethylase Proteins 0.000 description 1
- 101000697493 Homo sapiens Large proline-rich protein BAG6 Proteins 0.000 description 1
- 101001041031 Homo sapiens Lariat debranching enzyme Proteins 0.000 description 1
- 101000730000 Homo sapiens Late secretory pathway protein AVL9 homolog Proteins 0.000 description 1
- 101000585618 Homo sapiens Leptin receptor gene-related protein Proteins 0.000 description 1
- 101000966275 Homo sapiens Lethal(3)malignant brain tumor-like protein 3 Proteins 0.000 description 1
- 101001042527 Homo sapiens Leucine carboxyl methyltransferase 1 Proteins 0.000 description 1
- 101001065853 Homo sapiens Leucine repeat adapter protein 25 Proteins 0.000 description 1
- 101001054841 Homo sapiens Leucine zipper protein 6 Proteins 0.000 description 1
- 101000941884 Homo sapiens Leucine-rich repeat flightless-interacting protein 2 Proteins 0.000 description 1
- 101000703761 Homo sapiens Leucine-rich repeat protein SHOC-2 Proteins 0.000 description 1
- 101001017864 Homo sapiens Leucine-rich repeat-containing protein 14 Proteins 0.000 description 1
- 101001039167 Homo sapiens Leucine-rich repeat-containing protein 24 Proteins 0.000 description 1
- 101000972549 Homo sapiens Leucine-rich repeat-containing protein 37A2 Proteins 0.000 description 1
- 101000579894 Homo sapiens Leucine-rich repeat-containing protein 39 Proteins 0.000 description 1
- 101000984851 Homo sapiens Leucine-rich repeat-containing protein 40 Proteins 0.000 description 1
- 101000984848 Homo sapiens Leucine-rich repeat-containing protein 41 Proteins 0.000 description 1
- 101000984841 Homo sapiens Leucine-rich repeat-containing protein 42 Proteins 0.000 description 1
- 101000619640 Homo sapiens Leucine-rich repeats and immunoglobulin-like domains protein 1 Proteins 0.000 description 1
- 101000619642 Homo sapiens Leucine-rich repeats and immunoglobulin-like domains protein 2 Proteins 0.000 description 1
- 101000624540 Homo sapiens Leucine-tRNA ligase, mitochondrial Proteins 0.000 description 1
- 101001009985 Homo sapiens Leydig cell tumor 10 kDa protein homolog Proteins 0.000 description 1
- 101000605076 Homo sapiens Ligand-dependent nuclear receptor corepressor-like protein Proteins 0.000 description 1
- 101000619643 Homo sapiens Ligand-dependent nuclear receptor-interacting factor 1 Proteins 0.000 description 1
- 101001017764 Homo sapiens Lipopolysaccharide-responsive and beige-like anchor protein Proteins 0.000 description 1
- 101001005211 Homo sapiens Lipoyltransferase 1, mitochondrial Proteins 0.000 description 1
- 101001064427 Homo sapiens Liprin-beta-2 Proteins 0.000 description 1
- 101001036256 Homo sapiens Little elongation complex subunit 1 Proteins 0.000 description 1
- 101001036258 Homo sapiens Little elongation complex subunit 2 Proteins 0.000 description 1
- 101000938676 Homo sapiens Liver carboxylesterase 1 Proteins 0.000 description 1
- 101000841267 Homo sapiens Long chain 3-hydroxyacyl-CoA dehydrogenase Proteins 0.000 description 1
- 101000780208 Homo sapiens Long-chain-fatty-acid-CoA ligase 4 Proteins 0.000 description 1
- 101000923835 Homo sapiens Low density lipoprotein receptor adapter protein 1 Proteins 0.000 description 1
- 101000611240 Homo sapiens Low molecular weight phosphotyrosine protein phosphatase Proteins 0.000 description 1
- 101001043596 Homo sapiens Low-density lipoprotein receptor-related protein 3 Proteins 0.000 description 1
- 101001039199 Homo sapiens Low-density lipoprotein receptor-related protein 6 Proteins 0.000 description 1
- 101001008498 Homo sapiens Luc7-like protein 3 Proteins 0.000 description 1
- 101001063392 Homo sapiens Lymphocyte function-associated antigen 3 Proteins 0.000 description 1
- 101000871869 Homo sapiens Lys-63-specific deubiquitinase BRCC36 Proteins 0.000 description 1
- 101001026900 Homo sapiens Lysine-rich coiled-coil protein 1 Proteins 0.000 description 1
- 101000971423 Homo sapiens Lysine-rich nucleolar protein 1 Proteins 0.000 description 1
- 101000613958 Homo sapiens Lysine-specific demethylase 2A Proteins 0.000 description 1
- 101000614013 Homo sapiens Lysine-specific demethylase 2B Proteins 0.000 description 1
- 101000614017 Homo sapiens Lysine-specific demethylase 3A Proteins 0.000 description 1
- 101000614020 Homo sapiens Lysine-specific demethylase 3B Proteins 0.000 description 1
- 101000613625 Homo sapiens Lysine-specific demethylase 4A Proteins 0.000 description 1
- 101000613629 Homo sapiens Lysine-specific demethylase 4B Proteins 0.000 description 1
- 101001088893 Homo sapiens Lysine-specific demethylase 4C Proteins 0.000 description 1
- 101001088892 Homo sapiens Lysine-specific demethylase 5A Proteins 0.000 description 1
- 101001088887 Homo sapiens Lysine-specific demethylase 5C Proteins 0.000 description 1
- 101000692954 Homo sapiens Lysine-specific demethylase PHF2 Proteins 0.000 description 1
- 101001050886 Homo sapiens Lysine-specific histone demethylase 1A Proteins 0.000 description 1
- 101001047677 Homo sapiens Lysocardiolipin acyltransferase 1 Proteins 0.000 description 1
- 101000620894 Homo sapiens Lysophosphatidic acid phosphatase type 6 Proteins 0.000 description 1
- 101000742901 Homo sapiens Lysophosphatidylserine lipase ABHD12 Proteins 0.000 description 1
- 101001039669 Homo sapiens Lysophospholipid acyltransferase 5 Proteins 0.000 description 1
- 101001001294 Homo sapiens Lysosomal acid phosphatase Proteins 0.000 description 1
- 101001090454 Homo sapiens Lysosomal amino acid transporter 1 homolog Proteins 0.000 description 1
- 101000783776 Homo sapiens Lysosomal cobalamin transporter ABCD4 Proteins 0.000 description 1
- 101000946053 Homo sapiens Lysosomal-associated transmembrane protein 4A Proteins 0.000 description 1
- 101001115417 Homo sapiens M-phase phosphoprotein 8 Proteins 0.000 description 1
- 101000957257 Homo sapiens MAD2L1-binding protein Proteins 0.000 description 1
- 101000573522 Homo sapiens MAP kinase-interacting serine/threonine-protein kinase 1 Proteins 0.000 description 1
- 101001059429 Homo sapiens MAP/microtubule affinity-regulating kinase 3 Proteins 0.000 description 1
- 101001059427 Homo sapiens MAP/microtubule affinity-regulating kinase 4 Proteins 0.000 description 1
- 101001093139 Homo sapiens MAU2 chromatid cohesion factor homolog Proteins 0.000 description 1
- 101100345091 Homo sapiens MEPCE gene Proteins 0.000 description 1
- 101001018939 Homo sapiens MICOS complex subunit MIC10 Proteins 0.000 description 1
- 101001121072 Homo sapiens MICOS complex subunit MIC19 Proteins 0.000 description 1
- 101000572820 Homo sapiens MICOS complex subunit MIC60 Proteins 0.000 description 1
- 101001012662 Homo sapiens MIF4G domain-containing protein Proteins 0.000 description 1
- 101000952181 Homo sapiens MLX-interacting protein Proteins 0.000 description 1
- 101000730540 Homo sapiens MOB-like protein phocein Proteins 0.000 description 1
- 101001051810 Homo sapiens MORC family CW-type zinc finger protein 3 Proteins 0.000 description 1
- 101000987090 Homo sapiens MORF4 family-associated protein 1 Proteins 0.000 description 1
- 101000590679 Homo sapiens MPN domain-containing protein Proteins 0.000 description 1
- 101000591230 Homo sapiens MRN complex-interacting protein Proteins 0.000 description 1
- 101001045534 Homo sapiens MTRF1L release factor glutamine methyltransferase Proteins 0.000 description 1
- 101000578266 Homo sapiens Magnesium transporter NIPA2 Proteins 0.000 description 1
- 101001018720 Homo sapiens Magnesium-dependent phosphatase 1 Proteins 0.000 description 1
- 101000914251 Homo sapiens Major centromere autoantigen B Proteins 0.000 description 1
- 101000989639 Homo sapiens Major facilitator superfamily domain-containing protein 12 Proteins 0.000 description 1
- 101001033820 Homo sapiens Malate dehydrogenase, mitochondrial Proteins 0.000 description 1
- 101001027796 Homo sapiens Male-specific lethal 1 homolog Proteins 0.000 description 1
- 101001014562 Homo sapiens Male-specific lethal 3 homolog Proteins 0.000 description 1
- 101000950648 Homo sapiens Malectin Proteins 0.000 description 1
- 101001034310 Homo sapiens Malignant fibrous histiocytoma-amplified sequence 1 Proteins 0.000 description 1
- 101000834118 Homo sapiens Malonate-CoA ligase ACSF3, mitochondrial Proteins 0.000 description 1
- 101000937642 Homo sapiens Malonyl-CoA-acyl carrier protein transacylase, mitochondrial Proteins 0.000 description 1
- 101000857849 Homo sapiens Mannose-1-phosphate guanyltransferase alpha Proteins 0.000 description 1
- 101001040781 Homo sapiens Mannose-1-phosphate guanyltransferase beta Proteins 0.000 description 1
- 101000615932 Homo sapiens Mannosyl-oligosaccharide 1,2-alpha-mannosidase IB Proteins 0.000 description 1
- 101000980579 Homo sapiens Mapk-regulated corepressor-interacting protein 1 Proteins 0.000 description 1
- 101000825177 Homo sapiens Maspardin Proteins 0.000 description 1
- 101001005664 Homo sapiens Mastermind-like protein 1 Proteins 0.000 description 1
- 101000957559 Homo sapiens Matrin-3 Proteins 0.000 description 1
- 101001036580 Homo sapiens Max dimerization protein 4 Proteins 0.000 description 1
- 101001000302 Homo sapiens Max-interacting protein 1 Proteins 0.000 description 1
- 101000581326 Homo sapiens Mediator of DNA damage checkpoint protein 1 Proteins 0.000 description 1
- 101000614970 Homo sapiens Mediator of RNA polymerase II transcription subunit 11 Proteins 0.000 description 1
- 101000614988 Homo sapiens Mediator of RNA polymerase II transcription subunit 12 Proteins 0.000 description 1
- 101001055427 Homo sapiens Mediator of RNA polymerase II transcription subunit 13 Proteins 0.000 description 1
- 101001017592 Homo sapiens Mediator of RNA polymerase II transcription subunit 13-like Proteins 0.000 description 1
- 101001019104 Homo sapiens Mediator of RNA polymerase II transcription subunit 14 Proteins 0.000 description 1
- 101001013208 Homo sapiens Mediator of RNA polymerase II transcription subunit 15 Proteins 0.000 description 1
- 101000582813 Homo sapiens Mediator of RNA polymerase II transcription subunit 16 Proteins 0.000 description 1
- 101000575066 Homo sapiens Mediator of RNA polymerase II transcription subunit 17 Proteins 0.000 description 1
- 101000980162 Homo sapiens Mediator of RNA polymerase II transcription subunit 18 Proteins 0.000 description 1
- 101001055444 Homo sapiens Mediator of RNA polymerase II transcription subunit 20 Proteins 0.000 description 1
- 101000614990 Homo sapiens Mediator of RNA polymerase II transcription subunit 21 Proteins 0.000 description 1
- 101000582846 Homo sapiens Mediator of RNA polymerase II transcription subunit 22 Proteins 0.000 description 1
- 101001019117 Homo sapiens Mediator of RNA polymerase II transcription subunit 23 Proteins 0.000 description 1
- 101001019109 Homo sapiens Mediator of RNA polymerase II transcription subunit 24 Proteins 0.000 description 1
- 101000955282 Homo sapiens Mediator of RNA polymerase II transcription subunit 27 Proteins 0.000 description 1
- 101001013272 Homo sapiens Mediator of RNA polymerase II transcription subunit 29 Proteins 0.000 description 1
- 101001033754 Homo sapiens Mediator of RNA polymerase II transcription subunit 31 Proteins 0.000 description 1
- 101001055354 Homo sapiens Mediator of RNA polymerase II transcription subunit 6 Proteins 0.000 description 1
- 101000582864 Homo sapiens Mediator of RNA polymerase II transcription subunit 7 Proteins 0.000 description 1
- 101000979998 Homo sapiens Mediator of RNA polymerase II transcription subunit 8 Proteins 0.000 description 1
- 101000957743 Homo sapiens Meiosis regulator and mRNA stability factor 1 Proteins 0.000 description 1
- 101001012669 Homo sapiens Melanoma inhibitory activity protein 2 Proteins 0.000 description 1
- 101001057158 Homo sapiens Melanoma-associated antigen D1 Proteins 0.000 description 1
- 101001057154 Homo sapiens Melanoma-associated antigen D2 Proteins 0.000 description 1
- 101000963131 Homo sapiens Membralin Proteins 0.000 description 1
- 101000961414 Homo sapiens Membrane cofactor protein Proteins 0.000 description 1
- 101001057193 Homo sapiens Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 1 Proteins 0.000 description 1
- 101000731007 Homo sapiens Membrane-associated progesterone receptor component 2 Proteins 0.000 description 1
- 101001017332 Homo sapiens Membrane-bound transcription factor site-1 protease Proteins 0.000 description 1
- 101000581514 Homo sapiens Membrane-bound transcription factor site-2 protease Proteins 0.000 description 1
- 101001013023 Homo sapiens Mesoderm induction early response protein 1 Proteins 0.000 description 1
- 101001013017 Homo sapiens Mesoderm induction early response protein 2 Proteins 0.000 description 1
- 101000993455 Homo sapiens Metal transporter CNNM2 Proteins 0.000 description 1
- 101000993450 Homo sapiens Metal transporter CNNM3 Proteins 0.000 description 1
- 101000967087 Homo sapiens Metal-response element-binding transcription factor 2 Proteins 0.000 description 1
- 101000969780 Homo sapiens Metallophosphoesterase 1 Proteins 0.000 description 1
- 101001028019 Homo sapiens Metastasis-associated protein MTA2 Proteins 0.000 description 1
- 101000588067 Homo sapiens Metaxin-1 Proteins 0.000 description 1
- 101000623878 Homo sapiens Metaxin-2 Proteins 0.000 description 1
- 101000985376 Homo sapiens Methenyltetrahydrofolate cyclohydrolase Proteins 0.000 description 1
- 101000587083 Homo sapiens Methenyltetrahydrofolate synthase domain-containing protein Proteins 0.000 description 1
- 101000583944 Homo sapiens Methionine adenosyltransferase 2 subunit beta Proteins 0.000 description 1
- 101000578830 Homo sapiens Methionine aminopeptidase 1 Proteins 0.000 description 1
- 101000979001 Homo sapiens Methionine aminopeptidase 2 Proteins 0.000 description 1
- 101001116314 Homo sapiens Methionine synthase reductase Proteins 0.000 description 1
- 101000581507 Homo sapiens Methyl-CpG-binding domain protein 1 Proteins 0.000 description 1
- 101000615488 Homo sapiens Methyl-CpG-binding domain protein 2 Proteins 0.000 description 1
- 101000615495 Homo sapiens Methyl-CpG-binding domain protein 3 Proteins 0.000 description 1
- 101001013097 Homo sapiens Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial Proteins 0.000 description 1
- 101001003205 Homo sapiens Methylosome subunit pICln Proteins 0.000 description 1
- 101000969327 Homo sapiens Methylthioribose-1-phosphate isomerase Proteins 0.000 description 1
- 101001030284 Homo sapiens Methylthioribulose-1-phosphate dehydratase Proteins 0.000 description 1
- 101001000090 Homo sapiens Methyltransferase N6AMT1 Proteins 0.000 description 1
- 101001028136 Homo sapiens Methyltransferase-like 26 Proteins 0.000 description 1
- 101000990528 Homo sapiens Methyltransferase-like protein 17, mitochondrial Proteins 0.000 description 1
- 101001134259 Homo sapiens Methyltransferase-like protein 25B Proteins 0.000 description 1
- 101000575381 Homo sapiens Microfibril-associated glycoprotein 3 Proteins 0.000 description 1
- 101000869796 Homo sapiens Microprocessor complex subunit DGCR8 Proteins 0.000 description 1
- 101000628785 Homo sapiens Microsomal glutathione S-transferase 3 Proteins 0.000 description 1
- 101000616438 Homo sapiens Microtubule-associated protein 4 Proteins 0.000 description 1
- 101000957756 Homo sapiens Microtubule-associated protein RP/EB family member 2 Proteins 0.000 description 1
- 101000624613 Homo sapiens Microtubule-associated proteins 1A/1B light chain 3 beta 2 Proteins 0.000 description 1
- 101001018300 Homo sapiens Microtubule-associated serine/threonine-protein kinase 2 Proteins 0.000 description 1
- 101000578877 Homo sapiens Mid1-interacting protein 1 Proteins 0.000 description 1
- 101000581272 Homo sapiens Midasin Proteins 0.000 description 1
- 101000615613 Homo sapiens Mineralocorticoid receptor Proteins 0.000 description 1
- 101000581428 Homo sapiens Mini-chromosome maintenance complex-binding protein Proteins 0.000 description 1
- 101000573441 Homo sapiens Misshapen-like kinase 1 Proteins 0.000 description 1
- 101000585693 Homo sapiens Mitochondrial 2-oxodicarboxylate carrier Proteins 0.000 description 1
- 101000990982 Homo sapiens Mitochondrial Rho GTPase 1 Proteins 0.000 description 1
- 101000961382 Homo sapiens Mitochondrial calcium uniporter regulator 1 Proteins 0.000 description 1
- 101000623667 Homo sapiens Mitochondrial carrier homolog 1 Proteins 0.000 description 1
- 101001013994 Homo sapiens Mitochondrial carrier homolog 2 Proteins 0.000 description 1
- 101000697649 Homo sapiens Mitochondrial chaperone BCS1 Proteins 0.000 description 1
- 101000574832 Homo sapiens Mitochondrial dynamics protein MID49 Proteins 0.000 description 1
- 101000827338 Homo sapiens Mitochondrial fission 1 protein Proteins 0.000 description 1
- 101000623675 Homo sapiens Mitochondrial fission process protein 1 Proteins 0.000 description 1
- 101000623673 Homo sapiens Mitochondrial fission regulator 1 Proteins 0.000 description 1
- 101001055781 Homo sapiens Mitochondrial fission regulator 1-like Proteins 0.000 description 1
- 101000669640 Homo sapiens Mitochondrial import inner membrane translocase subunit TIM14 Proteins 0.000 description 1
- 101000831175 Homo sapiens Mitochondrial import inner membrane translocase subunit TIM16 Proteins 0.000 description 1
- 101000655004 Homo sapiens Mitochondrial import inner membrane translocase subunit TIM44 Proteins 0.000 description 1
- 101000802139 Homo sapiens Mitochondrial import inner membrane translocase subunit TIM50 Proteins 0.000 description 1
- 101000800374 Homo sapiens Mitochondrial import inner membrane translocase subunit Tim10 Proteins 0.000 description 1
- 101000637710 Homo sapiens Mitochondrial import inner membrane translocase subunit Tim13 Proteins 0.000 description 1
- 101000598416 Homo sapiens Mitochondrial import inner membrane translocase subunit Tim17-A Proteins 0.000 description 1
- 101000651269 Homo sapiens Mitochondrial import inner membrane translocase subunit Tim17-B Proteins 0.000 description 1
- 101000598199 Homo sapiens Mitochondrial import inner membrane translocase subunit Tim21 Proteins 0.000 description 1
- 101000645266 Homo sapiens Mitochondrial import inner membrane translocase subunit Tim22 Proteins 0.000 description 1
- 101000645277 Homo sapiens Mitochondrial import inner membrane translocase subunit Tim23 Proteins 0.000 description 1
- 101000763951 Homo sapiens Mitochondrial import inner membrane translocase subunit Tim8 A Proteins 0.000 description 1
- 101000853064 Homo sapiens Mitochondrial import inner membrane translocase subunit Tim8 B Proteins 0.000 description 1
- 101000637762 Homo sapiens Mitochondrial import inner membrane translocase subunit Tim9 Proteins 0.000 description 1
- 101000764216 Homo sapiens Mitochondrial import receptor subunit TOM40 homolog Proteins 0.000 description 1
- 101000764239 Homo sapiens Mitochondrial import receptor subunit TOM5 homolog Proteins 0.000 description 1
- 101000648387 Homo sapiens Mitochondrial import receptor subunit TOM6 homolog Proteins 0.000 description 1
- 101000648395 Homo sapiens Mitochondrial import receptor subunit TOM70 Proteins 0.000 description 1
- 101000960626 Homo sapiens Mitochondrial inner membrane protease subunit 2 Proteins 0.000 description 1
- 101001098460 Homo sapiens Mitochondrial inner membrane protein OXA1L Proteins 0.000 description 1
- 101000628925 Homo sapiens Mitochondrial intermediate peptidase Proteins 0.000 description 1
- 101001034133 Homo sapiens Mitochondrial intermembrane space import and assembly protein 40 Proteins 0.000 description 1
- 101000690071 Homo sapiens Mitochondrial mRNA pseudouridine synthase RPUSD3 Proteins 0.000 description 1
- 101000659691 Homo sapiens Mitochondrial mRNA pseudouridine synthase TRUB2 Proteins 0.000 description 1
- 101001013832 Homo sapiens Mitochondrial peptide methionine sulfoxide reductase Proteins 0.000 description 1
- 101000578128 Homo sapiens Mitochondrial potassium channel Proteins 0.000 description 1
- 101000608551 Homo sapiens Mitochondrial proton/calcium exchanger protein Proteins 0.000 description 1
- 101001014546 Homo sapiens Mitochondrial ribonuclease P catalytic subunit Proteins 0.000 description 1
- 101001132833 Homo sapiens Mitochondrial ribosome-associated GTPase 2 Proteins 0.000 description 1
- 101000882884 Homo sapiens Mitochondrial tRNA methylthiotransferase CDK5RAP1 Proteins 0.000 description 1
- 101000972158 Homo sapiens Mitochondrial tRNA-specific 2-thiouridylase 1 Proteins 0.000 description 1
- 101001133767 Homo sapiens Mitochondrial transcription rescue factor 1 Proteins 0.000 description 1
- 101001133003 Homo sapiens Mitochondrial translation release factor in rescue Proteins 0.000 description 1
- 101000577080 Homo sapiens Mitochondrial-processing peptidase subunit alpha Proteins 0.000 description 1
- 101000576973 Homo sapiens Mitochondrial-processing peptidase subunit beta Proteins 0.000 description 1
- 101001018717 Homo sapiens Mitofusin-2 Proteins 0.000 description 1
- 101001052493 Homo sapiens Mitogen-activated protein kinase 1 Proteins 0.000 description 1
- 101001052490 Homo sapiens Mitogen-activated protein kinase 3 Proteins 0.000 description 1
- 101000950710 Homo sapiens Mitogen-activated protein kinase 6 Proteins 0.000 description 1
- 101000950687 Homo sapiens Mitogen-activated protein kinase 7 Proteins 0.000 description 1
- 101000950695 Homo sapiens Mitogen-activated protein kinase 8 Proteins 0.000 description 1
- 101000950669 Homo sapiens Mitogen-activated protein kinase 9 Proteins 0.000 description 1
- 101000958409 Homo sapiens Mitogen-activated protein kinase kinase kinase 10 Proteins 0.000 description 1
- 101001005602 Homo sapiens Mitogen-activated protein kinase kinase kinase 11 Proteins 0.000 description 1
- 101001005552 Homo sapiens Mitogen-activated protein kinase kinase kinase 15 Proteins 0.000 description 1
- 101001018141 Homo sapiens Mitogen-activated protein kinase kinase kinase 2 Proteins 0.000 description 1
- 101001018145 Homo sapiens Mitogen-activated protein kinase kinase kinase 3 Proteins 0.000 description 1
- 101001018147 Homo sapiens Mitogen-activated protein kinase kinase kinase 4 Proteins 0.000 description 1
- 101001055092 Homo sapiens Mitogen-activated protein kinase kinase kinase 7 Proteins 0.000 description 1
- 101001059989 Homo sapiens Mitogen-activated protein kinase kinase kinase kinase 3 Proteins 0.000 description 1
- 101001059984 Homo sapiens Mitogen-activated protein kinase kinase kinase kinase 4 Proteins 0.000 description 1
- 101001059982 Homo sapiens Mitogen-activated protein kinase kinase kinase kinase 5 Proteins 0.000 description 1
- 101000973601 Homo sapiens Mitoguardin 1 Proteins 0.000 description 1
- 101000896484 Homo sapiens Mitotic checkpoint protein BUB3 Proteins 0.000 description 1
- 101000957106 Homo sapiens Mitotic spindle assembly checkpoint protein MAD1 Proteins 0.000 description 1
- 101000583811 Homo sapiens Mitotic spindle assembly checkpoint protein MAD2B Proteins 0.000 description 1
- 101000636558 Homo sapiens Mitotic-spindle organizing protein 2A Proteins 0.000 description 1
- 101000963903 Homo sapiens Modulator of smoothened protein Proteins 0.000 description 1
- 101000575440 Homo sapiens Molybdate-anion transporter Proteins 0.000 description 1
- 101001074975 Homo sapiens Molybdopterin molybdenumtransferase Proteins 0.000 description 1
- 101000591936 Homo sapiens Molybdopterin synthase catalytic subunit Proteins 0.000 description 1
- 101000963255 Homo sapiens Molybdopterin synthase sulfur carrier subunit Proteins 0.000 description 1
- 101000590830 Homo sapiens Monocarboxylate transporter 1 Proteins 0.000 description 1
- 101000969546 Homo sapiens Mortality factor 4-like protein 1 Proteins 0.000 description 1
- 101000992748 Homo sapiens Mortality factor 4-like protein 2 Proteins 0.000 description 1
- 101000623713 Homo sapiens Motile sperm domain-containing protein 3 Proteins 0.000 description 1
- 101000573451 Homo sapiens Msx2-interacting protein Proteins 0.000 description 1
- 101000798124 Homo sapiens Multifunctional methyltransferase subunit TRM112-like protein Proteins 0.000 description 1
- 101000615261 Homo sapiens Multiple coagulation factor deficiency protein 2 Proteins 0.000 description 1
- 101000955249 Homo sapiens Multiple epidermal growth factor-like domains protein 8 Proteins 0.000 description 1
- 101000573447 Homo sapiens Multiple inositol polyphosphate phosphatase 1 Proteins 0.000 description 1
- 101000573513 Homo sapiens Muskelin Proteins 0.000 description 1
- 101001017254 Homo sapiens Myb-binding protein 1A Proteins 0.000 description 1
- 101000982005 Homo sapiens Myb-related transcription factor, partner of profilin Proteins 0.000 description 1
- 101000624898 Homo sapiens Myb/SANT-like DNA-binding domain-containing protein 3 Proteins 0.000 description 1
- 101000911596 Homo sapiens Myelin-associated neurite-outgrowth inhibitor Proteins 0.000 description 1
- 101001013159 Homo sapiens Myeloid leukemia factor 2 Proteins 0.000 description 1
- 101001128505 Homo sapiens Myocardial zonula adherens protein Proteins 0.000 description 1
- 101000591295 Homo sapiens Myocardin-related transcription factor B Proteins 0.000 description 1
- 101000585775 Homo sapiens Myoneurin Proteins 0.000 description 1
- 101001028827 Homo sapiens Myosin phosphatase Rho-interacting protein Proteins 0.000 description 1
- 101000990985 Homo sapiens Myosin regulatory light chain 12B Proteins 0.000 description 1
- 101000969334 Homo sapiens Myotubularin-related protein 1 Proteins 0.000 description 1
- 101001116519 Homo sapiens Myotubularin-related protein 10 Proteins 0.000 description 1
- 101001116518 Homo sapiens Myotubularin-related protein 12 Proteins 0.000 description 1
- 101000594120 Homo sapiens Myotubularin-related protein 14 Proteins 0.000 description 1
- 101000966872 Homo sapiens Myotubularin-related protein 2 Proteins 0.000 description 1
- 101000966875 Homo sapiens Myotubularin-related protein 4 Proteins 0.000 description 1
- 101000966829 Homo sapiens Myotubularin-related protein 6 Proteins 0.000 description 1
- 101001116601 Homo sapiens Myotubularin-related protein 9 Proteins 0.000 description 1
- 101001024872 Homo sapiens N-acetylgalactosamine kinase Proteins 0.000 description 1
- 101001066305 Homo sapiens N-acetylgalactosamine-6-sulfatase Proteins 0.000 description 1
- 101000962156 Homo sapiens N-acetylglucosamine-1-phosphodiester alpha-N-acetylglucosaminidase Proteins 0.000 description 1
- 101000730680 Homo sapiens N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase Proteins 0.000 description 1
- 101000602350 Homo sapiens N-acetyltransferase 9 Proteins 0.000 description 1
- 101000588230 Homo sapiens N-alpha-acetyltransferase 10 Proteins 0.000 description 1
- 101000981997 Homo sapiens N-alpha-acetyltransferase 16, NatA auxiliary subunit Proteins 0.000 description 1
- 101000981987 Homo sapiens N-alpha-acetyltransferase 20 Proteins 0.000 description 1
- 101001128284 Homo sapiens N-alpha-acetyltransferase 30 Proteins 0.000 description 1
- 101000984688 Homo sapiens N-alpha-acetyltransferase 38, NatC auxiliary subunit Proteins 0.000 description 1
- 101000958778 Homo sapiens N-alpha-acetyltransferase 60 Proteins 0.000 description 1
- 101000650674 Homo sapiens N-lysine methyltransferase SETD6 Proteins 0.000 description 1
- 101000651201 Homo sapiens N-sulphoglucosamine sulphohydrolase Proteins 0.000 description 1
- 101000970374 Homo sapiens N-terminal Xaa-Pro-Lys N-methyltransferase 1 Proteins 0.000 description 1
- 101001128135 Homo sapiens NACHT, LRR and PYD domains-containing protein 4 Proteins 0.000 description 1
- 101000589671 Homo sapiens NAD kinase 2, mitochondrial Proteins 0.000 description 1
- 101000685982 Homo sapiens NAD(+) hydrolase SARM1 Proteins 0.000 description 1
- 101000616738 Homo sapiens NAD-dependent protein deacetylase sirtuin-6 Proteins 0.000 description 1
- 101000616727 Homo sapiens NAD-dependent protein deacylase sirtuin-5, mitochondrial Proteins 0.000 description 1
- 101000588478 Homo sapiens NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 4 Proteins 0.000 description 1
- 101000601616 Homo sapiens NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 1 Proteins 0.000 description 1
- 101000973461 Homo sapiens NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 12 Proteins 0.000 description 1
- 101000636665 Homo sapiens NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 13 Proteins 0.000 description 1
- 101001111244 Homo sapiens NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 2 Proteins 0.000 description 1
- 101001111238 Homo sapiens NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 3 Proteins 0.000 description 1
- 101001128581 Homo sapiens NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 5 Proteins 0.000 description 1
- 101000573220 Homo sapiens NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 7 Proteins 0.000 description 1
- 101001023513 Homo sapiens NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Proteins 0.000 description 1
- 101001111252 Homo sapiens NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 11, mitochondrial Proteins 0.000 description 1
- 101001128623 Homo sapiens NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 3 Proteins 0.000 description 1
- 101001128608 Homo sapiens NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4 Proteins 0.000 description 1
- 101000601625 Homo sapiens NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial Proteins 0.000 description 1
- 101000601568 Homo sapiens NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6 Proteins 0.000 description 1
- 101000601579 Homo sapiens NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 7 Proteins 0.000 description 1
- 101000979735 Homo sapiens NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial Proteins 0.000 description 1
- 101000979731 Homo sapiens NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 9 Proteins 0.000 description 1
- 101001111250 Homo sapiens NADH dehydrogenase [ubiquinone] 1 subunit C1, mitochondrial Proteins 0.000 description 1
- 101001023553 Homo sapiens NADH dehydrogenase [ubiquinone] 1 subunit C2 Proteins 0.000 description 1
- 101001023560 Homo sapiens NADH dehydrogenase [ubiquinone] 1 subunit C2, isoform 2 Proteins 0.000 description 1
- 101001111195 Homo sapiens NADH dehydrogenase [ubiquinone] flavoprotein 1, mitochondrial Proteins 0.000 description 1
- 101000573300 Homo sapiens NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial Proteins 0.000 description 1
- 101000601517 Homo sapiens NADH dehydrogenase [ubiquinone] iron-sulfur protein 5 Proteins 0.000 description 1
- 101000998623 Homo sapiens NADH-cytochrome b5 reductase 3 Proteins 0.000 description 1
- 101000962088 Homo sapiens NBAS subunit of NRZ tethering complex Proteins 0.000 description 1
- 101000651236 Homo sapiens NCK-interacting protein with SH3 domain Proteins 0.000 description 1
- 101000979357 Homo sapiens NEDD4 family-interacting protein 2 Proteins 0.000 description 1
- 101001030451 Homo sapiens NEDD4-binding protein 2-like 2 Proteins 0.000 description 1
- 101000650160 Homo sapiens NEDD4-like E3 ubiquitin-protein ligase WWP2 Proteins 0.000 description 1
- 101000970017 Homo sapiens NEDD8 ultimate buster 1 Proteins 0.000 description 1
- 101000644669 Homo sapiens NEDD8-conjugating enzyme Ubc12 Proteins 0.000 description 1
- 101000973618 Homo sapiens NF-kappa-B essential modulator Proteins 0.000 description 1
- 101000998158 Homo sapiens NF-kappa-B inhibitor beta Proteins 0.000 description 1
- 101000997252 Homo sapiens NF-kappa-B inhibitor-interacting Ras-like protein 2 Proteins 0.000 description 1
- 101000979596 Homo sapiens NF-kappa-B-repressing factor Proteins 0.000 description 1
- 101000979323 Homo sapiens NHP2-like protein 1 Proteins 0.000 description 1
- 101000601056 Homo sapiens NIF3-like protein 1 Proteins 0.000 description 1
- 101000979578 Homo sapiens NK-tumor recognition protein Proteins 0.000 description 1
- 101000608228 Homo sapiens NLR family pyrin domain-containing protein 2B Proteins 0.000 description 1
- 101001124062 Homo sapiens NSFL1 cofactor p47 Proteins 0.000 description 1
- 101000721712 Homo sapiens NTF2-related export protein 1 Proteins 0.000 description 1
- 101001108356 Homo sapiens Nardilysin Proteins 0.000 description 1
- 101001024710 Homo sapiens Nck-associated protein 5-like Proteins 0.000 description 1
- 101000979297 Homo sapiens Negative elongation factor A Proteins 0.000 description 1
- 101000979298 Homo sapiens Negative elongation factor B Proteins 0.000 description 1
- 101000979288 Homo sapiens Negative elongation factor E Proteins 0.000 description 1
- 101000636811 Homo sapiens Neudesin Proteins 0.000 description 1
- 101000973264 Homo sapiens Neuferricin Proteins 0.000 description 1
- 101000577905 Homo sapiens Neugrin Proteins 0.000 description 1
- 101000621420 Homo sapiens Neural Wiskott-Aldrich syndrome protein Proteins 0.000 description 1
- 101001024606 Homo sapiens Neuroblastoma breakpoint family member 10 Proteins 0.000 description 1
- 101001014610 Homo sapiens Neuroendocrine secretory protein 55 Proteins 0.000 description 1
- 101000927793 Homo sapiens Neuroepithelial cell-transforming gene 1 protein Proteins 0.000 description 1
- 101000637326 Homo sapiens Neuroguidin Proteins 0.000 description 1
- 101000604054 Homo sapiens Neuroplastin Proteins 0.000 description 1
- 101000785705 Homo sapiens Neurotrophin receptor-interacting factor homolog Proteins 0.000 description 1
- 101000655246 Homo sapiens Neutral amino acid transporter A Proteins 0.000 description 1
- 101000578062 Homo sapiens Nicastrin Proteins 0.000 description 1
- 101000633302 Homo sapiens Nicotinamide riboside kinase 1 Proteins 0.000 description 1
- 101000632154 Homo sapiens Ninjurin-1 Proteins 0.000 description 1
- 101001024120 Homo sapiens Nipped-B-like protein Proteins 0.000 description 1
- 101000603223 Homo sapiens Nischarin Proteins 0.000 description 1
- 101000604223 Homo sapiens Nocturnin Proteins 0.000 description 1
- 101000844245 Homo sapiens Non-receptor tyrosine-protein kinase TYK2 Proteins 0.000 description 1
- 101001124034 Homo sapiens Non-structural maintenance of chromosomes element 4 homolog A Proteins 0.000 description 1
- 101000864039 Homo sapiens Nonsense-mediated mRNA decay factor SMG5 Proteins 0.000 description 1
- 101000708763 Homo sapiens Nonsense-mediated mRNA decay factor SMG7 Proteins 0.000 description 1
- 101000597417 Homo sapiens Nuclear RNA export factor 1 Proteins 0.000 description 1
- 101000589497 Homo sapiens Nuclear cap-binding protein subunit 3 Proteins 0.000 description 1
- 101001121613 Homo sapiens Nuclear envelope pore membrane protein POM 121 Proteins 0.000 description 1
- 101001121610 Homo sapiens Nuclear envelope pore membrane protein POM 121C Proteins 0.000 description 1
- 101000979342 Homo sapiens Nuclear factor NF-kappa-B p105 subunit Proteins 0.000 description 1
- 101000588302 Homo sapiens Nuclear factor erythroid 2-related factor 2 Proteins 0.000 description 1
- 101000588303 Homo sapiens Nuclear factor erythroid 2-related factor 3 Proteins 0.000 description 1
- 101000973177 Homo sapiens Nuclear factor interleukin-3-regulated protein Proteins 0.000 description 1
- 101001023768 Homo sapiens Nuclear factor related to kappa-B-binding protein Proteins 0.000 description 1
- 101000590492 Homo sapiens Nuclear fragile X mental retardation-interacting protein 1 Proteins 0.000 description 1
- 101000598100 Homo sapiens Nuclear migration protein nudC Proteins 0.000 description 1
- 101000970403 Homo sapiens Nuclear pore complex protein Nup153 Proteins 0.000 description 1
- 101001108926 Homo sapiens Nuclear pore complex protein Nup160 Proteins 0.000 description 1
- 101000589749 Homo sapiens Nuclear pore complex protein Nup205 Proteins 0.000 description 1
- 101000996563 Homo sapiens Nuclear pore complex protein Nup214 Proteins 0.000 description 1
- 101001121654 Homo sapiens Nuclear pore complex protein Nup50 Proteins 0.000 description 1
- 101001007901 Homo sapiens Nuclear pore complex protein Nup88 Proteins 0.000 description 1
- 101001007909 Homo sapiens Nuclear pore complex protein Nup93 Proteins 0.000 description 1
- 101001118493 Homo sapiens Nuclear pore glycoprotein p62 Proteins 0.000 description 1
- 101000961846 Homo sapiens Nuclear prelamin A recognition factor Proteins 0.000 description 1
- 101000602930 Homo sapiens Nuclear receptor coactivator 2 Proteins 0.000 description 1
- 101000974356 Homo sapiens Nuclear receptor coactivator 3 Proteins 0.000 description 1
- 101000974349 Homo sapiens Nuclear receptor coactivator 6 Proteins 0.000 description 1
- 101000974345 Homo sapiens Nuclear receptor coactivator 7 Proteins 0.000 description 1
- 101000974340 Homo sapiens Nuclear receptor corepressor 1 Proteins 0.000 description 1
- 101000582254 Homo sapiens Nuclear receptor corepressor 2 Proteins 0.000 description 1
- 101001108314 Homo sapiens Nuclear receptor-binding protein Proteins 0.000 description 1
- 101000577547 Homo sapiens Nuclear respiratory factor 1 Proteins 0.000 description 1
- 101000634091 Homo sapiens Nuclear speckle splicing regulatory protein 1 Proteins 0.000 description 1
- 101000995046 Homo sapiens Nuclear transcription factor Y subunit alpha Proteins 0.000 description 1
- 101000973405 Homo sapiens Nuclear transcription factor Y subunit beta Proteins 0.000 description 1
- 101000588345 Homo sapiens Nuclear transcription factor Y subunit gamma Proteins 0.000 description 1
- 101001124017 Homo sapiens Nuclear transport factor 2 Proteins 0.000 description 1
- 101001024118 Homo sapiens Nuclear-interacting partner of ALK Proteins 0.000 description 1
- 101001008429 Homo sapiens Nucleobindin-2 Proteins 0.000 description 1
- 101000995979 Homo sapiens Nucleolar GTP-binding protein 2 Proteins 0.000 description 1
- 101000912678 Homo sapiens Nucleolar RNA helicase 2 Proteins 0.000 description 1
- 101001109620 Homo sapiens Nucleolar and coiled-body phosphoprotein 1 Proteins 0.000 description 1
- 101000634679 Homo sapiens Nucleolar complex protein 2 homolog Proteins 0.000 description 1
- 101000634526 Homo sapiens Nucleolar pre-ribosomal-associated protein 1 Proteins 0.000 description 1
- 101000604135 Homo sapiens Nucleolar protein 10 Proteins 0.000 description 1
- 101000973966 Homo sapiens Nucleolar protein 11 Proteins 0.000 description 1
- 101000604155 Homo sapiens Nucleolar protein 14 Proteins 0.000 description 1
- 101000634768 Homo sapiens Nucleolar protein 16 Proteins 0.000 description 1
- 101001109600 Homo sapiens Nucleolar protein 7 Proteins 0.000 description 1
- 101001109602 Homo sapiens Nucleolar protein 8 Proteins 0.000 description 1
- 101001124824 Homo sapiens Nucleolar protein of 40 kDa Proteins 0.000 description 1
- 101000809045 Homo sapiens Nucleolar transcription factor 1 Proteins 0.000 description 1
- 101001123843 Homo sapiens Nucleolus and neural progenitor protein Proteins 0.000 description 1
- 101001109719 Homo sapiens Nucleophosmin Proteins 0.000 description 1
- 101001109512 Homo sapiens Nucleoplasmin-3 Proteins 0.000 description 1
- 101001024723 Homo sapiens Nucleoporin NDC1 Proteins 0.000 description 1
- 101000598403 Homo sapiens Nucleoporin NUP42 Proteins 0.000 description 1
- 101000683898 Homo sapiens Nucleoporin SEH1 Proteins 0.000 description 1
- 101001121642 Homo sapiens Nucleoporin p54 Proteins 0.000 description 1
- 101001121636 Homo sapiens Nucleoporin p58/p45 Proteins 0.000 description 1
- 101001128748 Homo sapiens Nucleoside diphosphate kinase 3 Proteins 0.000 description 1
- 101001128739 Homo sapiens Nucleoside diphosphate kinase 6 Proteins 0.000 description 1
- 101001128732 Homo sapiens Nucleoside diphosphate kinase 7 Proteins 0.000 description 1
- 101000979623 Homo sapiens Nucleoside diphosphate kinase B Proteins 0.000 description 1
- 101000973997 Homo sapiens Nucleosome assembly protein 1-like 4 Proteins 0.000 description 1
- 101000934489 Homo sapiens Nucleosome-remodeling factor subunit BPTF Proteins 0.000 description 1
- 101001109269 Homo sapiens NudC domain-containing protein 3 Proteins 0.000 description 1
- 101001121964 Homo sapiens OCIA domain-containing protein 1 Proteins 0.000 description 1
- 101001121166 Homo sapiens ORM1-like protein 2 Proteins 0.000 description 1
- 101000721384 Homo sapiens OTU domain-containing protein 4 Proteins 0.000 description 1
- 101000721386 Homo sapiens OTU domain-containing protein 5 Proteins 0.000 description 1
- 101000597499 Homo sapiens Obg-like ATPase 1 Proteins 0.000 description 1
- 101000986786 Homo sapiens Orexin/Hypocretin receptor type 1 Proteins 0.000 description 1
- 101001041245 Homo sapiens Ornithine decarboxylase Proteins 0.000 description 1
- 101000594698 Homo sapiens Ornithine decarboxylase antizyme 1 Proteins 0.000 description 1
- 101000982889 Homo sapiens Ornithine decarboxylase antizyme 2 Proteins 0.000 description 1
- 101000613806 Homo sapiens Osteopetrosis-associated transmembrane protein 1 Proteins 0.000 description 1
- 101001120706 Homo sapiens Outer dense fiber protein 2 Proteins 0.000 description 1
- 101001134134 Homo sapiens Oxidation resistance protein 1 Proteins 0.000 description 1
- 101001121326 Homo sapiens Oxidative stress-induced growth inhibitor 2 Proteins 0.000 description 1
- 101000598781 Homo sapiens Oxidative stress-responsive serine-rich protein 1 Proteins 0.000 description 1
- 101000839399 Homo sapiens Oxidoreductase HTATIP2 Proteins 0.000 description 1
- 101000614286 Homo sapiens Oxidoreductase-like domain-containing protein 1 Proteins 0.000 description 1
- 101000992383 Homo sapiens Oxysterol-binding protein 1 Proteins 0.000 description 1
- 101000720696 Homo sapiens Oxysterol-binding protein-related protein 2 Proteins 0.000 description 1
- 101000992388 Homo sapiens Oxysterol-binding protein-related protein 8 Proteins 0.000 description 1
- 101000613365 Homo sapiens PABIR family member 2 Proteins 0.000 description 1
- 101000982939 Homo sapiens PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Proteins 0.000 description 1
- 101001098523 Homo sapiens PAX-interacting protein 1 Proteins 0.000 description 1
- 101001098494 Homo sapiens PAX3- and PAX7-binding protein 1 Proteins 0.000 description 1
- 101000579851 Homo sapiens PC-esterase domain-containing protein 1A Proteins 0.000 description 1
- 101000610034 Homo sapiens PCI domain-containing protein 2 Proteins 0.000 description 1
- 101000988394 Homo sapiens PDZ and LIM domain protein 5 Proteins 0.000 description 1
- 101000693225 Homo sapiens PDZ domain-containing protein 11 Proteins 0.000 description 1
- 101001129705 Homo sapiens PH domain leucine-rich repeat-containing protein phosphatase 2 Proteins 0.000 description 1
- 101001071233 Homo sapiens PHD finger protein 1 Proteins 0.000 description 1
- 101000597273 Homo sapiens PHD finger protein 11 Proteins 0.000 description 1
- 101001071242 Homo sapiens PHD finger protein 12 Proteins 0.000 description 1
- 101001071238 Homo sapiens PHD finger protein 14 Proteins 0.000 description 1
- 101000579354 Homo sapiens PHD finger protein 21A Proteins 0.000 description 1
- 101000692946 Homo sapiens PHD finger protein 3 Proteins 0.000 description 1
- 101001074613 Homo sapiens PIH1 domain-containing protein 1 Proteins 0.000 description 1
- 101000692633 Homo sapiens PIH1 domain-containing protein 2 Proteins 0.000 description 1
- 101100174573 Homo sapiens PIKFYVE gene Proteins 0.000 description 1
- 101001074571 Homo sapiens PIN2/TERF1-interacting telomerase inhibitor 1 Proteins 0.000 description 1
- 101000738901 Homo sapiens PMS1 protein homolog 1 Proteins 0.000 description 1
- 101000621228 Homo sapiens POC1 centriolar protein homolog B Proteins 0.000 description 1
- 101000595929 Homo sapiens POLG alternative reading frame Proteins 0.000 description 1
- 101001000780 Homo sapiens POU domain, class 2, transcription factor 1 Proteins 0.000 description 1
- 101001072590 Homo sapiens POZ-, AT hook-, and zinc finger-containing protein 1 Proteins 0.000 description 1
- 101001123296 Homo sapiens PR domain zinc finger protein 15 Proteins 0.000 description 1
- 101000687346 Homo sapiens PR domain zinc finger protein 2 Proteins 0.000 description 1
- 101000687340 Homo sapiens PR domain zinc finger protein 4 Proteins 0.000 description 1
- 101001123304 Homo sapiens PR domain-containing protein 11 Proteins 0.000 description 1
- 101000741949 Homo sapiens PRA1 family protein 2 Proteins 0.000 description 1
- 101000687425 Homo sapiens PRELI domain-containing protein 1, mitochondrial Proteins 0.000 description 1
- 101000604540 Homo sapiens PRKCA-binding protein Proteins 0.000 description 1
- 101000609957 Homo sapiens PTB-containing, cubilin and LRP1-interacting protein Proteins 0.000 description 1
- 101000586632 Homo sapiens PWWP domain-containing protein 2A Proteins 0.000 description 1
- 101000651906 Homo sapiens Paired amphipathic helix protein Sin3a Proteins 0.000 description 1
- 101000651908 Homo sapiens Paired amphipathic helix protein Sin3b Proteins 0.000 description 1
- 101000677825 Homo sapiens Palmitoyl-protein thioesterase ABHD10, mitochondrial Proteins 0.000 description 1
- 101000915562 Homo sapiens Palmitoyltransferase ZDHHC2 Proteins 0.000 description 1
- 101000915550 Homo sapiens Palmitoyltransferase ZDHHC4 Proteins 0.000 description 1
- 101000759566 Homo sapiens Palmitoyltransferase ZDHHC5 Proteins 0.000 description 1
- 101000759168 Homo sapiens Palmitoyltransferase ZDHHC7 Proteins 0.000 description 1
- 101000976669 Homo sapiens Palmitoyltransferase ZDHHC8 Proteins 0.000 description 1
- 101000589392 Homo sapiens Pannexin-1 Proteins 0.000 description 1
- 101000612657 Homo sapiens Paraspeckle component 1 Proteins 0.000 description 1
- 101001132132 Homo sapiens Partner of Y14 and mago Proteins 0.000 description 1
- 101001129182 Homo sapiens Patatin-like phospholipase domain-containing protein 4 Proteins 0.000 description 1
- 101001129178 Homo sapiens Patatin-like phospholipase domain-containing protein 6 Proteins 0.000 description 1
- 101000609943 Homo sapiens Pecanex-like protein 1 Proteins 0.000 description 1
- 101001073417 Homo sapiens Peflin Proteins 0.000 description 1
- 101000589784 Homo sapiens Pentatricopeptide repeat-containing protein 1, mitochondrial Proteins 0.000 description 1
- 101001090948 Homo sapiens Peptide chain release factor 1, mitochondrial Proteins 0.000 description 1
- 101001090954 Homo sapiens Peptide chain release factor 1-like, mitochondrial Proteins 0.000 description 1
- 101000603761 Homo sapiens Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Proteins 0.000 description 1
- 101001095231 Homo sapiens Peptidyl-prolyl cis-trans isomerase D Proteins 0.000 description 1
- 101001091203 Homo sapiens Peptidyl-prolyl cis-trans isomerase E Proteins 0.000 description 1
- 101001091191 Homo sapiens Peptidyl-prolyl cis-trans isomerase F, mitochondrial Proteins 0.000 description 1
- 101000827313 Homo sapiens Peptidyl-prolyl cis-trans isomerase FKBP3 Proteins 0.000 description 1
- 101000878221 Homo sapiens Peptidyl-prolyl cis-trans isomerase FKBP8 Proteins 0.000 description 1
- 101001091194 Homo sapiens Peptidyl-prolyl cis-trans isomerase G Proteins 0.000 description 1
- 101000741800 Homo sapiens Peptidyl-prolyl cis-trans isomerase H Proteins 0.000 description 1
- 101001084254 Homo sapiens Peptidyl-tRNA hydrolase 2, mitochondrial Proteins 0.000 description 1
- 101000840457 Homo sapiens Peptidyl-tRNA hydrolase ICT1, mitochondrial Proteins 0.000 description 1
- 101001091544 Homo sapiens Peptidylprolyl isomerase domain and WD repeat-containing protein 1 Proteins 0.000 description 1
- 101001117010 Homo sapiens Pericentrin Proteins 0.000 description 1
- 101001131592 Homo sapiens Periodic tryptophan protein 2 homolog Proteins 0.000 description 1
- 101001122930 Homo sapiens Periphilin-1 Proteins 0.000 description 1
- 101001124867 Homo sapiens Peroxiredoxin-1 Proteins 0.000 description 1
- 101001090065 Homo sapiens Peroxiredoxin-2 Proteins 0.000 description 1
- 101000619708 Homo sapiens Peroxiredoxin-6 Proteins 0.000 description 1
- 101000833892 Homo sapiens Peroxisomal acyl-coenzyme A oxidase 1 Proteins 0.000 description 1
- 101000833913 Homo sapiens Peroxisomal acyl-coenzyme A oxidase 3 Proteins 0.000 description 1
- 101001099381 Homo sapiens Peroxisomal biogenesis factor 19 Proteins 0.000 description 1
- 101000595347 Homo sapiens Peroxisomal coenzyme A diphosphatase NUDT7 Proteins 0.000 description 1
- 101000748102 Homo sapiens Peroxisomal membrane protein 11A Proteins 0.000 description 1
- 101000748116 Homo sapiens Peroxisomal membrane protein 11B Proteins 0.000 description 1
- 101001082864 Homo sapiens Peroxisomal membrane protein 4 Proteins 0.000 description 1
- 101000579352 Homo sapiens Peroxisomal membrane protein PEX13 Proteins 0.000 description 1
- 101000600178 Homo sapiens Peroxisomal membrane protein PEX14 Proteins 0.000 description 1
- 101000600189 Homo sapiens Peroxisomal membrane protein PEX16 Proteins 0.000 description 1
- 101001045218 Homo sapiens Peroxisomal multifunctional enzyme type 2 Proteins 0.000 description 1
- 101001073025 Homo sapiens Peroxisomal targeting signal 1 receptor Proteins 0.000 description 1
- 101000730779 Homo sapiens Peroxisome assembly factor 2 Proteins 0.000 description 1
- 101000579342 Homo sapiens Peroxisome assembly protein 12 Proteins 0.000 description 1
- 101001116682 Homo sapiens Peroxisome assembly protein 26 Proteins 0.000 description 1
- 101001099372 Homo sapiens Peroxisome biogenesis factor 1 Proteins 0.000 description 1
- 101001126498 Homo sapiens Peroxisome biogenesis factor 10 Proteins 0.000 description 1
- 101000693847 Homo sapiens Peroxisome biogenesis factor 2 Proteins 0.000 description 1
- 101000741788 Homo sapiens Peroxisome proliferator-activated receptor alpha Proteins 0.000 description 1
- 101001123325 Homo sapiens Peroxisome proliferator-activated receptor gamma coactivator 1-beta Proteins 0.000 description 1
- 101000687026 Homo sapiens Peroxisome proliferator-activated receptor gamma coactivator-related protein 1 Proteins 0.000 description 1
- 101000890327 Homo sapiens Peroxynitrite isomerase THAP4 Proteins 0.000 description 1
- 101001073193 Homo sapiens Pescadillo homolog Proteins 0.000 description 1
- 101000876782 Homo sapiens Phenylalanine-tRNA ligase alpha subunit Proteins 0.000 description 1
- 101000660828 Homo sapiens Phenylalanine-tRNA ligase beta subunit Proteins 0.000 description 1
- 101000842043 Homo sapiens Phenylalanine-tRNA ligase, mitochondrial Proteins 0.000 description 1
- 101000604957 Homo sapiens Phosducin-like protein Proteins 0.000 description 1
- 101001094004 Homo sapiens Phosphatase and actin regulator 4 Proteins 0.000 description 1
- 101000983854 Homo sapiens Phosphatidate phosphatase LPIN1 Proteins 0.000 description 1
- 101000620897 Homo sapiens Phosphatidylcholine transfer protein Proteins 0.000 description 1
- 101000825940 Homo sapiens Phosphatidylcholine:ceramide cholinephosphotransferase 2 Proteins 0.000 description 1
- 101000987493 Homo sapiens Phosphatidylethanolamine-binding protein 1 Proteins 0.000 description 1
- 101000738757 Homo sapiens Phosphatidylglycerophosphatase and protein-tyrosine phosphatase 1 Proteins 0.000 description 1
- 101000869523 Homo sapiens Phosphatidylinositide phosphatase SAC2 Proteins 0.000 description 1
- 101000688606 Homo sapiens Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Proteins 0.000 description 1
- 101000605630 Homo sapiens Phosphatidylinositol 3-kinase catalytic subunit type 3 Proteins 0.000 description 1
- 101001120056 Homo sapiens Phosphatidylinositol 3-kinase regulatory subunit alpha Proteins 0.000 description 1
- 101001120097 Homo sapiens Phosphatidylinositol 3-kinase regulatory subunit beta Proteins 0.000 description 1
- 101000605639 Homo sapiens Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit alpha isoform Proteins 0.000 description 1
- 101000595741 Homo sapiens Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit beta isoform Proteins 0.000 description 1
- 101001001516 Homo sapiens Phosphatidylinositol 4-kinase alpha Proteins 0.000 description 1
- 101000730433 Homo sapiens Phosphatidylinositol 4-kinase beta Proteins 0.000 description 1
- 101000721642 Homo sapiens Phosphatidylinositol 4-phosphate 3-kinase C2 domain-containing subunit alpha Proteins 0.000 description 1
- 101000730454 Homo sapiens Phosphatidylinositol 4-phosphate 5-kinase type-1 alpha Proteins 0.000 description 1
- 101001001527 Homo sapiens Phosphatidylinositol 5-phosphate 4-kinase type-2 beta Proteins 0.000 description 1
- 101001001513 Homo sapiens Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma Proteins 0.000 description 1
- 101000595489 Homo sapiens Phosphatidylinositol N-acetylglucosaminyltransferase subunit A Proteins 0.000 description 1
- 101001001505 Homo sapiens Phosphatidylinositol N-acetylglucosaminyltransferase subunit C Proteins 0.000 description 1
- 101001001500 Homo sapiens Phosphatidylinositol N-acetylglucosaminyltransferase subunit H Proteins 0.000 description 1
- 101001093731 Homo sapiens Phosphatidylinositol N-acetylglucosaminyltransferase subunit Q Proteins 0.000 description 1
- 101001074631 Homo sapiens Phosphatidylinositol N-acetylglucosaminyltransferase subunit Y Proteins 0.000 description 1
- 101000595859 Homo sapiens Phosphatidylinositol transfer protein alpha isoform Proteins 0.000 description 1
- 101000595868 Homo sapiens Phosphatidylinositol transfer protein beta isoform Proteins 0.000 description 1
- 101000869517 Homo sapiens Phosphatidylinositol-3-phosphatase SAC1 Proteins 0.000 description 1
- 101000583474 Homo sapiens Phosphatidylinositol-binding clathrin assembly protein Proteins 0.000 description 1
- 101001001487 Homo sapiens Phosphatidylinositol-glycan biosynthesis class F protein Proteins 0.000 description 1
- 101001074625 Homo sapiens Phosphatidylinositol-glycan biosynthesis class X protein Proteins 0.000 description 1
- 101001096169 Homo sapiens Phosphatidylserine decarboxylase proenzyme, mitochondrial Proteins 0.000 description 1
- 101000760646 Homo sapiens Phosphatidylserine lipase ABHD16A Proteins 0.000 description 1
- 101000833350 Homo sapiens Phosphoacetylglucosamine mutase Proteins 0.000 description 1
- 101000692672 Homo sapiens Phosphoinositide 3-kinase regulatory subunit 4 Proteins 0.000 description 1
- 101000730648 Homo sapiens Phospholipase A-2-activating protein Proteins 0.000 description 1
- 101000613133 Homo sapiens Phospholipase A2 group XV Proteins 0.000 description 1
- 101000730670 Homo sapiens Phospholipase D2 Proteins 0.000 description 1
- 101000829725 Homo sapiens Phospholipid hydroperoxide glutathione peroxidase Proteins 0.000 description 1
- 101001126231 Homo sapiens Phospholipid phosphatase 5 Proteins 0.000 description 1
- 101000582983 Homo sapiens Phospholipid phosphatase-related protein type 2 Proteins 0.000 description 1
- 101000867941 Homo sapiens Phospholipid transfer protein C2CD2L Proteins 0.000 description 1
- 101000923328 Homo sapiens Phospholipid-transporting ATPase IG Proteins 0.000 description 1
- 101000923322 Homo sapiens Phospholipid-transporting ATPase IH Proteins 0.000 description 1
- 101000981515 Homo sapiens Phospholysine phosphohistidine inorganic pyrophosphate phosphatase Proteins 0.000 description 1
- 101001094827 Homo sapiens Phosphomannomutase 1 Proteins 0.000 description 1
- 101001094831 Homo sapiens Phosphomannomutase 2 Proteins 0.000 description 1
- 101000687955 Homo sapiens Phosphomevalonate kinase Proteins 0.000 description 1
- 101001045704 Homo sapiens Phosphoribosyl pyrophosphate synthase-associated protein 1 Proteins 0.000 description 1
- 101001045695 Homo sapiens Phosphoribosyl pyrophosphate synthase-associated protein 2 Proteins 0.000 description 1
- 101001081953 Homo sapiens Phosphoribosylaminoimidazole carboxylase Proteins 0.000 description 1
- 101001136034 Homo sapiens Phosphoribosylformylglycinamidine synthase Proteins 0.000 description 1
- 101000945272 Homo sapiens Phosphorylase b kinase regulatory subunit alpha, liver isoform Proteins 0.000 description 1
- 101001137939 Homo sapiens Phosphorylase b kinase regulatory subunit beta Proteins 0.000 description 1
- 101000615965 Homo sapiens Phosphoserine phosphatase Proteins 0.000 description 1
- 101000595923 Homo sapiens Placenta growth factor Proteins 0.000 description 1
- 101000583189 Homo sapiens Plakophilin-4 Proteins 0.000 description 1
- 101000602212 Homo sapiens Plasmanylethanolamine desaturase Proteins 0.000 description 1
- 101001133656 Homo sapiens Plasminogen activator inhibitor 1 RNA-binding protein Proteins 0.000 description 1
- 101000987238 Homo sapiens Platelet-activating factor acetylhydrolase 2, cytoplasmic Proteins 0.000 description 1
- 101000609360 Homo sapiens Platelet-activating factor acetylhydrolase IB subunit alpha2 Proteins 0.000 description 1
- 101001064282 Homo sapiens Platelet-activating factor acetylhydrolase IB subunit beta Proteins 0.000 description 1
- 101000611888 Homo sapiens Platelet-derived growth factor C Proteins 0.000 description 1
- 101001126098 Homo sapiens Pleckstrin homology domain-containing family B member 2 Proteins 0.000 description 1
- 101000730607 Homo sapiens Pleckstrin homology domain-containing family G member 1 Proteins 0.000 description 1
- 101000583178 Homo sapiens Pleckstrin homology domain-containing family M member 1 Proteins 0.000 description 1
- 101001001802 Homo sapiens Pleckstrin homology domain-containing family M member 2 Proteins 0.000 description 1
- 101001001810 Homo sapiens Pleckstrin homology domain-containing family M member 3 Proteins 0.000 description 1
- 101001002066 Homo sapiens Pleiotropic regulator 1 Proteins 0.000 description 1
- 101001094868 Homo sapiens Plexin-D1 Proteins 0.000 description 1
- 101001066705 Homo sapiens Pogo transposable element with KRAB domain Proteins 0.000 description 1
- 101001066701 Homo sapiens Pogo transposable element with ZNF domain Proteins 0.000 description 1
- 101001113440 Homo sapiens Poly [ADP-ribose] polymerase 2 Proteins 0.000 description 1
- 101000663006 Homo sapiens Poly [ADP-ribose] polymerase tankyrase-1 Proteins 0.000 description 1
- 101000833167 Homo sapiens Poly(A) RNA polymerase GLD2 Proteins 0.000 description 1
- 101000610204 Homo sapiens Poly(A) polymerase alpha Proteins 0.000 description 1
- 101001113490 Homo sapiens Poly(A)-specific ribonuclease PARN Proteins 0.000 description 1
- 101000589450 Homo sapiens Poly(ADP-ribose) glycohydrolase Proteins 0.000 description 1
- 101001087352 Homo sapiens Poly(U)-binding-splicing factor PUF60 Proteins 0.000 description 1
- 101000735358 Homo sapiens Poly(rC)-binding protein 2 Proteins 0.000 description 1
- 101000735365 Homo sapiens Poly(rC)-binding protein 4 Proteins 0.000 description 1
- 101000609211 Homo sapiens Polyadenylate-binding protein 2 Proteins 0.000 description 1
- 101001133619 Homo sapiens Polyadenylate-binding protein-interacting protein 2 Proteins 0.000 description 1
- 101001000676 Homo sapiens Polyamine-modulated factor 1 Proteins 0.000 description 1
- 101000887201 Homo sapiens Polyamine-transporting ATPase 13A2 Proteins 0.000 description 1
- 101000613347 Homo sapiens Polycomb group RING finger protein 3 Proteins 0.000 description 1
- 101000613350 Homo sapiens Polycomb group RING finger protein 5 Proteins 0.000 description 1
- 101000613355 Homo sapiens Polycomb group RING finger protein 6 Proteins 0.000 description 1
- 101000728236 Homo sapiens Polycomb group protein ASXL1 Proteins 0.000 description 1
- 101000584499 Homo sapiens Polycomb protein SUZ12 Proteins 0.000 description 1
- 101000611427 Homo sapiens Polyglutamine-binding protein 1 Proteins 0.000 description 1
- 101000583616 Homo sapiens Polyhomeotic-like protein 2 Proteins 0.000 description 1
- 101001117245 Homo sapiens Polymerase delta-interacting protein 2 Proteins 0.000 description 1
- 101001094809 Homo sapiens Polynucleotide 5'-hydroxyl-kinase Proteins 0.000 description 1
- 101001002235 Homo sapiens Polypeptide N-acetylgalactosaminyltransferase 2 Proteins 0.000 description 1
- 101000827703 Homo sapiens Polyphosphoinositide phosphatase Proteins 0.000 description 1
- 101001135344 Homo sapiens Polypyrimidine tract-binding protein 1 Proteins 0.000 description 1
- 101001126591 Homo sapiens Post-GPI attachment to proteins factor 2 Proteins 0.000 description 1
- 101000610110 Homo sapiens Pre-B-cell leukemia transcription factor 2 Proteins 0.000 description 1
- 101000846284 Homo sapiens Pre-mRNA 3'-end-processing factor FIP1 Proteins 0.000 description 1
- 101001134844 Homo sapiens Pre-mRNA cleavage complex 2 protein Pcf11 Proteins 0.000 description 1
- 101001122801 Homo sapiens Pre-mRNA-processing factor 17 Proteins 0.000 description 1
- 101001125496 Homo sapiens Pre-mRNA-processing factor 19 Proteins 0.000 description 1
- 101000574013 Homo sapiens Pre-mRNA-processing factor 40 homolog A Proteins 0.000 description 1
- 101001105683 Homo sapiens Pre-mRNA-processing-splicing factor 8 Proteins 0.000 description 1
- 101001124937 Homo sapiens Pre-mRNA-splicing factor 38B Proteins 0.000 description 1
- 101000907912 Homo sapiens Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Proteins 0.000 description 1
- 101001122811 Homo sapiens Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16 Proteins 0.000 description 1
- 101000856372 Homo sapiens Pre-mRNA-splicing factor CWC25 homolog Proteins 0.000 description 1
- 101000609379 Homo sapiens Pre-mRNA-splicing factor ISY1 homolog Proteins 0.000 description 1
- 101000633869 Homo sapiens Pre-mRNA-splicing factor SLU7 Proteins 0.000 description 1
- 101000642431 Homo sapiens Pre-mRNA-splicing factor SPF27 Proteins 0.000 description 1
- 101000662112 Homo sapiens Pre-mRNA-splicing factor SYF2 Proteins 0.000 description 1
- 101000914035 Homo sapiens Pre-mRNA-splicing regulator WTAP Proteins 0.000 description 1
- 101000605345 Homo sapiens Prefoldin subunit 1 Proteins 0.000 description 1
- 101001116674 Homo sapiens Prefoldin subunit 2 Proteins 0.000 description 1
- 101001116668 Homo sapiens Prefoldin subunit 3 Proteins 0.000 description 1
- 101000693735 Homo sapiens Prefoldin subunit 4 Proteins 0.000 description 1
- 101000693750 Homo sapiens Prefoldin subunit 5 Proteins 0.000 description 1
- 101000730802 Homo sapiens Prefoldin subunit 6 Proteins 0.000 description 1
- 101000617536 Homo sapiens Presenilin-1 Proteins 0.000 description 1
- 101000617546 Homo sapiens Presenilin-2 Proteins 0.000 description 1
- 101000741967 Homo sapiens Presequence protease, mitochondrial Proteins 0.000 description 1
- 101000984960 Homo sapiens Probable 18S rRNA (guanine-N(7))-methyltransferase Proteins 0.000 description 1
- 101000973947 Homo sapiens Probable 28S rRNA (cytosine(4447)-C(5))-methyltransferase Proteins 0.000 description 1
- 101000720856 Homo sapiens Probable ATP-dependent RNA helicase DDX10 Proteins 0.000 description 1
- 101001041721 Homo sapiens Probable ATP-dependent RNA helicase DDX17 Proteins 0.000 description 1
- 101000912686 Homo sapiens Probable ATP-dependent RNA helicase DDX23 Proteins 0.000 description 1
- 101000870728 Homo sapiens Probable ATP-dependent RNA helicase DDX27 Proteins 0.000 description 1
- 101000874165 Homo sapiens Probable ATP-dependent RNA helicase DDX41 Proteins 0.000 description 1
- 101000874142 Homo sapiens Probable ATP-dependent RNA helicase DDX46 Proteins 0.000 description 1
- 101000830414 Homo sapiens Probable ATP-dependent RNA helicase DDX47 Proteins 0.000 description 1
- 101000952113 Homo sapiens Probable ATP-dependent RNA helicase DDX5 Proteins 0.000 description 1
- 101000883801 Homo sapiens Probable ATP-dependent RNA helicase DDX52 Proteins 0.000 description 1
- 101000951948 Homo sapiens Probable ATP-dependent RNA helicase DDX56 Proteins 0.000 description 1
- 101000952097 Homo sapiens Probable ATP-dependent RNA helicase DDX59 Proteins 0.000 description 1
- 101000919019 Homo sapiens Probable ATP-dependent RNA helicase DDX6 Proteins 0.000 description 1
- 101000901928 Homo sapiens Probable ATP-dependent RNA helicase DHX35 Proteins 0.000 description 1
- 101000864677 Homo sapiens Probable ATP-dependent RNA helicase DHX40 Proteins 0.000 description 1
- 101000915002 Homo sapiens Probable C-mannosyltransferase DPY19L1 Proteins 0.000 description 1
- 101000915008 Homo sapiens Probable C-mannosyltransferase DPY19L3 Proteins 0.000 description 1
- 101000872867 Homo sapiens Probable E3 ubiquitin-protein ligase HECTD4 Proteins 0.000 description 1
- 101000872514 Homo sapiens Probable E3 ubiquitin-protein ligase HERC1 Proteins 0.000 description 1
- 101001035260 Homo sapiens Probable E3 ubiquitin-protein ligase HERC3 Proteins 0.000 description 1
- 101001035259 Homo sapiens Probable E3 ubiquitin-protein ligase HERC4 Proteins 0.000 description 1
- 101000766246 Homo sapiens Probable E3 ubiquitin-protein ligase MID2 Proteins 0.000 description 1
- 101001028703 Homo sapiens Probable JmjC domain-containing histone demethylation protein 2C Proteins 0.000 description 1
- 101001062087 Homo sapiens Probable RNA-binding protein 19 Proteins 0.000 description 1
- 101000580713 Homo sapiens Probable RNA-binding protein 23 Proteins 0.000 description 1
- 101000881614 Homo sapiens Probable RNA-binding protein EIF1AD Proteins 0.000 description 1
- 101000808521 Homo sapiens Probable U3 small nucleolar RNA-associated protein 11 Proteins 0.000 description 1
- 101000694029 Homo sapiens Probable aminopeptidase NPEPL1 Proteins 0.000 description 1
- 101000640325 Homo sapiens Probable asparagine-tRNA ligase, mitochondrial Proteins 0.000 description 1
- 101000951118 Homo sapiens Probable dimethyladenosine transferase Proteins 0.000 description 1
- 101000717815 Homo sapiens Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Proteins 0.000 description 1
- 101000917550 Homo sapiens Probable fibrosin-1 Proteins 0.000 description 1
- 101000702559 Homo sapiens Probable global transcription activator SNF2L2 Proteins 0.000 description 1
- 101000630267 Homo sapiens Probable glutamate-tRNA ligase, mitochondrial Proteins 0.000 description 1
- 101000836337 Homo sapiens Probable helicase senataxin Proteins 0.000 description 1
- 101001083769 Homo sapiens Probable helicase with zinc finger domain Proteins 0.000 description 1
- 101000788412 Homo sapiens Probable methyltransferase TARBP1 Proteins 0.000 description 1
- 101001033177 Homo sapiens Probable methyltransferase-like protein 23 Proteins 0.000 description 1
- 101001135995 Homo sapiens Probable peptidyl-tRNA hydrolase Proteins 0.000 description 1
- 101001015936 Homo sapiens Probable rRNA-processing protein EBP2 Proteins 0.000 description 1
- 101000598806 Homo sapiens Probable tRNA N6-adenosine threonylcarbamoyltransferase Proteins 0.000 description 1
- 101000596553 Homo sapiens Probable tRNA(His) guanylyltransferase Proteins 0.000 description 1
- 101000808592 Homo sapiens Probable ubiquitin carboxyl-terminal hydrolase FAF-X Proteins 0.000 description 1
- 101000595913 Homo sapiens Procollagen glycosyltransferase Proteins 0.000 description 1
- 101000595904 Homo sapiens Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Proteins 0.000 description 1
- 101000577619 Homo sapiens Profilin-1 Proteins 0.000 description 1
- 101001134621 Homo sapiens Programmed cell death 6-interacting protein Proteins 0.000 description 1
- 101000611939 Homo sapiens Programmed cell death protein 2 Proteins 0.000 description 1
- 101000734643 Homo sapiens Programmed cell death protein 5 Proteins 0.000 description 1
- 101000734646 Homo sapiens Programmed cell death protein 6 Proteins 0.000 description 1
- 101000734650 Homo sapiens Programmed cell death protein 7 Proteins 0.000 description 1
- 101001129654 Homo sapiens Prohibitin-2 Proteins 0.000 description 1
- 101000611655 Homo sapiens Prolactin regulatory element-binding protein Proteins 0.000 description 1
- 101000983170 Homo sapiens Proliferation-associated protein 2G4 Proteins 0.000 description 1
- 101001125576 Homo sapiens Proline and serine-rich protein 3 Proteins 0.000 description 1
- 101000734702 Homo sapiens Proline-, glutamic acid- and leucine-rich protein 1 Proteins 0.000 description 1
- 101000690268 Homo sapiens Proline-rich AKT1 substrate 1 Proteins 0.000 description 1
- 101000738945 Homo sapiens Proline-rich nuclear receptor coactivator 2 Proteins 0.000 description 1
- 101000611614 Homo sapiens Proline-rich protein PRCC Proteins 0.000 description 1
- 101001043564 Homo sapiens Prolow-density lipoprotein receptor-related protein 1 Proteins 0.000 description 1
- 101001133941 Homo sapiens Prolyl 3-hydroxylase 1 Proteins 0.000 description 1
- 101000614345 Homo sapiens Prolyl 4-hydroxylase subunit alpha-1 Proteins 0.000 description 1
- 101001098982 Homo sapiens Propionyl-CoA carboxylase beta chain, mitochondrial Proteins 0.000 description 1
- 101001098872 Homo sapiens Proprotein convertase subtilisin/kexin type 7 Proteins 0.000 description 1
- 101001102318 Homo sapiens Prostate tumor-overexpressed gene 1 protein Proteins 0.000 description 1
- 101001115830 Homo sapiens Prostate-associated microseminoprotein Proteins 0.000 description 1
- 101000585054 Homo sapiens Proteasomal ATPase-associated factor 1 Proteins 0.000 description 1
- 101000705759 Homo sapiens Proteasome activator complex subunit 2 Proteins 0.000 description 1
- 101000705766 Homo sapiens Proteasome activator complex subunit 3 Proteins 0.000 description 1
- 101000705770 Homo sapiens Proteasome activator complex subunit 4 Proteins 0.000 description 1
- 101001104566 Homo sapiens Proteasome assembly chaperone 3 Proteins 0.000 description 1
- 101001104560 Homo sapiens Proteasome assembly chaperone 4 Proteins 0.000 description 1
- 101000610781 Homo sapiens Proteasome subunit alpha type-2 Proteins 0.000 description 1
- 101001136888 Homo sapiens Proteasome subunit alpha type-3 Proteins 0.000 description 1
- 101000577424 Homo sapiens Proteasome subunit alpha type-4 Proteins 0.000 description 1
- 101001124667 Homo sapiens Proteasome subunit alpha type-5 Proteins 0.000 description 1
- 101001090813 Homo sapiens Proteasome subunit alpha type-6 Proteins 0.000 description 1
- 101001105486 Homo sapiens Proteasome subunit alpha type-7 Proteins 0.000 description 1
- 101000706678 Homo sapiens Proteasome subunit beta type-1 Proteins 0.000 description 1
- 101000611053 Homo sapiens Proteasome subunit beta type-2 Proteins 0.000 description 1
- 101001089120 Homo sapiens Proteasome subunit beta type-3 Proteins 0.000 description 1
- 101000592466 Homo sapiens Proteasome subunit beta type-4 Proteins 0.000 description 1
- 101000735881 Homo sapiens Proteasome subunit beta type-5 Proteins 0.000 description 1
- 101000735893 Homo sapiens Proteasome subunit beta type-6 Proteins 0.000 description 1
- 101001136954 Homo sapiens Proteasome subunit beta type-7 Proteins 0.000 description 1
- 101000741885 Homo sapiens Protection of telomeres protein 1 Proteins 0.000 description 1
- 101000783851 Homo sapiens Protein AAR2 homolog Proteins 0.000 description 1
- 101000799554 Homo sapiens Protein AATF Proteins 0.000 description 1
- 101000677831 Homo sapiens Protein ABHD11 Proteins 0.000 description 1
- 101000760613 Homo sapiens Protein ABHD14A Proteins 0.000 description 1
- 101000742935 Homo sapiens Protein ABHD18 Proteins 0.000 description 1
- 101000718497 Homo sapiens Protein AF-10 Proteins 0.000 description 1
- 101000797903 Homo sapiens Protein ALEX Proteins 0.000 description 1
- 101000964373 Homo sapiens Protein Abitram Proteins 0.000 description 1
- 101000971151 Homo sapiens Protein BANP Proteins 0.000 description 1
- 101000794237 Homo sapiens Protein BRAWNIN Proteins 0.000 description 1
- 101000864393 Homo sapiens Protein BUD31 homolog Proteins 0.000 description 1
- 101000898093 Homo sapiens Protein C-ets-2 Proteins 0.000 description 1
- 101000942217 Homo sapiens Protein C19orf12 Proteins 0.000 description 1
- 101000794518 Homo sapiens Protein C1orf43 Proteins 0.000 description 1
- 101000947115 Homo sapiens Protein CASC3 Proteins 0.000 description 1
- 101000761460 Homo sapiens Protein CASP Proteins 0.000 description 1
- 101000892061 Homo sapiens Protein CCSMST1 Proteins 0.000 description 1
- 101000980965 Homo sapiens Protein CDV3 homolog Proteins 0.000 description 1
- 101000946275 Homo sapiens Protein CLEC16A Proteins 0.000 description 1
- 101000859935 Homo sapiens Protein CREG1 Proteins 0.000 description 1
- 101000884108 Homo sapiens Protein Churchill Proteins 0.000 description 1
- 101000948324 Homo sapiens Protein CutA Proteins 0.000 description 1
- 101000925095 Homo sapiens Protein EFR3 homolog A Proteins 0.000 description 1
- 101000881752 Homo sapiens Protein ELYS Proteins 0.000 description 1
- 101000920644 Homo sapiens Protein EOLA1 Proteins 0.000 description 1
- 101001064169 Homo sapiens Protein EOLA2 Proteins 0.000 description 1
- 101001038300 Homo sapiens Protein ERGIC-53 Proteins 0.000 description 1
- 101001063921 Homo sapiens Protein FAM104B Proteins 0.000 description 1
- 101001048764 Homo sapiens Protein FAM118A Proteins 0.000 description 1
- 101000882136 Homo sapiens Protein FAM133B Proteins 0.000 description 1
- 101000882083 Homo sapiens Protein FAM135A Proteins 0.000 description 1
- 101001062760 Homo sapiens Protein FAM13A Proteins 0.000 description 1
- 101001048811 Homo sapiens Protein FAM162A Proteins 0.000 description 1
- 101000854603 Homo sapiens Protein FAM168A Proteins 0.000 description 1
- 101000823451 Homo sapiens Protein FAM174C Proteins 0.000 description 1
- 101001028900 Homo sapiens Protein FAM177A1 Proteins 0.000 description 1
- 101000877816 Homo sapiens Protein FAM185A Proteins 0.000 description 1
- 101001048947 Homo sapiens Protein FAM189B Proteins 0.000 description 1
- 101001048938 Homo sapiens Protein FAM193A Proteins 0.000 description 1
- 101000848933 Homo sapiens Protein FAM193B Proteins 0.000 description 1
- 101000882270 Homo sapiens Protein FAM204A Proteins 0.000 description 1
- 101000882257 Homo sapiens Protein FAM210A Proteins 0.000 description 1
- 101000882228 Homo sapiens Protein FAM32A Proteins 0.000 description 1
- 101000891860 Homo sapiens Protein FAM3A Proteins 0.000 description 1
- 101000882217 Homo sapiens Protein FAM50A Proteins 0.000 description 1
- 101000882220 Homo sapiens Protein FAM50B Proteins 0.000 description 1
- 101001027850 Homo sapiens Protein FAM53C Proteins 0.000 description 1
- 101000911386 Homo sapiens Protein FAM8A1 Proteins 0.000 description 1
- 101000911388 Homo sapiens Protein FAM98A Proteins 0.000 description 1
- 101000823407 Homo sapiens Protein FAM98B Proteins 0.000 description 1
- 101001061041 Homo sapiens Protein FRG1 Proteins 0.000 description 1
- 101001070474 Homo sapiens Protein GPR107 Proteins 0.000 description 1
- 101001070470 Homo sapiens Protein GPR108 Proteins 0.000 description 1
- 101000842368 Homo sapiens Protein HIRA Proteins 0.000 description 1
- 101000994307 Homo sapiens Protein ITPRID2 Proteins 0.000 description 1
- 101000994476 Homo sapiens Protein Jade-3 Proteins 0.000 description 1
- 101001050612 Homo sapiens Protein KHNYN Proteins 0.000 description 1
- 101000579580 Homo sapiens Protein LSM14 homolog A Proteins 0.000 description 1
- 101000981685 Homo sapiens Protein Lines homolog 1 Proteins 0.000 description 1
- 101001016806 Homo sapiens Protein MANBAL Proteins 0.000 description 1
- 101000990964 Homo sapiens Protein MIS12 homolog Proteins 0.000 description 1
- 101000577964 Homo sapiens Protein MIX23 Proteins 0.000 description 1
- 101000624382 Homo sapiens Protein MON2 homolog Proteins 0.000 description 1
- 101000986265 Homo sapiens Protein MTSS 1 Proteins 0.000 description 1
- 101000969776 Homo sapiens Protein Mpv17 Proteins 0.000 description 1
- 101000594428 Homo sapiens Protein N-lysine methyltransferase METTL21A Proteins 0.000 description 1
- 101000594439 Homo sapiens Protein N-lysine methyltransferase METTL21D Proteins 0.000 description 1
- 101000996830 Homo sapiens Protein N-terminal asparagine amidohydrolase Proteins 0.000 description 1
- 101000585728 Homo sapiens Protein O-GlcNAcase Proteins 0.000 description 1
- 101001123963 Homo sapiens Protein O-mannosyl-transferase 1 Proteins 0.000 description 1
- 101000801296 Homo sapiens Protein O-mannosyl-transferase TMTC4 Proteins 0.000 description 1
- 101001133654 Homo sapiens Protein PALS1 Proteins 0.000 description 1
- 101000610095 Homo sapiens Protein PBDC1 Proteins 0.000 description 1
- 101000705607 Homo sapiens Protein PET100 homolog, mitochondrial Proteins 0.000 description 1
- 101001135375 Homo sapiens Protein PET117 homolog, mitochondrial Proteins 0.000 description 1
- 101000848498 Homo sapiens Protein POLR1D, isoform 2 Proteins 0.000 description 1
- 101001068634 Homo sapiens Protein PRRC2A Proteins 0.000 description 1
- 101001068630 Homo sapiens Protein PRRC2B Proteins 0.000 description 1
- 101001068628 Homo sapiens Protein PRRC2C Proteins 0.000 description 1
- 101000849321 Homo sapiens Protein RRP5 homolog Proteins 0.000 description 1
- 101000713957 Homo sapiens Protein RUFY3 Proteins 0.000 description 1
- 101000716750 Homo sapiens Protein SCAF11 Proteins 0.000 description 1
- 101000874364 Homo sapiens Protein SCO2 homolog, mitochondrial Proteins 0.000 description 1
- 101000617296 Homo sapiens Protein SEC13 homolog Proteins 0.000 description 1
- 101000739146 Homo sapiens Protein SFI1 homolog Proteins 0.000 description 1
- 101000739214 Homo sapiens Protein SGT1 homolog Proteins 0.000 description 1
- 101000786631 Homo sapiens Protein SYS1 homolog Proteins 0.000 description 1
- 101000595876 Homo sapiens Protein TASOR Proteins 0.000 description 1
- 101000596012 Homo sapiens Protein TASOR 2 Proteins 0.000 description 1
- 101000620365 Homo sapiens Protein TMEPAI Proteins 0.000 description 1
- 101000772227 Homo sapiens Protein TSSC4 Proteins 0.000 description 1
- 101000764357 Homo sapiens Protein Tob1 Proteins 0.000 description 1
- 101000650180 Homo sapiens Protein WWC3 Proteins 0.000 description 1
- 101000747057 Homo sapiens Protein YIF1B Proteins 0.000 description 1
- 101000789800 Homo sapiens Protein YIPF3 Proteins 0.000 description 1
- 101000793359 Homo sapiens Protein YIPF5 Proteins 0.000 description 1
- 101000793247 Homo sapiens Protein YIPF6 Proteins 0.000 description 1
- 101001027622 Homo sapiens Protein adenylyltransferase FICD Proteins 0.000 description 1
- 101000757216 Homo sapiens Protein arginine N-methyltransferase 1 Proteins 0.000 description 1
- 101000924541 Homo sapiens Protein arginine N-methyltransferase 3 Proteins 0.000 description 1
- 101000693024 Homo sapiens Protein arginine N-methyltransferase 7 Proteins 0.000 description 1
- 101000780650 Homo sapiens Protein argonaute-1 Proteins 0.000 description 1
- 101000923332 Homo sapiens Protein asteroid homolog 1 Proteins 0.000 description 1
- 101000873615 Homo sapiens Protein bicaudal D homolog 2 Proteins 0.000 description 1
- 101000900789 Homo sapiens Protein canopy homolog 2 Proteins 0.000 description 1
- 101000941994 Homo sapiens Protein cereblon Proteins 0.000 description 1
- 101000910825 Homo sapiens Protein chibby homolog 1 Proteins 0.000 description 1
- 101000900767 Homo sapiens Protein cornichon homolog 1 Proteins 0.000 description 1
- 101000909882 Homo sapiens Protein cornichon homolog 4 Proteins 0.000 description 1
- 101000928408 Homo sapiens Protein diaphanous homolog 2 Proteins 0.000 description 1
- 101000919288 Homo sapiens Protein disulfide isomerase CRELD1 Proteins 0.000 description 1
- 101000919297 Homo sapiens Protein disulfide isomerase CRELD2 Proteins 0.000 description 1
- 101001072202 Homo sapiens Protein disulfide-isomerase Proteins 0.000 description 1
- 101001098802 Homo sapiens Protein disulfide-isomerase A3 Proteins 0.000 description 1
- 101001098769 Homo sapiens Protein disulfide-isomerase A6 Proteins 0.000 description 1
- 101001064096 Homo sapiens Protein disulfide-thiol oxidoreductase Proteins 0.000 description 1
- 101000863994 Homo sapiens Protein dopey-1 Proteins 0.000 description 1
- 101000863956 Homo sapiens Protein dopey-2 Proteins 0.000 description 1
- 101000861587 Homo sapiens Protein farnesyltransferase subunit beta Proteins 0.000 description 1
- 101000877589 Homo sapiens Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha Proteins 0.000 description 1
- 101000931682 Homo sapiens Protein furry homolog-like Proteins 0.000 description 1
- 101000983130 Homo sapiens Protein kinase C and casein kinase substrate in neurons protein 2 Proteins 0.000 description 1
- 101000971404 Homo sapiens Protein kinase C iota type Proteins 0.000 description 1
- 101001074295 Homo sapiens Protein kinase C-binding protein 1 Proteins 0.000 description 1
- 101000972637 Homo sapiens Protein kintoun Proteins 0.000 description 1
- 101000981742 Homo sapiens Protein lifeguard 1 Proteins 0.000 description 1
- 101000981715 Homo sapiens Protein lifeguard 4 Proteins 0.000 description 1
- 101001004288 Homo sapiens Protein lin-52 homolog Proteins 0.000 description 1
- 101001004334 Homo sapiens Protein lin-54 homolog Proteins 0.000 description 1
- 101000628776 Homo sapiens Protein mago nashi homolog Proteins 0.000 description 1
- 101000613542 Homo sapiens Protein mono-ADP-ribosyltransferase PARP16 Proteins 0.000 description 1
- 101000735456 Homo sapiens Protein mono-ADP-ribosyltransferase PARP3 Proteins 0.000 description 1
- 101000735459 Homo sapiens Protein mono-ADP-ribosyltransferase PARP9 Proteins 0.000 description 1
- 101000735473 Homo sapiens Protein mono-ADP-ribosyltransferase TIPARP Proteins 0.000 description 1
- 101000597553 Homo sapiens Protein odr-4 homolog Proteins 0.000 description 1
- 101001000998 Homo sapiens Protein phosphatase 1 regulatory subunit 12C Proteins 0.000 description 1
- 101000742063 Homo sapiens Protein phosphatase 1 regulatory subunit 21 Proteins 0.000 description 1
- 101001123077 Homo sapiens Protein phosphatase 1 regulatory subunit 3E Proteins 0.000 description 1
- 101000741910 Homo sapiens Protein phosphatase 1 regulatory subunit 7 Proteins 0.000 description 1
- 101000742051 Homo sapiens Protein phosphatase 1B Proteins 0.000 description 1
- 101000742054 Homo sapiens Protein phosphatase 1D Proteins 0.000 description 1
- 101000704457 Homo sapiens Protein phosphatase Slingshot homolog 3 Proteins 0.000 description 1
- 101001095294 Homo sapiens Protein phosphatase methylesterase 1 Proteins 0.000 description 1
- 101001104863 Homo sapiens Protein prenyltransferase alpha subunit repeat-containing protein 1 Proteins 0.000 description 1
- 101000617017 Homo sapiens Protein scribble homolog Proteins 0.000 description 1
- 101000685275 Homo sapiens Protein sel-1 homolog 1 Proteins 0.000 description 1
- 101000652798 Homo sapiens Protein shisa-5 Proteins 0.000 description 1
- 101000702132 Homo sapiens Protein spinster homolog 1 Proteins 0.000 description 1
- 101000654448 Homo sapiens Protein transport protein Sec16A Proteins 0.000 description 1
- 101000685918 Homo sapiens Protein transport protein Sec23A Proteins 0.000 description 1
- 101000685914 Homo sapiens Protein transport protein Sec23B Proteins 0.000 description 1
- 101000685923 Homo sapiens Protein transport protein Sec24A Proteins 0.000 description 1
- 101000684926 Homo sapiens Protein transport protein Sec24B Proteins 0.000 description 1
- 101000822312 Homo sapiens Protein transport protein Sec24C Proteins 0.000 description 1
- 101000822339 Homo sapiens Protein transport protein Sec24D Proteins 0.000 description 1
- 101000641111 Homo sapiens Protein transport protein Sec61 subunit alpha isoform 1 Proteins 0.000 description 1
- 101001093116 Homo sapiens Protein transport protein Sec61 subunit beta Proteins 0.000 description 1
- 101001093143 Homo sapiens Protein transport protein Sec61 subunit gamma Proteins 0.000 description 1
- 101000830691 Homo sapiens Protein tyrosine phosphatase type IVA 2 Proteins 0.000 description 1
- 101000659526 Homo sapiens Protein unc-119 homolog B Proteins 0.000 description 1
- 101000644080 Homo sapiens Protein unc-45 homolog A Proteins 0.000 description 1
- 101000672307 Homo sapiens Protein unc-50 homolog Proteins 0.000 description 1
- 101000666873 Homo sapiens Protein virilizer homolog Proteins 0.000 description 1
- 101000769165 Homo sapiens Protein yippee-like 2 Proteins 0.000 description 1
- 101001134890 Homo sapiens Protein-L-isoaspartate O-methyltransferase domain-containing protein 2 Proteins 0.000 description 1
- 101001129833 Homo sapiens Protein-L-isoaspartate(D-aspartate) O-methyltransferase Proteins 0.000 description 1
- 101000649077 Homo sapiens Protein-tyrosine sulfotransferase 2 Proteins 0.000 description 1
- 101000801330 Homo sapiens Proton-transporting V-type ATPase complex assembly regulator TMEM9 Proteins 0.000 description 1
- 101000785735 Homo sapiens Protrudin Proteins 0.000 description 1
- 101001035676 Homo sapiens Pseudouridine-5'-phosphatase Proteins 0.000 description 1
- 101001082131 Homo sapiens Pumilio homolog 3 Proteins 0.000 description 1
- 101000592517 Homo sapiens Puromycin-sensitive aminopeptidase Proteins 0.000 description 1
- 101000890956 Homo sapiens Putative Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase Proteins 0.000 description 1
- 101000841688 Homo sapiens Putative E3 ubiquitin-protein ligase UNKL Proteins 0.000 description 1
- 101001130554 Homo sapiens Putative RNA-binding protein 15B Proteins 0.000 description 1
- 101001008492 Homo sapiens Putative RNA-binding protein Luc7-like 2 Proteins 0.000 description 1
- 101000797874 Homo sapiens Putative bifunctional UDP-N-acetylglucosamine transferase and deubiquitinase ALG13 Proteins 0.000 description 1
- 101000891568 Homo sapiens Putative deoxyribonuclease TATDN2 Proteins 0.000 description 1
- 101000891573 Homo sapiens Putative deoxyribonuclease TATDN3 Proteins 0.000 description 1
- 101000989486 Homo sapiens Putative methyltransferase C9orf114 Proteins 0.000 description 1
- 101001135635 Homo sapiens Putative peptidyl-tRNA hydrolase PTRHD1 Proteins 0.000 description 1
- 101001074414 Homo sapiens Putative phospholipase B-like 2 Proteins 0.000 description 1
- 101000586383 Homo sapiens Putative ribosome-binding factor A, mitochondrial Proteins 0.000 description 1
- 101000611731 Homo sapiens Putative tRNA (cytidine(32)/guanosine(34)-2'-O)-methyltransferase Proteins 0.000 description 1
- 101000741407 Homo sapiens Putative transferase CAF17, mitochondrial Proteins 0.000 description 1
- 101000626551 Homo sapiens Putative transmembrane protein 183BP Proteins 0.000 description 1
- 101000643923 Homo sapiens Putative ubiquitin-conjugating enzyme E2 N-like Proteins 0.000 description 1
- 101000941913 Homo sapiens Putative uncharacterized protein LINC02693 Proteins 0.000 description 1
- 101000689365 Homo sapiens Pyridoxal phosphate homeostasis protein Proteins 0.000 description 1
- 101000734537 Homo sapiens Pyridoxal-dependent decarboxylase domain-containing protein 1 Proteins 0.000 description 1
- 101001129465 Homo sapiens Pyroglutamyl-peptidase 1 Proteins 0.000 description 1
- 101000609336 Homo sapiens Pyrroline-5-carboxylate reductase 2 Proteins 0.000 description 1
- 101001137451 Homo sapiens Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Proteins 0.000 description 1
- 101000597542 Homo sapiens Pyruvate dehydrogenase protein X component, mitochondrial Proteins 0.000 description 1
- 101000743763 Homo sapiens R3H and coiled-coil domain-containing protein 1 Proteins 0.000 description 1
- 101000743768 Homo sapiens R3H domain-containing protein 1 Proteins 0.000 description 1
- 101000743771 Homo sapiens R3H domain-containing protein 2 Proteins 0.000 description 1
- 101000779418 Homo sapiens RAC-alpha serine/threonine-protein kinase Proteins 0.000 description 1
- 101000798015 Homo sapiens RAC-beta serine/threonine-protein kinase Proteins 0.000 description 1
- 101000712530 Homo sapiens RAF proto-oncogene serine/threonine-protein kinase Proteins 0.000 description 1
- 101001100176 Homo sapiens RB-associated KRAB zinc finger protein Proteins 0.000 description 1
- 101001112424 Homo sapiens RB1-inducible coiled-coil protein 1 Proteins 0.000 description 1
- 101000687448 Homo sapiens REST corepressor 1 Proteins 0.000 description 1
- 101000687459 Homo sapiens REST corepressor 3 Proteins 0.000 description 1
- 101000788755 Homo sapiens RING finger and CHY zinc finger domain-containing protein 1 Proteins 0.000 description 1
- 101000734222 Homo sapiens RING finger protein 10 Proteins 0.000 description 1
- 101000711928 Homo sapiens RING finger protein 11 Proteins 0.000 description 1
- 101001106969 Homo sapiens RING finger protein 141 Proteins 0.000 description 1
- 101000692973 Homo sapiens RING finger protein 145 Proteins 0.000 description 1
- 101000734275 Homo sapiens RING finger protein 214 Proteins 0.000 description 1
- 101000692686 Homo sapiens RING finger protein 37 Proteins 0.000 description 1
- 101001111714 Homo sapiens RING-box protein 2 Proteins 0.000 description 1
- 101000574242 Homo sapiens RING-type E3 ubiquitin-protein ligase PPIL2 Proteins 0.000 description 1
- 101000727821 Homo sapiens RING1 and YY1-binding protein Proteins 0.000 description 1
- 101000763328 Homo sapiens RISC-loading complex subunit TARBP2 Proteins 0.000 description 1
- 101000699762 Homo sapiens RNA 3'-terminal phosphate cyclase Proteins 0.000 description 1
- 101000580317 Homo sapiens RNA 3'-terminal phosphate cyclase-like protein Proteins 0.000 description 1
- 101000650354 Homo sapiens RNA binding motif protein, X-linked-like-1 Proteins 0.000 description 1
- 101001108656 Homo sapiens RNA cytosine C(5)-methyltransferase NSUN2 Proteins 0.000 description 1
- 101000959153 Homo sapiens RNA demethylase ALKBH5 Proteins 0.000 description 1
- 101001048702 Homo sapiens RNA polymerase II elongation factor ELL2 Proteins 0.000 description 1
- 101000725943 Homo sapiens RNA polymerase II subunit A C-terminal domain phosphatase Proteins 0.000 description 1
- 101000585534 Homo sapiens RNA polymerase II-associated factor 1 homolog Proteins 0.000 description 1
- 101000848478 Homo sapiens RNA polymerase II-associated protein 1 Proteins 0.000 description 1
- 101000848502 Homo sapiens RNA polymerase II-associated protein 3 Proteins 0.000 description 1
- 101000746142 Homo sapiens RNA polymerase-associated protein CTR9 homolog Proteins 0.000 description 1
- 101000639777 Homo sapiens RNA polymerase-associated protein RTF1 homolog Proteins 0.000 description 1
- 101000694402 Homo sapiens RNA transcription, translation and transport factor protein Proteins 0.000 description 1
- 101000687317 Homo sapiens RNA-binding motif protein, X chromosome Proteins 0.000 description 1
- 101000668336 Homo sapiens RNA-binding motif protein, X-linked 2 Proteins 0.000 description 1
- 101000580092 Homo sapiens RNA-binding protein 10 Proteins 0.000 description 1
- 101000580097 Homo sapiens RNA-binding protein 12 Proteins 0.000 description 1
- 101001062098 Homo sapiens RNA-binding protein 14 Proteins 0.000 description 1
- 101001062093 Homo sapiens RNA-binding protein 15 Proteins 0.000 description 1
- 101001076724 Homo sapiens RNA-binding protein 28 Proteins 0.000 description 1
- 101001076728 Homo sapiens RNA-binding protein 34 Proteins 0.000 description 1
- 101000743242 Homo sapiens RNA-binding protein 4 Proteins 0.000 description 1
- 101001111928 Homo sapiens RNA-binding protein 41 Proteins 0.000 description 1
- 101000743272 Homo sapiens RNA-binding protein 5 Proteins 0.000 description 1
- 101000743264 Homo sapiens RNA-binding protein 6 Proteins 0.000 description 1
- 101000743268 Homo sapiens RNA-binding protein 7 Proteins 0.000 description 1
- 101000668140 Homo sapiens RNA-binding protein 8A Proteins 0.000 description 1
- 101001109419 Homo sapiens RNA-binding protein NOB1 Proteins 0.000 description 1
- 101000685886 Homo sapiens RNA-binding protein RO60 Proteins 0.000 description 1
- 101001077488 Homo sapiens RNA-binding protein Raly Proteins 0.000 description 1
- 101000657350 Homo sapiens RNA-splicing ligase RtcB homolog Proteins 0.000 description 1
- 101000881131 Homo sapiens RNA/RNP complex-1-interacting phosphatase Proteins 0.000 description 1
- 101000680858 Homo sapiens RPA-interacting protein Proteins 0.000 description 1
- 101000683507 Homo sapiens RRP12-like protein Proteins 0.000 description 1
- 101000714026 Homo sapiens RUN and FYVE domain-containing protein 1 Proteins 0.000 description 1
- 101000822222 Homo sapiens RWD domain-containing protein 1 Proteins 0.000 description 1
- 101000693056 Homo sapiens RWD domain-containing protein 2B Proteins 0.000 description 1
- 101000822234 Homo sapiens RWD domain-containing protein 3 Proteins 0.000 description 1
- 101000926083 Homo sapiens Rab GDP dissociation inhibitor beta Proteins 0.000 description 1
- 101001130290 Homo sapiens Rab GTPase-binding effector protein 1 Proteins 0.000 description 1
- 101001106808 Homo sapiens Rab11 family-interacting protein 3 Proteins 0.000 description 1
- 101001061915 Homo sapiens Rab3 GTPase-activating protein catalytic subunit Proteins 0.000 description 1
- 101000712814 Homo sapiens Rab3 GTPase-activating protein non-catalytic subunit Proteins 0.000 description 1
- 101000620856 Homo sapiens Rab5 GDP/GTP exchange factor Proteins 0.000 description 1
- 101001130279 Homo sapiens Rab9 effector protein with kelch motifs Proteins 0.000 description 1
- 101000889795 Homo sapiens Rabankyrin-5 Proteins 0.000 description 1
- 101000619497 Homo sapiens Ragulator complex protein LAMTOR1 Proteins 0.000 description 1
- 101000619506 Homo sapiens Ragulator complex protein LAMTOR2 Proteins 0.000 description 1
- 101000965929 Homo sapiens Ragulator complex protein LAMTOR3 Proteins 0.000 description 1
- 101001017956 Homo sapiens Ragulator complex protein LAMTOR4 Proteins 0.000 description 1
- 101001017961 Homo sapiens Ragulator complex protein LAMTOR5 Proteins 0.000 description 1
- 101000709135 Homo sapiens Ral guanine nucleotide dissociation stimulator-like 2 Proteins 0.000 description 1
- 101001095989 Homo sapiens RalBP1-associated Eps domain-containing protein 1 Proteins 0.000 description 1
- 101000987118 Homo sapiens Ran guanine nucleotide release factor Proteins 0.000 description 1
- 101000848700 Homo sapiens Rap guanine nucleotide exchange factor 1 Proteins 0.000 description 1
- 101000848727 Homo sapiens Rap guanine nucleotide exchange factor 2 Proteins 0.000 description 1
- 101000926086 Homo sapiens Rap1 GTPase-GDP dissociation stimulator 1 Proteins 0.000 description 1
- 101000893689 Homo sapiens Ras GTPase-activating protein-binding protein 1 Proteins 0.000 description 1
- 101000893674 Homo sapiens Ras GTPase-activating protein-binding protein 2 Proteins 0.000 description 1
- 101000708222 Homo sapiens Ras and Rab interactor 2 Proteins 0.000 description 1
- 101000686153 Homo sapiens Ras-related GTP-binding protein A Proteins 0.000 description 1
- 101000686233 Homo sapiens Ras-related GTP-binding protein B Proteins 0.000 description 1
- 101000686231 Homo sapiens Ras-related GTP-binding protein C Proteins 0.000 description 1
- 101000686227 Homo sapiens Ras-related protein R-Ras2 Proteins 0.000 description 1
- 101000743845 Homo sapiens Ras-related protein Rab-10 Proteins 0.000 description 1
- 101000620798 Homo sapiens Ras-related protein Rab-11A Proteins 0.000 description 1
- 101001130576 Homo sapiens Ras-related protein Rab-11B Proteins 0.000 description 1
- 101000743829 Homo sapiens Ras-related protein Rab-12 Proteins 0.000 description 1
- 101001079084 Homo sapiens Ras-related protein Rab-18 Proteins 0.000 description 1
- 101001130308 Homo sapiens Ras-related protein Rab-21 Proteins 0.000 description 1
- 101001130302 Homo sapiens Ras-related protein Rab-24 Proteins 0.000 description 1
- 101001132256 Homo sapiens Ras-related protein Rab-28 Proteins 0.000 description 1
- 101001132279 Homo sapiens Ras-related protein Rab-2A Proteins 0.000 description 1
- 101001060828 Homo sapiens Ras-related protein Rab-2B Proteins 0.000 description 1
- 101001061942 Homo sapiens Ras-related protein Rab-40C Proteins 0.000 description 1
- 101000743853 Homo sapiens Ras-related protein Rab-4B Proteins 0.000 description 1
- 101001077409 Homo sapiens Ras-related protein Rab-5B Proteins 0.000 description 1
- 101001077405 Homo sapiens Ras-related protein Rab-5C Proteins 0.000 description 1
- 101000584773 Homo sapiens Ras-related protein Rab-6D Proteins 0.000 description 1
- 101000584785 Homo sapiens Ras-related protein Rab-7a Proteins 0.000 description 1
- 101001132549 Homo sapiens Ras-related protein Rab-9A Proteins 0.000 description 1
- 101001130465 Homo sapiens Ras-related protein Ral-A Proteins 0.000 description 1
- 101001130458 Homo sapiens Ras-related protein Ral-B Proteins 0.000 description 1
- 101000584600 Homo sapiens Ras-related protein Rap-1b Proteins 0.000 description 1
- 101001130433 Homo sapiens Ras-related protein Rap-2c Proteins 0.000 description 1
- 101000665846 Homo sapiens Receptor expression-enhancing protein 3 Proteins 0.000 description 1
- 101001106090 Homo sapiens Receptor expression-enhancing protein 5 Proteins 0.000 description 1
- 101001062222 Homo sapiens Receptor-binding cancer antigen expressed on SiSo cells Proteins 0.000 description 1
- 101001109145 Homo sapiens Receptor-interacting serine/threonine-protein kinase 1 Proteins 0.000 description 1
- 101000738769 Homo sapiens Receptor-type tyrosine-protein phosphatase alpha Proteins 0.000 description 1
- 101000591201 Homo sapiens Receptor-type tyrosine-protein phosphatase kappa Proteins 0.000 description 1
- 101000686675 Homo sapiens Regulation of nuclear pre-mRNA domain-containing protein 2 Proteins 0.000 description 1
- 101000579423 Homo sapiens Regulator of nonsense transcripts 1 Proteins 0.000 description 1
- 101000727979 Homo sapiens Remodeling and spacing factor 1 Proteins 0.000 description 1
- 101000579226 Homo sapiens Renin receptor Proteins 0.000 description 1
- 101001096365 Homo sapiens Replication factor C subunit 2 Proteins 0.000 description 1
- 101000582404 Homo sapiens Replication factor C subunit 4 Proteins 0.000 description 1
- 101000582412 Homo sapiens Replication factor C subunit 5 Proteins 0.000 description 1
- 101000665894 Homo sapiens Replication initiator 1 Proteins 0.000 description 1
- 101000709305 Homo sapiens Replication protein A 14 kDa subunit Proteins 0.000 description 1
- 101001092206 Homo sapiens Replication protein A 32 kDa subunit Proteins 0.000 description 1
- 101000689809 Homo sapiens Replication termination factor 2 Proteins 0.000 description 1
- 101000756805 Homo sapiens Repulsive guidance molecule B Proteins 0.000 description 1
- 101001061669 Homo sapiens Required for excision 1-B domain-containing protein Proteins 0.000 description 1
- 101000667643 Homo sapiens Required for meiotic nuclear division protein 1 homolog Proteins 0.000 description 1
- 101000580351 Homo sapiens Respirasome Complex Assembly Factor 1 Proteins 0.000 description 1
- 101001078093 Homo sapiens Reticulocalbin-1 Proteins 0.000 description 1
- 101001078087 Homo sapiens Reticulocalbin-2 Proteins 0.000 description 1
- 101000727472 Homo sapiens Reticulon-4 Proteins 0.000 description 1
- 101000602187 Homo sapiens Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta Proteins 0.000 description 1
- 101001077298 Homo sapiens Retinoblastoma-binding protein 5 Proteins 0.000 description 1
- 101001093899 Homo sapiens Retinoic acid receptor RXR-alpha Proteins 0.000 description 1
- 101000640876 Homo sapiens Retinoic acid receptor RXR-beta Proteins 0.000 description 1
- 101000742930 Homo sapiens Retinol dehydrogenase 13 Proteins 0.000 description 1
- 101000742934 Homo sapiens Retinol dehydrogenase 14 Proteins 0.000 description 1
- 101000699771 Homo sapiens Retrotransposon Gag-like protein 8A Proteins 0.000 description 1
- 101000856728 Homo sapiens Rho GDP-dissociation inhibitor 1 Proteins 0.000 description 1
- 101001106406 Homo sapiens Rho GTPase-activating protein 1 Proteins 0.000 description 1
- 101000581155 Homo sapiens Rho GTPase-activating protein 12 Proteins 0.000 description 1
- 101000581173 Homo sapiens Rho GTPase-activating protein 17 Proteins 0.000 description 1
- 101000703463 Homo sapiens Rho GTPase-activating protein 35 Proteins 0.000 description 1
- 101001106395 Homo sapiens Rho GTPase-activating protein 5 Proteins 0.000 description 1
- 101000575667 Homo sapiens Rho family-interacting cell polarization regulator 1 Proteins 0.000 description 1
- 101000927776 Homo sapiens Rho guanine nucleotide exchange factor 11 Proteins 0.000 description 1
- 101000927774 Homo sapiens Rho guanine nucleotide exchange factor 12 Proteins 0.000 description 1
- 101000927796 Homo sapiens Rho guanine nucleotide exchange factor 7 Proteins 0.000 description 1
- 101000669917 Homo sapiens Rho-associated protein kinase 1 Proteins 0.000 description 1
- 101000669921 Homo sapiens Rho-associated protein kinase 2 Proteins 0.000 description 1
- 101001096580 Homo sapiens Rhomboid domain-containing protein 2 Proteins 0.000 description 1
- 101001096578 Homo sapiens Rhomboid domain-containing protein 3 Proteins 0.000 description 1
- 101000709000 Homo sapiens Rhomboid-related protein 4 Proteins 0.000 description 1
- 101000846198 Homo sapiens Ribitol 5-phosphate transferase FKRP Proteins 0.000 description 1
- 101000846336 Homo sapiens Ribitol-5-phosphate transferase FKTN Proteins 0.000 description 1
- 101001093905 Homo sapiens Ribitol-5-phosphate xylosyltransferase 1 Proteins 0.000 description 1
- 101001103771 Homo sapiens Ribonuclease H2 subunit A Proteins 0.000 description 1
- 101001103768 Homo sapiens Ribonuclease H2 subunit B Proteins 0.000 description 1
- 101000686685 Homo sapiens Ribonuclease P protein subunit p14 Proteins 0.000 description 1
- 101001122597 Homo sapiens Ribonuclease P protein subunit p20 Proteins 0.000 description 1
- 101000849714 Homo sapiens Ribonuclease P protein subunit p29 Proteins 0.000 description 1
- 101000849723 Homo sapiens Ribonuclease P protein subunit p38 Proteins 0.000 description 1
- 101000849720 Homo sapiens Ribonuclease P protein subunit p40 Proteins 0.000 description 1
- 101001095807 Homo sapiens Ribonuclease inhibitor Proteins 0.000 description 1
- 101001095783 Homo sapiens Ribonucleoside-diphosphate reductase subunit M2 B Proteins 0.000 description 1
- 101001125551 Homo sapiens Ribose-phosphate pyrophosphokinase 1 Proteins 0.000 description 1
- 101000659995 Homo sapiens Ribosomal L1 domain-containing protein 1 Proteins 0.000 description 1
- 101001085897 Homo sapiens Ribosomal RNA processing protein 1 homolog A Proteins 0.000 description 1
- 101000849335 Homo sapiens Ribosomal RNA-processing protein 7 homolog A Proteins 0.000 description 1
- 101001119115 Homo sapiens Ribosomal RNA-processing protein 8 Proteins 0.000 description 1
- 101000712821 Homo sapiens Ribosomal biogenesis factor Proteins 0.000 description 1
- 101001008515 Homo sapiens Ribosomal biogenesis protein LAS1L Proteins 0.000 description 1
- 101000945090 Homo sapiens Ribosomal protein S6 kinase alpha-3 Proteins 0.000 description 1
- 101000945093 Homo sapiens Ribosomal protein S6 kinase alpha-4 Proteins 0.000 description 1
- 101001051706 Homo sapiens Ribosomal protein S6 kinase beta-1 Proteins 0.000 description 1
- 101001051714 Homo sapiens Ribosomal protein S6 kinase beta-2 Proteins 0.000 description 1
- 101001051707 Homo sapiens Ribosomal protein S6 kinase delta-1 Proteins 0.000 description 1
- 101001108716 Homo sapiens Ribosome biogenesis protein NSA2 homolog Proteins 0.000 description 1
- 101000682954 Homo sapiens Ribosome biogenesis regulatory protein homolog Proteins 0.000 description 1
- 101000631899 Homo sapiens Ribosome maturation protein SBDS Proteins 0.000 description 1
- 101000973629 Homo sapiens Ribosome quality control complex subunit NEMF Proteins 0.000 description 1
- 101000742883 Homo sapiens Roquin-2 Proteins 0.000 description 1
- 101000635799 Homo sapiens Run domain Beclin-1-interacting and cysteine-rich domain-containing protein Proteins 0.000 description 1
- 101000873502 Homo sapiens S-adenosylmethionine decarboxylase proenzyme Proteins 0.000 description 1
- 101000869503 Homo sapiens SAC3 domain-containing protein 1 Proteins 0.000 description 1
- 101000709114 Homo sapiens SAFB-like transcription modulator Proteins 0.000 description 1
- 101001046948 Homo sapiens SANT and BTB domain regulator of class switch recombination Proteins 0.000 description 1
- 101000640246 Homo sapiens SCAN domain-containing protein 1 Proteins 0.000 description 1
- 101000598783 Homo sapiens SCRIB overlapping open reading frame protein Proteins 0.000 description 1
- 101001093937 Homo sapiens SEC14-like protein 1 Proteins 0.000 description 1
- 101000640924 Homo sapiens SEC23-interacting protein Proteins 0.000 description 1
- 101000880116 Homo sapiens SERTA domain-containing protein 2 Proteins 0.000 description 1
- 101000836389 Homo sapiens SET domain-containing protein 9 Proteins 0.000 description 1
- 101100203078 Homo sapiens SF3B6 gene Proteins 0.000 description 1
- 101000707152 Homo sapiens SH2B adapter protein 1 Proteins 0.000 description 1
- 101000663831 Homo sapiens SH3 and PX domain-containing protein 2A Proteins 0.000 description 1
- 101000963987 Homo sapiens SH3 domain-binding protein 5 Proteins 0.000 description 1
- 101000654484 Homo sapiens SID1 transmembrane family member 2 Proteins 0.000 description 1
- 101000880044 Homo sapiens SLIT-ROBO Rho GTPase-activating protein 3 Proteins 0.000 description 1
- 101000709102 Homo sapiens SMC5-SMC6 complex localization factor protein 2 Proteins 0.000 description 1
- 101000633076 Homo sapiens SNARE-associated protein Snapin Proteins 0.000 description 1
- 101000836279 Homo sapiens SNW domain-containing protein 1 Proteins 0.000 description 1
- 101000828739 Homo sapiens SPATS2-like protein Proteins 0.000 description 1
- 101000587811 Homo sapiens SPRY domain-containing protein 7 Proteins 0.000 description 1
- 101000716740 Homo sapiens SR-related and CTD-associated factor 4 Proteins 0.000 description 1
- 101000716748 Homo sapiens SR-related and CTD-associated factor 8 Proteins 0.000 description 1
- 101000835998 Homo sapiens SRA stem-loop-interacting RNA-binding protein, mitochondrial Proteins 0.000 description 1
- 101000880088 Homo sapiens SRR1-like protein Proteins 0.000 description 1
- 101000826081 Homo sapiens SRSF protein kinase 1 Proteins 0.000 description 1
- 101000727831 Homo sapiens SS18-like protein 2 Proteins 0.000 description 1
- 101000628514 Homo sapiens STAGA complex 65 subunit gamma Proteins 0.000 description 1
- 101000832248 Homo sapiens STAM-binding protein Proteins 0.000 description 1
- 101000642656 Homo sapiens STE20-related kinase adapter protein beta Proteins 0.000 description 1
- 101000880385 Homo sapiens STING ER exit protein Proteins 0.000 description 1
- 101001094146 Homo sapiens SUMO-activating enzyme subunit 2 Proteins 0.000 description 1
- 101000939246 Homo sapiens SUMO-conjugating enzyme UBC9 Proteins 0.000 description 1
- 101000941088 Homo sapiens SUMO-specific isopeptidase USPL1 Proteins 0.000 description 1
- 101000706557 Homo sapiens SUN domain-containing protein 1 Proteins 0.000 description 1
- 101000706551 Homo sapiens SUN domain-containing protein 2 Proteins 0.000 description 1
- 101000834853 Homo sapiens SUZ domain-containing protein 1 Proteins 0.000 description 1
- 101000687718 Homo sapiens SWI/SNF complex subunit SMARCC1 Proteins 0.000 description 1
- 101000687720 Homo sapiens SWI/SNF complex subunit SMARCC2 Proteins 0.000 description 1
- 101000702544 Homo sapiens SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A member 5 Proteins 0.000 description 1
- 101000687737 Homo sapiens SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1 Proteins 0.000 description 1
- 101000702542 Homo sapiens SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1 Proteins 0.000 description 1
- 101000867039 Homo sapiens SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related Proteins 0.000 description 1
- 101000664408 Homo sapiens Sarcolemmal membrane-associated protein Proteins 0.000 description 1
- 101000655528 Homo sapiens Scaffold attachment factor B1 Proteins 0.000 description 1
- 101000655522 Homo sapiens Scaffold attachment factor B2 Proteins 0.000 description 1
- 101000716758 Homo sapiens Sec1 family domain-containing protein 1 Proteins 0.000 description 1
- 101000654301 Homo sapiens Secernin-3 Proteins 0.000 description 1
- 101000879836 Homo sapiens Secretion-regulating guanine nucleotide exchange factor Proteins 0.000 description 1
- 101000740417 Homo sapiens Secretory carrier-associated membrane protein 2 Proteins 0.000 description 1
- 101000873645 Homo sapiens Secretory carrier-associated membrane protein 3 Proteins 0.000 description 1
- 101000867466 Homo sapiens Segment polarity protein dishevelled homolog DVL-2 Proteins 0.000 description 1
- 101000867469 Homo sapiens Segment polarity protein dishevelled homolog DVL-3 Proteins 0.000 description 1
- 101000898985 Homo sapiens Seipin Proteins 0.000 description 1
- 101000587820 Homo sapiens Selenide, water dikinase 1 Proteins 0.000 description 1
- 101000822443 Homo sapiens Selenocysteine lyase Proteins 0.000 description 1
- 101000684503 Homo sapiens Sentrin-specific protease 3 Proteins 0.000 description 1
- 101000684514 Homo sapiens Sentrin-specific protease 6 Proteins 0.000 description 1
- 101000708013 Homo sapiens Sentrin-specific protease 7 Proteins 0.000 description 1
- 101000654668 Homo sapiens Septin-2 Proteins 0.000 description 1
- 101000632314 Homo sapiens Septin-6 Proteins 0.000 description 1
- 101000632319 Homo sapiens Septin-7 Proteins 0.000 description 1
- 101000632056 Homo sapiens Septin-9 Proteins 0.000 description 1
- 101000644537 Homo sapiens Sequestosome-1 Proteins 0.000 description 1
- 101001067604 Homo sapiens Serine hydroxymethyltransferase, mitochondrial Proteins 0.000 description 1
- 101000707471 Homo sapiens Serine incorporator 3 Proteins 0.000 description 1
- 101000865006 Homo sapiens Serine incorporator 4 Proteins 0.000 description 1
- 101000858430 Homo sapiens Serine/Arginine-related protein 53 Proteins 0.000 description 1
- 101000829211 Homo sapiens Serine/arginine repetitive matrix protein 1 Proteins 0.000 description 1
- 101000829212 Homo sapiens Serine/arginine repetitive matrix protein 2 Proteins 0.000 description 1
- 101000663222 Homo sapiens Serine/arginine-rich splicing factor 1 Proteins 0.000 description 1
- 101000643393 Homo sapiens Serine/arginine-rich splicing factor 10 Proteins 0.000 description 1
- 101000643391 Homo sapiens Serine/arginine-rich splicing factor 11 Proteins 0.000 description 1
- 101000587430 Homo sapiens Serine/arginine-rich splicing factor 2 Proteins 0.000 description 1
- 101000587434 Homo sapiens Serine/arginine-rich splicing factor 3 Proteins 0.000 description 1
- 101000587436 Homo sapiens Serine/arginine-rich splicing factor 4 Proteins 0.000 description 1
- 101000587442 Homo sapiens Serine/arginine-rich splicing factor 6 Proteins 0.000 description 1
- 101000700735 Homo sapiens Serine/arginine-rich splicing factor 7 Proteins 0.000 description 1
- 101000628578 Homo sapiens Serine/threonine-protein kinase 16 Proteins 0.000 description 1
- 101000628693 Homo sapiens Serine/threonine-protein kinase 25 Proteins 0.000 description 1
- 101000880439 Homo sapiens Serine/threonine-protein kinase 3 Proteins 0.000 description 1
- 101000771237 Homo sapiens Serine/threonine-protein kinase A-Raf Proteins 0.000 description 1
- 101000984753 Homo sapiens Serine/threonine-protein kinase B-raf Proteins 0.000 description 1
- 101001026885 Homo sapiens Serine/threonine-protein kinase D3 Proteins 0.000 description 1
- 101000939549 Homo sapiens Serine/threonine-protein kinase Kist Proteins 0.000 description 1
- 101001047642 Homo sapiens Serine/threonine-protein kinase LATS1 Proteins 0.000 description 1
- 101001047637 Homo sapiens Serine/threonine-protein kinase LATS2 Proteins 0.000 description 1
- 101001038335 Homo sapiens Serine/threonine-protein kinase LMTK2 Proteins 0.000 description 1
- 101000576904 Homo sapiens Serine/threonine-protein kinase MRCK beta Proteins 0.000 description 1
- 101000691459 Homo sapiens Serine/threonine-protein kinase N2 Proteins 0.000 description 1
- 101001123846 Homo sapiens Serine/threonine-protein kinase Nek1 Proteins 0.000 description 1
- 101000601460 Homo sapiens Serine/threonine-protein kinase Nek4 Proteins 0.000 description 1
- 101001098464 Homo sapiens Serine/threonine-protein kinase OSR1 Proteins 0.000 description 1
- 101000987310 Homo sapiens Serine/threonine-protein kinase PAK 2 Proteins 0.000 description 1
- 101000577652 Homo sapiens Serine/threonine-protein kinase PRP4 homolog Proteins 0.000 description 1
- 101000754913 Homo sapiens Serine/threonine-protein kinase RIO2 Proteins 0.000 description 1
- 101000754911 Homo sapiens Serine/threonine-protein kinase RIO3 Proteins 0.000 description 1
- 101000864057 Homo sapiens Serine/threonine-protein kinase SMG1 Proteins 0.000 description 1
- 101000628562 Homo sapiens Serine/threonine-protein kinase STK11 Proteins 0.000 description 1
- 101000838578 Homo sapiens Serine/threonine-protein kinase TAO2 Proteins 0.000 description 1
- 101000838596 Homo sapiens Serine/threonine-protein kinase TAO3 Proteins 0.000 description 1
- 101000665442 Homo sapiens Serine/threonine-protein kinase TBK1 Proteins 0.000 description 1
- 101000607332 Homo sapiens Serine/threonine-protein kinase ULK2 Proteins 0.000 description 1
- 101000607339 Homo sapiens Serine/threonine-protein kinase ULK3 Proteins 0.000 description 1
- 101000649931 Homo sapiens Serine/threonine-protein kinase VRK2 Proteins 0.000 description 1
- 101000770770 Homo sapiens Serine/threonine-protein kinase WNK1 Proteins 0.000 description 1
- 101001036145 Homo sapiens Serine/threonine-protein kinase greatwall Proteins 0.000 description 1
- 101000595531 Homo sapiens Serine/threonine-protein kinase pim-1 Proteins 0.000 description 1
- 101001001645 Homo sapiens Serine/threonine-protein kinase pim-3 Proteins 0.000 description 1
- 101000637847 Homo sapiens Serine/threonine-protein kinase tousled-like 2 Proteins 0.000 description 1
- 101000741917 Homo sapiens Serine/threonine-protein phosphatase 1 regulatory subunit 10 Proteins 0.000 description 1
- 101000802948 Homo sapiens Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Proteins 0.000 description 1
- 101000785887 Homo sapiens Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit alpha isoform Proteins 0.000 description 1
- 101000785890 Homo sapiens Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform Proteins 0.000 description 1
- 101000785904 Homo sapiens Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform Proteins 0.000 description 1
- 101000783377 Homo sapiens Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform Proteins 0.000 description 1
- 101000783373 Homo sapiens Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform Proteins 0.000 description 1
- 101000783404 Homo sapiens Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Proteins 0.000 description 1
- 101001135826 Homo sapiens Serine/threonine-protein phosphatase 2A activator Proteins 0.000 description 1
- 101001068027 Homo sapiens Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform Proteins 0.000 description 1
- 101001068019 Homo sapiens Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform Proteins 0.000 description 1
- 101000614403 Homo sapiens Serine/threonine-protein phosphatase 2A regulatory subunit B'' subunit gamma Proteins 0.000 description 1
- 101000611254 Homo sapiens Serine/threonine-protein phosphatase 2B catalytic subunit beta isoform Proteins 0.000 description 1
- 101000611251 Homo sapiens Serine/threonine-protein phosphatase 2B catalytic subunit gamma isoform Proteins 0.000 description 1
- 101001068219 Homo sapiens Serine/threonine-protein phosphatase 4 catalytic subunit Proteins 0.000 description 1
- 101001123146 Homo sapiens Serine/threonine-protein phosphatase 4 regulatory subunit 1 Proteins 0.000 description 1
- 101000987024 Homo sapiens Serine/threonine-protein phosphatase 4 regulatory subunit 3B Proteins 0.000 description 1
- 101000620653 Homo sapiens Serine/threonine-protein phosphatase 5 Proteins 0.000 description 1
- 101000620662 Homo sapiens Serine/threonine-protein phosphatase 6 catalytic subunit Proteins 0.000 description 1
- 101000780111 Homo sapiens Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit A Proteins 0.000 description 1
- 101001095386 Homo sapiens Serine/threonine-protein phosphatase 6 regulatory subunit 1 Proteins 0.000 description 1
- 101001095381 Homo sapiens Serine/threonine-protein phosphatase 6 regulatory subunit 2 Proteins 0.000 description 1
- 101001095380 Homo sapiens Serine/threonine-protein phosphatase 6 regulatory subunit 3 Proteins 0.000 description 1
- 101001099058 Homo sapiens Serine/threonine-protein phosphatase PGAM5, mitochondrial Proteins 0.000 description 1
- 101000595252 Homo sapiens Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Proteins 0.000 description 1
- 101001095368 Homo sapiens Serine/threonine-protein phosphatase PP1-gamma catalytic subunit Proteins 0.000 description 1
- 101000661457 Homo sapiens Serine/threonine/tyrosine-interacting-like protein 1 Proteins 0.000 description 1
- 101000740529 Homo sapiens Serologically defined colon cancer antigen 8 Proteins 0.000 description 1
- 101000836066 Homo sapiens Serpin B6 Proteins 0.000 description 1
- 101000643374 Homo sapiens Serrate RNA effector molecule homolog Proteins 0.000 description 1
- 101000700752 Homo sapiens Serum response factor-binding protein 1 Proteins 0.000 description 1
- 101000836394 Homo sapiens Sestrin-1 Proteins 0.000 description 1
- 101000703089 Homo sapiens Set1/Ash2 histone methyltransferase complex subunit ASH2 Proteins 0.000 description 1
- 101001093181 Homo sapiens Short coiled-coil protein Proteins 0.000 description 1
- 101000799180 Homo sapiens Short transient receptor potential channel 4-associated protein Proteins 0.000 description 1
- 101000697521 Homo sapiens Short transmembrane mitochondrial protein 1 Proteins 0.000 description 1
- 101000616718 Homo sapiens Sialate O-acetylesterase Proteins 0.000 description 1
- 101001123859 Homo sapiens Sialidase-1 Proteins 0.000 description 1
- 101000836994 Homo sapiens Sigma non-opioid intracellular receptor 1 Proteins 0.000 description 1
- 101000701936 Homo sapiens Signal peptidase complex subunit 1 Proteins 0.000 description 1
- 101000829012 Homo sapiens Signal peptidase complex subunit 2 Proteins 0.000 description 1
- 101000629635 Homo sapiens Signal recognition particle receptor subunit alpha Proteins 0.000 description 1
- 101000648038 Homo sapiens Signal transducing adapter molecule 2 Proteins 0.000 description 1
- 101000664956 Homo sapiens Single-strand selective monofunctional uracil DNA glycosylase Proteins 0.000 description 1
- 101000826116 Homo sapiens Single-stranded DNA-binding protein 3 Proteins 0.000 description 1
- 101000587445 Homo sapiens Single-stranded DNA-binding protein 4 Proteins 0.000 description 1
- 101000587455 Homo sapiens Single-stranded DNA-binding protein, mitochondrial Proteins 0.000 description 1
- 101000609920 Homo sapiens Sister chromatid cohesion protein PDS5 homolog A Proteins 0.000 description 1
- 101000609926 Homo sapiens Sister chromatid cohesion protein PDS5 homolog B Proteins 0.000 description 1
- 101000650652 Homo sapiens Small EDRK-rich factor 2 Proteins 0.000 description 1
- 101000739212 Homo sapiens Small G protein signaling modulator 2 Proteins 0.000 description 1
- 101000739205 Homo sapiens Small G protein signaling modulator 3 Proteins 0.000 description 1
- 101000688806 Homo sapiens Small integral membrane protein 12 Proteins 0.000 description 1
- 101000688821 Homo sapiens Small integral membrane protein 13 Proteins 0.000 description 1
- 101000825929 Homo sapiens Small integral membrane protein 19 Proteins 0.000 description 1
- 101000616755 Homo sapiens Small integral membrane protein 20 Proteins 0.000 description 1
- 101000687693 Homo sapiens Small integral membrane protein 8 Proteins 0.000 description 1
- 101000653812 Homo sapiens Small nuclear ribonucleoprotein E Proteins 0.000 description 1
- 101000713494 Homo sapiens Small nuclear ribonucleoprotein F Proteins 0.000 description 1
- 101000713459 Homo sapiens Small nuclear ribonucleoprotein G Proteins 0.000 description 1
- 101000665250 Homo sapiens Small nuclear ribonucleoprotein Sm D2 Proteins 0.000 description 1
- 101000825914 Homo sapiens Small nuclear ribonucleoprotein Sm D3 Proteins 0.000 description 1
- 101000941138 Homo sapiens Small subunit processome component 20 homolog Proteins 0.000 description 1
- 101000828766 Homo sapiens Snurportin-1 Proteins 0.000 description 1
- 101000740443 Homo sapiens Sodium channel modifier 1 Proteins 0.000 description 1
- 101000631937 Homo sapiens Sodium- and chloride-dependent glycine transporter 2 Proteins 0.000 description 1
- 101000639975 Homo sapiens Sodium-dependent noradrenaline transporter Proteins 0.000 description 1
- 101000910249 Homo sapiens Soluble calcium-activated nucleotidase 1 Proteins 0.000 description 1
- 101000693324 Homo sapiens Solute carrier family 66 member 2 Proteins 0.000 description 1
- 101000868154 Homo sapiens Son of sevenless homolog 2 Proteins 0.000 description 1
- 101000873843 Homo sapiens Sorting and assembly machinery component 50 homolog Proteins 0.000 description 1
- 101000702653 Homo sapiens Sorting nexin-1 Proteins 0.000 description 1
- 101000633142 Homo sapiens Sorting nexin-11 Proteins 0.000 description 1
- 101000633158 Homo sapiens Sorting nexin-12 Proteins 0.000 description 1
- 101000633153 Homo sapiens Sorting nexin-13 Proteins 0.000 description 1
- 101000633187 Homo sapiens Sorting nexin-15 Proteins 0.000 description 1
- 101000702681 Homo sapiens Sorting nexin-17 Proteins 0.000 description 1
- 101000702658 Homo sapiens Sorting nexin-18 Proteins 0.000 description 1
- 101000702657 Homo sapiens Sorting nexin-19 Proteins 0.000 description 1
- 101000824954 Homo sapiens Sorting nexin-2 Proteins 0.000 description 1
- 101000708470 Homo sapiens Sorting nexin-3 Proteins 0.000 description 1
- 101000664921 Homo sapiens Sorting nexin-4 Proteins 0.000 description 1
- 101000665020 Homo sapiens Sorting nexin-5 Proteins 0.000 description 1
- 101000868440 Homo sapiens Sorting nexin-8 Proteins 0.000 description 1
- 101000868465 Homo sapiens Sorting nexin-9 Proteins 0.000 description 1
- 101000642268 Homo sapiens Speckle-type POZ protein Proteins 0.000 description 1
- 101000704203 Homo sapiens Spectrin alpha chain, non-erythrocytic 1 Proteins 0.000 description 1
- 101000881252 Homo sapiens Spectrin beta chain, non-erythrocytic 1 Proteins 0.000 description 1
- 101000618110 Homo sapiens Sperm-associated antigen 7 Proteins 0.000 description 1
- 101000642671 Homo sapiens Spermatid perinuclear RNA-binding protein Proteins 0.000 description 1
- 101000652359 Homo sapiens Spermatogenesis-associated protein 2 Proteins 0.000 description 1
- 101000642328 Homo sapiens Spermatogenesis-associated protein 20 Proteins 0.000 description 1
- 101000868917 Homo sapiens Spermatogenesis-defective protein 39 homolog Proteins 0.000 description 1
- 101000952234 Homo sapiens Sphingolipid delta(4)-desaturase DES1 Proteins 0.000 description 1
- 101000785978 Homo sapiens Sphingomyelin phosphodiesterase Proteins 0.000 description 1
- 101001108753 Homo sapiens Sphingomyelin phosphodiesterase 4 Proteins 0.000 description 1
- 101000641017 Homo sapiens Sphingomyelin synthase-related protein 1 Proteins 0.000 description 1
- 101000651197 Homo sapiens Sphingosine kinase 2 Proteins 0.000 description 1
- 101000688561 Homo sapiens Sphingosine-1-phosphate lyase 1 Proteins 0.000 description 1
- 101000908580 Homo sapiens Spliceosome RNA helicase DDX39B Proteins 0.000 description 1
- 101000948265 Homo sapiens Spliceosome-associated protein CWC15 homolog Proteins 0.000 description 1
- 101000889087 Homo sapiens Spliceosome-associated protein CWC27 homolog Proteins 0.000 description 1
- 101000707546 Homo sapiens Splicing factor 3A subunit 1 Proteins 0.000 description 1
- 101000707569 Homo sapiens Splicing factor 3A subunit 3 Proteins 0.000 description 1
- 101000707567 Homo sapiens Splicing factor 3B subunit 1 Proteins 0.000 description 1
- 101000707770 Homo sapiens Splicing factor 3B subunit 2 Proteins 0.000 description 1
- 101000642347 Homo sapiens Splicing factor 45 Proteins 0.000 description 1
- 101000658075 Homo sapiens Splicing factor U2AF 26 kDa subunit Proteins 0.000 description 1
- 101000808799 Homo sapiens Splicing factor U2AF 35 kDa subunit Proteins 0.000 description 1
- 101000658071 Homo sapiens Splicing factor U2AF 65 kDa subunit Proteins 0.000 description 1
- 101000654583 Homo sapiens Splicing factor, suppressor of white-apricot homolog Proteins 0.000 description 1
- 101000663181 Homo sapiens Splicing regulatory glutamine/lysine-rich protein 1 Proteins 0.000 description 1
- 101000878981 Homo sapiens Squalene synthase Proteins 0.000 description 1
- 101000873927 Homo sapiens Squamous cell carcinoma antigen recognized by T-cells 3 Proteins 0.000 description 1
- 101000829367 Homo sapiens Src substrate cortactin Proteins 0.000 description 1
- 101000617805 Homo sapiens Staphylococcal nuclease domain-containing protein 1 Proteins 0.000 description 1
- 101000851700 Homo sapiens Steroid hormone receptor ERR1 Proteins 0.000 description 1
- 101000642613 Homo sapiens Sterol O-acyltransferase 2 Proteins 0.000 description 1
- 101000629605 Homo sapiens Sterol regulatory element-binding protein 2 Proteins 0.000 description 1
- 101000634060 Homo sapiens Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating Proteins 0.000 description 1
- 101000820460 Homo sapiens Stomatin Proteins 0.000 description 1
- 101000831928 Homo sapiens Stomatin-like protein 1 Proteins 0.000 description 1
- 101000831927 Homo sapiens Stomatin-like protein 2, mitochondrial Proteins 0.000 description 1
- 101000740275 Homo sapiens Store-operated calcium entry-associated regulatory factor Proteins 0.000 description 1
- 101000903318 Homo sapiens Stress-70 protein, mitochondrial Proteins 0.000 description 1
- 101000648196 Homo sapiens Striatin Proteins 0.000 description 1
- 101000585019 Homo sapiens Striatin-3 Proteins 0.000 description 1
- 101000648203 Homo sapiens Striatin-4 Proteins 0.000 description 1
- 101000648213 Homo sapiens Striatin-interacting protein 1 Proteins 0.000 description 1
- 101000684994 Homo sapiens Stromal cell-derived factor 2 Proteins 0.000 description 1
- 101000615382 Homo sapiens Stromal membrane-associated protein 1 Proteins 0.000 description 1
- 101000633445 Homo sapiens Structural maintenance of chromosomes protein 2 Proteins 0.000 description 1
- 101000708766 Homo sapiens Structural maintenance of chromosomes protein 3 Proteins 0.000 description 1
- 101000825726 Homo sapiens Structural maintenance of chromosomes protein 4 Proteins 0.000 description 1
- 101000825904 Homo sapiens Structural maintenance of chromosomes protein 5 Proteins 0.000 description 1
- 101000702566 Homo sapiens Structural maintenance of chromosomes protein 6 Proteins 0.000 description 1
- 101000951145 Homo sapiens Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial Proteins 0.000 description 1
- 101000685323 Homo sapiens Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Proteins 0.000 description 1
- 101000874160 Homo sapiens Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Proteins 0.000 description 1
- 101000934888 Homo sapiens Succinate dehydrogenase cytochrome b560 subunit, mitochondrial Proteins 0.000 description 1
- 101000661446 Homo sapiens Succinate-CoA ligase [ADP-forming] subunit beta, mitochondrial Proteins 0.000 description 1
- 101000832009 Homo sapiens Succinate-CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Proteins 0.000 description 1
- 101000661451 Homo sapiens Succinate-CoA ligase [GDP-forming] subunit beta, mitochondrial Proteins 0.000 description 1
- 101000643865 Homo sapiens Sulfite oxidase, mitochondrial Proteins 0.000 description 1
- 101000628483 Homo sapiens Suppressor of tumorigenicity 7 protein-like Proteins 0.000 description 1
- 101000630748 Homo sapiens Surfeit locus protein 6 Proteins 0.000 description 1
- 101000868422 Homo sapiens Sushi, nidogen and EGF-like domain-containing protein 1 Proteins 0.000 description 1
- 101000670986 Homo sapiens Symplekin Proteins 0.000 description 1
- 101000828537 Homo sapiens Synaptic functional regulator FMR1 Proteins 0.000 description 1
- 101000828633 Homo sapiens Synaptobrevin homolog YKT6 Proteins 0.000 description 1
- 101000879408 Homo sapiens Synaptonemal complex central element protein 1-like Proteins 0.000 description 1
- 101000643632 Homo sapiens Synaptonemal complex protein 3 Proteins 0.000 description 1
- 101000652300 Homo sapiens Synaptosomal-associated protein 23 Proteins 0.000 description 1
- 101000687633 Homo sapiens Synaptosomal-associated protein 29 Proteins 0.000 description 1
- 101000803647 Homo sapiens Syndetin Proteins 0.000 description 1
- 101000659071 Homo sapiens Synergin gamma Proteins 0.000 description 1
- 101000706160 Homo sapiens Syntaxin-10 Proteins 0.000 description 1
- 101000706184 Homo sapiens Syntaxin-16 Proteins 0.000 description 1
- 101000706175 Homo sapiens Syntaxin-17 Proteins 0.000 description 1
- 101000697800 Homo sapiens Syntaxin-4 Proteins 0.000 description 1
- 101000697810 Homo sapiens Syntaxin-5 Proteins 0.000 description 1
- 101000831895 Homo sapiens Syntaxin-7 Proteins 0.000 description 1
- 101000648224 Homo sapiens Syntaxin-8 Proteins 0.000 description 1
- 101000820477 Homo sapiens Syntaxin-binding protein 3 Proteins 0.000 description 1
- 101000820494 Homo sapiens Syntaxin-binding protein 5 Proteins 0.000 description 1
- 101000740523 Homo sapiens Syntenin-1 Proteins 0.000 description 1
- 101000835670 Homo sapiens T-cell activation inhibitor, mitochondrial Proteins 0.000 description 1
- 101000666730 Homo sapiens T-complex protein 1 subunit alpha Proteins 0.000 description 1
- 101000837443 Homo sapiens T-complex protein 1 subunit beta Proteins 0.000 description 1
- 101000653567 Homo sapiens T-complex protein 1 subunit delta Proteins 0.000 description 1
- 101000653663 Homo sapiens T-complex protein 1 subunit epsilon Proteins 0.000 description 1
- 101000713879 Homo sapiens T-complex protein 1 subunit eta Proteins 0.000 description 1
- 101000595467 Homo sapiens T-complex protein 1 subunit gamma Proteins 0.000 description 1
- 101000835696 Homo sapiens T-complex protein 1 subunit theta Proteins 0.000 description 1
- 101000653469 Homo sapiens T-complex protein 1 subunit zeta Proteins 0.000 description 1
- 101000838240 Homo sapiens T-complex protein 11-like protein 1 Proteins 0.000 description 1
- 101000891092 Homo sapiens TAR DNA-binding protein 43 Proteins 0.000 description 1
- 101000837903 Homo sapiens TATA box-binding protein-associated factor RNA polymerase I subunit B Proteins 0.000 description 1
- 101000596084 Homo sapiens TATA box-binding protein-associated factor RNA polymerase I subunit C Proteins 0.000 description 1
- 101000694973 Homo sapiens TATA-binding protein-associated factor 172 Proteins 0.000 description 1
- 101001099181 Homo sapiens TATA-binding protein-associated factor 2N Proteins 0.000 description 1
- 101000625846 Homo sapiens TBC domain-containing protein kinase-like protein Proteins 0.000 description 1
- 101000891620 Homo sapiens TBC1 domain family member 1 Proteins 0.000 description 1
- 101000835608 Homo sapiens TBC1 domain family member 10B Proteins 0.000 description 1
- 101000665486 Homo sapiens TBC1 domain family member 12 Proteins 0.000 description 1
- 101000665419 Homo sapiens TBC1 domain family member 14 Proteins 0.000 description 1
- 101000653585 Homo sapiens TBC1 domain family member 15 Proteins 0.000 description 1
- 101000653590 Homo sapiens TBC1 domain family member 17 Proteins 0.000 description 1
- 101000625768 Homo sapiens TBC1 domain family member 22A Proteins 0.000 description 1
- 101000625765 Homo sapiens TBC1 domain family member 22B Proteins 0.000 description 1
- 101000653597 Homo sapiens TBC1 domain family member 23 Proteins 0.000 description 1
- 101000788505 Homo sapiens TBC1 domain family member 24 Proteins 0.000 description 1
- 101000788513 Homo sapiens TBC1 domain family member 25 Proteins 0.000 description 1
- 101000891623 Homo sapiens TBC1 domain family member 5 Proteins 0.000 description 1
- 101000891627 Homo sapiens TBC1 domain family member 7 Proteins 0.000 description 1
- 101000652482 Homo sapiens TBC1 domain family member 8 Proteins 0.000 description 1
- 101000652484 Homo sapiens TBC1 domain family member 9 Proteins 0.000 description 1
- 101000595764 Homo sapiens TBC1 domain family member 9B Proteins 0.000 description 1
- 101000835632 Homo sapiens TBCC domain-containing protein 1 Proteins 0.000 description 1
- 101000835082 Homo sapiens TCF3 fusion partner Proteins 0.000 description 1
- 101000633815 Homo sapiens TELO2-interacting protein 1 homolog Proteins 0.000 description 1
- 101000633807 Homo sapiens TELO2-interacting protein 2 Proteins 0.000 description 1
- 101000800312 Homo sapiens TERF1-interacting nuclear factor 2 Proteins 0.000 description 1
- 101000674728 Homo sapiens TGF-beta-activated kinase 1 and MAP3K7-binding protein 2 Proteins 0.000 description 1
- 101000890333 Homo sapiens THAP domain-containing protein 3 Proteins 0.000 description 1
- 101000652995 Homo sapiens THAP domain-containing protein 5 Proteins 0.000 description 1
- 101000652999 Homo sapiens THAP domain-containing protein 7 Proteins 0.000 description 1
- 101000800099 Homo sapiens THO complex subunit 1 Proteins 0.000 description 1
- 101000800113 Homo sapiens THO complex subunit 2 Proteins 0.000 description 1
- 101000852214 Homo sapiens THO complex subunit 4 Proteins 0.000 description 1
- 101000852217 Homo sapiens THO complex subunit 6 homolog Proteins 0.000 description 1
- 101000802053 Homo sapiens THUMP domain-containing protein 1 Proteins 0.000 description 1
- 101000802069 Homo sapiens THUMP domain-containing protein 3 Proteins 0.000 description 1
- 101000763890 Homo sapiens TIP41-like protein Proteins 0.000 description 1
- 101000801058 Homo sapiens TM2 domain-containing protein 2 Proteins 0.000 description 1
- 101000663000 Homo sapiens TNFAIP3-interacting protein 1 Proteins 0.000 description 1
- 101000663004 Homo sapiens TNFAIP3-interacting protein 2 Proteins 0.000 description 1
- 101000889527 Homo sapiens TOG array regulator of axonemal microtubules protein 1 Proteins 0.000 description 1
- 101000762938 Homo sapiens TOX high mobility group box family member 4 Proteins 0.000 description 1
- 101000795222 Homo sapiens TP53-regulated inhibitor of apoptosis 1 Proteins 0.000 description 1
- 101000634866 Homo sapiens TRAF-type zinc finger domain-containing protein 1 Proteins 0.000 description 1
- 101000628937 Homo sapiens TRAF3-interacting protein 1 Proteins 0.000 description 1
- 101000795313 Homo sapiens TRMT1-like protein Proteins 0.000 description 1
- 101000835665 Homo sapiens TRPM8 channel-associated factor 1 Proteins 0.000 description 1
- 101000596335 Homo sapiens TSC22 domain family protein 2 Proteins 0.000 description 1
- 101000649068 Homo sapiens Tapasin Proteins 0.000 description 1
- 101000801710 Homo sapiens Taperin Proteins 0.000 description 1
- 101000652747 Homo sapiens Target of rapamycin complex 2 subunit MAPKAP1 Proteins 0.000 description 1
- 101000665590 Homo sapiens Tax1-binding protein 1 Proteins 0.000 description 1
- 101000653430 Homo sapiens Tectonic-1 Proteins 0.000 description 1
- 101000653435 Homo sapiens Tectonic-3 Proteins 0.000 description 1
- 101000835708 Homo sapiens Tectonin beta-propeller repeat-containing protein 1 Proteins 0.000 description 1
- 101000835705 Homo sapiens Tectonin beta-propeller repeat-containing protein 2 Proteins 0.000 description 1
- 101000653533 Homo sapiens Telomerase Cajal body protein 1 Proteins 0.000 description 1
- 101001063514 Homo sapiens Telomerase-binding protein EST1A Proteins 0.000 description 1
- 101000625504 Homo sapiens Telomere attrition and p53 response 1 protein Proteins 0.000 description 1
- 101000800495 Homo sapiens Telomere length and silencing protein 1 homolog Proteins 0.000 description 1
- 101000940176 Homo sapiens Telomere zinc finger-associated protein Proteins 0.000 description 1
- 101001095487 Homo sapiens Telomere-associated protein RIF1 Proteins 0.000 description 1
- 101000735429 Homo sapiens Terminal nucleotidyltransferase 4B Proteins 0.000 description 1
- 101000642191 Homo sapiens Terminal uridylyltransferase 4 Proteins 0.000 description 1
- 101000642188 Homo sapiens Terminal uridylyltransferase 7 Proteins 0.000 description 1
- 101000889886 Homo sapiens Testis-expressed protein 10 Proteins 0.000 description 1
- 101000658250 Homo sapiens Testis-expressed protein 264 Proteins 0.000 description 1
- 101000728490 Homo sapiens Tether containing UBX domain for GLUT4 Proteins 0.000 description 1
- 101000794147 Homo sapiens Tetraspanin-17 Proteins 0.000 description 1
- 101000612990 Homo sapiens Tetraspanin-3 Proteins 0.000 description 1
- 101000658745 Homo sapiens Tetraspanin-31 Proteins 0.000 description 1
- 101000847024 Homo sapiens Tetratricopeptide repeat protein 1 Proteins 0.000 description 1
- 101000759349 Homo sapiens Tetratricopeptide repeat protein 14 Proteins 0.000 description 1
- 101000846996 Homo sapiens Tetratricopeptide repeat protein 19, mitochondrial Proteins 0.000 description 1
- 101000795810 Homo sapiens Tetratricopeptide repeat protein 27 Proteins 0.000 description 1
- 101000612743 Homo sapiens Tetratricopeptide repeat protein 32 Proteins 0.000 description 1
- 101000612746 Homo sapiens Tetratricopeptide repeat protein 33 Proteins 0.000 description 1
- 101000633680 Homo sapiens Tetratricopeptide repeat protein 37 Proteins 0.000 description 1
- 101000845188 Homo sapiens Tetratricopeptide repeat protein 4 Proteins 0.000 description 1
- 101000845201 Homo sapiens Tetratricopeptide repeat protein 7B Proteins 0.000 description 1
- 101000753769 Homo sapiens Thiamine-triphosphatase Proteins 0.000 description 1
- 101000638722 Homo sapiens Thimet oligopeptidase Proteins 0.000 description 1
- 101000844208 Homo sapiens Thioredoxin domain-containing protein 11 Proteins 0.000 description 1
- 101000844204 Homo sapiens Thioredoxin domain-containing protein 12 Proteins 0.000 description 1
- 101000844217 Homo sapiens Thioredoxin domain-containing protein 16 Proteins 0.000 description 1
- 101000796028 Homo sapiens Thioredoxin domain-containing protein 9 Proteins 0.000 description 1
- 101000844686 Homo sapiens Thioredoxin reductase 1, cytoplasmic Proteins 0.000 description 1
- 101000845013 Homo sapiens Thioredoxin reductase 2, mitochondrial Proteins 0.000 description 1
- 101000801891 Homo sapiens Thioredoxin, mitochondrial Proteins 0.000 description 1
- 101001090050 Homo sapiens Thioredoxin-dependent peroxide reductase, mitochondrial Proteins 0.000 description 1
- 101000796121 Homo sapiens Thioredoxin-like protein 1 Proteins 0.000 description 1
- 101000773153 Homo sapiens Thioredoxin-like protein 4A Proteins 0.000 description 1
- 101000773151 Homo sapiens Thioredoxin-like protein 4B Proteins 0.000 description 1
- 101000851425 Homo sapiens Thioredoxin-related transmembrane protein 2 Proteins 0.000 description 1
- 101000674603 Homo sapiens Threonine aspartase 1 Proteins 0.000 description 1
- 101000658120 Homo sapiens Threonine-tRNA ligase, mitochondrial Proteins 0.000 description 1
- 101001027052 Homo sapiens Thymidylate kinase Proteins 0.000 description 1
- 101000800125 Homo sapiens Thymocyte nuclear protein 1 Proteins 0.000 description 1
- 101000666234 Homo sapiens Thyroid adenoma-associated protein Proteins 0.000 description 1
- 101000795185 Homo sapiens Thyroid hormone receptor-associated protein 3 Proteins 0.000 description 1
- 101000649022 Homo sapiens Thyroid receptor-interacting protein 11 Proteins 0.000 description 1
- 101000652578 Homo sapiens Thyroid transcription factor 1-associated protein 26 Proteins 0.000 description 1
- 101000831005 Homo sapiens Tigger transposable element-derived protein 6 Proteins 0.000 description 1
- 101000785523 Homo sapiens Tight junction protein ZO-2 Proteins 0.000 description 1
- 101000645332 Homo sapiens Tight junction-associated protein 1 Proteins 0.000 description 1
- 101000637726 Homo sapiens Toll/interleukin-1 receptor domain-containing adapter protein Proteins 0.000 description 1
- 101000662686 Homo sapiens Torsin-1A Proteins 0.000 description 1
- 101000679875 Homo sapiens Torsin-1A-interacting protein 1 Proteins 0.000 description 1
- 101000679867 Homo sapiens Torsin-1A-interacting protein 2 Proteins 0.000 description 1
- 101001010861 Homo sapiens Torsin-1A-interacting protein 2, isoform IFRG15 Proteins 0.000 description 1
- 101000662688 Homo sapiens Torsin-1B Proteins 0.000 description 1
- 101000610726 Homo sapiens Trafficking kinesin-binding protein 1 Proteins 0.000 description 1
- 101000648075 Homo sapiens Trafficking protein particle complex subunit 1 Proteins 0.000 description 1
- 101000662690 Homo sapiens Trafficking protein particle complex subunit 10 Proteins 0.000 description 1
- 101000662708 Homo sapiens Trafficking protein particle complex subunit 12 Proteins 0.000 description 1
- 101000679575 Homo sapiens Trafficking protein particle complex subunit 2 Proteins 0.000 description 1
- 101000679568 Homo sapiens Trafficking protein particle complex subunit 2-like protein Proteins 0.000 description 1
- 101000662791 Homo sapiens Trafficking protein particle complex subunit 3 Proteins 0.000 description 1
- 101000662809 Homo sapiens Trafficking protein particle complex subunit 4 Proteins 0.000 description 1
- 101000662805 Homo sapiens Trafficking protein particle complex subunit 5 Proteins 0.000 description 1
- 101000679485 Homo sapiens Trafficking protein particle complex subunit 6A Proteins 0.000 description 1
- 101000648279 Homo sapiens Trafficking protein particle complex subunit 6B Proteins 0.000 description 1
- 101000636981 Homo sapiens Trafficking protein particle complex subunit 8 Proteins 0.000 description 1
- 101000637031 Homo sapiens Trafficking protein particle complex subunit 9 Proteins 0.000 description 1
- 101000837849 Homo sapiens Trans-Golgi network integral membrane protein 2 Proteins 0.000 description 1
- 101000702545 Homo sapiens Transcription activator BRG1 Proteins 0.000 description 1
- 101000920618 Homo sapiens Transcription and mRNA export factor ENY2 Proteins 0.000 description 1
- 101000805518 Homo sapiens Transcription cofactor vestigial-like protein 4 Proteins 0.000 description 1
- 101000663444 Homo sapiens Transcription elongation factor SPT4 Proteins 0.000 description 1
- 101000702364 Homo sapiens Transcription elongation factor SPT5 Proteins 0.000 description 1
- 101000829436 Homo sapiens Transcription elongation factor SPT6 Proteins 0.000 description 1
- 101000891371 Homo sapiens Transcription elongation regulator 1 Proteins 0.000 description 1
- 101001041525 Homo sapiens Transcription factor 12 Proteins 0.000 description 1
- 101000800583 Homo sapiens Transcription factor 20 Proteins 0.000 description 1
- 101000653538 Homo sapiens Transcription factor 25 Proteins 0.000 description 1
- 101000596771 Homo sapiens Transcription factor 7-like 2 Proteins 0.000 description 1
- 101000835023 Homo sapiens Transcription factor A, mitochondrial Proteins 0.000 description 1
- 101000933542 Homo sapiens Transcription factor BTF3 Proteins 0.000 description 1
- 101000984924 Homo sapiens Transcription factor BTF3 homolog 4 Proteins 0.000 description 1
- 101000895882 Homo sapiens Transcription factor E2F4 Proteins 0.000 description 1
- 101000837845 Homo sapiens Transcription factor E3 Proteins 0.000 description 1
- 101000879604 Homo sapiens Transcription factor E4F1 Proteins 0.000 description 1
- 101000813738 Homo sapiens Transcription factor ETV6 Proteins 0.000 description 1
- 101000714243 Homo sapiens Transcription factor IIIB 90 kDa subunit Proteins 0.000 description 1
- 101001050297 Homo sapiens Transcription factor JunD Proteins 0.000 description 1
- 101000635741 Homo sapiens Transcription initiation factor IIA subunit 1 Proteins 0.000 description 1
- 101000838169 Homo sapiens Transcription initiation factor IIA subunit 2 Proteins 0.000 description 1
- 101000800860 Homo sapiens Transcription initiation factor IIB Proteins 0.000 description 1
- 101000658563 Homo sapiens Transcription initiation factor IIE subunit beta Proteins 0.000 description 1
- 101000596093 Homo sapiens Transcription initiation factor TFIID subunit 1 Proteins 0.000 description 1
- 101000715069 Homo sapiens Transcription initiation factor TFIID subunit 10 Proteins 0.000 description 1
- 101000715062 Homo sapiens Transcription initiation factor TFIID subunit 11 Proteins 0.000 description 1
- 101000788147 Homo sapiens Transcription initiation factor TFIID subunit 13 Proteins 0.000 description 1
- 101000625358 Homo sapiens Transcription initiation factor TFIID subunit 2 Proteins 0.000 description 1
- 101000652707 Homo sapiens Transcription initiation factor TFIID subunit 4 Proteins 0.000 description 1
- 101000674710 Homo sapiens Transcription initiation factor TFIID subunit 6 Proteins 0.000 description 1
- 101000715159 Homo sapiens Transcription initiation factor TFIID subunit 9 Proteins 0.000 description 1
- 101000715157 Homo sapiens Transcription initiation factor TFIID subunit 9B Proteins 0.000 description 1
- 101000845269 Homo sapiens Transcription termination factor 1 Proteins 0.000 description 1
- 101000845264 Homo sapiens Transcription termination factor 2 Proteins 0.000 description 1
- 101000594296 Homo sapiens Transcription termination factor 2, mitochondrial Proteins 0.000 description 1
- 101000594302 Homo sapiens Transcription termination factor 3, mitochondrial Proteins 0.000 description 1
- 101001137337 Homo sapiens Transcriptional activator protein Pur-alpha Proteins 0.000 description 1
- 101000657352 Homo sapiens Transcriptional adapter 2-alpha Proteins 0.000 description 1
- 101000652684 Homo sapiens Transcriptional adapter 3 Proteins 0.000 description 1
- 101000975007 Homo sapiens Transcriptional regulator Kaiso Proteins 0.000 description 1
- 101001060442 Homo sapiens Transcriptional regulator QRICH1 Proteins 0.000 description 1
- 101001098095 Homo sapiens Transcriptional repressor p66-alpha Proteins 0.000 description 1
- 101000837456 Homo sapiens Transducin beta-like protein 3 Proteins 0.000 description 1
- 101000669432 Homo sapiens Transducin-like enhancer protein 1 Proteins 0.000 description 1
- 101000835093 Homo sapiens Transferrin receptor protein 1 Proteins 0.000 description 1
- 101000796673 Homo sapiens Transformation/transcription domain-associated protein Proteins 0.000 description 1
- 101000679340 Homo sapiens Transformer-2 protein homolog alpha Proteins 0.000 description 1
- 101000679343 Homo sapiens Transformer-2 protein homolog beta Proteins 0.000 description 1
- 101000655536 Homo sapiens Transforming growth factor-beta receptor-associated protein 1 Proteins 0.000 description 1
- 101000844518 Homo sapiens Transient receptor potential cation channel subfamily M member 7 Proteins 0.000 description 1
- 101000840378 Homo sapiens Translation initiation factor IF-2, mitochondrial Proteins 0.000 description 1
- 101001034442 Homo sapiens Translation initiation factor IF-3, mitochondrial Proteins 0.000 description 1
- 101001057681 Homo sapiens Translation initiation factor eIF-2B subunit beta Proteins 0.000 description 1
- 101000925982 Homo sapiens Translation initiation factor eIF-2B subunit delta Proteins 0.000 description 1
- 101000925985 Homo sapiens Translation initiation factor eIF-2B subunit epsilon Proteins 0.000 description 1
- 101001049688 Homo sapiens Translation initiation factor eIF-2B subunit gamma Proteins 0.000 description 1
- 101000801038 Homo sapiens Translation machinery-associated protein 7 Proteins 0.000 description 1
- 101000653679 Homo sapiens Translationally-controlled tumor protein Proteins 0.000 description 1
- 101000847066 Homo sapiens Translin-associated protein X Proteins 0.000 description 1
- 101000649115 Homo sapiens Translocating chain-associated membrane protein 1 Proteins 0.000 description 1
- 101000631620 Homo sapiens Translocation protein SEC63 homolog Proteins 0.000 description 1
- 101000629937 Homo sapiens Translocon-associated protein subunit alpha Proteins 0.000 description 1
- 101000697347 Homo sapiens Translocon-associated protein subunit gamma Proteins 0.000 description 1
- 101000597923 Homo sapiens Transmembrane 7 superfamily member 3 Proteins 0.000 description 1
- 101000798727 Homo sapiens Transmembrane 9 superfamily member 2 Proteins 0.000 description 1
- 101000798726 Homo sapiens Transmembrane 9 superfamily member 4 Proteins 0.000 description 1
- 101000663031 Homo sapiens Transmembrane and coiled-coil domains protein 1 Proteins 0.000 description 1
- 101000680036 Homo sapiens Transmembrane and ubiquitin-like domain-containing protein 1 Proteins 0.000 description 1
- 101000680010 Homo sapiens Transmembrane and ubiquitin-like domain-containing protein 2 Proteins 0.000 description 1
- 101000831851 Homo sapiens Transmembrane emp24 domain-containing protein 10 Proteins 0.000 description 1
- 101000638180 Homo sapiens Transmembrane emp24 domain-containing protein 2 Proteins 0.000 description 1
- 101000638204 Homo sapiens Transmembrane emp24 domain-containing protein 5 Proteins 0.000 description 1
- 101000851544 Homo sapiens Transmembrane emp24 domain-containing protein 9 Proteins 0.000 description 1
- 101000852847 Homo sapiens Transmembrane protein 104 Proteins 0.000 description 1
- 101000834926 Homo sapiens Transmembrane protein 106B Proteins 0.000 description 1
- 101000658658 Homo sapiens Transmembrane protein 106C Proteins 0.000 description 1
- 101000597747 Homo sapiens Transmembrane protein 11, mitochondrial Proteins 0.000 description 1
- 101000598045 Homo sapiens Transmembrane protein 115 Proteins 0.000 description 1
- 101000640713 Homo sapiens Transmembrane protein 126A Proteins 0.000 description 1
- 101000637950 Homo sapiens Transmembrane protein 127 Proteins 0.000 description 1
- 101000801109 Homo sapiens Transmembrane protein 131 Proteins 0.000 description 1
- 101000801114 Homo sapiens Transmembrane protein 134 Proteins 0.000 description 1
- 101000763462 Homo sapiens Transmembrane protein 135 Proteins 0.000 description 1
- 101000851660 Homo sapiens Transmembrane protein 147 Proteins 0.000 description 1
- 101000655136 Homo sapiens Transmembrane protein 14B Proteins 0.000 description 1
- 101000655141 Homo sapiens Transmembrane protein 14C Proteins 0.000 description 1
- 101000787985 Homo sapiens Transmembrane protein 150A Proteins 0.000 description 1
- 101000596317 Homo sapiens Transmembrane protein 161A Proteins 0.000 description 1
- 101000637888 Homo sapiens Transmembrane protein 177 Proteins 0.000 description 1
- 101000892326 Homo sapiens Transmembrane protein 184B Proteins 0.000 description 1
- 101000831515 Homo sapiens Transmembrane protein 186 Proteins 0.000 description 1
- 101000831508 Homo sapiens Transmembrane protein 187 Proteins 0.000 description 1
- 101000598067 Homo sapiens Transmembrane protein 192 Proteins 0.000 description 1
- 101000763430 Homo sapiens Transmembrane protein 205 Proteins 0.000 description 1
- 101000763453 Homo sapiens Transmembrane protein 208 Proteins 0.000 description 1
- 101000851588 Homo sapiens Transmembrane protein 214 Proteins 0.000 description 1
- 101000680186 Homo sapiens Transmembrane protein 218 Proteins 0.000 description 1
- 101000655162 Homo sapiens Transmembrane protein 223 Proteins 0.000 description 1
- 101000655171 Homo sapiens Transmembrane protein 230 Proteins 0.000 description 1
- 101000645439 Homo sapiens Transmembrane protein 250 Proteins 0.000 description 1
- 101000648518 Homo sapiens Transmembrane protein 251 Proteins 0.000 description 1
- 101000597877 Homo sapiens Transmembrane protein 254 Proteins 0.000 description 1
- 101000597903 Homo sapiens Transmembrane protein 258 Proteins 0.000 description 1
- 101000831825 Homo sapiens Transmembrane protein 41B Proteins 0.000 description 1
- 101000648528 Homo sapiens Transmembrane protein 50A Proteins 0.000 description 1
- 101000648531 Homo sapiens Transmembrane protein 50B Proteins 0.000 description 1
- 101000680271 Homo sapiens Transmembrane protein 59 Proteins 0.000 description 1
- 101000851550 Homo sapiens Transmembrane protein 64 Proteins 0.000 description 1
- 101000851415 Homo sapiens Transmembrane protein 69 Proteins 0.000 description 1
- 101000851431 Homo sapiens Transmembrane protein 70, mitochondrial Proteins 0.000 description 1
- 101000648687 Homo sapiens Transmembrane protein 80 Proteins 0.000 description 1
- 101000597830 Homo sapiens Transmembrane protein 87A Proteins 0.000 description 1
- 101000662961 Homo sapiens Transmembrane protein 94 Proteins 0.000 description 1
- 101000896379 Homo sapiens Transmembrane reductase CYB561D2 Proteins 0.000 description 1
- 101000836339 Homo sapiens Transposon Hsmar1 transposase Proteins 0.000 description 1
- 101000653548 Homo sapiens Trichoplein keratin filament-binding protein Proteins 0.000 description 1
- 101000764644 Homo sapiens Trimethyllysine dioxygenase, mitochondrial Proteins 0.000 description 1
- 101000830563 Homo sapiens Trinucleotide repeat-containing gene 18 protein Proteins 0.000 description 1
- 101000611194 Homo sapiens Trinucleotide repeat-containing gene 6A protein Proteins 0.000 description 1
- 101000611192 Homo sapiens Trinucleotide repeat-containing gene 6B protein Proteins 0.000 description 1
- 101000611197 Homo sapiens Trinucleotide repeat-containing gene 6C protein Proteins 0.000 description 1
- 101000848653 Homo sapiens Tripartite motif-containing protein 26 Proteins 0.000 description 1
- 101000664600 Homo sapiens Tripartite motif-containing protein 3 Proteins 0.000 description 1
- 101000648997 Homo sapiens Tripartite motif-containing protein 44 Proteins 0.000 description 1
- 101000830228 Homo sapiens Tripartite motif-containing protein 65 Proteins 0.000 description 1
- 101000649030 Homo sapiens Triple QxxK/R motif-containing protein Proteins 0.000 description 1
- 101000597778 Homo sapiens Tropomodulin-3 Proteins 0.000 description 1
- 101000801701 Homo sapiens Tropomyosin alpha-1 chain Proteins 0.000 description 1
- 101000850794 Homo sapiens Tropomyosin alpha-3 chain Proteins 0.000 description 1
- 101000640986 Homo sapiens Tryptophan-tRNA ligase, mitochondrial Proteins 0.000 description 1
- 101000772165 Homo sapiens Tubby-related protein 4 Proteins 0.000 description 1
- 101000625825 Homo sapiens Tubulin delta chain Proteins 0.000 description 1
- 101000659236 Homo sapiens Tubulin polyglutamylase TTLL11 Proteins 0.000 description 1
- 101000835634 Homo sapiens Tubulin-folding cofactor B Proteins 0.000 description 1
- 101000835622 Homo sapiens Tubulin-specific chaperone A Proteins 0.000 description 1
- 101000625842 Homo sapiens Tubulin-specific chaperone E Proteins 0.000 description 1
- 101000652492 Homo sapiens Tubulin-specific chaperone cofactor E-like protein Proteins 0.000 description 1
- 101000659230 Homo sapiens Tubulin-tyrosine ligase-like protein 12 Proteins 0.000 description 1
- 101000835787 Homo sapiens Tudor domain-containing protein 3 Proteins 0.000 description 1
- 101000655421 Homo sapiens Tuftelin-interacting protein 11 Proteins 0.000 description 1
- 101000610604 Homo sapiens Tumor necrosis factor receptor superfamily member 10B Proteins 0.000 description 1
- 101000801228 Homo sapiens Tumor necrosis factor receptor superfamily member 1A Proteins 0.000 description 1
- 101000636802 Homo sapiens Tumor protein D54 Proteins 0.000 description 1
- 101000659267 Homo sapiens Tumor suppressor candidate 2 Proteins 0.000 description 1
- 101000613251 Homo sapiens Tumor susceptibility gene 101 protein Proteins 0.000 description 1
- 101000659324 Homo sapiens Twinfilin-1 Proteins 0.000 description 1
- 101000795921 Homo sapiens Twinfilin-2 Proteins 0.000 description 1
- 101000763003 Homo sapiens Two pore channel protein 1 Proteins 0.000 description 1
- 101001068211 Homo sapiens Type 1 phosphatidylinositol 4,5-bisphosphate 4-phosphatase Proteins 0.000 description 1
- 101000962366 Homo sapiens Type II inositol 1,4,5-trisphosphate 5-phosphatase Proteins 0.000 description 1
- 101000823316 Homo sapiens Tyrosine-protein kinase ABL1 Proteins 0.000 description 1
- 101000823271 Homo sapiens Tyrosine-protein kinase ABL2 Proteins 0.000 description 1
- 101000997835 Homo sapiens Tyrosine-protein kinase JAK1 Proteins 0.000 description 1
- 101000820294 Homo sapiens Tyrosine-protein kinase Yes Proteins 0.000 description 1
- 101001087394 Homo sapiens Tyrosine-protein phosphatase non-receptor type 1 Proteins 0.000 description 1
- 101001087416 Homo sapiens Tyrosine-protein phosphatase non-receptor type 11 Proteins 0.000 description 1
- 101001087418 Homo sapiens Tyrosine-protein phosphatase non-receptor type 12 Proteins 0.000 description 1
- 101001135572 Homo sapiens Tyrosine-protein phosphatase non-receptor type 2 Proteins 0.000 description 1
- 101001135585 Homo sapiens Tyrosine-protein phosphatase non-receptor type 23 Proteins 0.000 description 1
- 101000641003 Homo sapiens Tyrosine-tRNA ligase, cytoplasmic Proteins 0.000 description 1
- 101000760781 Homo sapiens Tyrosyl-DNA phosphodiesterase 2 Proteins 0.000 description 1
- 101000617779 Homo sapiens U1 small nuclear ribonucleoprotein A Proteins 0.000 description 1
- 101001094573 Homo sapiens U1 small nuclear ribonucleoprotein C Proteins 0.000 description 1
- 101000639802 Homo sapiens U2 small nuclear ribonucleoprotein B'' Proteins 0.000 description 1
- 101000658084 Homo sapiens U2 small nuclear ribonucleoprotein auxiliary factor 35 kDa subunit-related protein 2 Proteins 0.000 description 1
- 101000704170 Homo sapiens U2 snRNP-associated SURP motif-containing protein Proteins 0.000 description 1
- 101000671653 Homo sapiens U3 small nucleolar RNA-associated protein 14 homolog A Proteins 0.000 description 1
- 101000941126 Homo sapiens U3 small nucleolar RNA-associated protein 18 homolog Proteins 0.000 description 1
- 101000638903 Homo sapiens U3 small nucleolar RNA-associated protein 25 homolog Proteins 0.000 description 1
- 101000796184 Homo sapiens U3 small nucleolar RNA-interacting protein 2 Proteins 0.000 description 1
- 101000590687 Homo sapiens U3 small nucleolar ribonucleoprotein protein MPP10 Proteins 0.000 description 1
- 101000610640 Homo sapiens U4/U6 small nuclear ribonucleoprotein Prp3 Proteins 0.000 description 1
- 101000610557 Homo sapiens U4/U6 small nuclear ribonucleoprotein Prp31 Proteins 0.000 description 1
- 101000577737 Homo sapiens U4/U6 small nuclear ribonucleoprotein Prp4 Proteins 0.000 description 1
- 101000708378 Homo sapiens U4/U6.U5 small nuclear ribonucleoprotein 27 kDa protein Proteins 0.000 description 1
- 101000836268 Homo sapiens U4/U6.U5 tri-snRNP-associated protein 1 Proteins 0.000 description 1
- 101000836261 Homo sapiens U4/U6.U5 tri-snRNP-associated protein 2 Proteins 0.000 description 1
- 101000659545 Homo sapiens U5 small nuclear ribonucleoprotein 200 kDa helicase Proteins 0.000 description 1
- 101000708392 Homo sapiens U5 small nuclear ribonucleoprotein 40 kDa protein Proteins 0.000 description 1
- 101000941170 Homo sapiens U6 snRNA phosphodiesterase 1 Proteins 0.000 description 1
- 101001017896 Homo sapiens U6 snRNA-associated Sm-like protein LSm1 Proteins 0.000 description 1
- 101001017894 Homo sapiens U6 snRNA-associated Sm-like protein LSm3 Proteins 0.000 description 1
- 101000579604 Homo sapiens U6 snRNA-associated Sm-like protein LSm4 Proteins 0.000 description 1
- 101000579613 Homo sapiens U6 snRNA-associated Sm-like protein LSm5 Proteins 0.000 description 1
- 101001065732 Homo sapiens U6 snRNA-associated Sm-like protein LSm6 Proteins 0.000 description 1
- 101000965658 Homo sapiens U6 snRNA-associated Sm-like protein LSm7 Proteins 0.000 description 1
- 101000991942 Homo sapiens U8 snoRNA-decapping enzyme Proteins 0.000 description 1
- 101000807631 Homo sapiens UAP56-interacting factor Proteins 0.000 description 1
- 101000747564 Homo sapiens UBX domain-containing protein 1 Proteins 0.000 description 1
- 101000939409 Homo sapiens UBX domain-containing protein 2B Proteins 0.000 description 1
- 101000777156 Homo sapiens UBX domain-containing protein 4 Proteins 0.000 description 1
- 101000777142 Homo sapiens UBX domain-containing protein 6 Proteins 0.000 description 1
- 101000777106 Homo sapiens UBX domain-containing protein 7 Proteins 0.000 description 1
- 101000662009 Homo sapiens UDP-N-acetylglucosamine pyrophosphorylase Proteins 0.000 description 1
- 101000621863 Homo sapiens UDP-glucuronic acid decarboxylase 1 Proteins 0.000 description 1
- 101000807276 Homo sapiens UHRF1-binding protein 1 Proteins 0.000 description 1
- 101000768621 Homo sapiens UHRF1-binding protein 1-like Proteins 0.000 description 1
- 101001138544 Homo sapiens UMP-CMP kinase Proteins 0.000 description 1
- 101000989650 Homo sapiens UNC93-like protein MFSD11 Proteins 0.000 description 1
- 101000710897 Homo sapiens UPF0235 protein C15orf40 Proteins 0.000 description 1
- 101000710040 Homo sapiens UPF0415 protein C7orf25 Proteins 0.000 description 1
- 101000945528 Homo sapiens UPF0461 protein C5orf24 Proteins 0.000 description 1
- 101000884249 Homo sapiens UPF0462 protein C4orf33 Proteins 0.000 description 1
- 101000910952 Homo sapiens UPF0538 protein C2orf76 Proteins 0.000 description 1
- 101000889074 Homo sapiens UPF0545 protein C22orf39 Proteins 0.000 description 1
- 101000855244 Homo sapiens UPF0547 protein C16orf87 Proteins 0.000 description 1
- 101000793972 Homo sapiens UPF0561 protein C2orf68 Proteins 0.000 description 1
- 101000944555 Homo sapiens UPF0598 protein C8orf82 Proteins 0.000 description 1
- 101000914187 Homo sapiens UPF0669 protein C6orf120 Proteins 0.000 description 1
- 101000957919 Homo sapiens UPF0711 protein C18orf21 Proteins 0.000 description 1
- 101000957906 Homo sapiens UPF0729 protein C18orf32 Proteins 0.000 description 1
- 101000608019 Homo sapiens USP6 N-terminal-like protein Proteins 0.000 description 1
- 101000809490 Homo sapiens UTP-glucose-1-phosphate uridylyltransferase Proteins 0.000 description 1
- 101000717424 Homo sapiens UV excision repair protein RAD23 homolog B Proteins 0.000 description 1
- 101000777263 Homo sapiens UV radiation resistance-associated gene protein Proteins 0.000 description 1
- 101000608653 Homo sapiens UbiA prenyltransferase domain-containing protein 1 Proteins 0.000 description 1
- 101000809273 Homo sapiens Ubinuclein-1 Proteins 0.000 description 1
- 101000607626 Homo sapiens Ubiquilin-1 Proteins 0.000 description 1
- 101000607639 Homo sapiens Ubiquilin-2 Proteins 0.000 description 1
- 101000841768 Homo sapiens Ubiquinol-cytochrome-c reductase complex assembly factor 1 Proteins 0.000 description 1
- 101000875780 Homo sapiens Ubiquinone biosynthesis protein COQ4 homolog, mitochondrial Proteins 0.000 description 1
- 101000809243 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 10 Proteins 0.000 description 1
- 101000841477 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 14 Proteins 0.000 description 1
- 101000841471 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 15 Proteins 0.000 description 1
- 101000644815 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 16 Proteins 0.000 description 1
- 101000644843 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 19 Proteins 0.000 description 1
- 101000607865 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 20 Proteins 0.000 description 1
- 101000607872 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 21 Proteins 0.000 description 1
- 101000807524 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 22 Proteins 0.000 description 1
- 101000807541 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 24 Proteins 0.000 description 1
- 101000939135 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 27 Proteins 0.000 description 1
- 101000748141 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 32 Proteins 0.000 description 1
- 101000748157 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 33 Proteins 0.000 description 1
- 101000748161 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 34 Proteins 0.000 description 1
- 101000809257 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 4 Proteins 0.000 description 1
- 101000760243 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 45 Proteins 0.000 description 1
- 101000759988 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 48 Proteins 0.000 description 1
- 101000643890 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 5 Proteins 0.000 description 1
- 101000841466 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 8 Proteins 0.000 description 1
- 101000740048 Homo sapiens Ubiquitin carboxyl-terminal hydrolase BAP1 Proteins 0.000 description 1
- 101000573455 Homo sapiens Ubiquitin carboxyl-terminal hydrolase MINDY-1 Proteins 0.000 description 1
- 101000759918 Homo sapiens Ubiquitin carboxyl-terminal hydrolase isozyme L3 Proteins 0.000 description 1
- 101000809126 Homo sapiens Ubiquitin carboxyl-terminal hydrolase isozyme L5 Proteins 0.000 description 1
- 101000808654 Homo sapiens Ubiquitin conjugation factor E4 A Proteins 0.000 description 1
- 101000809046 Homo sapiens Ubiquitin conjugation factor E4 B Proteins 0.000 description 1
- 101000809513 Homo sapiens Ubiquitin recognition factor in ER-associated degradation protein 1 Proteins 0.000 description 1
- 101001121442 Homo sapiens Ubiquitin thioesterase OTU1 Proteins 0.000 description 1
- 101000614277 Homo sapiens Ubiquitin thioesterase OTUB1 Proteins 0.000 description 1
- 101000723423 Homo sapiens Ubiquitin thioesterase ZRANB1 Proteins 0.000 description 1
- 101001115218 Homo sapiens Ubiquitin-40S ribosomal protein S27a Proteins 0.000 description 1
- 101000840051 Homo sapiens Ubiquitin-60S ribosomal protein L40 Proteins 0.000 description 1
- 101000662031 Homo sapiens Ubiquitin-associated domain-containing protein 2 Proteins 0.000 description 1
- 101000939255 Homo sapiens Ubiquitin-associated protein 1 Proteins 0.000 description 1
- 101000939460 Homo sapiens Ubiquitin-associated protein 2-like Proteins 0.000 description 1
- 101000807344 Homo sapiens Ubiquitin-conjugating enzyme E2 A Proteins 0.000 description 1
- 101000807337 Homo sapiens Ubiquitin-conjugating enzyme E2 B Proteins 0.000 description 1
- 101000772901 Homo sapiens Ubiquitin-conjugating enzyme E2 D2 Proteins 0.000 description 1
- 101000772913 Homo sapiens Ubiquitin-conjugating enzyme E2 D3 Proteins 0.000 description 1
- 101000644675 Homo sapiens Ubiquitin-conjugating enzyme E2 D4 Proteins 0.000 description 1
- 101000644655 Homo sapiens Ubiquitin-conjugating enzyme E2 E1 Proteins 0.000 description 1
- 101000644661 Homo sapiens Ubiquitin-conjugating enzyme E2 E3 Proteins 0.000 description 1
- 101000644657 Homo sapiens Ubiquitin-conjugating enzyme E2 G1 Proteins 0.000 description 1
- 101000761646 Homo sapiens Ubiquitin-conjugating enzyme E2 G2 Proteins 0.000 description 1
- 101000644682 Homo sapiens Ubiquitin-conjugating enzyme E2 H Proteins 0.000 description 1
- 101000761725 Homo sapiens Ubiquitin-conjugating enzyme E2 J1 Proteins 0.000 description 1
- 101000644689 Homo sapiens Ubiquitin-conjugating enzyme E2 K Proteins 0.000 description 1
- 101000761737 Homo sapiens Ubiquitin-conjugating enzyme E2 L3 Proteins 0.000 description 1
- 101000644684 Homo sapiens Ubiquitin-conjugating enzyme E2 N Proteins 0.000 description 1
- 101000761741 Homo sapiens Ubiquitin-conjugating enzyme E2 Q1 Proteins 0.000 description 1
- 101000808784 Homo sapiens Ubiquitin-conjugating enzyme E2 R1 Proteins 0.000 description 1
- 101000808789 Homo sapiens Ubiquitin-conjugating enzyme E2 R2 Proteins 0.000 description 1
- 101000837574 Homo sapiens Ubiquitin-conjugating enzyme E2 W Proteins 0.000 description 1
- 101000808753 Homo sapiens Ubiquitin-conjugating enzyme E2 variant 1 Proteins 0.000 description 1
- 101000940063 Homo sapiens Ubiquitin-conjugating enzyme E2 variant 2 Proteins 0.000 description 1
- 101000607560 Homo sapiens Ubiquitin-conjugating enzyme E2 variant 3 Proteins 0.000 description 1
- 101000809090 Homo sapiens Ubiquitin-fold modifier-conjugating enzyme 1 Proteins 0.000 description 1
- 101000662278 Homo sapiens Ubiquitin-like protein 3 Proteins 0.000 description 1
- 101000662296 Homo sapiens Ubiquitin-like protein 4A Proteins 0.000 description 1
- 101000772767 Homo sapiens Ubiquitin-like protein 5 Proteins 0.000 description 1
- 101000789849 Homo sapiens Ubiquitin-like-conjugating enzyme ATG10 Proteins 0.000 description 1
- 101000772888 Homo sapiens Ubiquitin-protein ligase E3A Proteins 0.000 description 1
- 101000772955 Homo sapiens Ubiquitin-protein ligase E3B Proteins 0.000 description 1
- 101000772964 Homo sapiens Ubiquitin-protein ligase E3C Proteins 0.000 description 1
- 101000941158 Homo sapiens Ubiquitin-related modifier 1 Proteins 0.000 description 1
- 101000761740 Homo sapiens Ubiquitin/ISG15-conjugating enzyme E2 L6 Proteins 0.000 description 1
- 101000989779 Homo sapiens Uncharacterized protein C12orf29 Proteins 0.000 description 1
- 101000900754 Homo sapiens Uncharacterized protein C14orf28 Proteins 0.000 description 1
- 101000710891 Homo sapiens Uncharacterized protein C15orf61 Proteins 0.000 description 1
- 101000910945 Homo sapiens Uncharacterized protein C2orf74 Proteins 0.000 description 1
- 101000777650 Homo sapiens Uncharacterized protein C4orf3 Proteins 0.000 description 1
- 101000776449 Homo sapiens Uncharacterized protein C6orf136 Proteins 0.000 description 1
- 101000884594 Homo sapiens Uncharacterized protein C6orf226 Proteins 0.000 description 1
- 101000709986 Homo sapiens Uncharacterized protein C7orf50 Proteins 0.000 description 1
- 101000734214 Homo sapiens Unconventional prefoldin RPB5 interactor 1 Proteins 0.000 description 1
- 101000768133 Homo sapiens Unhealthy ribosome biogenesis protein 2 homolog Proteins 0.000 description 1
- 101000776508 Homo sapiens Up-regulator of cell proliferation Proteins 0.000 description 1
- 101000671649 Homo sapiens Upstream stimulatory factor 2 Proteins 0.000 description 1
- 101000590277 Homo sapiens Uridine diphosphate glucose pyrophosphatase NUDT22 Proteins 0.000 description 1
- 101000809140 Homo sapiens Uridine-cytidine kinase 1 Proteins 0.000 description 1
- 101000841505 Homo sapiens Uridine-cytidine kinase 2 Proteins 0.000 description 1
- 101000841520 Homo sapiens Uridine-cytidine kinase-like 1 Proteins 0.000 description 1
- 101000910482 Homo sapiens Uroporphyrinogen decarboxylase Proteins 0.000 description 1
- 101000805729 Homo sapiens V-type proton ATPase 116 kDa subunit a 1 Proteins 0.000 description 1
- 101000854879 Homo sapiens V-type proton ATPase 116 kDa subunit a 2 Proteins 0.000 description 1
- 101000954434 Homo sapiens V-type proton ATPase 21 kDa proteolipid subunit c'' Proteins 0.000 description 1
- 101000775709 Homo sapiens V-type proton ATPase subunit C 1 Proteins 0.000 description 1
- 101000850489 Homo sapiens V-type proton ATPase subunit D Proteins 0.000 description 1
- 101000670960 Homo sapiens V-type proton ATPase subunit E 1 Proteins 0.000 description 1
- 101000954551 Homo sapiens V-type proton ATPase subunit F Proteins 0.000 description 1
- 101000806424 Homo sapiens V-type proton ATPase subunit G 1 Proteins 0.000 description 1
- 101000807961 Homo sapiens V-type proton ATPase subunit H Proteins 0.000 description 1
- 101000807820 Homo sapiens V-type proton ATPase subunit S1 Proteins 0.000 description 1
- 101000852150 Homo sapiens V-type proton ATPase subunit d 1 Proteins 0.000 description 1
- 101000749359 Homo sapiens V-type proton ATPase subunit e 1 Proteins 0.000 description 1
- 101001038317 Homo sapiens VIP36-like protein Proteins 0.000 description 1
- 101000667230 Homo sapiens VPS9 domain-containing protein 1 Proteins 0.000 description 1
- 101000803527 Homo sapiens Vacuolar ATPase assembly integral membrane protein VMA21 Proteins 0.000 description 1
- 101000777620 Homo sapiens Vacuolar fusion protein CCZ1 homolog Proteins 0.000 description 1
- 101000591906 Homo sapiens Vacuolar fusion protein MON1 homolog A Proteins 0.000 description 1
- 101000591909 Homo sapiens Vacuolar fusion protein MON1 homolog B Proteins 0.000 description 1
- 101000667092 Homo sapiens Vacuolar protein sorting-associated protein 13A Proteins 0.000 description 1
- 101000667110 Homo sapiens Vacuolar protein sorting-associated protein 13B Proteins 0.000 description 1
- 101000667104 Homo sapiens Vacuolar protein sorting-associated protein 13C Proteins 0.000 description 1
- 101000667116 Homo sapiens Vacuolar protein sorting-associated protein 13D Proteins 0.000 description 1
- 101000743587 Homo sapiens Vacuolar protein sorting-associated protein 26A Proteins 0.000 description 1
- 101000743596 Homo sapiens Vacuolar protein sorting-associated protein 26C Proteins 0.000 description 1
- 101000649937 Homo sapiens Vacuolar protein sorting-associated protein 28 homolog Proteins 0.000 description 1
- 101000649946 Homo sapiens Vacuolar protein sorting-associated protein 29 Proteins 0.000 description 1
- 101000771982 Homo sapiens Vacuolar protein sorting-associated protein 45 Proteins 0.000 description 1
- 101000803685 Homo sapiens Vacuolar protein sorting-associated protein 4A Proteins 0.000 description 1
- 101000955962 Homo sapiens Vacuolar protein sorting-associated protein 51 homolog Proteins 0.000 description 1
- 101000804736 Homo sapiens Vacuolar protein sorting-associated protein 54 Proteins 0.000 description 1
- 101000743430 Homo sapiens Vacuolar protein sorting-associated protein 8 homolog Proteins 0.000 description 1
- 101000621529 Homo sapiens Vacuolar protein-sorting-associated protein 36 Proteins 0.000 description 1
- 101000825841 Homo sapiens Vacuolar-sorting protein SNF8 Proteins 0.000 description 1
- 101000934581 Homo sapiens Valacyclovir hydrolase Proteins 0.000 description 1
- 101000787276 Homo sapiens Valine-tRNA ligase, mitochondrial Proteins 0.000 description 1
- 101000621540 Homo sapiens Vam6/Vps39-like protein Proteins 0.000 description 1
- 101000622427 Homo sapiens Vang-like protein 1 Proteins 0.000 description 1
- 101001070756 Homo sapiens Vasculin Proteins 0.000 description 1
- 101000806266 Homo sapiens Very-long-chain 3-oxoacyl-CoA reductase Proteins 0.000 description 1
- 101000904204 Homo sapiens Vesicle transport protein GOT1B Proteins 0.000 description 1
- 101000873111 Homo sapiens Vesicle transport protein SEC20 Proteins 0.000 description 1
- 101000766771 Homo sapiens Vesicle-associated membrane protein-associated protein A Proteins 0.000 description 1
- 101000775932 Homo sapiens Vesicle-associated membrane protein-associated protein B/C Proteins 0.000 description 1
- 101000654430 Homo sapiens Vesicle-trafficking protein SEC22a Proteins 0.000 description 1
- 101000631907 Homo sapiens Vesicle-trafficking protein SEC22b Proteins 0.000 description 1
- 101000631914 Homo sapiens Vesicle-trafficking protein SEC22c Proteins 0.000 description 1
- 101000767603 Homo sapiens Vezatin Proteins 0.000 description 1
- 101000805481 Homo sapiens Vigilin Proteins 0.000 description 1
- 101000622000 Homo sapiens Vinexin Proteins 0.000 description 1
- 101000742236 Homo sapiens Vitamin K-dependent gamma-carboxylase Proteins 0.000 description 1
- 101000850658 Homo sapiens Voltage-dependent anion-selective channel protein 3 Proteins 0.000 description 1
- 101000965721 Homo sapiens Volume-regulated anion channel subunit LRRC8A Proteins 0.000 description 1
- 101000954957 Homo sapiens WASH complex subunit 2C Proteins 0.000 description 1
- 101000743114 Homo sapiens WASH complex subunit 4 Proteins 0.000 description 1
- 101000743129 Homo sapiens WASH complex subunit 5 Proteins 0.000 description 1
- 101000803343 Homo sapiens WASP homolog-associated protein with actin, membranes and microtubules Proteins 0.000 description 1
- 101000621371 Homo sapiens WD and tetratricopeptide repeats protein 1 Proteins 0.000 description 1
- 101000771662 Homo sapiens WD repeat and FYVE domain-containing protein 3 Proteins 0.000 description 1
- 101000954798 Homo sapiens WD repeat domain phosphoinositide-interacting protein 2 Proteins 0.000 description 1
- 101000954820 Homo sapiens WD repeat domain phosphoinositide-interacting protein 4 Proteins 0.000 description 1
- 101000782040 Homo sapiens WD repeat domain-containing protein 83 Proteins 0.000 description 1
- 101000782180 Homo sapiens WD repeat-containing protein 1 Proteins 0.000 description 1
- 101000667291 Homo sapiens WD repeat-containing protein 13 Proteins 0.000 description 1
- 101000782147 Homo sapiens WD repeat-containing protein 20 Proteins 0.000 description 1
- 101000743163 Homo sapiens WD repeat-containing protein 25 Proteins 0.000 description 1
- 101000743172 Homo sapiens WD repeat-containing protein 26 Proteins 0.000 description 1
- 101000955093 Homo sapiens WD repeat-containing protein 3 Proteins 0.000 description 1
- 101000743195 Homo sapiens WD repeat-containing protein 35 Proteins 0.000 description 1
- 101000955107 Homo sapiens WD repeat-containing protein 37 Proteins 0.000 description 1
- 101000955101 Homo sapiens WD repeat-containing protein 43 Proteins 0.000 description 1
- 101000955100 Homo sapiens WD repeat-containing protein 44 Proteins 0.000 description 1
- 101000650009 Homo sapiens WD repeat-containing protein 46 Proteins 0.000 description 1
- 101000771599 Homo sapiens WD repeat-containing protein 5 Proteins 0.000 description 1
- 101000803751 Homo sapiens WD repeat-containing protein 55 Proteins 0.000 description 1
- 101000666074 Homo sapiens WD repeat-containing protein 7 Proteins 0.000 description 1
- 101000666077 Homo sapiens WD repeat-containing protein 81 Proteins 0.000 description 1
- 101000782051 Homo sapiens WD repeat-containing protein 89 Proteins 0.000 description 1
- 101000804817 Homo sapiens WD repeat-containing protein WRAP73 Proteins 0.000 description 1
- 101000650000 Homo sapiens WW domain binding protein 1-like Proteins 0.000 description 1
- 101000649993 Homo sapiens WW domain-binding protein 1 Proteins 0.000 description 1
- 101000650028 Homo sapiens WW domain-binding protein 11 Proteins 0.000 description 1
- 101000814304 Homo sapiens WW domain-binding protein 2 Proteins 0.000 description 1
- 101000814296 Homo sapiens WW domain-binding protein 4 Proteins 0.000 description 1
- 101000854951 Homo sapiens Wings apart-like protein homolog Proteins 0.000 description 1
- 101001104102 Homo sapiens X-linked retinitis pigmentosa GTPase regulator Proteins 0.000 description 1
- 101000666502 Homo sapiens Xaa-Pro aminopeptidase 1 Proteins 0.000 description 1
- 101000626697 Homo sapiens YEATS domain-containing protein 4 Proteins 0.000 description 1
- 101000744742 Homo sapiens YTH domain-containing family protein 1 Proteins 0.000 description 1
- 101000744745 Homo sapiens YTH domain-containing family protein 2 Proteins 0.000 description 1
- 101000976373 Homo sapiens YTH domain-containing protein 1 Proteins 0.000 description 1
- 101000791652 Homo sapiens YY1-associated factor 2 Proteins 0.000 description 1
- 101000759453 Homo sapiens YY1-associated protein 1 Proteins 0.000 description 1
- 101000976379 Homo sapiens ZZ-type zinc finger-containing protein 3 Proteins 0.000 description 1
- 101000786321 Homo sapiens Zinc finger BED domain-containing protein 4 Proteins 0.000 description 1
- 101000786335 Homo sapiens Zinc finger BED domain-containing protein 6 Proteins 0.000 description 1
- 101000916523 Homo sapiens Zinc finger C4H2 domain-containing protein Proteins 0.000 description 1
- 101000788845 Homo sapiens Zinc finger CCCH domain-containing protein 11A Proteins 0.000 description 1
- 101000782060 Homo sapiens Zinc finger CCCH domain-containing protein 13 Proteins 0.000 description 1
- 101000781948 Homo sapiens Zinc finger CCCH domain-containing protein 3 Proteins 0.000 description 1
- 101000781946 Homo sapiens Zinc finger CCCH domain-containing protein 4 Proteins 0.000 description 1
- 101000781866 Homo sapiens Zinc finger CCCH domain-containing protein 7A Proteins 0.000 description 1
- 101000781865 Homo sapiens Zinc finger CCCH domain-containing protein 7B Proteins 0.000 description 1
- 101000915511 Homo sapiens Zinc finger CCCH-type with G patch domain-containing protein Proteins 0.000 description 1
- 101000916510 Homo sapiens Zinc finger CCHC domain-containing protein 10 Proteins 0.000 description 1
- 101000723815 Homo sapiens Zinc finger CCHC domain-containing protein 14 Proteins 0.000 description 1
- 101000723811 Homo sapiens Zinc finger CCHC domain-containing protein 2 Proteins 0.000 description 1
- 101000788819 Homo sapiens Zinc finger CCHC domain-containing protein 9 Proteins 0.000 description 1
- 101000759188 Homo sapiens Zinc finger FYVE domain-containing protein 16 Proteins 0.000 description 1
- 101000785721 Homo sapiens Zinc finger FYVE domain-containing protein 26 Proteins 0.000 description 1
- 101000915578 Homo sapiens Zinc finger HIT domain-containing protein 3 Proteins 0.000 description 1
- 101000788669 Homo sapiens Zinc finger MYM-type protein 2 Proteins 0.000 description 1
- 101000788741 Homo sapiens Zinc finger MYM-type protein 4 Proteins 0.000 description 1
- 101000788744 Homo sapiens Zinc finger MYM-type protein 5 Proteins 0.000 description 1
- 101000788738 Homo sapiens Zinc finger MYM-type protein 6 Proteins 0.000 description 1
- 101000915470 Homo sapiens Zinc finger MYND domain-containing protein 11 Proteins 0.000 description 1
- 101000915738 Homo sapiens Zinc finger Ran-binding domain-containing protein 2 Proteins 0.000 description 1
- 101000802344 Homo sapiens Zinc finger SWIM domain-containing protein 7 Proteins 0.000 description 1
- 101000964855 Homo sapiens Zinc finger SWIM domain-containing protein 8 Proteins 0.000 description 1
- 101000784552 Homo sapiens Zinc finger X-linked protein ZXDA Proteins 0.000 description 1
- 101000784551 Homo sapiens Zinc finger X-linked protein ZXDB Proteins 0.000 description 1
- 101000976377 Homo sapiens Zinc finger ZZ-type and EF-hand domain-containing protein 1 Proteins 0.000 description 1
- 101000759565 Homo sapiens Zinc finger and BTB domain-containing protein 1 Proteins 0.000 description 1
- 101000964419 Homo sapiens Zinc finger and BTB domain-containing protein 10 Proteins 0.000 description 1
- 101000964417 Homo sapiens Zinc finger and BTB domain-containing protein 11 Proteins 0.000 description 1
- 101000964427 Homo sapiens Zinc finger and BTB domain-containing protein 14 Proteins 0.000 description 1
- 101000964478 Homo sapiens Zinc finger and BTB domain-containing protein 17 Proteins 0.000 description 1
- 101000964479 Homo sapiens Zinc finger and BTB domain-containing protein 18 Proteins 0.000 description 1
- 101000818575 Homo sapiens Zinc finger and BTB domain-containing protein 21 Proteins 0.000 description 1
- 101000818569 Homo sapiens Zinc finger and BTB domain-containing protein 24 Proteins 0.000 description 1
- 101000818563 Homo sapiens Zinc finger and BTB domain-containing protein 25 Proteins 0.000 description 1
- 101000916533 Homo sapiens Zinc finger and BTB domain-containing protein 39 Proteins 0.000 description 1
- 101000916530 Homo sapiens Zinc finger and BTB domain-containing protein 40 Proteins 0.000 description 1
- 101000916535 Homo sapiens Zinc finger and BTB domain-containing protein 44 Proteins 0.000 description 1
- 101000788769 Homo sapiens Zinc finger and BTB domain-containing protein 5 Proteins 0.000 description 1
- 101000788840 Homo sapiens Zinc finger and BTB domain-containing protein 6 Proteins 0.000 description 1
- 101000759547 Homo sapiens Zinc finger and BTB domain-containing protein 7A Proteins 0.000 description 1
- 101000784535 Homo sapiens Zinc finger and SCAN domain-containing protein 12 Proteins 0.000 description 1
- 101000785559 Homo sapiens Zinc finger and SCAN domain-containing protein 26 Proteins 0.000 description 1
- 101000785562 Homo sapiens Zinc finger and SCAN domain-containing protein 30 Proteins 0.000 description 1
- 101000785564 Homo sapiens Zinc finger and SCAN domain-containing protein 32 Proteins 0.000 description 1
- 101000785558 Homo sapiens Zinc finger and SCAN domain-containing protein 9 Proteins 0.000 description 1
- 101000744900 Homo sapiens Zinc finger homeobox protein 3 Proteins 0.000 description 1
- 101000915491 Homo sapiens Zinc finger matrin-type protein 5 Proteins 0.000 description 1
- 101000818737 Homo sapiens Zinc finger protein 12 Proteins 0.000 description 1
- 101000976576 Homo sapiens Zinc finger protein 121 Proteins 0.000 description 1
- 101000976574 Homo sapiens Zinc finger protein 131 Proteins 0.000 description 1
- 101000976580 Homo sapiens Zinc finger protein 133 Proteins 0.000 description 1
- 101000976581 Homo sapiens Zinc finger protein 134 Proteins 0.000 description 1
- 101000759241 Homo sapiens Zinc finger protein 138 Proteins 0.000 description 1
- 101000759233 Homo sapiens Zinc finger protein 140 Proteins 0.000 description 1
- 101000759236 Homo sapiens Zinc finger protein 142 Proteins 0.000 description 1
- 101000759226 Homo sapiens Zinc finger protein 143 Proteins 0.000 description 1
- 101000964611 Homo sapiens Zinc finger protein 155 Proteins 0.000 description 1
- 101000818759 Homo sapiens Zinc finger protein 16 Proteins 0.000 description 1
- 101000964584 Homo sapiens Zinc finger protein 160 Proteins 0.000 description 1
- 101000818752 Homo sapiens Zinc finger protein 17 Proteins 0.000 description 1
- 101000964587 Homo sapiens Zinc finger protein 174 Proteins 0.000 description 1
- 101000964590 Homo sapiens Zinc finger protein 175 Proteins 0.000 description 1
- 101000964592 Homo sapiens Zinc finger protein 181 Proteins 0.000 description 1
- 101000964678 Homo sapiens Zinc finger protein 182 Proteins 0.000 description 1
- 101000744887 Homo sapiens Zinc finger protein 189 Proteins 0.000 description 1
- 101000744886 Homo sapiens Zinc finger protein 195 Proteins 0.000 description 1
- 101000744885 Homo sapiens Zinc finger protein 197 Proteins 0.000 description 1
- 101000760288 Homo sapiens Zinc finger protein 2 Proteins 0.000 description 1
- 101000744935 Homo sapiens Zinc finger protein 202 Proteins 0.000 description 1
- 101000744929 Homo sapiens Zinc finger protein 205 Proteins 0.000 description 1
- 101000744930 Homo sapiens Zinc finger protein 212 Proteins 0.000 description 1
- 101000723746 Homo sapiens Zinc finger protein 22 Proteins 0.000 description 1
- 101000782145 Homo sapiens Zinc finger protein 226 Proteins 0.000 description 1
- 101000782169 Homo sapiens Zinc finger protein 232 Proteins 0.000 description 1
- 101000782166 Homo sapiens Zinc finger protein 235 Proteins 0.000 description 1
- 101000818690 Homo sapiens Zinc finger protein 236 Proteins 0.000 description 1
- 101000723740 Homo sapiens Zinc finger protein 24 Proteins 0.000 description 1
- 101000818795 Homo sapiens Zinc finger protein 250 Proteins 0.000 description 1
- 101000818817 Homo sapiens Zinc finger protein 263 Proteins 0.000 description 1
- 101000723761 Homo sapiens Zinc finger protein 28 Proteins 0.000 description 1
- 101000964390 Homo sapiens Zinc finger protein 280D Proteins 0.000 description 1
- 101000785710 Homo sapiens Zinc finger protein 281 Proteins 0.000 description 1
- 101000785712 Homo sapiens Zinc finger protein 282 Proteins 0.000 description 1
- 101000723902 Homo sapiens Zinc finger protein 292 Proteins 0.000 description 1
- 101000760174 Homo sapiens Zinc finger protein 3 Proteins 0.000 description 1
- 101000760285 Homo sapiens Zinc finger protein 30 Proteins 0.000 description 1
- 101000915529 Homo sapiens Zinc finger protein 30 homolog Proteins 0.000 description 1
- 101000723907 Homo sapiens Zinc finger protein 302 Proteins 0.000 description 1
- 101000723912 Homo sapiens Zinc finger protein 317 Proteins 0.000 description 1
- 101000723913 Homo sapiens Zinc finger protein 318 Proteins 0.000 description 1
- 101000760284 Homo sapiens Zinc finger protein 32 Proteins 0.000 description 1
- 101000723710 Homo sapiens Zinc finger protein 322 Proteins 0.000 description 1
- 101000964394 Homo sapiens Zinc finger protein 324A Proteins 0.000 description 1
- 101000915655 Homo sapiens Zinc finger protein 330 Proteins 0.000 description 1
- 101000760224 Homo sapiens Zinc finger protein 337 Proteins 0.000 description 1
- 101000760214 Homo sapiens Zinc finger protein 33A Proteins 0.000 description 1
- 101000760212 Homo sapiens Zinc finger protein 33B Proteins 0.000 description 1
- 101000760248 Homo sapiens Zinc finger protein 346 Proteins 0.000 description 1
- 101000788750 Homo sapiens Zinc finger protein 347 Proteins 0.000 description 1
- 101000760175 Homo sapiens Zinc finger protein 35 Proteins 0.000 description 1
- 101000964392 Homo sapiens Zinc finger protein 354A Proteins 0.000 description 1
- 101000788735 Homo sapiens Zinc finger protein 37A Proteins 0.000 description 1
- 101000964718 Homo sapiens Zinc finger protein 384 Proteins 0.000 description 1
- 101000964701 Homo sapiens Zinc finger protein 407 Proteins 0.000 description 1
- 101000976608 Homo sapiens Zinc finger protein 408 Proteins 0.000 description 1
- 101000760181 Homo sapiens Zinc finger protein 41 Proteins 0.000 description 1
- 101000976610 Homo sapiens Zinc finger protein 410 Proteins 0.000 description 1
- 101000976617 Homo sapiens Zinc finger protein 414 Proteins 0.000 description 1
- 101000976614 Homo sapiens Zinc finger protein 416 Proteins 0.000 description 1
- 101000976598 Homo sapiens Zinc finger protein 419 Proteins 0.000 description 1
- 101000818829 Homo sapiens Zinc finger protein 429 Proteins 0.000 description 1
- 101000818823 Homo sapiens Zinc finger protein 438 Proteins 0.000 description 1
- 101000782464 Homo sapiens Zinc finger protein 444 Proteins 0.000 description 1
- 101000782461 Homo sapiens Zinc finger protein 446 Proteins 0.000 description 1
- 101000760182 Homo sapiens Zinc finger protein 45 Proteins 0.000 description 1
- 101000782485 Homo sapiens Zinc finger protein 460 Proteins 0.000 description 1
- 101000760177 Homo sapiens Zinc finger protein 48 Proteins 0.000 description 1
- 101000915629 Homo sapiens Zinc finger protein 484 Proteins 0.000 description 1
- 101000744924 Homo sapiens Zinc finger protein 506 Proteins 0.000 description 1
- 101000744923 Homo sapiens Zinc finger protein 507 Proteins 0.000 description 1
- 101000743804 Homo sapiens Zinc finger protein 510 Proteins 0.000 description 1
- 101000785684 Homo sapiens Zinc finger protein 513 Proteins 0.000 description 1
- 101000781876 Homo sapiens Zinc finger protein 518A Proteins 0.000 description 1
- 101000802319 Homo sapiens Zinc finger protein 554 Proteins 0.000 description 1
- 101000802318 Homo sapiens Zinc finger protein 555 Proteins 0.000 description 1
- 101000802332 Homo sapiens Zinc finger protein 557 Proteins 0.000 description 1
- 101000964705 Homo sapiens Zinc finger protein 562 Proteins 0.000 description 1
- 101000964702 Homo sapiens Zinc finger protein 565 Proteins 0.000 description 1
- 101000964699 Homo sapiens Zinc finger protein 566 Proteins 0.000 description 1
- 101000760255 Homo sapiens Zinc finger protein 576 Proteins 0.000 description 1
- 101000760252 Homo sapiens Zinc finger protein 580 Proteins 0.000 description 1
- 101000976376 Homo sapiens Zinc finger protein 587 Proteins 0.000 description 1
- 101000976452 Homo sapiens Zinc finger protein 592 Proteins 0.000 description 1
- 101000976443 Homo sapiens Zinc finger protein 593 Proteins 0.000 description 1
- 101000818836 Homo sapiens Zinc finger protein 609 Proteins 0.000 description 1
- 101000818719 Homo sapiens Zinc finger protein 613 Proteins 0.000 description 1
- 101000818738 Homo sapiens Zinc finger protein 619 Proteins 0.000 description 1
- 101000782280 Homo sapiens Zinc finger protein 620 Proteins 0.000 description 1
- 101000782283 Homo sapiens Zinc finger protein 623 Proteins 0.000 description 1
- 101000782287 Homo sapiens Zinc finger protein 629 Proteins 0.000 description 1
- 101000782295 Homo sapiens Zinc finger protein 630 Proteins 0.000 description 1
- 101000782294 Homo sapiens Zinc finger protein 638 Proteins 0.000 description 1
- 101000785694 Homo sapiens Zinc finger protein 639 Proteins 0.000 description 1
- 101000785598 Homo sapiens Zinc finger protein 641 Proteins 0.000 description 1
- 101000785600 Homo sapiens Zinc finger protein 644 Proteins 0.000 description 1
- 101000785613 Homo sapiens Zinc finger protein 652 Proteins 0.000 description 1
- 101000785609 Homo sapiens Zinc finger protein 655 Proteins 0.000 description 1
- 101000915623 Homo sapiens Zinc finger protein 664 Proteins 0.000 description 1
- 101000915614 Homo sapiens Zinc finger protein 668 Proteins 0.000 description 1
- 101000915609 Homo sapiens Zinc finger protein 669 Proteins 0.000 description 1
- 101000915610 Homo sapiens Zinc finger protein 670 Proteins 0.000 description 1
- 101000743803 Homo sapiens Zinc finger protein 674 Proteins 0.000 description 1
- 101000743805 Homo sapiens Zinc finger protein 680 Proteins 0.000 description 1
- 101000743822 Homo sapiens Zinc finger protein 688 Proteins 0.000 description 1
- 101000964746 Homo sapiens Zinc finger protein 69 Proteins 0.000 description 1
- 101000723609 Homo sapiens Zinc finger protein 691 Proteins 0.000 description 1
- 101000723645 Homo sapiens Zinc finger protein 697 Proteins 0.000 description 1
- 101000964736 Homo sapiens Zinc finger protein 7 Proteins 0.000 description 1
- 101000723630 Homo sapiens Zinc finger protein 700 Proteins 0.000 description 1
- 101000964750 Homo sapiens Zinc finger protein 706 Proteins 0.000 description 1
- 101000760278 Homo sapiens Zinc finger protein 740 Proteins 0.000 description 1
- 101000760275 Homo sapiens Zinc finger protein 746 Proteins 0.000 description 1
- 101000802403 Homo sapiens Zinc finger protein 75D Proteins 0.000 description 1
- 101000964726 Homo sapiens Zinc finger protein 76 Proteins 0.000 description 1
- 101000802395 Homo sapiens Zinc finger protein 764 Proteins 0.000 description 1
- 101000802397 Homo sapiens Zinc finger protein 766 Proteins 0.000 description 1
- 101000802413 Homo sapiens Zinc finger protein 770 Proteins 0.000 description 1
- 101000915596 Homo sapiens Zinc finger protein 777 Proteins 0.000 description 1
- 101000915597 Homo sapiens Zinc finger protein 778 Proteins 0.000 description 1
- 101000915604 Homo sapiens Zinc finger protein 782 Proteins 0.000 description 1
- 101000915587 Homo sapiens Zinc finger protein 787 Proteins 0.000 description 1
- 101000976465 Homo sapiens Zinc finger protein 790 Proteins 0.000 description 1
- 101000976457 Homo sapiens Zinc finger protein 805 Proteins 0.000 description 1
- 101000976458 Homo sapiens Zinc finger protein 808 Proteins 0.000 description 1
- 101000976415 Homo sapiens Zinc finger protein 814 Proteins 0.000 description 1
- 101000782302 Homo sapiens Zinc finger protein 823 Proteins 0.000 description 1
- 101000782317 Homo sapiens Zinc finger protein 839 Proteins 0.000 description 1
- 101000964795 Homo sapiens Zinc finger protein 84 Proteins 0.000 description 1
- 101000785582 Homo sapiens Zinc finger protein 862 Proteins 0.000 description 1
- 101000785583 Homo sapiens Zinc finger protein 865 Proteins 0.000 description 1
- 101000743781 Homo sapiens Zinc finger protein 91 Proteins 0.000 description 1
- 101000833157 Homo sapiens Zinc finger protein AEBP2 Proteins 0.000 description 1
- 101000721407 Homo sapiens Zinc finger protein OZF Proteins 0.000 description 1
- 101001002579 Homo sapiens Zinc finger protein Pegasus Proteins 0.000 description 1
- 101000634977 Homo sapiens Zinc finger protein RFP Proteins 0.000 description 1
- 101000782089 Homo sapiens Zinc finger protein ZFAT Proteins 0.000 description 1
- 101000915742 Homo sapiens Zinc finger protein ZPR1 Proteins 0.000 description 1
- 101000784571 Homo sapiens Zinc finger protein ZXDC Proteins 0.000 description 1
- 101000708874 Homo sapiens Zinc finger protein ubi-d4 Proteins 0.000 description 1
- 101000785641 Homo sapiens Zinc finger protein with KRAB and SCAN domains 1 Proteins 0.000 description 1
- 101000785655 Homo sapiens Zinc finger protein with KRAB and SCAN domains 3 Proteins 0.000 description 1
- 101000723953 Homo sapiens Zinc finger protein with KRAB and SCAN domains 5 Proteins 0.000 description 1
- 101000723957 Homo sapiens Zinc finger protein with KRAB and SCAN domains 8 Proteins 0.000 description 1
- 101000788690 Homo sapiens Zinc fingers and homeoboxes protein 1 Proteins 0.000 description 1
- 101000788664 Homo sapiens Zinc fingers and homeoboxes protein 2 Proteins 0.000 description 1
- 101000788658 Homo sapiens Zinc fingers and homeoboxes protein 3 Proteins 0.000 description 1
- 101000669028 Homo sapiens Zinc phosphodiesterase ELAC protein 2 Proteins 0.000 description 1
- 101000739853 Homo sapiens [3-methyl-2-oxobutanoate dehydrogenase [lipoamide]] kinase, mitochondrial Proteins 0.000 description 1
- 101000991054 Homo sapiens [F-actin]-monooxygenase MICAL3 Proteins 0.000 description 1
- 101001117143 Homo sapiens [Pyruvate dehydrogenase (acetyl-transferring)] kinase isozyme 2, mitochondrial Proteins 0.000 description 1
- 101000994496 Homo sapiens cAMP-dependent protein kinase catalytic subunit alpha Proteins 0.000 description 1
- 101001026573 Homo sapiens cAMP-dependent protein kinase type I-alpha regulatory subunit Proteins 0.000 description 1
- 101000614798 Homo sapiens cAMP-dependent protein kinase type II-alpha regulatory subunit Proteins 0.000 description 1
- 101000859416 Homo sapiens cAMP-responsive element-binding protein-like 2 Proteins 0.000 description 1
- 101000655533 Homo sapiens dTDP-D-glucose 4,6-dehydratase Proteins 0.000 description 1
- 101000926525 Homo sapiens eIF-2-alpha kinase GCN2 Proteins 0.000 description 1
- 101000802734 Homo sapiens eIF5-mimic protein 2 Proteins 0.000 description 1
- 101000871498 Homo sapiens m7GpppX diphosphatase Proteins 0.000 description 1
- 101001039684 Homo sapiens mRNA cap guanine-N7 methyltransferase Proteins 0.000 description 1
- 101000802094 Homo sapiens mRNA decay activator protein ZFP36L1 Proteins 0.000 description 1
- 101001039228 Homo sapiens mRNA export factor GLE1 Proteins 0.000 description 1
- 101000963221 Homo sapiens mRNA guanylyltransferase Proteins 0.000 description 1
- 101000730577 Homo sapiens p21-activated protein kinase-interacting protein 1 Proteins 0.000 description 1
- 101000743197 Homo sapiens pre-mRNA 3' end processing protein WDR33 Proteins 0.000 description 1
- 101000868892 Homo sapiens pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Proteins 0.000 description 1
- 101001012529 Homo sapiens rRNA N6-adenosine-methyltransferase METTL5 Proteins 0.000 description 1
- 101000625241 Homo sapiens rRNA methyltransferase 2, mitochondrial Proteins 0.000 description 1
- 101000687642 Homo sapiens snRNA-activating protein complex subunit 1 Proteins 0.000 description 1
- 101000825856 Homo sapiens snRNA-activating protein complex subunit 3 Proteins 0.000 description 1
- 101000825848 Homo sapiens snRNA-activating protein complex subunit 4 Proteins 0.000 description 1
- 101000824944 Homo sapiens snRNA-activating protein complex subunit 5 Proteins 0.000 description 1
- 101000680450 Homo sapiens tRNA (adenine(37)-N6)-methyltransferase Proteins 0.000 description 1
- 101000797207 Homo sapiens tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6 Proteins 0.000 description 1
- 101000662861 Homo sapiens tRNA (adenine(58)-N(1))-methyltransferase, mitochondrial Proteins 0.000 description 1
- 101000766249 Homo sapiens tRNA (guanine(10)-N2)-methyltransferase homolog Proteins 0.000 description 1
- 101000848450 Homo sapiens tRNA (guanine(26)-N(2))-dimethyltransferase Proteins 0.000 description 1
- 101000814246 Homo sapiens tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit WDR4 Proteins 0.000 description 1
- 101000795260 Homo sapiens tRNA (uracil(54)-C(5))-methyltransferase homolog Proteins 0.000 description 1
- 101000680608 Homo sapiens tRNA (uracil-5-)-methyltransferase homolog A Proteins 0.000 description 1
- 101000772567 Homo sapiens tRNA 2'-phosphotransferase 1 Proteins 0.000 description 1
- 101000645380 Homo sapiens tRNA methyltransferase 10 homolog C Proteins 0.000 description 1
- 101000828889 Homo sapiens tRNA modification GTPase GTPBP3, mitochondrial Proteins 0.000 description 1
- 101001064674 Homo sapiens tRNA pseudouridine(38/39) synthase Proteins 0.000 description 1
- 101000844909 Homo sapiens tRNA selenocysteine 1-associated protein 1 Proteins 0.000 description 1
- 101000644602 Homo sapiens tRNA wybutosine-synthesizing protein 3 homolog Proteins 0.000 description 1
- 101000940142 Homo sapiens tRNA wybutosine-synthesizing protein 5 Proteins 0.000 description 1
- 101000865875 Homo sapiens tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like Proteins 0.000 description 1
- 101000799160 Homo sapiens tRNA-specific adenosine deaminase 1 Proteins 0.000 description 1
- 101000873442 Homo sapiens tRNA-splicing endonuclease subunit Sen15 Proteins 0.000 description 1
- 101000615747 Homo sapiens tRNA-splicing endonuclease subunit Sen2 Proteins 0.000 description 1
- 101000615763 Homo sapiens tRNA-splicing endonuclease subunit Sen34 Proteins 0.000 description 1
- 101000923892 Homo sapiens tRNA-uridine aminocarboxypropyltransferase 1 Proteins 0.000 description 1
- 101000667264 Homo sapiens von Willebrand factor A domain-containing protein 8 Proteins 0.000 description 1
- 102100039923 Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 1 protein Human genes 0.000 description 1
- 102100037898 Homologous-pairing protein 2 homolog Human genes 0.000 description 1
- 108010027310 Host Cell Factor C1 Proteins 0.000 description 1
- 102100030355 Host cell factor 1 Human genes 0.000 description 1
- 102100029105 Host cell factor C1 regulator 1 Human genes 0.000 description 1
- 102100031716 Hsp70-binding protein 1 Human genes 0.000 description 1
- 102100031568 Hsp90 co-chaperone Cdc37 Human genes 0.000 description 1
- 102100031587 Hsp90 co-chaperone Cdc37-like 1 Human genes 0.000 description 1
- 101150069138 HtrA2 gene Proteins 0.000 description 1
- 102100035957 Huntingtin-interacting protein 1 Human genes 0.000 description 1
- 102100039255 Huntingtin-interacting protein K Human genes 0.000 description 1
- 102100040544 Hydroxyacylglutathione hydrolase, mitochondrial Human genes 0.000 description 1
- 102100021101 Hydroxylysine kinase Human genes 0.000 description 1
- 102100024004 Hydroxymethylglutaryl-CoA lyase, mitochondrial Human genes 0.000 description 1
- 102100036501 Hydroxysteroid 11-beta-dehydrogenase 1-like protein Human genes 0.000 description 1
- 102100021656 Hydroxysteroid dehydrogenase-like protein 2 Human genes 0.000 description 1
- 102100030481 Hypoxia-inducible factor 1-alpha inhibitor Human genes 0.000 description 1
- 108060006678 I-kappa-B kinase Proteins 0.000 description 1
- 102000001284 I-kappa-B kinase Human genes 0.000 description 1
- 102100025958 IGF-like family receptor 1 Human genes 0.000 description 1
- 101150091468 IGSF8 gene Proteins 0.000 description 1
- 108010007666 IMP cyclohydrolase Proteins 0.000 description 1
- 102100029842 IQ calmodulin-binding motif-containing protein 1 Human genes 0.000 description 1
- 102100025097 IQ motif and SEC7 domain-containing protein 1 Human genes 0.000 description 1
- 102100023423 IST1 homolog Human genes 0.000 description 1
- 102100031531 Immediate early response 3-interacting protein 1 Human genes 0.000 description 1
- 102100038062 Immunity-related GTPase family Q protein Human genes 0.000 description 1
- 102100036489 Immunoglobulin superfamily member 8 Human genes 0.000 description 1
- 102100036188 Importin subunit alpha-3 Human genes 0.000 description 1
- 102100036187 Importin subunit alpha-4 Human genes 0.000 description 1
- 102100027002 Importin subunit alpha-7 Human genes 0.000 description 1
- 102100028867 Inactive C-alpha-formylglycine-generating enzyme 2 Human genes 0.000 description 1
- 102100021647 Inactive hydroxysteroid dehydrogenase-like protein 1 Human genes 0.000 description 1
- 102100028288 Inactive serine/threonine-protein kinase VRK3 Human genes 0.000 description 1
- 102100026539 Induced myeloid leukemia cell differentiation protein Mcl-1 Human genes 0.000 description 1
- 102100027638 Inhibitor of Bruton tyrosine kinase Human genes 0.000 description 1
- 108090000191 Inhibitor of growth protein 1 Proteins 0.000 description 1
- 102000003781 Inhibitor of growth protein 1 Human genes 0.000 description 1
- 102100024067 Inhibitor of growth protein 2 Human genes 0.000 description 1
- 102100035677 Inhibitor of growth protein 4 Human genes 0.000 description 1
- 102100021892 Inhibitor of nuclear factor kappa-B kinase subunit alpha Human genes 0.000 description 1
- 102100039872 Inner centromere protein Human genes 0.000 description 1
- 102100028799 Inner nuclear membrane protein Man1 Human genes 0.000 description 1
- 102100034415 Inorganic pyrophosphatase 2, mitochondrial Human genes 0.000 description 1
- 102100020796 Inosine 5'-monophosphate cyclohydrolase Human genes 0.000 description 1
- 102100025458 Inosine triphosphate pyrophosphatase Human genes 0.000 description 1
- 102100025891 Inosine-5'-monophosphate dehydrogenase 2 Human genes 0.000 description 1
- 102100024037 Inositol 1,4,5-trisphosphate receptor type 2 Human genes 0.000 description 1
- 102100039741 Inositol 1,4,5-trisphosphate receptor-interacting protein-like 2 Human genes 0.000 description 1
- 102100037739 Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Human genes 0.000 description 1
- 102100037736 Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 2 Human genes 0.000 description 1
- 102100030213 Inositol hexakisphosphate kinase 1 Human genes 0.000 description 1
- 102100030212 Inositol hexakisphosphate kinase 2 Human genes 0.000 description 1
- 101710133957 Inositol polyphosphate 1-phosphatase Proteins 0.000 description 1
- 102100024368 Inositol polyphosphate 5-phosphatase K Human genes 0.000 description 1
- 102100039253 Inositol polyphosphate-5-phosphatase A Human genes 0.000 description 1
- 102100022296 Inositol-tetrakisphosphate 1-kinase Human genes 0.000 description 1
- 102100036721 Insulin receptor Human genes 0.000 description 1
- 102100037970 Insulin-induced gene 2 protein Human genes 0.000 description 1
- 102100022214 Insulin-like growth factor-binding protein 3 receptor Human genes 0.000 description 1
- 102100020700 Integral membrane protein DGCR2/IDD Human genes 0.000 description 1
- 102100035568 Integral membrane protein GPR137 Human genes 0.000 description 1
- 102100041017 Integral membrane protein GPR155 Human genes 0.000 description 1
- 102100024061 Integrator complex subunit 1 Human genes 0.000 description 1
- 102100024370 Integrator complex subunit 11 Human genes 0.000 description 1
- 102100037944 Integrator complex subunit 12 Human genes 0.000 description 1
- 102100027018 Integrator complex subunit 14 Human genes 0.000 description 1
- 102100039133 Integrator complex subunit 6 Human genes 0.000 description 1
- 102100030147 Integrator complex subunit 7 Human genes 0.000 description 1
- 102100030148 Integrator complex subunit 8 Human genes 0.000 description 1
- 102100030206 Integrator complex subunit 9 Human genes 0.000 description 1
- 102100022341 Integrin alpha-E Human genes 0.000 description 1
- 102100022337 Integrin alpha-V Human genes 0.000 description 1
- 102100025304 Integrin beta-1 Human genes 0.000 description 1
- 102100033335 Integrin beta-1-binding protein 1 Human genes 0.000 description 1
- 102100036714 Interferon alpha/beta receptor 1 Human genes 0.000 description 1
- 102100035678 Interferon gamma receptor 1 Human genes 0.000 description 1
- 102100036157 Interferon gamma receptor 2 Human genes 0.000 description 1
- 102100029838 Interferon regulatory factor 2 Human genes 0.000 description 1
- 102100025355 Interferon regulatory factor 2-binding protein 1 Human genes 0.000 description 1
- 102100025356 Interferon regulatory factor 2-binding protein 2 Human genes 0.000 description 1
- 102100029843 Interferon regulatory factor 3 Human genes 0.000 description 1
- 102100038251 Interferon regulatory factor 9 Human genes 0.000 description 1
- 102100033273 Interferon-induced 35 kDa protein Human genes 0.000 description 1
- 102100029408 Interferon-inducible double-stranded RNA-dependent protein kinase activator A Human genes 0.000 description 1
- 102100036527 Interferon-related developmental regulator 1 Human genes 0.000 description 1
- 102100036480 Interferon-related developmental regulator 2 Human genes 0.000 description 1
- 102100039060 Interleukin enhancer-binding factor 2 Human genes 0.000 description 1
- 102100036342 Interleukin-1 receptor-associated kinase 1 Human genes 0.000 description 1
- 102100023533 Interleukin-1 receptor-associated kinase 4 Human genes 0.000 description 1
- 102100020787 Interleukin-11 receptor subunit alpha Human genes 0.000 description 1
- 102100020791 Interleukin-13 receptor subunit alpha-1 Human genes 0.000 description 1
- 102100035012 Interleukin-17 receptor C Human genes 0.000 description 1
- 102100037795 Interleukin-6 receptor subunit beta Human genes 0.000 description 1
- 102100025494 Intersectin-1 Human genes 0.000 description 1
- 102100025505 Intersectin-2 Human genes 0.000 description 1
- 102100026220 Intraflagellar transport protein 20 homolog Human genes 0.000 description 1
- 102100039343 Intraflagellar transport protein 27 homolog Human genes 0.000 description 1
- 101710119233 Intraflagellar transport protein 27 homolog Proteins 0.000 description 1
- 102100039342 Intraflagellar transport protein 43 homolog Human genes 0.000 description 1
- 102100022489 Intraflagellar transport protein 46 homolog Human genes 0.000 description 1
- 102100030498 Intron Large complex component GCFC2 Human genes 0.000 description 1
- 102100033257 Inversin Human genes 0.000 description 1
- 102100030075 Inverted formin-2 Human genes 0.000 description 1
- 101150069749 Ipo9 gene Proteins 0.000 description 1
- 108090001028 Iron regulatory protein 2 Proteins 0.000 description 1
- 102000004902 Iron regulatory protein 2 Human genes 0.000 description 1
- 102100038096 Iron-sulfur cluster assembly enzyme ISCU, mitochondrial Human genes 0.000 description 1
- 102100021504 Iron-sulfur clusters transporter ABCB7, mitochondrial Human genes 0.000 description 1
- 102100021646 Isobutyryl-CoA dehydrogenase, mitochondrial Human genes 0.000 description 1
- 102100031386 Isochorismatase domain-containing protein 1 Human genes 0.000 description 1
- 102100031385 Isochorismatase domain-containing protein 2 Human genes 0.000 description 1
- 102100021332 Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial Human genes 0.000 description 1
- 102100021311 Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Human genes 0.000 description 1
- 102100039906 Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial Human genes 0.000 description 1
- 102100027665 Isopentenyl-diphosphate Delta-isomerase 1 Human genes 0.000 description 1
- 108060001621 Isoprenylcysteine carboxyl methyltransferase Proteins 0.000 description 1
- 102100025837 JNK1/MAPK8-associated membrane protein Human genes 0.000 description 1
- 101710176060 JNK1/MAPK8-associated membrane protein Proteins 0.000 description 1
- 102100023958 JmjC domain-containing protein 8 Human genes 0.000 description 1
- 102100032732 Josephin-1 Human genes 0.000 description 1
- 102100032731 Josephin-2 Human genes 0.000 description 1
- 102100022902 KAT8 regulatory NSL complex subunit 2 Human genes 0.000 description 1
- 102100037489 KAT8 regulatory NSL complex subunit 3 Human genes 0.000 description 1
- 102100023408 KH domain-containing, RNA-binding, signal transduction-associated protein 1 Human genes 0.000 description 1
- 102100021449 KH homology domain-containing protein 4 Human genes 0.000 description 1
- 101710015718 KIAA0100 Proteins 0.000 description 1
- 101710015514 KIAA0232 Proteins 0.000 description 1
- 101710036322 KIAA0586 Proteins 0.000 description 1
- 101710043141 KIAA0930 Proteins 0.000 description 1
- 101710024993 KIAA1109 Proteins 0.000 description 1
- 101710059984 KIAA1191 Proteins 0.000 description 1
- 101710058882 KIAA1671 Proteins 0.000 description 1
- 102100026895 KICSTOR complex protein SZT2 Human genes 0.000 description 1
- 102100024883 KICSTOR complex protein kaptin Human genes 0.000 description 1
- 102100037326 KRAB domain-containing protein 4 Human genes 0.000 description 1
- 102100037323 KRAB domain-containing protein 5 Human genes 0.000 description 1
- 108700042464 KRIT1 Proteins 0.000 description 1
- 101150090242 KRIT1 gene Proteins 0.000 description 1
- 102100023093 Kalirin Human genes 0.000 description 1
- 102100025636 Katanin-interacting protein Human genes 0.000 description 1
- 102100033609 Kelch domain-containing protein 2 Human genes 0.000 description 1
- 102100033603 Kelch domain-containing protein 4 Human genes 0.000 description 1
- 102100034075 Kelch repeat and BTB domain-containing protein 2 Human genes 0.000 description 1
- 102100022838 Kelch repeat and BTB domain-containing protein 4 Human genes 0.000 description 1
- 108090000484 Kelch-Like ECH-Associated Protein 1 Proteins 0.000 description 1
- 102000004034 Kelch-Like ECH-Associated Protein 1 Human genes 0.000 description 1
- 102100023681 Kelch-like protein 20 Human genes 0.000 description 1
- 102100027794 Kelch-like protein 24 Human genes 0.000 description 1
- 102100033556 Kelch-like protein 28 Human genes 0.000 description 1
- 102100027785 Kelch-like protein 5 Human genes 0.000 description 1
- 102100023970 Keratin, type I cytoskeletal 10 Human genes 0.000 description 1
- 102100034751 Kinectin Human genes 0.000 description 1
- 102100027930 Kinesin-associated protein 3 Human genes 0.000 description 1
- 102100034865 Kinesin-like protein KIF13A Human genes 0.000 description 1
- 102100034863 Kinesin-like protein KIF13B Human genes 0.000 description 1
- 108050007394 Kinesin-like protein KIF20B Proteins 0.000 description 1
- 102100020693 Kinesin-like protein KIF3B Human genes 0.000 description 1
- 102100024062 Kinetochore-associated protein DSN1 homolog Human genes 0.000 description 1
- 102100035878 Krev interaction trapped protein 1 Human genes 0.000 description 1
- 102100027798 Krueppel-like factor 10 Human genes 0.000 description 1
- 102100027797 Krueppel-like factor 11 Human genes 0.000 description 1
- 102100020678 Krueppel-like factor 3 Human genes 0.000 description 1
- 102100020684 Krueppel-like factor 9 Human genes 0.000 description 1
- 102000015335 Ku Autoantigen Human genes 0.000 description 1
- 108010025026 Ku Autoantigen Proteins 0.000 description 1
- 102100036075 KxDL motif-containing protein 1 Human genes 0.000 description 1
- 102100021209 Kynurenine-oxoglutarate transaminase 1 Human genes 0.000 description 1
- 102100022892 Kynurenine-oxoglutarate transaminase 3 Human genes 0.000 description 1
- 102100026384 L-aminoadipate-semialdehyde dehydrogenase-phosphopantetheinyl transferase Human genes 0.000 description 1
- 102100034671 L-lactate dehydrogenase A chain Human genes 0.000 description 1
- 239000002136 L01XE07 - Lapatinib Substances 0.000 description 1
- 239000002118 L01XE12 - Vandetanib Substances 0.000 description 1
- 102100028291 LEM domain-containing protein 2 Human genes 0.000 description 1
- 102100038448 LETM1 domain-containing protein 1 Human genes 0.000 description 1
- PWOLHTNHGNWQMH-UHFFFAOYSA-N LGPVTQE Natural products CC(C)CC(N)C(=O)NCC(=O)N1CCCC1C(=O)NC(C(C)C)C(=O)NC(C(C)O)C(=O)NC(CCC(N)=O)C(=O)NC(CCC(O)=O)C(O)=O PWOLHTNHGNWQMH-UHFFFAOYSA-N 0.000 description 1
- 102100025687 LHFPL tetraspan subfamily member 2 protein Human genes 0.000 description 1
- 102100021754 LIM and senescent cell antigen-like-containing domain protein 1 Human genes 0.000 description 1
- 102000016443 LTN1 Human genes 0.000 description 1
- 102100025154 LYR motif-containing protein 4 Human genes 0.000 description 1
- 102100020859 La-related protein 1 Human genes 0.000 description 1
- 102100020861 La-related protein 4 Human genes 0.000 description 1
- 102100030946 La-related protein 4B Human genes 0.000 description 1
- 102100027436 La-related protein 7 Human genes 0.000 description 1
- 102100023981 Lamina-associated polypeptide 2, isoform alpha Human genes 0.000 description 1
- 102100021695 Lanosterol 14-alpha demethylase Human genes 0.000 description 1
- 102100028047 Large proline-rich protein BAG6 Human genes 0.000 description 1
- 102100021155 Lariat debranching enzyme Human genes 0.000 description 1
- 102100032642 Late secretory pathway protein AVL9 homolog Human genes 0.000 description 1
- 101000740049 Latilactobacillus curvatus Bioactive peptide 1 Proteins 0.000 description 1
- 102100029825 Leptin receptor gene-related protein Human genes 0.000 description 1
- 102100040548 Lethal(3)malignant brain tumor-like protein 3 Human genes 0.000 description 1
- 102100021737 Leucine carboxyl methyltransferase 1 Human genes 0.000 description 1
- 102100032097 Leucine repeat adapter protein 25 Human genes 0.000 description 1
- 102100026913 Leucine zipper protein 6 Human genes 0.000 description 1
- 102100032694 Leucine-rich repeat flightless-interacting protein 2 Human genes 0.000 description 1
- 102100031956 Leucine-rich repeat protein SHOC-2 Human genes 0.000 description 1
- 102100033287 Leucine-rich repeat-containing protein 14 Human genes 0.000 description 1
- 102100040694 Leucine-rich repeat-containing protein 24 Human genes 0.000 description 1
- 102100022675 Leucine-rich repeat-containing protein 37A2 Human genes 0.000 description 1
- 102100027494 Leucine-rich repeat-containing protein 39 Human genes 0.000 description 1
- 102100027151 Leucine-rich repeat-containing protein 40 Human genes 0.000 description 1
- 102100027168 Leucine-rich repeat-containing protein 41 Human genes 0.000 description 1
- 102100027170 Leucine-rich repeat-containing protein 42 Human genes 0.000 description 1
- 102100022170 Leucine-rich repeats and immunoglobulin-like domains protein 1 Human genes 0.000 description 1
- 102100022173 Leucine-rich repeats and immunoglobulin-like domains protein 2 Human genes 0.000 description 1
- 102100033284 Leucine-rich repeats and immunoglobulin-like domains protein 3 Human genes 0.000 description 1
- 102100023342 Leucine-tRNA ligase, mitochondrial Human genes 0.000 description 1
- 241000714210 Leviviridae Species 0.000 description 1
- 102100030939 Leydig cell tumor 10 kDa protein homolog Human genes 0.000 description 1
- 102100038260 Ligand-dependent corepressor Human genes 0.000 description 1
- 102100038259 Ligand-dependent nuclear receptor corepressor-like protein Human genes 0.000 description 1
- 102100022172 Ligand-dependent nuclear receptor-interacting factor 1 Human genes 0.000 description 1
- 102100033353 Lipopolysaccharide-responsive and beige-like anchor protein Human genes 0.000 description 1
- 102100025853 Lipoyltransferase 1, mitochondrial Human genes 0.000 description 1
- 102100031981 Liprin-beta-2 Human genes 0.000 description 1
- 102100039423 Little elongation complex subunit 1 Human genes 0.000 description 1
- 102100039420 Little elongation complex subunit 2 Human genes 0.000 description 1
- 102100023113 Long-chain fatty acid transport protein 4 Human genes 0.000 description 1
- 102100034319 Long-chain-fatty-acid-CoA ligase 4 Human genes 0.000 description 1
- 102100034389 Low density lipoprotein receptor adapter protein 1 Human genes 0.000 description 1
- 102100021917 Low-density lipoprotein receptor-related protein 3 Human genes 0.000 description 1
- 102100040704 Low-density lipoprotein receptor-related protein 6 Human genes 0.000 description 1
- 101000761444 Loxosceles laeta Dermonecrotic toxin Proteins 0.000 description 1
- 102100027434 Luc7-like protein 3 Human genes 0.000 description 1
- 102100030984 Lymphocyte function-associated antigen 3 Human genes 0.000 description 1
- 102100033638 Lys-63-specific deubiquitinase BRCC36 Human genes 0.000 description 1
- 102100037307 Lysine-rich coiled-coil protein 1 Human genes 0.000 description 1
- 102100021547 Lysine-rich nucleolar protein 1 Human genes 0.000 description 1
- 102100040598 Lysine-specific demethylase 2A Human genes 0.000 description 1
- 102100040584 Lysine-specific demethylase 2B Human genes 0.000 description 1
- 102100040581 Lysine-specific demethylase 3A Human genes 0.000 description 1
- 102100040582 Lysine-specific demethylase 3B Human genes 0.000 description 1
- 102100040863 Lysine-specific demethylase 4A Human genes 0.000 description 1
- 102100040860 Lysine-specific demethylase 4B Human genes 0.000 description 1
- 102100033230 Lysine-specific demethylase 4C Human genes 0.000 description 1
- 102100033246 Lysine-specific demethylase 5A Human genes 0.000 description 1
- 102100033249 Lysine-specific demethylase 5C Human genes 0.000 description 1
- 102100026395 Lysine-specific demethylase PHF2 Human genes 0.000 description 1
- 102100024985 Lysine-specific histone demethylase 1A Human genes 0.000 description 1
- 102100024033 Lysocardiolipin acyltransferase 1 Human genes 0.000 description 1
- 102100022916 Lysophosphatidic acid phosphatase type 6 Human genes 0.000 description 1
- 102100038056 Lysophosphatidylserine lipase ABHD12 Human genes 0.000 description 1
- 102100040944 Lysophospholipid acyltransferase 5 Human genes 0.000 description 1
- 102100033320 Lysosomal Pro-X carboxypeptidase Human genes 0.000 description 1
- 102100035699 Lysosomal acid phosphatase Human genes 0.000 description 1
- 102100034797 Lysosomal amino acid transporter 1 homolog Human genes 0.000 description 1
- 102100020978 Lysosomal cobalamin transporter ABCD4 Human genes 0.000 description 1
- 108010009491 Lysosomal-Associated Membrane Protein 2 Proteins 0.000 description 1
- 102100034728 Lysosomal-associated transmembrane protein 4A Human genes 0.000 description 1
- 102100020983 Lysosome membrane protein 2 Human genes 0.000 description 1
- 102100038225 Lysosome-associated membrane glycoprotein 2 Human genes 0.000 description 1
- 102100023268 M-phase phosphoprotein 8 Human genes 0.000 description 1
- 102100038793 MAD2L1-binding protein Human genes 0.000 description 1
- 108010068342 MAP Kinase Kinase 1 Proteins 0.000 description 1
- 108010068305 MAP Kinase Kinase 5 Proteins 0.000 description 1
- 102100034069 MAP kinase-activated protein kinase 2 Human genes 0.000 description 1
- 102100028396 MAP kinase-activated protein kinase 5 Human genes 0.000 description 1
- 102100026299 MAP kinase-interacting serine/threonine-protein kinase 1 Human genes 0.000 description 1
- 108010041955 MAP-kinase-activated kinase 2 Proteins 0.000 description 1
- 108010041164 MAP-kinase-activated kinase 5 Proteins 0.000 description 1
- 102100028920 MAP/microtubule affinity-regulating kinase 3 Human genes 0.000 description 1
- 102100028913 MAP/microtubule affinity-regulating kinase 4 Human genes 0.000 description 1
- 108700012928 MAPK14 Proteins 0.000 description 1
- 102100036309 MAU2 chromatid cohesion factor homolog Human genes 0.000 description 1
- 102000017274 MDM4 Human genes 0.000 description 1
- 108050005300 MDM4 Proteins 0.000 description 1
- 101150083522 MECP2 gene Proteins 0.000 description 1
- 108010018650 MEF2 Transcription Factors Proteins 0.000 description 1
- 102100022819 MHC class II regulatory factor RFX1 Human genes 0.000 description 1
- 102000044235 MICAL3 Human genes 0.000 description 1
- 102100033551 MICOS complex subunit MIC10 Human genes 0.000 description 1
- 102100026626 MICOS complex subunit MIC19 Human genes 0.000 description 1
- 102100026639 MICOS complex subunit MIC60 Human genes 0.000 description 1
- 108060004872 MIF Proteins 0.000 description 1
- 102000034655 MIF Human genes 0.000 description 1
- 102100029806 MIF4G domain-containing protein Human genes 0.000 description 1
- 101150088406 MLST8 gene Proteins 0.000 description 1
- 102100037406 MLX-interacting protein Human genes 0.000 description 1
- 102100032587 MOB-like protein phocein Human genes 0.000 description 1
- 102100024822 MORC family CW-type zinc finger protein 3 Human genes 0.000 description 1
- 102100027862 MORF4 family-associated protein 1 Human genes 0.000 description 1
- 102100032496 MPN domain-containing protein Human genes 0.000 description 1
- 102000046961 MRE11 Homologue Human genes 0.000 description 1
- 108700019589 MRE11 Homologue Proteins 0.000 description 1
- 102100034087 MRN complex-interacting protein Human genes 0.000 description 1
- 229910015837 MSH2 Inorganic materials 0.000 description 1
- 101150020396 MSRB2 gene Proteins 0.000 description 1
- 102100022211 MTRF1L release factor glutamine methyltransferase Human genes 0.000 description 1
- 108091007877 MYCBP2 Proteins 0.000 description 1
- 102100028111 Magnesium transporter NIPA2 Human genes 0.000 description 1
- 102100025833 Major centromere autoantigen B Human genes 0.000 description 1
- 102100029281 Major facilitator superfamily domain-containing protein 12 Human genes 0.000 description 1
- 102100039742 Malate dehydrogenase, mitochondrial Human genes 0.000 description 1
- 102100032515 Male-specific lethal 3 homolog Human genes 0.000 description 1
- 102100037750 Malectin Human genes 0.000 description 1
- 102100039668 Malignant fibrous histiocytoma-amplified sequence 1 Human genes 0.000 description 1
- 102100026665 Malonate-CoA ligase ACSF3, mitochondrial Human genes 0.000 description 1
- 102100027329 Malonyl-CoA-acyl carrier protein transacylase, mitochondrial Human genes 0.000 description 1
- 101710137760 Malonyl-CoA-acyl carrier protein transacylase, mitochondrial Proteins 0.000 description 1
- 102100025302 Mannose-1-phosphate guanyltransferase alpha Human genes 0.000 description 1
- 102100021171 Mannose-1-phosphate guanyltransferase beta Human genes 0.000 description 1
- 102100021767 Mannosyl-oligosaccharide 1,2-alpha-mannosidase IB Human genes 0.000 description 1
- 102100024162 Mapk-regulated corepressor-interacting protein 1 Human genes 0.000 description 1
- 101150003941 Mapk14 gene Proteins 0.000 description 1
- 102100022280 Maspardin Human genes 0.000 description 1
- 102100025129 Mastermind-like protein 1 Human genes 0.000 description 1
- 102100038645 Matrin-3 Human genes 0.000 description 1
- 102100039515 Max dimerization protein 4 Human genes 0.000 description 1
- 102100035880 Max-interacting protein 1 Human genes 0.000 description 1
- 102100027643 Mediator of DNA damage checkpoint protein 1 Human genes 0.000 description 1
- 102100021089 Mediator of RNA polymerase II transcription subunit 11 Human genes 0.000 description 1
- 102100021070 Mediator of RNA polymerase II transcription subunit 12 Human genes 0.000 description 1
- 102100026161 Mediator of RNA polymerase II transcription subunit 13 Human genes 0.000 description 1
- 102100034164 Mediator of RNA polymerase II transcription subunit 13-like Human genes 0.000 description 1
- 102100034820 Mediator of RNA polymerase II transcription subunit 14 Human genes 0.000 description 1
- 102100029663 Mediator of RNA polymerase II transcription subunit 15 Human genes 0.000 description 1
- 102100030253 Mediator of RNA polymerase II transcription subunit 16 Human genes 0.000 description 1
- 102100025530 Mediator of RNA polymerase II transcription subunit 17 Human genes 0.000 description 1
- 102100024280 Mediator of RNA polymerase II transcription subunit 18 Human genes 0.000 description 1
- 102100026165 Mediator of RNA polymerase II transcription subunit 20 Human genes 0.000 description 1
- 102100021072 Mediator of RNA polymerase II transcription subunit 21 Human genes 0.000 description 1
- 102100034771 Mediator of RNA polymerase II transcription subunit 23 Human genes 0.000 description 1
- 102100034821 Mediator of RNA polymerase II transcription subunit 24 Human genes 0.000 description 1
- 102100039001 Mediator of RNA polymerase II transcription subunit 27 Human genes 0.000 description 1
- 102100029668 Mediator of RNA polymerase II transcription subunit 29 Human genes 0.000 description 1
- 102100039122 Mediator of RNA polymerase II transcription subunit 31 Human genes 0.000 description 1
- 102100026174 Mediator of RNA polymerase II transcription subunit 6 Human genes 0.000 description 1
- 102100030235 Mediator of RNA polymerase II transcription subunit 7 Human genes 0.000 description 1
- 102100024294 Mediator of RNA polymerase II transcription subunit 8 Human genes 0.000 description 1
- 102100038620 Meiosis regulator and mRNA stability factor 1 Human genes 0.000 description 1
- 102100029778 Melanoma inhibitory activity protein 2 Human genes 0.000 description 1
- 102100027247 Melanoma-associated antigen D1 Human genes 0.000 description 1
- 102100027251 Melanoma-associated antigen D2 Human genes 0.000 description 1
- 108010049137 Member 1 Subfamily D ATP Binding Cassette Transporter Proteins 0.000 description 1
- 108010090306 Member 2 Subfamily G ATP Binding Cassette Transporter Proteins 0.000 description 1
- 102100039605 Membralin Human genes 0.000 description 1
- 102100039373 Membrane cofactor protein Human genes 0.000 description 1
- 102100027240 Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 1 Human genes 0.000 description 1
- 102100032400 Membrane-associated progesterone receptor component 2 Human genes 0.000 description 1
- 102100034028 Membrane-bound transcription factor site-1 protease Human genes 0.000 description 1
- 102100027382 Membrane-bound transcription factor site-2 protease Human genes 0.000 description 1
- 102100029623 Mesoderm induction early response protein 1 Human genes 0.000 description 1
- 102100029625 Mesoderm induction early response protein 2 Human genes 0.000 description 1
- 102100031677 Metal transporter CNNM2 Human genes 0.000 description 1
- 102100031678 Metal transporter CNNM3 Human genes 0.000 description 1
- 102100040632 Metal-response element-binding transcription factor 2 Human genes 0.000 description 1
- 102100021274 Metallophosphoesterase 1 Human genes 0.000 description 1
- 102100037511 Metastasis-associated protein MTA2 Human genes 0.000 description 1
- 102100031603 Metaxin-1 Human genes 0.000 description 1
- 102100023138 Metaxin-2 Human genes 0.000 description 1
- 102100028691 Methenyltetrahydrofolate cyclohydrolase Human genes 0.000 description 1
- 102100029682 Methenyltetrahydrofolate synthase domain-containing protein Human genes 0.000 description 1
- 102100030932 Methionine adenosyltransferase 2 subunit beta Human genes 0.000 description 1
- 102100028379 Methionine aminopeptidase 1 Human genes 0.000 description 1
- 102100023174 Methionine aminopeptidase 2 Human genes 0.000 description 1
- 102100024614 Methionine synthase reductase Human genes 0.000 description 1
- 102100024862 Methionine-R-sulfoxide reductase B2, mitochondrial Human genes 0.000 description 1
- 102100027383 Methyl-CpG-binding domain protein 1 Human genes 0.000 description 1
- 102100021299 Methyl-CpG-binding domain protein 2 Human genes 0.000 description 1
- 102100021291 Methyl-CpG-binding domain protein 3 Human genes 0.000 description 1
- 102100039124 Methyl-CpG-binding protein 2 Human genes 0.000 description 1
- 102100025825 Methylated-DNA-protein-cysteine methyltransferase Human genes 0.000 description 1
- 102100029676 Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial Human genes 0.000 description 1
- 102100020846 Methylosome subunit pICln Human genes 0.000 description 1
- 102100021415 Methylthioribose-1-phosphate isomerase Human genes 0.000 description 1
- 102100038593 Methylthioribulose-1-phosphate dehydratase Human genes 0.000 description 1
- 108060004795 Methyltransferase Proteins 0.000 description 1
- 102100036543 Methyltransferase N6AMT1 Human genes 0.000 description 1
- 102100037543 Methyltransferase-like 26 Human genes 0.000 description 1
- 102100030508 Methyltransferase-like protein 17, mitochondrial Human genes 0.000 description 1
- 102100034182 Methyltransferase-like protein 25B Human genes 0.000 description 1
- 108700011259 MicroRNAs Proteins 0.000 description 1
- 102100025600 Microfibril-associated glycoprotein 3 Human genes 0.000 description 1
- 102100032459 Microprocessor complex subunit DGCR8 Human genes 0.000 description 1
- 102100026722 Microsomal glutathione S-transferase 3 Human genes 0.000 description 1
- 102100021794 Microtubule-associated protein 4 Human genes 0.000 description 1
- 102100038615 Microtubule-associated protein RP/EB family member 2 Human genes 0.000 description 1
- 102100023333 Microtubule-associated proteins 1A/1B light chain 3 beta 2 Human genes 0.000 description 1
- 102100033253 Microtubule-associated serine/threonine-protein kinase 2 Human genes 0.000 description 1
- 102100028338 Mid1-interacting protein 1 Human genes 0.000 description 1
- 102100027666 Midasin Human genes 0.000 description 1
- 102100021316 Mineralocorticoid receptor Human genes 0.000 description 1
- 102100027372 Mini-chromosome maintenance complex-binding protein Human genes 0.000 description 1
- 102100026287 Misshapen-like kinase 1 Human genes 0.000 description 1
- 102100021769 Mitochondrial 2-oxoglutarate/malate carrier protein Human genes 0.000 description 1
- 108010009513 Mitochondrial Aldehyde Dehydrogenase Proteins 0.000 description 1
- 102100030331 Mitochondrial Rho GTPase 1 Human genes 0.000 description 1
- 102100023727 Mitochondrial antiviral-signaling protein Human genes 0.000 description 1
- 101710142315 Mitochondrial antiviral-signaling protein Proteins 0.000 description 1
- 102100039374 Mitochondrial calcium uniporter regulator 1 Human genes 0.000 description 1
- 102100031332 Mitochondrial carrier homolog 2 Human genes 0.000 description 1
- 102100027891 Mitochondrial chaperone BCS1 Human genes 0.000 description 1
- 102100025529 Mitochondrial dynamics protein MID49 Human genes 0.000 description 1
- 102100023845 Mitochondrial fission 1 protein Human genes 0.000 description 1
- 102100023200 Mitochondrial fission process protein 1 Human genes 0.000 description 1
- 102100023197 Mitochondrial fission regulator 1 Human genes 0.000 description 1
- 102100026107 Mitochondrial fission regulator 1-like Human genes 0.000 description 1
- 102100039325 Mitochondrial import inner membrane translocase subunit TIM14 Human genes 0.000 description 1
- 102100024285 Mitochondrial import inner membrane translocase subunit TIM16 Human genes 0.000 description 1
- 102100032585 Mitochondrial import inner membrane translocase subunit TIM44 Human genes 0.000 description 1
- 102100034699 Mitochondrial import inner membrane translocase subunit TIM50 Human genes 0.000 description 1
- 102100033066 Mitochondrial import inner membrane translocase subunit Tim10 Human genes 0.000 description 1
- 102100034853 Mitochondrial import inner membrane translocase subunit Tim10 B Human genes 0.000 description 1
- 101710203784 Mitochondrial import inner membrane translocase subunit Tim10-B Proteins 0.000 description 1
- 102100032125 Mitochondrial import inner membrane translocase subunit Tim13 Human genes 0.000 description 1
- 102100037824 Mitochondrial import inner membrane translocase subunit Tim17-A Human genes 0.000 description 1
- 102100027649 Mitochondrial import inner membrane translocase subunit Tim17-B Human genes 0.000 description 1
- 102100036957 Mitochondrial import inner membrane translocase subunit Tim21 Human genes 0.000 description 1
- 102100026258 Mitochondrial import inner membrane translocase subunit Tim22 Human genes 0.000 description 1
- 102100026255 Mitochondrial import inner membrane translocase subunit Tim23 Human genes 0.000 description 1
- 102100026808 Mitochondrial import inner membrane translocase subunit Tim8 A Human genes 0.000 description 1
- 102100036655 Mitochondrial import inner membrane translocase subunit Tim8 B Human genes 0.000 description 1
- 102100032107 Mitochondrial import inner membrane translocase subunit Tim9 Human genes 0.000 description 1
- 102100026905 Mitochondrial import receptor subunit TOM40 homolog Human genes 0.000 description 1
- 102100026902 Mitochondrial import receptor subunit TOM5 homolog Human genes 0.000 description 1
- 102100028812 Mitochondrial import receptor subunit TOM6 homolog Human genes 0.000 description 1
- 102100028811 Mitochondrial import receptor subunit TOM70 Human genes 0.000 description 1
- 102100039840 Mitochondrial inner membrane protease subunit 2 Human genes 0.000 description 1
- 102100037148 Mitochondrial inner membrane protein OXA1L Human genes 0.000 description 1
- 102100026934 Mitochondrial intermediate peptidase Human genes 0.000 description 1
- 102100039802 Mitochondrial intermembrane space import and assembly protein 40 Human genes 0.000 description 1
- 102100024054 Mitochondrial mRNA pseudouridine synthase RPUSD3 Human genes 0.000 description 1
- 102100036288 Mitochondrial mRNA pseudouridine synthase TRUB2 Human genes 0.000 description 1
- 102100031767 Mitochondrial peptide methionine sulfoxide reductase Human genes 0.000 description 1
- 102100028054 Mitochondrial potassium channel Human genes 0.000 description 1
- 102100028134 Mitochondrial potassium channel ATP-binding subunit Human genes 0.000 description 1
- 101710106113 Mitochondrial potassium channel ATP-binding subunit Proteins 0.000 description 1
- 102100039186 Mitochondrial proton/calcium exchanger protein Human genes 0.000 description 1
- 101710165595 Mitochondrial pyruvate carrier 2 Proteins 0.000 description 1
- 102100025031 Mitochondrial pyruvate carrier 2 Human genes 0.000 description 1
- 102100032519 Mitochondrial ribonuclease P catalytic subunit Human genes 0.000 description 1
- 102100033820 Mitochondrial ribosome-associated GTPase 2 Human genes 0.000 description 1
- 102100038450 Mitochondrial tRNA methylthiotransferase CDK5RAP1 Human genes 0.000 description 1
- 102100034059 Mitochondrial transcription rescue factor 1 Human genes 0.000 description 1
- 102100033858 Mitochondrial translation release factor in rescue Human genes 0.000 description 1
- 102100025321 Mitochondrial-processing peptidase subunit alpha Human genes 0.000 description 1
- 102100025298 Mitochondrial-processing peptidase subunit beta Human genes 0.000 description 1
- 102100033703 Mitofusin-2 Human genes 0.000 description 1
- 102100024193 Mitogen-activated protein kinase 1 Human genes 0.000 description 1
- 102000054819 Mitogen-activated protein kinase 14 Human genes 0.000 description 1
- 102100024192 Mitogen-activated protein kinase 3 Human genes 0.000 description 1
- 102100037801 Mitogen-activated protein kinase 6 Human genes 0.000 description 1
- 102100037805 Mitogen-activated protein kinase 7 Human genes 0.000 description 1
- 102100037808 Mitogen-activated protein kinase 8 Human genes 0.000 description 1
- 102100037809 Mitogen-activated protein kinase 9 Human genes 0.000 description 1
- 102100038243 Mitogen-activated protein kinase kinase kinase 10 Human genes 0.000 description 1
- 102100025207 Mitogen-activated protein kinase kinase kinase 11 Human genes 0.000 description 1
- 102100025216 Mitogen-activated protein kinase kinase kinase 15 Human genes 0.000 description 1
- 102100033058 Mitogen-activated protein kinase kinase kinase 2 Human genes 0.000 description 1
- 102100033059 Mitogen-activated protein kinase kinase kinase 3 Human genes 0.000 description 1
- 102100033060 Mitogen-activated protein kinase kinase kinase 4 Human genes 0.000 description 1
- 102100026888 Mitogen-activated protein kinase kinase kinase 7 Human genes 0.000 description 1
- 102100028193 Mitogen-activated protein kinase kinase kinase kinase 3 Human genes 0.000 description 1
- 102100028194 Mitogen-activated protein kinase kinase kinase kinase 4 Human genes 0.000 description 1
- 102100028195 Mitogen-activated protein kinase kinase kinase kinase 5 Human genes 0.000 description 1
- 102100022238 Mitoguardin 1 Human genes 0.000 description 1
- 102100021718 Mitotic checkpoint protein BUB3 Human genes 0.000 description 1
- 102100038828 Mitotic spindle assembly checkpoint protein MAD1 Human genes 0.000 description 1
- 102100030955 Mitotic spindle assembly checkpoint protein MAD2B Human genes 0.000 description 1
- 102100031965 Mitotic-spindle organizing protein 2A Human genes 0.000 description 1
- 102100040097 Modulator of smoothened protein Human genes 0.000 description 1
- 102100025610 Molybdate-anion transporter Human genes 0.000 description 1
- 102100035971 Molybdopterin molybdenumtransferase Human genes 0.000 description 1
- 102100039428 Molybdopterin synthase sulfur carrier subunit Human genes 0.000 description 1
- 102100021395 Mortality factor 4-like protein 1 Human genes 0.000 description 1
- 102100031304 Mortality factor 4-like protein 2 Human genes 0.000 description 1
- 102100025751 Mothers against decapentaplegic homolog 2 Human genes 0.000 description 1
- 101710143123 Mothers against decapentaplegic homolog 2 Proteins 0.000 description 1
- 102100025725 Mothers against decapentaplegic homolog 4 Human genes 0.000 description 1
- 101710143112 Mothers against decapentaplegic homolog 4 Proteins 0.000 description 1
- 102100030610 Mothers against decapentaplegic homolog 5 Human genes 0.000 description 1
- 101710143113 Mothers against decapentaplegic homolog 5 Proteins 0.000 description 1
- 102100030608 Mothers against decapentaplegic homolog 7 Human genes 0.000 description 1
- 102100023091 Motile sperm domain-containing protein 3 Human genes 0.000 description 1
- 102100026285 Msx2-interacting protein Human genes 0.000 description 1
- 101150097381 Mtor gene Proteins 0.000 description 1
- 102100034256 Mucin-1 Human genes 0.000 description 1
- 102100032242 Multifunctional methyltransferase subunit TRM112-like protein Human genes 0.000 description 1
- 102100021387 Multiple coagulation factor deficiency protein 2 Human genes 0.000 description 1
- 102100038990 Multiple epidermal growth factor-like domains protein 8 Human genes 0.000 description 1
- 102100026284 Multiple inositol polyphosphate phosphatase 1 Human genes 0.000 description 1
- 101100058550 Mus musculus Bmi1 gene Proteins 0.000 description 1
- 101100460128 Mus musculus Nedd1 gene Proteins 0.000 description 1
- 101100242031 Mus musculus Pdha2 gene Proteins 0.000 description 1
- 101000744522 Mus musculus Ras-related protein Rab-22A Proteins 0.000 description 1
- 101100193698 Mus musculus Rasal1 gene Proteins 0.000 description 1
- 102100026301 Muskelin Human genes 0.000 description 1
- 102100034005 Myb-binding protein 1A Human genes 0.000 description 1
- 102100026787 Myb-related transcription factor, partner of profilin Human genes 0.000 description 1
- 102100023254 Myb/SANT-like DNA-binding domain-containing protein 3 Human genes 0.000 description 1
- 101001033610 Mycobacterium tuberculosis (strain ATCC 25618 / H37Rv) Inosine-5'-monophosphate dehydrogenase Proteins 0.000 description 1
- 102100026933 Myelin-associated neurite-outgrowth inhibitor Human genes 0.000 description 1
- 102100029687 Myeloid leukemia factor 2 Human genes 0.000 description 1
- 102100032160 Myocardial zonula adherens protein Human genes 0.000 description 1
- 102100034100 Myocardin-related transcription factor B Human genes 0.000 description 1
- 102100021148 Myocyte-specific enhancer factor 2A Human genes 0.000 description 1
- 102100030166 Myoneurin Human genes 0.000 description 1
- 102100037183 Myosin phosphatase Rho-interacting protein Human genes 0.000 description 1
- 102100030330 Myosin regulatory light chain 12B Human genes 0.000 description 1
- 102100021416 Myotubularin-related protein 1 Human genes 0.000 description 1
- 102100024958 Myotubularin-related protein 10 Human genes 0.000 description 1
- 102100024957 Myotubularin-related protein 12 Human genes 0.000 description 1
- 102100035739 Myotubularin-related protein 14 Human genes 0.000 description 1
- 102100040602 Myotubularin-related protein 2 Human genes 0.000 description 1
- 102100040599 Myotubularin-related protein 4 Human genes 0.000 description 1
- 102100040604 Myotubularin-related protein 5 Human genes 0.000 description 1
- 108050003253 Myotubularin-related protein 5 Proteins 0.000 description 1
- 102100040603 Myotubularin-related protein 6 Human genes 0.000 description 1
- 102100024941 Myotubularin-related protein 9 Human genes 0.000 description 1
- 108010062010 N-Acetylmuramoyl-L-alanine Amidase Proteins 0.000 description 1
- WWGBHDIHIVGYLZ-UHFFFAOYSA-N N-[4-[3-[[[7-(hydroxyamino)-7-oxoheptyl]amino]-oxomethyl]-5-isoxazolyl]phenyl]carbamic acid tert-butyl ester Chemical compound C1=CC(NC(=O)OC(C)(C)C)=CC=C1C1=CC(C(=O)NCCCCCCC(=O)NO)=NO1 WWGBHDIHIVGYLZ-UHFFFAOYSA-N 0.000 description 1
- 102100037774 N-acetylgalactosamine kinase Human genes 0.000 description 1
- 102100031688 N-acetylgalactosamine-6-sulfatase Human genes 0.000 description 1
- 102100039267 N-acetylglucosamine-1-phosphodiester alpha-N-acetylglucosaminidase Human genes 0.000 description 1
- 102100032979 N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase Human genes 0.000 description 1
- 102100037155 N-acetyltransferase 9 Human genes 0.000 description 1
- 102100031641 N-alpha-acetyltransferase 10 Human genes 0.000 description 1
- 102100026783 N-alpha-acetyltransferase 16, NatA auxiliary subunit Human genes 0.000 description 1
- 102100026778 N-alpha-acetyltransferase 20 Human genes 0.000 description 1
- 102100031871 N-alpha-acetyltransferase 30 Human genes 0.000 description 1
- 102100027110 N-alpha-acetyltransferase 38, NatC auxiliary subunit Human genes 0.000 description 1
- 102100038334 N-alpha-acetyltransferase 60 Human genes 0.000 description 1
- ZBZXYUYUUDZCNB-UHFFFAOYSA-N N-cyclohexa-1,3-dien-1-yl-N-phenyl-4-[4-(N-[4-[4-(N-[4-[4-(N-phenylanilino)phenyl]phenyl]anilino)phenyl]phenyl]anilino)phenyl]aniline Chemical compound C1=CCCC(N(C=2C=CC=CC=2)C=2C=CC(=CC=2)C=2C=CC(=CC=2)N(C=2C=CC=CC=2)C=2C=CC(=CC=2)C=2C=CC(=CC=2)N(C=2C=CC=CC=2)C=2C=CC(=CC=2)C=2C=CC(=CC=2)N(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 ZBZXYUYUUDZCNB-UHFFFAOYSA-N 0.000 description 1
- 102100027709 N-lysine methyltransferase SETD6 Human genes 0.000 description 1
- 102100027661 N-sulphoglucosamine sulphohydrolase Human genes 0.000 description 1
- 102100021721 N-terminal Xaa-Pro-Lys N-methyltransferase 1 Human genes 0.000 description 1
- 101150098207 NAAA gene Proteins 0.000 description 1
- 102100032217 NAD kinase 2, mitochondrial Human genes 0.000 description 1
- 102100023356 NAD(+) hydrolase SARM1 Human genes 0.000 description 1
- 102100022913 NAD-dependent protein deacetylase sirtuin-2 Human genes 0.000 description 1
- 102100030710 NAD-dependent protein deacetylase sirtuin-3, mitochondrial Human genes 0.000 description 1
- 102100021840 NAD-dependent protein deacetylase sirtuin-6 Human genes 0.000 description 1
- 102100021839 NAD-dependent protein deacylase sirtuin-5, mitochondrial Human genes 0.000 description 1
- 102100031394 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 4 Human genes 0.000 description 1
- 102100037508 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 1 Human genes 0.000 description 1
- 102100022198 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 12 Human genes 0.000 description 1
- 102100031924 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 13 Human genes 0.000 description 1
- 102100023950 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 2 Human genes 0.000 description 1
- 102100023948 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 3 Human genes 0.000 description 1
- 102100032199 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 5 Human genes 0.000 description 1
- 102100026374 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 7 Human genes 0.000 description 1
- 102100035383 NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Human genes 0.000 description 1
- 102100023955 NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 11, mitochondrial Human genes 0.000 description 1
- 102100032195 NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 3 Human genes 0.000 description 1
- 102100032205 NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4 Human genes 0.000 description 1
- 102100037507 NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial Human genes 0.000 description 1
- 102100037524 NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6 Human genes 0.000 description 1
- 102100037520 NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 7 Human genes 0.000 description 1
- 102100024975 NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial Human genes 0.000 description 1
- 102100024978 NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 9 Human genes 0.000 description 1
- 102100023953 NADH dehydrogenase [ubiquinone] 1 subunit C1, mitochondrial Human genes 0.000 description 1
- 102100035386 NADH dehydrogenase [ubiquinone] 1 subunit C2 Human genes 0.000 description 1
- 102100035479 NADH dehydrogenase [ubiquinone] 1 subunit C2, isoform 2 Human genes 0.000 description 1
- 102100023963 NADH dehydrogenase [ubiquinone] flavoprotein 1, mitochondrial Human genes 0.000 description 1
- 102100026360 NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial Human genes 0.000 description 1
- 102100037701 NADH dehydrogenase [ubiquinone] iron-sulfur protein 5 Human genes 0.000 description 1
- 102100033153 NADH-cytochrome b5 reductase 3 Human genes 0.000 description 1
- 102100039210 NBAS subunit of NRZ tethering complex Human genes 0.000 description 1
- 102100027673 NCK-interacting protein with SH3 domain Human genes 0.000 description 1
- 102100023052 NEDD4 family-interacting protein 2 Human genes 0.000 description 1
- 102100038544 NEDD4-binding protein 2-like 2 Human genes 0.000 description 1
- 102100027549 NEDD4-like E3 ubiquitin-protein ligase WWP2 Human genes 0.000 description 1
- 102100031911 NEDD8 Human genes 0.000 description 1
- 108700004934 NEDD8 Proteins 0.000 description 1
- 101150107958 NEDD8 gene Proteins 0.000 description 1
- 102100021741 NEDD8 ultimate buster 1 Human genes 0.000 description 1
- 102100020710 NEDD8-conjugating enzyme Ubc12 Human genes 0.000 description 1
- 108091007368 NEURL4 Proteins 0.000 description 1
- 108010071382 NF-E2-Related Factor 2 Proteins 0.000 description 1
- 102100022219 NF-kappa-B essential modulator Human genes 0.000 description 1
- 102100033457 NF-kappa-B inhibitor beta Human genes 0.000 description 1
- 102100034325 NF-kappa-B inhibitor-interacting Ras-like protein 2 Human genes 0.000 description 1
- 102100023379 NF-kappa-B-repressing factor Human genes 0.000 description 1
- 108010018525 NFATC Transcription Factors Proteins 0.000 description 1
- 102000002673 NFATC Transcription Factors Human genes 0.000 description 1
- 102100023058 NHP2-like protein 1 Human genes 0.000 description 1
- 102100037380 NIF3-like protein 1 Human genes 0.000 description 1
- 102100023384 NK-tumor recognition protein Human genes 0.000 description 1
- 102100039890 NLR family pyrin domain-containing protein 2B Human genes 0.000 description 1
- 102000002441 NOSIP Human genes 0.000 description 1
- 101150074334 NOSIP gene Proteins 0.000 description 1
- 102100028383 NSFL1 cofactor p47 Human genes 0.000 description 1
- 102100025055 NTF2-related export protein 1 Human genes 0.000 description 1
- 102100021850 Nardilysin Human genes 0.000 description 1
- 102100021867 Natural resistance-associated macrophage protein 2 Human genes 0.000 description 1
- 102100036953 Nck-associated protein 5-like Human genes 0.000 description 1
- 102100023062 Negative elongation factor A Human genes 0.000 description 1
- 102100023061 Negative elongation factor B Human genes 0.000 description 1
- 102100023070 Negative elongation factor E Human genes 0.000 description 1
- 102100031903 Neudesin Human genes 0.000 description 1
- 102100022158 Neuferricin Human genes 0.000 description 1
- 102100027993 Neugrin Human genes 0.000 description 1
- 102100023031 Neural Wiskott-Aldrich syndrome protein Human genes 0.000 description 1
- 102100023071 Neuralized-like protein 4 Human genes 0.000 description 1
- 102100037003 Neuroblastoma breakpoint family member 10 Human genes 0.000 description 1
- 102100032139 Neuroguidin Human genes 0.000 description 1
- 102100038434 Neuroplastin Human genes 0.000 description 1
- 102100026325 Neurotrophin receptor-interacting factor homolog Human genes 0.000 description 1
- 102100028056 Nicastrin Human genes 0.000 description 1
- 108010064862 Nicotinamide phosphoribosyltransferase Proteins 0.000 description 1
- 102100033223 Nicotinamide phosphoribosyltransferase Human genes 0.000 description 1
- 102100029562 Nicotinamide riboside kinase 1 Human genes 0.000 description 1
- 102100027894 Ninjurin-1 Human genes 0.000 description 1
- 102100035377 Nipped-B-like protein Human genes 0.000 description 1
- 102100038995 Nischarin Human genes 0.000 description 1
- 102100038815 Nocturnin Human genes 0.000 description 1
- 102100032028 Non-receptor tyrosine-protein kinase TYK2 Human genes 0.000 description 1
- 102100028403 Non-structural maintenance of chromosomes element 4 homolog A Human genes 0.000 description 1
- 102100029940 Nonsense-mediated mRNA decay factor SMG5 Human genes 0.000 description 1
- 102100032729 Nonsense-mediated mRNA decay factor SMG7 Human genes 0.000 description 1
- 101150074217 Nprl2 gene Proteins 0.000 description 1
- 101150009730 Nprl3 gene Proteins 0.000 description 1
- 108010029782 Nuclear Cap-Binding Protein Complex Proteins 0.000 description 1
- 108700031302 Nuclear Factor 45 Proteins 0.000 description 1
- 102000015863 Nuclear Factor 90 Proteins Human genes 0.000 description 1
- 108010010424 Nuclear Factor 90 Proteins Proteins 0.000 description 1
- 102100035402 Nuclear RNA export factor 1 Human genes 0.000 description 1
- 108010062309 Nuclear Receptor Interacting Protein 1 Proteins 0.000 description 1
- 102100023904 Nuclear autoantigenic sperm protein Human genes 0.000 description 1
- 101710149564 Nuclear autoantigenic sperm protein Proteins 0.000 description 1
- 102100032342 Nuclear cap-binding protein subunit 2 Human genes 0.000 description 1
- 102100032343 Nuclear cap-binding protein subunit 3 Human genes 0.000 description 1
- 102100025815 Nuclear envelope pore membrane protein POM 121C Human genes 0.000 description 1
- 102100023050 Nuclear factor NF-kappa-B p105 subunit Human genes 0.000 description 1
- 102100031700 Nuclear factor erythroid 2-related factor 3 Human genes 0.000 description 1
- 102100022163 Nuclear factor interleukin-3-regulated protein Human genes 0.000 description 1
- 102100035397 Nuclear factor related to kappa-B-binding protein Human genes 0.000 description 1
- 102100032428 Nuclear fragile X mental retardation-interacting protein 1 Human genes 0.000 description 1
- 102100036965 Nuclear migration protein nudC Human genes 0.000 description 1
- 102100021706 Nuclear pore complex protein Nup153 Human genes 0.000 description 1
- 102100021510 Nuclear pore complex protein Nup160 Human genes 0.000 description 1
- 102100032226 Nuclear pore complex protein Nup205 Human genes 0.000 description 1
- 102100033819 Nuclear pore complex protein Nup214 Human genes 0.000 description 1
- 102100025447 Nuclear pore complex protein Nup50 Human genes 0.000 description 1
- 102100027586 Nuclear pore complex protein Nup88 Human genes 0.000 description 1
- 102100027585 Nuclear pore complex protein Nup93 Human genes 0.000 description 1
- 102100025372 Nuclear pore complex protein Nup98-Nup96 Human genes 0.000 description 1
- 102100024057 Nuclear pore glycoprotein p62 Human genes 0.000 description 1
- 102100037226 Nuclear receptor coactivator 2 Human genes 0.000 description 1
- 102100022929 Nuclear receptor coactivator 6 Human genes 0.000 description 1
- 102100022930 Nuclear receptor coactivator 7 Human genes 0.000 description 1
- 102100022935 Nuclear receptor corepressor 1 Human genes 0.000 description 1
- 102100030569 Nuclear receptor corepressor 2 Human genes 0.000 description 1
- 102100028470 Nuclear receptor subfamily 2 group C member 1 Human genes 0.000 description 1
- 102100028448 Nuclear receptor subfamily 2 group C member 2 Human genes 0.000 description 1
- 102100021858 Nuclear receptor-binding protein Human genes 0.000 description 1
- 102100029558 Nuclear receptor-interacting protein 1 Human genes 0.000 description 1
- 102100029230 Nuclear speckle splicing regulatory protein 1 Human genes 0.000 description 1
- 102100034408 Nuclear transcription factor Y subunit alpha Human genes 0.000 description 1
- 102100022201 Nuclear transcription factor Y subunit beta Human genes 0.000 description 1
- 102100031719 Nuclear transcription factor Y subunit gamma Human genes 0.000 description 1
- 102100028418 Nuclear transport factor 2 Human genes 0.000 description 1
- 102100035376 Nuclear-interacting partner of ALK Human genes 0.000 description 1
- 102100027441 Nucleobindin-2 Human genes 0.000 description 1
- 102100034507 Nucleolar GTP-binding protein 2 Human genes 0.000 description 1
- 102100022726 Nucleolar and coiled-body phosphoprotein 1 Human genes 0.000 description 1
- 102100029101 Nucleolar complex protein 2 homolog Human genes 0.000 description 1
- 102100029053 Nucleolar pre-ribosomal-associated protein 1 Human genes 0.000 description 1
- 102100038456 Nucleolar protein 10 Human genes 0.000 description 1
- 102100022402 Nucleolar protein 11 Human genes 0.000 description 1
- 102100038789 Nucleolar protein 14 Human genes 0.000 description 1
- 102100029102 Nucleolar protein 16 Human genes 0.000 description 1
- 102100022741 Nucleolar protein 7 Human genes 0.000 description 1
- 102100022740 Nucleolar protein 8 Human genes 0.000 description 1
- 102100029156 Nucleolar protein of 40 kDa Human genes 0.000 description 1
- 102100038485 Nucleolar transcription factor 1 Human genes 0.000 description 1
- 102100028752 Nucleolus and neural progenitor protein Human genes 0.000 description 1
- 102100022678 Nucleophosmin Human genes 0.000 description 1
- 102100022684 Nucleoplasmin-3 Human genes 0.000 description 1
- 102100037826 Nucleoporin NDC1 Human genes 0.000 description 1
- 102100037821 Nucleoporin NUP42 Human genes 0.000 description 1
- 102100023782 Nucleoporin SEH1 Human genes 0.000 description 1
- 102100025453 Nucleoporin p54 Human genes 0.000 description 1
- 102100025794 Nucleoporin p58/p45 Human genes 0.000 description 1
- 102100032209 Nucleoside diphosphate kinase 3 Human genes 0.000 description 1
- 102100032113 Nucleoside diphosphate kinase 6 Human genes 0.000 description 1
- 102100032115 Nucleoside diphosphate kinase 7 Human genes 0.000 description 1
- 102100023258 Nucleoside diphosphate kinase B Human genes 0.000 description 1
- 102100022396 Nucleosome assembly protein 1-like 4 Human genes 0.000 description 1
- 102100025062 Nucleosome-remodeling factor subunit BPTF Human genes 0.000 description 1
- 102100022471 NudC domain-containing protein 3 Human genes 0.000 description 1
- 102100030224 O-phosphoseryl-tRNA(Sec) selenium transferase Human genes 0.000 description 1
- 102100027183 OCIA domain-containing protein 1 Human genes 0.000 description 1
- 102100026498 ORM1-like protein 2 Human genes 0.000 description 1
- 102100025193 OTU domain-containing protein 4 Human genes 0.000 description 1
- 102100025194 OTU domain-containing protein 5 Human genes 0.000 description 1
- 102100035415 Obg-like ATPase 1 Human genes 0.000 description 1
- 101150042165 Ogfr gene Proteins 0.000 description 1
- 102100026949 Opioid growth factor receptor Human genes 0.000 description 1
- 102100021079 Ornithine decarboxylase Human genes 0.000 description 1
- 102100036199 Ornithine decarboxylase antizyme 1 Human genes 0.000 description 1
- 102100027035 Ornithine decarboxylase antizyme 2 Human genes 0.000 description 1
- 101100532088 Oryza sativa subsp. japonica RUB2 gene Proteins 0.000 description 1
- 101100532090 Oryza sativa subsp. japonica RUB3 gene Proteins 0.000 description 1
- 102100040559 Osteopetrosis-associated transmembrane protein 1 Human genes 0.000 description 1
- 102100026069 Outer dense fiber protein 2 Human genes 0.000 description 1
- 102100034219 Oxidation resistance protein 1 Human genes 0.000 description 1
- 102100026317 Oxidative stress-induced growth inhibitor 2 Human genes 0.000 description 1
- 102100037780 Oxidative stress-responsive serine-rich protein 1 Human genes 0.000 description 1
- 102100027952 Oxidoreductase HTATIP2 Human genes 0.000 description 1
- 102100040462 Oxidoreductase-like domain-containing protein 1 Human genes 0.000 description 1
- 102100032163 Oxysterol-binding protein 1 Human genes 0.000 description 1
- 102100025925 Oxysterol-binding protein-related protein 2 Human genes 0.000 description 1
- 102100032151 Oxysterol-binding protein-related protein 8 Human genes 0.000 description 1
- 102100040912 PABIR family member 2 Human genes 0.000 description 1
- 102100037141 PAX-interacting protein 1 Human genes 0.000 description 1
- 102100037222 PAX3- and PAX7-binding protein 1 Human genes 0.000 description 1
- 102100027496 PC-esterase domain-containing protein 1A Human genes 0.000 description 1
- 102100040140 PCI domain-containing protein 2 Human genes 0.000 description 1
- 102100029181 PDZ and LIM domain protein 5 Human genes 0.000 description 1
- 102100025661 PDZ domain-containing protein 11 Human genes 0.000 description 1
- 150000005857 PFAS Chemical class 0.000 description 1
- 102100031136 PH domain leucine-rich repeat-containing protein phosphatase 2 Human genes 0.000 description 1
- 102100036879 PHD finger protein 1 Human genes 0.000 description 1
- 102100035126 PHD finger protein 11 Human genes 0.000 description 1
- 102100036868 PHD finger protein 12 Human genes 0.000 description 1
- 102100036866 PHD finger protein 14 Human genes 0.000 description 1
- 102100028222 PHD finger protein 21A Human genes 0.000 description 1
- 102100026391 PHD finger protein 3 Human genes 0.000 description 1
- 102100036249 PIH1 domain-containing protein 1 Human genes 0.000 description 1
- 102100026507 PIH1 domain-containing protein 2 Human genes 0.000 description 1
- 102100036257 PIN2/TERF1-interacting telomerase inhibitor 1 Human genes 0.000 description 1
- 102100037482 PMS1 protein homolog 1 Human genes 0.000 description 1
- 102100022769 POC1 centriolar protein homolog B Human genes 0.000 description 1
- 101150045883 POMGNT1 gene Proteins 0.000 description 1
- 102100035593 POU domain, class 2, transcription factor 1 Human genes 0.000 description 1
- 102100036665 POZ-, AT hook-, and zinc finger-containing protein 1 Human genes 0.000 description 1
- 108010015181 PPAR delta Proteins 0.000 description 1
- 102000012643 PPIL2 Human genes 0.000 description 1
- 102100028975 PR domain zinc finger protein 15 Human genes 0.000 description 1
- 102100024885 PR domain zinc finger protein 2 Human genes 0.000 description 1
- 102100024890 PR domain zinc finger protein 4 Human genes 0.000 description 1
- 102100028957 PR domain-containing protein 11 Human genes 0.000 description 1
- 102100038658 PRA1 family protein 2 Human genes 0.000 description 1
- 102100024818 PRELI domain-containing protein 1, mitochondrial Human genes 0.000 description 1
- 102100038730 PRKCA-binding protein Human genes 0.000 description 1
- MIQYPPGTNIFAPO-CABCVRRESA-N PS(6:0/6:0) Chemical compound CCCCCC(=O)OC[C@@H](OC(=O)CCCCC)COP(O)(=O)OC[C@H](N)C(O)=O MIQYPPGTNIFAPO-CABCVRRESA-N 0.000 description 1
- 108010047613 PTB-Associated Splicing Factor Proteins 0.000 description 1
- 102100039157 PTB-containing, cubilin and LRP1-interacting protein Human genes 0.000 description 1
- 108010011536 PTEN Phosphohydrolase Proteins 0.000 description 1
- 102100029733 PWWP domain-containing protein 2A Human genes 0.000 description 1
- 102100027334 Paired amphipathic helix protein Sin3a Human genes 0.000 description 1
- 102100027333 Paired amphipathic helix protein Sin3b Human genes 0.000 description 1
- 108020002591 Palmitoyl protein thioesterase Proteins 0.000 description 1
- 102000005327 Palmitoyl protein thioesterase Human genes 0.000 description 1
- 102100021498 Palmitoyl-protein thioesterase ABHD10, mitochondrial Human genes 0.000 description 1
- 102100028614 Palmitoyltransferase ZDHHC2 Human genes 0.000 description 1
- 102100028615 Palmitoyltransferase ZDHHC4 Human genes 0.000 description 1
- 102100023246 Palmitoyltransferase ZDHHC5 Human genes 0.000 description 1
- 102100023402 Palmitoyltransferase ZDHHC7 Human genes 0.000 description 1
- 102100023491 Palmitoyltransferase ZDHHC8 Human genes 0.000 description 1
- 102100032361 Pannexin-1 Human genes 0.000 description 1
- 101000669384 Papaver somniferum Reticuline N-methyltransferase Proteins 0.000 description 1
- 102100040974 Paraspeckle component 1 Human genes 0.000 description 1
- 102100037499 Parkinson disease protein 7 Human genes 0.000 description 1
- 102100034516 Partner of Y14 and mago Human genes 0.000 description 1
- 102100031252 Patatin-like phospholipase domain-containing protein 4 Human genes 0.000 description 1
- 102100031254 Patatin-like phospholipase domain-containing protein 6 Human genes 0.000 description 1
- 102100039176 Pecanex-like protein 1 Human genes 0.000 description 1
- 102100035845 Peflin Human genes 0.000 description 1
- 102100032227 Pentatricopeptide repeat-containing protein 1, mitochondrial Human genes 0.000 description 1
- 102100035019 Peptide chain release factor 1, mitochondrial Human genes 0.000 description 1
- 102100035038 Peptide chain release factor 1-like, mitochondrial Human genes 0.000 description 1
- 102100038551 Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Human genes 0.000 description 1
- 108010037490 Peptidyl-Prolyl Cis-Trans Isomerase NIMA-Interacting 4 Proteins 0.000 description 1
- 102100037827 Peptidyl-prolyl cis-trans isomerase D Human genes 0.000 description 1
- 102100034844 Peptidyl-prolyl cis-trans isomerase E Human genes 0.000 description 1
- 102100034943 Peptidyl-prolyl cis-trans isomerase F, mitochondrial Human genes 0.000 description 1
- 102100023846 Peptidyl-prolyl cis-trans isomerase FKBP3 Human genes 0.000 description 1
- 102100020739 Peptidyl-prolyl cis-trans isomerase FKBP4 Human genes 0.000 description 1
- 102100036978 Peptidyl-prolyl cis-trans isomerase FKBP8 Human genes 0.000 description 1
- 102100034850 Peptidyl-prolyl cis-trans isomerase G Human genes 0.000 description 1
- 102100038827 Peptidyl-prolyl cis-trans isomerase H Human genes 0.000 description 1
- 102100031653 Peptidyl-prolyl cis-trans isomerase NIMA-interacting 4 Human genes 0.000 description 1
- 102100030867 Peptidyl-tRNA hydrolase 2, mitochondrial Human genes 0.000 description 1
- 102100029221 Peptidyl-tRNA hydrolase ICT1, mitochondrial Human genes 0.000 description 1
- 102100034852 Peptidylprolyl isomerase domain and WD repeat-containing protein 1 Human genes 0.000 description 1
- 102100024315 Pericentrin Human genes 0.000 description 1
- 102000001486 Perilipin-3 Human genes 0.000 description 1
- 108010068633 Perilipin-3 Proteins 0.000 description 1
- 102100034421 Periodic tryptophan protein 2 homolog Human genes 0.000 description 1
- 102100028525 Periphilin-1 Human genes 0.000 description 1
- 102100029139 Peroxiredoxin-1 Human genes 0.000 description 1
- 102100034763 Peroxiredoxin-2 Human genes 0.000 description 1
- 108010077056 Peroxisomal Targeting Signal 2 Receptor Proteins 0.000 description 1
- 102100026798 Peroxisomal acyl-coenzyme A oxidase 1 Human genes 0.000 description 1
- 102100026777 Peroxisomal acyl-coenzyme A oxidase 3 Human genes 0.000 description 1
- 102100038883 Peroxisomal biogenesis factor 19 Human genes 0.000 description 1
- 102100036024 Peroxisomal coenzyme A diphosphatase NUDT7 Human genes 0.000 description 1
- 102100040056 Peroxisomal membrane protein 11A Human genes 0.000 description 1
- 102100040054 Peroxisomal membrane protein 11B Human genes 0.000 description 1
- 102100030555 Peroxisomal membrane protein 4 Human genes 0.000 description 1
- 102100028223 Peroxisomal membrane protein PEX13 Human genes 0.000 description 1
- 102100037476 Peroxisomal membrane protein PEX14 Human genes 0.000 description 1
- 102100037479 Peroxisomal membrane protein PEX16 Human genes 0.000 description 1
- 102100022587 Peroxisomal multifunctional enzyme type 2 Human genes 0.000 description 1
- 102100036598 Peroxisomal targeting signal 1 receptor Human genes 0.000 description 1
- 102100032924 Peroxisomal targeting signal 2 receptor Human genes 0.000 description 1
- 102100032931 Peroxisome assembly factor 2 Human genes 0.000 description 1
- 102100028224 Peroxisome assembly protein 12 Human genes 0.000 description 1
- 102100024925 Peroxisome assembly protein 26 Human genes 0.000 description 1
- 102100038881 Peroxisome biogenesis factor 1 Human genes 0.000 description 1
- 102100030554 Peroxisome biogenesis factor 10 Human genes 0.000 description 1
- 102100038831 Peroxisome proliferator-activated receptor alpha Human genes 0.000 description 1
- 102100038824 Peroxisome proliferator-activated receptor delta Human genes 0.000 description 1
- 102100028961 Peroxisome proliferator-activated receptor gamma coactivator 1-beta Human genes 0.000 description 1
- 102100024620 Peroxisome proliferator-activated receptor gamma coactivator-related protein 1 Human genes 0.000 description 1
- 102100040041 Peroxynitrite isomerase THAP4 Human genes 0.000 description 1
- 102100035816 Pescadillo homolog Human genes 0.000 description 1
- 102100035215 Phenylalanine-tRNA ligase alpha subunit Human genes 0.000 description 1
- 102100035312 Phenylalanine-tRNA ligase beta subunit Human genes 0.000 description 1
- 102100029354 Phenylalanine-tRNA ligase, mitochondrial Human genes 0.000 description 1
- 102100038218 Phosducin-like protein Human genes 0.000 description 1
- 102100035228 Phosphatase and actin regulator 4 Human genes 0.000 description 1
- 101710178746 Phosphatidate cytidylyltransferase 2 Proteins 0.000 description 1
- 102100025731 Phosphatidate phosphatase LPIN1 Human genes 0.000 description 1
- 102100022906 Phosphatidylcholine transfer protein Human genes 0.000 description 1
- 102100022771 Phosphatidylcholine:ceramide cholinephosphotransferase 2 Human genes 0.000 description 1
- 108010030678 Phosphatidylethanolamine N-Methyltransferase Proteins 0.000 description 1
- 102100028489 Phosphatidylethanolamine-binding protein 1 Human genes 0.000 description 1
- 102100037408 Phosphatidylglycerophosphatase and protein-tyrosine phosphatase 1 Human genes 0.000 description 1
- 102100032287 Phosphatidylinositide phosphatase SAC2 Human genes 0.000 description 1
- 102100032543 Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN Human genes 0.000 description 1
- 102100024242 Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Human genes 0.000 description 1
- 102100038329 Phosphatidylinositol 3-kinase catalytic subunit type 3 Human genes 0.000 description 1
- 102100026169 Phosphatidylinositol 3-kinase regulatory subunit alpha Human genes 0.000 description 1
- 102100026177 Phosphatidylinositol 3-kinase regulatory subunit beta Human genes 0.000 description 1
- 102100038332 Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit alpha isoform Human genes 0.000 description 1
- 102100036061 Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit beta isoform Human genes 0.000 description 1
- 102100036161 Phosphatidylinositol 4-kinase alpha Human genes 0.000 description 1
- 102100032619 Phosphatidylinositol 4-kinase beta Human genes 0.000 description 1
- 102100025058 Phosphatidylinositol 4-phosphate 3-kinase C2 domain-containing subunit alpha Human genes 0.000 description 1
- 102100032615 Phosphatidylinositol 4-phosphate 5-kinase type-1 alpha Human genes 0.000 description 1
- 102100036137 Phosphatidylinositol 5-phosphate 4-kinase type-2 beta Human genes 0.000 description 1
- 102100036159 Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma Human genes 0.000 description 1
- 102100036050 Phosphatidylinositol N-acetylglucosaminyltransferase subunit A Human genes 0.000 description 1
- 102100036163 Phosphatidylinositol N-acetylglucosaminyltransferase subunit C Human genes 0.000 description 1
- 102100036162 Phosphatidylinositol N-acetylglucosaminyltransferase subunit H Human genes 0.000 description 1
- 102100035193 Phosphatidylinositol N-acetylglucosaminyltransferase subunit Q Human genes 0.000 description 1
- 102100036331 Phosphatidylinositol N-acetylglucosaminyltransferase subunit Y Human genes 0.000 description 1
- 102100036062 Phosphatidylinositol transfer protein alpha isoform Human genes 0.000 description 1
- 102100036063 Phosphatidylinositol transfer protein beta isoform Human genes 0.000 description 1
- 102100032286 Phosphatidylinositol-3-phosphatase SAC1 Human genes 0.000 description 1
- 102100031014 Phosphatidylinositol-binding clathrin assembly protein Human genes 0.000 description 1
- 102100036247 Phosphatidylinositol-glycan biosynthesis class X protein Human genes 0.000 description 1
- 102100024634 Phosphatidylserine lipase ABHD16A Human genes 0.000 description 1
- 102100024440 Phosphoacetylglucosamine mutase Human genes 0.000 description 1
- 102100026481 Phosphoinositide 3-kinase regulatory subunit 4 Human genes 0.000 description 1
- 102100032572 Phospholipase A-2-activating protein Human genes 0.000 description 1
- 102100040865 Phospholipase A2 group XV Human genes 0.000 description 1
- 102100032983 Phospholipase D2 Human genes 0.000 description 1
- 102100023410 Phospholipid hydroperoxide glutathione peroxidase Human genes 0.000 description 1
- 102100030452 Phospholipid phosphatase 5 Human genes 0.000 description 1
- 102100030384 Phospholipid phosphatase-related protein type 2 Human genes 0.000 description 1
- 102100032943 Phospholipid transfer protein C2CD2L Human genes 0.000 description 1
- 102100032660 Phospholipid-transporting ATPase IG Human genes 0.000 description 1
- 102100032688 Phospholipid-transporting ATPase IH Human genes 0.000 description 1
- 102100024111 Phospholysine phosphohistidine inorganic pyrophosphate phosphatase Human genes 0.000 description 1
- 102100035367 Phosphomannomutase 1 Human genes 0.000 description 1
- 102100035362 Phosphomannomutase 2 Human genes 0.000 description 1
- 102100024279 Phosphomevalonate kinase Human genes 0.000 description 1
- 102100022063 Phosphoribosyl pyrophosphate synthase-associated protein 1 Human genes 0.000 description 1
- 102100022060 Phosphoribosyl pyrophosphate synthase-associated protein 2 Human genes 0.000 description 1
- 102100027330 Phosphoribosylaminoimidazole carboxylase Human genes 0.000 description 1
- 102100036473 Phosphoribosylformylglycinamidine synthase Human genes 0.000 description 1
- 102100033548 Phosphorylase b kinase regulatory subunit alpha, liver isoform Human genes 0.000 description 1
- 102100020854 Phosphorylase b kinase regulatory subunit beta Human genes 0.000 description 1
- 102100021762 Phosphoserine phosphatase Human genes 0.000 description 1
- 108091007412 Piwi-interacting RNA Proteins 0.000 description 1
- 102100035194 Placenta growth factor Human genes 0.000 description 1
- 102100030365 Plakophilin-4 Human genes 0.000 description 1
- 102100037592 Plasmanylethanolamine desaturase Human genes 0.000 description 1
- 102100034055 Plasminogen activator inhibitor 1 RNA-binding protein Human genes 0.000 description 1
- 102100027932 Platelet-activating factor acetylhydrolase 2, cytoplasmic Human genes 0.000 description 1
- 102100039449 Platelet-activating factor acetylhydrolase IB subunit alpha2 Human genes 0.000 description 1
- 102100030655 Platelet-activating factor acetylhydrolase IB subunit beta Human genes 0.000 description 1
- 102100040681 Platelet-derived growth factor C Human genes 0.000 description 1
- 102100030463 Pleckstrin homology domain-containing family B member 2 Human genes 0.000 description 1
- 102100032595 Pleckstrin homology domain-containing family G member 1 Human genes 0.000 description 1
- 102100030349 Pleckstrin homology domain-containing family M member 1 Human genes 0.000 description 1
- 102100036246 Pleckstrin homology domain-containing family M member 2 Human genes 0.000 description 1
- 102100036332 Pleckstrin homology domain-containing family M member 3 Human genes 0.000 description 1
- 102100035968 Pleiotropic regulator 1 Human genes 0.000 description 1
- 102100035380 Plexin-D1 Human genes 0.000 description 1
- 102100034346 Pogo transposable element with KRAB domain Human genes 0.000 description 1
- 102100034345 Pogo transposable element with ZNF domain Human genes 0.000 description 1
- 108010064218 Poly (ADP-Ribose) Polymerase-1 Proteins 0.000 description 1
- 102100023712 Poly [ADP-ribose] polymerase 1 Human genes 0.000 description 1
- 102100023652 Poly [ADP-ribose] polymerase 2 Human genes 0.000 description 1
- 102100037664 Poly [ADP-ribose] polymerase tankyrase-1 Human genes 0.000 description 1
- 102100024380 Poly(A) RNA polymerase GLD2 Human genes 0.000 description 1
- 102100040155 Poly(A) polymerase alpha Human genes 0.000 description 1
- 102100023715 Poly(A)-specific ribonuclease PARN Human genes 0.000 description 1
- 102100032347 Poly(ADP-ribose) glycohydrolase Human genes 0.000 description 1
- 102100033008 Poly(U)-binding-splicing factor PUF60 Human genes 0.000 description 1
- 102100034961 Poly(rC)-binding protein 2 Human genes 0.000 description 1
- 102100034956 Poly(rC)-binding protein 4 Human genes 0.000 description 1
- 102100039427 Polyadenylate-binding protein 2 Human genes 0.000 description 1
- 102100034313 Polyadenylate-binding protein-interacting protein 2 Human genes 0.000 description 1
- 102100035922 Polyamine-modulated factor 1 Human genes 0.000 description 1
- 102100039917 Polyamine-transporting ATPase 13A2 Human genes 0.000 description 1
- 102100040920 Polycomb group RING finger protein 3 Human genes 0.000 description 1
- 102100040916 Polycomb group RING finger protein 5 Human genes 0.000 description 1
- 102100040917 Polycomb group RING finger protein 6 Human genes 0.000 description 1
- 102100029799 Polycomb group protein ASXL1 Human genes 0.000 description 1
- 102100030702 Polycomb protein SUZ12 Human genes 0.000 description 1
- 102100040748 Polyglutamine-binding protein 1 Human genes 0.000 description 1
- 102100030903 Polyhomeotic-like protein 2 Human genes 0.000 description 1
- 102100024168 Polymerase delta-interacting protein 2 Human genes 0.000 description 1
- 102100035460 Polynucleotide 5'-hydroxyl-kinase Human genes 0.000 description 1
- 102100020950 Polypeptide N-acetylgalactosaminyltransferase 2 Human genes 0.000 description 1
- 102100023591 Polyphosphoinositide phosphatase Human genes 0.000 description 1
- 102100033073 Polypyrimidine tract-binding protein 1 Human genes 0.000 description 1
- 102100023504 Polyribonucleotide 5'-hydroxyl-kinase Clp1 Human genes 0.000 description 1
- 101710189720 Porphobilinogen deaminase Proteins 0.000 description 1
- 102100034391 Porphobilinogen deaminase Human genes 0.000 description 1
- 101710170827 Porphobilinogen deaminase, chloroplastic Proteins 0.000 description 1
- 102100030422 Post-GPI attachment to proteins factor 2 Human genes 0.000 description 1
- 101710163352 Potassium voltage-gated channel subfamily H member 4 Proteins 0.000 description 1
- 102100040168 Pre-B-cell leukemia transcription factor 2 Human genes 0.000 description 1
- 102100031755 Pre-mRNA 3'-end-processing factor FIP1 Human genes 0.000 description 1
- 102100033427 Pre-mRNA cleavage complex 2 protein Pcf11 Human genes 0.000 description 1
- 102100028730 Pre-mRNA-processing factor 17 Human genes 0.000 description 1
- 102100029522 Pre-mRNA-processing factor 19 Human genes 0.000 description 1
- 102100025822 Pre-mRNA-processing factor 40 homolog A Human genes 0.000 description 1
- 102100021231 Pre-mRNA-processing-splicing factor 8 Human genes 0.000 description 1
- 102100029436 Pre-mRNA-splicing factor 38B Human genes 0.000 description 1
- 102100023390 Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Human genes 0.000 description 1
- 102100028729 Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16 Human genes 0.000 description 1
- 102100025585 Pre-mRNA-splicing factor CWC25 homolog Human genes 0.000 description 1
- 102100029252 Pre-mRNA-splicing factor SLU7 Human genes 0.000 description 1
- 102100036347 Pre-mRNA-splicing factor SPF27 Human genes 0.000 description 1
- 102100037901 Pre-mRNA-splicing factor SYF2 Human genes 0.000 description 1
- 102100026431 Pre-mRNA-splicing regulator WTAP Human genes 0.000 description 1
- 102100038255 Prefoldin subunit 1 Human genes 0.000 description 1
- 102100024920 Prefoldin subunit 2 Human genes 0.000 description 1
- 102100024884 Prefoldin subunit 3 Human genes 0.000 description 1
- 102100025542 Prefoldin subunit 4 Human genes 0.000 description 1
- 102100025513 Prefoldin subunit 5 Human genes 0.000 description 1
- 102100032926 Prefoldin subunit 6 Human genes 0.000 description 1
- 102100022033 Presenilin-1 Human genes 0.000 description 1
- 102100022036 Presenilin-2 Human genes 0.000 description 1
- 102100027142 Probable 18S rRNA (guanine-N(7))-methyltransferase Human genes 0.000 description 1
- 102100022407 Probable 28S rRNA (cytosine(4447)-C(5))-methyltransferase Human genes 0.000 description 1
- 102100025897 Probable ATP-dependent RNA helicase DDX10 Human genes 0.000 description 1
- 102100021409 Probable ATP-dependent RNA helicase DDX17 Human genes 0.000 description 1
- 102100026136 Probable ATP-dependent RNA helicase DDX23 Human genes 0.000 description 1
- 102100033405 Probable ATP-dependent RNA helicase DDX27 Human genes 0.000 description 1
- 102100035727 Probable ATP-dependent RNA helicase DDX41 Human genes 0.000 description 1
- 102100035725 Probable ATP-dependent RNA helicase DDX46 Human genes 0.000 description 1
- 102100024771 Probable ATP-dependent RNA helicase DDX47 Human genes 0.000 description 1
- 102100037434 Probable ATP-dependent RNA helicase DDX5 Human genes 0.000 description 1
- 102100038267 Probable ATP-dependent RNA helicase DDX52 Human genes 0.000 description 1
- 102100037436 Probable ATP-dependent RNA helicase DDX59 Human genes 0.000 description 1
- 102100029480 Probable ATP-dependent RNA helicase DDX6 Human genes 0.000 description 1
- 102100022424 Probable ATP-dependent RNA helicase DHX35 Human genes 0.000 description 1
- 102100030094 Probable ATP-dependent RNA helicase DHX40 Human genes 0.000 description 1
- 102100028693 Probable C-mannosyltransferase DPY19L1 Human genes 0.000 description 1
- 102100028677 Probable C-mannosyltransferase DPY19L3 Human genes 0.000 description 1
- 102100034679 Probable E3 ubiquitin-protein ligase HECTD4 Human genes 0.000 description 1
- 102100034747 Probable E3 ubiquitin-protein ligase HERC1 Human genes 0.000 description 1
- 102100039910 Probable E3 ubiquitin-protein ligase HERC3 Human genes 0.000 description 1
- 102100039913 Probable E3 ubiquitin-protein ligase HERC4 Human genes 0.000 description 1
- 102100026310 Probable E3 ubiquitin-protein ligase MID2 Human genes 0.000 description 1
- 102100037169 Probable JmjC domain-containing histone demethylation protein 2C Human genes 0.000 description 1
- 102100029246 Probable RNA-binding protein 19 Human genes 0.000 description 1
- 102100027483 Probable RNA-binding protein 23 Human genes 0.000 description 1
- 102100037234 Probable RNA-binding protein EIF1AD Human genes 0.000 description 1
- 102100038592 Probable U3 small nucleolar RNA-associated protein 11 Human genes 0.000 description 1
- 101710136728 Probable UDP-arabinopyranose mutase 1 Proteins 0.000 description 1
- 102100027191 Probable aminopeptidase NPEPL1 Human genes 0.000 description 1
- 102100033917 Probable asparagine-tRNA ligase, mitochondrial Human genes 0.000 description 1
- 102100038011 Probable dimethyladenosine transferase Human genes 0.000 description 1
- 102100026610 Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Human genes 0.000 description 1
- 102100029532 Probable fibrosin-1 Human genes 0.000 description 1
- 101710155795 Probable folylpolyglutamate synthase Proteins 0.000 description 1
- 102100031021 Probable global transcription activator SNF2L2 Human genes 0.000 description 1
- 102100026125 Probable glutamate-tRNA ligase, mitochondrial Human genes 0.000 description 1
- 102100027178 Probable helicase senataxin Human genes 0.000 description 1
- 102100031018 Probable helicase with zinc finger domain Human genes 0.000 description 1
- 102100025214 Probable methyltransferase TARBP1 Human genes 0.000 description 1
- 102100038289 Probable methyltransferase-like protein 23 Human genes 0.000 description 1
- 102100032871 Probable mitochondrial glutathione transporter SLC25A39 Human genes 0.000 description 1
- 101710101698 Probable mitochondrial pyruvate carrier 2 Proteins 0.000 description 1
- 102100036829 Probable peptidyl-tRNA hydrolase Human genes 0.000 description 1
- 101710100896 Probable porphobilinogen deaminase Proteins 0.000 description 1
- 102100032223 Probable rRNA-processing protein EBP2 Human genes 0.000 description 1
- 102100033874 Probable sodium-coupled neutral amino acid transporter 6 Human genes 0.000 description 1
- 102100037775 Probable tRNA N6-adenosine threonylcarbamoyltransferase Human genes 0.000 description 1
- 102100035064 Probable tRNA(His) guanylyltransferase Human genes 0.000 description 1
- 102100038603 Probable ubiquitin carboxyl-terminal hydrolase FAF-X Human genes 0.000 description 1
- 102100035199 Procollagen glycosyltransferase Human genes 0.000 description 1
- 102100035202 Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Human genes 0.000 description 1
- 206010036790 Productive cough Diseases 0.000 description 1
- 102100028857 Profilin-1 Human genes 0.000 description 1
- 102100033344 Programmed cell death 6-interacting protein Human genes 0.000 description 1
- 102100040676 Programmed cell death protein 2 Human genes 0.000 description 1
- 102100034807 Programmed cell death protein 5 Human genes 0.000 description 1
- 102100034785 Programmed cell death protein 6 Human genes 0.000 description 1
- 102100034694 Programmed cell death protein 7 Human genes 0.000 description 1
- 102100031156 Prohibitin-2 Human genes 0.000 description 1
- 102100040658 Prolactin regulatory element-binding protein Human genes 0.000 description 1
- 102100036691 Proliferating cell nuclear antigen Human genes 0.000 description 1
- 102100026899 Proliferation-associated protein 2G4 Human genes 0.000 description 1
- 102100029499 Proline and serine-rich protein 3 Human genes 0.000 description 1
- 102100034729 Proline-, glutamic acid- and leucine-rich protein 1 Human genes 0.000 description 1
- 102100024091 Proline-rich AKT1 substrate 1 Human genes 0.000 description 1
- 102100037393 Proline-rich nuclear receptor coactivator 2 Human genes 0.000 description 1
- 102100040829 Proline-rich protein PRCC Human genes 0.000 description 1
- 102100034144 Prolyl 3-hydroxylase 1 Human genes 0.000 description 1
- 102100040477 Prolyl 4-hydroxylase subunit alpha-1 Human genes 0.000 description 1
- 102100039025 Propionyl-CoA carboxylase beta chain, mitochondrial Human genes 0.000 description 1
- 102100038950 Proprotein convertase subtilisin/kexin type 7 Human genes 0.000 description 1
- 102100030484 Prostaglandin E synthase 2 Human genes 0.000 description 1
- 102100028642 Prostaglandin E synthase 3 Human genes 0.000 description 1
- 102100039279 Prostate tumor-overexpressed gene 1 protein Human genes 0.000 description 1
- 102100025013 Prostate-associated microseminoprotein Human genes 0.000 description 1
- 102100029959 Proteasomal ATPase-associated factor 1 Human genes 0.000 description 1
- 102100031299 Proteasome activator complex subunit 2 Human genes 0.000 description 1
- 102100031298 Proteasome activator complex subunit 3 Human genes 0.000 description 1
- 102100031297 Proteasome activator complex subunit 4 Human genes 0.000 description 1
- 102100041010 Proteasome assembly chaperone 3 Human genes 0.000 description 1
- 102100041012 Proteasome assembly chaperone 4 Human genes 0.000 description 1
- 102100040364 Proteasome subunit alpha type-2 Human genes 0.000 description 1
- 102100035908 Proteasome subunit alpha type-3 Human genes 0.000 description 1
- 102100028813 Proteasome subunit alpha type-4 Human genes 0.000 description 1
- 102100029270 Proteasome subunit alpha type-5 Human genes 0.000 description 1
- 102100034664 Proteasome subunit alpha type-6 Human genes 0.000 description 1
- 102100021201 Proteasome subunit alpha type-7 Human genes 0.000 description 1
- 102100031566 Proteasome subunit beta type-1 Human genes 0.000 description 1
- 102100040400 Proteasome subunit beta type-2 Human genes 0.000 description 1
- 102100033755 Proteasome subunit beta type-3 Human genes 0.000 description 1
- 102100033190 Proteasome subunit beta type-4 Human genes 0.000 description 1
- 102100036127 Proteasome subunit beta type-5 Human genes 0.000 description 1
- 102100036128 Proteasome subunit beta type-6 Human genes 0.000 description 1
- 102100035763 Proteasome subunit beta type-7 Human genes 0.000 description 1
- 102100038745 Protection of telomeres protein 1 Human genes 0.000 description 1
- 102100020958 Protein AAR2 homolog Human genes 0.000 description 1
- 102100034180 Protein AATF Human genes 0.000 description 1
- 102100021499 Protein ABHD11 Human genes 0.000 description 1
- 102100024648 Protein ABHD14A Human genes 0.000 description 1
- 102100038051 Protein ABHD18 Human genes 0.000 description 1
- 102100026286 Protein AF-10 Human genes 0.000 description 1
- 102100040265 Protein Abitram Human genes 0.000 description 1
- 102100021567 Protein BANP Human genes 0.000 description 1
- 102100030143 Protein BRAWNIN Human genes 0.000 description 1
- 102100030160 Protein BUD31 homolog Human genes 0.000 description 1
- 102100021890 Protein C-ets-2 Human genes 0.000 description 1
- 102100032608 Protein C19orf12 Human genes 0.000 description 1
- 102100030064 Protein C1orf43 Human genes 0.000 description 1
- 102100035601 Protein CASC3 Human genes 0.000 description 1
- 102100040781 Protein CCSMST1 Human genes 0.000 description 1
- 102100024449 Protein CDV3 homolog Human genes 0.000 description 1
- 102100034718 Protein CLEC16A Human genes 0.000 description 1
- 102100027796 Protein CREG1 Human genes 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 102100036046 Protein CutA Human genes 0.000 description 1
- 108010032428 Protein Deglycase DJ-1 Proteins 0.000 description 1
- 102100033963 Protein EFR3 homolog A Human genes 0.000 description 1
- 102100037113 Protein ELYS Human genes 0.000 description 1
- 102100031946 Protein EOLA1 Human genes 0.000 description 1
- 102100030750 Protein EOLA2 Human genes 0.000 description 1
- 102100040252 Protein ERGIC-53 Human genes 0.000 description 1
- 102100030896 Protein FAM104B Human genes 0.000 description 1
- 102100023783 Protein FAM118A Human genes 0.000 description 1
- 102100038971 Protein FAM133B Human genes 0.000 description 1
- 102100039003 Protein FAM135A Human genes 0.000 description 1
- 102100030557 Protein FAM13A Human genes 0.000 description 1
- 102100023788 Protein FAM162A Human genes 0.000 description 1
- 102100020938 Protein FAM168A Human genes 0.000 description 1
- 102100022628 Protein FAM174C Human genes 0.000 description 1
- 102100037216 Protein FAM177A1 Human genes 0.000 description 1
- 102100035455 Protein FAM185A Human genes 0.000 description 1
- 102100023844 Protein FAM189B Human genes 0.000 description 1
- 102100023842 Protein FAM193A Human genes 0.000 description 1
- 102100034506 Protein FAM193B Human genes 0.000 description 1
- 102100038860 Protein FAM204A Human genes 0.000 description 1
- 102100038863 Protein FAM210A Human genes 0.000 description 1
- 102100038922 Protein FAM32A Human genes 0.000 description 1
- 102100040819 Protein FAM3A Human genes 0.000 description 1
- 102100038926 Protein FAM50A Human genes 0.000 description 1
- 102100038927 Protein FAM50B Human genes 0.000 description 1
- 102100037526 Protein FAM53C Human genes 0.000 description 1
- 102100026751 Protein FAM8A1 Human genes 0.000 description 1
- 102100026734 Protein FAM98A Human genes 0.000 description 1
- 102100022569 Protein FAM98B Human genes 0.000 description 1
- 102100028387 Protein FRG1 Human genes 0.000 description 1
- 102100034143 Protein GPR107 Human genes 0.000 description 1
- 102100034142 Protein GPR108 Human genes 0.000 description 1
- 102100030473 Protein HIRA Human genes 0.000 description 1
- 102100032831 Protein ITPRID2 Human genes 0.000 description 1
- 108010038241 Protein Inhibitors of Activated STAT Proteins 0.000 description 1
- 102100032707 Protein Jade-3 Human genes 0.000 description 1
- 102100023409 Protein KHNYN Human genes 0.000 description 1
- 102100037163 Protein KIAA0100 Human genes 0.000 description 1
- 102100028259 Protein LSM14 homolog A Human genes 0.000 description 1
- 102100024087 Protein Lines homolog 1 Human genes 0.000 description 1
- 102100032473 Protein MANBAL Human genes 0.000 description 1
- 102100030327 Protein MIS12 homolog Human genes 0.000 description 1
- 102100028174 Protein MIX23 Human genes 0.000 description 1
- 102100023396 Protein MON2 homolog Human genes 0.000 description 1
- 102100028951 Protein MTSS 1 Human genes 0.000 description 1
- 102100021273 Protein Mpv17 Human genes 0.000 description 1
- 102100035607 Protein N-lysine methyltransferase METTL21A Human genes 0.000 description 1
- 102100035512 Protein N-lysine methyltransferase METTL21D Human genes 0.000 description 1
- 102100034233 Protein N-terminal asparagine amidohydrolase Human genes 0.000 description 1
- 102100030122 Protein O-GlcNAcase Human genes 0.000 description 1
- 102100036226 Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1 Human genes 0.000 description 1
- 102100028120 Protein O-mannosyl-transferase 1 Human genes 0.000 description 1
- 102100033737 Protein O-mannosyl-transferase TMTC4 Human genes 0.000 description 1
- 102100034054 Protein PALS1 Human genes 0.000 description 1
- 102100040170 Protein PBDC1 Human genes 0.000 description 1
- 102100031244 Protein PET100 homolog, mitochondrial Human genes 0.000 description 1
- 102100033074 Protein PET117 homolog, mitochondrial Human genes 0.000 description 1
- 102100034616 Protein POLR1D, isoform 2 Human genes 0.000 description 1
- 102100033954 Protein PRRC2A Human genes 0.000 description 1
- 102100033953 Protein PRRC2B Human genes 0.000 description 1
- 102100033952 Protein PRRC2C Human genes 0.000 description 1
- 102100033976 Protein RRP5 homolog Human genes 0.000 description 1
- 102100036452 Protein RUFY3 Human genes 0.000 description 1
- 102100020876 Protein SCAF11 Human genes 0.000 description 1
- 102100035546 Protein SCO2 homolog, mitochondrial Human genes 0.000 description 1
- 102100021725 Protein SEC13 homolog Human genes 0.000 description 1
- 102100037271 Protein SFI1 homolog Human genes 0.000 description 1
- 102100037337 Protein SGT1 homolog Human genes 0.000 description 1
- 102100025575 Protein SYS1 homolog Human genes 0.000 description 1
- 102100028545 Protein TALPID3 Human genes 0.000 description 1
- 102100035191 Protein TASOR Human genes 0.000 description 1
- 102100035171 Protein TASOR 2 Human genes 0.000 description 1
- 102100022429 Protein TMEPAI Human genes 0.000 description 1
- 102100029345 Protein TSSC4 Human genes 0.000 description 1
- 102100027546 Protein WWC3 Human genes 0.000 description 1
- 102100039144 Protein YIF1B Human genes 0.000 description 1
- 102100028077 Protein YIPF3 Human genes 0.000 description 1
- 102100030950 Protein YIPF5 Human genes 0.000 description 1
- 102100030938 Protein YIPF6 Human genes 0.000 description 1
- 102100037689 Protein adenylyltransferase FICD Human genes 0.000 description 1
- 102100022985 Protein arginine N-methyltransferase 1 Human genes 0.000 description 1
- 102100034603 Protein arginine N-methyltransferase 3 Human genes 0.000 description 1
- 102100034607 Protein arginine N-methyltransferase 5 Human genes 0.000 description 1
- 101710084427 Protein arginine N-methyltransferase 5 Proteins 0.000 description 1
- 102100026297 Protein arginine N-methyltransferase 7 Human genes 0.000 description 1
- 102100034183 Protein argonaute-1 Human genes 0.000 description 1
- 102100032661 Protein asteroid homolog 1 Human genes 0.000 description 1
- 102100035900 Protein bicaudal D homolog 2 Human genes 0.000 description 1
- 102100022050 Protein canopy homolog 2 Human genes 0.000 description 1
- 102100026774 Protein chibby homolog 1 Human genes 0.000 description 1
- 102100022049 Protein cornichon homolog 1 Human genes 0.000 description 1
- 102100024517 Protein cornichon homolog 4 Human genes 0.000 description 1
- 102100036469 Protein diaphanous homolog 2 Human genes 0.000 description 1
- 102100029371 Protein disulfide isomerase CRELD1 Human genes 0.000 description 1
- 102100029370 Protein disulfide isomerase CRELD2 Human genes 0.000 description 1
- 102100036352 Protein disulfide-isomerase Human genes 0.000 description 1
- 102100037097 Protein disulfide-isomerase A3 Human genes 0.000 description 1
- 102100037061 Protein disulfide-isomerase A6 Human genes 0.000 description 1
- 102100030728 Protein disulfide-thiol oxidoreductase Human genes 0.000 description 1
- 102100029936 Protein dopey-1 Human genes 0.000 description 1
- 102100029929 Protein dopey-2 Human genes 0.000 description 1
- 102100027569 Protein farnesyltransferase subunit beta Human genes 0.000 description 1
- 102100035480 Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha Human genes 0.000 description 1
- 102100020916 Protein furry homolog-like Human genes 0.000 description 1
- 102100024924 Protein kinase C alpha type Human genes 0.000 description 1
- 102100026843 Protein kinase C and casein kinase substrate in neurons protein 2 Human genes 0.000 description 1
- 102100021557 Protein kinase C iota type Human genes 0.000 description 1
- 102100035697 Protein kinase C-binding protein 1 Human genes 0.000 description 1
- 102100022660 Protein kintoun Human genes 0.000 description 1
- 102100024139 Protein lifeguard 1 Human genes 0.000 description 1
- 102100024094 Protein lifeguard 4 Human genes 0.000 description 1
- 102100025689 Protein lin-52 homolog Human genes 0.000 description 1
- 102100025692 Protein lin-54 homolog Human genes 0.000 description 1
- 102100026740 Protein mago nashi homolog Human genes 0.000 description 1
- 102100040905 Protein mono-ADP-ribosyltransferase PARP16 Human genes 0.000 description 1
- 102100034935 Protein mono-ADP-ribosyltransferase PARP3 Human genes 0.000 description 1
- 102100034930 Protein mono-ADP-ribosyltransferase PARP9 Human genes 0.000 description 1
- 102100034905 Protein mono-ADP-ribosyltransferase TIPARP Human genes 0.000 description 1
- 102100035450 Protein odr-4 homolog Human genes 0.000 description 1
- 102100035620 Protein phosphatase 1 regulatory subunit 12C Human genes 0.000 description 1
- 102100038671 Protein phosphatase 1 regulatory subunit 21 Human genes 0.000 description 1
- 102100028562 Protein phosphatase 1 regulatory subunit 3E Human genes 0.000 description 1
- 102100038755 Protein phosphatase 1 regulatory subunit 7 Human genes 0.000 description 1
- 102100038702 Protein phosphatase 1B Human genes 0.000 description 1
- 102100038675 Protein phosphatase 1D Human genes 0.000 description 1
- 102100037834 Protein phosphatase methylesterase 1 Human genes 0.000 description 1
- 102100040911 Protein prenyltransferase alpha subunit repeat-containing protein 1 Human genes 0.000 description 1
- 102100021674 Protein scribble homolog Human genes 0.000 description 1
- 102100023159 Protein sel-1 homolog 1 Human genes 0.000 description 1
- 102100030908 Protein shisa-5 Human genes 0.000 description 1
- 102100030293 Protein spinster homolog 1 Human genes 0.000 description 1
- 102100031479 Protein transport protein Sec16A Human genes 0.000 description 1
- 102100023365 Protein transport protein Sec23A Human genes 0.000 description 1
- 102100023366 Protein transport protein Sec23B Human genes 0.000 description 1
- 102100023368 Protein transport protein Sec24A Human genes 0.000 description 1
- 102100023146 Protein transport protein Sec24B Human genes 0.000 description 1
- 102100022538 Protein transport protein Sec24C Human genes 0.000 description 1
- 102100022542 Protein transport protein Sec24D Human genes 0.000 description 1
- 102100034271 Protein transport protein Sec61 subunit alpha isoform 1 Human genes 0.000 description 1
- 102100036308 Protein transport protein Sec61 subunit beta Human genes 0.000 description 1
- 102100036306 Protein transport protein Sec61 subunit gamma Human genes 0.000 description 1
- 102100024602 Protein tyrosine phosphatase type IVA 2 Human genes 0.000 description 1
- 102100036229 Protein unc-119 homolog B Human genes 0.000 description 1
- 102100040294 Protein unc-50 homolog Human genes 0.000 description 1
- 102100038288 Protein virilizer homolog Human genes 0.000 description 1
- 102100028367 Protein yippee-like 2 Human genes 0.000 description 1
- 102100033430 Protein-L-isoaspartate O-methyltransferase domain-containing protein 2 Human genes 0.000 description 1
- 102100031674 Protein-L-isoaspartate(D-aspartate) O-methyltransferase Human genes 0.000 description 1
- 102100035033 Protein-S-isoprenylcysteine O-methyltransferase Human genes 0.000 description 1
- 102100028087 Protein-tyrosine sulfotransferase 2 Human genes 0.000 description 1
- 102100033543 Proton-transporting V-type ATPase complex assembly regulator TMEM9 Human genes 0.000 description 1
- 102100026403 Protrudin Human genes 0.000 description 1
- 208000003251 Pruritus Diseases 0.000 description 1
- 102100039391 Pseudouridine-5'-phosphatase Human genes 0.000 description 1
- 108010007100 Pulmonary Surfactant-Associated Protein A Proteins 0.000 description 1
- 102100027358 Pumilio homolog 3 Human genes 0.000 description 1
- 102100033192 Puromycin-sensitive aminopeptidase Human genes 0.000 description 1
- 102100040383 Putative Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase Human genes 0.000 description 1
- 102100029460 Putative E3 ubiquitin-protein ligase UNKL Human genes 0.000 description 1
- 102100031409 Putative RNA-binding protein 15B Human genes 0.000 description 1
- 102100027435 Putative RNA-binding protein Luc7-like 2 Human genes 0.000 description 1
- 102100032337 Putative bifunctional UDP-N-acetylglucosamine transferase and deubiquitinase ALG13 Human genes 0.000 description 1
- 102100040260 Putative deoxyribonuclease TATDN2 Human genes 0.000 description 1
- 102100040246 Putative deoxyribonuclease TATDN3 Human genes 0.000 description 1
- 101710151871 Putative folylpolyglutamate synthase Proteins 0.000 description 1
- 102100029317 Putative methyltransferase C9orf114 Human genes 0.000 description 1
- 102100030016 Putative monooxygenase p33MONOX Human genes 0.000 description 1
- 102100033217 Putative peptidyl-tRNA hydrolase PTRHD1 Human genes 0.000 description 1
- 102100036164 Putative phospholipase B-like 2 Human genes 0.000 description 1
- 102100029728 Putative ribosome-binding factor A, mitochondrial Human genes 0.000 description 1
- 102100021483 Putative sodium-coupled neutral amino acid transporter 10 Human genes 0.000 description 1
- 102100040688 Putative tRNA (cytidine(32)/guanosine(34)-2'-O)-methyltransferase Human genes 0.000 description 1
- 102100038549 Putative transferase CAF17, mitochondrial Human genes 0.000 description 1
- 102100024909 Putative transmembrane protein 183BP Human genes 0.000 description 1
- 102100021011 Putative ubiquitin-conjugating enzyme E2 N-like Human genes 0.000 description 1
- 102100032774 Putative uncharacterized protein LINC02693 Human genes 0.000 description 1
- 102100024487 Pyridoxal phosphate homeostasis protein Human genes 0.000 description 1
- 102100034759 Pyridoxal-dependent decarboxylase domain-containing protein 1 Human genes 0.000 description 1
- 102100031108 Pyroglutamyl-peptidase 1 Human genes 0.000 description 1
- 102100039450 Pyrroline-5-carboxylate reductase 2 Human genes 0.000 description 1
- 102100035711 Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Human genes 0.000 description 1
- 102100035459 Pyruvate dehydrogenase protein X component, mitochondrial Human genes 0.000 description 1
- 102100038386 R3H and coiled-coil domain-containing protein 1 Human genes 0.000 description 1
- 102100038382 R3H domain-containing protein 1 Human genes 0.000 description 1
- 102100038384 R3H domain-containing protein 2 Human genes 0.000 description 1
- 102100030255 RAB6A-GEF complex partner protein 2 Human genes 0.000 description 1
- 102100033810 RAC-alpha serine/threonine-protein kinase Human genes 0.000 description 1
- 102100032315 RAC-beta serine/threonine-protein kinase Human genes 0.000 description 1
- 102100033479 RAF proto-oncogene serine/threonine-protein kinase Human genes 0.000 description 1
- 102100038422 RB-associated KRAB zinc finger protein Human genes 0.000 description 1
- 102100023588 RB1-inducible coiled-coil protein 1 Human genes 0.000 description 1
- 102100024864 REST corepressor 1 Human genes 0.000 description 1
- 102100024871 REST corepressor 3 Human genes 0.000 description 1
- 101150020518 RHEB gene Proteins 0.000 description 1
- 101150111584 RHOA gene Proteins 0.000 description 1
- 102100025427 RING finger and CHY zinc finger domain-containing protein 1 Human genes 0.000 description 1
- 102100033605 RING finger protein 10 Human genes 0.000 description 1
- 102100034186 RING finger protein 11 Human genes 0.000 description 1
- 102100021764 RING finger protein 141 Human genes 0.000 description 1
- 102100026364 RING finger protein 145 Human genes 0.000 description 1
- 102100034832 RING finger protein 214 Human genes 0.000 description 1
- 102100026249 RING finger protein 37 Human genes 0.000 description 1
- 101710178916 RING-box protein 1 Proteins 0.000 description 1
- 102100023874 RING-box protein 2 Human genes 0.000 description 1
- 102100029760 RING1 and YY1-binding protein Human genes 0.000 description 1
- 102100026965 RISC-loading complex subunit TARBP2 Human genes 0.000 description 1
- 102100029143 RNA 3'-terminal phosphate cyclase Human genes 0.000 description 1
- 102100027566 RNA 3'-terminal phosphate cyclase-like protein Human genes 0.000 description 1
- 102100027429 RNA binding motif protein, X-linked-like-1 Human genes 0.000 description 1
- 102100021555 RNA cytosine C(5)-methyltransferase NSUN2 Human genes 0.000 description 1
- 102100039083 RNA demethylase ALKBH5 Human genes 0.000 description 1
- 102100023750 RNA polymerase II elongation factor ELL2 Human genes 0.000 description 1
- 102100027669 RNA polymerase II subunit A C-terminal domain phosphatase Human genes 0.000 description 1
- 102100034620 RNA polymerase II-associated protein 1 Human genes 0.000 description 1
- 102100034617 RNA polymerase II-associated protein 3 Human genes 0.000 description 1
- 102100039525 RNA polymerase-associated protein CTR9 homolog Human genes 0.000 description 1
- 102100034463 RNA polymerase-associated protein RTF1 homolog Human genes 0.000 description 1
- 102100027122 RNA transcription, translation and transport factor protein Human genes 0.000 description 1
- 102100024939 RNA-binding motif protein, X chromosome Human genes 0.000 description 1
- 102100040028 RNA-binding motif protein, X-linked 2 Human genes 0.000 description 1
- 102100027514 RNA-binding protein 10 Human genes 0.000 description 1
- 102100027512 RNA-binding protein 12 Human genes 0.000 description 1
- 102100029250 RNA-binding protein 14 Human genes 0.000 description 1
- 102100029244 RNA-binding protein 15 Human genes 0.000 description 1
- 102100025872 RNA-binding protein 28 Human genes 0.000 description 1
- 102100025870 RNA-binding protein 34 Human genes 0.000 description 1
- 102100025858 RNA-binding protein 39 Human genes 0.000 description 1
- 102100038153 RNA-binding protein 4 Human genes 0.000 description 1
- 102100023862 RNA-binding protein 41 Human genes 0.000 description 1
- 102100038152 RNA-binding protein 5 Human genes 0.000 description 1
- 102100038150 RNA-binding protein 6 Human genes 0.000 description 1
- 102100038149 RNA-binding protein 7 Human genes 0.000 description 1
- 102100039691 RNA-binding protein 8A Human genes 0.000 description 1
- 102000004229 RNA-binding protein EWS Human genes 0.000 description 1
- 108090000740 RNA-binding protein EWS Proteins 0.000 description 1
- 102100022491 RNA-binding protein NOB1 Human genes 0.000 description 1
- 102100023433 RNA-binding protein RO60 Human genes 0.000 description 1
- 102100025052 RNA-binding protein Raly Human genes 0.000 description 1
- 102100034776 RNA-splicing ligase RtcB homolog Human genes 0.000 description 1
- 102100037566 RNA/RNP complex-1-interacting phosphatase Human genes 0.000 description 1
- 108091007364 RNF139 Proteins 0.000 description 1
- 102000001152 RNF14 Human genes 0.000 description 1
- 102000056817 RNF5 Human genes 0.000 description 1
- 102000004910 RNF8 Human genes 0.000 description 1
- 102100022419 RPA-interacting protein Human genes 0.000 description 1
- 102100023535 RRP12-like protein Human genes 0.000 description 1
- 238000010240 RT-PCR analysis Methods 0.000 description 1
- 102100036446 RUN and FYVE domain-containing protein 1 Human genes 0.000 description 1
- 102100021515 RWD domain-containing protein 1 Human genes 0.000 description 1
- 102100025673 RWD domain-containing protein 2B Human genes 0.000 description 1
- 102100021509 RWD domain-containing protein 3 Human genes 0.000 description 1
- 102100034335 Rab GDP dissociation inhibitor alpha Human genes 0.000 description 1
- 102100034328 Rab GDP dissociation inhibitor beta Human genes 0.000 description 1
- 102100031523 Rab GTPase-binding effector protein 1 Human genes 0.000 description 1
- 102100021312 Rab11 family-interacting protein 3 Human genes 0.000 description 1
- 102000020140 Rab12 Human genes 0.000 description 1
- 108050007545 Rab20 Proteins 0.000 description 1
- 102000020171 Rab20 Human genes 0.000 description 1
- 102000020146 Rab21 Human genes 0.000 description 1
- 102000028671 Rab24 Human genes 0.000 description 1
- 102100029548 Rab3 GTPase-activating protein catalytic subunit Human genes 0.000 description 1
- 102100033185 Rab3 GTPase-activating protein non-catalytic subunit Human genes 0.000 description 1
- 108050007316 Rab35 Proteins 0.000 description 1
- 102000028593 Rab35 Human genes 0.000 description 1
- 102100022851 Rab5 GDP/GTP exchange factor Human genes 0.000 description 1
- 102100031543 Rab9 effector protein with kelch motifs Human genes 0.000 description 1
- 102100040160 Rabankyrin-5 Human genes 0.000 description 1
- 102100022151 Ragulator complex protein LAMTOR1 Human genes 0.000 description 1
- 102100022154 Ragulator complex protein LAMTOR2 Human genes 0.000 description 1
- 102100040885 Ragulator complex protein LAMTOR3 Human genes 0.000 description 1
- 102100033372 Ragulator complex protein LAMTOR4 Human genes 0.000 description 1
- 102100033373 Ragulator complex protein LAMTOR5 Human genes 0.000 description 1
- 102100032786 Ral guanine nucleotide dissociation stimulator-like 2 Human genes 0.000 description 1
- 102100037881 RalBP1-associated Eps domain-containing protein 1 Human genes 0.000 description 1
- 102100038473 Ran GTPase-activating protein 1 Human genes 0.000 description 1
- 102100027976 Ran guanine nucleotide release factor Human genes 0.000 description 1
- 102100033975 Ran-binding protein 3 Human genes 0.000 description 1
- 102100036012 Ran-binding protein 6 Human genes 0.000 description 1
- 102100033982 Ran-binding protein 9 Human genes 0.000 description 1
- 102100039790 Ran-specific GTPase-activating protein Human genes 0.000 description 1
- 101710179353 Ran-specific GTPase-activating protein Proteins 0.000 description 1
- 101710180752 Ran-specific GTPase-activating protein 1 Proteins 0.000 description 1
- 101150020444 Ranbp3 gene Proteins 0.000 description 1
- 101150085698 Ranbp6 gene Proteins 0.000 description 1
- 101150070864 Rangap1 gene Proteins 0.000 description 1
- 102100034589 Rap guanine nucleotide exchange factor 1 Human genes 0.000 description 1
- 102100034585 Rap guanine nucleotide exchange factor 2 Human genes 0.000 description 1
- 102100034329 Rap1 GTPase-GDP dissociation stimulator 1 Human genes 0.000 description 1
- 102100040854 Ras GTPase-activating protein-binding protein 1 Human genes 0.000 description 1
- 102100040857 Ras GTPase-activating protein-binding protein 2 Human genes 0.000 description 1
- 102100031490 Ras and Rab interactor 2 Human genes 0.000 description 1
- 102100025001 Ras-related GTP-binding protein A Human genes 0.000 description 1
- 102100025006 Ras-related GTP-binding protein B Human genes 0.000 description 1
- 102100025009 Ras-related GTP-binding protein C Human genes 0.000 description 1
- 102100025003 Ras-related protein R-Ras2 Human genes 0.000 description 1
- 102100039103 Ras-related protein Rab-10 Human genes 0.000 description 1
- 102100022873 Ras-related protein Rab-11A Human genes 0.000 description 1
- 102100028149 Ras-related protein Rab-18 Human genes 0.000 description 1
- 102100028191 Ras-related protein Rab-1A Human genes 0.000 description 1
- 102100034489 Ras-related protein Rab-28 Human genes 0.000 description 1
- 102100034485 Ras-related protein Rab-2A Human genes 0.000 description 1
- 102100027917 Ras-related protein Rab-2B Human genes 0.000 description 1
- 102100029539 Ras-related protein Rab-40C Human genes 0.000 description 1
- 102100039099 Ras-related protein Rab-4A Human genes 0.000 description 1
- 102100039101 Ras-related protein Rab-4B Human genes 0.000 description 1
- 102100039100 Ras-related protein Rab-5A Human genes 0.000 description 1
- 102100025132 Ras-related protein Rab-5B Human genes 0.000 description 1
- 102100025138 Ras-related protein Rab-5C Human genes 0.000 description 1
- 102100030020 Ras-related protein Rab-6D Human genes 0.000 description 1
- 102100030019 Ras-related protein Rab-7a Human genes 0.000 description 1
- 102100033966 Ras-related protein Rab-9A Human genes 0.000 description 1
- 102100031424 Ras-related protein Ral-A Human genes 0.000 description 1
- 102100031425 Ras-related protein Ral-B Human genes 0.000 description 1
- 102100030706 Ras-related protein Rap-1A Human genes 0.000 description 1
- 102100030705 Ras-related protein Rap-1b Human genes 0.000 description 1
- 102100031422 Ras-related protein Rap-2c Human genes 0.000 description 1
- 101000727837 Rattus norvegicus Reduced folate transporter Proteins 0.000 description 1
- 101000629598 Rattus norvegicus Sterol regulatory element-binding protein 1 Proteins 0.000 description 1
- 102100038273 Receptor expression-enhancing protein 3 Human genes 0.000 description 1
- 102100021077 Receptor expression-enhancing protein 5 Human genes 0.000 description 1
- 108010079933 Receptor-Interacting Protein Serine-Threonine Kinase 2 Proteins 0.000 description 1
- 102100029165 Receptor-binding cancer antigen expressed on SiSo cells Human genes 0.000 description 1
- 102100022501 Receptor-interacting serine/threonine-protein kinase 1 Human genes 0.000 description 1
- 102100022502 Receptor-interacting serine/threonine-protein kinase 2 Human genes 0.000 description 1
- 102100037405 Receptor-type tyrosine-protein phosphatase alpha Human genes 0.000 description 1
- 102100034089 Receptor-type tyrosine-protein phosphatase kappa Human genes 0.000 description 1
- 108020004511 Recombinant DNA Proteins 0.000 description 1
- 102100024756 Regulation of nuclear pre-mRNA domain-containing protein 2 Human genes 0.000 description 1
- 102100035772 Regulator of G-protein signaling 12 Human genes 0.000 description 1
- 101710148337 Regulator of G-protein signaling 12 Proteins 0.000 description 1
- 102100037415 Regulator of G-protein signaling 3 Human genes 0.000 description 1
- 101710140411 Regulator of G-protein signaling 3 Proteins 0.000 description 1
- 102100028287 Regulator of nonsense transcripts 1 Human genes 0.000 description 1
- 102100021087 Regulator of nonsense transcripts 2 Human genes 0.000 description 1
- 108010030933 Regulatory Factor X1 Proteins 0.000 description 1
- 108010029031 Regulatory-Associated Protein of mTOR Proteins 0.000 description 1
- 102100040969 Regulatory-associated protein of mTOR Human genes 0.000 description 1
- 102100029771 Remodeling and spacing factor 1 Human genes 0.000 description 1
- 102100037851 Replication factor C subunit 2 Human genes 0.000 description 1
- 102100030542 Replication factor C subunit 4 Human genes 0.000 description 1
- 102100030541 Replication factor C subunit 5 Human genes 0.000 description 1
- 102100038242 Replication initiator 1 Human genes 0.000 description 1
- 102100034372 Replication protein A 14 kDa subunit Human genes 0.000 description 1
- 102100024384 Replication termination factor 2 Human genes 0.000 description 1
- 102100022814 Repulsive guidance molecule B Human genes 0.000 description 1
- 102100028426 Required for excision 1-B domain-containing protein Human genes 0.000 description 1
- 102100039800 Required for meiotic nuclear division protein 1 homolog Human genes 0.000 description 1
- 102100027558 Respirasome Complex Assembly Factor 1 Human genes 0.000 description 1
- 102100025335 Reticulocalbin-1 Human genes 0.000 description 1
- 102100025337 Reticulocalbin-2 Human genes 0.000 description 1
- 102100029831 Reticulon-4 Human genes 0.000 description 1
- 102100037593 Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta Human genes 0.000 description 1
- 108010071034 Retinoblastoma-Binding Protein 4 Proteins 0.000 description 1
- 108010071000 Retinoblastoma-Binding Protein 7 Proteins 0.000 description 1
- 108010003494 Retinoblastoma-Like Protein p130 Proteins 0.000 description 1
- 102000004642 Retinoblastoma-Like Protein p130 Human genes 0.000 description 1
- 102100025192 Retinoblastoma-binding protein 5 Human genes 0.000 description 1
- 102100035178 Retinoic acid receptor RXR-alpha Human genes 0.000 description 1
- 102100034253 Retinoic acid receptor RXR-beta Human genes 0.000 description 1
- 102100038058 Retinol dehydrogenase 13 Human genes 0.000 description 1
- 102100038052 Retinol dehydrogenase 14 Human genes 0.000 description 1
- 102100029148 Retrotransposon Gag-like protein 8A Human genes 0.000 description 1
- 102100025642 Rho GDP-dissociation inhibitor 1 Human genes 0.000 description 1
- 102100021433 Rho GTPase-activating protein 1 Human genes 0.000 description 1
- 102100027663 Rho GTPase-activating protein 12 Human genes 0.000 description 1
- 102100027656 Rho GTPase-activating protein 17 Human genes 0.000 description 1
- 102100030676 Rho GTPase-activating protein 35 Human genes 0.000 description 1
- 102100021428 Rho GTPase-activating protein 5 Human genes 0.000 description 1
- 102100025999 Rho family-interacting cell polarization regulator 1 Human genes 0.000 description 1
- 102100033194 Rho guanine nucleotide exchange factor 11 Human genes 0.000 description 1
- 102100033193 Rho guanine nucleotide exchange factor 12 Human genes 0.000 description 1
- 102100033200 Rho guanine nucleotide exchange factor 7 Human genes 0.000 description 1
- 102100039313 Rho-associated protein kinase 1 Human genes 0.000 description 1
- 102100039314 Rho-associated protein kinase 2 Human genes 0.000 description 1
- 102100027611 Rho-related GTP-binding protein RhoB Human genes 0.000 description 1
- 101150054980 Rhob gene Proteins 0.000 description 1
- 102100037470 Rhomboid domain-containing protein 2 Human genes 0.000 description 1
- 102100037471 Rhomboid domain-containing protein 3 Human genes 0.000 description 1
- 102100032690 Rhomboid-related protein 4 Human genes 0.000 description 1
- IWUCXVSUMQZMFG-AFCXAGJDSA-N Ribavirin Chemical compound N1=C(C(=O)N)N=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 IWUCXVSUMQZMFG-AFCXAGJDSA-N 0.000 description 1
- 102100031774 Ribitol 5-phosphate transferase FKRP Human genes 0.000 description 1
- 102100031754 Ribitol-5-phosphate transferase FKTN Human genes 0.000 description 1
- 102100035179 Ribitol-5-phosphate xylosyltransferase 1 Human genes 0.000 description 1
- 102100025290 Ribonuclease H1 Human genes 0.000 description 1
- 102100039493 Ribonuclease H2 subunit A Human genes 0.000 description 1
- 102100039474 Ribonuclease H2 subunit B Human genes 0.000 description 1
- 101710205841 Ribonuclease P protein component 3 Proteins 0.000 description 1
- 101710205896 Ribonuclease P protein component 4 Proteins 0.000 description 1
- 102100024757 Ribonuclease P protein subunit p14 Human genes 0.000 description 1
- 102100028674 Ribonuclease P protein subunit p20 Human genes 0.000 description 1
- 102100024753 Ribonuclease P protein subunit p21 Human genes 0.000 description 1
- 102100033795 Ribonuclease P protein subunit p30 Human genes 0.000 description 1
- 102100033790 Ribonuclease P protein subunit p38 Human genes 0.000 description 1
- 102100033789 Ribonuclease P protein subunit p40 Human genes 0.000 description 1
- 102100038013 Ribonucleoside-diphosphate reductase subunit M2 B Human genes 0.000 description 1
- 102100029508 Ribose-phosphate pyrophosphokinase 1 Human genes 0.000 description 1
- 102100035066 Ribosomal L1 domain-containing protein 1 Human genes 0.000 description 1
- 102100033978 Ribosomal RNA-processing protein 7 homolog A Human genes 0.000 description 1
- 102100026762 Ribosomal RNA-processing protein 8 Human genes 0.000 description 1
- 102100033169 Ribosomal biogenesis factor Human genes 0.000 description 1
- 102100027433 Ribosomal biogenesis protein LAS1L Human genes 0.000 description 1
- 102100033643 Ribosomal protein S6 kinase alpha-3 Human genes 0.000 description 1
- 102100033644 Ribosomal protein S6 kinase alpha-4 Human genes 0.000 description 1
- 102100024908 Ribosomal protein S6 kinase beta-1 Human genes 0.000 description 1
- 102100024917 Ribosomal protein S6 kinase beta-2 Human genes 0.000 description 1
- 102100024913 Ribosomal protein S6 kinase delta-1 Human genes 0.000 description 1
- 102100021459 Ribosome biogenesis protein NSA2 homolog Human genes 0.000 description 1
- 102100023902 Ribosome biogenesis regulatory protein homolog Human genes 0.000 description 1
- 102100028750 Ribosome maturation protein SBDS Human genes 0.000 description 1
- 102100022213 Ribosome quality control complex subunit NEMF Human genes 0.000 description 1
- 102100022945 Ribosome-recycling factor, mitochondrial Human genes 0.000 description 1
- 208000035217 Ring chromosome 1 syndrome Diseases 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- 102100038059 Roquin-2 Human genes 0.000 description 1
- 102100030852 Run domain Beclin-1-interacting and cysteine-rich domain-containing protein Human genes 0.000 description 1
- 102100027160 RuvB-like 1 Human genes 0.000 description 1
- 101710169742 RuvB-like protein 1 Proteins 0.000 description 1
- 102100035914 S-adenosylmethionine decarboxylase proenzyme Human genes 0.000 description 1
- 102100034187 S-methyl-5'-thioadenosine phosphorylase Human genes 0.000 description 1
- 101710136206 S-methyl-5'-thioadenosine phosphorylase Proteins 0.000 description 1
- 102100032278 SAC3 domain-containing protein 1 Human genes 0.000 description 1
- 102100032664 SAFB-like transcription modulator Human genes 0.000 description 1
- 102100022847 SANT and BTB domain regulator of class switch recombination Human genes 0.000 description 1
- 102100033957 SCAN domain-containing protein 1 Human genes 0.000 description 1
- 108091005488 SCARB2 Proteins 0.000 description 1
- 102100035214 SEC14-like protein 1 Human genes 0.000 description 1
- 102100034247 SEC23-interacting protein Human genes 0.000 description 1
- 101150116830 SEPSECS gene Proteins 0.000 description 1
- 102100037351 SERTA domain-containing protein 2 Human genes 0.000 description 1
- 102100027291 SET domain-containing protein 9 Human genes 0.000 description 1
- 102100031770 SH2B adapter protein 1 Human genes 0.000 description 1
- 102100038875 SH3 and PX domain-containing protein 2A Human genes 0.000 description 1
- 102100040119 SH3 domain-binding protein 5 Human genes 0.000 description 1
- 102100022340 SHC-transforming protein 1 Human genes 0.000 description 1
- 102100031453 SID1 transmembrane family member 2 Human genes 0.000 description 1
- 108091005770 SIRT3 Proteins 0.000 description 1
- 108091006618 SLC11A2 Proteins 0.000 description 1
- 108091006622 SLC12A4 Proteins 0.000 description 1
- 108091006626 SLC12A7 Proteins 0.000 description 1
- 108091006627 SLC12A9 Proteins 0.000 description 1
- 102000012978 SLC1A4 Human genes 0.000 description 1
- 108091006788 SLC20A1 Proteins 0.000 description 1
- 108091006766 SLC22A23 Proteins 0.000 description 1
- 108091006703 SLC25A1 Proteins 0.000 description 1
- 108091006417 SLC25A11 Proteins 0.000 description 1
- 108091006464 SLC25A23 Proteins 0.000 description 1
- 108091006455 SLC25A25 Proteins 0.000 description 1
- 108060004934 SLC25A38 Proteins 0.000 description 1
- 102000016696 SLC25A38 Human genes 0.000 description 1
- 108091006472 SLC25A39 Proteins 0.000 description 1
- 108091006480 SLC25A44 Proteins 0.000 description 1
- 108091006715 SLC25A5 Proteins 0.000 description 1
- 108091006533 SLC27A4 Proteins 0.000 description 1
- 108091006555 SLC30A5 Proteins 0.000 description 1
- 108091006554 SLC30A6 Proteins 0.000 description 1
- 108091006559 SLC30A9 Proteins 0.000 description 1
- 108091006565 SLC31A1 Proteins 0.000 description 1
- 108091006570 SLC33A1 Proteins 0.000 description 1
- 108091006540 SLC35A1 Proteins 0.000 description 1
- 108091006539 SLC35A2 Proteins 0.000 description 1
- 108091006948 SLC35B1 Proteins 0.000 description 1
- 108091006949 SLC35B3 Proteins 0.000 description 1
- 108091006955 SLC35C1 Proteins 0.000 description 1
- 108091006958 SLC35C2 Proteins 0.000 description 1
- 108091006960 SLC35D2 Proteins 0.000 description 1
- 108091006953 SLC35E2B Proteins 0.000 description 1
- 108091006964 SLC35F6 Proteins 0.000 description 1
- 108091006928 SLC38A10 Proteins 0.000 description 1
- 108091006935 SLC38A6 Proteins 0.000 description 1
- 108091006930 SLC39A1 Proteins 0.000 description 1
- 108091006947 SLC39A4 Proteins 0.000 description 1
- 108091006940 SLC39A7 Proteins 0.000 description 1
- 108091006313 SLC3A2 Proteins 0.000 description 1
- 108091006984 SLC41A3 Proteins 0.000 description 1
- 108091007001 SLC44A2 Proteins 0.000 description 1
- 108091007579 SLC48A1 Proteins 0.000 description 1
- 108091006260 SLC4A2 Proteins 0.000 description 1
- 108091007634 SLC52A2 Proteins 0.000 description 1
- 108091006657 SLC9A6 Proteins 0.000 description 1
- 108091006658 SLC9A8 Proteins 0.000 description 1
- 102100037372 SLIT-ROBO Rho GTPase-activating protein 2 Human genes 0.000 description 1
- 101700032040 SMAD1 Proteins 0.000 description 1
- 101700026522 SMAD7 Proteins 0.000 description 1
- 102100032662 SMC5-SMC6 complex localization factor protein 2 Human genes 0.000 description 1
- 102100027242 SNW domain-containing protein 1 Human genes 0.000 description 1
- 108700022176 SOS1 Proteins 0.000 description 1
- 102100023521 SPATS2-like protein Human genes 0.000 description 1
- 102100031123 SPRY domain-containing protein 7 Human genes 0.000 description 1
- 102100020878 SR-related and CTD-associated factor 4 Human genes 0.000 description 1
- 102100020875 SR-related and CTD-associated factor 8 Human genes 0.000 description 1
- 102100025491 SRA stem-loop-interacting RNA-binding protein, mitochondrial Human genes 0.000 description 1
- 102100037353 SRR1-like protein Human genes 0.000 description 1
- 102100023010 SRSF protein kinase 1 Human genes 0.000 description 1
- 102100029754 SS18-like protein 2 Human genes 0.000 description 1
- 102100026710 STAGA complex 65 subunit gamma Human genes 0.000 description 1
- 102100024472 STAM-binding protein Human genes 0.000 description 1
- 108010044012 STAT1 Transcription Factor Proteins 0.000 description 1
- 108010081691 STAT2 Transcription Factor Proteins 0.000 description 1
- 108010017324 STAT3 Transcription Factor Proteins 0.000 description 1
- 101150063267 STAT5B gene Proteins 0.000 description 1
- 102100035929 STE20-related kinase adapter protein beta Human genes 0.000 description 1
- 102100037658 STING ER exit protein Human genes 0.000 description 1
- 102100035250 SUMO-activating enzyme subunit 2 Human genes 0.000 description 1
- 102100029807 SUMO-conjugating enzyme UBC9 Human genes 0.000 description 1
- 102100031343 SUMO-specific isopeptidase USPL1 Human genes 0.000 description 1
- 102100031130 SUN domain-containing protein 1 Human genes 0.000 description 1
- 102100031131 SUN domain-containing protein 2 Human genes 0.000 description 1
- 102100026877 SUZ domain-containing protein 1 Human genes 0.000 description 1
- 102100024793 SWI/SNF complex subunit SMARCC1 Human genes 0.000 description 1
- 102100024790 SWI/SNF complex subunit SMARCC2 Human genes 0.000 description 1
- 102100031028 SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A member 5 Human genes 0.000 description 1
- 102100024777 SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1 Human genes 0.000 description 1
- 102100031029 SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1 Human genes 0.000 description 1
- 102100031482 SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related Human genes 0.000 description 1
- 101100197320 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) RPL35A gene Proteins 0.000 description 1
- 101100501116 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) TUF1 gene Proteins 0.000 description 1
- 102100038582 Sarcolemmal membrane-associated protein Human genes 0.000 description 1
- 102100032357 Scaffold attachment factor B1 Human genes 0.000 description 1
- 102100032356 Scaffold attachment factor B2 Human genes 0.000 description 1
- 101100279491 Schizosaccharomyces pombe (strain 972 / ATCC 24843) int6 gene Proteins 0.000 description 1
- 101100501193 Schizosaccharomyces pombe (strain 972 / ATCC 24843) moe1 gene Proteins 0.000 description 1
- 101100225588 Schizosaccharomyces pombe (strain 972 / ATCC 24843) nip1 gene Proteins 0.000 description 1
- 101100279513 Schizosaccharomyces pombe (strain 972 / ATCC 24843) sum1 gene Proteins 0.000 description 1
- 101100444985 Schizosaccharomyces pombe (strain 972 / ATCC 24843) tif35 gene Proteins 0.000 description 1
- 102100020874 Sec1 family domain-containing protein 1 Human genes 0.000 description 1
- 102100031320 Secernin-3 Human genes 0.000 description 1
- 102100037341 Secretion-regulating guanine nucleotide exchange factor Human genes 0.000 description 1
- 102100037233 Secretory carrier-associated membrane protein 2 Human genes 0.000 description 1
- 102100035895 Secretory carrier-associated membrane protein 3 Human genes 0.000 description 1
- 102100032753 Segment polarity protein dishevelled homolog DVL-2 Human genes 0.000 description 1
- 102100032754 Segment polarity protein dishevelled homolog DVL-3 Human genes 0.000 description 1
- 102100021463 Seipin Human genes 0.000 description 1
- 102100031163 Selenide, water dikinase 1 Human genes 0.000 description 1
- 102100022513 Selenocysteine lyase Human genes 0.000 description 1
- 241000252141 Semionotiformes Species 0.000 description 1
- 102100023645 Sentrin-specific protease 3 Human genes 0.000 description 1
- 102100023713 Sentrin-specific protease 6 Human genes 0.000 description 1
- 102100031406 Sentrin-specific protease 7 Human genes 0.000 description 1
- 102100027982 Septin-6 Human genes 0.000 description 1
- 102100027981 Septin-7 Human genes 0.000 description 1
- 102100028024 Septin-9 Human genes 0.000 description 1
- 102100020814 Sequestosome-1 Human genes 0.000 description 1
- 102100034606 Serine hydroxymethyltransferase, mitochondrial Human genes 0.000 description 1
- 102100031727 Serine incorporator 3 Human genes 0.000 description 1
- 102100029762 Serine incorporator 4 Human genes 0.000 description 1
- 102100021117 Serine protease HTRA2, mitochondrial Human genes 0.000 description 1
- 102100028826 Serine/Arginine-related protein 53 Human genes 0.000 description 1
- 102100023664 Serine/arginine repetitive matrix protein 1 Human genes 0.000 description 1
- 102100023657 Serine/arginine repetitive matrix protein 2 Human genes 0.000 description 1
- 102100023662 Serine/arginine repetitive matrix protein 5 Human genes 0.000 description 1
- 102100037044 Serine/arginine-rich splicing factor 1 Human genes 0.000 description 1
- 102100035701 Serine/arginine-rich splicing factor 10 Human genes 0.000 description 1
- 102100035719 Serine/arginine-rich splicing factor 11 Human genes 0.000 description 1
- 102100029666 Serine/arginine-rich splicing factor 2 Human genes 0.000 description 1
- 102100029665 Serine/arginine-rich splicing factor 3 Human genes 0.000 description 1
- 102100029705 Serine/arginine-rich splicing factor 4 Human genes 0.000 description 1
- 102100029710 Serine/arginine-rich splicing factor 6 Human genes 0.000 description 1
- 102100029287 Serine/arginine-rich splicing factor 7 Human genes 0.000 description 1
- 102100026758 Serine/threonine-protein kinase 16 Human genes 0.000 description 1
- 102100026737 Serine/threonine-protein kinase 25 Human genes 0.000 description 1
- 102100029437 Serine/threonine-protein kinase A-Raf Human genes 0.000 description 1
- 102100027103 Serine/threonine-protein kinase B-raf Human genes 0.000 description 1
- 102100037311 Serine/threonine-protein kinase D3 Human genes 0.000 description 1
- 102100029680 Serine/threonine-protein kinase Kist Human genes 0.000 description 1
- 102100024031 Serine/threonine-protein kinase LATS1 Human genes 0.000 description 1
- 102100024043 Serine/threonine-protein kinase LATS2 Human genes 0.000 description 1
- 102100040292 Serine/threonine-protein kinase LMTK2 Human genes 0.000 description 1
- 102100025347 Serine/threonine-protein kinase MRCK beta Human genes 0.000 description 1
- 102100026180 Serine/threonine-protein kinase N2 Human genes 0.000 description 1
- 102100028751 Serine/threonine-protein kinase Nek1 Human genes 0.000 description 1
- 102100037705 Serine/threonine-protein kinase Nek4 Human genes 0.000 description 1
- 102100037143 Serine/threonine-protein kinase OSR1 Human genes 0.000 description 1
- 102100027939 Serine/threonine-protein kinase PAK 2 Human genes 0.000 description 1
- 102100028868 Serine/threonine-protein kinase PRP4 homolog Human genes 0.000 description 1
- 102100022090 Serine/threonine-protein kinase RIO2 Human genes 0.000 description 1
- 102100022109 Serine/threonine-protein kinase RIO3 Human genes 0.000 description 1
- 102100029938 Serine/threonine-protein kinase SMG1 Human genes 0.000 description 1
- 102100026715 Serine/threonine-protein kinase STK11 Human genes 0.000 description 1
- 102100028949 Serine/threonine-protein kinase TAO2 Human genes 0.000 description 1
- 102100028954 Serine/threonine-protein kinase TAO3 Human genes 0.000 description 1
- 102100038192 Serine/threonine-protein kinase TBK1 Human genes 0.000 description 1
- 102100039988 Serine/threonine-protein kinase ULK1 Human genes 0.000 description 1
- 102100039987 Serine/threonine-protein kinase ULK2 Human genes 0.000 description 1
- 102100039985 Serine/threonine-protein kinase ULK3 Human genes 0.000 description 1
- 102100028234 Serine/threonine-protein kinase VRK2 Human genes 0.000 description 1
- 102100029064 Serine/threonine-protein kinase WNK1 Human genes 0.000 description 1
- 102100039278 Serine/threonine-protein kinase greatwall Human genes 0.000 description 1
- 102100023085 Serine/threonine-protein kinase mTOR Human genes 0.000 description 1
- 102100036119 Serine/threonine-protein kinase pim-3 Human genes 0.000 description 1
- 102100032014 Serine/threonine-protein kinase tousled-like 2 Human genes 0.000 description 1
- 102100038743 Serine/threonine-protein phosphatase 1 regulatory subunit 10 Human genes 0.000 description 1
- 102100035728 Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Human genes 0.000 description 1
- 102100026282 Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit alpha isoform Human genes 0.000 description 1
- 102100026283 Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform Human genes 0.000 description 1
- 102100026281 Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform Human genes 0.000 description 1
- 102100036141 Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform Human genes 0.000 description 1
- 102100036140 Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform Human genes 0.000 description 1
- 102100036122 Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Human genes 0.000 description 1
- 102100036782 Serine/threonine-protein phosphatase 2A activator Human genes 0.000 description 1
- 102100034464 Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform Human genes 0.000 description 1
- 102100034470 Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform Human genes 0.000 description 1
- 102100040447 Serine/threonine-protein phosphatase 2A regulatory subunit B'' subunit gamma Human genes 0.000 description 1
- 102100040321 Serine/threonine-protein phosphatase 2B catalytic subunit beta isoform Human genes 0.000 description 1
- 102100040320 Serine/threonine-protein phosphatase 2B catalytic subunit gamma isoform Human genes 0.000 description 1
- 102100034492 Serine/threonine-protein phosphatase 4 catalytic subunit Human genes 0.000 description 1
- 102100028618 Serine/threonine-protein phosphatase 4 regulatory subunit 1 Human genes 0.000 description 1
- 102100027865 Serine/threonine-protein phosphatase 4 regulatory subunit 3B Human genes 0.000 description 1
- 102100022346 Serine/threonine-protein phosphatase 5 Human genes 0.000 description 1
- 102100022345 Serine/threonine-protein phosphatase 6 catalytic subunit Human genes 0.000 description 1
- 102100034285 Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit A Human genes 0.000 description 1
- 102100037762 Serine/threonine-protein phosphatase 6 regulatory subunit 1 Human genes 0.000 description 1
- 102100037763 Serine/threonine-protein phosphatase 6 regulatory subunit 2 Human genes 0.000 description 1
- 102100037760 Serine/threonine-protein phosphatase 6 regulatory subunit 3 Human genes 0.000 description 1
- 102100038901 Serine/threonine-protein phosphatase PGAM5, mitochondrial Human genes 0.000 description 1
- 102100036033 Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Human genes 0.000 description 1
- 102100037761 Serine/threonine-protein phosphatase PP1-gamma catalytic subunit Human genes 0.000 description 1
- 102100037782 Serine/threonine/tyrosine-interacting-like protein 1 Human genes 0.000 description 1
- 102100037221 Serologically defined colon cancer antigen 8 Human genes 0.000 description 1
- 102100025512 Serpin B6 Human genes 0.000 description 1
- 102100035712 Serrate RNA effector molecule homolog Human genes 0.000 description 1
- 102100029282 Serum response factor-binding protein 1 Human genes 0.000 description 1
- 102100027288 Sestrin-1 Human genes 0.000 description 1
- 102100030733 Set1/Ash2 histone methyltransferase complex subunit ASH2 Human genes 0.000 description 1
- 108010090763 Shiga Toxin 2 Proteins 0.000 description 1
- 102100036292 Short coiled-coil protein Human genes 0.000 description 1
- 102100034106 Short transient receptor potential channel 4-associated protein Human genes 0.000 description 1
- 102100028050 Short transmembrane mitochondrial protein 1 Human genes 0.000 description 1
- 102100021837 Sialate O-acetylesterase Human genes 0.000 description 1
- 102100028760 Sialidase-1 Human genes 0.000 description 1
- 102100028656 Sigma non-opioid intracellular receptor 1 Human genes 0.000 description 1
- 102100030313 Signal peptidase complex subunit 1 Human genes 0.000 description 1
- 102100023776 Signal peptidase complex subunit 2 Human genes 0.000 description 1
- 102100030404 Signal peptide peptidase-like 2B Human genes 0.000 description 1
- 102100037082 Signal recognition particle 14 kDa protein Human genes 0.000 description 1
- 101710089523 Signal recognition particle 14 kDa protein Proteins 0.000 description 1
- 102100027388 Signal recognition particle 19 kDa protein Human genes 0.000 description 1
- 101710122555 Signal recognition particle 19 kDa protein Proteins 0.000 description 1
- 102100031877 Signal recognition particle 54 kDa protein Human genes 0.000 description 1
- 101710187184 Signal recognition particle 54 kDa protein Proteins 0.000 description 1
- 101710150385 Signal recognition particle 54 kDa protein 1 Proteins 0.000 description 1
- 101710150383 Signal recognition particle 54 kDa protein 2 Proteins 0.000 description 1
- 101710150391 Signal recognition particle 54 kDa protein 3 Proteins 0.000 description 1
- 101710128823 Signal recognition particle 54 kDa protein homolog Proteins 0.000 description 1
- 102100022055 Signal recognition particle 9 kDa protein Human genes 0.000 description 1
- 101710131307 Signal recognition particle 9 kDa protein Proteins 0.000 description 1
- 102100026900 Signal recognition particle receptor subunit alpha Human genes 0.000 description 1
- 102100027318 Signal recognition particle subunit SRP68 Human genes 0.000 description 1
- 101710132566 Signal recognition particle subunit srp68 Proteins 0.000 description 1
- 102100029904 Signal transducer and activator of transcription 1-alpha/beta Human genes 0.000 description 1
- 102100023978 Signal transducer and activator of transcription 2 Human genes 0.000 description 1
- 102100024040 Signal transducer and activator of transcription 3 Human genes 0.000 description 1
- 102100024474 Signal transducer and activator of transcription 5B Human genes 0.000 description 1
- 102100025265 Signal transducing adapter molecule 2 Human genes 0.000 description 1
- 102100038661 Single-strand selective monofunctional uracil DNA glycosylase Human genes 0.000 description 1
- 102100023008 Single-stranded DNA-binding protein 3 Human genes 0.000 description 1
- 102100029702 Single-stranded DNA-binding protein 4 Human genes 0.000 description 1
- 102100029719 Single-stranded DNA-binding protein, mitochondrial Human genes 0.000 description 1
- 108010041216 Sirtuin 2 Proteins 0.000 description 1
- 102100039166 Sister chromatid cohesion protein PDS5 homolog A Human genes 0.000 description 1
- 102100039163 Sister chromatid cohesion protein PDS5 homolog B Human genes 0.000 description 1
- 102100027692 Small EDRK-rich factor 2 Human genes 0.000 description 1
- 102100037274 Small G protein signaling modulator 2 Human genes 0.000 description 1
- 102100037275 Small G protein signaling modulator 3 Human genes 0.000 description 1
- 108020004688 Small Nuclear RNA Proteins 0.000 description 1
- 102000039471 Small Nuclear RNA Human genes 0.000 description 1
- 108020003224 Small Nucleolar RNA Proteins 0.000 description 1
- 102000042773 Small Nucleolar RNA Human genes 0.000 description 1
- 102100024477 Small integral membrane protein 12 Human genes 0.000 description 1
- 102100024480 Small integral membrane protein 13 Human genes 0.000 description 1
- 102100022777 Small integral membrane protein 19 Human genes 0.000 description 1
- 102100021844 Small integral membrane protein 20 Human genes 0.000 description 1
- 102100024789 Small integral membrane protein 8 Human genes 0.000 description 1
- 102100029809 Small nuclear ribonucleoprotein E Human genes 0.000 description 1
- 102100036758 Small nuclear ribonucleoprotein F Human genes 0.000 description 1
- 102100036768 Small nuclear ribonucleoprotein G Human genes 0.000 description 1
- 102100038685 Small nuclear ribonucleoprotein Sm D2 Human genes 0.000 description 1
- 102100022775 Small nuclear ribonucleoprotein Sm D3 Human genes 0.000 description 1
- 102100031321 Small subunit processome component 20 homolog Human genes 0.000 description 1
- 102000008736 Snapin Human genes 0.000 description 1
- 102100023502 Snurportin-1 Human genes 0.000 description 1
- 102100037246 Sodium channel modifier 1 Human genes 0.000 description 1
- 102100029797 Sodium-dependent phosphate transporter 1 Human genes 0.000 description 1
- 102100029972 Sodium/hydrogen exchanger 6 Human genes 0.000 description 1
- 102100029970 Sodium/hydrogen exchanger 8 Human genes 0.000 description 1
- 102100024397 Soluble calcium-activated nucleotidase 1 Human genes 0.000 description 1
- 102100034244 Solute carrier family 12 member 4 Human genes 0.000 description 1
- 102100034252 Solute carrier family 12 member 7 Human genes 0.000 description 1
- 102100036742 Solute carrier family 12 member 9 Human genes 0.000 description 1
- 102100023100 Solute carrier family 22 member 23 Human genes 0.000 description 1
- 102100032414 Solute carrier family 25 member 44 Human genes 0.000 description 1
- 102100025664 Solute carrier family 35 member B1 Human genes 0.000 description 1
- 102100032283 Solute carrier family 35 member C2 Human genes 0.000 description 1
- 102100033783 Solute carrier family 35 member E2B Human genes 0.000 description 1
- 102100032109 Solute carrier family 35 member F6 Human genes 0.000 description 1
- 102100037254 Solute carrier family 41 member 3 Human genes 0.000 description 1
- 102100036862 Solute carrier family 52, riboflavin transporter, member 2 Human genes 0.000 description 1
- 102100025806 Solute carrier family 66 member 2 Human genes 0.000 description 1
- 102100032929 Son of sevenless homolog 1 Human genes 0.000 description 1
- 102100032930 Son of sevenless homolog 2 Human genes 0.000 description 1
- 102100035853 Sorting and assembly machinery component 50 homolog Human genes 0.000 description 1
- 102100030992 Sorting nexin-1 Human genes 0.000 description 1
- 102100029609 Sorting nexin-11 Human genes 0.000 description 1
- 102100029600 Sorting nexin-12 Human genes 0.000 description 1
- 102100029606 Sorting nexin-13 Human genes 0.000 description 1
- 102100029593 Sorting nexin-15 Human genes 0.000 description 1
- 102100030995 Sorting nexin-17 Human genes 0.000 description 1
- 102100030997 Sorting nexin-18 Human genes 0.000 description 1
- 102100030998 Sorting nexin-19 Human genes 0.000 description 1
- 102100022378 Sorting nexin-2 Human genes 0.000 description 1
- 102100032829 Sorting nexin-3 Human genes 0.000 description 1
- 102100038650 Sorting nexin-4 Human genes 0.000 description 1
- 102100038624 Sorting nexin-5 Human genes 0.000 description 1
- 102100032848 Sorting nexin-8 Human genes 0.000 description 1
- 102100032854 Sorting nexin-9 Human genes 0.000 description 1
- 101150100839 Sos1 gene Proteins 0.000 description 1
- 102100036422 Speckle-type POZ protein Human genes 0.000 description 1
- 102100031874 Spectrin alpha chain, non-erythrocytic 1 Human genes 0.000 description 1
- 102100037612 Spectrin beta chain, non-erythrocytic 1 Human genes 0.000 description 1
- 102100021912 Sperm-associated antigen 7 Human genes 0.000 description 1
- 102100035935 Spermatid perinuclear RNA-binding protein Human genes 0.000 description 1
- 102100030254 Spermatogenesis-associated protein 2 Human genes 0.000 description 1
- 102100036414 Spermatogenesis-associated protein 20 Human genes 0.000 description 1
- 102100032313 Spermatogenesis-defective protein 39 homolog Human genes 0.000 description 1
- 102100037416 Sphingolipid delta(4)-desaturase DES1 Human genes 0.000 description 1
- 102100026263 Sphingomyelin phosphodiesterase Human genes 0.000 description 1
- 102100021460 Sphingomyelin phosphodiesterase 4 Human genes 0.000 description 1
- 102100034292 Sphingomyelin synthase-related protein 1 Human genes 0.000 description 1
- 102100027662 Sphingosine kinase 2 Human genes 0.000 description 1
- 102100024239 Sphingosine-1-phosphate lyase 1 Human genes 0.000 description 1
- 102100024690 Spliceosome RNA helicase DDX39B Human genes 0.000 description 1
- 102100036029 Spliceosome-associated protein CWC15 homolog Human genes 0.000 description 1
- 102100039430 Spliceosome-associated protein CWC27 homolog Human genes 0.000 description 1
- 102100031713 Splicing factor 3A subunit 1 Human genes 0.000 description 1
- 102100031710 Splicing factor 3A subunit 3 Human genes 0.000 description 1
- 102100031711 Splicing factor 3B subunit 1 Human genes 0.000 description 1
- 102100031436 Splicing factor 3B subunit 2 Human genes 0.000 description 1
- 102100021817 Splicing factor 3B subunit 6 Human genes 0.000 description 1
- 102100036374 Splicing factor 45 Human genes 0.000 description 1
- 102100038501 Splicing factor U2AF 35 kDa subunit Human genes 0.000 description 1
- 102100035040 Splicing factor U2AF 65 kDa subunit Human genes 0.000 description 1
- 102100027780 Splicing factor, proline- and glutamine-rich Human genes 0.000 description 1
- 102100032652 Splicing factor, suppressor of white-apricot homolog Human genes 0.000 description 1
- 102100037079 Splicing regulatory glutamine/lysine-rich protein 1 Human genes 0.000 description 1
- 101150100832 Sppl2b gene Proteins 0.000 description 1
- 102100037997 Squalene synthase Human genes 0.000 description 1
- 102100035748 Squamous cell carcinoma antigen recognized by T-cells 3 Human genes 0.000 description 1
- 102100023719 Src substrate cortactin Human genes 0.000 description 1
- 102100026719 StAR-related lipid transfer protein 3 Human genes 0.000 description 1
- 102100021996 Staphylococcal nuclease domain-containing protein 1 Human genes 0.000 description 1
- 101150020213 Stard3 gene Proteins 0.000 description 1
- 102100036832 Steroid hormone receptor ERR1 Human genes 0.000 description 1
- 102100026841 Sterol regulatory element-binding protein 2 Human genes 0.000 description 1
- 102100029238 Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating Human genes 0.000 description 1
- 102100021685 Stomatin Human genes 0.000 description 1
- 102100024173 Stomatin-like protein 1 Human genes 0.000 description 1
- 102100024172 Stomatin-like protein 2, mitochondrial Human genes 0.000 description 1
- 102100037172 Store-operated calcium entry-associated regulatory factor Human genes 0.000 description 1
- 102100022760 Stress-70 protein, mitochondrial Human genes 0.000 description 1
- 102100028898 Striatin Human genes 0.000 description 1
- 102100029955 Striatin-3 Human genes 0.000 description 1
- 102100028806 Striatin-4 Human genes 0.000 description 1
- 102100028804 Striatin-interacting protein 1 Human genes 0.000 description 1
- 102000004094 Stromal Interaction Molecule 1 Human genes 0.000 description 1
- 108090000532 Stromal Interaction Molecule 1 Proteins 0.000 description 1
- 108010030731 Stromal Interaction Molecule 2 Proteins 0.000 description 1
- 102100023184 Stromal cell-derived factor 2 Human genes 0.000 description 1
- 102100035562 Stromal interaction molecule 2 Human genes 0.000 description 1
- 102100029540 Structural maintenance of chromosomes protein 2 Human genes 0.000 description 1
- 102100032723 Structural maintenance of chromosomes protein 3 Human genes 0.000 description 1
- 102100022842 Structural maintenance of chromosomes protein 4 Human genes 0.000 description 1
- 102100022773 Structural maintenance of chromosomes protein 5 Human genes 0.000 description 1
- 102100031030 Structural maintenance of chromosomes protein 6 Human genes 0.000 description 1
- 241000030560 Styx Species 0.000 description 1
- 102100038014 Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial Human genes 0.000 description 1
- 102100023155 Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Human genes 0.000 description 1
- 102100035726 Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Human genes 0.000 description 1
- 102100031715 Succinate dehydrogenase assembly factor 2, mitochondrial Human genes 0.000 description 1
- 108050007461 Succinate dehydrogenase assembly factor 2, mitochondrial Proteins 0.000 description 1
- 102100025393 Succinate dehydrogenase cytochrome b560 subunit, mitochondrial Human genes 0.000 description 1
- 102100037811 Succinate-CoA ligase [ADP-forming] subunit beta, mitochondrial Human genes 0.000 description 1
- 102100024241 Succinate-CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Human genes 0.000 description 1
- 102100037788 Succinate-CoA ligase [GDP-forming] subunit beta, mitochondrial Human genes 0.000 description 1
- 102100020951 Sulfite oxidase, mitochondrial Human genes 0.000 description 1
- 108010021188 Superoxide Dismutase-1 Proteins 0.000 description 1
- 102100038836 Superoxide dismutase [Cu-Zn] Human genes 0.000 description 1
- 102100026721 Suppressor of tumorigenicity 7 protein-like Human genes 0.000 description 1
- 108060007963 Surf-1 Proteins 0.000 description 1
- 102000046669 Surf-1 Human genes 0.000 description 1
- 102100026318 Surfeit locus protein 6 Human genes 0.000 description 1
- 102100032853 Sushi, nidogen and EGF-like domain-containing protein 1 Human genes 0.000 description 1
- 102100039485 Symplekin Human genes 0.000 description 1
- 102100023532 Synaptic functional regulator FMR1 Human genes 0.000 description 1
- 102100023512 Synaptobrevin homolog YKT6 Human genes 0.000 description 1
- 102100037485 Synaptonemal complex central element protein 1-like Human genes 0.000 description 1
- 102100036235 Synaptonemal complex protein 3 Human genes 0.000 description 1
- 102100030545 Synaptosomal-associated protein 23 Human genes 0.000 description 1
- 102100024836 Synaptosomal-associated protein 29 Human genes 0.000 description 1
- 102100035073 Syndetin Human genes 0.000 description 1
- 102100035600 Synergin gamma Human genes 0.000 description 1
- 102100031099 Syntaxin-10 Human genes 0.000 description 1
- 102100031100 Syntaxin-16 Human genes 0.000 description 1
- 102100031101 Syntaxin-17 Human genes 0.000 description 1
- 102100035936 Syntaxin-2 Human genes 0.000 description 1
- 102100027975 Syntaxin-4 Human genes 0.000 description 1
- 102100027973 Syntaxin-5 Human genes 0.000 description 1
- 102100024174 Syntaxin-7 Human genes 0.000 description 1
- 102100028808 Syntaxin-8 Human genes 0.000 description 1
- 102100021679 Syntaxin-binding protein 3 Human genes 0.000 description 1
- 102100021682 Syntaxin-binding protein 5 Human genes 0.000 description 1
- 102100037219 Syntenin-1 Human genes 0.000 description 1
- 102100026356 T-cell activation inhibitor, mitochondrial Human genes 0.000 description 1
- 102100038410 T-complex protein 1 subunit alpha Human genes 0.000 description 1
- 102100028679 T-complex protein 1 subunit beta Human genes 0.000 description 1
- 102100029958 T-complex protein 1 subunit delta Human genes 0.000 description 1
- 102100029886 T-complex protein 1 subunit epsilon Human genes 0.000 description 1
- 102100036476 T-complex protein 1 subunit eta Human genes 0.000 description 1
- 102100036049 T-complex protein 1 subunit gamma Human genes 0.000 description 1
- 102100026311 T-complex protein 1 subunit theta Human genes 0.000 description 1
- 102100030664 T-complex protein 1 subunit zeta Human genes 0.000 description 1
- 102100028607 T-complex protein 11-like protein 1 Human genes 0.000 description 1
- 102100030838 TAF5-like RNA polymerase II p300/CBP-associated factor-associated factor 65 kDa subunit 5L Human genes 0.000 description 1
- 101710192270 TAF5-like RNA polymerase II p300/CBP-associated factor-associated factor 65 kDa subunit 5L Proteins 0.000 description 1
- 102100021169 TAF6-like RNA polymerase II p300/CBP-associated factor-associated factor 65 kDa subunit 6L Human genes 0.000 description 1
- 101710161105 TAF6-like RNA polymerase II p300/CBP-associated factor-associated factor 65 kDa subunit 6L Proteins 0.000 description 1
- 102100040347 TAR DNA-binding protein 43 Human genes 0.000 description 1
- 102100028546 TATA box-binding protein-associated factor RNA polymerase I subunit B Human genes 0.000 description 1
- 102100035213 TATA box-binding protein-associated factor RNA polymerase I subunit C Human genes 0.000 description 1
- 102100028639 TATA-binding protein-associated factor 172 Human genes 0.000 description 1
- 102100024750 TBC domain-containing protein kinase-like protein Human genes 0.000 description 1
- 102100040238 TBC1 domain family member 1 Human genes 0.000 description 1
- 102100026506 TBC1 domain family member 10B Human genes 0.000 description 1
- 102100038201 TBC1 domain family member 12 Human genes 0.000 description 1
- 102100038190 TBC1 domain family member 14 Human genes 0.000 description 1
- 102100029870 TBC1 domain family member 15 Human genes 0.000 description 1
- 102100029868 TBC1 domain family member 17 Human genes 0.000 description 1
- 102100024691 TBC1 domain family member 22A Human genes 0.000 description 1
- 102100024686 TBC1 domain family member 22B Human genes 0.000 description 1
- 102100029850 TBC1 domain family member 23 Human genes 0.000 description 1
- 102100025233 TBC1 domain family member 24 Human genes 0.000 description 1
- 102100025231 TBC1 domain family member 25 Human genes 0.000 description 1
- 102100040256 TBC1 domain family member 5 Human genes 0.000 description 1
- 102100040254 TBC1 domain family member 7 Human genes 0.000 description 1
- 102100030302 TBC1 domain family member 8 Human genes 0.000 description 1
- 102100030306 TBC1 domain family member 9 Human genes 0.000 description 1
- 102100036069 TBC1 domain family member 9B Human genes 0.000 description 1
- 102100026485 TBCC domain-containing protein 1 Human genes 0.000 description 1
- 102100026140 TCF3 fusion partner Human genes 0.000 description 1
- 102100029253 TELO2-interacting protein 1 homolog Human genes 0.000 description 1
- 102100029259 TELO2-interacting protein 2 Human genes 0.000 description 1
- 102100033085 TERF1-interacting nuclear factor 2 Human genes 0.000 description 1
- 102100033456 TGF-beta receptor type-1 Human genes 0.000 description 1
- 102100021227 TGF-beta-activated kinase 1 and MAP3K7-binding protein 2 Human genes 0.000 description 1
- 102100040039 THAP domain-containing protein 3 Human genes 0.000 description 1
- 102100030952 THAP domain-containing protein 5 Human genes 0.000 description 1
- 102100030957 THAP domain-containing protein 7 Human genes 0.000 description 1
- 102100033489 THO complex subunit 1 Human genes 0.000 description 1
- 102100033491 THO complex subunit 2 Human genes 0.000 description 1
- 102100036434 THO complex subunit 4 Human genes 0.000 description 1
- 102100036435 THO complex subunit 6 homolog Human genes 0.000 description 1
- 102100034704 THUMP domain-containing protein 1 Human genes 0.000 description 1
- 102100034706 THUMP domain-containing protein 3 Human genes 0.000 description 1
- 102100026811 TIP41-like protein Human genes 0.000 description 1
- 102100033691 TM2 domain-containing protein 2 Human genes 0.000 description 1
- 102000002970 TMEM129 Human genes 0.000 description 1
- 102000004399 TNF receptor-associated factor 3 Human genes 0.000 description 1
- 108090000922 TNF receptor-associated factor 3 Proteins 0.000 description 1
- 102000003714 TNF receptor-associated factor 6 Human genes 0.000 description 1
- 108090000009 TNF receptor-associated factor 6 Proteins 0.000 description 1
- 102100037667 TNFAIP3-interacting protein 1 Human genes 0.000 description 1
- 102100037668 TNFAIP3-interacting protein 2 Human genes 0.000 description 1
- 102100039142 TOG array regulator of axonemal microtubules protein 1 Human genes 0.000 description 1
- 102100026749 TOX high mobility group box family member 4 Human genes 0.000 description 1
- 102100029669 TP53-regulated inhibitor of apoptosis 1 Human genes 0.000 description 1
- 102100029451 TRAF-type zinc finger domain-containing protein 1 Human genes 0.000 description 1
- 102100026938 TRAF3-interacting protein 1 Human genes 0.000 description 1
- 108091007283 TRIM24 Proteins 0.000 description 1
- 108091007076 TRIP12 Proteins 0.000 description 1
- 102100029664 TRMT1-like protein Human genes 0.000 description 1
- 102000003611 TRPM7 Human genes 0.000 description 1
- 102100026351 TRPM8 channel-associated factor 1 Human genes 0.000 description 1
- 102100035052 TSC22 domain family protein 2 Human genes 0.000 description 1
- 101150026786 TUFM gene Proteins 0.000 description 1
- 101800000849 Tachykinin-associated peptide 2 Proteins 0.000 description 1
- 102100028082 Tapasin Human genes 0.000 description 1
- 102100033600 Taperin Human genes 0.000 description 1
- 102100030904 Target of rapamycin complex 2 subunit MAPKAP1 Human genes 0.000 description 1
- 102100027802 Target of rapamycin complex subunit LST8 Human genes 0.000 description 1
- 102100038193 Tax1-binding protein 1 Human genes 0.000 description 1
- 102100030746 Tectonic-1 Human genes 0.000 description 1
- 102100030785 Tectonic-3 Human genes 0.000 description 1
- 102100026429 Tectonin beta-propeller repeat-containing protein 1 Human genes 0.000 description 1
- 102100026312 Tectonin beta-propeller repeat-containing protein 2 Human genes 0.000 description 1
- 102100030629 Telomerase Cajal body protein 1 Human genes 0.000 description 1
- 102100031022 Telomerase-binding protein EST1A Human genes 0.000 description 1
- 102100024684 Telomere attrition and p53 response 1 protein Human genes 0.000 description 1
- 102100033113 Telomere length and silencing protein 1 homolog Human genes 0.000 description 1
- 102100031146 Telomere zinc finger-associated protein Human genes 0.000 description 1
- 108010033711 Telomeric Repeat Binding Protein 1 Proteins 0.000 description 1
- 108010033710 Telomeric Repeat Binding Protein 2 Proteins 0.000 description 1
- 102100036497 Telomeric repeat-binding factor 1 Human genes 0.000 description 1
- 102100030784 Telomeric repeat-binding factor 2 Human genes 0.000 description 1
- 102100034938 Terminal nucleotidyltransferase 4B Human genes 0.000 description 1
- 102100033225 Terminal uridylyltransferase 4 Human genes 0.000 description 1
- 102100033224 Terminal uridylyltransferase 7 Human genes 0.000 description 1
- 102100040174 Testis-expressed protein 10 Human genes 0.000 description 1
- 102100034948 Testis-expressed protein 264 Human genes 0.000 description 1
- 102100029773 Tether containing UBX domain for GLUT4 Human genes 0.000 description 1
- 102100030164 Tetraspanin-17 Human genes 0.000 description 1
- 102100040874 Tetraspanin-3 Human genes 0.000 description 1
- 102100035874 Tetraspanin-31 Human genes 0.000 description 1
- 102100032841 Tetratricopeptide repeat protein 1 Human genes 0.000 description 1
- 102100023279 Tetratricopeptide repeat protein 14 Human genes 0.000 description 1
- 102100031473 Tetratricopeptide repeat protein 19, mitochondrial Human genes 0.000 description 1
- 102100031763 Tetratricopeptide repeat protein 27 Human genes 0.000 description 1
- 102100040945 Tetratricopeptide repeat protein 32 Human genes 0.000 description 1
- 102100040943 Tetratricopeptide repeat protein 33 Human genes 0.000 description 1
- 102100029210 Tetratricopeptide repeat protein 37 Human genes 0.000 description 1
- 102100031279 Tetratricopeptide repeat protein 4 Human genes 0.000 description 1
- 102100031270 Tetratricopeptide repeat protein 7B Human genes 0.000 description 1
- 102100021911 Thiamine-triphosphatase Human genes 0.000 description 1
- 102100031293 Thimet oligopeptidase Human genes 0.000 description 1
- 102100032030 Thioredoxin domain-containing protein 11 Human genes 0.000 description 1
- 102100032032 Thioredoxin domain-containing protein 12 Human genes 0.000 description 1
- 102100032034 Thioredoxin domain-containing protein 16 Human genes 0.000 description 1
- 102100031350 Thioredoxin domain-containing protein 9 Human genes 0.000 description 1
- 102100031208 Thioredoxin reductase 1, cytoplasmic Human genes 0.000 description 1
- 102100031241 Thioredoxin reductase 2, mitochondrial Human genes 0.000 description 1
- 102100034795 Thioredoxin, mitochondrial Human genes 0.000 description 1
- 102100034769 Thioredoxin-dependent peroxide reductase, mitochondrial Human genes 0.000 description 1
- 102100031373 Thioredoxin-like protein 1 Human genes 0.000 description 1
- 102100030272 Thioredoxin-like protein 4A Human genes 0.000 description 1
- 102100030273 Thioredoxin-like protein 4B Human genes 0.000 description 1
- 102100036927 Thioredoxin-related transmembrane protein 2 Human genes 0.000 description 1
- 102100040483 Threonine aspartase 1 Human genes 0.000 description 1
- 102100034997 Threonine-tRNA ligase, mitochondrial Human genes 0.000 description 1
- 102100037357 Thymidylate kinase Human genes 0.000 description 1
- 102100033520 Thymocyte nuclear protein 1 Human genes 0.000 description 1
- 102100038148 Thyroid adenoma-associated protein Human genes 0.000 description 1
- 102100029689 Thyroid hormone receptor-associated protein 3 Human genes 0.000 description 1
- 102100028094 Thyroid receptor-interacting protein 11 Human genes 0.000 description 1
- 102100030344 Thyroid transcription factor 1-associated protein 26 Human genes 0.000 description 1
- 102100024833 Tigger transposable element-derived protein 6 Human genes 0.000 description 1
- 102100026637 Tight junction protein ZO-2 Human genes 0.000 description 1
- 102100026268 Tight junction-associated protein 1 Human genes 0.000 description 1
- 102000019347 Tob1 Human genes 0.000 description 1
- 102100032120 Toll/interleukin-1 receptor domain-containing adapter protein Human genes 0.000 description 1
- 102100037454 Torsin-1A Human genes 0.000 description 1
- 102100022147 Torsin-1A-interacting protein 1 Human genes 0.000 description 1
- 102100022155 Torsin-1A-interacting protein 2 Human genes 0.000 description 1
- 102100037453 Torsin-1B Human genes 0.000 description 1
- 102100040379 Trafficking kinesin-binding protein 1 Human genes 0.000 description 1
- 102100025256 Trafficking protein particle complex subunit 1 Human genes 0.000 description 1
- 102100037456 Trafficking protein particle complex subunit 10 Human genes 0.000 description 1
- 102100037451 Trafficking protein particle complex subunit 12 Human genes 0.000 description 1
- 102100022613 Trafficking protein particle complex subunit 2 Human genes 0.000 description 1
- 102100022610 Trafficking protein particle complex subunit 2-like protein Human genes 0.000 description 1
- 102100037494 Trafficking protein particle complex subunit 3 Human genes 0.000 description 1
- 102100037496 Trafficking protein particle complex subunit 4 Human genes 0.000 description 1
- 102100037497 Trafficking protein particle complex subunit 5 Human genes 0.000 description 1
- 102100022607 Trafficking protein particle complex subunit 6A Human genes 0.000 description 1
- 102100028828 Trafficking protein particle complex subunit 6B Human genes 0.000 description 1
- 102100031937 Trafficking protein particle complex subunit 8 Human genes 0.000 description 1
- 102100031926 Trafficking protein particle complex subunit 9 Human genes 0.000 description 1
- 102100028621 Trans-Golgi network integral membrane protein 2 Human genes 0.000 description 1
- 108010068068 Transcription Factor TFIIIA Proteins 0.000 description 1
- 102100031027 Transcription activator BRG1 Human genes 0.000 description 1
- 102100031954 Transcription and mRNA export factor ENY2 Human genes 0.000 description 1
- 102100038034 Transcription cofactor vestigial-like protein 4 Human genes 0.000 description 1
- 102100038997 Transcription elongation factor SPT4 Human genes 0.000 description 1
- 102100030402 Transcription elongation factor SPT5 Human genes 0.000 description 1
- 102100023690 Transcription elongation factor SPT6 Human genes 0.000 description 1
- 102100040393 Transcription elongation regulator 1 Human genes 0.000 description 1
- 102100021123 Transcription factor 12 Human genes 0.000 description 1
- 102100033142 Transcription factor 20 Human genes 0.000 description 1
- 102100030628 Transcription factor 25 Human genes 0.000 description 1
- 102100035101 Transcription factor 7-like 2 Human genes 0.000 description 1
- 102100026155 Transcription factor A, mitochondrial Human genes 0.000 description 1
- 102100026043 Transcription factor BTF3 Human genes 0.000 description 1
- 102100027158 Transcription factor BTF3 homolog 4 Human genes 0.000 description 1
- 102100021783 Transcription factor E2F4 Human genes 0.000 description 1
- 102100028507 Transcription factor E3 Human genes 0.000 description 1
- 102100037331 Transcription factor E4F1 Human genes 0.000 description 1
- 102100039580 Transcription factor ETV6 Human genes 0.000 description 1
- 102100028509 Transcription factor IIIA Human genes 0.000 description 1
- 102100023118 Transcription factor JunD Human genes 0.000 description 1
- 102100030879 Transcription initiation factor IIA subunit 1 Human genes 0.000 description 1
- 102100028604 Transcription initiation factor IIA subunit 2 Human genes 0.000 description 1
- 102100033662 Transcription initiation factor IIB Human genes 0.000 description 1
- 102100034904 Transcription initiation factor IIE subunit beta Human genes 0.000 description 1
- 102100035222 Transcription initiation factor TFIID subunit 1 Human genes 0.000 description 1
- 102100036677 Transcription initiation factor TFIID subunit 10 Human genes 0.000 description 1
- 102100036676 Transcription initiation factor TFIID subunit 11 Human genes 0.000 description 1
- 102100025171 Transcription initiation factor TFIID subunit 12 Human genes 0.000 description 1
- 102100025941 Transcription initiation factor TFIID subunit 13 Human genes 0.000 description 1
- 102100025041 Transcription initiation factor TFIID subunit 2 Human genes 0.000 description 1
- 102100030833 Transcription initiation factor TFIID subunit 4 Human genes 0.000 description 1
- 102100021170 Transcription initiation factor TFIID subunit 6 Human genes 0.000 description 1
- 102100036651 Transcription initiation factor TFIID subunit 9 Human genes 0.000 description 1
- 102100036653 Transcription initiation factor TFIID subunit 9B Human genes 0.000 description 1
- 102100022011 Transcription intermediary factor 1-alpha Human genes 0.000 description 1
- 102100022012 Transcription intermediary factor 1-beta Human genes 0.000 description 1
- 101710177718 Transcription intermediary factor 1-beta Proteins 0.000 description 1
- 102100031080 Transcription termination factor 2 Human genes 0.000 description 1
- 102100035550 Transcription termination factor 2, mitochondrial Human genes 0.000 description 1
- 102100035551 Transcription termination factor 3, mitochondrial Human genes 0.000 description 1
- 102100035715 Transcriptional activator protein Pur-alpha Human genes 0.000 description 1
- 102100034777 Transcriptional adapter 2-alpha Human genes 0.000 description 1
- 102100030836 Transcriptional adapter 3 Human genes 0.000 description 1
- 102100023011 Transcriptional regulator Kaiso Human genes 0.000 description 1
- 102100027895 Transcriptional regulator QRICH1 Human genes 0.000 description 1
- 102100027671 Transcriptional repressor CTCF Human genes 0.000 description 1
- 102100037558 Transcriptional repressor p66-alpha Human genes 0.000 description 1
- 102100028683 Transducin beta-like protein 3 Human genes 0.000 description 1
- 102100039362 Transducin-like enhancer protein 1 Human genes 0.000 description 1
- 108020004566 Transfer RNA Proteins 0.000 description 1
- 102100026144 Transferrin receptor protein 1 Human genes 0.000 description 1
- 102100032762 Transformation/transcription domain-associated protein Human genes 0.000 description 1
- 102100022573 Transformer-2 protein homolog alpha Human genes 0.000 description 1
- 102100022572 Transformer-2 protein homolog beta Human genes 0.000 description 1
- 108010011702 Transforming Growth Factor-beta Type I Receptor Proteins 0.000 description 1
- 108010040625 Transforming Protein 1 Src Homology 2 Domain-Containing Proteins 0.000 description 1
- 101710204707 Transforming growth factor-beta receptor-associated protein 1 Proteins 0.000 description 1
- 102100022387 Transforming protein RhoA Human genes 0.000 description 1
- 102100029550 Translation initiation factor IF-2, mitochondrial Human genes 0.000 description 1
- 102100039649 Translation initiation factor IF-3, mitochondrial Human genes 0.000 description 1
- 102100027059 Translation initiation factor eIF-2B subunit alpha Human genes 0.000 description 1
- 102100027065 Translation initiation factor eIF-2B subunit beta Human genes 0.000 description 1
- 102100034266 Translation initiation factor eIF-2B subunit delta Human genes 0.000 description 1
- 102100034267 Translation initiation factor eIF-2B subunit epsilon Human genes 0.000 description 1
- 102100023225 Translation initiation factor eIF-2B subunit gamma Human genes 0.000 description 1
- 102100033696 Translation machinery-associated protein 7 Human genes 0.000 description 1
- 102100029887 Translationally-controlled tumor protein Human genes 0.000 description 1
- 102100032834 Translin-associated protein X Human genes 0.000 description 1
- 102100029006 Translocation protein SEC63 homolog Human genes 0.000 description 1
- 102100026231 Translocon-associated protein subunit alpha Human genes 0.000 description 1
- 102100028160 Translocon-associated protein subunit gamma Human genes 0.000 description 1
- 102100035339 Transmembrane 7 superfamily member 3 Human genes 0.000 description 1
- 102100032503 Transmembrane 9 superfamily member 2 Human genes 0.000 description 1
- 102100032466 Transmembrane 9 superfamily member 4 Human genes 0.000 description 1
- 102100037718 Transmembrane and coiled-coil domains protein 1 Human genes 0.000 description 1
- 102100022175 Transmembrane and ubiquitin-like domain-containing protein 1 Human genes 0.000 description 1
- 102100022189 Transmembrane and ubiquitin-like domain-containing protein 2 Human genes 0.000 description 1
- 102100024180 Transmembrane emp24 domain-containing protein 10 Human genes 0.000 description 1
- 102100031987 Transmembrane emp24 domain-containing protein 2 Human genes 0.000 description 1
- 102100032105 Transmembrane emp24 domain-containing protein 5 Human genes 0.000 description 1
- 102100036760 Transmembrane emp24 domain-containing protein 9 Human genes 0.000 description 1
- 102100036722 Transmembrane protein 104 Human genes 0.000 description 1
- 102100026232 Transmembrane protein 106B Human genes 0.000 description 1
- 102100034851 Transmembrane protein 106C Human genes 0.000 description 1
- 102100035320 Transmembrane protein 11, mitochondrial Human genes 0.000 description 1
- 102100036987 Transmembrane protein 115 Human genes 0.000 description 1
- 102100033846 Transmembrane protein 126A Human genes 0.000 description 1
- 102100032072 Transmembrane protein 127 Human genes 0.000 description 1
- 102100033700 Transmembrane protein 131 Human genes 0.000 description 1
- 102100033701 Transmembrane protein 134 Human genes 0.000 description 1
- 102100027031 Transmembrane protein 135 Human genes 0.000 description 1
- 102100036798 Transmembrane protein 147 Human genes 0.000 description 1
- 102100033027 Transmembrane protein 14B Human genes 0.000 description 1
- 102100033022 Transmembrane protein 14C Human genes 0.000 description 1
- 102100025917 Transmembrane protein 150A Human genes 0.000 description 1
- 102100035059 Transmembrane protein 161A Human genes 0.000 description 1
- 102100032000 Transmembrane protein 177 Human genes 0.000 description 1
- 102100040670 Transmembrane protein 184B Human genes 0.000 description 1
- 102100024328 Transmembrane protein 186 Human genes 0.000 description 1
- 102100024327 Transmembrane protein 187 Human genes 0.000 description 1
- 102100037035 Transmembrane protein 192 Human genes 0.000 description 1
- 102100027022 Transmembrane protein 205 Human genes 0.000 description 1
- 102100027025 Transmembrane protein 208 Human genes 0.000 description 1
- 102100036748 Transmembrane protein 214 Human genes 0.000 description 1
- 102100022216 Transmembrane protein 218 Human genes 0.000 description 1
- 102100033034 Transmembrane protein 223 Human genes 0.000 description 1
- 102100033033 Transmembrane protein 230 Human genes 0.000 description 1
- 102100025715 Transmembrane protein 250 Human genes 0.000 description 1
- 102100028766 Transmembrane protein 251 Human genes 0.000 description 1
- 102100035332 Transmembrane protein 254 Human genes 0.000 description 1
- 102100035328 Transmembrane protein 258 Human genes 0.000 description 1
- 102100024196 Transmembrane protein 41B Human genes 0.000 description 1
- 102100028770 Transmembrane protein 50A Human genes 0.000 description 1
- 102100028769 Transmembrane protein 50B Human genes 0.000 description 1
- 102100022075 Transmembrane protein 59 Human genes 0.000 description 1
- 102100036756 Transmembrane protein 64 Human genes 0.000 description 1
- 102100036925 Transmembrane protein 69 Human genes 0.000 description 1
- 102100036921 Transmembrane protein 70, mitochondrial Human genes 0.000 description 1
- 102100028838 Transmembrane protein 80 Human genes 0.000 description 1
- 102100035303 Transmembrane protein 87A Human genes 0.000 description 1
- 102100037621 Transmembrane protein 94 Human genes 0.000 description 1
- 102100025378 Transmembrane protein KIAA1109 Human genes 0.000 description 1
- 102100021728 Transmembrane reductase CYB561D2 Human genes 0.000 description 1
- 102100027172 Transposon Hsmar1 transposase Human genes 0.000 description 1
- 102100036216 Tricarboxylate transport protein, mitochondrial Human genes 0.000 description 1
- 102100030645 Trichoplein keratin filament-binding protein Human genes 0.000 description 1
- 102100026223 Trimethyllysine dioxygenase, mitochondrial Human genes 0.000 description 1
- 102100024597 Trinucleotide repeat-containing gene 18 protein Human genes 0.000 description 1
- 102100040241 Trinucleotide repeat-containing gene 6A protein Human genes 0.000 description 1
- 102100040244 Trinucleotide repeat-containing gene 6B protein Human genes 0.000 description 1
- 102100040242 Trinucleotide repeat-containing gene 6C protein Human genes 0.000 description 1
- 102100034593 Tripartite motif-containing protein 26 Human genes 0.000 description 1
- 102100038798 Tripartite motif-containing protein 3 Human genes 0.000 description 1
- 102100028017 Tripartite motif-containing protein 44 Human genes 0.000 description 1
- 102100025016 Tripartite motif-containing protein 65 Human genes 0.000 description 1
- 108010039203 Tripeptidyl-Peptidase 1 Proteins 0.000 description 1
- 102100034197 Tripeptidyl-peptidase 1 Human genes 0.000 description 1
- 102100040411 Tripeptidyl-peptidase 2 Human genes 0.000 description 1
- 102100028097 Triple QxxK/R motif-containing protein Human genes 0.000 description 1
- 102100035287 Tropomodulin-3 Human genes 0.000 description 1
- 102100033632 Tropomyosin alpha-1 chain Human genes 0.000 description 1
- 102100033080 Tropomyosin alpha-3 chain Human genes 0.000 description 1
- 102100034302 Tryptophan-tRNA ligase, mitochondrial Human genes 0.000 description 1
- 102100029299 Tubby-related protein 4 Human genes 0.000 description 1
- 102100024764 Tubulin delta chain Human genes 0.000 description 1
- 102100036105 Tubulin polyglutamylase TTLL11 Human genes 0.000 description 1
- 102100026482 Tubulin-folding cofactor B Human genes 0.000 description 1
- 102100026477 Tubulin-specific chaperone A Human genes 0.000 description 1
- 102100040255 Tubulin-specific chaperone C Human genes 0.000 description 1
- 102100024769 Tubulin-specific chaperone E Human genes 0.000 description 1
- 102100030286 Tubulin-specific chaperone cofactor E-like protein Human genes 0.000 description 1
- 102100036111 Tubulin-tyrosine ligase-like protein 12 Human genes 0.000 description 1
- 102100026362 Tudor domain-containing protein 3 Human genes 0.000 description 1
- 102100032856 Tuftelin-interacting protein 11 Human genes 0.000 description 1
- 102000000504 Tumor Suppressor p53-Binding Protein 1 Human genes 0.000 description 1
- 108010041385 Tumor Suppressor p53-Binding Protein 1 Proteins 0.000 description 1
- 102100040112 Tumor necrosis factor receptor superfamily member 10B Human genes 0.000 description 1
- 102100033732 Tumor necrosis factor receptor superfamily member 1A Human genes 0.000 description 1
- 102100031904 Tumor protein D54 Human genes 0.000 description 1
- 102100036129 Tumor suppressor candidate 2 Human genes 0.000 description 1
- 102100040879 Tumor susceptibility gene 101 protein Human genes 0.000 description 1
- 102100036223 Twinfilin-1 Human genes 0.000 description 1
- 102100031721 Twinfilin-2 Human genes 0.000 description 1
- 102100026736 Two pore channel protein 1 Human genes 0.000 description 1
- 102100034491 Type 1 phosphatidylinositol 4,5-bisphosphate 4-phosphatase Human genes 0.000 description 1
- 108010046308 Type II DNA Topoisomerases Proteins 0.000 description 1
- 102100039257 Type II inositol 1,4,5-trisphosphate 5-phosphatase Human genes 0.000 description 1
- 102100022596 Tyrosine-protein kinase ABL1 Human genes 0.000 description 1
- 102100022651 Tyrosine-protein kinase ABL2 Human genes 0.000 description 1
- 102100033438 Tyrosine-protein kinase JAK1 Human genes 0.000 description 1
- 102100022356 Tyrosine-protein kinase Mer Human genes 0.000 description 1
- 102100021788 Tyrosine-protein kinase Yes Human genes 0.000 description 1
- 102100033001 Tyrosine-protein phosphatase non-receptor type 1 Human genes 0.000 description 1
- 102100033019 Tyrosine-protein phosphatase non-receptor type 11 Human genes 0.000 description 1
- 102100033020 Tyrosine-protein phosphatase non-receptor type 12 Human genes 0.000 description 1
- 102100033141 Tyrosine-protein phosphatase non-receptor type 2 Human genes 0.000 description 1
- 102100033137 Tyrosine-protein phosphatase non-receptor type 23 Human genes 0.000 description 1
- 102100034298 Tyrosine-tRNA ligase, cytoplasmic Human genes 0.000 description 1
- 102100025336 Tyrosine-tRNA ligase, mitochondrial Human genes 0.000 description 1
- 102100024578 Tyrosyl-DNA phosphodiesterase 2 Human genes 0.000 description 1
- 102100024121 U1 small nuclear ribonucleoprotein 70 kDa Human genes 0.000 description 1
- 102100022013 U1 small nuclear ribonucleoprotein A Human genes 0.000 description 1
- 102100035136 U1 small nuclear ribonucleoprotein C Human genes 0.000 description 1
- 102100034461 U2 small nuclear ribonucleoprotein B'' Human genes 0.000 description 1
- 102100035036 U2 small nuclear ribonucleoprotein auxiliary factor 35 kDa subunit-related protein 2 Human genes 0.000 description 1
- 102100031884 U2 snRNP-associated SURP motif-containing protein Human genes 0.000 description 1
- 102100040099 U3 small nucleolar RNA-associated protein 14 homolog A Human genes 0.000 description 1
- 102100031348 U3 small nucleolar RNA-associated protein 18 homolog Human genes 0.000 description 1
- 102100031542 U3 small nucleolar RNA-associated protein 25 homolog Human genes 0.000 description 1
- 102100031376 U3 small nucleolar RNA-interacting protein 2 Human genes 0.000 description 1
- 102100032497 U3 small nucleolar ribonucleoprotein protein MPP10 Human genes 0.000 description 1
- 102100040374 U4/U6 small nuclear ribonucleoprotein Prp3 Human genes 0.000 description 1
- 102100040118 U4/U6 small nuclear ribonucleoprotein Prp31 Human genes 0.000 description 1
- 102100028852 U4/U6 small nuclear ribonucleoprotein Prp4 Human genes 0.000 description 1
- 102100031467 U4/U6.U5 small nuclear ribonucleoprotein 27 kDa protein Human genes 0.000 description 1
- 102100027244 U4/U6.U5 tri-snRNP-associated protein 1 Human genes 0.000 description 1
- 102100027243 U4/U6.U5 tri-snRNP-associated protein 2 Human genes 0.000 description 1
- 102100036230 U5 small nuclear ribonucleoprotein 200 kDa helicase Human genes 0.000 description 1
- 102100031471 U5 small nuclear ribonucleoprotein 40 kDa protein Human genes 0.000 description 1
- 102100031314 U6 snRNA phosphodiesterase 1 Human genes 0.000 description 1
- 102100033314 U6 snRNA-associated Sm-like protein LSm1 Human genes 0.000 description 1
- 102100033313 U6 snRNA-associated Sm-like protein LSm3 Human genes 0.000 description 1
- 102100028262 U6 snRNA-associated Sm-like protein LSm4 Human genes 0.000 description 1
- 102100028261 U6 snRNA-associated Sm-like protein LSm5 Human genes 0.000 description 1
- 102100032068 U6 snRNA-associated Sm-like protein LSm6 Human genes 0.000 description 1
- 102100040951 U6 snRNA-associated Sm-like protein LSm7 Human genes 0.000 description 1
- 102100030662 U8 snoRNA-decapping enzyme Human genes 0.000 description 1
- 102100037229 UAP56-interacting factor Human genes 0.000 description 1
- 102000003436 UBA3 Human genes 0.000 description 1
- 108060008744 UBA3 Proteins 0.000 description 1
- 102000056723 UBE3C Human genes 0.000 description 1
- 101150056689 UBR2 gene Proteins 0.000 description 1
- 102100040201 UBX domain-containing protein 1 Human genes 0.000 description 1
- 102100029788 UBX domain-containing protein 2B Human genes 0.000 description 1
- 102100031308 UBX domain-containing protein 4 Human genes 0.000 description 1
- 102100031309 UBX domain-containing protein 6 Human genes 0.000 description 1
- 102100031302 UBX domain-containing protein 7 Human genes 0.000 description 1
- 102100037921 UDP-N-acetylglucosamine pyrophosphorylase Human genes 0.000 description 1
- 102100038413 UDP-N-acetylglucosamine-dolichyl-phosphate N-acetylglucosaminephosphotransferase Human genes 0.000 description 1
- 102100032285 UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Human genes 0.000 description 1
- 102100033782 UDP-galactose translocator Human genes 0.000 description 1
- 102100023914 UDP-glucuronic acid decarboxylase 1 Human genes 0.000 description 1
- 102000003450 UFL1 Human genes 0.000 description 1
- 102100037610 UHRF1-binding protein 1 Human genes 0.000 description 1
- 102100027977 UHRF1-binding protein 1-like Human genes 0.000 description 1
- 102100020797 UMP-CMP kinase Human genes 0.000 description 1
- 102100029286 UNC93-like protein MFSD11 Human genes 0.000 description 1
- 102100033873 UPF0235 protein C15orf40 Human genes 0.000 description 1
- 102100034623 UPF0415 protein C7orf25 Human genes 0.000 description 1
- 102100034828 UPF0461 protein C5orf24 Human genes 0.000 description 1
- 102100038065 UPF0462 protein C4orf33 Human genes 0.000 description 1
- 102100026670 UPF0538 protein C2orf76 Human genes 0.000 description 1
- 102100039432 UPF0545 protein C22orf39 Human genes 0.000 description 1
- 102100026604 UPF0547 protein C16orf87 Human genes 0.000 description 1
- 102100029888 UPF0561 protein C2orf68 Human genes 0.000 description 1
- 102100033664 UPF0598 protein C8orf82 Human genes 0.000 description 1
- 102100025761 UPF0669 protein C6orf120 Human genes 0.000 description 1
- 102100038729 UPF0711 protein C18orf21 Human genes 0.000 description 1
- 102100038711 UPF0729 protein C18orf32 Human genes 0.000 description 1
- 101710028540 UPF2 Proteins 0.000 description 1
- 102100039854 USP6 N-terminal-like protein Human genes 0.000 description 1
- 101150020913 USP7 gene Proteins 0.000 description 1
- 102100038834 UTP-glucose-1-phosphate uridylyltransferase Human genes 0.000 description 1
- 102100020779 UV excision repair protein RAD23 homolog B Human genes 0.000 description 1
- 102100031275 UV radiation resistance-associated gene protein Human genes 0.000 description 1
- 102100039547 UbiA prenyltransferase domain-containing protein 1 Human genes 0.000 description 1
- 102100038458 Ubinuclein-1 Human genes 0.000 description 1
- 102100039934 Ubiquilin-1 Human genes 0.000 description 1
- 102100039933 Ubiquilin-2 Human genes 0.000 description 1
- 102100029512 Ubiquinol-cytochrome-c reductase complex assembly factor 1 Human genes 0.000 description 1
- 102100035953 Ubiquinone biosynthesis protein COQ4 homolog, mitochondrial Human genes 0.000 description 1
- 102100038426 Ubiquitin carboxyl-terminal hydrolase 10 Human genes 0.000 description 1
- 102100029163 Ubiquitin carboxyl-terminal hydrolase 14 Human genes 0.000 description 1
- 102100029164 Ubiquitin carboxyl-terminal hydrolase 15 Human genes 0.000 description 1
- 102100020730 Ubiquitin carboxyl-terminal hydrolase 16 Human genes 0.000 description 1
- 102100020728 Ubiquitin carboxyl-terminal hydrolase 19 Human genes 0.000 description 1
- 102100039920 Ubiquitin carboxyl-terminal hydrolase 20 Human genes 0.000 description 1
- 102100037184 Ubiquitin carboxyl-terminal hydrolase 22 Human genes 0.000 description 1
- 102100037176 Ubiquitin carboxyl-terminal hydrolase 24 Human genes 0.000 description 1
- 102100029736 Ubiquitin carboxyl-terminal hydrolase 27 Human genes 0.000 description 1
- 102100040047 Ubiquitin carboxyl-terminal hydrolase 33 Human genes 0.000 description 1
- 102100040048 Ubiquitin carboxyl-terminal hydrolase 35 Human genes 0.000 description 1
- 102100038463 Ubiquitin carboxyl-terminal hydrolase 4 Human genes 0.000 description 1
- 102100024718 Ubiquitin carboxyl-terminal hydrolase 45 Human genes 0.000 description 1
- 102100025023 Ubiquitin carboxyl-terminal hydrolase 48 Human genes 0.000 description 1
- 102100021017 Ubiquitin carboxyl-terminal hydrolase 5 Human genes 0.000 description 1
- 102100021013 Ubiquitin carboxyl-terminal hydrolase 7 Human genes 0.000 description 1
- 102100029088 Ubiquitin carboxyl-terminal hydrolase 8 Human genes 0.000 description 1
- 102100026279 Ubiquitin carboxyl-terminal hydrolase MINDY-1 Human genes 0.000 description 1
- 102100025040 Ubiquitin carboxyl-terminal hydrolase isozyme L3 Human genes 0.000 description 1
- 102100038443 Ubiquitin carboxyl-terminal hydrolase isozyme L5 Human genes 0.000 description 1
- 102100038532 Ubiquitin conjugation factor E4 A Human genes 0.000 description 1
- 102100038487 Ubiquitin conjugation factor E4 B Human genes 0.000 description 1
- 102100038833 Ubiquitin recognition factor in ER-associated degradation protein 1 Human genes 0.000 description 1
- 102100026369 Ubiquitin thioesterase OTU1 Human genes 0.000 description 1
- 102100040461 Ubiquitin thioesterase OTUB1 Human genes 0.000 description 1
- 102100027846 Ubiquitin thioesterase ZRANB1 Human genes 0.000 description 1
- 102100023341 Ubiquitin-40S ribosomal protein S27a Human genes 0.000 description 1
- 102100028462 Ubiquitin-60S ribosomal protein L40 Human genes 0.000 description 1
- 108700011958 Ubiquitin-Specific Peptidase 7 Proteins 0.000 description 1
- 102100037933 Ubiquitin-associated domain-containing protein 2 Human genes 0.000 description 1
- 102100029779 Ubiquitin-associated protein 1 Human genes 0.000 description 1
- 102100029817 Ubiquitin-associated protein 2-like Human genes 0.000 description 1
- 102100037261 Ubiquitin-conjugating enzyme E2 A Human genes 0.000 description 1
- 102100037262 Ubiquitin-conjugating enzyme E2 B Human genes 0.000 description 1
- 102100030439 Ubiquitin-conjugating enzyme E2 D2 Human genes 0.000 description 1
- 102100030425 Ubiquitin-conjugating enzyme E2 D3 Human genes 0.000 description 1
- 102100020699 Ubiquitin-conjugating enzyme E2 D4 Human genes 0.000 description 1
- 102100020711 Ubiquitin-conjugating enzyme E2 E1 Human genes 0.000 description 1
- 102100020709 Ubiquitin-conjugating enzyme E2 E3 Human genes 0.000 description 1
- 102100020712 Ubiquitin-conjugating enzyme E2 G1 Human genes 0.000 description 1
- 102100024870 Ubiquitin-conjugating enzyme E2 G2 Human genes 0.000 description 1
- 102100020698 Ubiquitin-conjugating enzyme E2 H Human genes 0.000 description 1
- 102100024860 Ubiquitin-conjugating enzyme E2 J1 Human genes 0.000 description 1
- 102100020696 Ubiquitin-conjugating enzyme E2 K Human genes 0.000 description 1
- 102100024861 Ubiquitin-conjugating enzyme E2 L3 Human genes 0.000 description 1
- 102100020695 Ubiquitin-conjugating enzyme E2 N Human genes 0.000 description 1
- 102100024846 Ubiquitin-conjugating enzyme E2 Q1 Human genes 0.000 description 1
- 102100038466 Ubiquitin-conjugating enzyme E2 R1 Human genes 0.000 description 1
- 102100038499 Ubiquitin-conjugating enzyme E2 R2 Human genes 0.000 description 1
- 102100028700 Ubiquitin-conjugating enzyme E2 W Human genes 0.000 description 1
- 102100038467 Ubiquitin-conjugating enzyme E2 variant 1 Human genes 0.000 description 1
- 102100031122 Ubiquitin-conjugating enzyme E2 variant 2 Human genes 0.000 description 1
- 102100039936 Ubiquitin-conjugating enzyme E2 variant 3 Human genes 0.000 description 1
- 102100038483 Ubiquitin-fold modifier-conjugating enzyme 1 Human genes 0.000 description 1
- 102100022979 Ubiquitin-like modifier-activating enzyme ATG7 Human genes 0.000 description 1
- 102100037847 Ubiquitin-like protein 3 Human genes 0.000 description 1
- 102100037842 Ubiquitin-like protein 4A Human genes 0.000 description 1
- 102100030580 Ubiquitin-like protein 5 Human genes 0.000 description 1
- 102100028060 Ubiquitin-like-conjugating enzyme ATG10 Human genes 0.000 description 1
- 102100030434 Ubiquitin-protein ligase E3A Human genes 0.000 description 1
- 102100030429 Ubiquitin-protein ligase E3B Human genes 0.000 description 1
- 102100031319 Ubiquitin-related modifier 1 Human genes 0.000 description 1
- 229940126752 Ubiquitin-specific protease 7 inhibitor Drugs 0.000 description 1
- 102100024843 Ubiquitin/ISG15-conjugating enzyme E2 L6 Human genes 0.000 description 1
- 102100029353 Uncharacterized protein C12orf29 Human genes 0.000 description 1
- 102100022065 Uncharacterized protein C14orf28 Human genes 0.000 description 1
- 102100033881 Uncharacterized protein C15orf61 Human genes 0.000 description 1
- 102100026673 Uncharacterized protein C2orf74 Human genes 0.000 description 1
- 102100031588 Uncharacterized protein C4orf3 Human genes 0.000 description 1
- 102100031218 Uncharacterized protein C6orf136 Human genes 0.000 description 1
- 102100038116 Uncharacterized protein C6orf226 Human genes 0.000 description 1
- 102100034425 Uncharacterized protein C7orf50 Human genes 0.000 description 1
- 102100037145 Uncharacterized protein KIAA0232 Human genes 0.000 description 1
- 102100025766 Uncharacterized protein KIAA0930 Human genes 0.000 description 1
- 102100022862 Uncharacterized protein KIAA1671 Human genes 0.000 description 1
- 102100033622 Unconventional prefoldin RPB5 interactor 1 Human genes 0.000 description 1
- 102100028185 Unhealthy ribosome biogenesis protein 2 homolog Human genes 0.000 description 1
- 102100031205 Up-regulator of cell proliferation Human genes 0.000 description 1
- 102100040103 Upstream stimulatory factor 2 Human genes 0.000 description 1
- 102100032304 Uridine diphosphate glucose pyrophosphatase NUDT22 Human genes 0.000 description 1
- 102100038442 Uridine-cytidine kinase 1 Human genes 0.000 description 1
- 102100029150 Uridine-cytidine kinase 2 Human genes 0.000 description 1
- 102100029155 Uridine-cytidine kinase-like 1 Human genes 0.000 description 1
- 102100024118 Uroporphyrinogen decarboxylase Human genes 0.000 description 1
- 108020000963 Uroporphyrinogen-III synthase Proteins 0.000 description 1
- 102100034397 Uroporphyrinogen-III synthase Human genes 0.000 description 1
- 108010075653 Utrophin Proteins 0.000 description 1
- 102100029092 Utrophin Human genes 0.000 description 1
- 102100037979 V-type proton ATPase 116 kDa subunit a 1 Human genes 0.000 description 1
- 102100020745 V-type proton ATPase 116 kDa subunit a 2 Human genes 0.000 description 1
- 102100037167 V-type proton ATPase 21 kDa proteolipid subunit c'' Human genes 0.000 description 1
- 102100032189 V-type proton ATPase subunit C 1 Human genes 0.000 description 1
- 102100033478 V-type proton ATPase subunit D Human genes 0.000 description 1
- 102100039465 V-type proton ATPase subunit E 1 Human genes 0.000 description 1
- 102100037112 V-type proton ATPase subunit F Human genes 0.000 description 1
- 102100037433 V-type proton ATPase subunit G 1 Human genes 0.000 description 1
- 102100039006 V-type proton ATPase subunit H Human genes 0.000 description 1
- 102100037090 V-type proton ATPase subunit S1 Human genes 0.000 description 1
- 102100036507 V-type proton ATPase subunit d 1 Human genes 0.000 description 1
- 102100040563 V-type proton ATPase subunit e 1 Human genes 0.000 description 1
- 102100040248 VIP36-like protein Human genes 0.000 description 1
- 101710075829 VPS37A Proteins 0.000 description 1
- 102100039138 VPS9 domain-containing protein 1 Human genes 0.000 description 1
- 102100035048 Vacuolar ATPase assembly integral membrane protein VMA21 Human genes 0.000 description 1
- 102100031583 Vacuolar fusion protein CCZ1 homolog Human genes 0.000 description 1
- 102100033389 Vacuolar fusion protein MON1 homolog A Human genes 0.000 description 1
- 102100033385 Vacuolar fusion protein MON1 homolog B Human genes 0.000 description 1
- 102100039114 Vacuolar protein sorting-associated protein 13A Human genes 0.000 description 1
- 102100039113 Vacuolar protein sorting-associated protein 13B Human genes 0.000 description 1
- 102100039112 Vacuolar protein sorting-associated protein 13C Human genes 0.000 description 1
- 102100039110 Vacuolar protein sorting-associated protein 13D Human genes 0.000 description 1
- 102100038398 Vacuolar protein sorting-associated protein 26A Human genes 0.000 description 1
- 102100038397 Vacuolar protein sorting-associated protein 26C Human genes 0.000 description 1
- 102100028227 Vacuolar protein sorting-associated protein 28 homolog Human genes 0.000 description 1
- 102100028290 Vacuolar protein sorting-associated protein 29 Human genes 0.000 description 1
- 102100034324 Vacuolar protein sorting-associated protein 37A Human genes 0.000 description 1
- 102100029495 Vacuolar protein sorting-associated protein 45 Human genes 0.000 description 1
- 102100035085 Vacuolar protein sorting-associated protein 4A Human genes 0.000 description 1
- 102100038936 Vacuolar protein sorting-associated protein 51 homolog Human genes 0.000 description 1
- 102100035288 Vacuolar protein sorting-associated protein 54 Human genes 0.000 description 1
- 102100038324 Vacuolar protein sorting-associated protein 8 homolog Human genes 0.000 description 1
- 102100022960 Vacuolar protein-sorting-associated protein 36 Human genes 0.000 description 1
- 102100022787 Vacuolar-sorting protein SNF8 Human genes 0.000 description 1
- 102100025139 Valacyclovir hydrolase Human genes 0.000 description 1
- 102100022962 Vam6/Vps39-like protein Human genes 0.000 description 1
- 102100023517 Vang-like protein 1 Human genes 0.000 description 1
- 102100034166 Vasculin Human genes 0.000 description 1
- 102100037438 Very-long-chain 3-oxoacyl-CoA reductase Human genes 0.000 description 1
- 102100024018 Vesicle transport protein GOT1B Human genes 0.000 description 1
- 102100035030 Vesicle transport protein SEC20 Human genes 0.000 description 1
- 108010017749 Vesicle-Associated Membrane Protein 3 Proteins 0.000 description 1
- 108090000169 Vesicle-associated membrane protein 2 Proteins 0.000 description 1
- 102000003786 Vesicle-associated membrane protein 2 Human genes 0.000 description 1
- 102100031486 Vesicle-associated membrane protein 3 Human genes 0.000 description 1
- 102100028641 Vesicle-associated membrane protein-associated protein A Human genes 0.000 description 1
- 102100032026 Vesicle-associated membrane protein-associated protein B/C Human genes 0.000 description 1
- 102100031495 Vesicle-trafficking protein SEC22a Human genes 0.000 description 1
- 102100028753 Vesicle-trafficking protein SEC22b Human genes 0.000 description 1
- 102100028759 Vesicle-trafficking protein SEC22c Human genes 0.000 description 1
- 102100028982 Vezatin Human genes 0.000 description 1
- 102100037814 Vigilin Human genes 0.000 description 1
- 102100023479 Vinexin Human genes 0.000 description 1
- 108010067390 Viral Proteins Proteins 0.000 description 1
- 102100038182 Vitamin K-dependent gamma-carboxylase Human genes 0.000 description 1
- 108010022133 Voltage-Dependent Anion Channel 1 Proteins 0.000 description 1
- 108010022109 Voltage-Dependent Anion Channel 2 Proteins 0.000 description 1
- 102100037820 Voltage-dependent anion-selective channel protein 1 Human genes 0.000 description 1
- 102100037803 Voltage-dependent anion-selective channel protein 2 Human genes 0.000 description 1
- 102100033099 Voltage-dependent anion-selective channel protein 3 Human genes 0.000 description 1
- 102100040985 Volume-regulated anion channel subunit LRRC8A Human genes 0.000 description 1
- 102100037107 WASH complex subunit 2C Human genes 0.000 description 1
- 102100038143 WASH complex subunit 4 Human genes 0.000 description 1
- 102100038142 WASH complex subunit 5 Human genes 0.000 description 1
- 102100036048 WASP homolog-associated protein with actin, membranes and microtubules Human genes 0.000 description 1
- 102100023038 WD and tetratricopeptide repeats protein 1 Human genes 0.000 description 1
- 102100029465 WD repeat and FYVE domain-containing protein 3 Human genes 0.000 description 1
- 108010020277 WD repeat containing planar cell polarity effector Proteins 0.000 description 1
- 102100037050 WD repeat domain phosphoinositide-interacting protein 2 Human genes 0.000 description 1
- 102100037048 WD repeat domain phosphoinositide-interacting protein 4 Human genes 0.000 description 1
- 102100036626 WD repeat domain-containing protein 83 Human genes 0.000 description 1
- 102100020877 WD repeat-containing and planar cell polarity effector protein fritz homolog Human genes 0.000 description 1
- 102100036551 WD repeat-containing protein 1 Human genes 0.000 description 1
- 102100039130 WD repeat-containing protein 13 Human genes 0.000 description 1
- 102100036561 WD repeat-containing protein 20 Human genes 0.000 description 1
- 102100038139 WD repeat-containing protein 25 Human genes 0.000 description 1
- 102100038138 WD repeat-containing protein 26 Human genes 0.000 description 1
- 102100038964 WD repeat-containing protein 3 Human genes 0.000 description 1
- 102100038158 WD repeat-containing protein 35 Human genes 0.000 description 1
- 102100038947 WD repeat-containing protein 37 Human genes 0.000 description 1
- 102100038960 WD repeat-containing protein 43 Human genes 0.000 description 1
- 102100038961 WD repeat-containing protein 44 Human genes 0.000 description 1
- 102100028276 WD repeat-containing protein 46 Human genes 0.000 description 1
- 102100029445 WD repeat-containing protein 5 Human genes 0.000 description 1
- 102100035132 WD repeat-containing protein 55 Human genes 0.000 description 1
- 102100038088 WD repeat-containing protein 7 Human genes 0.000 description 1
- 102100038087 WD repeat-containing protein 81 Human genes 0.000 description 1
- 102100036634 WD repeat-containing protein 89 Human genes 0.000 description 1
- 102100035327 WD repeat-containing protein WRAP73 Human genes 0.000 description 1
- 108010036639 WW Domain-Containing Oxidoreductase Proteins 0.000 description 1
- 102100028277 WW domain binding protein 1-like Human genes 0.000 description 1
- 102100028275 WW domain-binding protein 11 Human genes 0.000 description 1
- 102100039412 WW domain-binding protein 2 Human genes 0.000 description 1
- 102100039411 WW domain-binding protein 4 Human genes 0.000 description 1
- 102100027534 WW domain-containing oxidoreductase Human genes 0.000 description 1
- 108091008852 Waterwitch Proteins 0.000 description 1
- 102100020735 Wings apart-like protein homolog Human genes 0.000 description 1
- 108700031544 X-Linked Inhibitor of Apoptosis Proteins 0.000 description 1
- 102100040092 X-linked retinitis pigmentosa GTPase regulator Human genes 0.000 description 1
- 102100038365 Xaa-Pro aminopeptidase 1 Human genes 0.000 description 1
- 101100445056 Xenopus laevis elavl1-a gene Proteins 0.000 description 1
- 101100445057 Xenopus laevis elavl1-b gene Proteins 0.000 description 1
- 108010004696 Xenotropic and Polytropic Retrovirus Receptor Proteins 0.000 description 1
- 102100036974 Xenotropic and polytropic retrovirus receptor 1 Human genes 0.000 description 1
- 108700031763 Xeroderma Pigmentosum Group D Proteins 0.000 description 1
- 108091002437 YBX1 Proteins 0.000 description 1
- 102000033021 YBX1 Human genes 0.000 description 1
- 102100024780 YEATS domain-containing protein 4 Human genes 0.000 description 1
- 108091009222 YME1L1 Proteins 0.000 description 1
- 102100039647 YTH domain-containing family protein 1 Human genes 0.000 description 1
- 102100039644 YTH domain-containing family protein 2 Human genes 0.000 description 1
- 102100023905 YTH domain-containing protein 1 Human genes 0.000 description 1
- 102100027644 YY1-associated factor 2 Human genes 0.000 description 1
- 102100023267 YY1-associated protein 1 Human genes 0.000 description 1
- 108091009221 ZMPSTE24 Proteins 0.000 description 1
- 102100023893 ZZ-type zinc finger-containing protein 3 Human genes 0.000 description 1
- 102100025788 Zinc finger BED domain-containing protein 4 Human genes 0.000 description 1
- 102100025792 Zinc finger BED domain-containing protein 6 Human genes 0.000 description 1
- 102100028880 Zinc finger C4H2 domain-containing protein Human genes 0.000 description 1
- 102100025402 Zinc finger CCCH domain-containing protein 11A Human genes 0.000 description 1
- 102100036624 Zinc finger CCCH domain-containing protein 13 Human genes 0.000 description 1
- 102100036578 Zinc finger CCCH domain-containing protein 3 Human genes 0.000 description 1
- 102100036582 Zinc finger CCCH domain-containing protein 4 Human genes 0.000 description 1
- 102100036644 Zinc finger CCCH domain-containing protein 7A Human genes 0.000 description 1
- 102100036643 Zinc finger CCCH domain-containing protein 7B Human genes 0.000 description 1
- 102100028540 Zinc finger CCCH-type with G patch domain-containing protein Human genes 0.000 description 1
- 102100028883 Zinc finger CCHC domain-containing protein 10 Human genes 0.000 description 1
- 102100028477 Zinc finger CCHC domain-containing protein 14 Human genes 0.000 description 1
- 102100028479 Zinc finger CCHC domain-containing protein 2 Human genes 0.000 description 1
- 102100025362 Zinc finger CCHC domain-containing protein 9 Human genes 0.000 description 1
- 102100023385 Zinc finger FYVE domain-containing protein 16 Human genes 0.000 description 1
- 102100026419 Zinc finger FYVE domain-containing protein 26 Human genes 0.000 description 1
- 102100028598 Zinc finger HIT domain-containing protein 3 Human genes 0.000 description 1
- 102100025085 Zinc finger MYM-type protein 2 Human genes 0.000 description 1
- 102100025418 Zinc finger MYM-type protein 4 Human genes 0.000 description 1
- 102100025415 Zinc finger MYM-type protein 5 Human genes 0.000 description 1
- 102100025424 Zinc finger MYM-type protein 6 Human genes 0.000 description 1
- 102100028551 Zinc finger MYND domain-containing protein 11 Human genes 0.000 description 1
- 102100028956 Zinc finger Ran-binding domain-containing protein 2 Human genes 0.000 description 1
- 102100034654 Zinc finger SWIM domain-containing protein 7 Human genes 0.000 description 1
- 102100040696 Zinc finger SWIM domain-containing protein 8 Human genes 0.000 description 1
- 102100020909 Zinc finger X-linked protein ZXDA Human genes 0.000 description 1
- 102100020911 Zinc finger X-linked protein ZXDB Human genes 0.000 description 1
- 102100023894 Zinc finger ZZ-type and EF-hand domain-containing protein 1 Human genes 0.000 description 1
- 102100023253 Zinc finger and BTB domain-containing protein 1 Human genes 0.000 description 1
- 102100040327 Zinc finger and BTB domain-containing protein 10 Human genes 0.000 description 1
- 102100040330 Zinc finger and BTB domain-containing protein 11 Human genes 0.000 description 1
- 102100040315 Zinc finger and BTB domain-containing protein 14 Human genes 0.000 description 1
- 102100040761 Zinc finger and BTB domain-containing protein 17 Human genes 0.000 description 1
- 102100040762 Zinc finger and BTB domain-containing protein 18 Human genes 0.000 description 1
- 102100021130 Zinc finger and BTB domain-containing protein 21 Human genes 0.000 description 1
- 102100021129 Zinc finger and BTB domain-containing protein 24 Human genes 0.000 description 1
- 102100021127 Zinc finger and BTB domain-containing protein 25 Human genes 0.000 description 1
- 102100028133 Zinc finger and BTB domain-containing protein 39 Human genes 0.000 description 1
- 102100028128 Zinc finger and BTB domain-containing protein 40 Human genes 0.000 description 1
- 102100028132 Zinc finger and BTB domain-containing protein 44 Human genes 0.000 description 1
- 102100025377 Zinc finger and BTB domain-containing protein 5 Human genes 0.000 description 1
- 102100025396 Zinc finger and BTB domain-containing protein 6 Human genes 0.000 description 1
- 102100023264 Zinc finger and BTB domain-containing protein 7A Human genes 0.000 description 1
- 102100020922 Zinc finger and SCAN domain-containing protein 12 Human genes 0.000 description 1
- 102100026583 Zinc finger and SCAN domain-containing protein 26 Human genes 0.000 description 1
- 102100026582 Zinc finger and SCAN domain-containing protein 30 Human genes 0.000 description 1
- 102100026587 Zinc finger and SCAN domain-containing protein 32 Human genes 0.000 description 1
- 102100026624 Zinc finger and SCAN domain-containing protein 9 Human genes 0.000 description 1
- 102100039966 Zinc finger homeobox protein 3 Human genes 0.000 description 1
- 102100028542 Zinc finger matrin-type protein 5 Human genes 0.000 description 1
- 102100021058 Zinc finger protein 12 Human genes 0.000 description 1
- 102100023570 Zinc finger protein 121 Human genes 0.000 description 1
- 102100023571 Zinc finger protein 131 Human genes 0.000 description 1
- 102100023575 Zinc finger protein 133 Human genes 0.000 description 1
- 102100023574 Zinc finger protein 134 Human genes 0.000 description 1
- 102100023394 Zinc finger protein 138 Human genes 0.000 description 1
- 102100023393 Zinc finger protein 140 Human genes 0.000 description 1
- 102100023392 Zinc finger protein 142 Human genes 0.000 description 1
- 102100023389 Zinc finger protein 143 Human genes 0.000 description 1
- 102100040783 Zinc finger protein 155 Human genes 0.000 description 1
- 102100021378 Zinc finger protein 16 Human genes 0.000 description 1
- 102100040815 Zinc finger protein 160 Human genes 0.000 description 1
- 102100021376 Zinc finger protein 17 Human genes 0.000 description 1
- 102100040812 Zinc finger protein 174 Human genes 0.000 description 1
- 102100040810 Zinc finger protein 175 Human genes 0.000 description 1
- 102100040811 Zinc finger protein 181 Human genes 0.000 description 1
- 102100040778 Zinc finger protein 182 Human genes 0.000 description 1
- 102100040027 Zinc finger protein 189 Human genes 0.000 description 1
- 102100040030 Zinc finger protein 195 Human genes 0.000 description 1
- 102100040029 Zinc finger protein 197 Human genes 0.000 description 1
- 102100024687 Zinc finger protein 2 Human genes 0.000 description 1
- 102100039976 Zinc finger protein 202 Human genes 0.000 description 1
- 102100039959 Zinc finger protein 205 Human genes 0.000 description 1
- 102100039979 Zinc finger protein 212 Human genes 0.000 description 1
- 102100028356 Zinc finger protein 22 Human genes 0.000 description 1
- 102100036559 Zinc finger protein 226 Human genes 0.000 description 1
- 102100036549 Zinc finger protein 232 Human genes 0.000 description 1
- 102100036554 Zinc finger protein 235 Human genes 0.000 description 1
- 102100021120 Zinc finger protein 236 Human genes 0.000 description 1
- 102100028365 Zinc finger protein 24 Human genes 0.000 description 1
- 102100021364 Zinc finger protein 250 Human genes 0.000 description 1
- 102100021359 Zinc finger protein 263 Human genes 0.000 description 1
- 102100028399 Zinc finger protein 28 Human genes 0.000 description 1
- 102100040319 Zinc finger protein 280D Human genes 0.000 description 1
- 102100026316 Zinc finger protein 281 Human genes 0.000 description 1
- 102100026417 Zinc finger protein 282 Human genes 0.000 description 1
- 102100028431 Zinc finger protein 292 Human genes 0.000 description 1
- 102100024671 Zinc finger protein 3 Human genes 0.000 description 1
- 102100024704 Zinc finger protein 30 Human genes 0.000 description 1
- 102100028613 Zinc finger protein 30 homolog Human genes 0.000 description 1
- 102100028434 Zinc finger protein 302 Human genes 0.000 description 1
- 102100028454 Zinc finger protein 317 Human genes 0.000 description 1
- 102100028453 Zinc finger protein 318 Human genes 0.000 description 1
- 102100024703 Zinc finger protein 32 Human genes 0.000 description 1
- 102100028366 Zinc finger protein 322 Human genes 0.000 description 1
- 102100040336 Zinc finger protein 324A Human genes 0.000 description 1
- 102100029022 Zinc finger protein 330 Human genes 0.000 description 1
- 102100024659 Zinc finger protein 337 Human genes 0.000 description 1
- 102100024658 Zinc finger protein 33A Human genes 0.000 description 1
- 102100024657 Zinc finger protein 33B Human genes 0.000 description 1
- 102100024723 Zinc finger protein 346 Human genes 0.000 description 1
- 102100025433 Zinc finger protein 347 Human genes 0.000 description 1
- 102100024672 Zinc finger protein 35 Human genes 0.000 description 1
- 102100040317 Zinc finger protein 354A Human genes 0.000 description 1
- 102100025435 Zinc finger protein 37A Human genes 0.000 description 1
- 102100040731 Zinc finger protein 384 Human genes 0.000 description 1
- 102100040832 Zinc finger protein 407 Human genes 0.000 description 1
- 102100023554 Zinc finger protein 408 Human genes 0.000 description 1
- 102100024669 Zinc finger protein 41 Human genes 0.000 description 1
- 102100023547 Zinc finger protein 410 Human genes 0.000 description 1
- 102100023548 Zinc finger protein 414 Human genes 0.000 description 1
- 102100023549 Zinc finger protein 416 Human genes 0.000 description 1
- 102100023560 Zinc finger protein 419 Human genes 0.000 description 1
- 102100021352 Zinc finger protein 429 Human genes 0.000 description 1
- 102100021348 Zinc finger protein 438 Human genes 0.000 description 1
- 102100035868 Zinc finger protein 444 Human genes 0.000 description 1
- 102100035866 Zinc finger protein 446 Human genes 0.000 description 1
- 102100024670 Zinc finger protein 45 Human genes 0.000 description 1
- 102100035843 Zinc finger protein 460 Human genes 0.000 description 1
- 102100024667 Zinc finger protein 48 Human genes 0.000 description 1
- 102100028938 Zinc finger protein 484 Human genes 0.000 description 1
- 102100039960 Zinc finger protein 506 Human genes 0.000 description 1
- 102100039963 Zinc finger protein 507 Human genes 0.000 description 1
- 102100039058 Zinc finger protein 510 Human genes 0.000 description 1
- 102100026525 Zinc finger protein 513 Human genes 0.000 description 1
- 102100036690 Zinc finger protein 518A Human genes 0.000 description 1
- 102100034645 Zinc finger protein 554 Human genes 0.000 description 1
- 102100034651 Zinc finger protein 555 Human genes 0.000 description 1
- 102100034660 Zinc finger protein 557 Human genes 0.000 description 1
- 102100040828 Zinc finger protein 562 Human genes 0.000 description 1
- 102100040833 Zinc finger protein 565 Human genes 0.000 description 1
- 102100040787 Zinc finger protein 566 Human genes 0.000 description 1
- 102100024727 Zinc finger protein 580 Human genes 0.000 description 1
- 102100023891 Zinc finger protein 587 Human genes 0.000 description 1
- 102100023642 Zinc finger protein 592 Human genes 0.000 description 1
- 102100023638 Zinc finger protein 593 Human genes 0.000 description 1
- 102100021355 Zinc finger protein 609 Human genes 0.000 description 1
- 102100021106 Zinc finger protein 613 Human genes 0.000 description 1
- 102100021372 Zinc finger protein 619 Human genes 0.000 description 1
- 102100035819 Zinc finger protein 620 Human genes 0.000 description 1
- 102100035815 Zinc finger protein 623 Human genes 0.000 description 1
- 102100035817 Zinc finger protein 629 Human genes 0.000 description 1
- 102100035807 Zinc finger protein 630 Human genes 0.000 description 1
- 102100035806 Zinc finger protein 638 Human genes 0.000 description 1
- 102100026331 Zinc finger protein 639 Human genes 0.000 description 1
- 102100026509 Zinc finger protein 641 Human genes 0.000 description 1
- 102100026510 Zinc finger protein 644 Human genes 0.000 description 1
- 102100026453 Zinc finger protein 652 Human genes 0.000 description 1
- 102100026494 Zinc finger protein 655 Human genes 0.000 description 1
- 102100028934 Zinc finger protein 664 Human genes 0.000 description 1
- 102100028936 Zinc finger protein 668 Human genes 0.000 description 1
- 102100028941 Zinc finger protein 669 Human genes 0.000 description 1
- 102100028937 Zinc finger protein 670 Human genes 0.000 description 1
- 102100039040 Zinc finger protein 674 Human genes 0.000 description 1
- 102100039056 Zinc finger protein 680 Human genes 0.000 description 1
- 102100039108 Zinc finger protein 688 Human genes 0.000 description 1
- 102100027860 Zinc finger protein 691 Human genes 0.000 description 1
- 102100028373 Zinc finger protein 697 Human genes 0.000 description 1
- 102100040726 Zinc finger protein 7 Human genes 0.000 description 1
- 102100027850 Zinc finger protein 700 Human genes 0.000 description 1
- 102100040664 Zinc finger protein 706 Human genes 0.000 description 1
- 102100024699 Zinc finger protein 740 Human genes 0.000 description 1
- 102100024714 Zinc finger protein 746 Human genes 0.000 description 1
- 102100034966 Zinc finger protein 75D Human genes 0.000 description 1
- 102100040710 Zinc finger protein 76 Human genes 0.000 description 1
- 102100034973 Zinc finger protein 764 Human genes 0.000 description 1
- 102100034975 Zinc finger protein 766 Human genes 0.000 description 1
- 102100034984 Zinc finger protein 770 Human genes 0.000 description 1
- 102100028587 Zinc finger protein 777 Human genes 0.000 description 1
- 102100028586 Zinc finger protein 778 Human genes 0.000 description 1
- 102100028584 Zinc finger protein 782 Human genes 0.000 description 1
- 102100028590 Zinc finger protein 787 Human genes 0.000 description 1
- 102100023629 Zinc finger protein 790 Human genes 0.000 description 1
- 102100023624 Zinc finger protein 805 Human genes 0.000 description 1
- 102100023623 Zinc finger protein 808 Human genes 0.000 description 1
- 102100023595 Zinc finger protein 814 Human genes 0.000 description 1
- 102100035804 Zinc finger protein 823 Human genes 0.000 description 1
- 102100035783 Zinc finger protein 839 Human genes 0.000 description 1
- 102100040636 Zinc finger protein 84 Human genes 0.000 description 1
- 102100026487 Zinc finger protein 862 Human genes 0.000 description 1
- 102100026490 Zinc finger protein 865 Human genes 0.000 description 1
- 102100039070 Zinc finger protein 91 Human genes 0.000 description 1
- 102100024389 Zinc finger protein AEBP2 Human genes 0.000 description 1
- 102100025229 Zinc finger protein OZF Human genes 0.000 description 1
- 102100020893 Zinc finger protein Pegasus Human genes 0.000 description 1
- 102100029504 Zinc finger protein RFP Human genes 0.000 description 1
- 102100036606 Zinc finger protein ZFAT Human genes 0.000 description 1
- 102100028959 Zinc finger protein ZPR1 Human genes 0.000 description 1
- 102100020906 Zinc finger protein ZXDC Human genes 0.000 description 1
- 102100032701 Zinc finger protein ubi-d4 Human genes 0.000 description 1
- 102100026463 Zinc finger protein with KRAB and SCAN domains 1 Human genes 0.000 description 1
- 102100026520 Zinc finger protein with KRAB and SCAN domains 3 Human genes 0.000 description 1
- 102100028353 Zinc finger protein with KRAB and SCAN domains 5 Human genes 0.000 description 1
- 102100028346 Zinc finger protein with KRAB and SCAN domains 8 Human genes 0.000 description 1
- 102100025105 Zinc fingers and homeoboxes protein 1 Human genes 0.000 description 1
- 102100025093 Zinc fingers and homeoboxes protein 2 Human genes 0.000 description 1
- 102100025095 Zinc fingers and homeoboxes protein 3 Human genes 0.000 description 1
- 102100039877 Zinc phosphodiesterase ELAC protein 2 Human genes 0.000 description 1
- 102100026644 Zinc transporter 5 Human genes 0.000 description 1
- 102100026642 Zinc transporter 6 Human genes 0.000 description 1
- 102100021421 Zinc transporter 9 Human genes 0.000 description 1
- 102100023141 Zinc transporter SLC39A7 Human genes 0.000 description 1
- 102100025452 Zinc transporter ZIP1 Human genes 0.000 description 1
- 102100023140 Zinc transporter ZIP4 Human genes 0.000 description 1
- JLCPHMBAVCMARE-UHFFFAOYSA-N [3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[3-[[3-[[3-[[3-[[3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-5-(4-amino-2-oxopyrimidin-1-yl)oxolan-2-yl]methyl [5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate Polymers Cc1cn(C2CC(OP(O)(=O)OCC3OC(CC3OP(O)(=O)OCC3OC(CC3O)n3cnc4c3nc(N)[nH]c4=O)n3cnc4c3nc(N)[nH]c4=O)C(COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3COP(O)(=O)OC3CC(OC3CO)n3cnc4c(N)ncnc34)n3ccc(N)nc3=O)n3cnc4c(N)ncnc34)n3ccc(N)nc3=O)n3ccc(N)nc3=O)n3ccc(N)nc3=O)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cc(C)c(=O)[nH]c3=O)n3cc(C)c(=O)[nH]c3=O)n3ccc(N)nc3=O)n3cc(C)c(=O)[nH]c3=O)n3cnc4c3nc(N)[nH]c4=O)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)n3cnc4c(N)ncnc34)O2)c(=O)[nH]c1=O JLCPHMBAVCMARE-UHFFFAOYSA-N 0.000 description 1
- 102100037607 [3-methyl-2-oxobutanoate dehydrogenase [lipoamide]] kinase, mitochondrial Human genes 0.000 description 1
- QLACRIKFZRFWRU-UHFFFAOYSA-N [4-oxo-4-(4-oxobutan-2-yloxy)butan-2-yl] 3-hydroxybutanoate Chemical compound CC(O)CC(=O)OC(C)CC(=O)OC(C)CC=O QLACRIKFZRFWRU-UHFFFAOYSA-N 0.000 description 1
- 102100024150 [Pyruvate dehydrogenase (acetyl-transferring)] kinase isozyme 2, mitochondrial Human genes 0.000 description 1
- BOPGDPNILDQYTO-NDOGXIPWSA-N [[(2r,3r,4r,5r)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2r,3r,4r,5r)-5-(3-carbamoyl-4h-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate Chemical compound C1=CCC(C(=O)N)=CN1[C@H]1[C@H](O)[C@@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OC[C@@H]2[C@@H]([C@@H](O)[C@@H](O2)N2C3=NC=NC(N)=C3N=C2)O)O1 BOPGDPNILDQYTO-NDOGXIPWSA-N 0.000 description 1
- ZUPXXZAVUHFCNV-UHFFFAOYSA-N [[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [5-(3-carbamoyl-4h-pyridin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate;potassium Chemical compound [K].C1=CCC(C(=O)N)=CN1C1C(O)C(O)C(COP(O)(=O)OP(O)(=O)OCC2C(C(O)C(O2)N2C3=NC=NC(N)=C3N=C2)O)O1 ZUPXXZAVUHFCNV-UHFFFAOYSA-N 0.000 description 1
- 230000001594 aberrant effect Effects 0.000 description 1
- 230000023445 activated T cell autonomous cell death Effects 0.000 description 1
- 108010078976 aflatoxin B1 aldehyde reductase Proteins 0.000 description 1
- 108010009380 alpha-N-acetyl-D-glucosaminidase Proteins 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 210000004381 amniotic fluid Anatomy 0.000 description 1
- CWJNMKKMGIAGDK-UHFFFAOYSA-N amtolmetin guacil Chemical compound COC1=CC=CC=C1OC(=O)CNC(=O)CC(N1C)=CC=C1C(=O)C1=CC=C(C)C=C1 CWJNMKKMGIAGDK-UHFFFAOYSA-N 0.000 description 1
- 101150001938 anapc4 gene Proteins 0.000 description 1
- 101150085085 anapc7 gene Proteins 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 210000003567 ascitic fluid Anatomy 0.000 description 1
- 108700000711 bcl-X Proteins 0.000 description 1
- 230000006399 behavior Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000027455 binding Effects 0.000 description 1
- 108010005713 bis(5'-adenosyl)triphosphatase Proteins 0.000 description 1
- 108010018804 c-Mer Tyrosine Kinase Proteins 0.000 description 1
- 102100037490 cAMP-dependent protein kinase type I-alpha regulatory subunit Human genes 0.000 description 1
- 102100021204 cAMP-dependent protein kinase type II-alpha regulatory subunit Human genes 0.000 description 1
- 102100027985 cAMP-responsive element-binding protein-like 2 Human genes 0.000 description 1
- 101150113057 cactin gene Proteins 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 108010051348 cdc42 GTP-Binding Protein Proteins 0.000 description 1
- WYUSVOMTXWRGEK-HBWVYFAYSA-N cefpodoxime Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC)C(O)=O)C(=O)C(=N/OC)\C1=CSC(N)=N1 WYUSVOMTXWRGEK-HBWVYFAYSA-N 0.000 description 1
- 230000034303 cell budding Effects 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 230000033077 cellular process Effects 0.000 description 1
- 229960005395 cetuximab Drugs 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 101150018325 chmp1a gene Proteins 0.000 description 1
- 230000001332 colony forming effect Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000003750 conditioning effect Effects 0.000 description 1
- 230000002596 correlated effect Effects 0.000 description 1
- 101150118453 ctbp-1 gene Proteins 0.000 description 1
- 210000002726 cyst fluid Anatomy 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 102100032354 dTDP-D-glucose 4,6-dehydratase Human genes 0.000 description 1
- 101150077768 ddb1 gene Proteins 0.000 description 1
- 238000004925 denaturation Methods 0.000 description 1
- 230000036425 denaturation Effects 0.000 description 1
- 108010028753 deoxyhypusine hydroxylase Proteins 0.000 description 1
- 108010049285 dephospho-CoA kinase Proteins 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 108010043113 dolichyl-phosphate alpha-N-acetylglucosaminyltransferase Proteins 0.000 description 1
- 238000011304 droplet digital PCR Methods 0.000 description 1
- 102100034175 eIF-2-alpha kinase GCN2 Human genes 0.000 description 1
- 101150093313 eIF3c gene Proteins 0.000 description 1
- 101150004703 eIF3i gene Proteins 0.000 description 1
- 101150029915 eIF3j gene Proteins 0.000 description 1
- 102100035859 eIF5-mimic protein 2 Human genes 0.000 description 1
- 101150112638 eif3b gene Proteins 0.000 description 1
- 101150001367 eif3d gene Proteins 0.000 description 1
- 101150081549 eif3f gene Proteins 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000008995 epigenetic change Effects 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 230000004077 genetic alteration Effects 0.000 description 1
- 231100000118 genetic alteration Toxicity 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 108020004445 glyceraldehyde-3-phosphate dehydrogenase Proteins 0.000 description 1
- 101150055960 hemB gene Proteins 0.000 description 1
- 108010052188 hepatoma-derived growth factor Proteins 0.000 description 1
- 210000004251 human milk Anatomy 0.000 description 1
- 235000020256 human milk Nutrition 0.000 description 1
- 101150095658 ilf2 gene Proteins 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 108010085650 interferon gamma receptor Proteins 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- NUHSROFQTUXZQQ-UHFFFAOYSA-N isopentenyl diphosphate Chemical compound CC(=C)CCO[P@](O)(=O)OP(O)(O)=O NUHSROFQTUXZQQ-UHFFFAOYSA-N 0.000 description 1
- 229960004891 lapatinib Drugs 0.000 description 1
- BCFGMOOMADDAQU-UHFFFAOYSA-N lapatinib Chemical compound O1C(CNCCS(=O)(=O)C)=CC=C1C1=CC=C(N=CN=C2NC=3C=C(Cl)C(OCC=4C=C(F)C=CC=4)=CC=3)C2=C1 BCFGMOOMADDAQU-UHFFFAOYSA-N 0.000 description 1
- 238000011528 liquid biopsy Methods 0.000 description 1
- 102000004311 liver X receptors Human genes 0.000 description 1
- 108090000865 liver X receptors Proteins 0.000 description 1
- 208000037841 lung tumor Diseases 0.000 description 1
- 210000004880 lymph fluid Anatomy 0.000 description 1
- 210000004324 lymphatic system Anatomy 0.000 description 1
- 239000006166 lysate Substances 0.000 description 1
- 108010057284 lysosomal Pro-X carboxypeptidase Proteins 0.000 description 1
- 102100033718 m7GpppX diphosphatase Human genes 0.000 description 1
- 102100040949 mRNA cap guanine-N7 methyltransferase Human genes 0.000 description 1
- 102100034702 mRNA decay activator protein ZFP36L1 Human genes 0.000 description 1
- 102100040700 mRNA export factor GLE1 Human genes 0.000 description 1
- 102100039604 mRNA guanylyltransferase Human genes 0.000 description 1
- 208000000540 mast syndrome Diseases 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 230000035800 maturation Effects 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 108040008770 methylated-DNA-[protein]-cysteine S-methyltransferase activity proteins Proteins 0.000 description 1
- 238000007479 molecular analysis Methods 0.000 description 1
- 101150071637 mre11 gene Proteins 0.000 description 1
- LBCGUKCXRVUULK-QGZVFWFLSA-N n-[2-(1,3-benzodioxol-5-yl)ethyl]-1-[2-(1h-imidazol-1-yl)-6-methylpyrimidin-4-yl]-d-prolinamide Chemical compound N=1C(C)=CC(N2[C@H](CCC2)C(=O)NCCC=2C=C3OCOC3=CC=2)=NC=1N1C=CN=C1 LBCGUKCXRVUULK-QGZVFWFLSA-N 0.000 description 1
- 101150021549 ncbp1 gene Proteins 0.000 description 1
- 229960000513 necitumumab Drugs 0.000 description 1
- 230000017074 necrotic cell death Effects 0.000 description 1
- 239000013642 negative control Substances 0.000 description 1
- 229950008835 neratinib Drugs 0.000 description 1
- ZNHPZUKZSNBOSQ-BQYQJAHWSA-N neratinib Chemical compound C=12C=C(NC\C=C\CN(C)C)C(OCC)=CC2=NC=C(C#N)C=1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZNHPZUKZSNBOSQ-BQYQJAHWSA-N 0.000 description 1
- 238000007481 next generation sequencing Methods 0.000 description 1
- 210000002445 nipple Anatomy 0.000 description 1
- 101150050665 nubp-1 gene Proteins 0.000 description 1
- 108010054452 nuclear pore complex protein 98 Proteins 0.000 description 1
- 238000007826 nucleic acid assay Methods 0.000 description 1
- QQBDLJCYGRGAKP-UHFFFAOYSA-N olsalazine Chemical compound C1=C(O)C(C(=O)O)=CC(N=NC=2C=C(C(O)=CC=2)C(O)=O)=C1 QQBDLJCYGRGAKP-UHFFFAOYSA-N 0.000 description 1
- 239000011022 opal Substances 0.000 description 1
- 238000000424 optical density measurement Methods 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 108010035632 ornithine decarboxylase antizyme inhibitor Proteins 0.000 description 1
- UCDPMNSCCRBWIC-UHFFFAOYSA-N orthosulfamuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)NC=2C(=CC=CC=2)C(=O)N(C)C)=N1 UCDPMNSCCRBWIC-UHFFFAOYSA-N 0.000 description 1
- 229960003278 osimertinib Drugs 0.000 description 1
- DUYJMQONPNNFPI-UHFFFAOYSA-N osimertinib Chemical compound COC1=CC(N(C)CCN(C)C)=C(NC(=O)C=C)C=C1NC1=NC=CC(C=2C3=CC=CC=C3N(C)C=2)=N1 DUYJMQONPNNFPI-UHFFFAOYSA-N 0.000 description 1
- 102100032579 p21-activated protein kinase-interacting protein 1 Human genes 0.000 description 1
- 229960001972 panitumumab Drugs 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 210000004910 pleural fluid Anatomy 0.000 description 1
- 229920005735 poly(methyl vinyl ketone) Polymers 0.000 description 1
- 229920002463 poly(p-dioxanone) polymer Polymers 0.000 description 1
- 229920002791 poly-4-hydroxybutyrate Polymers 0.000 description 1
- IXJYMUFPNFFKIB-FMONCPFKSA-N pomp protocol Chemical compound S=C1N=CNC2=C1NC=N2.O=C1C=C[C@]2(C)[C@H]3C(=O)C[C@](C)([C@@](CC4)(O)C(=O)CO)[C@@H]4[C@@H]3CCC2=C1.C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1.C([C@H](C[C@]1(C(=O)OC)C=2C(=C3C([C@]45[C@H]([C@@]([C@H](OC(C)=O)[C@]6(CC)C=CCN([C@H]56)CC4)(O)C(=O)OC)N3C=O)=CC=2)OC)C[C@@](C2)(O)CC)N2CCC2=C1NC1=CC=CC=C21 IXJYMUFPNFFKIB-FMONCPFKSA-N 0.000 description 1
- 239000004175 ponceau 4R Substances 0.000 description 1
- 239000013641 positive control Substances 0.000 description 1
- 102100038155 pre-mRNA 3' end processing protein WDR33 Human genes 0.000 description 1
- 102100032318 pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Human genes 0.000 description 1
- LFULEKSKNZEWOE-UHFFFAOYSA-N propanil Chemical compound CCC(=O)NC1=CC=C(Cl)C(Cl)=C1 LFULEKSKNZEWOE-UHFFFAOYSA-N 0.000 description 1
- 108010078587 pseudouridylate synthetase Proteins 0.000 description 1
- 238000003908 quality control method Methods 0.000 description 1
- 102100029739 rRNA N6-adenosine-methyltransferase METTL5 Human genes 0.000 description 1
- 102100024984 rRNA methyltransferase 2, mitochondrial Human genes 0.000 description 1
- 108010054067 rab1 GTP-Binding Proteins Proteins 0.000 description 1
- 108010044923 rab4 GTP-Binding Proteins Proteins 0.000 description 1
- 108010032037 rab5 GTP-Binding Proteins Proteins 0.000 description 1
- 108010062219 ran-binding protein 2 Proteins 0.000 description 1
- 101150010582 ranbp9 gene Proteins 0.000 description 1
- 108010036805 rap1 GTP-Binding Proteins Proteins 0.000 description 1
- 230000000241 respiratory effect Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 108020004418 ribosomal RNA Proteins 0.000 description 1
- 102000004314 ribosomal protein S14 Human genes 0.000 description 1
- 108090000850 ribosomal protein S14 Proteins 0.000 description 1
- 108010037379 ribosome releasing factor Proteins 0.000 description 1
- 101150024074 rub1 gene Proteins 0.000 description 1
- 210000003296 saliva Anatomy 0.000 description 1
- 210000000582 semen Anatomy 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 102100024840 snRNA-activating protein complex subunit 1 Human genes 0.000 description 1
- 102100022779 snRNA-activating protein complex subunit 3 Human genes 0.000 description 1
- 102100022780 snRNA-activating protein complex subunit 4 Human genes 0.000 description 1
- 102100022383 snRNA-activating protein complex subunit 5 Human genes 0.000 description 1
- 101150083938 snrnp70 gene Proteins 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 210000001082 somatic cell Anatomy 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 210000003802 sputum Anatomy 0.000 description 1
- 208000024794 sputum Diseases 0.000 description 1
- 238000013517 stratification Methods 0.000 description 1
- CXVGEDCSTKKODG-UHFFFAOYSA-N sulisobenzone Chemical compound C1=C(S(O)(=O)=O)C(OC)=CC(O)=C1C(=O)C1=CC=CC=C1 CXVGEDCSTKKODG-UHFFFAOYSA-N 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 108010016910 synaptojanin Proteins 0.000 description 1
- 102000000580 synaptojanin Human genes 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 102100022110 tRNA (adenine(37)-N6)-methyltransferase Human genes 0.000 description 1
- 102100032968 tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6 Human genes 0.000 description 1
- 102100037302 tRNA (adenine(58)-N(1))-methyltransferase, mitochondrial Human genes 0.000 description 1
- 102100026307 tRNA (guanine(10)-N2)-methyltransferase homolog Human genes 0.000 description 1
- 102100039415 tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit WDR4 Human genes 0.000 description 1
- 102100029667 tRNA (uracil(54)-C(5))-methyltransferase homolog Human genes 0.000 description 1
- 102100022348 tRNA (uracil-5-)-methyltransferase homolog A Human genes 0.000 description 1
- 102100030611 tRNA 2'-phosphotransferase 1 Human genes 0.000 description 1
- 102100025774 tRNA methyltransferase 10 homolog C Human genes 0.000 description 1
- 102100023793 tRNA modification GTPase GTPBP3, mitochondrial Human genes 0.000 description 1
- 102100029783 tRNA pseudouridine synthase A Human genes 0.000 description 1
- 102100031917 tRNA pseudouridine(38/39) synthase Human genes 0.000 description 1
- 102100031240 tRNA selenocysteine 1-associated protein 1 Human genes 0.000 description 1
- 102100020794 tRNA wybutosine-synthesizing protein 3 homolog Human genes 0.000 description 1
- 102100031143 tRNA wybutosine-synthesizing protein 5 Human genes 0.000 description 1
- 102100029679 tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like Human genes 0.000 description 1
- 102100034113 tRNA-specific adenosine deaminase 1 Human genes 0.000 description 1
- 102100034921 tRNA-splicing endonuclease subunit Sen15 Human genes 0.000 description 1
- 102100021774 tRNA-splicing endonuclease subunit Sen2 Human genes 0.000 description 1
- 102100021776 tRNA-splicing endonuclease subunit Sen34 Human genes 0.000 description 1
- 102100034440 tRNA-uridine aminocarboxypropyltransferase 1 Human genes 0.000 description 1
- 108010067247 tacrolimus binding protein 4 Proteins 0.000 description 1
- YCCHNFGPIFYNTF-UHFFFAOYSA-N tertiary cymene hydroperoxide Natural products CC1=CC=C(C(C)(C)OO)C=C1 YCCHNFGPIFYNTF-UHFFFAOYSA-N 0.000 description 1
- 108091008744 testicular receptors 2 Proteins 0.000 description 1
- 108091008743 testicular receptors 4 Proteins 0.000 description 1
- 238000012549 training Methods 0.000 description 1
- WLPUWLXVBWGYMZ-UHFFFAOYSA-N tricyclohexylphosphine Chemical compound C1CCCCC1P(C1CCCCC1)C1CCCCC1 WLPUWLXVBWGYMZ-UHFFFAOYSA-N 0.000 description 1
- WVLBCYQITXONBZ-UHFFFAOYSA-N trimethyl phosphate Chemical compound COP(=O)(OC)OC WVLBCYQITXONBZ-UHFFFAOYSA-N 0.000 description 1
- 108010039189 tripeptidyl-peptidase 2 Proteins 0.000 description 1
- 108010093459 tubulin-specific chaperone C Proteins 0.000 description 1
- 239000000107 tumor biomarker Substances 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- 229940121358 tyrosine kinase inhibitor Drugs 0.000 description 1
- SQQWBSBBCSFQGC-JLHYYAGUSA-N ubiquinone-2 Chemical compound COC1=C(OC)C(=O)C(C\C=C(/C)CCC=C(C)C)=C(C)C1=O SQQWBSBBCSFQGC-JLHYYAGUSA-N 0.000 description 1
- 101150091685 ufl1 gene Proteins 0.000 description 1
- 238000005199 ultracentrifugation Methods 0.000 description 1
- 229960000241 vandetanib Drugs 0.000 description 1
- UHTHHESEBZOYNR-UHFFFAOYSA-N vandetanib Chemical compound COC1=CC(C(/N=CN2)=N/C=3C(=CC(Br)=CC=3)F)=C2C=C1OCC1CCN(C)CC1 UHTHHESEBZOYNR-UHFFFAOYSA-N 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 102100039135 von Willebrand factor A domain-containing protein 8 Human genes 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 108010073629 xeroderma pigmentosum group F protein Proteins 0.000 description 1
- OIWCYIUQAVBPGV-DAQGAKHBSA-N {1-O-hexadecanoyl-2-O-[(Z)-octadec-9-enoyl]-sn-glycero-3-phospho}serine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP(O)(=O)OC[C@H](N)C(O)=O)OC(=O)CCCCCCC\C=C/CCCCCCCC OIWCYIUQAVBPGV-DAQGAKHBSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12Q—MEASURING OR TESTING PROCESSES INVOLVING ENZYMES, NUCLEIC ACIDS OR MICROORGANISMS; COMPOSITIONS OR TEST PAPERS THEREFOR; PROCESSES OF PREPARING SUCH COMPOSITIONS; CONDITION-RESPONSIVE CONTROL IN MICROBIOLOGICAL OR ENZYMOLOGICAL PROCESSES
- C12Q1/00—Measuring or testing processes involving enzymes, nucleic acids or microorganisms; Compositions therefor; Processes of preparing such compositions
- C12Q1/68—Measuring or testing processes involving enzymes, nucleic acids or microorganisms; Compositions therefor; Processes of preparing such compositions involving nucleic acids
- C12Q1/6844—Nucleic acid amplification reactions
- C12Q1/6851—Quantitative amplification
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12Q—MEASURING OR TESTING PROCESSES INVOLVING ENZYMES, NUCLEIC ACIDS OR MICROORGANISMS; COMPOSITIONS OR TEST PAPERS THEREFOR; PROCESSES OF PREPARING SUCH COMPOSITIONS; CONDITION-RESPONSIVE CONTROL IN MICROBIOLOGICAL OR ENZYMOLOGICAL PROCESSES
- C12Q1/00—Measuring or testing processes involving enzymes, nucleic acids or microorganisms; Compositions therefor; Processes of preparing such compositions
- C12Q1/68—Measuring or testing processes involving enzymes, nucleic acids or microorganisms; Compositions therefor; Processes of preparing such compositions involving nucleic acids
- C12Q1/6876—Nucleic acid products used in the analysis of nucleic acids, e.g. primers or probes
- C12Q1/6883—Nucleic acid products used in the analysis of nucleic acids, e.g. primers or probes for diseases caused by alterations of genetic material
- C12Q1/6886—Nucleic acid products used in the analysis of nucleic acids, e.g. primers or probes for diseases caused by alterations of genetic material for cancer
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12Q—MEASURING OR TESTING PROCESSES INVOLVING ENZYMES, NUCLEIC ACIDS OR MICROORGANISMS; COMPOSITIONS OR TEST PAPERS THEREFOR; PROCESSES OF PREPARING SUCH COMPOSITIONS; CONDITION-RESPONSIVE CONTROL IN MICROBIOLOGICAL OR ENZYMOLOGICAL PROCESSES
- C12Q2600/00—Oligonucleotides characterized by their use
- C12Q2600/106—Pharmacogenomics, i.e. genetic variability in individual responses to drugs and drug metabolism
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12Q—MEASURING OR TESTING PROCESSES INVOLVING ENZYMES, NUCLEIC ACIDS OR MICROORGANISMS; COMPOSITIONS OR TEST PAPERS THEREFOR; PROCESSES OF PREPARING SUCH COMPOSITIONS; CONDITION-RESPONSIVE CONTROL IN MICROBIOLOGICAL OR ENZYMOLOGICAL PROCESSES
- C12Q2600/00—Oligonucleotides characterized by their use
- C12Q2600/118—Prognosis of disease development
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12Q—MEASURING OR TESTING PROCESSES INVOLVING ENZYMES, NUCLEIC ACIDS OR MICROORGANISMS; COMPOSITIONS OR TEST PAPERS THEREFOR; PROCESSES OF PREPARING SUCH COMPOSITIONS; CONDITION-RESPONSIVE CONTROL IN MICROBIOLOGICAL OR ENZYMOLOGICAL PROCESSES
- C12Q2600/00—Oligonucleotides characterized by their use
- C12Q2600/156—Polymorphic or mutational markers
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12Q—MEASURING OR TESTING PROCESSES INVOLVING ENZYMES, NUCLEIC ACIDS OR MICROORGANISMS; COMPOSITIONS OR TEST PAPERS THEREFOR; PROCESSES OF PREPARING SUCH COMPOSITIONS; CONDITION-RESPONSIVE CONTROL IN MICROBIOLOGICAL OR ENZYMOLOGICAL PROCESSES
- C12Q2600/00—Oligonucleotides characterized by their use
- C12Q2600/16—Primer sets for multiplex assays
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Zoology (AREA)
- Wood Science & Technology (AREA)
- Engineering & Computer Science (AREA)
- Genetics & Genomics (AREA)
- Analytical Chemistry (AREA)
- Immunology (AREA)
- Molecular Biology (AREA)
- General Engineering & Computer Science (AREA)
- Biotechnology (AREA)
- Biophysics (AREA)
- Physics & Mathematics (AREA)
- Biochemistry (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Microbiology (AREA)
- General Health & Medical Sciences (AREA)
- Pathology (AREA)
- Hospice & Palliative Care (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Measuring Or Testing Involving Enzymes Or Micro-Organisms (AREA)
- Investigating Or Analysing Biological Materials (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201662428059P | 2016-11-30 | 2016-11-30 | |
| US62/428,059 | 2016-11-30 | ||
| PCT/US2017/062370 WO2018102162A1 (en) | 2016-11-30 | 2017-11-17 | Methods and compositions to detect mutations in plasma using exosomal rna and cell free dna from non-small cell lung cancer patients |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA3044056A1 true CA3044056A1 (en) | 2018-06-07 |
Family
ID=60766137
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA3044056A Pending CA3044056A1 (en) | 2016-11-30 | 2017-11-17 | Methods and compositions to detect mutations in plasma using exosomal rna and cell free dna from non-small cell lung cancer patients |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US11427864B2 (cg-RX-API-DMAC7.html) |
| EP (1) | EP3548635B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JP7280823B2 (cg-RX-API-DMAC7.html) |
| CN (1) | CN110446790B (cg-RX-API-DMAC7.html) |
| AU (1) | AU2017366813B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA3044056A1 (cg-RX-API-DMAC7.html) |
| WO (1) | WO2018102162A1 (cg-RX-API-DMAC7.html) |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2018102162A1 (en) | 2016-11-30 | 2018-06-07 | Exosome Diagnostics, Inc. | Methods and compositions to detect mutations in plasma using exosomal rna and cell free dna from non-small cell lung cancer patients |
| WO2019099629A1 (en) * | 2017-11-17 | 2019-05-23 | Gen-Probe Incorporated | COMPOSITIONS AND METHODS FOR DETECTING C1orf43 NUCLEIC ACID |
| CN108707671A (zh) * | 2018-06-12 | 2018-10-26 | 上海浦美生物医药科技有限公司 | 一种用于血液egfr c797s突变检测的引物探针组合物和试剂盒 |
| CN109207595A (zh) * | 2018-10-07 | 2019-01-15 | 浙江数问生物技术有限公司 | 一种人egfr基因t790m突变检测试剂盒及其检测方法 |
| US20220155304A1 (en) * | 2019-03-01 | 2022-05-19 | Mercy Bioanalytics, Inc. | Systems, compositions, and methods for target entity detection |
| CN110749734A (zh) * | 2019-12-06 | 2020-02-04 | 四川大学华西医院 | Gtf2i自身抗体检测试剂在制备肺癌筛查试剂盒中的用途 |
| CN111733158B (zh) * | 2020-02-11 | 2022-09-06 | 昆明医科大学 | 一种抑制hsa_circ_0003599表达的siRNA及其应用 |
| CN111500640B (zh) * | 2020-04-17 | 2021-09-10 | 四川省人民医院 | Rp疾病模型的构建方法以及培育方法 |
| CN111748624B (zh) * | 2020-06-08 | 2022-11-04 | 郑州大学第一附属医院 | 用于预测肝癌是否复发的生物标志物 |
| CN111676290B (zh) * | 2020-07-02 | 2021-03-02 | 王伟佳 | 一种急性髓系白血病诱导分化治疗耐药的分子标志物及其应用 |
| CN111690752A (zh) * | 2020-07-16 | 2020-09-22 | 重庆浦洛通基因医学研究院有限公司 | 一种检测人类egfr基因突变的试剂盒及其方法 |
| CN112410335B (zh) * | 2020-11-03 | 2022-10-04 | 安徽大学 | 一种阻止lactb2表达来抑制非小细胞肺癌增殖生长的应用 |
| CN112501292B (zh) * | 2020-11-09 | 2022-12-02 | 中国人民解放军海军军医大学 | cFAM210A在制备肝癌诊断或术后预测试剂盒以及药物中的应用 |
| CN114480607B (zh) * | 2020-11-12 | 2024-04-30 | 上海昂朴生物科技有限公司 | 用于检测gipc1基因5’-utr区域cgg扩增次数的pcr检测试剂盒及应用 |
| CN112375810A (zh) * | 2020-11-16 | 2021-02-19 | 北京大学人民医院 | GnT-II基因下调表达作为肝癌预后标志物中的应用 |
| CN112370527B (zh) * | 2020-12-02 | 2022-11-01 | 成都医学院第一附属医院 | Dnajc19基因作为靶点在制备治疗非小细胞肺癌药物中的应用 |
| CN112481234B (zh) * | 2020-12-03 | 2023-09-22 | 重庆工业职业技术学院 | 一种焦磷酸酶突变体合成核酸糖类似物及其应用 |
| CN112795652A (zh) * | 2021-02-02 | 2021-05-14 | 中国科学院合肥物质科学研究院 | 环形RNAcircURI1在制备胃癌生物标志物的应用及其试剂盒 |
| US20240301413A1 (en) * | 2021-03-11 | 2024-09-12 | The Children's Hospital Of Philadelphia | Compositions and methods useful for the treatment of bone marrow failure diseases associated with ribosomopathies |
| CN113373206A (zh) * | 2021-08-03 | 2021-09-10 | 远辰生物科技(苏州)有限公司 | 一种egfr基因突变检测体系及其试剂盒 |
| CN113774135B (zh) * | 2021-09-17 | 2024-03-08 | 广东省人民医院 | 一组用于预测高级别浆液性卵巢癌预后的标志物及其应用 |
| CN113549697B (zh) * | 2021-09-23 | 2022-03-01 | 广州医科大学附属肿瘤医院 | 一种胃癌热化疗敏感标志物及其应用 |
| CN113913333B (zh) * | 2021-10-20 | 2022-09-02 | 南京世和基因生物技术股份有限公司 | 一种肺癌诊断标志物及用途 |
| CN114231529B (zh) * | 2021-11-17 | 2023-08-01 | 中国科学院昆明动物研究所 | 一种人pkmyt1ar基因及其应用 |
| CN114934048B (zh) * | 2022-02-22 | 2023-09-26 | 浙大城市学院 | 一种用于肿瘤治疗靶点和诊断生物标志物的circMTMR14及试剂盒和应用 |
| EP4491745A1 (en) * | 2022-03-08 | 2025-01-15 | Korea Advanced Institute of Science and Technology | Pharmaceutical composition comprising setmar inhibitor for preventing or treating cancer |
| CN114672564B (zh) * | 2022-03-31 | 2025-06-13 | 郑州颐和医院 | Tmod3和/或adsl在非小细胞癌中的应用 |
| CN114592006A (zh) * | 2022-04-29 | 2022-06-07 | 昆明理工大学 | Memo1基因的新用途 |
| CN114839375B (zh) * | 2022-05-23 | 2025-07-25 | 中国药科大学 | 与肺癌相关的尿液微囊泡蛋白及其应用 |
| CN114703287B (zh) * | 2022-06-06 | 2022-08-12 | 江苏省肿瘤医院 | CXorf56基因在治疗三阴性乳腺癌中的应用 |
| CN114703288B (zh) * | 2022-06-06 | 2022-09-13 | 珠海圣美生物诊断技术有限公司 | 用于扩增EGFR-T790M基因变异的blocker探针、引物组及其应用 |
| CN115896262B (zh) * | 2022-07-12 | 2025-05-30 | 重庆医科大学附属儿童医院 | 一种神经嵴疾病的诊断标志物及其应用 |
| CN115877004B (zh) * | 2022-08-09 | 2024-12-20 | 重庆大学 | 一种taok3抑制剂以及taok3及其抑制剂在调控天然免疫系统中的应用 |
| CN115948532A (zh) * | 2022-08-17 | 2023-04-11 | 湖南圣洲生物科技有限公司 | 基于数字pcr技术的sma检测试剂盒 |
| CN115354079A (zh) * | 2022-09-05 | 2022-11-18 | 复旦大学附属中山医院 | 一种用于检测egfr靶向药物治疗适用性的试剂盒 |
| WO2024064814A1 (en) * | 2022-09-21 | 2024-03-28 | Zephyr Ai, Inc. | Apparatus and methods for determining sensitivity to osimertinib |
| CN115595372B (zh) * | 2022-12-16 | 2023-03-14 | 南京世和基因生物技术股份有限公司 | 一种血浆游离dna来源的甲基化检测方法、肺癌诊断标志物以及试剂盒 |
| CN116240275A (zh) * | 2023-03-01 | 2023-06-09 | 申联生物医药（上海）股份有限公司 | 一种哺乳动物通用的rna内参基因及其引物和应用 |
| CN116751873B (zh) * | 2023-06-26 | 2025-04-08 | 宁夏大学 | 与牛十字部高相关的snp位点及应用 |
| CN117491636A (zh) * | 2023-11-21 | 2024-02-02 | 郑州大学 | 一种用于肺癌诊断的生物标志物及其应用 |
| CN118599905A (zh) * | 2024-02-21 | 2024-09-06 | 湖北文理学院 | Tm9sf1在用于抑制fen1进入细胞核中的应用 |
| CN120392963A (zh) * | 2024-03-26 | 2025-08-01 | 首都医科大学附属北京胸科医院 | 一种改善耐药性肺癌患者对egfr-tki抑制剂敏感性的药物 |
| CN118813812B (zh) * | 2024-06-26 | 2025-12-05 | 中国农业大学 | 一种与鸡不同周龄胸深相关的snp分子标记及应用 |
| CN118910268B (zh) * | 2024-06-26 | 2025-12-05 | 中国农业大学 | 一种与鸡六周龄体重性状相关的snp标记及其应用 |
| CN119709991B (zh) * | 2025-02-28 | 2025-06-24 | 华中科技大学同济医学院附属同济医院 | 芳基硫酸酯酶k在制备预防、延缓或治疗慢性阻塞性肺疾病药物中的应用 |
Family Cites Families (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5639611A (en) | 1988-12-12 | 1997-06-17 | City Of Hope | Allele specific polymerase chain reaction |
| US5219727A (en) | 1989-08-21 | 1993-06-15 | Hoffmann-Laroche Inc. | Quantitation of nucleic acids using the polymerase chain reaction |
| CA2218875C (en) | 1991-07-23 | 2000-11-07 | The Research Foundation Of State University Of New York | Improvements in the in situ pcr |
| US5605798A (en) | 1993-01-07 | 1997-02-25 | Sequenom, Inc. | DNA diagnostic based on mass spectrometry |
| US5639606A (en) | 1993-04-06 | 1997-06-17 | The University Of Rochester | Method for quantitative measurement of gene expression using multiplex competitive reverse transcriptase-polymerase chain reaction |
| US5556773A (en) | 1993-08-06 | 1996-09-17 | Yourno; Joseph | Method and apparatus for nested polymerase chain reaction (PCR) with single closed reaction tubes |
| EP0954612A2 (en) | 1996-11-06 | 1999-11-10 | Sequenom, Inc. | Dna diagnostics based on mass spectrometry |
| US6994960B1 (en) | 1997-05-28 | 2006-02-07 | The Walter And Eliza Hall Institute Of Medical Research | Nucleic acid diagnostics based on mass spectrometry or mass separation and base specific cleavage |
| US6004755A (en) | 1998-04-07 | 1999-12-21 | Incyte Pharmaceuticals, Inc. | Quantitative microarray hybridizaton assays |
| FR2788780B1 (fr) | 1999-01-27 | 2001-03-30 | Ap Cells Inc | Procede de preparation de vesicules membranaires |
| US6277607B1 (en) | 1999-05-24 | 2001-08-21 | Sanjay Tyagi | High specificity primers, amplification methods and kits |
| GB9927320D0 (en) | 1999-11-18 | 2000-01-12 | Chiron Spa | Exosome separation |
| US6812023B1 (en) | 2000-04-27 | 2004-11-02 | Anosys, Inc. | Methods of producing membrane vesicles |
| US6913879B1 (en) | 2000-07-10 | 2005-07-05 | Telechem International Inc. | Microarray method of genotyping multiple samples at multiple LOCI |
| US6696271B2 (en) | 2001-08-23 | 2004-02-24 | The Regents Of The University Of California | Frozen tissue microarray technology for analysis of RNA, DNA, and proteins |
| WO2003023065A1 (en) | 2001-09-06 | 2003-03-20 | Syngenta Participations Ag | Dna methylation patterns |
| EP2339025B1 (en) | 2002-06-26 | 2013-10-09 | Cold Spring Harbor Laboratory | Methods for determining the methylation profiles |
| WO2004020667A1 (en) | 2002-09-02 | 2004-03-11 | Pamgene B.V. | Novel integrated microarray analysis |
| US7141371B2 (en) | 2002-09-06 | 2006-11-28 | State Of Oregon Acting By And Through The State Board Of Higher Education On Behalf Of The University Of Oregon | Methods for detecting and localizing DNA mutations by microarray |
| WO2006113590A2 (en) | 2005-04-15 | 2006-10-26 | Cedars-Sinai Medical Center | Flow-cytometric heteroduplex analysis for detection of genetic alterations |
| AU2007293280A1 (en) * | 2006-09-07 | 2008-03-13 | Astrazeneca Ab | Method for evaluating patients for treatment with drugs targeting RET receptor tyrosine kinase |
| CN101622349A (zh) * | 2006-12-08 | 2010-01-06 | 奥斯瑞根公司 | 作为治疗性干预靶标的miR-21调节的基因和途径 |
| US20090104120A1 (en) * | 2007-09-25 | 2009-04-23 | The Regents Of The University Of Michigan | Dlx1 cancer markers |
| KR101970908B1 (ko) * | 2008-02-01 | 2019-04-19 | 더 제너럴 하스피탈 코포레이션 | 의학적 질환 및 병태의 진단, 예후, 및 치료에 있어서 미세소포체의 용도 |
| US20160041153A1 (en) * | 2008-11-12 | 2016-02-11 | Kirk Brown | Biomarker compositions and markers |
| WO2012135844A2 (en) * | 2011-04-01 | 2012-10-04 | Cornell University | Circulating exosomes as diagnostic/prognostic indicators and therapeutic targets of melanoma and other cancers |
| CN105026911B (zh) | 2013-01-03 | 2019-01-22 | 外来体诊断公司 | 用于分离微囊泡的方法 |
| EP4253558B1 (en) * | 2013-03-15 | 2025-07-02 | The Board of Trustees of the Leland Stanford Junior University | Identification and use of circulating nucleic acid tumor markers |
| WO2014193999A2 (en) * | 2013-05-28 | 2014-12-04 | Caris Science, Inc. | Biomarker methods and compositions |
| US20150132256A1 (en) * | 2013-10-19 | 2015-05-14 | Trovagene, Inc. | Detecting and monitoring mutations in histiocytosis |
| US10519502B2 (en) * | 2013-10-31 | 2019-12-31 | The Children's Hospital Of Philadelphia | Mitochondrial disease genetic diagnostics |
| EP3125907A4 (en) * | 2014-04-01 | 2017-11-29 | Cornell University | Use of double-stranded dna in exosomes: a novel biomarker in cancer detection |
| CA3084920C (en) | 2014-07-09 | 2023-02-28 | Exosome Diagnostics, Inc. | Methods for isolating microvesicles and extracting nucleic acids from biological samples |
| WO2018102162A1 (en) | 2016-11-30 | 2018-06-07 | Exosome Diagnostics, Inc. | Methods and compositions to detect mutations in plasma using exosomal rna and cell free dna from non-small cell lung cancer patients |
-
2017
- 2017-11-17 WO PCT/US2017/062370 patent/WO2018102162A1/en not_active Ceased
- 2017-11-17 AU AU2017366813A patent/AU2017366813B2/en active Active
- 2017-11-17 EP EP17817952.9A patent/EP3548635B1/en active Active
- 2017-11-17 US US16/463,820 patent/US11427864B2/en active Active
- 2017-11-17 CN CN201780084970.6A patent/CN110446790B/zh active Active
- 2017-11-17 JP JP2019528833A patent/JP7280823B2/ja active Active
- 2017-11-17 CA CA3044056A patent/CA3044056A1/en active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| AU2017366813B2 (en) | 2023-04-20 |
| CN110446790B (zh) | 2023-03-31 |
| EP3548635B1 (en) | 2021-04-28 |
| EP3548635A1 (en) | 2019-10-09 |
| JP2019536456A (ja) | 2019-12-19 |
| CN110446790A (zh) | 2019-11-12 |
| JP7280823B2 (ja) | 2023-05-24 |
| WO2018102162A1 (en) | 2018-06-07 |
| AU2017366813A1 (en) | 2019-06-13 |
| US20190376128A1 (en) | 2019-12-12 |
| US11427864B2 (en) | 2022-08-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP3548635B1 (en) | Methods to detect mutations in plasma using exosomal rna and cell free dna from non-small cell lung cancer patients | |
| US20190093172A1 (en) | Plasma-based detection of anaplastic lymphoma kinase (alk) nucleic acids and alk fusion transcripts and uses thereof in diagnosis and treatment of cancer | |
| US12139766B2 (en) | Methods and kits comprising gene signatures for stratifying breast cancer patients | |
| US10636512B2 (en) | Immuno-oncology applications using next generation sequencing | |
| KR102080161B1 (ko) | 개인 맞춤형 의료를 위한 유전자 패널, 그를 구성하는 방법, 및 그를 이용한 개인 맞춤형 치료 방법 | |
| US20190360051A1 (en) | Swarm intelligence-enhanced diagnosis and therapy selection for cancer using tumor- educated platelets | |
| US20180371550A1 (en) | Loss of transcriptional fidelity leads to immunotherapy resistance in cancers | |
| WO2019008412A1 (en) | USE OF BLOOD GENE EXPRESSION ANALYSIS FOR CANCER CARE | |
| US20230112964A1 (en) | Assessment of melanoma therapy response | |
| WO2019008415A1 (en) | EXOSOMED AND PBMC GENE EXPRESSION ANALYSIS FOR CANCER CARE | |
| WO2019008414A1 (en) | GENE EXPRESSION ANALYSIS BASED ON EXOSOMES FOR THE CARE OF CANCER | |
| WO2019014647A1 (en) | IMMUNO-ONCOLOGIC APPLICATIONS USING NEXT GENERATION SEQUENCING | |
| US20240218457A1 (en) | Method for diagnosing active tuberculosis and progression to active tuberculosis | |
| US20230143295A1 (en) | Methods and kits for determining the risk of breast cancer recurrence | |
| Ma | Detecting Gene Modules Differentially Expressed in Multiple Human Brain Regions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request |
Effective date: 20220928 |
|
| EEER | Examination request |
Effective date: 20220928 |
|
| EEER | Examination request |
Effective date: 20220928 |
|
| EEER | Examination request |
Effective date: 20220928 |